Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2023-52754 (GCVE-0-2023-52754)
Vulnerability from cvelistv5 – Published: 2024-05-21 15:30 – Updated: 2026-05-11 19:32| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
21677cfc562a27e099719d413287bc8d1d24deb7 , < 0f5068519f89d928d6c51100e4b274479123829f
(git)
Affected: 21677cfc562a27e099719d413287bc8d1d24deb7 , < 5e0b788fb96be36d1baf1a5c88d09c7c82a0452a (git) Affected: 21677cfc562a27e099719d413287bc8d1d24deb7 , < b083aaf5db2eeca9e362723258e5d8698f7dd84e (git) Affected: 21677cfc562a27e099719d413287bc8d1d24deb7 , < 10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9 (git) Affected: 21677cfc562a27e099719d413287bc8d1d24deb7 , < 2a493a34bd6e496c55fabedd82b957193ace178f (git) Affected: 21677cfc562a27e099719d413287bc8d1d24deb7 , < a1766a4fd83befa0b34d932d532e7ebb7fab1fa7 (git) |
guessed | |
| Linux | Linux |
Affected:
2.6.35
Unaffected: 0 , < 2.6.35 (semver) Unaffected: 5.10.202 , ≤ 5.10.* (semver) Unaffected: 5.15.140 , ≤ 5.15.* (semver) Unaffected: 6.1.64 , ≤ 6.1.* (semver) Unaffected: 6.5.13 , ≤ 6.5.* (semver) Unaffected: 6.6.3 , ≤ 6.6.* (semver) Unaffected: 6.7 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-52754",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-05-21T18:42:53.248204Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-06-04T17:22:36.610Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
},
{
"providerMetadata": {
"dateUpdated": "2024-08-02T23:11:35.519Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/media/rc/imon.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "0f5068519f89d928d6c51100e4b274479123829f",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "5e0b788fb96be36d1baf1a5c88d09c7c82a0452a",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "b083aaf5db2eeca9e362723258e5d8698f7dd84e",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "2a493a34bd6e496c55fabedd82b957193ace178f",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "a1766a4fd83befa0b34d932d532e7ebb7fab1fa7",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/media/rc/imon.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.35"
},
{
"lessThan": "2.6.35",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.202",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.140",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.64",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.5.*",
"status": "unaffected",
"version": "6.5.13",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.7",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.202",
"versionStartIncluding": "2.6.35",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.140",
"versionStartIncluding": "2.6.35",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.64",
"versionStartIncluding": "2.6.35",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.5.13",
"versionStartIncluding": "2.6.35",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.3",
"versionStartIncluding": "2.6.35",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.7",
"versionStartIncluding": "2.6.35",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmedia: imon: fix access to invalid resource for the second interface\n\nimon driver probes two USB interfaces, and at the probe of the second\ninterface, the driver assumes blindly that the first interface got\nbound with the same imon driver. It\u0027s usually true, but it\u0027s still\npossible that the first interface is bound with another driver via a\nmalformed descriptor. Then it may lead to a memory corruption, as\nspotted by syzkaller; imon driver accesses the data from drvdata as\nstruct imon_context object although it\u0027s a completely different one\nthat was assigned by another driver.\n\nThis patch adds a sanity check -- whether the first interface is\nreally bound with the imon driver or not -- for avoiding the problem\nabove at the probe time."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T19:32:33.337Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f"
},
{
"url": "https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a"
},
{
"url": "https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e"
},
{
"url": "https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9"
},
{
"url": "https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f"
},
{
"url": "https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7"
}
],
"title": "media: imon: fix access to invalid resource for the second interface",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-52754",
"datePublished": "2024-05-21T15:30:42.198Z",
"dateReserved": "2024-05-21T15:19:24.235Z",
"dateUpdated": "2026-05-11T19:32:33.337Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2023-52754",
"date": "2026-10-01",
"epss": "0.00241",
"percentile": "0.13727"
},
"fkie_nvd": {
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmedia: imon: fix access to invalid resource for the second interface\n\nimon driver probes two USB interfaces, and at the probe of the second\ninterface, the driver assumes blindly that the first interface got\nbound with the same imon driver. It\u0027s usually true, but it\u0027s still\npossible that the first interface is bound with another driver via a\nmalformed descriptor. Then it may lead to a memory corruption, as\nspotted by syzkaller; imon driver accesses the data from drvdata as\nstruct imon_context object although it\u0027s a completely different one\nthat was assigned by another driver.\n\nThis patch adds a sanity check -- whether the first interface is\nreally bound with the imon driver or not -- for avoiding the problem\nabove at the probe time."
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: medios: imon: corrige el acceso a un recurso no v\u00e1lido para la segunda interfaz. El controlador imon prueba dos interfaces USB y, en la prueba de la segunda interfaz, el controlador asume ciegamente que la primera interfaz obtuvo atado con el mismo conductor imon. Generalmente es cierto, pero a\u00fan es posible que la primera interfaz est\u00e9 vinculada con otro controlador a trav\u00e9s de un descriptor con formato incorrecto. Entonces puede provocar una corrupci\u00f3n de la memoria, como descubri\u00f3 syzkaller; El controlador imon accede a los datos de drvdata como objeto struct imon_context aunque es uno completamente diferente asignado por otro controlador. Este parche agrega una verificaci\u00f3n de cordura (si la primera interfaz est\u00e1 realmente vinculada con el controlador imon o no) para evitar el problema anterior en el momento de la prueba."
}
],
"id": "CVE-2023-52754",
"lastModified": "2024-11-21T08:40:31.083",
"published": "2024-05-21T16:15:14.970",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Awaiting Analysis"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/media/rc/imon.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "0f5068519f89d928d6c51100e4b274479123829f",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "5e0b788fb96be36d1baf1a5c88d09c7c82a0452a",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "b083aaf5db2eeca9e362723258e5d8698f7dd84e",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "2a493a34bd6e496c55fabedd82b957193ace178f",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "a1766a4fd83befa0b34d932d532e7ebb7fab1fa7",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/media/rc/imon.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.35"
},
{
"lessThan": "2.6.35",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.202",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.140",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.64",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.5.*",
"status": "unaffected",
"version": "6.5.13",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.7",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "FF5E31E1-4DDB-480A-966E-3470C98B932E",
"versionEndExcluding": "5.10.202",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "15D6C23C-78A3-40D2-B76B-4F1D9C2D95C0",
"versionEndExcluding": "5.15.140",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "8D7C884A-CAA2-4EA2-9FEB-5CE776D7B05F",
"versionEndExcluding": "6.1.64",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "674C4F82-C336-4B49-BF64-1DE422E889C4",
"versionEndExcluding": "6.5.13",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B58252FA-A49C-411F-9B28-DC5FE44BC5A0",
"versionEndExcluding": "6.6.3",
"versionStartIncluding": "6.6",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmedia: imon: fix access to invalid resource for the second interface\n\nimon driver probes two USB interfaces, and at the probe of the second\ninterface, the driver assumes blindly that the first interface got\nbound with the same imon driver. It\u0027s usually true, but it\u0027s still\npossible that the first interface is bound with another driver via a\nmalformed descriptor. Then it may lead to a memory corruption, as\nspotted by syzkaller; imon driver accesses the data from drvdata as\nstruct imon_context object although it\u0027s a completely different one\nthat was assigned by another driver.\n\nThis patch adds a sanity check -- whether the first interface is\nreally bound with the imon driver or not -- for avoiding the problem\nabove at the probe time."
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: medios: imon: corrige el acceso a un recurso no v\u00e1lido para la segunda interfaz. El controlador imon prueba dos interfaces USB y, en la prueba de la segunda interfaz, el controlador asume ciegamente que la primera interfaz obtuvo atado con el mismo conductor imon. Generalmente es cierto, pero a\u00fan es posible que la primera interfaz est\u00e9 vinculada con otro controlador a trav\u00e9s de un descriptor con formato incorrecto. Entonces puede provocar una corrupci\u00f3n de la memoria, como descubri\u00f3 syzkaller; El controlador imon accede a los datos de drvdata como objeto struct imon_context aunque es uno completamente diferente asignado por otro controlador. Este parche agrega una verificaci\u00f3n de cordura (si la primera interfaz est\u00e1 realmente vinculada con el controlador imon o no) para evitar el problema anterior en el momento de la prueba."
}
],
"id": "CVE-2023-52754",
"lastModified": "2026-06-17T06:43:30.537",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-52754",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-05-21T18:42:53.248204Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-05-21T16:15:14.970",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-401"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Low",
"current_release_date": "2025-11-21T10:55:15+00:00",
"cve": "CVE-2023-52754",
"id": "CVE-2023-52754",
"initial_release_date": "2023-01-01T00:00:00+00:00",
"product_status:known_affected": "90",
"product_status:known_not_affected": "108",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: media: imon: fix access to invalid resource for the second interface",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2023/cve-2023-52754.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-09-05T00:49:57Z",
"cve": "CVE-2023-52754",
"id": "CVE-2023-52754",
"initial_release_date": "2024-05-28T15:01:15Z",
"product_status:known_affected": "435",
"product_status:known_not_affected": "28",
"product_status:recommended": "889",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2023-52754",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2023-52754.json",
"version": "109"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T23:11:35.519Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-52754",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-05-21T18:42:53.248204Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-05-23T19:01:25.462Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/media/rc/imon.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "0f5068519f89d928d6c51100e4b274479123829f",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "5e0b788fb96be36d1baf1a5c88d09c7c82a0452a",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "b083aaf5db2eeca9e362723258e5d8698f7dd84e",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "2a493a34bd6e496c55fabedd82b957193ace178f",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "a1766a4fd83befa0b34d932d532e7ebb7fab1fa7",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/media/rc/imon.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.35"
},
{
"lessThan": "2.6.35",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.202",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.140",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.64",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.5.*",
"status": "unaffected",
"version": "6.5.13",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.7",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.202",
"versionStartIncluding": "2.6.35",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.140",
"versionStartIncluding": "2.6.35",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.64",
"versionStartIncluding": "2.6.35",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.5.13",
"versionStartIncluding": "2.6.35",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.3",
"versionStartIncluding": "2.6.35",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.7",
"versionStartIncluding": "2.6.35",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmedia: imon: fix access to invalid resource for the second interface\n\nimon driver probes two USB interfaces, and at the probe of the second\ninterface, the driver assumes blindly that the first interface got\nbound with the same imon driver. It\u0027s usually true, but it\u0027s still\npossible that the first interface is bound with another driver via a\nmalformed descriptor. Then it may lead to a memory corruption, as\nspotted by syzkaller; imon driver accesses the data from drvdata as\nstruct imon_context object although it\u0027s a completely different one\nthat was assigned by another driver.\n\nThis patch adds a sanity check -- whether the first interface is\nreally bound with the imon driver or not -- for avoiding the problem\nabove at the probe time."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T19:32:33.337Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f"
},
{
"url": "https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a"
},
{
"url": "https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e"
},
{
"url": "https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9"
},
{
"url": "https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f"
},
{
"url": "https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7"
}
],
"title": "media: imon: fix access to invalid resource for the second interface",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-52754",
"datePublished": "2024-05-21T15:30:42.198Z",
"dateReserved": "2024-05-21T15:19:24.235Z",
"dateUpdated": "2026-05-11T19:32:33.337Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
CERTFR-2024-AVI-0526
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent une élévation de privilèges, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Software Development Kit 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 12 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | openSUSE Leap Micro 5.3 | ||
| SUSE | N/A | openSUSE Leap Micro 5.4 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Software Development Kit 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 12 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-3743",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3743"
},
{
"name": "CVE-2021-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43056"
},
{
"name": "CVE-2021-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39698"
},
{
"name": "CVE-2022-1195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1195"
},
{
"name": "CVE-2022-20132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20132"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-2176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2176"
},
{
"name": "CVE-2023-2860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2860"
},
{
"name": "CVE-2023-42755",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42755"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-6931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6931"
},
{
"name": "CVE-2023-6546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6546"
},
{
"name": "CVE-2023-6531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6531"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-47233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47233"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26597"
},
{
"name": "CVE-2023-52340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52340"
},
{
"name": "CVE-2024-26622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26622"
},
{
"name": "CVE-2023-6270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6270"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52434"
},
{
"name": "CVE-2021-47104",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47104"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2023-52608",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52608"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2023-52628",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52628"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2021-46933",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46933"
},
{
"name": "CVE-2023-52492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52492"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26766"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26737"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2023-52616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52616"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26816"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2023-52640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52640"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26779"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2023-52641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52641"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2023-52635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52635"
},
{
"name": "CVE-2024-26774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26774"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26731"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2024-26736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26736"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2024-26848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26848"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2021-47171",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47171"
},
{
"name": "CVE-2023-52503",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52503"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-27047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27047"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26861"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26978"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-52644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52644"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26610"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26883"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-27073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27073"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26874"
},
{
"name": "CVE-2024-26956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26956"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27052"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2024-26979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26979"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27074"
},
{
"name": "CVE-2023-52650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52650"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26885"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26898"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26877"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-27030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27030"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-27076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27076"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-27077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27077"
},
{
"name": "CVE-2024-27078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27078"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2024-27046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27046"
},
{
"name": "CVE-2024-26903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26903"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-27053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27053"
},
{
"name": "CVE-2024-27075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27075"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2024-27045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27045"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-27022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27022"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2024-26632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26632"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2024-26856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26856"
},
{
"name": "CVE-2022-48703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48703"
},
{
"name": "CVE-2024-26881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26881"
},
{
"name": "CVE-2021-47206",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47206"
},
{
"name": "CVE-2023-52652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52652"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-27054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27054"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48686",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48686"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2024-26972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26972"
},
{
"name": "CVE-2022-48688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48688"
},
{
"name": "CVE-2022-48650",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48650"
},
{
"name": "CVE-2022-48634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48634"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48651",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48651"
},
{
"name": "CVE-2022-48693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48693"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2021-47192",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47192"
},
{
"name": "CVE-2022-48671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48671"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2024-27072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27072"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2024-26836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26836"
},
{
"name": "CVE-2021-47200",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47200"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2022-48700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48700"
},
{
"name": "CVE-2022-48687",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48687"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2022-48695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48695"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48692",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48692"
},
{
"name": "CVE-2022-48636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48636"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26783"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2022-48697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48697"
},
{
"name": "CVE-2022-48699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48699"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2024-26915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26915"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2021-47113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47113"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-267600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-267600"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2022-48669",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48669"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2020-36788",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36788"
},
{
"name": "CVE-2021-4148",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4148"
},
{
"name": "CVE-2021-47220",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47220"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47228",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47228"
},
{
"name": "CVE-2021-47229",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47229"
},
{
"name": "CVE-2021-47230",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47230"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47235",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47235"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47238",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47238"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47240"
},
{
"name": "CVE-2021-47241",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47241"
},
{
"name": "CVE-2021-47245",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47245"
},
{
"name": "CVE-2021-47246",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47246"
},
{
"name": "CVE-2021-47248",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47248"
},
{
"name": "CVE-2021-47249",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47249"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47252",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47252"
},
{
"name": "CVE-2021-47253",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47253"
},
{
"name": "CVE-2021-47254",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47254"
},
{
"name": "CVE-2021-47255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47255"
},
{
"name": "CVE-2021-47258",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47258"
},
{
"name": "CVE-2021-47259",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47259"
},
{
"name": "CVE-2021-47260",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47260"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47263",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47263"
},
{
"name": "CVE-2021-47265",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47265"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47269",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47269"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47274",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47274"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47276",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47276"
},
{
"name": "CVE-2021-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47277"
},
{
"name": "CVE-2021-47280",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47280"
},
{
"name": "CVE-2021-47281",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47281"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47285",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47285"
},
{
"name": "CVE-2021-47288",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47288"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2021-47296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47296"
},
{
"name": "CVE-2021-47301",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47301"
},
{
"name": "CVE-2021-47302",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47302"
},
{
"name": "CVE-2021-47305",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47305"
},
{
"name": "CVE-2021-47307",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47307"
},
{
"name": "CVE-2021-47308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47308"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2021-47314",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47314"
},
{
"name": "CVE-2021-47315",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47315"
},
{
"name": "CVE-2021-47319",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47319"
},
{
"name": "CVE-2021-47320",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47320"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2021-47323",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47323"
},
{
"name": "CVE-2021-47324",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47324"
},
{
"name": "CVE-2021-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47329"
},
{
"name": "CVE-2021-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47330"
},
{
"name": "CVE-2021-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47332"
},
{
"name": "CVE-2021-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47333"
},
{
"name": "CVE-2021-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47334"
},
{
"name": "CVE-2021-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47337"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2021-47340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47340"
},
{
"name": "CVE-2021-47341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47341"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47344",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47344"
},
{
"name": "CVE-2021-47345",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47345"
},
{
"name": "CVE-2021-47347",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47347"
},
{
"name": "CVE-2021-47348",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47348"
},
{
"name": "CVE-2021-47350",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47350"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47355",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47355"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2021-47357",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47357"
},
{
"name": "CVE-2021-47358",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47358"
},
{
"name": "CVE-2021-47359",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47359"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47361",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47361"
},
{
"name": "CVE-2021-47362",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47362"
},
{
"name": "CVE-2021-47363",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47363"
},
{
"name": "CVE-2021-47364",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47364"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47366",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47366"
},
{
"name": "CVE-2021-47367",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47367"
},
{
"name": "CVE-2021-47368",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47368"
},
{
"name": "CVE-2021-47369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47369"
},
{
"name": "CVE-2021-47370",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47370"
},
{
"name": "CVE-2021-47371",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47371"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47374",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47374"
},
{
"name": "CVE-2021-47375",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47375"
},
{
"name": "CVE-2021-47376",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47376"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47380",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47380"
},
{
"name": "CVE-2021-47381",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47381"
},
{
"name": "CVE-2021-47382",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47382"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2021-47387",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47387"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47389"
},
{
"name": "CVE-2021-47390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47390"
},
{
"name": "CVE-2021-47391",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47391"
},
{
"name": "CVE-2021-47392",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47392"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47394",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47394"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47396"
},
{
"name": "CVE-2021-47397",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47397"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47400",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47400"
},
{
"name": "CVE-2021-47401",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47401"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47406",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47406"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47409"
},
{
"name": "CVE-2021-47410",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47410"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2021-47413",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47413"
},
{
"name": "CVE-2021-47414",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47414"
},
{
"name": "CVE-2021-47415",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47415"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47417",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47417"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47419",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47419"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47421"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47423",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47423"
},
{
"name": "CVE-2021-47424",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47424"
},
{
"name": "CVE-2021-47425",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47425"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47427",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47427"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47431",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47431"
},
{
"name": "CVE-2021-47433",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47433"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47435",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47435"
},
{
"name": "CVE-2021-47436",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47436"
},
{
"name": "CVE-2021-47437",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47437"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47439"
},
{
"name": "CVE-2021-47440",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47440"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47442",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47442"
},
{
"name": "CVE-2021-47443",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47443"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47446",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47446"
},
{
"name": "CVE-2021-47447",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47447"
},
{
"name": "CVE-2021-47448",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47448"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47450",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47450"
},
{
"name": "CVE-2021-47451",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47451"
},
{
"name": "CVE-2021-47452",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47452"
},
{
"name": "CVE-2021-47453",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47453"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47458",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47458"
},
{
"name": "CVE-2021-47459",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47459"
},
{
"name": "CVE-2021-47460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47460"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47462",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47462"
},
{
"name": "CVE-2021-47463",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47463"
},
{
"name": "CVE-2021-47464",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47464"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2021-47467",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47467"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47469",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47469"
},
{
"name": "CVE-2021-47470",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47470"
},
{
"name": "CVE-2021-47471",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47471"
},
{
"name": "CVE-2021-47472",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47472"
},
{
"name": "CVE-2021-47473",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47473"
},
{
"name": "CVE-2021-47474",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47474"
},
{
"name": "CVE-2021-47475",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47475"
},
{
"name": "CVE-2021-47476",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47476"
},
{
"name": "CVE-2021-47477",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47477"
},
{
"name": "CVE-2021-47478",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47478"
},
{
"name": "CVE-2021-47479",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47479"
},
{
"name": "CVE-2021-47480",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47480"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47482",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47482"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47484",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47484"
},
{
"name": "CVE-2021-47485",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47485"
},
{
"name": "CVE-2021-47486",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47486"
},
{
"name": "CVE-2021-47488",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47488"
},
{
"name": "CVE-2021-47489",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47489"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47492",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47492"
},
{
"name": "CVE-2021-47493",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47493"
},
{
"name": "CVE-2021-47494",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47494"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47496",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47496"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47502",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47502"
},
{
"name": "CVE-2021-47503",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47503"
},
{
"name": "CVE-2021-47504",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47504"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47507",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47507"
},
{
"name": "CVE-2021-47508",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47508"
},
{
"name": "CVE-2021-47509",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47509"
},
{
"name": "CVE-2021-47510",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47510"
},
{
"name": "CVE-2021-47511",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47511"
},
{
"name": "CVE-2021-47512",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47512"
},
{
"name": "CVE-2021-47513",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47513"
},
{
"name": "CVE-2021-47514",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47514"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47521"
},
{
"name": "CVE-2021-47522",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47522"
},
{
"name": "CVE-2021-47523",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47523"
},
{
"name": "CVE-2021-47524",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47524"
},
{
"name": "CVE-2021-47525",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47525"
},
{
"name": "CVE-2021-47526",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47526"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47528",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47528"
},
{
"name": "CVE-2021-47529",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47529"
},
{
"name": "CVE-2021-47530",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47530"
},
{
"name": "CVE-2021-47531",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47531"
},
{
"name": "CVE-2021-47532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47532"
},
{
"name": "CVE-2021-47533",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47533"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47535"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47540",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47540"
},
{
"name": "CVE-2021-47541",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47541"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2021-47549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47549"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47551",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47551"
},
{
"name": "CVE-2021-47552",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47552"
},
{
"name": "CVE-2021-47553",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47553"
},
{
"name": "CVE-2021-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47554"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47556"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2021-47558",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47558"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2021-47562",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47562"
},
{
"name": "CVE-2021-47563",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47563"
},
{
"name": "CVE-2021-47564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47564"
},
{
"name": "CVE-2021-47565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47565"
},
{
"name": "CVE-2021-47569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47569"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48708"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52705"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52708"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2023-52733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52733"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52738",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52738"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52741",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52741"
},
{
"name": "CVE-2023-52742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52742"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52745"
},
{
"name": "CVE-2023-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52746"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26692"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27037"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52483",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52483"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52681"
},
{
"name": "CVE-2023-52687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52687"
},
{
"name": "CVE-2023-52695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52695"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2023-52771",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52771"
},
{
"name": "CVE-2023-52772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52772"
},
{
"name": "CVE-2023-6238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6238"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26652",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26652"
},
{
"name": "CVE-2024-26657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26657"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2024-26757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26757"
},
{
"name": "CVE-2024-26786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26786"
},
{
"name": "CVE-2024-26794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26794"
},
{
"name": "CVE-2024-26832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26832"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26854"
},
{
"name": "CVE-2024-26858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26858"
},
{
"name": "CVE-2024-26860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26860"
},
{
"name": "CVE-2024-26868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26868"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26909"
},
{
"name": "CVE-2024-26932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26932"
},
{
"name": "CVE-2024-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26945"
},
{
"name": "CVE-2024-26946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26946"
},
{
"name": "CVE-2024-26949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26949"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-26963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26963"
},
{
"name": "CVE-2024-26986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26986"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-26991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26991"
},
{
"name": "CVE-2024-26995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26995"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27029"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27036"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-27067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27067"
},
{
"name": "CVE-2024-27080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27080"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2024-27411",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27411"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-35786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35786"
},
{
"name": "CVE-2024-35788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35788"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35800"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35841"
},
{
"name": "CVE-2024-35842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35842"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35883"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35909"
},
{
"name": "CVE-2024-35911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35911"
},
{
"name": "CVE-2024-35916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35916"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35921"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35928"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-35953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35953"
},
{
"name": "CVE-2024-35954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35954"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-35972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35972"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35975"
},
{
"name": "CVE-2024-35977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35977"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36018"
},
{
"name": "CVE-2024-36019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36019"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36885"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0526",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-06-28T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent une \u00e9l\u00e9vation de privil\u00e8ges, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2115-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242115-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2143-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242143-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2147-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242147-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2165-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242165-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2135-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242135-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2139-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242139-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2189-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242189-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2166-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242166-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2183-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242183-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2191-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242191-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2208-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242208-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2149-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242149-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2207-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242207-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2216-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242216-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2184-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242184-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2190-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242190-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2130-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242130-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2160-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242160-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2202-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242202-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2145-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242145-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2120-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242120-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2121-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242121-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2156-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242156-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2185-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242185-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2221-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242221-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2164-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242164-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2124-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242124-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2123-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242123-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2163-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242163-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2205-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242205-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2162-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242162-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2209-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242209-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2148-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242148-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2217-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242217-1"
}
]
}
CERTFR-2024-AVI-0578
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-10135",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10135"
},
{
"name": "CVE-2021-3896",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3896"
},
{
"name": "CVE-2021-43389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43389"
},
{
"name": "CVE-2022-2938",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2938"
},
{
"name": "CVE-2022-22942",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-22942"
},
{
"name": "CVE-2022-0435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0435"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-24023",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24023"
},
{
"name": "CVE-2023-20521",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-20521"
},
{
"name": "CVE-2021-46774",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46774"
},
{
"name": "CVE-2021-46766",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46766"
},
{
"name": "CVE-2023-20526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-20526"
},
{
"name": "CVE-2023-20566",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-20566"
},
{
"name": "CVE-2021-26345",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-26345"
},
{
"name": "CVE-2023-20592",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-20592"
},
{
"name": "CVE-2022-23830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23830"
},
{
"name": "CVE-2023-20533",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-20533"
},
{
"name": "CVE-2022-23820",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23820"
},
{
"name": "CVE-2023-20519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-20519"
},
{
"name": "CVE-2023-6546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6546"
},
{
"name": "CVE-2023-6531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6531"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52340"
},
{
"name": "CVE-2024-26622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26622"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2024-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23307"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26745"
},
{
"name": "CVE-2024-26766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26766"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26687"
},
{
"name": "CVE-2024-26641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26641"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-26863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26863"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-26610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26610"
},
{
"name": "CVE-2024-26644",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26644"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2022-48651",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48651"
},
{
"name": "CVE-2021-47193",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47193"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47368",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47368"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2023-52672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52672"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2021-47293",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47293"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2021-4439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4439"
},
{
"name": "CVE-2021-47089",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47089"
},
{
"name": "CVE-2021-47103",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47103"
},
{
"name": "CVE-2021-47247",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47247"
},
{
"name": "CVE-2021-47294",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47294"
},
{
"name": "CVE-2021-47297",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47297"
},
{
"name": "CVE-2021-47309",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47309"
},
{
"name": "CVE-2021-47328",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47328"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2021-47515",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47515"
},
{
"name": "CVE-2021-47539",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47539"
},
{
"name": "CVE-2021-47566",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47566"
},
{
"name": "CVE-2021-47571",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47571"
},
{
"name": "CVE-2021-47572",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47572"
},
{
"name": "CVE-2021-47576",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47576"
},
{
"name": "CVE-2021-47577",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47577"
},
{
"name": "CVE-2021-47578",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47578"
},
{
"name": "CVE-2021-47580",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47580"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2021-47583",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47583"
},
{
"name": "CVE-2021-47584",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47584"
},
{
"name": "CVE-2021-47585",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47585"
},
{
"name": "CVE-2021-47586",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47586"
},
{
"name": "CVE-2021-47587",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47587"
},
{
"name": "CVE-2021-47589",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47589"
},
{
"name": "CVE-2021-47592",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47592"
},
{
"name": "CVE-2021-47595",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47595"
},
{
"name": "CVE-2021-47596",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47596"
},
{
"name": "CVE-2021-47597",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47597"
},
{
"name": "CVE-2021-47600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47600"
},
{
"name": "CVE-2021-47601",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47601"
},
{
"name": "CVE-2021-47602",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47602"
},
{
"name": "CVE-2021-47603",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47603"
},
{
"name": "CVE-2021-47604",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47604"
},
{
"name": "CVE-2021-47605",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47605"
},
{
"name": "CVE-2021-47607",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47607"
},
{
"name": "CVE-2021-47608",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47608"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2021-47610",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47610"
},
{
"name": "CVE-2021-47611",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47611"
},
{
"name": "CVE-2021-47612",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47612"
},
{
"name": "CVE-2021-47614",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47614"
},
{
"name": "CVE-2021-47615",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47615"
},
{
"name": "CVE-2021-47616",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47616"
},
{
"name": "CVE-2021-47617",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47617"
},
{
"name": "CVE-2021-47618",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47618"
},
{
"name": "CVE-2021-47619",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47619"
},
{
"name": "CVE-2021-47620",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47620"
},
{
"name": "CVE-2022-48711",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48711"
},
{
"name": "CVE-2022-48712",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48712"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48714",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48714"
},
{
"name": "CVE-2022-48715",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48715"
},
{
"name": "CVE-2022-48716",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48716"
},
{
"name": "CVE-2022-48717",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48717"
},
{
"name": "CVE-2022-48718",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48718"
},
{
"name": "CVE-2022-48720",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48720"
},
{
"name": "CVE-2022-48721",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48721"
},
{
"name": "CVE-2022-48722",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48722"
},
{
"name": "CVE-2022-48723",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48723"
},
{
"name": "CVE-2022-48724",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48724"
},
{
"name": "CVE-2022-48725",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48725"
},
{
"name": "CVE-2022-48726",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48726"
},
{
"name": "CVE-2022-48727",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48727"
},
{
"name": "CVE-2022-48728",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48728"
},
{
"name": "CVE-2022-48729",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48729"
},
{
"name": "CVE-2022-48730",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48730"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48733",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48733"
},
{
"name": "CVE-2022-48734",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48734"
},
{
"name": "CVE-2022-48735",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48735"
},
{
"name": "CVE-2022-48736",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48736"
},
{
"name": "CVE-2022-48737",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48737"
},
{
"name": "CVE-2022-48738",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48738"
},
{
"name": "CVE-2022-48739",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48739"
},
{
"name": "CVE-2022-48740",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48740"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2022-48744",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48744"
},
{
"name": "CVE-2022-48745",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48745"
},
{
"name": "CVE-2022-48746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48746"
},
{
"name": "CVE-2022-48747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48747"
},
{
"name": "CVE-2022-48748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48748"
},
{
"name": "CVE-2022-48749",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48749"
},
{
"name": "CVE-2022-48751",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48751"
},
{
"name": "CVE-2022-48752",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48752"
},
{
"name": "CVE-2022-48753",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48753"
},
{
"name": "CVE-2022-48754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48754"
},
{
"name": "CVE-2022-48755",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48755"
},
{
"name": "CVE-2022-48756",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48756"
},
{
"name": "CVE-2022-48758",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48758"
},
{
"name": "CVE-2022-48759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48759"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2022-48761",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48761"
},
{
"name": "CVE-2022-48763",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48763"
},
{
"name": "CVE-2022-48765",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48765"
},
{
"name": "CVE-2022-48766",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48766"
},
{
"name": "CVE-2022-48767",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48767"
},
{
"name": "CVE-2022-48768",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48768"
},
{
"name": "CVE-2022-48769",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48769"
},
{
"name": "CVE-2022-48770",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48770"
},
{
"name": "CVE-2022-48771",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48771"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-5281",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5281"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52846"
},
{
"name": "CVE-2023-52869",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52869"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36592"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38545"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0578",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-07-12T00:00:00.000000"
}
],
"risks": [
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2362-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242362-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2372-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242372-1"
},
{
"published_at": "2024-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2381-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242381-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2358-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242358-1"
},
{
"published_at": "2024-07-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2396-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242396-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2351-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242351-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2376-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242376-1"
},
{
"published_at": "2024-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2385-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242385-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2369-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242369-1"
},
{
"published_at": "2024-07-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2335-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242335-1"
},
{
"published_at": "2024-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2394-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242394-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2344-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242344-1"
},
{
"published_at": "2024-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2384-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242384-1"
},
{
"published_at": "2024-07-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2338-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242338-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2343-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242343-1"
},
{
"published_at": "2024-07-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2326-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242326-1"
},
{
"published_at": "2024-07-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2411-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242411-1"
},
{
"published_at": "2024-07-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2337-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242337-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2368-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242368-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2365-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242365-1"
},
{
"published_at": "2024-07-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2407-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242407-1"
},
{
"published_at": "2024-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2382-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242382-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2373-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242373-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2341-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242341-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2360-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242360-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2357-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242357-1"
},
{
"published_at": "2024-07-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2410-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242410-1"
},
{
"published_at": "2024-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2342-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242342-1"
}
]
}
CERTFR-2024-AVI-0610
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 12 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Software Development Kit 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 12 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Software Development Kit 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-10135",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10135"
},
{
"name": "CVE-2021-43389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43389"
},
{
"name": "CVE-2022-22942",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-22942"
},
{
"name": "CVE-2022-0435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0435"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-24023",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24023"
},
{
"name": "CVE-2023-6546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6546"
},
{
"name": "CVE-2023-52340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52340"
},
{
"name": "CVE-2024-26622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26622"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2023-52507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52507"
},
{
"name": "CVE-2024-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23307"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26745"
},
{
"name": "CVE-2024-26766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26766"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26687"
},
{
"name": "CVE-2024-26641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26641"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-26863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26863"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-26610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26610"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2022-48651",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48651"
},
{
"name": "CVE-2021-47201",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47201"
},
{
"name": "CVE-2021-47193",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47193"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-35805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35805"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2021-47293",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47293"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2021-4439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4439"
},
{
"name": "CVE-2021-47103",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47103"
},
{
"name": "CVE-2021-47294",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47294"
},
{
"name": "CVE-2021-47297",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47297"
},
{
"name": "CVE-2021-47309",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47309"
},
{
"name": "CVE-2021-47328",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47328"
},
{
"name": "CVE-2021-47566",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47566"
},
{
"name": "CVE-2021-47571",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47571"
},
{
"name": "CVE-2021-47576",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47576"
},
{
"name": "CVE-2021-47587",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47587"
},
{
"name": "CVE-2021-47589",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47589"
},
{
"name": "CVE-2021-47600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47600"
},
{
"name": "CVE-2021-47602",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47602"
},
{
"name": "CVE-2021-47603",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47603"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2021-47617",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47617"
},
{
"name": "CVE-2022-48711",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48711"
},
{
"name": "CVE-2022-48715",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48715"
},
{
"name": "CVE-2022-48722",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48722"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48733",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48733"
},
{
"name": "CVE-2022-48740",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48740"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2022-48754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48754"
},
{
"name": "CVE-2022-48756",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48756"
},
{
"name": "CVE-2022-48758",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48758"
},
{
"name": "CVE-2022-48759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48759"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2022-48761",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48761"
},
{
"name": "CVE-2022-48771",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48771"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-5281",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5281"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52846"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38545"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2021-47145",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47145"
},
{
"name": "CVE-2021-47547",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47547"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0610",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-07-19T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-07-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2472-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242472-1"
},
{
"published_at": "2024-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2493-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242493-1"
},
{
"published_at": "2024-07-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2487-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242487-1"
},
{
"published_at": "2024-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2530-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242530-1"
},
{
"published_at": "2024-07-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2474-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242474-1"
},
{
"published_at": "2024-07-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2488-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242488-1"
},
{
"published_at": "2024-07-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2448-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242448-1"
},
{
"published_at": "2024-07-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2480-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242480-1"
},
{
"published_at": "2024-07-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2447-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242447-1"
},
{
"published_at": "2024-07-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2561-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242561-1"
},
{
"published_at": "2024-07-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2559-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242559-1"
},
{
"published_at": "2024-07-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2449-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242449-1"
},
{
"published_at": "2024-07-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2549-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242549-1"
},
{
"published_at": "2024-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2495-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242495-1"
},
{
"published_at": "2024-07-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2473-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242473-1"
},
{
"published_at": "2024-07-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2437-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242437-1"
},
{
"published_at": "2024-07-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2558-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242558-1"
},
{
"published_at": "2024-07-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2446-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242446-1"
}
]
}
CERTFR-2024-AVI-0632
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une atteinte à la confidentialité des données, un contournement de la politique de sécurité et un déni de service.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP6 | ||
| SUSE | N/A | Basesystem Module 15-SP6 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | Legacy Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | Development Tools Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 |
| Title | Publication Time | Tags | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Desktop 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26750"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26780"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-0090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0090"
},
{
"name": "CVE-2024-0091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0091"
},
{
"name": "CVE-2024-0092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0092"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2023-52672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52672"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52846"
},
{
"name": "CVE-2023-52869",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52869"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38545"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52765"
},
{
"name": "CVE-2023-52767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52767"
},
{
"name": "CVE-2023-52768",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52768"
},
{
"name": "CVE-2023-52769",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52769"
},
{
"name": "CVE-2023-52776",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52776"
},
{
"name": "CVE-2023-52780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52780"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52783",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52783"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52801"
},
{
"name": "CVE-2023-52812",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52812"
},
{
"name": "CVE-2023-52827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52827"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52850"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2023-52862",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52862"
},
{
"name": "CVE-2023-52863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52863"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2023-52874",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52874"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2023-52883",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52883"
},
{
"name": "CVE-2024-26482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26482"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38391"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39362",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39362"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0632",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-07-26T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es, un contournement de la politique de s\u00e9curit\u00e9 et un d\u00e9ni de service.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2575-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242575-1"
},
{
"published_at": "2024-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2585-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242585-1"
},
{
"published_at": "2024-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2571-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242571-1"
}
]
}
CERTFR-2024-AVI-0693
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une élévation de privilèges et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP5 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | openSUSE Leap Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-26558",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26558"
},
{
"name": "CVE-2021-0129",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0129"
},
{
"name": "CVE-2021-43389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43389"
},
{
"name": "CVE-2022-20368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20368"
},
{
"name": "CVE-2022-0854",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0854"
},
{
"name": "CVE-2022-2964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2964"
},
{
"name": "CVE-2022-28748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28748"
},
{
"name": "CVE-2023-1582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1582"
},
{
"name": "CVE-2023-37453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37453"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-24023",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24023"
},
{
"name": "CVE-2023-51780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51780"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52594"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2023-52612",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52612"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-26659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26659"
},
{
"name": "CVE-2023-52507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52507"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26800"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26750"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2024-26780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26780"
},
{
"name": "CVE-2024-26641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26641"
},
{
"name": "CVE-2023-52580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52580"
},
{
"name": "CVE-2024-26863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26863"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26615"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-26644",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26644"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2024-26623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26623"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2021-47219",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47219"
},
{
"name": "CVE-2021-47197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47197"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2021-47201",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47201"
},
{
"name": "CVE-2021-47194",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47194"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2023-52672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52672"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2024-35805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35805"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35934"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-26944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26944"
},
{
"name": "CVE-2024-27064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27064"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2021-4439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4439"
},
{
"name": "CVE-2021-47089",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47089"
},
{
"name": "CVE-2021-47103",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47103"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2021-47515",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47515"
},
{
"name": "CVE-2021-47539",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47539"
},
{
"name": "CVE-2021-47566",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47566"
},
{
"name": "CVE-2021-47571",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47571"
},
{
"name": "CVE-2021-47572",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47572"
},
{
"name": "CVE-2021-47576",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47576"
},
{
"name": "CVE-2021-47577",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47577"
},
{
"name": "CVE-2021-47578",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47578"
},
{
"name": "CVE-2021-47580",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47580"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2021-47583",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47583"
},
{
"name": "CVE-2021-47584",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47584"
},
{
"name": "CVE-2021-47585",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47585"
},
{
"name": "CVE-2021-47586",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47586"
},
{
"name": "CVE-2021-47587",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47587"
},
{
"name": "CVE-2021-47589",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47589"
},
{
"name": "CVE-2021-47592",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47592"
},
{
"name": "CVE-2021-47595",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47595"
},
{
"name": "CVE-2021-47596",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47596"
},
{
"name": "CVE-2021-47597",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47597"
},
{
"name": "CVE-2021-47600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47600"
},
{
"name": "CVE-2021-47601",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47601"
},
{
"name": "CVE-2021-47602",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47602"
},
{
"name": "CVE-2021-47603",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47603"
},
{
"name": "CVE-2021-47604",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47604"
},
{
"name": "CVE-2021-47605",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47605"
},
{
"name": "CVE-2021-47607",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47607"
},
{
"name": "CVE-2021-47608",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47608"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2021-47610",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47610"
},
{
"name": "CVE-2021-47611",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47611"
},
{
"name": "CVE-2021-47612",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47612"
},
{
"name": "CVE-2021-47614",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47614"
},
{
"name": "CVE-2021-47615",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47615"
},
{
"name": "CVE-2021-47616",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47616"
},
{
"name": "CVE-2021-47617",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47617"
},
{
"name": "CVE-2021-47618",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47618"
},
{
"name": "CVE-2021-47619",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47619"
},
{
"name": "CVE-2021-47620",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47620"
},
{
"name": "CVE-2022-48711",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48711"
},
{
"name": "CVE-2022-48712",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48712"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48714",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48714"
},
{
"name": "CVE-2022-48715",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48715"
},
{
"name": "CVE-2022-48716",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48716"
},
{
"name": "CVE-2022-48717",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48717"
},
{
"name": "CVE-2022-48718",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48718"
},
{
"name": "CVE-2022-48720",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48720"
},
{
"name": "CVE-2022-48721",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48721"
},
{
"name": "CVE-2022-48722",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48722"
},
{
"name": "CVE-2022-48723",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48723"
},
{
"name": "CVE-2022-48724",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48724"
},
{
"name": "CVE-2022-48725",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48725"
},
{
"name": "CVE-2022-48726",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48726"
},
{
"name": "CVE-2022-48727",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48727"
},
{
"name": "CVE-2022-48728",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48728"
},
{
"name": "CVE-2022-48729",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48729"
},
{
"name": "CVE-2022-48730",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48730"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48733",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48733"
},
{
"name": "CVE-2022-48734",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48734"
},
{
"name": "CVE-2022-48735",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48735"
},
{
"name": "CVE-2022-48736",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48736"
},
{
"name": "CVE-2022-48737",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48737"
},
{
"name": "CVE-2022-48738",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48738"
},
{
"name": "CVE-2022-48739",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48739"
},
{
"name": "CVE-2022-48740",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48740"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2022-48744",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48744"
},
{
"name": "CVE-2022-48745",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48745"
},
{
"name": "CVE-2022-48746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48746"
},
{
"name": "CVE-2022-48747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48747"
},
{
"name": "CVE-2022-48748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48748"
},
{
"name": "CVE-2022-48749",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48749"
},
{
"name": "CVE-2022-48751",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48751"
},
{
"name": "CVE-2022-48752",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48752"
},
{
"name": "CVE-2022-48753",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48753"
},
{
"name": "CVE-2022-48754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48754"
},
{
"name": "CVE-2022-48755",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48755"
},
{
"name": "CVE-2022-48756",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48756"
},
{
"name": "CVE-2022-48758",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48758"
},
{
"name": "CVE-2022-48759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48759"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2022-48761",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48761"
},
{
"name": "CVE-2022-48763",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48763"
},
{
"name": "CVE-2022-48765",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48765"
},
{
"name": "CVE-2022-48766",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48766"
},
{
"name": "CVE-2022-48767",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48767"
},
{
"name": "CVE-2022-48768",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48768"
},
{
"name": "CVE-2022-48769",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48769"
},
{
"name": "CVE-2022-48770",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48770"
},
{
"name": "CVE-2022-48771",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48771"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52846"
},
{
"name": "CVE-2023-52869",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52869"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36592"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38545"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47145",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47145"
},
{
"name": "CVE-2021-47547",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47547"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52765"
},
{
"name": "CVE-2023-52767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52767"
},
{
"name": "CVE-2023-52768",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52768"
},
{
"name": "CVE-2023-52769",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52769"
},
{
"name": "CVE-2023-52776",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52776"
},
{
"name": "CVE-2023-52780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52780"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52783",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52783"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52801"
},
{
"name": "CVE-2023-52812",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52812"
},
{
"name": "CVE-2023-52827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52827"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52850"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2023-52862",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52862"
},
{
"name": "CVE-2023-52863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52863"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2023-52874",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52874"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2023-52883",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52883"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38391"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39362",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39362"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2023-52751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52751"
},
{
"name": "CVE-2024-26785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26785"
},
{
"name": "CVE-2024-27402",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27402"
},
{
"name": "CVE-2024-27404",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27404"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2016-20022",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-20022"
},
{
"name": "CVE-2021-47086",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47086"
},
{
"name": "CVE-2021-47126",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47126"
},
{
"name": "CVE-2021-47186",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47186"
},
{
"name": "CVE-2021-47291",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47291"
},
{
"name": "CVE-2021-47295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47295"
},
{
"name": "CVE-2021-47546",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47546"
},
{
"name": "CVE-2021-47588",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47588"
},
{
"name": "CVE-2021-47590",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47590"
},
{
"name": "CVE-2021-47591",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47591"
},
{
"name": "CVE-2021-47593",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47593"
},
{
"name": "CVE-2021-47598",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47598"
},
{
"name": "CVE-2021-47599",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47599"
},
{
"name": "CVE-2021-47606",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47606"
},
{
"name": "CVE-2021-47622",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47622"
},
{
"name": "CVE-2021-47623",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47623"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2022-48774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48774"
},
{
"name": "CVE-2022-48775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48775"
},
{
"name": "CVE-2022-48776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48776"
},
{
"name": "CVE-2022-48777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48777"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48780"
},
{
"name": "CVE-2022-48783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48783"
},
{
"name": "CVE-2022-48784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48784"
},
{
"name": "CVE-2022-48785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48785"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48788",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48788"
},
{
"name": "CVE-2022-48789",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48789"
},
{
"name": "CVE-2022-48790",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48790"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48792",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48792"
},
{
"name": "CVE-2022-48793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48793"
},
{
"name": "CVE-2022-48794",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48794"
},
{
"name": "CVE-2022-48796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48796"
},
{
"name": "CVE-2022-48797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48797"
},
{
"name": "CVE-2022-48798",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48798"
},
{
"name": "CVE-2022-48799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48799"
},
{
"name": "CVE-2022-48800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48800"
},
{
"name": "CVE-2022-48801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48801"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48803"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2022-48805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48805"
},
{
"name": "CVE-2022-48806",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48806"
},
{
"name": "CVE-2022-48807",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48807"
},
{
"name": "CVE-2022-48809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48809"
},
{
"name": "CVE-2022-48810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48810"
},
{
"name": "CVE-2022-48811",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48811"
},
{
"name": "CVE-2022-48812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48812"
},
{
"name": "CVE-2022-48813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48813"
},
{
"name": "CVE-2022-48814",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48814"
},
{
"name": "CVE-2022-48815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48815"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2022-48817",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48817"
},
{
"name": "CVE-2022-48818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48818"
},
{
"name": "CVE-2022-48820",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48820"
},
{
"name": "CVE-2022-48821",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48821"
},
{
"name": "CVE-2022-48822",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48822"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48824"
},
{
"name": "CVE-2022-48825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48825"
},
{
"name": "CVE-2022-48826",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48826"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2022-48828",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48828"
},
{
"name": "CVE-2022-48829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48829"
},
{
"name": "CVE-2022-48830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48830"
},
{
"name": "CVE-2022-48831",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48831"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48838",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48838"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48840"
},
{
"name": "CVE-2022-48841",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48841"
},
{
"name": "CVE-2022-48842",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48842"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48844",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48844"
},
{
"name": "CVE-2022-48846",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48846"
},
{
"name": "CVE-2022-48847",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48847"
},
{
"name": "CVE-2022-48849",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48849"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48851"
},
{
"name": "CVE-2022-48852",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48852"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48855",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48855"
},
{
"name": "CVE-2022-48856",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48856"
},
{
"name": "CVE-2022-48857",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48857"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2022-48859",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48859"
},
{
"name": "CVE-2022-48860",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48860"
},
{
"name": "CVE-2022-48861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48861"
},
{
"name": "CVE-2022-48862",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48862"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2022-48864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48864"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2023-31315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31315"
},
{
"name": "CVE-2023-52573",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52573"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0693",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-16T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une \u00e9l\u00e9vation de privil\u00e8ges et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2911-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242911-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2894-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242894-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2892-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242892-1"
},
{
"published_at": "2024-08-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2923-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242923-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2939-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242939-1"
},
{
"published_at": "2024-08-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2929-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242929-1"
},
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2902-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242902-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2895-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242895-1"
},
{
"published_at": "2024-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2874-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242874-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2896-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242896-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2893-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242893-1"
},
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2901-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242901-1"
}
]
}
CERTFR-2024-AVI-0717
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | Public Cloud Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Software Development Kit 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 12 12-SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP6 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap 15.6 |
| Title | Publication Time | Tags | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Software Development Kit 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 12 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-26558",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26558"
},
{
"name": "CVE-2021-0129",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0129"
},
{
"name": "CVE-2022-20368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20368"
},
{
"name": "CVE-2022-2964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2964"
},
{
"name": "CVE-2022-28748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28748"
},
{
"name": "CVE-2023-1582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1582"
},
{
"name": "CVE-2023-37453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37453"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-51780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51780"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52594"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2023-52612",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52612"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-26659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26659"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26800"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-26737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26737"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2023-52616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52616"
},
{
"name": "CVE-2024-26750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26750"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26816"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2023-52640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52640"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2023-52641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52641"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2023-52635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52635"
},
{
"name": "CVE-2024-26774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26774"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26780"
},
{
"name": "CVE-2024-26731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26731"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2024-26641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26641"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2023-52503",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52503"
},
{
"name": "CVE-2023-52580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52580"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26863"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26861"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26978"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26615"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26883"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26885"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-27030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27030"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2024-27046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27046"
},
{
"name": "CVE-2024-26903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26903"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-27022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27022"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26650"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2024-26623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26623"
},
{
"name": "CVE-2024-26632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26632"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2021-47219",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47219"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2021-47197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47197"
},
{
"name": "CVE-2024-26856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26856"
},
{
"name": "CVE-2024-26881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26881"
},
{
"name": "CVE-2023-52652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52652"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2024-26972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26972"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2024-26836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26836"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26783"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2021-47194",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47194"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52681"
},
{
"name": "CVE-2023-52687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52687"
},
{
"name": "CVE-2023-52695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52695"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2023-52771",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52771"
},
{
"name": "CVE-2023-52772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52772"
},
{
"name": "CVE-2023-6238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6238"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26652",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26652"
},
{
"name": "CVE-2024-26657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26657"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2024-26786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26786"
},
{
"name": "CVE-2024-26794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26794"
},
{
"name": "CVE-2024-26832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26832"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26854"
},
{
"name": "CVE-2024-26858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26858"
},
{
"name": "CVE-2024-26860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26860"
},
{
"name": "CVE-2024-26868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26868"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26909"
},
{
"name": "CVE-2024-26932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26932"
},
{
"name": "CVE-2024-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26945"
},
{
"name": "CVE-2024-26946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26946"
},
{
"name": "CVE-2024-26949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26949"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-26963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26963"
},
{
"name": "CVE-2024-26986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26986"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-26991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26991"
},
{
"name": "CVE-2024-26995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26995"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-27067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27067"
},
{
"name": "CVE-2024-27080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27080"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2024-27411",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27411"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-35786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35786"
},
{
"name": "CVE-2024-35788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35788"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35800"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35841"
},
{
"name": "CVE-2024-35842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35842"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35883"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35909"
},
{
"name": "CVE-2024-35911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35911"
},
{
"name": "CVE-2024-35916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35916"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35921"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35928"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-35953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35953"
},
{
"name": "CVE-2024-35954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35954"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-35972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35972"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35975"
},
{
"name": "CVE-2024-35977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35977"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36018"
},
{
"name": "CVE-2024-36019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36019"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36885"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2023-52672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52672"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2024-35805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35805"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35934"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-26944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26944"
},
{
"name": "CVE-2024-27064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27064"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2021-47103",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47103"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2021-47580",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47580"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2021-47597",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47597"
},
{
"name": "CVE-2021-47600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47600"
},
{
"name": "CVE-2021-47619",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47619"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48730",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48730"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48749",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48749"
},
{
"name": "CVE-2022-48756",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48756"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52869",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52869"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36592"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47547",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47547"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52765"
},
{
"name": "CVE-2023-52767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52767"
},
{
"name": "CVE-2023-52768",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52768"
},
{
"name": "CVE-2023-52769",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52769"
},
{
"name": "CVE-2023-52776",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52776"
},
{
"name": "CVE-2023-52780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52780"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52783",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52783"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52801"
},
{
"name": "CVE-2023-52812",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52812"
},
{
"name": "CVE-2023-52827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52827"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52850"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2023-52862",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52862"
},
{
"name": "CVE-2023-52863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52863"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2023-52874",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52874"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2023-52883",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52883"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38391"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39362",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39362"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2023-52751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52751"
},
{
"name": "CVE-2024-26785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26785"
},
{
"name": "CVE-2024-27402",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27402"
},
{
"name": "CVE-2024-27404",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27404"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2021-47086",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47086"
},
{
"name": "CVE-2021-47126",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47126"
},
{
"name": "CVE-2021-47186",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47186"
},
{
"name": "CVE-2021-47291",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47291"
},
{
"name": "CVE-2021-47295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47295"
},
{
"name": "CVE-2021-47546",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47546"
},
{
"name": "CVE-2021-47588",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47588"
},
{
"name": "CVE-2021-47590",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47590"
},
{
"name": "CVE-2021-47591",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47591"
},
{
"name": "CVE-2021-47593",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47593"
},
{
"name": "CVE-2021-47598",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47598"
},
{
"name": "CVE-2021-47599",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47599"
},
{
"name": "CVE-2021-47606",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47606"
},
{
"name": "CVE-2021-47622",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47622"
},
{
"name": "CVE-2021-47623",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47623"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2022-48774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48774"
},
{
"name": "CVE-2022-48775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48775"
},
{
"name": "CVE-2022-48776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48776"
},
{
"name": "CVE-2022-48777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48777"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48780"
},
{
"name": "CVE-2022-48783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48783"
},
{
"name": "CVE-2022-48784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48784"
},
{
"name": "CVE-2022-48785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48785"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48788",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48788"
},
{
"name": "CVE-2022-48789",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48789"
},
{
"name": "CVE-2022-48790",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48790"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48792",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48792"
},
{
"name": "CVE-2022-48793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48793"
},
{
"name": "CVE-2022-48794",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48794"
},
{
"name": "CVE-2022-48796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48796"
},
{
"name": "CVE-2022-48797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48797"
},
{
"name": "CVE-2022-48798",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48798"
},
{
"name": "CVE-2022-48799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48799"
},
{
"name": "CVE-2022-48800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48800"
},
{
"name": "CVE-2022-48801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48801"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48803"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2022-48805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48805"
},
{
"name": "CVE-2022-48806",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48806"
},
{
"name": "CVE-2022-48807",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48807"
},
{
"name": "CVE-2022-48809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48809"
},
{
"name": "CVE-2022-48810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48810"
},
{
"name": "CVE-2022-48811",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48811"
},
{
"name": "CVE-2022-48812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48812"
},
{
"name": "CVE-2022-48813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48813"
},
{
"name": "CVE-2022-48814",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48814"
},
{
"name": "CVE-2022-48815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48815"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2022-48817",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48817"
},
{
"name": "CVE-2022-48818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48818"
},
{
"name": "CVE-2022-48820",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48820"
},
{
"name": "CVE-2022-48821",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48821"
},
{
"name": "CVE-2022-48822",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48822"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48824"
},
{
"name": "CVE-2022-48825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48825"
},
{
"name": "CVE-2022-48826",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48826"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2022-48828",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48828"
},
{
"name": "CVE-2022-48829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48829"
},
{
"name": "CVE-2022-48830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48830"
},
{
"name": "CVE-2022-48831",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48831"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48838",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48838"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48840"
},
{
"name": "CVE-2022-48841",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48841"
},
{
"name": "CVE-2022-48842",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48842"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48844",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48844"
},
{
"name": "CVE-2022-48846",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48846"
},
{
"name": "CVE-2022-48847",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48847"
},
{
"name": "CVE-2022-48849",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48849"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48851"
},
{
"name": "CVE-2022-48852",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48852"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48855",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48855"
},
{
"name": "CVE-2022-48856",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48856"
},
{
"name": "CVE-2022-48857",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48857"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2022-48859",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48859"
},
{
"name": "CVE-2022-48860",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48860"
},
{
"name": "CVE-2022-48861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48861"
},
{
"name": "CVE-2022-48862",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48862"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2022-48864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48864"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2023-31315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31315"
},
{
"name": "CVE-2023-52573",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52573"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0717",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-23T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-08-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2980-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242980-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2940-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242940-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2944-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242944-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2943-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242943-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2948-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242948-1"
},
{
"published_at": "2024-08-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2973-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242973-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2947-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242947-1"
}
]
}
FKIE_CVE-2023-52754
Vulnerability from fkie_nvd - Published: 2024-05-21 16:15 - Updated: 2026-06-17 06:43| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9 | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7 | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/media/rc/imon.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "0f5068519f89d928d6c51100e4b274479123829f",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "5e0b788fb96be36d1baf1a5c88d09c7c82a0452a",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "b083aaf5db2eeca9e362723258e5d8698f7dd84e",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "2a493a34bd6e496c55fabedd82b957193ace178f",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
},
{
"lessThan": "a1766a4fd83befa0b34d932d532e7ebb7fab1fa7",
"status": "affected",
"version": "21677cfc562a27e099719d413287bc8d1d24deb7",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/media/rc/imon.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.35"
},
{
"lessThan": "2.6.35",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.202",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.140",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.64",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.5.*",
"status": "unaffected",
"version": "6.5.13",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.7",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "FF5E31E1-4DDB-480A-966E-3470C98B932E",
"versionEndExcluding": "5.10.202",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "15D6C23C-78A3-40D2-B76B-4F1D9C2D95C0",
"versionEndExcluding": "5.15.140",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "8D7C884A-CAA2-4EA2-9FEB-5CE776D7B05F",
"versionEndExcluding": "6.1.64",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "674C4F82-C336-4B49-BF64-1DE422E889C4",
"versionEndExcluding": "6.5.13",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B58252FA-A49C-411F-9B28-DC5FE44BC5A0",
"versionEndExcluding": "6.6.3",
"versionStartIncluding": "6.6",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmedia: imon: fix access to invalid resource for the second interface\n\nimon driver probes two USB interfaces, and at the probe of the second\ninterface, the driver assumes blindly that the first interface got\nbound with the same imon driver. It\u0027s usually true, but it\u0027s still\npossible that the first interface is bound with another driver via a\nmalformed descriptor. Then it may lead to a memory corruption, as\nspotted by syzkaller; imon driver accesses the data from drvdata as\nstruct imon_context object although it\u0027s a completely different one\nthat was assigned by another driver.\n\nThis patch adds a sanity check -- whether the first interface is\nreally bound with the imon driver or not -- for avoiding the problem\nabove at the probe time."
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: medios: imon: corrige el acceso a un recurso no v\u00e1lido para la segunda interfaz. El controlador imon prueba dos interfaces USB y, en la prueba de la segunda interfaz, el controlador asume ciegamente que la primera interfaz obtuvo atado con el mismo conductor imon. Generalmente es cierto, pero a\u00fan es posible que la primera interfaz est\u00e9 vinculada con otro controlador a trav\u00e9s de un descriptor con formato incorrecto. Entonces puede provocar una corrupci\u00f3n de la memoria, como descubri\u00f3 syzkaller; El controlador imon accede a los datos de drvdata como objeto struct imon_context aunque es uno completamente diferente asignado por otro controlador. Este parche agrega una verificaci\u00f3n de cordura (si la primera interfaz est\u00e1 realmente vinculada con el controlador imon o no) para evitar el problema anterior en el momento de la prueba."
}
],
"id": "CVE-2023-52754",
"lastModified": "2026-06-17T06:43:30.537",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-52754",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-05-21T18:42:53.248204Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-05-21T16:15:14.970",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-401"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-2QM9-92XG-CR8H
Vulnerability from github – Published: 2024-05-21 18:31 – Updated: 2025-09-23 21:30In the Linux kernel, the following vulnerability has been resolved:
media: imon: fix access to invalid resource for the second interface
imon driver probes two USB interfaces, and at the probe of the second interface, the driver assumes blindly that the first interface got bound with the same imon driver. It's usually true, but it's still possible that the first interface is bound with another driver via a malformed descriptor. Then it may lead to a memory corruption, as spotted by syzkaller; imon driver accesses the data from drvdata as struct imon_context object although it's a completely different one that was assigned by another driver.
This patch adds a sanity check -- whether the first interface is really bound with the imon driver or not -- for avoiding the problem above at the probe time.
{
"affected": [],
"aliases": [
"CVE-2023-52754"
],
"database_specific": {
"cwe_ids": [
"CWE-401"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-05-21T16:15:14Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nmedia: imon: fix access to invalid resource for the second interface\n\nimon driver probes two USB interfaces, and at the probe of the second\ninterface, the driver assumes blindly that the first interface got\nbound with the same imon driver. It\u0027s usually true, but it\u0027s still\npossible that the first interface is bound with another driver via a\nmalformed descriptor. Then it may lead to a memory corruption, as\nspotted by syzkaller; imon driver accesses the data from drvdata as\nstruct imon_context object although it\u0027s a completely different one\nthat was assigned by another driver.\n\nThis patch adds a sanity check -- whether the first interface is\nreally bound with the imon driver or not -- for avoiding the problem\nabove at the probe time.",
"id": "GHSA-2qm9-92xg-cr8h",
"modified": "2025-09-23T21:30:53Z",
"published": "2024-05-21T18:31:20Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52754"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/0f5068519f89d928d6c51100e4b274479123829f"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/10ec5a97f8f5a772a1a42b4eb27196b447cd3aa9"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/2a493a34bd6e496c55fabedd82b957193ace178f"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/5e0b788fb96be36d1baf1a5c88d09c7c82a0452a"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/a1766a4fd83befa0b34d932d532e7ebb7fab1fa7"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/b083aaf5db2eeca9e362723258e5d8698f7dd84e"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2024-1705 (CVE-2021-47236)
Vulnerability from osv_openeuler – Published: 2024-06-14 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
net: cdc_eem: fix tx fixup skb leak
when usbnet transmit a skb, eem fixup it in eem_tx_fixup(), if skb_copy_expand() failed, it return NULL, usbnet_start_xmit() will have no chance to free original skb.
fix it by free orginal skb in eem_tx_fixup() first, then check skb clone status, if failed, return NULL to usbnet.(CVE-2021-47236)
In the Linux kernel, the following vulnerability has been resolved:
gfs2: Fix use-after-free in gfs2_glock_shrink_scan
The GLF_LRU flag is checked under lru_lock in gfs2_glock_remove_from_lru() to remove the glock from the lru list in __gfs2_glock_put().
On the shrink scan path, the same flag is cleared under lru_lock but because of cond_resched_lock(&lru_lock) in gfs2_dispose_glock_lru(), progress on the put side can be made without deleting the glock from the lru list.
Keep GLF_LRU across the race window opened by cond_resched_lock(&lru_lock) to ensure correct behavior on both sides - clear GLF_LRU after list_del under lru_lock.(CVE-2021-47254)
In the Linux kernel, the following vulnerability has been resolved:
netrom: Decrease sock refcount when sock timers expire
Commit 63346650c1a9 ("netrom: switch to sock timer API") switched to use sock timer API. It replaces mod_timer() by sk_reset_timer(), and del_timer() by sk_stop_timer().
Function sk_reset_timer() will increase the refcount of sock if it is called on an inactive timer, hence, in case the timer expires, we need to decrease the refcount ourselves in the handler, otherwise, the sock refcount will be unbalanced and the sock will never be freed.(CVE-2021-47294)
In the Linux kernel, the following vulnerability has been resolved:
memory: fsl_ifc: fix leak of IO mapping on probe failure
On probe error the driver should unmap the IO memory. Smatch reports:
drivers/memory/fsl_ifc.c:298 fsl_ifc_ctrl_probe() warn: 'fsl_ifc_ctrl_dev->gregs' not released on lines: 298.(CVE-2021-47315)
In the Linux kernel, the following vulnerability has been resolved:
watchdog: Fix possible use-after-free in wdt_startup()
This module's remove path calls del_timer(). However, that function does not wait until the timer handler finishes. This means that the timer handler may still be running after the driver's remove function has finished, which would result in a use-after-free.
Fix by calling del_timer_sync(), which makes sure the timer handler has finished, and unable to re-schedule itself.(CVE-2021-47324)
In the Linux kernel, the following vulnerability has been resolved:
scsi: megaraid_sas: Fix resource leak in case of probe failure
The driver doesn't clean up all the allocated resources properly when scsi_add_host(), megasas_start_aen() function fails during the PCI device probe.
Clean up all those resources.(CVE-2021-47329)
In the Linux kernel, the following vulnerability has been resolved:
ipack: ipoctal: fix module reference leak
A reference to the carrier module was taken on every open but was only released once when the final reference to the tty struct was dropped.
Fix this by taking the module reference and initialising the tty driver data when installing the tty.(CVE-2021-47403)
In the Linux kernel, the following vulnerability has been resolved:
usb: dwc2: check return value after calling platform_get_resource()
It will cause null-ptr-deref if platform_get_resource() returns NULL, we need check the return value.(CVE-2021-47409)
In the Linux kernel, the following vulnerability has been resolved:
i40e: Fix freeing of uninitialized misc IRQ vector
When VSI set up failed in i40e_probe() as part of PF switch set up driver was trying to free misc IRQ vectors in i40e_clear_interrupt_scheme and produced a kernel Oops:
Trying to free already-free IRQ 266 WARNING: CPU: 0 PID: 5 at kernel/irq/manage.c:1731 __free_irq+0x9a/0x300 Workqueue: events work_for_cpu_fn RIP: 0010:__free_irq+0x9a/0x300 Call Trace: ? synchronize_irq+0x3a/0xa0 free_irq+0x2e/0x60 i40e_clear_interrupt_scheme+0x53/0x190 [i40e] i40e_probe.part.108+0x134b/0x1a40 [i40e] ? kmem_cache_alloc+0x158/0x1c0 ? acpi_ut_update_ref_count.part.1+0x8e/0x345 ? acpi_ut_update_object_reference+0x15e/0x1e2 ? strstr+0x21/0x70 ? irq_get_irq_data+0xa/0x20 ? mp_check_pin_attr+0x13/0xc0 ? irq_get_irq_data+0xa/0x20 ? mp_map_pin_to_irq+0xd3/0x2f0 ? acpi_register_gsi_ioapic+0x93/0x170 ? pci_conf1_read+0xa4/0x100 ? pci_bus_read_config_word+0x49/0x70 ? do_pci_enable_device+0xcc/0x100 local_pci_probe+0x41/0x90 work_for_cpu_fn+0x16/0x20 process_one_work+0x1a7/0x360 worker_thread+0x1cf/0x390 ? create_worker+0x1a0/0x1a0 kthread+0x112/0x130 ? kthread_flush_work_fn+0x10/0x10 ret_from_fork+0x1f/0x40
The problem is that at that point misc IRQ vectors were not allocated yet and we get a call trace that driver is trying to free already free IRQ vectors.
Add a check in i40e_clear_interrupt_scheme for __I40E_MISC_IRQ_REQUESTED PF state before calling i40e_free_misc_vector. This state is set only if misc IRQ vectors were properly initialized.(CVE-2021-47424)
In the Linux kernel, the following vulnerability has been resolved:
ocfs2: fix data corruption after conversion from inline format
Commit 6dbf7bb55598 ("fs: Don't invalidate page buffers in block_write_full_page()") uncovered a latent bug in ocfs2 conversion from inline inode format to a normal inode format.
The code in ocfs2_convert_inline_data_to_extents() attempts to zero out the whole cluster allocated for file data by grabbing, zeroing, and dirtying all pages covering this cluster. However these pages are beyond i_size, thus writeback code generally ignores these dirty pages and no blocks were ever actually zeroed on the disk.
This oversight was fixed by commit 693c241a5f6a ("ocfs2: No need to zero pages past i_size.") for standard ocfs2 write path, inline conversion path was apparently forgotten; the commit log also has a reasoning why the zeroing actually is not needed.
After commit 6dbf7bb55598, things became worse as writeback code stopped invalidating buffers on pages beyond i_size and thus these pages end up with clean PageDirty bit but with buffers attached to these pages being still dirty. So when a file is converted from inline format, then writeback triggers, and then the file is grown so that these pages become valid, the invalid dirtiness state is preserved, mark_buffer_dirty() does nothing on these pages (buffers are already dirty) but page is never written back because it is clean. So data written to these pages is lost once pages are reclaimed.
Simple reproducer for the problem is:
xfs_io -f -c "pwrite 0 2000" -c "pwrite 2000 2000" -c "fsync" \ -c "pwrite 4000 2000" ocfs2_file
After unmounting and mounting the fs again, you can observe that end of 'ocfs2_file' has lost its contents.
Fix the problem by not doing the pointless zeroing during conversion from inline format similarly as in the standard write path.
akpm@linux-foundation.org: fix whitespace, per Joseph
In the Linux kernel, the following vulnerability has been resolved:
comedi: ni_usb6501: fix NULL-deref in command paths
The driver uses endpoint-sized USB transfer buffers but had no sanity checks on the sizes. This can lead to zero-size-pointer dereferences or overflowed transfer buffers in ni6501_port_command() and ni6501_counter_command() if a (malicious) device has smaller max-packet sizes than expected (or when doing descriptor fuzz testing).
Add the missing sanity checks to probe().(CVE-2021-47476)
In the Linux kernel, the following vulnerability has been resolved:
isofs: Fix out of bound access for corrupted isofs image
When isofs image is suitably corrupted isofs_read_inode() can read data beyond the end of buffer. Sanity-check the directory entry length before using it.(CVE-2021-47478)
In the Linux kernel, the following vulnerability has been resolved:
staging: rtl8712: fix use-after-free in rtl8712_dl_fw
Syzbot reported use-after-free in rtl8712_dl_fw(). The problem was in race condition between r871xu_dev_remove() ->ndo_open() callback.
It's easy to see from crash log, that driver accesses released firmware in ->ndo_open() callback. It may happen, since driver was releasing firmware before unregistering netdev. Fix it by moving unregister_netdev() before cleaning up resources.
Call Trace: ... rtl871x_open_fw drivers/staging/rtl8712/hal_init.c:83 [inline] rtl8712_dl_fw+0xd95/0xe10 drivers/staging/rtl8712/hal_init.c:170 rtl8712_hal_init drivers/staging/rtl8712/hal_init.c:330 [inline] rtl871x_hal_init+0xae/0x180 drivers/staging/rtl8712/hal_init.c:394 netdev_open+0xe6/0x6c0 drivers/staging/rtl8712/os_intfs.c:380 __dev_open+0x2bc/0x4d0 net/core/dev.c:1484
Freed by task 1306: ... release_firmware+0x1b/0x30 drivers/base/firmware_loader/main.c:1053 r871xu_dev_remove+0xcc/0x2c0 drivers/staging/rtl8712/usb_intf.c:599 usb_unbind_interface+0x1d8/0x8d0 drivers/usb/core/driver.c:458(CVE-2021-47479)
In the Linux kernel, the following vulnerability has been resolved:
iio: accel: kxcjk-1013: Fix possible memory leak in probe and remove
When ACPI type is ACPI_SMO8500, the data->dready_trig will not be set, the memory allocated by iio_triggered_buffer_setup() will not be freed, and cause memory leak as follows:
unreferenced object 0xffff888009551400 (size 512): comm "i2c-SMO8500-125", pid 911, jiffies 4294911787 (age 83.852s) hex dump (first 32 bytes): 02 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................ 00 00 00 00 00 00 00 00 20 e2 e5 c0 ff ff ff ff ........ ....... backtrace: [<0000000041ce75ee>] kmem_cache_alloc_trace+0x16d/0x360 [<000000000aeb17b0>] iio_kfifo_allocate+0x41/0x130 [kfifo_buf] [<000000004b40c1f5>] iio_triggered_buffer_setup_ext+0x2c/0x210 [industrialio_triggered_buffer] [<000000004375b15f>] kxcjk1013_probe+0x10c3/0x1d81 [kxcjk_1013]
Fix it by remove data->dready_trig condition in probe and remove.(CVE-2021-47499)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: pcm: oss: Fix negative period/buffer sizes
The period size calculation in OSS layer may receive a negative value as an error, but the code there assumes only the positive values and handle them with size_t. Due to that, a too big value may be passed to the lower layers.
This patch changes the code to handle with ssize_t and adds the proper error checks appropriately.(CVE-2021-47511)
In the Linux kernel, the following vulnerability has been resolved:
nfc: fix potential NULL pointer deref in nfc_genl_dump_ses_done
The done() netlink callback nfc_genl_dump_ses_done() should check if received argument is non-NULL, because its allocation could fail earlier in dumpit() (nfc_genl_dump_ses()).(CVE-2021-47518)
In the Linux kernel, the following vulnerability has been resolved:
rxrpc: Fix rxrpc_local leak in rxrpc_lookup_peer()
Need to call rxrpc_put_local() for peer candidate before kfree() as it holds a ref to rxrpc_local.
DH: v2: Changed to abstract the peer freeing code out into a function
In the Linux kernel, the following vulnerability has been resolved:
net/mlx4_en: Fix an use-after-free bug in mlx4_en_try_alloc_resources()
In mlx4_en_try_alloc_resources(), mlx4_en_copy_priv() is called and tmp->tx_cq will be freed on the error path of mlx4_en_copy_priv(). After that mlx4_en_alloc_resources() is called and there is a dereference of &tmp->tx_cq[t][i] in mlx4_en_alloc_resources(), which could lead to a use after free problem on failure of mlx4_en_copy_priv().
Fix this bug by adding a check of mlx4_en_copy_priv()
This bug was found by a static analyzer. The analysis employs differential checking to identify inconsistent security operations (e.g., checks or kfrees) between two code paths and confirms that the inconsistent operations are not recovered in the current function or the callers, so they constitute bugs.
Note that, as a bug found by static analysis, it can be a false positive or hard to trigger. Multiple researchers have cross-reviewed the bug.
Builds with CONFIG_MLX4_EN=m show no new warnings, and our static analyzer no longer warns about this code.(CVE-2021-47541)
In the Linux kernel, the following vulnerability has been resolved:
net: qlogic: qlcnic: Fix a NULL pointer dereference in qlcnic_83xx_add_rings()
In qlcnic_83xx_add_rings(), the indirect function of ahw->hw_ops->alloc_mbx_args will be called to allocate memory for cmd.req.arg, and there is a dereference of it in qlcnic_83xx_add_rings(), which could lead to a NULL pointer dereference on failure of the indirect function like qlcnic_83xx_alloc_mbx_args().
Fix this bug by adding a check of alloc_mbx_args(), this patch imitates the logic of mbx_cmd()'s failure handling.
This bug was found by a static analyzer. The analysis employs differential checking to identify inconsistent security operations (e.g., checks or kfrees) between two code paths and confirms that the inconsistent operations are not recovered in the current function or the callers, so they constitute bugs.
Note that, as a bug found by static analysis, it can be a false positive or hard to trigger. Multiple researchers have cross-reviewed the bug.
Builds with CONFIG_QLCNIC=m show no new warnings, and our static analyzer no longer warns about this code.(CVE-2021-47542)
Rejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2021-47543)
In the Linux kernel, the following vulnerability has been resolved:
tcp: fix page frag corruption on page fault
Steffen reported a TCP stream corruption for HTTP requests served by the apache web-server using a cifs mount-point and memory mapping the relevant file.
The root cause is quite similar to the one addressed by commit 20eb4f29b602 ("net: fix sk_page_frag() recursion from memory reclaim"). Here the nested access to the task page frag is caused by a page fault on the (mmapped) user-space memory buffer coming from the cifs file.
The page fault handler performs an smb transaction on a different socket, inside the same process context. Since sk->sk_allaction for such socket does not prevent the usage for the task_frag, the nested allocation modify "under the hood" the page frag in use by the outer sendmsg call, corrupting the stream.
The overall relevant stack trace looks like the following:
httpd 78268 [001] 3461630.850950: probe:tcp_sendmsg_locked: ffffffff91461d91 tcp_sendmsg_locked+0x1 ffffffff91462b57 tcp_sendmsg+0x27 ffffffff9139814e sock_sendmsg+0x3e ffffffffc06dfe1d smb_send_kvec+0x28 [...] ffffffffc06cfaf8 cifs_readpages+0x213 ffffffff90e83c4b read_pages+0x6b ffffffff90e83f31 __do_page_cache_readahead+0x1c1 ffffffff90e79e98 filemap_fault+0x788 ffffffff90eb0458 __do_fault+0x38 ffffffff90eb5280 do_fault+0x1a0 ffffffff90eb7c84 __handle_mm_fault+0x4d4 ffffffff90eb8093 handle_mm_fault+0xc3 ffffffff90c74f6d __do_page_fault+0x1ed ffffffff90c75277 do_page_fault+0x37 ffffffff9160111e page_fault+0x1e ffffffff9109e7b5 copyin+0x25 ffffffff9109eb40 _copy_from_iter_full+0xe0 ffffffff91462370 tcp_sendmsg_locked+0x5e0 ffffffff91462370 tcp_sendmsg_locked+0x5e0 ffffffff91462b57 tcp_sendmsg+0x27 ffffffff9139815c sock_sendmsg+0x4c ffffffff913981f7 sock_write_iter+0x97 ffffffff90f2cc56 do_iter_readv_writev+0x156 ffffffff90f2dff0 do_iter_write+0x80 ffffffff90f2e1c3 vfs_writev+0xa3 ffffffff90f2e27c do_writev+0x5c ffffffff90c042bb do_syscall_64+0x5b ffffffff916000ad entry_SYSCALL_64_after_hwframe+0x65
The cifs filesystem rightfully sets sk_allocations to GFP_NOFS, we can avoid the nesting using the sk page frag for allocation lacking the __GFP_FS flag. Do not define an additional mm-helper for that, as this is strictly tied to the sk page frag usage.
v1 -> v2: - use a stricted sk_page_frag() check instead of reordering the code (Eric)(CVE-2021-47544)
In the Linux kernel, the following vulnerability has been resolved:
net: tulip: de4x5: fix the problem that the array 'lp->phy[8]' may be out of bound
In line 5001, if all id in the array 'lp->phy[8]' is not 0, when the 'for' end, the 'k' is 8.
At this time, the array 'lp->phy[8]' may be out of bound.(CVE-2021-47547)
In the Linux kernel, the following vulnerability has been resolved:
powerpc/powernv: Add a null pointer check in opal_event_init()
kasprintf() returns a pointer to dynamically allocated memory which can be NULL upon failure.(CVE-2023-52686)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: fix underflow in second superblock position calculations
Macro NILFS_SB2_OFFSET_BYTES, which computes the position of the second superblock, underflows when the argument device size is less than 4096 bytes. Therefore, when using this macro, it is necessary to check in advance that the device size is not less than a lower limit, or at least that underflow does not occur.
The current nilfs2 implementation lacks this check, causing out-of-bound block access when mounting devices smaller than 4096 bytes:
I/O error, dev loop0, sector 36028797018963960 op 0x0:(READ) flags 0x0 phys_seg 1 prio class 2 NILFS (loop0): unable to read secondary superblock (blocksize = 1024)
In addition, when trying to resize the filesystem to a size below 4096 bytes, this underflow occurs in nilfs_resize_fs(), passing a huge number of segments to nilfs_sufile_resize(), corrupting parameters such as the number of segments in superblocks. This causes excessive loop iterations in nilfs_sufile_resize() during a subsequent resize ioctl, causing semaphore ns_segctor_sem to block for a long time and hang the writer thread:
INFO: task segctord:5067 blocked for more than 143 seconds. Not tainted 6.2.0-rc8-syzkaller-00015-gf6feea56f66d #0 "echo 0 > /proc/sys/kernel/hung_task_timeout_secs" disables this message. task:segctord state:D stack:23456 pid:5067 ppid:2 flags:0x00004000 Call Trace: <TASK> context_switch kernel/sched/core.c:5293 [inline] __schedule+0x1409/0x43f0 kernel/sched/core.c:6606 schedule+0xc3/0x190 kernel/sched/core.c:6682 rwsem_down_write_slowpath+0xfcf/0x14a0 kernel/locking/rwsem.c:1190 nilfs_transaction_lock+0x25c/0x4f0 fs/nilfs2/segment.c:357 nilfs_segctor_thread_construct fs/nilfs2/segment.c:2486 [inline] nilfs_segctor_thread+0x52f/0x1140 fs/nilfs2/segment.c:2570 kthread+0x270/0x300 kernel/kthread.c:376 ret_from_fork+0x1f/0x30 arch/x86/entry/entry_64.S:308 </TASK> ... Call Trace: <TASK> folio_mark_accessed+0x51c/0xf00 mm/swap.c:515 __nilfs_get_page_block fs/nilfs2/page.c:42 [inline] nilfs_grab_buffer+0x3d3/0x540 fs/nilfs2/page.c:61 nilfs_mdt_submit_block+0xd7/0x8f0 fs/nilfs2/mdt.c:121 nilfs_mdt_read_block+0xeb/0x430 fs/nilfs2/mdt.c:176 nilfs_mdt_get_block+0x12d/0xbb0 fs/nilfs2/mdt.c:251 nilfs_sufile_get_segment_usage_block fs/nilfs2/sufile.c:92 [inline] nilfs_sufile_truncate_range fs/nilfs2/sufile.c:679 [inline] nilfs_sufile_resize+0x7a3/0x12b0 fs/nilfs2/sufile.c:777 nilfs_resize_fs+0x20c/0xed0 fs/nilfs2/super.c:422 nilfs_ioctl_resize fs/nilfs2/ioctl.c:1033 [inline] nilfs_ioctl+0x137c/0x2440 fs/nilfs2/ioctl.c:1301 ...
This fixes these issues by inserting appropriate minimum device size checks or anti-underflow checks, depending on where the macro is used.(CVE-2023-52705)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Avoid NULL dereference of timing generator
[Why & How] Check whether assigned timing generator is NULL or not before accessing its funcs to prevent NULL dereference.(CVE-2023-52753)
In the Linux kernel, the following vulnerability has been resolved:
media: imon: fix access to invalid resource for the second interface
imon driver probes two USB interfaces, and at the probe of the second interface, the driver assumes blindly that the first interface got bound with the same imon driver. It's usually true, but it's still possible that the first interface is bound with another driver via a malformed descriptor. Then it may lead to a memory corruption, as spotted by syzkaller; imon driver accesses the data from drvdata as struct imon_context object although it's a completely different one that was assigned by another driver.
This patch adds a sanity check -- whether the first interface is really bound with the imon driver or not -- for avoiding the problem above at the probe time.(CVE-2023-52754)
Rejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2023-52756)
In the Linux kernel, the following vulnerability has been resolved:
s390/dasd: protect device queue against concurrent access
In dasd_profile_start() the amount of requests on the device queue are counted. The access to the device queue is unprotected against concurrent access. With a lot of parallel I/O, especially with alias devices enabled, the device queue can change while dasd_profile_start() is accessing the queue. In the worst case this leads to a kernel panic due to incorrect pointer accesses.
Fix this by taking the device lock before accessing the queue and counting the requests. Additionally the check for a valid profile data pointer can be done earlier to avoid unnecessary locking in a hot path.(CVE-2023-52774)
In the Linux kernel, the following vulnerability has been resolved:
SUNRPC: Fix RPC client cleaned up the freed pipefs dentries
RPC client pipefs dentries cleanup is in separated rpc_remove_pipedir() workqueue,which takes care about pipefs superblock locking. In some special scenarios, when kernel frees the pipefs sb of the current client and immediately alloctes a new pipefs sb, rpc_remove_pipedir function would misjudge the existence of pipefs sb which is not the one it used to hold. As a result, the rpc_remove_pipedir would clean the released freed pipefs dentries.
To fix this issue, rpc_remove_pipedir should check whether the current pipefs sb is consistent with the original pipefs sb.
This error can be catched by KASAN:
[ 250.497700] BUG: KASAN: slab-use-after-free in dget_parent+0x195/0x200 [ 250.498315] Read of size 4 at addr ffff88800a2ab804 by task kworker/0:18/106503 [ 250.500549] Workqueue: events rpc_free_client_work [ 250.501001] Call Trace: [ 250.502880] kasan_report+0xb6/0xf0 [ 250.503209] ? dget_parent+0x195/0x200 [ 250.503561] dget_parent+0x195/0x200 [ 250.503897] ? __pfx_rpc_clntdir_depopulate+0x10/0x10 [ 250.504384] rpc_rmdir_depopulate+0x1b/0x90 [ 250.504781] rpc_remove_client_dir+0xf5/0x150 [ 250.505195] rpc_free_client_work+0xe4/0x230 [ 250.505598] process_one_work+0x8ee/0x13b0 ... [ 22.039056] Allocated by task 244: [ 22.039390] kasan_save_stack+0x22/0x50 [ 22.039758] kasan_set_track+0x25/0x30 [ 22.040109] __kasan_slab_alloc+0x59/0x70 [ 22.040487] kmem_cache_alloc_lru+0xf0/0x240 [ 22.040889] __d_alloc+0x31/0x8e0 [ 22.041207] d_alloc+0x44/0x1f0 [ 22.041514] __rpc_lookup_create_exclusive+0x11c/0x140 [ 22.041987] rpc_mkdir_populate.constprop.0+0x5f/0x110 [ 22.042459] rpc_create_client_dir+0x34/0x150 [ 22.042874] rpc_setup_pipedir_sb+0x102/0x1c0 [ 22.043284] rpc_client_register+0x136/0x4e0 [ 22.043689] rpc_new_client+0x911/0x1020 [ 22.044057] rpc_create_xprt+0xcb/0x370 [ 22.044417] rpc_create+0x36b/0x6c0 ... [ 22.049524] Freed by task 0: [ 22.049803] kasan_save_stack+0x22/0x50 [ 22.050165] kasan_set_track+0x25/0x30 [ 22.050520] kasan_save_free_info+0x2b/0x50 [ 22.050921] __kasan_slab_free+0x10e/0x1a0 [ 22.051306] kmem_cache_free+0xa5/0x390 [ 22.051667] rcu_core+0x62c/0x1930 [ 22.051995] __do_softirq+0x165/0x52a [ 22.052347] [ 22.052503] Last potentially related work creation: [ 22.052952] kasan_save_stack+0x22/0x50 [ 22.053313] __kasan_record_aux_stack+0x8e/0xa0 [ 22.053739] __call_rcu_common.constprop.0+0x6b/0x8b0 [ 22.054209] dentry_free+0xb2/0x140 [ 22.054540] __dentry_kill+0x3be/0x540 [ 22.054900] shrink_dentry_list+0x199/0x510 [ 22.055293] shrink_dcache_parent+0x190/0x240 [ 22.055703] do_one_tree+0x11/0x40 [ 22.056028] shrink_dcache_for_umount+0x61/0x140 [ 22.056461] generic_shutdown_super+0x70/0x590 [ 22.056879] kill_anon_super+0x3a/0x60 [ 22.057234] rpc_kill_sb+0x121/0x200(CVE-2023-52803)
In the Linux kernel, the following vulnerability has been resolved:
platform/x86: wmi: Fix opening of char device
Since commit fa1f68db6ca7 ("drivers: misc: pass miscdevice pointer via file private data"), the miscdevice stores a pointer to itself inside filp->private_data, which means that private_data will not be NULL when wmi_char_open() is called. This might cause memory corruption should wmi_char_open() be unable to find its driver, something which can happen when the associated WMI device is deleted in wmi_free_devices().
Fix the problem by using the miscdevice pointer to retrieve the WMI device data associated with a char device using container_of(). This also avoids wmi_char_open() picking a wrong WMI device bound to a driver with the same name as the original driver.(CVE-2023-52864)
In the Linux kernel, the following vulnerability has been resolved:
clk: mediatek: clk-mt6797: Add check for mtk_alloc_clk_data
Add the check for the return value of mtk_alloc_clk_data() in order to avoid NULL pointer dereference.(CVE-2023-52865)
In the Linux kernel, the following vulnerability has been resolved:
soc: qcom: llcc: Handle a second device without data corruption
Usually there is only one llcc device. But if there were a second, even a failed probe call would modify the global drv_data pointer. So check if drv_data is valid before overwriting it.(CVE-2023-52871)
In the Linux kernel, the following vulnerability has been resolved:
efi/capsule-loader: fix incorrect allocation size
gcc-14 notices that the allocation with sizeof(void) on 32-bit architectures is not enough for a 64-bit phys_addr_t:
drivers/firmware/efi/capsule-loader.c: In function 'efi_capsule_open': drivers/firmware/efi/capsule-loader.c:295:24: error: allocation of insufficient size '4' for type 'phys_addr_t' {aka 'long long unsigned int'} with size '8' [-Werror=alloc-size] 295 | cap_info->phys = kzalloc(sizeof(void *), GFP_KERNEL); | ^
Use the correct type instead here.(CVE-2024-27413)
In the Linux kernel, the following vulnerability has been resolved:
PCI/PM: Drain runtime-idle callbacks before driver removal
A race condition between the .runtime_idle() callback and the .remove() callback in the rtsx_pcr PCI driver leads to a kernel crash due to an unhandled page fault [1].
The problem is that rtsx_pci_runtime_idle() is not expected to be running after pm_runtime_get_sync() has been called, but the latter doesn't really guarantee that. It only guarantees that the suspend and resume callbacks will not be running when it returns.
However, if a .runtime_idle() callback is already running when pm_runtime_get_sync() is called, the latter will notice that the runtime PM status of the device is RPM_ACTIVE and it will return right away without waiting for the former to complete. In fact, it cannot wait for .runtime_idle() to complete because it may be called from that callback (it arguably does not make much sense to do that, but it is not strictly prohibited).
Thus in general, whoever is providing a .runtime_idle() callback needs to protect it from running in parallel with whatever code runs after pm_runtime_get_sync(). [Note that .runtime_idle() will not start after pm_runtime_get_sync() has returned, but it may continue running then if it has started earlier.]
One way to address that race condition is to call pm_runtime_barrier() after pm_runtime_get_sync() (not before it, because a nonzero value of the runtime PM usage counter is necessary to prevent runtime PM callbacks from being invoked) to wait for the .runtime_idle() callback to complete should it be running at that point. A suitable place for doing that is in pci_device_remove() which calls pm_runtime_get_sync() before removing the driver, so it may as well call pm_runtime_barrier() subsequently, which will prevent the race in question from occurring, not just in the rtsx_pcr driver, but in any PCI drivers providing .runtime_idle() callbacks.(CVE-2024-35809)
In the Linux kernel, the following vulnerability has been resolved:
wifi: brcmfmac: Fix use-after-free bug in brcmf_cfg80211_detach
This is the candidate patch of CVE-2023-47233 : https://nvd.nist.gov/vuln/detail/CVE-2023-47233
In brcm80211 driver,it starts with the following invoking chain to start init a timeout worker:
->brcmf_usb_probe ->brcmf_usb_probe_cb ->brcmf_attach ->brcmf_bus_started ->brcmf_cfg80211_attach ->wl_init_priv ->brcmf_init_escan ->INIT_WORK(&cfg->escan_timeout_work, brcmf_cfg80211_escan_timeout_worker);
If we disconnect the USB by hotplug, it will call brcmf_usb_disconnect to make cleanup. The invoking chain is :
brcmf_usb_disconnect ->brcmf_usb_disconnect_cb ->brcmf_detach ->brcmf_cfg80211_detach ->kfree(cfg);
While the timeout woker may still be running. This will cause a use-after-free bug on cfg in brcmf_cfg80211_escan_timeout_worker.
Fix it by deleting the timer and canceling the worker in brcmf_cfg80211_detach.
arend.vanspriel@broadcom.com: keep timer delete as is and cancel work just before free
In the Linux kernel, the following vulnerability has been resolved:
erspan: make sure erspan_base_hdr is present in skb->head
syzbot reported a problem in ip6erspan_rcv() [1]
Issue is that ip6erspan_rcv() (and erspan_rcv()) no longer make sure erspan_base_hdr is present in skb linear part (skb->head) before getting @ver field from it.
Add the missing pskb_may_pull() calls.
v2: Reload iph pointer in erspan_rcv() after pskb_may_pull() because skb->head might have changed.
[1]
BUG: KMSAN: uninit-value in pskb_may_pull_reason include/linux/skbuff.h:2742 [inline] BUG: KMSAN: uninit-value in pskb_may_pull include/linux/skbuff.h:2756 [inline] BUG: KMSAN: uninit-value in ip6erspan_rcv net/ipv6/ip6_gre.c:541 [inline] BUG: KMSAN: uninit-value in gre_rcv+0x11f8/0x1930 net/ipv6/ip6_gre.c:610 pskb_may_pull_reason include/linux/skbuff.h:2742 [inline] pskb_may_pull include/linux/skbuff.h:2756 [inline] ip6erspan_rcv net/ipv6/ip6_gre.c:541 [inline] gre_rcv+0x11f8/0x1930 net/ipv6/ip6_gre.c:610 ip6_protocol_deliver_rcu+0x1d4c/0x2ca0 net/ipv6/ip6_input.c:438 ip6_input_finish net/ipv6/ip6_input.c:483 [inline] NF_HOOK include/linux/netfilter.h:314 [inline] ip6_input+0x15d/0x430 net/ipv6/ip6_input.c:492 ip6_mc_input+0xa7e/0xc80 net/ipv6/ip6_input.c:586 dst_input include/net/dst.h:460 [inline] ip6_rcv_finish+0x955/0x970 net/ipv6/ip6_input.c:79 NF_HOOK include/linux/netfilter.h:314 [inline] ipv6_rcv+0xde/0x390 net/ipv6/ip6_input.c:310 __netif_receive_skb_one_core net/core/dev.c:5538 [inline] __netif_receive_skb+0x1da/0xa00 net/core/dev.c:5652 netif_receive_skb_internal net/core/dev.c:5738 [inline] netif_receive_skb+0x58/0x660 net/core/dev.c:5798 tun_rx_batched+0x3ee/0x980 drivers/net/tun.c:1549 tun_get_user+0x5566/0x69e0 drivers/net/tun.c:2002 tun_chr_write_iter+0x3af/0x5d0 drivers/net/tun.c:2048 call_write_iter include/linux/fs.h:2108 [inline] new_sync_write fs/read_write.c:497 [inline] vfs_write+0xb63/0x1520 fs/read_write.c:590 ksys_write+0x20f/0x4c0 fs/read_write.c:643 __do_sys_write fs/read_write.c:655 [inline] __se_sys_write fs/read_write.c:652 [inline] __x64_sys_write+0x93/0xe0 fs/read_write.c:652 do_syscall_64+0xd5/0x1f0 entry_SYSCALL_64_after_hwframe+0x6d/0x75
Uninit was created at: slab_post_alloc_hook mm/slub.c:3804 [inline] slab_alloc_node mm/slub.c:3845 [inline] kmem_cache_alloc_node+0x613/0xc50 mm/slub.c:3888 kmalloc_reserve+0x13d/0x4a0 net/core/skbuff.c:577 __alloc_skb+0x35b/0x7a0 net/core/skbuff.c:668 alloc_skb include/linux/skbuff.h:1318 [inline] alloc_skb_with_frags+0xc8/0xbf0 net/core/skbuff.c:6504 sock_alloc_send_pskb+0xa81/0xbf0 net/core/sock.c:2795 tun_alloc_skb drivers/net/tun.c:1525 [inline] tun_get_user+0x209a/0x69e0 drivers/net/tun.c:1846 tun_chr_write_iter+0x3af/0x5d0 drivers/net/tun.c:2048 call_write_iter include/linux/fs.h:2108 [inline] new_sync_write fs/read_write.c:497 [inline] vfs_write+0xb63/0x1520 fs/read_write.c:590 ksys_write+0x20f/0x4c0 fs/read_write.c:643 __do_sys_write fs/read_write.c:655 [inline] __se_sys_write fs/read_write.c:652 [inline] __x64_sys_write+0x93/0xe0 fs/read_write.c:652 do_syscall_64+0xd5/0x1f0 entry_SYSCALL_64_after_hwframe+0x6d/0x75
CPU: 1 PID: 5045 Comm: syz-executor114 Not tainted 6.9.0-rc1-syzkaller-00021-g962490525cff #0(CVE-2024-35888)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: validate user input for expected length
I got multiple syzbot reports showing old bugs exposed by BPF after commit 20f2505fb436 ("bpf: Try to avoid kzalloc in cgroup/{s,g}etsockopt")
setsockopt() @optlen argument should be taken into account before copying data.
BUG: KASAN: slab-out-of-bounds in copy_from_sockptr_offset include/linux/sockptr.h:49 [inline] BUG: KASAN: slab-out-of-bounds in copy_from_sockptr include/linux/sockptr.h:55 [inline] BUG: KASAN: slab-out-of-bounds in do_replace net/ipv4/netfilter/ip_tables.c:1111 [inline] BUG: KASAN: slab-out-of-bounds in do_ipt_set_ctl+0x902/0x3dd0 net/ipv4/netfilter/ip_tables.c:1627 Read of size 96 at addr ffff88802cd73da0 by task syz-executor.4/7238
CPU: 1 PID: 7238 Comm: syz-executor.4 Not tainted 6.9.0-rc2-next-20240403-syzkaller #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 03/27/2024 Call Trace: <TASK> __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0x241/0x360 lib/dump_stack.c:114 print_address_description mm/kasan/report.c:377 [inline] print_report+0x169/0x550 mm/kasan/report.c:488 kasan_report+0x143/0x180 mm/kasan/report.c:601 kasan_check_range+0x282/0x290 mm/kasan/generic.c:189 __asan_memcpy+0x29/0x70 mm/kasan/shadow.c:105 copy_from_sockptr_offset include/linux/sockptr.h:49 [inline] copy_from_sockptr include/linux/sockptr.h:55 [inline] do_replace net/ipv4/netfilter/ip_tables.c:1111 [inline] do_ipt_set_ctl+0x902/0x3dd0 net/ipv4/netfilter/ip_tables.c:1627 nf_setsockopt+0x295/0x2c0 net/netfilter/nf_sockopt.c:101 do_sock_setsockopt+0x3af/0x720 net/socket.c:2311 __sys_setsockopt+0x1ae/0x250 net/socket.c:2334 __do_sys_setsockopt net/socket.c:2343 [inline] __se_sys_setsockopt net/socket.c:2340 [inline] __x64_sys_setsockopt+0xb5/0xd0 net/socket.c:2340 do_syscall_64+0xfb/0x240 entry_SYSCALL_64_after_hwframe+0x72/0x7a RIP: 0033:0x7fd22067dde9 Code: 28 00 00 00 75 05 48 83 c4 28 c3 e8 e1 20 00 00 90 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48 RSP: 002b:00007fd21f9ff0c8 EFLAGS: 00000246 ORIG_RAX: 0000000000000036 RAX: ffffffffffffffda RBX: 00007fd2207abf80 RCX: 00007fd22067dde9 RDX: 0000000000000040 RSI: 0000000000000000 RDI: 0000000000000003 RBP: 00007fd2206ca47a R08: 0000000000000001 R09: 0000000000000000 R10: 0000000020000880 R11: 0000000000000246 R12: 0000000000000000 R13: 000000000000000b R14: 00007fd2207abf80 R15: 00007ffd2d0170d8 </TASK>
Allocated by task 7238: kasan_save_stack mm/kasan/common.c:47 [inline] kasan_save_track+0x3f/0x80 mm/kasan/common.c:68 poison_kmalloc_redzone mm/kasan/common.c:370 [inline] __kasan_kmalloc+0x98/0xb0 mm/kasan/common.c:387 kasan_kmalloc include/linux/kasan.h:211 [inline] __do_kmalloc_node mm/slub.c:4069 [inline] __kmalloc_noprof+0x200/0x410 mm/slub.c:4082 kmalloc_noprof include/linux/slab.h:664 [inline] __cgroup_bpf_run_filter_setsockopt+0xd47/0x1050 kernel/bpf/cgroup.c:1869 do_sock_setsockopt+0x6b4/0x720 net/socket.c:2293 __sys_setsockopt+0x1ae/0x250 net/socket.c:2334 __do_sys_setsockopt net/socket.c:2343 [inline] __se_sys_setsockopt net/socket.c:2340 [inline] __x64_sys_setsockopt+0xb5/0xd0 net/socket.c:2340 do_syscall_64+0xfb/0x240 entry_SYSCALL_64_after_hwframe+0x72/0x7a
The buggy address belongs to the object at ffff88802cd73da0 which belongs to the cache kmalloc-8 of size 8 The buggy address is located 0 bytes inside of allocated 1-byte region [ffff88802cd73da0, ffff88802cd73da1)
The buggy address belongs to the physical page: page: refcount:1 mapcount:0 mapping:0000000000000000 index:0xffff88802cd73020 pfn:0x2cd73 flags: 0xfff80000000000(node=0|zone=1|lastcpupid=0xfff) page_type: 0xffffefff(slab) raw: 00fff80000000000 ffff888015041280 dead000000000100 dead000000000122 raw: ffff88802cd73020 000000008080007f 00000001ffffefff 00 ---truncated---(CVE-2024-35896)
In the Linux kernel, the following vulnerability has been resolved:
i2c: smbus: fix NULL function pointer dereference
Baruch reported an OOPS when using the designware controller as target only. Target-only modes break the assumption of one transfer function always being available. Fix this by always checking the pointer in __i2c_transfer.
wsa: dropped the simplification in core-smbus to avoid theoretical regressions
In the Linux kernel, the following vulnerability has been resolved:
rtnetlink: Correct nested IFLA_VF_VLAN_LIST attribute validation
Each attribute inside a nested IFLA_VF_VLAN_LIST is assumed to be a struct ifla_vf_vlan_info so the size of such attribute needs to be at least of sizeof(struct ifla_vf_vlan_info) which is 14 bytes. The current size validation in do_setvfinfo is against NLA_HDRLEN (4 bytes) which is less than sizeof(struct ifla_vf_vlan_info) so this validation is not enough and a too small attribute might be cast to a struct ifla_vf_vlan_info, this might result in an out of bands read access when accessing the saved (casted) entry in ivvl.(CVE-2024-36017)
In the Linux kernel, the following vulnerability has been resolved:
mmc: sdhci-msm: pervent access to suspended controller
Generic sdhci code registers LED device and uses host->runtime_suspended flag to protect access to it. The sdhci-msm driver doesn't set this flag, which causes a crash when LED is accessed while controller is runtime suspended. Fix this by setting the flag correctly.(CVE-2024-36029)
In the Linux kernel, the following vulnerability has been resolved:
net: fix out-of-bounds access in ops_init
net_alloc_generic is called by net_alloc, which is called without any locking. It reads max_gen_ptrs, which is changed under pernet_ops_rwsem. It is read twice, first to allocate an array, then to set s.len, which is later used to limit the bounds of the array access.
It is possible that the array is allocated and another thread is registering a new pernet ops, increments max_gen_ptrs, which is then used to set s.len with a larger than allocated length for the variable array.
Fix it by reading max_gen_ptrs only once in net_alloc_generic. If max_gen_ptrs is later incremented, it will be caught in net_assign_generic.(CVE-2024-36883)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: fib6_rules: avoid possible NULL dereference in fib6_rule_action()
syzbot is able to trigger the following crash [1], caused by unsafe ip6_dst_idev() use.
Indeed ip6_dst_idev() can return NULL, and must always be checked.
[1]
Oops: general protection fault, probably for non-canonical address 0xdffffc0000000000: 0000 [#1] PREEMPT SMP KASAN PTI KASAN: null-ptr-deref in range [0x0000000000000000-0x0000000000000007] CPU: 0 PID: 31648 Comm: syz-executor.0 Not tainted 6.9.0-rc4-next-20240417-syzkaller #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 03/27/2024 RIP: 0010:__fib6_rule_action net/ipv6/fib6_rules.c:237 [inline] RIP: 0010:fib6_rule_action+0x241/0x7b0 net/ipv6/fib6_rules.c:267 Code: 02 00 00 49 8d 9f d8 00 00 00 48 89 d8 48 c1 e8 03 42 80 3c 20 00 74 08 48 89 df e8 f9 32 bf f7 48 8b 1b 48 89 d8 48 c1 e8 03 <42> 80 3c 20 00 74 08 48 89 df e8 e0 32 bf f7 4c 8b 03 48 89 ef 4c RSP: 0018:ffffc9000fc1f2f0 EFLAGS: 00010246 RAX: 0000000000000000 RBX: 0000000000000000 RCX: 1a772f98c8186700 RDX: 0000000000000003 RSI: ffffffff8bcac4e0 RDI: ffffffff8c1f9760 RBP: ffff8880673fb980 R08: ffffffff8fac15ef R09: 1ffffffff1f582bd R10: dffffc0000000000 R11: fffffbfff1f582be R12: dffffc0000000000 R13: 0000000000000080 R14: ffff888076509000 R15: ffff88807a029a00 FS: 00007f55e82ca6c0(0000) GS:ffff8880b9400000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000001b31d23000 CR3: 0000000022b66000 CR4: 00000000003506f0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> fib_rules_lookup+0x62c/0xdb0 net/core/fib_rules.c:317 fib6_rule_lookup+0x1fd/0x790 net/ipv6/fib6_rules.c:108 ip6_route_output_flags_noref net/ipv6/route.c:2637 [inline] ip6_route_output_flags+0x38e/0x610 net/ipv6/route.c:2649 ip6_route_output include/net/ip6_route.h:93 [inline] ip6_dst_lookup_tail+0x189/0x11a0 net/ipv6/ip6_output.c:1120 ip6_dst_lookup_flow+0xb9/0x180 net/ipv6/ip6_output.c:1250 sctp_v6_get_dst+0x792/0x1e20 net/sctp/ipv6.c:326 sctp_transport_route+0x12c/0x2e0 net/sctp/transport.c:455 sctp_assoc_add_peer+0x614/0x15c0 net/sctp/associola.c:662 sctp_connect_new_asoc+0x31d/0x6c0 net/sctp/socket.c:1099 __sctp_connect+0x66d/0xe30 net/sctp/socket.c:1197 sctp_connect net/sctp/socket.c:4819 [inline] sctp_inet_connect+0x149/0x1f0 net/sctp/socket.c:4834 __sys_connect_file net/socket.c:2048 [inline] __sys_connect+0x2df/0x310 net/socket.c:2065 __do_sys_connect net/socket.c:2075 [inline] __se_sys_connect net/socket.c:2072 [inline] __x64_sys_connect+0x7a/0x90 net/socket.c:2072 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xf5/0x240 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-36902)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: Fix potential uninit-value access in __ip6_make_skb()
As it was done in commit fc1092f51567 ("ipv4: Fix uninit-value access in __ip_make_skb()") for IPv4, check FLOWI_FLAG_KNOWN_NH on fl6->flowi6_flags instead of testing HDRINCL on the socket to avoid a race condition which causes uninit-value access.(CVE-2024-36903)
In the Linux kernel, the following vulnerability has been resolved:
block: fix overflow in blk_ioctl_discard()
There is no check for overflow of 'start + len' in blk_ioctl_discard(). Hung task occurs if submit an discard ioctl with the following param: start = 0x80000000000ff000, len = 0x8000000000fff000; Add the overflow validation now.(CVE-2024-36917)
In the Linux kernel, the following vulnerability has been resolved:
scsi: lpfc: Release hbalock before calling lpfc_worker_wake_up()
lpfc_worker_wake_up() calls the lpfc_work_done() routine, which takes the hbalock. Thus, lpfc_worker_wake_up() should not be called while holding the hbalock to avoid potential deadlock.(CVE-2024-36924)
In the Linux kernel, the following vulnerability has been resolved:
tipc: fix a possible memleak in tipc_buf_append
__skb_linearize() doesn't free the skb when it fails, so move '*buf = NULL' after __skb_linearize(), so that the skb can be freed on the err path.(CVE-2024-36954)
In the Linux kernel, the following vulnerability has been resolved:
fs/9p: only translate RWX permissions for plain 9P2000
Garbage in plain 9P2000's perm bits is allowed through, which causes it to be able to set (among others) the suid bit. This was presumably not the intent since the unix extended bits are handled explicitly and conditionally on .u.(CVE-2024-36964)
| URL | Type | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"python2-perf-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"bpftool-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm",
"perf-debuginfo-4.19.90-2406.2.0.0281.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2406.2.0.0281.oe2003sp4.src.rpm"
],
"x86_64": [
"bpftool-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"perf-debuginfo-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2406.2.0.0281.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2406.2.0.0281.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: cdc_eem: fix tx fixup skb leak\r\n\r\nwhen usbnet transmit a skb, eem fixup it in eem_tx_fixup(),\nif skb_copy_expand() failed, it return NULL,\nusbnet_start_xmit() will have no chance to free original skb.\r\n\r\nfix it by free orginal skb in eem_tx_fixup() first,\nthen check skb clone status, if failed, return NULL to usbnet.(CVE-2021-47236)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ngfs2: Fix use-after-free in gfs2_glock_shrink_scan\r\n\r\nThe GLF_LRU flag is checked under lru_lock in gfs2_glock_remove_from_lru() to\nremove the glock from the lru list in __gfs2_glock_put().\r\n\r\nOn the shrink scan path, the same flag is cleared under lru_lock but because\nof cond_resched_lock(\u0026amp;lru_lock) in gfs2_dispose_glock_lru(), progress on the\nput side can be made without deleting the glock from the lru list.\r\n\r\nKeep GLF_LRU across the race window opened by cond_resched_lock(\u0026amp;lru_lock) to\nensure correct behavior on both sides - clear GLF_LRU after list_del under\nlru_lock.(CVE-2021-47254)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetrom: Decrease sock refcount when sock timers expire\r\n\r\nCommit 63346650c1a9 (\u0026quot;netrom: switch to sock timer API\u0026quot;) switched to use\nsock timer API. It replaces mod_timer() by sk_reset_timer(), and\ndel_timer() by sk_stop_timer().\r\n\r\nFunction sk_reset_timer() will increase the refcount of sock if it is\ncalled on an inactive timer, hence, in case the timer expires, we need to\ndecrease the refcount ourselves in the handler, otherwise, the sock\nrefcount will be unbalanced and the sock will never be freed.(CVE-2021-47294)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmemory: fsl_ifc: fix leak of IO mapping on probe failure\r\n\r\nOn probe error the driver should unmap the IO memory. Smatch reports:\r\n\r\n drivers/memory/fsl_ifc.c:298 fsl_ifc_ctrl_probe() warn: \u0026apos;fsl_ifc_ctrl_dev-\u0026gt;gregs\u0026apos; not released on lines: 298.(CVE-2021-47315)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwatchdog: Fix possible use-after-free in wdt_startup()\r\n\r\nThis module\u0026apos;s remove path calls del_timer(). However, that function\ndoes not wait until the timer handler finishes. This means that the\ntimer handler may still be running after the driver\u0026apos;s remove function\nhas finished, which would result in a use-after-free.\r\n\r\nFix by calling del_timer_sync(), which makes sure the timer handler\nhas finished, and unable to re-schedule itself.(CVE-2021-47324)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: megaraid_sas: Fix resource leak in case of probe failure\r\n\r\nThe driver doesn\u0026apos;t clean up all the allocated resources properly when\nscsi_add_host(), megasas_start_aen() function fails during the PCI device\nprobe.\r\n\r\nClean up all those resources.(CVE-2021-47329)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipack: ipoctal: fix module reference leak\r\n\r\nA reference to the carrier module was taken on every open but was only\nreleased once when the final reference to the tty struct was dropped.\r\n\r\nFix this by taking the module reference and initialising the tty driver\ndata when installing the tty.(CVE-2021-47403)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nusb: dwc2: check return value after calling platform_get_resource()\r\n\r\nIt will cause null-ptr-deref if platform_get_resource() returns NULL,\nwe need check the return value.(CVE-2021-47409)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ni40e: Fix freeing of uninitialized misc IRQ vector\r\n\r\nWhen VSI set up failed in i40e_probe() as part of PF switch set up\ndriver was trying to free misc IRQ vectors in\ni40e_clear_interrupt_scheme and produced a kernel Oops:\r\n\r\n Trying to free already-free IRQ 266\n WARNING: CPU: 0 PID: 5 at kernel/irq/manage.c:1731 __free_irq+0x9a/0x300\n Workqueue: events work_for_cpu_fn\n RIP: 0010:__free_irq+0x9a/0x300\n Call Trace:\n ? synchronize_irq+0x3a/0xa0\n free_irq+0x2e/0x60\n i40e_clear_interrupt_scheme+0x53/0x190 [i40e]\n i40e_probe.part.108+0x134b/0x1a40 [i40e]\n ? kmem_cache_alloc+0x158/0x1c0\n ? acpi_ut_update_ref_count.part.1+0x8e/0x345\n ? acpi_ut_update_object_reference+0x15e/0x1e2\n ? strstr+0x21/0x70\n ? irq_get_irq_data+0xa/0x20\n ? mp_check_pin_attr+0x13/0xc0\n ? irq_get_irq_data+0xa/0x20\n ? mp_map_pin_to_irq+0xd3/0x2f0\n ? acpi_register_gsi_ioapic+0x93/0x170\n ? pci_conf1_read+0xa4/0x100\n ? pci_bus_read_config_word+0x49/0x70\n ? do_pci_enable_device+0xcc/0x100\n local_pci_probe+0x41/0x90\n work_for_cpu_fn+0x16/0x20\n process_one_work+0x1a7/0x360\n worker_thread+0x1cf/0x390\n ? create_worker+0x1a0/0x1a0\n kthread+0x112/0x130\n ? kthread_flush_work_fn+0x10/0x10\n ret_from_fork+0x1f/0x40\r\n\r\nThe problem is that at that point misc IRQ vectors\nwere not allocated yet and we get a call trace\nthat driver is trying to free already free IRQ vectors.\r\n\r\nAdd a check in i40e_clear_interrupt_scheme for __I40E_MISC_IRQ_REQUESTED\nPF state before calling i40e_free_misc_vector. This state is set only if\nmisc IRQ vectors were properly initialized.(CVE-2021-47424)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nocfs2: fix data corruption after conversion from inline format\r\n\r\nCommit 6dbf7bb55598 (\u0026quot;fs: Don\u0026apos;t invalidate page buffers in\nblock_write_full_page()\u0026quot;) uncovered a latent bug in ocfs2 conversion\nfrom inline inode format to a normal inode format.\r\n\r\nThe code in ocfs2_convert_inline_data_to_extents() attempts to zero out\nthe whole cluster allocated for file data by grabbing, zeroing, and\ndirtying all pages covering this cluster. However these pages are\nbeyond i_size, thus writeback code generally ignores these dirty pages\nand no blocks were ever actually zeroed on the disk.\r\n\r\nThis oversight was fixed by commit 693c241a5f6a (\u0026quot;ocfs2: No need to zero\npages past i_size.\u0026quot;) for standard ocfs2 write path, inline conversion\npath was apparently forgotten; the commit log also has a reasoning why\nthe zeroing actually is not needed.\r\n\r\nAfter commit 6dbf7bb55598, things became worse as writeback code stopped\ninvalidating buffers on pages beyond i_size and thus these pages end up\nwith clean PageDirty bit but with buffers attached to these pages being\nstill dirty. So when a file is converted from inline format, then\nwriteback triggers, and then the file is grown so that these pages\nbecome valid, the invalid dirtiness state is preserved,\nmark_buffer_dirty() does nothing on these pages (buffers are already\ndirty) but page is never written back because it is clean. So data\nwritten to these pages is lost once pages are reclaimed.\r\n\r\nSimple reproducer for the problem is:\r\n\r\n xfs_io -f -c \u0026quot;pwrite 0 2000\u0026quot; -c \u0026quot;pwrite 2000 2000\u0026quot; -c \u0026quot;fsync\u0026quot; \\\n -c \u0026quot;pwrite 4000 2000\u0026quot; ocfs2_file\r\n\r\nAfter unmounting and mounting the fs again, you can observe that end of\n\u0026apos;ocfs2_file\u0026apos; has lost its contents.\r\n\r\nFix the problem by not doing the pointless zeroing during conversion\nfrom inline format similarly as in the standard write path.\r\n\r\n[akpm@linux-foundation.org: fix whitespace, per Joseph](CVE-2021-47460)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncomedi: ni_usb6501: fix NULL-deref in command paths\r\n\r\nThe driver uses endpoint-sized USB transfer buffers but had no sanity\nchecks on the sizes. This can lead to zero-size-pointer dereferences or\noverflowed transfer buffers in ni6501_port_command() and\nni6501_counter_command() if a (malicious) device has smaller max-packet\nsizes than expected (or when doing descriptor fuzz testing).\r\n\r\nAdd the missing sanity checks to probe().(CVE-2021-47476)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nisofs: Fix out of bound access for corrupted isofs image\r\n\r\nWhen isofs image is suitably corrupted isofs_read_inode() can read data\nbeyond the end of buffer. Sanity-check the directory entry length before\nusing it.(CVE-2021-47478)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nstaging: rtl8712: fix use-after-free in rtl8712_dl_fw\r\n\r\nSyzbot reported use-after-free in rtl8712_dl_fw(). The problem was in\nrace condition between r871xu_dev_remove() -\u0026gt;ndo_open() callback.\r\n\r\nIt\u0026apos;s easy to see from crash log, that driver accesses released firmware\nin -\u0026gt;ndo_open() callback. It may happen, since driver was releasing\nfirmware _before_ unregistering netdev. Fix it by moving\nunregister_netdev() before cleaning up resources.\r\n\r\nCall Trace:\n...\n rtl871x_open_fw drivers/staging/rtl8712/hal_init.c:83 [inline]\n rtl8712_dl_fw+0xd95/0xe10 drivers/staging/rtl8712/hal_init.c:170\n rtl8712_hal_init drivers/staging/rtl8712/hal_init.c:330 [inline]\n rtl871x_hal_init+0xae/0x180 drivers/staging/rtl8712/hal_init.c:394\n netdev_open+0xe6/0x6c0 drivers/staging/rtl8712/os_intfs.c:380\n __dev_open+0x2bc/0x4d0 net/core/dev.c:1484\r\n\r\nFreed by task 1306:\n...\n release_firmware+0x1b/0x30 drivers/base/firmware_loader/main.c:1053\n r871xu_dev_remove+0xcc/0x2c0 drivers/staging/rtl8712/usb_intf.c:599\n usb_unbind_interface+0x1d8/0x8d0 drivers/usb/core/driver.c:458(CVE-2021-47479)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\niio: accel: kxcjk-1013: Fix possible memory leak in probe and remove\r\n\r\nWhen ACPI type is ACPI_SMO8500, the data-\u0026gt;dready_trig will not be set, the\nmemory allocated by iio_triggered_buffer_setup() will not be freed, and cause\nmemory leak as follows:\r\n\r\nunreferenced object 0xffff888009551400 (size 512):\n comm \u0026quot;i2c-SMO8500-125\u0026quot;, pid 911, jiffies 4294911787 (age 83.852s)\n hex dump (first 32 bytes):\n 02 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................\n 00 00 00 00 00 00 00 00 20 e2 e5 c0 ff ff ff ff ........ .......\n backtrace:\n [\u0026lt;0000000041ce75ee\u0026gt;] kmem_cache_alloc_trace+0x16d/0x360\n [\u0026lt;000000000aeb17b0\u0026gt;] iio_kfifo_allocate+0x41/0x130 [kfifo_buf]\n [\u0026lt;000000004b40c1f5\u0026gt;] iio_triggered_buffer_setup_ext+0x2c/0x210 [industrialio_triggered_buffer]\n [\u0026lt;000000004375b15f\u0026gt;] kxcjk1013_probe+0x10c3/0x1d81 [kxcjk_1013]\r\n\r\nFix it by remove data-\u0026gt;dready_trig condition in probe and remove.(CVE-2021-47499)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nALSA: pcm: oss: Fix negative period/buffer sizes\r\n\r\nThe period size calculation in OSS layer may receive a negative value\nas an error, but the code there assumes only the positive values and\nhandle them with size_t. Due to that, a too big value may be passed\nto the lower layers.\r\n\r\nThis patch changes the code to handle with ssize_t and adds the proper\nerror checks appropriately.(CVE-2021-47511)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnfc: fix potential NULL pointer deref in nfc_genl_dump_ses_done\r\n\r\nThe done() netlink callback nfc_genl_dump_ses_done() should check if\nreceived argument is non-NULL, because its allocation could fail earlier\nin dumpit() (nfc_genl_dump_ses()).(CVE-2021-47518)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nrxrpc: Fix rxrpc_local leak in rxrpc_lookup_peer()\r\n\r\nNeed to call rxrpc_put_local() for peer candidate before kfree() as it\nholds a ref to rxrpc_local.\r\n\r\n[DH: v2: Changed to abstract the peer freeing code out into a function](CVE-2021-47538)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/mlx4_en: Fix an use-after-free bug in mlx4_en_try_alloc_resources()\r\n\r\nIn mlx4_en_try_alloc_resources(), mlx4_en_copy_priv() is called and\ntmp-\u0026gt;tx_cq will be freed on the error path of mlx4_en_copy_priv().\nAfter that mlx4_en_alloc_resources() is called and there is a dereference\nof \u0026amp;tmp-\u0026gt;tx_cq[t][i] in mlx4_en_alloc_resources(), which could lead to\na use after free problem on failure of mlx4_en_copy_priv().\r\n\r\nFix this bug by adding a check of mlx4_en_copy_priv()\r\n\r\nThis bug was found by a static analyzer. The analysis employs\ndifferential checking to identify inconsistent security operations\n(e.g., checks or kfrees) between two code paths and confirms that the\ninconsistent operations are not recovered in the current function or\nthe callers, so they constitute bugs.\r\n\r\nNote that, as a bug found by static analysis, it can be a false\npositive or hard to trigger. Multiple researchers have cross-reviewed\nthe bug.\r\n\r\nBuilds with CONFIG_MLX4_EN=m show no new warnings,\nand our static analyzer no longer warns about this code.(CVE-2021-47541)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: qlogic: qlcnic: Fix a NULL pointer dereference in qlcnic_83xx_add_rings()\r\n\r\nIn qlcnic_83xx_add_rings(), the indirect function of\nahw-\u0026gt;hw_ops-\u0026gt;alloc_mbx_args will be called to allocate memory for\ncmd.req.arg, and there is a dereference of it in qlcnic_83xx_add_rings(),\nwhich could lead to a NULL pointer dereference on failure of the\nindirect function like qlcnic_83xx_alloc_mbx_args().\r\n\r\nFix this bug by adding a check of alloc_mbx_args(), this patch\nimitates the logic of mbx_cmd()\u0026apos;s failure handling.\r\n\r\nThis bug was found by a static analyzer. The analysis employs\ndifferential checking to identify inconsistent security operations\n(e.g., checks or kfrees) between two code paths and confirms that the\ninconsistent operations are not recovered in the current function or\nthe callers, so they constitute bugs.\r\n\r\nNote that, as a bug found by static analysis, it can be a false\npositive or hard to trigger. Multiple researchers have cross-reviewed\nthe bug.\r\n\r\nBuilds with CONFIG_QLCNIC=m show no new warnings, and our\nstatic analyzer no longer warns about this code.(CVE-2021-47542)\r\n\r\nRejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2021-47543)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntcp: fix page frag corruption on page fault\r\n\r\nSteffen reported a TCP stream corruption for HTTP requests\nserved by the apache web-server using a cifs mount-point\nand memory mapping the relevant file.\r\n\r\nThe root cause is quite similar to the one addressed by\ncommit 20eb4f29b602 (\u0026quot;net: fix sk_page_frag() recursion from\nmemory reclaim\u0026quot;). Here the nested access to the task page frag\nis caused by a page fault on the (mmapped) user-space memory\nbuffer coming from the cifs file.\r\n\r\nThe page fault handler performs an smb transaction on a different\nsocket, inside the same process context. Since sk-\u0026gt;sk_allaction\nfor such socket does not prevent the usage for the task_frag,\nthe nested allocation modify \u0026quot;under the hood\u0026quot; the page frag\nin use by the outer sendmsg call, corrupting the stream.\r\n\r\nThe overall relevant stack trace looks like the following:\r\n\r\nhttpd 78268 [001] 3461630.850950: probe:tcp_sendmsg_locked:\n ffffffff91461d91 tcp_sendmsg_locked+0x1\n ffffffff91462b57 tcp_sendmsg+0x27\n ffffffff9139814e sock_sendmsg+0x3e\n ffffffffc06dfe1d smb_send_kvec+0x28\n [...]\n ffffffffc06cfaf8 cifs_readpages+0x213\n ffffffff90e83c4b read_pages+0x6b\n ffffffff90e83f31 __do_page_cache_readahead+0x1c1\n ffffffff90e79e98 filemap_fault+0x788\n ffffffff90eb0458 __do_fault+0x38\n ffffffff90eb5280 do_fault+0x1a0\n ffffffff90eb7c84 __handle_mm_fault+0x4d4\n ffffffff90eb8093 handle_mm_fault+0xc3\n ffffffff90c74f6d __do_page_fault+0x1ed\n ffffffff90c75277 do_page_fault+0x37\n ffffffff9160111e page_fault+0x1e\n ffffffff9109e7b5 copyin+0x25\n ffffffff9109eb40 _copy_from_iter_full+0xe0\n ffffffff91462370 tcp_sendmsg_locked+0x5e0\n ffffffff91462370 tcp_sendmsg_locked+0x5e0\n ffffffff91462b57 tcp_sendmsg+0x27\n ffffffff9139815c sock_sendmsg+0x4c\n ffffffff913981f7 sock_write_iter+0x97\n ffffffff90f2cc56 do_iter_readv_writev+0x156\n ffffffff90f2dff0 do_iter_write+0x80\n ffffffff90f2e1c3 vfs_writev+0xa3\n ffffffff90f2e27c do_writev+0x5c\n ffffffff90c042bb do_syscall_64+0x5b\n ffffffff916000ad entry_SYSCALL_64_after_hwframe+0x65\r\n\r\nThe cifs filesystem rightfully sets sk_allocations to GFP_NOFS,\nwe can avoid the nesting using the sk page frag for allocation\nlacking the __GFP_FS flag. Do not define an additional mm-helper\nfor that, as this is strictly tied to the sk page frag usage.\r\n\r\nv1 -\u0026gt; v2:\n - use a stricted sk_page_frag() check instead of reordering the\n code (Eric)(CVE-2021-47544)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: tulip: de4x5: fix the problem that the array \u0026apos;lp-\u0026gt;phy[8]\u0026apos; may be out of bound\r\n\r\nIn line 5001, if all id in the array \u0026apos;lp-\u0026gt;phy[8]\u0026apos; is not 0, when the\n\u0026apos;for\u0026apos; end, the \u0026apos;k\u0026apos; is 8.\r\n\r\nAt this time, the array \u0026apos;lp-\u0026gt;phy[8]\u0026apos; may be out of bound.(CVE-2021-47547)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npowerpc/powernv: Add a null pointer check in opal_event_init()\r\n\r\nkasprintf() returns a pointer to dynamically allocated memory\nwhich can be NULL upon failure.(CVE-2023-52686)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: fix underflow in second superblock position calculations\r\n\r\nMacro NILFS_SB2_OFFSET_BYTES, which computes the position of the second\nsuperblock, underflows when the argument device size is less than 4096\nbytes. Therefore, when using this macro, it is necessary to check in\nadvance that the device size is not less than a lower limit, or at least\nthat underflow does not occur.\r\n\r\nThe current nilfs2 implementation lacks this check, causing out-of-bound\nblock access when mounting devices smaller than 4096 bytes:\r\n\r\n I/O error, dev loop0, sector 36028797018963960 op 0x0:(READ) flags 0x0\n phys_seg 1 prio class 2\n NILFS (loop0): unable to read secondary superblock (blocksize = 1024)\r\n\r\nIn addition, when trying to resize the filesystem to a size below 4096\nbytes, this underflow occurs in nilfs_resize_fs(), passing a huge number\nof segments to nilfs_sufile_resize(), corrupting parameters such as the\nnumber of segments in superblocks. This causes excessive loop iterations\nin nilfs_sufile_resize() during a subsequent resize ioctl, causing\nsemaphore ns_segctor_sem to block for a long time and hang the writer\nthread:\r\n\r\n INFO: task segctord:5067 blocked for more than 143 seconds.\n Not tainted 6.2.0-rc8-syzkaller-00015-gf6feea56f66d #0\n \u0026quot;echo 0 \u0026gt; /proc/sys/kernel/hung_task_timeout_secs\u0026quot; disables this message.\n task:segctord state:D stack:23456 pid:5067 ppid:2\n flags:0x00004000\n Call Trace:\n \u0026lt;TASK\u0026gt;\n context_switch kernel/sched/core.c:5293 [inline]\n __schedule+0x1409/0x43f0 kernel/sched/core.c:6606\n schedule+0xc3/0x190 kernel/sched/core.c:6682\n rwsem_down_write_slowpath+0xfcf/0x14a0 kernel/locking/rwsem.c:1190\n nilfs_transaction_lock+0x25c/0x4f0 fs/nilfs2/segment.c:357\n nilfs_segctor_thread_construct fs/nilfs2/segment.c:2486 [inline]\n nilfs_segctor_thread+0x52f/0x1140 fs/nilfs2/segment.c:2570\n kthread+0x270/0x300 kernel/kthread.c:376\n ret_from_fork+0x1f/0x30 arch/x86/entry/entry_64.S:308\n \u0026lt;/TASK\u0026gt;\n ...\n Call Trace:\n \u0026lt;TASK\u0026gt;\n folio_mark_accessed+0x51c/0xf00 mm/swap.c:515\n __nilfs_get_page_block fs/nilfs2/page.c:42 [inline]\n nilfs_grab_buffer+0x3d3/0x540 fs/nilfs2/page.c:61\n nilfs_mdt_submit_block+0xd7/0x8f0 fs/nilfs2/mdt.c:121\n nilfs_mdt_read_block+0xeb/0x430 fs/nilfs2/mdt.c:176\n nilfs_mdt_get_block+0x12d/0xbb0 fs/nilfs2/mdt.c:251\n nilfs_sufile_get_segment_usage_block fs/nilfs2/sufile.c:92 [inline]\n nilfs_sufile_truncate_range fs/nilfs2/sufile.c:679 [inline]\n nilfs_sufile_resize+0x7a3/0x12b0 fs/nilfs2/sufile.c:777\n nilfs_resize_fs+0x20c/0xed0 fs/nilfs2/super.c:422\n nilfs_ioctl_resize fs/nilfs2/ioctl.c:1033 [inline]\n nilfs_ioctl+0x137c/0x2440 fs/nilfs2/ioctl.c:1301\n ...\r\n\r\nThis fixes these issues by inserting appropriate minimum device size\nchecks or anti-underflow checks, depending on where the macro is used.(CVE-2023-52705)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Avoid NULL dereference of timing generator\r\n\r\n[Why \u0026amp; How]\nCheck whether assigned timing generator is NULL or not before\naccessing its funcs to prevent NULL dereference.(CVE-2023-52753)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: imon: fix access to invalid resource for the second interface\r\n\r\nimon driver probes two USB interfaces, and at the probe of the second\ninterface, the driver assumes blindly that the first interface got\nbound with the same imon driver. It\u0026apos;s usually true, but it\u0026apos;s still\npossible that the first interface is bound with another driver via a\nmalformed descriptor. Then it may lead to a memory corruption, as\nspotted by syzkaller; imon driver accesses the data from drvdata as\nstruct imon_context object although it\u0026apos;s a completely different one\nthat was assigned by another driver.\r\n\r\nThis patch adds a sanity check -- whether the first interface is\nreally bound with the imon driver or not -- for avoiding the problem\nabove at the probe time.(CVE-2023-52754)\r\n\r\nRejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2023-52756)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ns390/dasd: protect device queue against concurrent access\r\n\r\nIn dasd_profile_start() the amount of requests on the device queue are\ncounted. The access to the device queue is unprotected against\nconcurrent access. With a lot of parallel I/O, especially with alias\ndevices enabled, the device queue can change while dasd_profile_start()\nis accessing the queue. In the worst case this leads to a kernel panic\ndue to incorrect pointer accesses.\r\n\r\nFix this by taking the device lock before accessing the queue and\ncounting the requests. Additionally the check for a valid profile data\npointer can be done earlier to avoid unnecessary locking in a hot path.(CVE-2023-52774)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nSUNRPC: Fix RPC client cleaned up the freed pipefs dentries\r\n\r\nRPC client pipefs dentries cleanup is in separated rpc_remove_pipedir()\nworkqueue,which takes care about pipefs superblock locking.\nIn some special scenarios, when kernel frees the pipefs sb of the\ncurrent client and immediately alloctes a new pipefs sb,\nrpc_remove_pipedir function would misjudge the existence of pipefs\nsb which is not the one it used to hold. As a result,\nthe rpc_remove_pipedir would clean the released freed pipefs dentries.\r\n\r\nTo fix this issue, rpc_remove_pipedir should check whether the\ncurrent pipefs sb is consistent with the original pipefs sb.\r\n\r\nThis error can be catched by KASAN:\n=========================================================\n[ 250.497700] BUG: KASAN: slab-use-after-free in dget_parent+0x195/0x200\n[ 250.498315] Read of size 4 at addr ffff88800a2ab804 by task kworker/0:18/106503\n[ 250.500549] Workqueue: events rpc_free_client_work\n[ 250.501001] Call Trace:\n[ 250.502880] kasan_report+0xb6/0xf0\n[ 250.503209] ? dget_parent+0x195/0x200\n[ 250.503561] dget_parent+0x195/0x200\n[ 250.503897] ? __pfx_rpc_clntdir_depopulate+0x10/0x10\n[ 250.504384] rpc_rmdir_depopulate+0x1b/0x90\n[ 250.504781] rpc_remove_client_dir+0xf5/0x150\n[ 250.505195] rpc_free_client_work+0xe4/0x230\n[ 250.505598] process_one_work+0x8ee/0x13b0\n...\n[ 22.039056] Allocated by task 244:\n[ 22.039390] kasan_save_stack+0x22/0x50\n[ 22.039758] kasan_set_track+0x25/0x30\n[ 22.040109] __kasan_slab_alloc+0x59/0x70\n[ 22.040487] kmem_cache_alloc_lru+0xf0/0x240\n[ 22.040889] __d_alloc+0x31/0x8e0\n[ 22.041207] d_alloc+0x44/0x1f0\n[ 22.041514] __rpc_lookup_create_exclusive+0x11c/0x140\n[ 22.041987] rpc_mkdir_populate.constprop.0+0x5f/0x110\n[ 22.042459] rpc_create_client_dir+0x34/0x150\n[ 22.042874] rpc_setup_pipedir_sb+0x102/0x1c0\n[ 22.043284] rpc_client_register+0x136/0x4e0\n[ 22.043689] rpc_new_client+0x911/0x1020\n[ 22.044057] rpc_create_xprt+0xcb/0x370\n[ 22.044417] rpc_create+0x36b/0x6c0\n...\n[ 22.049524] Freed by task 0:\n[ 22.049803] kasan_save_stack+0x22/0x50\n[ 22.050165] kasan_set_track+0x25/0x30\n[ 22.050520] kasan_save_free_info+0x2b/0x50\n[ 22.050921] __kasan_slab_free+0x10e/0x1a0\n[ 22.051306] kmem_cache_free+0xa5/0x390\n[ 22.051667] rcu_core+0x62c/0x1930\n[ 22.051995] __do_softirq+0x165/0x52a\n[ 22.052347]\n[ 22.052503] Last potentially related work creation:\n[ 22.052952] kasan_save_stack+0x22/0x50\n[ 22.053313] __kasan_record_aux_stack+0x8e/0xa0\n[ 22.053739] __call_rcu_common.constprop.0+0x6b/0x8b0\n[ 22.054209] dentry_free+0xb2/0x140\n[ 22.054540] __dentry_kill+0x3be/0x540\n[ 22.054900] shrink_dentry_list+0x199/0x510\n[ 22.055293] shrink_dcache_parent+0x190/0x240\n[ 22.055703] do_one_tree+0x11/0x40\n[ 22.056028] shrink_dcache_for_umount+0x61/0x140\n[ 22.056461] generic_shutdown_super+0x70/0x590\n[ 22.056879] kill_anon_super+0x3a/0x60\n[ 22.057234] rpc_kill_sb+0x121/0x200(CVE-2023-52803)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nplatform/x86: wmi: Fix opening of char device\r\n\r\nSince commit fa1f68db6ca7 (\u0026quot;drivers: misc: pass miscdevice pointer via\nfile private data\u0026quot;), the miscdevice stores a pointer to itself inside\nfilp-\u0026gt;private_data, which means that private_data will not be NULL when\nwmi_char_open() is called. This might cause memory corruption should\nwmi_char_open() be unable to find its driver, something which can\nhappen when the associated WMI device is deleted in wmi_free_devices().\r\n\r\nFix the problem by using the miscdevice pointer to retrieve the WMI\ndevice data associated with a char device using container_of(). This\nalso avoids wmi_char_open() picking a wrong WMI device bound to a\ndriver with the same name as the original driver.(CVE-2023-52864)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: mediatek: clk-mt6797: Add check for mtk_alloc_clk_data\r\n\r\nAdd the check for the return value of mtk_alloc_clk_data() in order to\navoid NULL pointer dereference.(CVE-2023-52865)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nsoc: qcom: llcc: Handle a second device without data corruption\r\n\r\nUsually there is only one llcc device. But if there were a second, even\na failed probe call would modify the global drv_data pointer. So check\nif drv_data is valid before overwriting it.(CVE-2023-52871)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nefi/capsule-loader: fix incorrect allocation size\r\n\r\ngcc-14 notices that the allocation with sizeof(void) on 32-bit architectures\nis not enough for a 64-bit phys_addr_t:\r\n\r\ndrivers/firmware/efi/capsule-loader.c: In function \u0026apos;efi_capsule_open\u0026apos;:\ndrivers/firmware/efi/capsule-loader.c:295:24: error: allocation of insufficient size \u0026apos;4\u0026apos; for type \u0026apos;phys_addr_t\u0026apos; {aka \u0026apos;long long unsigned int\u0026apos;} with size \u0026apos;8\u0026apos; [-Werror=alloc-size]\n 295 | cap_info-\u0026gt;phys = kzalloc(sizeof(void *), GFP_KERNEL);\n | ^\r\n\r\nUse the correct type instead here.(CVE-2024-27413)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nPCI/PM: Drain runtime-idle callbacks before driver removal\r\n\r\nA race condition between the .runtime_idle() callback and the .remove()\ncallback in the rtsx_pcr PCI driver leads to a kernel crash due to an\nunhandled page fault [1].\r\n\r\nThe problem is that rtsx_pci_runtime_idle() is not expected to be running\nafter pm_runtime_get_sync() has been called, but the latter doesn\u0026apos;t really\nguarantee that. It only guarantees that the suspend and resume callbacks\nwill not be running when it returns.\r\n\r\nHowever, if a .runtime_idle() callback is already running when\npm_runtime_get_sync() is called, the latter will notice that the runtime PM\nstatus of the device is RPM_ACTIVE and it will return right away without\nwaiting for the former to complete. In fact, it cannot wait for\n.runtime_idle() to complete because it may be called from that callback (it\narguably does not make much sense to do that, but it is not strictly\nprohibited).\r\n\r\nThus in general, whoever is providing a .runtime_idle() callback needs\nto protect it from running in parallel with whatever code runs after\npm_runtime_get_sync(). [Note that .runtime_idle() will not start after\npm_runtime_get_sync() has returned, but it may continue running then if it\nhas started earlier.]\r\n\r\nOne way to address that race condition is to call pm_runtime_barrier()\nafter pm_runtime_get_sync() (not before it, because a nonzero value of the\nruntime PM usage counter is necessary to prevent runtime PM callbacks from\nbeing invoked) to wait for the .runtime_idle() callback to complete should\nit be running at that point. A suitable place for doing that is in\npci_device_remove() which calls pm_runtime_get_sync() before removing the\ndriver, so it may as well call pm_runtime_barrier() subsequently, which\nwill prevent the race in question from occurring, not just in the rtsx_pcr\ndriver, but in any PCI drivers providing .runtime_idle() callbacks.(CVE-2024-35809)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: brcmfmac: Fix use-after-free bug in brcmf_cfg80211_detach\r\n\r\nThis is the candidate patch of CVE-2023-47233 :\nhttps://nvd.nist.gov/vuln/detail/CVE-2023-47233\r\n\r\nIn brcm80211 driver,it starts with the following invoking chain\nto start init a timeout worker:\r\n\r\n-\u0026gt;brcmf_usb_probe\n -\u0026gt;brcmf_usb_probe_cb\n -\u0026gt;brcmf_attach\n -\u0026gt;brcmf_bus_started\n -\u0026gt;brcmf_cfg80211_attach\n -\u0026gt;wl_init_priv\n -\u0026gt;brcmf_init_escan\n -\u0026gt;INIT_WORK(\u0026amp;cfg-\u0026gt;escan_timeout_work,\n\t\t brcmf_cfg80211_escan_timeout_worker);\r\n\r\nIf we disconnect the USB by hotplug, it will call\nbrcmf_usb_disconnect to make cleanup. The invoking chain is :\r\n\r\nbrcmf_usb_disconnect\n -\u0026gt;brcmf_usb_disconnect_cb\n -\u0026gt;brcmf_detach\n -\u0026gt;brcmf_cfg80211_detach\n -\u0026gt;kfree(cfg);\r\n\r\nWhile the timeout woker may still be running. This will cause\na use-after-free bug on cfg in brcmf_cfg80211_escan_timeout_worker.\r\n\r\nFix it by deleting the timer and canceling the worker in\nbrcmf_cfg80211_detach.\r\n\r\n[arend.vanspriel@broadcom.com: keep timer delete as is and cancel work just before free](CVE-2024-35811)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nerspan: make sure erspan_base_hdr is present in skb-\u0026gt;head\r\n\r\nsyzbot reported a problem in ip6erspan_rcv() [1]\r\n\r\nIssue is that ip6erspan_rcv() (and erspan_rcv()) no longer make\nsure erspan_base_hdr is present in skb linear part (skb-\u0026gt;head)\nbefore getting @ver field from it.\r\n\r\nAdd the missing pskb_may_pull() calls.\r\n\r\nv2: Reload iph pointer in erspan_rcv() after pskb_may_pull()\n because skb-\u0026gt;head might have changed.\r\n\r\n[1]\r\n\r\n BUG: KMSAN: uninit-value in pskb_may_pull_reason include/linux/skbuff.h:2742 [inline]\n BUG: KMSAN: uninit-value in pskb_may_pull include/linux/skbuff.h:2756 [inline]\n BUG: KMSAN: uninit-value in ip6erspan_rcv net/ipv6/ip6_gre.c:541 [inline]\n BUG: KMSAN: uninit-value in gre_rcv+0x11f8/0x1930 net/ipv6/ip6_gre.c:610\n pskb_may_pull_reason include/linux/skbuff.h:2742 [inline]\n pskb_may_pull include/linux/skbuff.h:2756 [inline]\n ip6erspan_rcv net/ipv6/ip6_gre.c:541 [inline]\n gre_rcv+0x11f8/0x1930 net/ipv6/ip6_gre.c:610\n ip6_protocol_deliver_rcu+0x1d4c/0x2ca0 net/ipv6/ip6_input.c:438\n ip6_input_finish net/ipv6/ip6_input.c:483 [inline]\n NF_HOOK include/linux/netfilter.h:314 [inline]\n ip6_input+0x15d/0x430 net/ipv6/ip6_input.c:492\n ip6_mc_input+0xa7e/0xc80 net/ipv6/ip6_input.c:586\n dst_input include/net/dst.h:460 [inline]\n ip6_rcv_finish+0x955/0x970 net/ipv6/ip6_input.c:79\n NF_HOOK include/linux/netfilter.h:314 [inline]\n ipv6_rcv+0xde/0x390 net/ipv6/ip6_input.c:310\n __netif_receive_skb_one_core net/core/dev.c:5538 [inline]\n __netif_receive_skb+0x1da/0xa00 net/core/dev.c:5652\n netif_receive_skb_internal net/core/dev.c:5738 [inline]\n netif_receive_skb+0x58/0x660 net/core/dev.c:5798\n tun_rx_batched+0x3ee/0x980 drivers/net/tun.c:1549\n tun_get_user+0x5566/0x69e0 drivers/net/tun.c:2002\n tun_chr_write_iter+0x3af/0x5d0 drivers/net/tun.c:2048\n call_write_iter include/linux/fs.h:2108 [inline]\n new_sync_write fs/read_write.c:497 [inline]\n vfs_write+0xb63/0x1520 fs/read_write.c:590\n ksys_write+0x20f/0x4c0 fs/read_write.c:643\n __do_sys_write fs/read_write.c:655 [inline]\n __se_sys_write fs/read_write.c:652 [inline]\n __x64_sys_write+0x93/0xe0 fs/read_write.c:652\n do_syscall_64+0xd5/0x1f0\n entry_SYSCALL_64_after_hwframe+0x6d/0x75\r\n\r\nUninit was created at:\n slab_post_alloc_hook mm/slub.c:3804 [inline]\n slab_alloc_node mm/slub.c:3845 [inline]\n kmem_cache_alloc_node+0x613/0xc50 mm/slub.c:3888\n kmalloc_reserve+0x13d/0x4a0 net/core/skbuff.c:577\n __alloc_skb+0x35b/0x7a0 net/core/skbuff.c:668\n alloc_skb include/linux/skbuff.h:1318 [inline]\n alloc_skb_with_frags+0xc8/0xbf0 net/core/skbuff.c:6504\n sock_alloc_send_pskb+0xa81/0xbf0 net/core/sock.c:2795\n tun_alloc_skb drivers/net/tun.c:1525 [inline]\n tun_get_user+0x209a/0x69e0 drivers/net/tun.c:1846\n tun_chr_write_iter+0x3af/0x5d0 drivers/net/tun.c:2048\n call_write_iter include/linux/fs.h:2108 [inline]\n new_sync_write fs/read_write.c:497 [inline]\n vfs_write+0xb63/0x1520 fs/read_write.c:590\n ksys_write+0x20f/0x4c0 fs/read_write.c:643\n __do_sys_write fs/read_write.c:655 [inline]\n __se_sys_write fs/read_write.c:652 [inline]\n __x64_sys_write+0x93/0xe0 fs/read_write.c:652\n do_syscall_64+0xd5/0x1f0\n entry_SYSCALL_64_after_hwframe+0x6d/0x75\r\n\r\nCPU: 1 PID: 5045 Comm: syz-executor114 Not tainted 6.9.0-rc1-syzkaller-00021-g962490525cff #0(CVE-2024-35888)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: validate user input for expected length\r\n\r\nI got multiple syzbot reports showing old bugs exposed\nby BPF after commit 20f2505fb436 (\u0026quot;bpf: Try to avoid kzalloc\nin cgroup/{s,g}etsockopt\u0026quot;)\r\n\r\nsetsockopt() @optlen argument should be taken into account\nbefore copying data.\r\n\r\n BUG: KASAN: slab-out-of-bounds in copy_from_sockptr_offset include/linux/sockptr.h:49 [inline]\n BUG: KASAN: slab-out-of-bounds in copy_from_sockptr include/linux/sockptr.h:55 [inline]\n BUG: KASAN: slab-out-of-bounds in do_replace net/ipv4/netfilter/ip_tables.c:1111 [inline]\n BUG: KASAN: slab-out-of-bounds in do_ipt_set_ctl+0x902/0x3dd0 net/ipv4/netfilter/ip_tables.c:1627\nRead of size 96 at addr ffff88802cd73da0 by task syz-executor.4/7238\r\n\r\nCPU: 1 PID: 7238 Comm: syz-executor.4 Not tainted 6.9.0-rc2-next-20240403-syzkaller #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 03/27/2024\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0x241/0x360 lib/dump_stack.c:114\n print_address_description mm/kasan/report.c:377 [inline]\n print_report+0x169/0x550 mm/kasan/report.c:488\n kasan_report+0x143/0x180 mm/kasan/report.c:601\n kasan_check_range+0x282/0x290 mm/kasan/generic.c:189\n __asan_memcpy+0x29/0x70 mm/kasan/shadow.c:105\n copy_from_sockptr_offset include/linux/sockptr.h:49 [inline]\n copy_from_sockptr include/linux/sockptr.h:55 [inline]\n do_replace net/ipv4/netfilter/ip_tables.c:1111 [inline]\n do_ipt_set_ctl+0x902/0x3dd0 net/ipv4/netfilter/ip_tables.c:1627\n nf_setsockopt+0x295/0x2c0 net/netfilter/nf_sockopt.c:101\n do_sock_setsockopt+0x3af/0x720 net/socket.c:2311\n __sys_setsockopt+0x1ae/0x250 net/socket.c:2334\n __do_sys_setsockopt net/socket.c:2343 [inline]\n __se_sys_setsockopt net/socket.c:2340 [inline]\n __x64_sys_setsockopt+0xb5/0xd0 net/socket.c:2340\n do_syscall_64+0xfb/0x240\n entry_SYSCALL_64_after_hwframe+0x72/0x7a\nRIP: 0033:0x7fd22067dde9\nCode: 28 00 00 00 75 05 48 83 c4 28 c3 e8 e1 20 00 00 90 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48\nRSP: 002b:00007fd21f9ff0c8 EFLAGS: 00000246 ORIG_RAX: 0000000000000036\nRAX: ffffffffffffffda RBX: 00007fd2207abf80 RCX: 00007fd22067dde9\nRDX: 0000000000000040 RSI: 0000000000000000 RDI: 0000000000000003\nRBP: 00007fd2206ca47a R08: 0000000000000001 R09: 0000000000000000\nR10: 0000000020000880 R11: 0000000000000246 R12: 0000000000000000\nR13: 000000000000000b R14: 00007fd2207abf80 R15: 00007ffd2d0170d8\n \u0026lt;/TASK\u0026gt;\r\n\r\nAllocated by task 7238:\n kasan_save_stack mm/kasan/common.c:47 [inline]\n kasan_save_track+0x3f/0x80 mm/kasan/common.c:68\n poison_kmalloc_redzone mm/kasan/common.c:370 [inline]\n __kasan_kmalloc+0x98/0xb0 mm/kasan/common.c:387\n kasan_kmalloc include/linux/kasan.h:211 [inline]\n __do_kmalloc_node mm/slub.c:4069 [inline]\n __kmalloc_noprof+0x200/0x410 mm/slub.c:4082\n kmalloc_noprof include/linux/slab.h:664 [inline]\n __cgroup_bpf_run_filter_setsockopt+0xd47/0x1050 kernel/bpf/cgroup.c:1869\n do_sock_setsockopt+0x6b4/0x720 net/socket.c:2293\n __sys_setsockopt+0x1ae/0x250 net/socket.c:2334\n __do_sys_setsockopt net/socket.c:2343 [inline]\n __se_sys_setsockopt net/socket.c:2340 [inline]\n __x64_sys_setsockopt+0xb5/0xd0 net/socket.c:2340\n do_syscall_64+0xfb/0x240\n entry_SYSCALL_64_after_hwframe+0x72/0x7a\r\n\r\nThe buggy address belongs to the object at ffff88802cd73da0\n which belongs to the cache kmalloc-8 of size 8\nThe buggy address is located 0 bytes inside of\n allocated 1-byte region [ffff88802cd73da0, ffff88802cd73da1)\r\n\r\nThe buggy address belongs to the physical page:\npage: refcount:1 mapcount:0 mapping:0000000000000000 index:0xffff88802cd73020 pfn:0x2cd73\nflags: 0xfff80000000000(node=0|zone=1|lastcpupid=0xfff)\npage_type: 0xffffefff(slab)\nraw: 00fff80000000000 ffff888015041280 dead000000000100 dead000000000122\nraw: ffff88802cd73020 000000008080007f 00000001ffffefff 00\n---truncated---(CVE-2024-35896)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ni2c: smbus: fix NULL function pointer dereference\r\n\r\nBaruch reported an OOPS when using the designware controller as target\nonly. Target-only modes break the assumption of one transfer function\nalways being available. Fix this by always checking the pointer in\n__i2c_transfer.\r\n\r\n[wsa: dropped the simplification in core-smbus to avoid theoretical regressions](CVE-2024-35984)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nrtnetlink: Correct nested IFLA_VF_VLAN_LIST attribute validation\r\n\r\nEach attribute inside a nested IFLA_VF_VLAN_LIST is assumed to be a\nstruct ifla_vf_vlan_info so the size of such attribute needs to be at least\nof sizeof(struct ifla_vf_vlan_info) which is 14 bytes.\nThe current size validation in do_setvfinfo is against NLA_HDRLEN (4 bytes)\nwhich is less than sizeof(struct ifla_vf_vlan_info) so this validation\nis not enough and a too small attribute might be cast to a\nstruct ifla_vf_vlan_info, this might result in an out of bands\nread access when accessing the saved (casted) entry in ivvl.(CVE-2024-36017)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmmc: sdhci-msm: pervent access to suspended controller\r\n\r\nGeneric sdhci code registers LED device and uses host-\u0026gt;runtime_suspended\nflag to protect access to it. The sdhci-msm driver doesn\u0026apos;t set this flag,\nwhich causes a crash when LED is accessed while controller is runtime\nsuspended. Fix this by setting the flag correctly.(CVE-2024-36029)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: fix out-of-bounds access in ops_init\r\n\r\nnet_alloc_generic is called by net_alloc, which is called without any\nlocking. It reads max_gen_ptrs, which is changed under pernet_ops_rwsem. It\nis read twice, first to allocate an array, then to set s.len, which is\nlater used to limit the bounds of the array access.\r\n\r\nIt is possible that the array is allocated and another thread is\nregistering a new pernet ops, increments max_gen_ptrs, which is then used\nto set s.len with a larger than allocated length for the variable array.\r\n\r\nFix it by reading max_gen_ptrs only once in net_alloc_generic. If\nmax_gen_ptrs is later incremented, it will be caught in net_assign_generic.(CVE-2024-36883)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: fib6_rules: avoid possible NULL dereference in fib6_rule_action()\r\n\r\nsyzbot is able to trigger the following crash [1],\ncaused by unsafe ip6_dst_idev() use.\r\n\r\nIndeed ip6_dst_idev() can return NULL, and must always be checked.\r\n\r\n[1]\r\n\r\nOops: general protection fault, probably for non-canonical address 0xdffffc0000000000: 0000 [#1] PREEMPT SMP KASAN PTI\nKASAN: null-ptr-deref in range [0x0000000000000000-0x0000000000000007]\nCPU: 0 PID: 31648 Comm: syz-executor.0 Not tainted 6.9.0-rc4-next-20240417-syzkaller #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 03/27/2024\n RIP: 0010:__fib6_rule_action net/ipv6/fib6_rules.c:237 [inline]\n RIP: 0010:fib6_rule_action+0x241/0x7b0 net/ipv6/fib6_rules.c:267\nCode: 02 00 00 49 8d 9f d8 00 00 00 48 89 d8 48 c1 e8 03 42 80 3c 20 00 74 08 48 89 df e8 f9 32 bf f7 48 8b 1b 48 89 d8 48 c1 e8 03 \u0026lt;42\u0026gt; 80 3c 20 00 74 08 48 89 df e8 e0 32 bf f7 4c 8b 03 48 89 ef 4c\nRSP: 0018:ffffc9000fc1f2f0 EFLAGS: 00010246\nRAX: 0000000000000000 RBX: 0000000000000000 RCX: 1a772f98c8186700\nRDX: 0000000000000003 RSI: ffffffff8bcac4e0 RDI: ffffffff8c1f9760\nRBP: ffff8880673fb980 R08: ffffffff8fac15ef R09: 1ffffffff1f582bd\nR10: dffffc0000000000 R11: fffffbfff1f582be R12: dffffc0000000000\nR13: 0000000000000080 R14: ffff888076509000 R15: ffff88807a029a00\nFS: 00007f55e82ca6c0(0000) GS:ffff8880b9400000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000001b31d23000 CR3: 0000000022b66000 CR4: 00000000003506f0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n \u0026lt;TASK\u0026gt;\n fib_rules_lookup+0x62c/0xdb0 net/core/fib_rules.c:317\n fib6_rule_lookup+0x1fd/0x790 net/ipv6/fib6_rules.c:108\n ip6_route_output_flags_noref net/ipv6/route.c:2637 [inline]\n ip6_route_output_flags+0x38e/0x610 net/ipv6/route.c:2649\n ip6_route_output include/net/ip6_route.h:93 [inline]\n ip6_dst_lookup_tail+0x189/0x11a0 net/ipv6/ip6_output.c:1120\n ip6_dst_lookup_flow+0xb9/0x180 net/ipv6/ip6_output.c:1250\n sctp_v6_get_dst+0x792/0x1e20 net/sctp/ipv6.c:326\n sctp_transport_route+0x12c/0x2e0 net/sctp/transport.c:455\n sctp_assoc_add_peer+0x614/0x15c0 net/sctp/associola.c:662\n sctp_connect_new_asoc+0x31d/0x6c0 net/sctp/socket.c:1099\n __sctp_connect+0x66d/0xe30 net/sctp/socket.c:1197\n sctp_connect net/sctp/socket.c:4819 [inline]\n sctp_inet_connect+0x149/0x1f0 net/sctp/socket.c:4834\n __sys_connect_file net/socket.c:2048 [inline]\n __sys_connect+0x2df/0x310 net/socket.c:2065\n __do_sys_connect net/socket.c:2075 [inline]\n __se_sys_connect net/socket.c:2072 [inline]\n __x64_sys_connect+0x7a/0x90 net/socket.c:2072\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xf5/0x240 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-36902)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: Fix potential uninit-value access in __ip6_make_skb()\r\n\r\nAs it was done in commit fc1092f51567 (\u0026quot;ipv4: Fix uninit-value access in\n__ip_make_skb()\u0026quot;) for IPv4, check FLOWI_FLAG_KNOWN_NH on fl6-\u0026gt;flowi6_flags\ninstead of testing HDRINCL on the socket to avoid a race condition which\ncauses uninit-value access.(CVE-2024-36903)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nblock: fix overflow in blk_ioctl_discard()\r\n\r\nThere is no check for overflow of \u0026apos;start + len\u0026apos; in blk_ioctl_discard().\nHung task occurs if submit an discard ioctl with the following param:\n start = 0x80000000000ff000, len = 0x8000000000fff000;\nAdd the overflow validation now.(CVE-2024-36917)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: lpfc: Release hbalock before calling lpfc_worker_wake_up()\r\n\r\nlpfc_worker_wake_up() calls the lpfc_work_done() routine, which takes the\nhbalock. Thus, lpfc_worker_wake_up() should not be called while holding the\nhbalock to avoid potential deadlock.(CVE-2024-36924)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntipc: fix a possible memleak in tipc_buf_append\r\n\r\n__skb_linearize() doesn\u0026apos;t free the skb when it fails, so move\n\u0026apos;*buf = NULL\u0026apos; after __skb_linearize(), so that the skb can be\nfreed on the err path.(CVE-2024-36954)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/9p: only translate RWX permissions for plain 9P2000\r\n\r\nGarbage in plain 9P2000\u0026apos;s perm bits is allowed through, which causes it\nto be able to set (among others) the suid bit. This was presumably not\nthe intent since the unix extended bits are handled explicitly and\nconditionally on .u.(CVE-2024-36964)",
"id": "OESA-2024-1705",
"modified": "2026-08-06T11:07:10Z",
"published": "2024-06-14T11:07:10Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1705"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47236"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47254"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47294"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47315"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47324"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47329"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47403"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47409"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47424"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47460"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47476"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47478"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47479"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47499"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47511"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47518"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47538"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47541"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47542"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47543"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47544"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47547"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52686"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52705"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52753"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52754"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52756"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52774"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52803"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52864"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52865"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52871"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27413"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35809"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35811"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35888"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35896"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35984"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36017"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36029"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36883"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36902"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36903"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36917"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36924"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36954"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36964"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:H/PR:H/UI:N/S:U/C:N/I:N/A:N",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47236",
"CVE-2021-47254",
"CVE-2021-47294",
"CVE-2021-47315",
"CVE-2021-47324",
"CVE-2021-47329",
"CVE-2021-47403",
"CVE-2021-47409",
"CVE-2021-47424",
"CVE-2021-47460",
"CVE-2021-47476",
"CVE-2021-47478",
"CVE-2021-47479",
"CVE-2021-47499",
"CVE-2021-47511",
"CVE-2021-47518",
"CVE-2021-47538",
"CVE-2021-47541",
"CVE-2021-47542",
"CVE-2021-47543",
"CVE-2021-47544",
"CVE-2021-47547",
"CVE-2023-52686",
"CVE-2023-52705",
"CVE-2023-52753",
"CVE-2023-52754",
"CVE-2023-52756",
"CVE-2023-52774",
"CVE-2023-52803",
"CVE-2023-52864",
"CVE-2023-52865",
"CVE-2023-52871",
"CVE-2024-27413",
"CVE-2024-35809",
"CVE-2024-35811",
"CVE-2024-35888",
"CVE-2024-35896",
"CVE-2024-35984",
"CVE-2024-36017",
"CVE-2024-36029",
"CVE-2024-36883",
"CVE-2024-36902",
"CVE-2024-36903",
"CVE-2024-36917",
"CVE-2024-36924",
"CVE-2024-36954",
"CVE-2024-36964"
]
}
OESA-2024-2126 (CVE-2022-48867)
Vulnerability from osv_openeuler – Published: 2024-09-14 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
dmaengine: idxd: Prevent use after free on completion memory
On driver unload any pending descriptors are flushed at the time the interrupt is freed: idxd_dmaengine_drv_remove() -> drv_disable_wq() -> idxd_wq_free_irq() -> idxd_flush_pending_descs().
If there are any descriptors present that need to be flushed this flow triggers a "not present" page fault as below:
BUG: unable to handle page fault for address: ff391c97c70c9040 #PF: supervisor read access in kernel mode #PF: error_code(0x0000) - not-present page
The address that triggers the fault is the address of the descriptor that was freed moments earlier via: drv_disable_wq()->idxd_wq_free_resources()
Fix the use after free by freeing the descriptors after any possible usage. This is done after idxd_wq_reset() to ensure that the memory remains accessible during possible completion writes by the device.(CVE-2022-48867)
In the Linux kernel, the following vulnerability has been resolved:
drm/vmwgfx: Remove rcu locks from user resources
User resource lookups used rcu to avoid two extra atomics. Unfortunately the rcu paths were buggy and it was easy to make the driver crash by submitting command buffers from two different threads. Because the lookups never show up in performance profiles replace them with a regular spin lock which fixes the races in accesses to those shared resources.
Fixes kernel oops'es in IGT's vmwgfx execution_buffer stress test and seen crashes with apps using shared resources.(CVE-2022-48887)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: do not start relocation until in progress drops are done
We hit a bug with a recovering relocation on mount for one of our file systems in production. I reproduced this locally by injecting errors into snapshot delete with balance running at the same time. This presented as an error while looking up an extent item
WARNING: CPU: 5 PID: 1501 at fs/btrfs/extent-tree.c:866 lookup_inline_extent_backref+0x647/0x680 CPU: 5 PID: 1501 Comm: btrfs-balance Not tainted 5.16.0-rc8+ #8 RIP: 0010:lookup_inline_extent_backref+0x647/0x680 RSP: 0018:ffffae0a023ab960 EFLAGS: 00010202 RAX: 0000000000000001 RBX: 0000000000000000 RCX: 0000000000000000 RDX: 0000000000000000 RSI: 000000000000000c RDI: 0000000000000000 RBP: ffff943fd2a39b60 R08: 0000000000000000 R09: 0000000000000001 R10: 0001434088152de0 R11: 0000000000000000 R12: 0000000001d05000 R13: ffff943fd2a39b60 R14: ffff943fdb96f2a0 R15: ffff9442fc923000 FS: 0000000000000000(0000) GS:ffff944e9eb40000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007f1157b1fca8 CR3: 000000010f092000 CR4: 0000000000350ee0 Call Trace: <TASK> insert_inline_extent_backref+0x46/0xd0 __btrfs_inc_extent_ref.isra.0+0x5f/0x200 ? btrfs_merge_delayed_refs+0x164/0x190 __btrfs_run_delayed_refs+0x561/0xfa0 ? btrfs_search_slot+0x7b4/0xb30 ? btrfs_update_root+0x1a9/0x2c0 btrfs_run_delayed_refs+0x73/0x1f0 ? btrfs_update_root+0x1a9/0x2c0 btrfs_commit_transaction+0x50/0xa50 ? btrfs_update_reloc_root+0x122/0x220 prepare_to_merge+0x29f/0x320 relocate_block_group+0x2b8/0x550 btrfs_relocate_block_group+0x1a6/0x350 btrfs_relocate_chunk+0x27/0xe0 btrfs_balance+0x777/0xe60 balance_kthread+0x35/0x50 ? btrfs_balance+0xe60/0xe60 kthread+0x16b/0x190 ? set_kthread_struct+0x40/0x40 ret_from_fork+0x22/0x30 </TASK>
Normally snapshot deletion and relocation are excluded from running at the same time by the fs_info->cleaner_mutex. However if we had a pending balance waiting to get the ->cleaner_mutex, and a snapshot deletion was running, and then the box crashed, we would come up in a state where we have a half deleted snapshot.
Again, in the normal case the snapshot deletion needs to complete before relocation can start, but in this case relocation could very well start before the snapshot deletion completes, as we simply add the root to the dead roots list and wait for the next time the cleaner runs to clean up the snapshot.
Fix this by setting a bit on the fs_info if we have any DEAD_ROOT's that had a pending drop_progress key. If they do then we know we were in the middle of the drop operation and set a flag on the fs_info. Then balance can wait until this flag is cleared to start up again.
If there are DEAD_ROOT's that don't have a drop_progress set then we're safe to start balance right away as we'll be properly protected by the cleaner_mutex.(CVE-2022-48901)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: do not WARN_ON() if we have PageError set
Whenever we do any extent buffer operations we call assert_eb_page_uptodate() to complain loudly if we're operating on an non-uptodate page. Our overnight tests caught this warning earlier this week
WARNING: CPU: 1 PID: 553508 at fs/btrfs/extent_io.c:6849 assert_eb_page_uptodate+0x3f/0x50 CPU: 1 PID: 553508 Comm: kworker/u4:13 Tainted: G W 5.17.0-rc3+ #564 Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.13.0-2.fc32 04/01/2014 Workqueue: btrfs-cache btrfs_work_helper RIP: 0010:assert_eb_page_uptodate+0x3f/0x50 RSP: 0018:ffffa961440a7c68 EFLAGS: 00010246 RAX: 0017ffffc0002112 RBX: ffffe6e74453f9c0 RCX: 0000000000001000 RDX: ffffe6e74467c887 RSI: ffffe6e74453f9c0 RDI: ffff8d4c5efc2fc0 RBP: 0000000000000d56 R08: ffff8d4d4a224000 R09: 0000000000000000 R10: 00015817fa9d1ef0 R11: 000000000000000c R12: 00000000000007b1 R13: ffff8d4c5efc2fc0 R14: 0000000001500000 R15: 0000000001cb1000 FS: 0000000000000000(0000) GS:ffff8d4dbbd00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007ff31d3448d8 CR3: 0000000118be8004 CR4: 0000000000370ee0 Call Trace:
extent_buffer_test_bit+0x3f/0x70 free_space_test_bit+0xa6/0xc0 load_free_space_tree+0x1f6/0x470 caching_thread+0x454/0x630 ? rcu_read_lock_sched_held+0x12/0x60 ? rcu_read_lock_sched_held+0x12/0x60 ? rcu_read_lock_sched_held+0x12/0x60 ? lock_release+0x1f0/0x2d0 btrfs_work_helper+0xf2/0x3e0 ? lock_release+0x1f0/0x2d0 ? finish_task_switch.isra.0+0xf9/0x3a0 process_one_work+0x26d/0x580 ? process_one_work+0x580/0x580 worker_thread+0x55/0x3b0 ? process_one_work+0x580/0x580 kthread+0xf0/0x120 ? kthread_complete_and_exit+0x20/0x20 ret_from_fork+0x1f/0x30
This was partially fixed by c2e39305299f01 ("btrfs: clear extent buffer uptodate when we fail to write it"), however all that fix did was keep us from finding extent buffers after a failed writeout. It didn't keep us from continuing to use a buffer that we already had found.
In this case we're searching the commit root to cache the block group, so we can start committing the transaction and switch the commit root and then start writing. After the switch we can look up an extent buffer that hasn't been written yet and start processing that block group. Then we fail to write that block out and clear Uptodate on the page, and then we start spewing these errors.
Normally we're protected by the tree lock to a certain degree here. If we read a block we have that block read locked, and we block the writer from locking the block before we submit it for the write. However this isn't necessarily fool proof because the read could happen before we do the submit_bio and after we locked and unlocked the extent buffer.
Also in this particular case we have path->skip_locking set, so that won't save us here. We'll simply get a block that was valid when we read it, but became invalid while we were using it.
What we really want is to catch the case where we've "read" a block but it's not marked Uptodate. On read we ClearPageError(), so if we're !Uptodate and !Error we know we didn't do the right thing for reading the page.
Fix this by checking !Uptodate && !Error, this way we will not complain if our buffer gets invalidated while we're using it, and we'll maintain the spirit of the check which is to make sure we have a fully in-cache block while we're messing with it.(CVE-2022-48902)
ntfs3 in the Linux kernel through 6.8.0 allows a physically proximate attacker to read kernel memory by mounting a filesystem (e.g., if a Linux distribution is configured to allow unprivileged mounts of removable media) and then leveraging local access to trigger an out-of-bounds read. A length value can be larger than the amount of memory allocated. NOTE: the supplier's perspective is that there is no vulnerability when an attack requires an attacker-modified filesystem image.(CVE-2023-45896)
In the Linux kernel, the following vulnerability has been resolved:
powerpc/pseries/memhp: Fix access beyond end of drmem array
dlpar_memory_remove_by_index() may access beyond the bounds of the drmem lmb array when the LMB lookup fails to match an entry with the given DRC index. When the search fails, the cursor is left pointing to &drmem_info->lmbs[drmem_info->n_lmbs], which is one element past the last valid entry in the array. The debug message at the end of the function then dereferences this pointer:
pr_debug("Failed to hot-remove memory at %llx\n",
lmb->base_addr);
This was found by inspection and confirmed with KASAN:
pseries-hotplug-mem: Attempting to hot-remove LMB, drc index 1234 ================================================================== BUG: KASAN: slab-out-of-bounds in dlpar_memory+0x298/0x1658 Read of size 8 at addr c000000364e97fd0 by task bash/949
dump_stack_lvl+0xa4/0xfc (unreliable) print_report+0x214/0x63c kasan_report+0x140/0x2e0 __asan_load8+0xa8/0xe0 dlpar_memory+0x298/0x1658 handle_dlpar_errorlog+0x130/0x1d0 dlpar_store+0x18c/0x3e0 kobj_attr_store+0x68/0xa0 sysfs_kf_write+0xc4/0x110 kernfs_fop_write_iter+0x26c/0x390 vfs_write+0x2d4/0x4e0 ksys_write+0xac/0x1a0 system_call_exception+0x268/0x530 system_call_vectored_common+0x15c/0x2ec
Allocated by task 1: kasan_save_stack+0x48/0x80 kasan_set_track+0x34/0x50 kasan_save_alloc_info+0x34/0x50 __kasan_kmalloc+0xd0/0x120 __kmalloc+0x8c/0x320 kmalloc_array.constprop.0+0x48/0x5c drmem_init+0x2a0/0x41c do_one_initcall+0xe0/0x5c0 kernel_init_freeable+0x4ec/0x5a0 kernel_init+0x30/0x1e0 ret_from_kernel_user_thread+0x14/0x1c
The buggy address belongs to the object at c000000364e80000 which belongs to the cache kmalloc-128k of size 131072 The buggy address is located 0 bytes to the right of allocated 98256-byte region [c000000364e80000, c000000364e97fd0)
================================================================== pseries-hotplug-mem: Failed to hot-remove memory at 0
Log failed lookups with a separate message and dereference the cursor only when it points to a valid entry.(CVE-2023-52451)
In the Linux kernel, the following vulnerability has been resolved:
serial: sc16is7xx: convert from raw to noinc regmap functions for FIFO
The SC16IS7XX IC supports a burst mode to access the FIFOs where the initial register address is sent ($00), followed by all the FIFO data without having to resend the register address each time. In this mode, the IC doesn't increment the register address for each R/W byte.
The regmap_raw_read() and regmap_raw_write() are functions which can perform IO over multiple registers. They are currently used to read/write from/to the FIFO, and although they operate correctly in this burst mode on the SPI bus, they would corrupt the regmap cache if it was not disabled manually. The reason is that when the R/W size is more than 1 byte, these functions assume that the register address is incremented and handle the cache accordingly.
Convert FIFO R/W functions to use the regmap noinc versions in order to remove the manual cache control which was a workaround when using the raw versions. FIFO registers are properly declared as volatile so cache will not be used/updated for FIFO accesses.(CVE-2023-52488)
In the Linux kernel, the following vulnerability has been resolved:
media: imon: fix access to invalid resource for the second interface
imon driver probes two USB interfaces, and at the probe of the second interface, the driver assumes blindly that the first interface got bound with the same imon driver. It's usually true, but it's still possible that the first interface is bound with another driver via a malformed descriptor. Then it may lead to a memory corruption, as spotted by syzkaller; imon driver accesses the data from drvdata as struct imon_context object although it's a completely different one that was assigned by another driver.
This patch adds a sanity check -- whether the first interface is really bound with the imon driver or not -- for avoiding the problem above at the probe time.(CVE-2023-52754)
In the Linux kernel, the following vulnerability has been resolved:
usb: dwc2: fix possible NULL pointer dereference caused by driver concurrency
In _dwc2_hcd_urb_enqueue(), "urb->hcpriv = NULL" is executed without holding the lock "hsotg->lock". In _dwc2_hcd_urb_dequeue():
spin_lock_irqsave(&hsotg->lock, flags);
...
if (!urb->hcpriv) {
dev_dbg(hsotg->dev, "## urb->hcpriv is NULL ##\n");
goto out;
}
rc = dwc2_hcd_urb_dequeue(hsotg, urb->hcpriv); // Use urb->hcpriv
...
out: spin_unlock_irqrestore(&hsotg->lock, flags);
When _dwc2_hcd_urb_enqueue() and _dwc2_hcd_urb_dequeue() are concurrently executed, the NULL check of "urb->hcpriv" can be executed before "urb->hcpriv = NULL". After urb->hcpriv is NULL, it can be used in the function call to dwc2_hcd_urb_dequeue(), which can cause a NULL pointer dereference.
This possible bug is found by an experimental static analysis tool developed by myself. This tool analyzes the locking APIs to extract function pairs that can be concurrently executed, and then analyzes the instructions in the paired functions to identify possible concurrency bugs including data races and atomicity violations. The above possible bug is reported, when my tool analyzes the source code of Linux 6.5.
To fix this possible bug, "urb->hcpriv = NULL" should be executed with holding the lock "hsotg->lock". After using this patch, my tool never reports the possible bug, with the kernelconfiguration allyesconfig for x86_64. Because I have no associated hardware, I cannot test the patch in runtime testing, and just verify it according to the code logic.(CVE-2023-52855)
In the Linux kernel, the following vulnerability has been resolved:
bna: ensure the copied buf is NUL terminated
Currently, we allocate a nbytes-sized kernel buffer and copy nbytes from userspace to that buffer. Later, we use sscanf on this buffer but we don't ensure that the string is terminated inside the buffer, this can lead to OOB read when using sscanf. Fix this issue by using memdup_user_nul instead of memdup_user.(CVE-2024-36934)
In the Linux kernel, the following vulnerability has been resolved:
nvme-pci: add missing condition check for existence of mapped data
nvme_map_data() is called when request has physical segments, hence the nvme_unmap_data() should have same condition to avoid dereference.(CVE-2024-42276)
In the Linux kernel, the following vulnerability has been resolved:
hfs: fix to initialize fields of hfs_inode_info after hfs_alloc_inode()
Syzbot reports uninitialized value access issue as below:
loop0: detected capacity change from 0 to 64
BUG: KMSAN: uninit-value in hfs_revalidate_dentry+0x307/0x3f0 fs/hfs/sysdep.c:30 hfs_revalidate_dentry+0x307/0x3f0 fs/hfs/sysdep.c:30 d_revalidate fs/namei.c:862 [inline] lookup_fast+0x89e/0x8e0 fs/namei.c:1649 walk_component fs/namei.c:2001 [inline] link_path_walk+0x817/0x1480 fs/namei.c:2332 path_lookupat+0xd9/0x6f0 fs/namei.c:2485 filename_lookup+0x22e/0x740 fs/namei.c:2515 user_path_at_empty+0x8b/0x390 fs/namei.c:2924 user_path_at include/linux/namei.h:57 [inline] do_mount fs/namespace.c:3689 [inline] __do_sys_mount fs/namespace.c:3898 [inline] __se_sys_mount+0x66b/0x810 fs/namespace.c:3875 __x64_sys_mount+0xe4/0x140 fs/namespace.c:3875 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x63/0x6b
BUG: KMSAN: uninit-value in hfs_ext_read_extent fs/hfs/extent.c:196 [inline] BUG: KMSAN: uninit-value in hfs_get_block+0x92d/0x1620 fs/hfs/extent.c:366 hfs_ext_read_extent fs/hfs/extent.c:196 [inline] hfs_get_block+0x92d/0x1620 fs/hfs/extent.c:366 block_read_full_folio+0x4ff/0x11b0 fs/buffer.c:2271 hfs_read_folio+0x55/0x60 fs/hfs/inode.c:39 filemap_read_folio+0x148/0x4f0 mm/filemap.c:2426 do_read_cache_folio+0x7c8/0xd90 mm/filemap.c:3553 do_read_cache_page mm/filemap.c:3595 [inline] read_cache_page+0xfb/0x2f0 mm/filemap.c:3604 read_mapping_page include/linux/pagemap.h:755 [inline] hfs_btree_open+0x928/0x1ae0 fs/hfs/btree.c:78 hfs_mdb_get+0x260c/0x3000 fs/hfs/mdb.c:204 hfs_fill_super+0x1fb1/0x2790 fs/hfs/super.c:406 mount_bdev+0x628/0x920 fs/super.c:1359 hfs_mount+0xcd/0xe0 fs/hfs/super.c:456 legacy_get_tree+0x167/0x2e0 fs/fs_context.c:610 vfs_get_tree+0xdc/0x5d0 fs/super.c:1489 do_new_mount+0x7a9/0x16f0 fs/namespace.c:3145 path_mount+0xf98/0x26a0 fs/namespace.c:3475 do_mount fs/namespace.c:3488 [inline] __do_sys_mount fs/namespace.c:3697 [inline] __se_sys_mount+0x919/0x9e0 fs/namespace.c:3674 __ia32_sys_mount+0x15b/0x1b0 fs/namespace.c:3674 do_syscall_32_irqs_on arch/x86/entry/common.c:112 [inline] __do_fast_syscall_32+0xa2/0x100 arch/x86/entry/common.c:178 do_fast_syscall_32+0x37/0x80 arch/x86/entry/common.c:203 do_SYSENTER_32+0x1f/0x30 arch/x86/entry/common.c:246 entry_SYSENTER_compat_after_hwframe+0x70/0x82
Uninit was created at: __alloc_pages+0x9a6/0xe00 mm/page_alloc.c:4590 __alloc_pages_node include/linux/gfp.h:238 [inline] alloc_pages_node include/linux/gfp.h:261 [inline] alloc_slab_page mm/slub.c:2190 [inline] allocate_slab mm/slub.c:2354 [inline] new_slab+0x2d7/0x1400 mm/slub.c:2407 slaballoc+0x16b5/0x3970 mm/slub.c:3540 slab_alloc mm/slub.c:3625 [inline] __slab_alloc_node mm/slub.c:3678 [inline] slab_alloc_node mm/slub.c:3850 [inline] kmem_cache_alloc_lru+0x64d/0xb30 mm/slub.c:3879 alloc_inode_sb include/linux/fs.h:3018 [inline] hfs_alloc_inode+0x5a/0xc0 fs/hfs/super.c:165 alloc_inode+0x83/0x440 fs/inode.c:260 new_inode_pseudo fs/inode.c:1005 [inline] new_inode+0x38/0x4f0 fs/inode.c:1031 hfs_new_inode+0x61/0x1010 fs/hfs/inode.c:186 hfs_mkdir+0x54/0x250 fs/hfs/dir.c:228 vfs_mkdir+0x49a/0x700 fs/namei.c:4126 do_mkdirat+0x529/0x810 fs/namei.c:4149 __do_sys_mkdirat fs/namei.c:4164 [inline] __se_sys_mkdirat fs/namei.c:4162 [inline] __x64_sys_mkdirat+0xc8/0x120 fs/namei.c:4162 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x63/0x6b
It missed to initialize .tz_secondswest, .cached_start and .cached_blocks fields in struct hfs_inode_info after hfs_alloc_inode(), fix it.(CVE-2024-42311)
In the Linux kernel, the following vulnerability has been resolved:
soc: qcom: pdr: protect locator_addr with the main mutex
If the service locator server is restarted fast enough, the PDR can rewrite locator_addr fields concurrently. Protect them by placing modification of those fields under the main pdr->lock.(CVE-2024-43849)
In the Linux kernel, the following vulnerability has been resolved:
dma: fix call order in dmam_free_coherent
dmam_free_coherent() frees a DMA allocation, which makes the freed vaddr available for reuse, then calls devres_destroy() to remove and free the data structure used to track the DMA allocation. Between the two calls, it is possible for a concurrent task to make an allocation with the same vaddr and add it to the devres list.
If this happens, there will be two entries in the devres list with the same vaddr and devres_destroy() can free the wrong entry, triggering the WARN_ON() in dmam_match.
Fix by destroying the devres entry before freeing the DMA allocation.
kokonut //net/encryption http://sponge2/b9145fe6-0f72-4325-ac2f-a84d81075b03(CVE-2024-43856)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix null pointer deref in dcn20_resource.c
Fixes a hang thats triggered when MPV is run on a DCN401 dGPU:
mpv --hwdec=vaapi --vo=gpu --hwdec-codecs=all
and then enabling fullscreen playback (double click on the video)
The following calltrace will be seen:
[ 181.843989] BUG: kernel NULL pointer dereference, address: 0000000000000000 [ 181.843997] #PF: supervisor instruction fetch in kernel mode [ 181.844003] #PF: error_code(0x0010) - not-present page [ 181.844009] PGD 0 P4D 0 [ 181.844020] Oops: 0010 [#1] PREEMPT SMP NOPTI [ 181.844028] CPU: 6 PID: 1892 Comm: gnome-shell Tainted: G W OE 6.5.0-41-generic #41~22.04.2-Ubuntu [ 181.844038] Hardware name: System manufacturer System Product Name/CROSSHAIR VI HERO, BIOS 6302 10/23/2018 [ 181.844044] RIP: 0010:0x0 [ 181.844079] Code: Unable to access opcode bytes at 0xffffffffffffffd6. [ 181.844084] RSP: 0018:ffffb593c2b8f7b0 EFLAGS: 00010246 [ 181.844093] RAX: 0000000000000000 RBX: 0000000000000000 RCX: 0000000000000004 [ 181.844099] RDX: ffffb593c2b8f804 RSI: ffffb593c2b8f7e0 RDI: ffff9e3c8e758400 [ 181.844105] RBP: ffffb593c2b8f7b8 R08: ffffb593c2b8f9c8 R09: ffffb593c2b8f96c [ 181.844110] R10: 0000000000000000 R11: 0000000000000000 R12: ffffb593c2b8f9c8 [ 181.844115] R13: 0000000000000001 R14: ffff9e3c88000000 R15: 0000000000000005 [ 181.844121] FS: 00007c6e323bb5c0(0000) GS:ffff9e3f85f80000(0000) knlGS:0000000000000000 [ 181.844128] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 181.844134] CR2: ffffffffffffffd6 CR3: 0000000140fbe000 CR4: 00000000003506e0 [ 181.844141] Call Trace: [ 181.844146] <TASK> [ 181.844153] ? show_regs+0x6d/0x80 [ 181.844167] ? __die+0x24/0x80 [ 181.844179] ? page_fault_oops+0x99/0x1b0 [ 181.844192] ? do_user_addr_fault+0x31d/0x6b0 [ 181.844204] ? exc_page_fault+0x83/0x1b0 [ 181.844216] ? asm_exc_page_fault+0x27/0x30 [ 181.844237] dcn20_get_dcc_compression_cap+0x23/0x30 [amdgpu] [ 181.845115] amdgpu_dm_plane_validate_dcc.constprop.0+0xe5/0x180 [amdgpu] [ 181.845985] amdgpu_dm_plane_fill_plane_buffer_attributes+0x300/0x580 [amdgpu] [ 181.846848] fill_dc_plane_info_and_addr+0x258/0x350 [amdgpu] [ 181.847734] fill_dc_plane_attributes+0x162/0x350 [amdgpu] [ 181.848748] dm_update_plane_state.constprop.0+0x4e3/0x6b0 [amdgpu] [ 181.849791] ? dm_update_plane_state.constprop.0+0x4e3/0x6b0 [amdgpu] [ 181.850840] amdgpu_dm_atomic_check+0xdfe/0x1760 amdgpu
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu/pm: Fix the null pointer dereference in apply_state_adjust_rules
Check the pointer value to fix potential null pointer dereference(CVE-2024-43907)
In the Linux kernel, the following vulnerability has been resolved:
md/raid5: avoid BUG_ON() while continue reshape after reassembling
Currently, mdadm support --revert-reshape to abort the reshape while reassembling, as the test 07revert-grow. However, following BUG_ON() can be triggerred by the test:
kernel BUG at drivers/md/raid5.c:6278! invalid opcode: 0000 [#1] PREEMPT SMP PTI irq event stamp: 158985 CPU: 6 PID: 891 Comm: md0_reshape Not tainted 6.9.0-03335-g7592a0b0049a #94 RIP: 0010:reshape_request+0x3f1/0xe60 Call Trace: <TASK> raid5_sync_request+0x43d/0x550 md_do_sync+0xb7a/0x2110 md_thread+0x294/0x2b0 kthread+0x147/0x1c0 ret_from_fork+0x59/0x70 ret_from_fork_asm+0x1a/0x30 </TASK>
Root cause is that --revert-reshape update the raid_disks from 5 to 4, while reshape position is still set, and after reassembling the array, reshape position will be read from super block, then during reshape the checking of 'writepos' that is caculated by old reshape position will fail.
Fix this panic the easy way first, by converting the BUG_ON() to WARN_ON(), and stop the reshape if checkings fail.
Noted that mdadm must fix --revert-shape as well, and probably md/raid should enhance metadata validation as well, however this means reassemble will fail and there must be user tools to fix the wrong metadata.(CVE-2024-43914)
In the Linux kernel, the following vulnerability has been resolved:
sctp: Fix null-ptr-deref in reuseport_add_sock().
syzbot reported a null-ptr-deref while accessing sk2->sk_reuseport_cb in reuseport_add_sock(). [0]
The repro first creates a listener with SO_REUSEPORT. Then, it creates another listener on the same port and concurrently closes the first listener.
The second listen() calls reuseport_add_sock() with the first listener as sk2, where sk2->sk_reuseport_cb is not expected to be cleared concurrently, but the close() does clear it by reuseport_detach_sock().
The problem is SCTP does not properly synchronise reuseport_alloc(), reuseport_add_sock(), and reuseport_detach_sock().
The caller of reuseport_alloc() and reuseport_{add,detach}_sock() must provide synchronisation for sockets that are classified into the same reuseport group.
Otherwise, such sockets form multiple identical reuseport groups, and all groups except one would be silently dead.
- Two sockets call listen() concurrently
- No socket in the same group found in sctp_ep_hashtable[]
- Two sockets call reuseport_alloc() and form two reuseport groups
- Only one group hit first in __sctp_rcv_lookup_endpoint() receives incoming packets
Also, the reported null-ptr-deref could occur.
TCP/UDP guarantees that would not happen by holding the hash bucket lock.
Let's apply the locking strategy to __sctp_hash_endpoint() and __sctp_unhash_endpoint().
[0]: Oops: general protection fault, probably for non-canonical address 0xdffffc0000000002: 0000 [#1] PREEMPT SMP KASAN PTI KASAN: null-ptr-deref in range [0x0000000000000010-0x0000000000000017] CPU: 1 UID: 0 PID: 10230 Comm: syz-executor119 Not tainted 6.10.0-syzkaller-12585-g301927d2d2eb #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 06/27/2024 RIP: 0010:reuseport_add_sock+0x27e/0x5e0 net/core/sock_reuseport.c:350 Code: 00 0f b7 5d 00 bf 01 00 00 00 89 de e8 1b a4 ff f7 83 fb 01 0f 85 a3 01 00 00 e8 6d a0 ff f7 49 8d 7e 12 48 89 f8 48 c1 e8 03 <42> 0f b6 04 28 84 c0 0f 85 4b 02 00 00 41 0f b7 5e 12 49 8d 7e 14 RSP: 0018:ffffc9000b947c98 EFLAGS: 00010202 RAX: 0000000000000002 RBX: ffff8880252ddf98 RCX: ffff888079478000 RDX: 0000000000000000 RSI: 0000000000000001 RDI: 0000000000000012 RBP: 0000000000000001 R08: ffffffff8993e18d R09: 1ffffffff1fef385 R10: dffffc0000000000 R11: fffffbfff1fef386 R12: ffff8880252ddac0 R13: dffffc0000000000 R14: 0000000000000000 R15: 0000000000000000 FS: 00007f24e45b96c0(0000) GS:ffff8880b9300000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007ffcced5f7b8 CR3: 00000000241be000 CR4: 00000000003506f0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> __sctp_hash_endpoint net/sctp/input.c:762 [inline] sctp_hash_endpoint+0x52a/0x600 net/sctp/input.c:790 sctp_listen_start net/sctp/socket.c:8570 [inline] sctp_inet_listen+0x767/0xa20 net/sctp/socket.c:8625 __sys_listen_socket net/socket.c:1883 [inline] __sys_listen+0x1b7/0x230 net/socket.c:1894 __do_sys_listen net/socket.c:1902 [inline] __se_sys_listen net/socket.c:1900 [inline] __x64_sys_listen+0x5a/0x70 net/socket.c:1900 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xf3/0x230 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f RIP: 0033:0x7f24e46039b9 Code: 28 00 00 00 75 05 48 83 c4 28 c3 e8 91 1a 00 00 90 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48 RSP: 002b:00007f24e45b9228 EFLAGS: 00000246 ORIG_RAX: 0000000000000032 RAX: ffffffffffffffda RBX: 00007f24e468e428 RCX: 00007f24e46039b9 RDX: 00007f24e46039b9 RSI: 0000000000000003 RDI: 0000000000000004 RBP: 00007f24e468e420 R08: 00007f24e45b96c0 R09: 00007f24e45b96c0 R10: 00007f24e45b96c0 R11: 0000000000000246 R12: 00007f24e468e42c R13: ---truncated---(CVE-2024-44935)
In the Linux kernel, the following vulnerability has been resolved:
fuse: Initialize beyond-EOF page contents before setting uptodate
fuse_notify_store(), unlike fuse_do_readpage(), does not enable page zeroing (because it can be used to change partial page contents).
So fuse_notify_store() must be more careful to fully initialize page contents (including parts of the page that are beyond end-of-file) before marking the page uptodate.
The current code can leave beyond-EOF page contents uninitialized, which makes these uninitialized page contents visible to userspace via mmap().
This is an information leak, but only affects systems which do not enable init-on-alloc (via CONFIG_INIT_ON_ALLOC_DEFAULT_ON=y or the corresponding kernel command line parameter).(CVE-2024-44947)
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: bcm_sf2: Fix a possible memory leak in bcm_sf2_mdio_register()
bcm_sf2_mdio_register() calls of_phy_find_device() and then phy_device_remove() in a loop to remove existing PHY devices. of_phy_find_device() eventually calls bus_find_device(), which calls get_device() on the returned struct device * to increment the refcount. The current implementation does not decrement the refcount, which causes memory leak.
This commit adds the missing phy_device_free() call to decrement the refcount via put_device() to balance the refcount.(CVE-2024-44971)
In the Linux kernel, the following vulnerability has been resolved:
mptcp: pm: avoid possible UaF when selecting endp
select_local_address() and select_signal_address() both select an endpoint entry from the list inside an RCU protected section, but return a reference to it, to be read later on. If the entry is dereferenced after the RCU unlock, reading info could cause a Use-after-Free.
A simple solution is to copy the required info while inside the RCU protected section to avoid any risk of UaF later. The address ID might need to be modified later to handle the ID0 case later, so a copy seems OK to deal with.(CVE-2024-44974)
| URL | Type | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm",
"kernel-debuginfo-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm",
"kernel-debugsource-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm",
"kernel-devel-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm",
"kernel-headers-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm",
"kernel-source-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm",
"kernel-tools-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm",
"kernel-tools-devel-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm",
"perf-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm",
"perf-debuginfo-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm",
"python3-perf-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-228.0.0.130.oe2203sp3.aarch64.rpm"
],
"src": [
"kernel-5.10.0-228.0.0.130.oe2203sp3.src.rpm"
],
"x86_64": [
"kernel-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm",
"kernel-debuginfo-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm",
"kernel-debugsource-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm",
"kernel-devel-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm",
"kernel-headers-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm",
"kernel-source-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm",
"kernel-tools-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm",
"kernel-tools-devel-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm",
"perf-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm",
"perf-debuginfo-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm",
"python3-perf-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-228.0.0.130.oe2203sp3.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP3",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP3"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-228.0.0.130.oe2203sp3"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndmaengine: idxd: Prevent use after free on completion memory\r\n\r\nOn driver unload any pending descriptors are flushed at the\ntime the interrupt is freed:\nidxd_dmaengine_drv_remove() -\u0026gt;\n\tdrv_disable_wq() -\u0026gt;\n\t\tidxd_wq_free_irq() -\u0026gt;\n\t\t\tidxd_flush_pending_descs().\r\n\r\nIf there are any descriptors present that need to be flushed this\nflow triggers a \u0026quot;not present\u0026quot; page fault as below:\r\n\r\n BUG: unable to handle page fault for address: ff391c97c70c9040\n #PF: supervisor read access in kernel mode\n #PF: error_code(0x0000) - not-present page\r\n\r\nThe address that triggers the fault is the address of the\ndescriptor that was freed moments earlier via:\ndrv_disable_wq()-\u0026gt;idxd_wq_free_resources()\r\n\r\nFix the use after free by freeing the descriptors after any possible\nusage. This is done after idxd_wq_reset() to ensure that the memory\nremains accessible during possible completion writes by the device.(CVE-2022-48867)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/vmwgfx: Remove rcu locks from user resources\r\n\r\nUser resource lookups used rcu to avoid two extra atomics. Unfortunately\nthe rcu paths were buggy and it was easy to make the driver crash by\nsubmitting command buffers from two different threads. Because the\nlookups never show up in performance profiles replace them with a\nregular spin lock which fixes the races in accesses to those shared\nresources.\r\n\r\nFixes kernel oops\u0026apos;es in IGT\u0026apos;s vmwgfx execution_buffer stress test and\nseen crashes with apps using shared resources.(CVE-2022-48887)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: do not start relocation until in progress drops are done\r\n\r\nWe hit a bug with a recovering relocation on mount for one of our file\nsystems in production. I reproduced this locally by injecting errors\ninto snapshot delete with balance running at the same time. This\npresented as an error while looking up an extent item\r\n\r\n WARNING: CPU: 5 PID: 1501 at fs/btrfs/extent-tree.c:866 lookup_inline_extent_backref+0x647/0x680\n CPU: 5 PID: 1501 Comm: btrfs-balance Not tainted 5.16.0-rc8+ #8\n RIP: 0010:lookup_inline_extent_backref+0x647/0x680\n RSP: 0018:ffffae0a023ab960 EFLAGS: 00010202\n RAX: 0000000000000001 RBX: 0000000000000000 RCX: 0000000000000000\n RDX: 0000000000000000 RSI: 000000000000000c RDI: 0000000000000000\n RBP: ffff943fd2a39b60 R08: 0000000000000000 R09: 0000000000000001\n R10: 0001434088152de0 R11: 0000000000000000 R12: 0000000001d05000\n R13: ffff943fd2a39b60 R14: ffff943fdb96f2a0 R15: ffff9442fc923000\n FS: 0000000000000000(0000) GS:ffff944e9eb40000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 00007f1157b1fca8 CR3: 000000010f092000 CR4: 0000000000350ee0\n Call Trace:\n \u0026lt;TASK\u0026gt;\n insert_inline_extent_backref+0x46/0xd0\n __btrfs_inc_extent_ref.isra.0+0x5f/0x200\n ? btrfs_merge_delayed_refs+0x164/0x190\n __btrfs_run_delayed_refs+0x561/0xfa0\n ? btrfs_search_slot+0x7b4/0xb30\n ? btrfs_update_root+0x1a9/0x2c0\n btrfs_run_delayed_refs+0x73/0x1f0\n ? btrfs_update_root+0x1a9/0x2c0\n btrfs_commit_transaction+0x50/0xa50\n ? btrfs_update_reloc_root+0x122/0x220\n prepare_to_merge+0x29f/0x320\n relocate_block_group+0x2b8/0x550\n btrfs_relocate_block_group+0x1a6/0x350\n btrfs_relocate_chunk+0x27/0xe0\n btrfs_balance+0x777/0xe60\n balance_kthread+0x35/0x50\n ? btrfs_balance+0xe60/0xe60\n kthread+0x16b/0x190\n ? set_kthread_struct+0x40/0x40\n ret_from_fork+0x22/0x30\n \u0026lt;/TASK\u0026gt;\r\n\r\nNormally snapshot deletion and relocation are excluded from running at\nthe same time by the fs_info-\u0026gt;cleaner_mutex. However if we had a\npending balance waiting to get the -\u0026gt;cleaner_mutex, and a snapshot\ndeletion was running, and then the box crashed, we would come up in a\nstate where we have a half deleted snapshot.\r\n\r\nAgain, in the normal case the snapshot deletion needs to complete before\nrelocation can start, but in this case relocation could very well start\nbefore the snapshot deletion completes, as we simply add the root to the\ndead roots list and wait for the next time the cleaner runs to clean up\nthe snapshot.\r\n\r\nFix this by setting a bit on the fs_info if we have any DEAD_ROOT\u0026apos;s that\nhad a pending drop_progress key. If they do then we know we were in the\nmiddle of the drop operation and set a flag on the fs_info. Then\nbalance can wait until this flag is cleared to start up again.\r\n\r\nIf there are DEAD_ROOT\u0026apos;s that don\u0026apos;t have a drop_progress set then we\u0026apos;re\nsafe to start balance right away as we\u0026apos;ll be properly protected by the\ncleaner_mutex.(CVE-2022-48901)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: do not WARN_ON() if we have PageError set\r\n\r\nWhenever we do any extent buffer operations we call\nassert_eb_page_uptodate() to complain loudly if we\u0026apos;re operating on an\nnon-uptodate page. Our overnight tests caught this warning earlier this\nweek\r\n\r\n WARNING: CPU: 1 PID: 553508 at fs/btrfs/extent_io.c:6849 assert_eb_page_uptodate+0x3f/0x50\n CPU: 1 PID: 553508 Comm: kworker/u4:13 Tainted: G W 5.17.0-rc3+ #564\n Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.13.0-2.fc32 04/01/2014\n Workqueue: btrfs-cache btrfs_work_helper\n RIP: 0010:assert_eb_page_uptodate+0x3f/0x50\n RSP: 0018:ffffa961440a7c68 EFLAGS: 00010246\n RAX: 0017ffffc0002112 RBX: ffffe6e74453f9c0 RCX: 0000000000001000\n RDX: ffffe6e74467c887 RSI: ffffe6e74453f9c0 RDI: ffff8d4c5efc2fc0\n RBP: 0000000000000d56 R08: ffff8d4d4a224000 R09: 0000000000000000\n R10: 00015817fa9d1ef0 R11: 000000000000000c R12: 00000000000007b1\n R13: ffff8d4c5efc2fc0 R14: 0000000001500000 R15: 0000000001cb1000\n FS: 0000000000000000(0000) GS:ffff8d4dbbd00000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 00007ff31d3448d8 CR3: 0000000118be8004 CR4: 0000000000370ee0\n Call Trace:\r\n\r\n extent_buffer_test_bit+0x3f/0x70\n free_space_test_bit+0xa6/0xc0\n load_free_space_tree+0x1f6/0x470\n caching_thread+0x454/0x630\n ? rcu_read_lock_sched_held+0x12/0x60\n ? rcu_read_lock_sched_held+0x12/0x60\n ? rcu_read_lock_sched_held+0x12/0x60\n ? lock_release+0x1f0/0x2d0\n btrfs_work_helper+0xf2/0x3e0\n ? lock_release+0x1f0/0x2d0\n ? finish_task_switch.isra.0+0xf9/0x3a0\n process_one_work+0x26d/0x580\n ? process_one_work+0x580/0x580\n worker_thread+0x55/0x3b0\n ? process_one_work+0x580/0x580\n kthread+0xf0/0x120\n ? kthread_complete_and_exit+0x20/0x20\n ret_from_fork+0x1f/0x30\r\n\r\nThis was partially fixed by c2e39305299f01 (\u0026quot;btrfs: clear extent buffer\nuptodate when we fail to write it\u0026quot;), however all that fix did was keep\nus from finding extent buffers after a failed writeout. It didn\u0026apos;t keep\nus from continuing to use a buffer that we already had found.\r\n\r\nIn this case we\u0026apos;re searching the commit root to cache the block group,\nso we can start committing the transaction and switch the commit root\nand then start writing. After the switch we can look up an extent\nbuffer that hasn\u0026apos;t been written yet and start processing that block\ngroup. Then we fail to write that block out and clear Uptodate on the\npage, and then we start spewing these errors.\r\n\r\nNormally we\u0026apos;re protected by the tree lock to a certain degree here. If\nwe read a block we have that block read locked, and we block the writer\nfrom locking the block before we submit it for the write. However this\nisn\u0026apos;t necessarily fool proof because the read could happen before we do\nthe submit_bio and after we locked and unlocked the extent buffer.\r\n\r\nAlso in this particular case we have path-\u0026gt;skip_locking set, so that\nwon\u0026apos;t save us here. We\u0026apos;ll simply get a block that was valid when we\nread it, but became invalid while we were using it.\r\n\r\nWhat we really want is to catch the case where we\u0026apos;ve \u0026quot;read\u0026quot; a block but\nit\u0026apos;s not marked Uptodate. On read we ClearPageError(), so if we\u0026apos;re\n!Uptodate and !Error we know we didn\u0026apos;t do the right thing for reading\nthe page.\r\n\r\nFix this by checking !Uptodate \u0026amp;\u0026amp; !Error, this way we will not complain\nif our buffer gets invalidated while we\u0026apos;re using it, and we\u0026apos;ll maintain\nthe spirit of the check which is to make sure we have a fully in-cache\nblock while we\u0026apos;re messing with it.(CVE-2022-48902)\r\n\r\nntfs3 in the Linux kernel through 6.8.0 allows a physically proximate attacker to read kernel memory by mounting a filesystem (e.g., if a Linux distribution is configured to allow unprivileged mounts of removable media) and then leveraging local access to trigger an out-of-bounds read. A length value can be larger than the amount of memory allocated. NOTE: the supplier\u0026apos;s perspective is that there is no vulnerability when an attack requires an attacker-modified filesystem image.(CVE-2023-45896)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npowerpc/pseries/memhp: Fix access beyond end of drmem array\r\n\r\ndlpar_memory_remove_by_index() may access beyond the bounds of the\ndrmem lmb array when the LMB lookup fails to match an entry with the\ngiven DRC index. When the search fails, the cursor is left pointing to\n\u0026amp;drmem_info-\u0026gt;lmbs[drmem_info-\u0026gt;n_lmbs], which is one element past the\nlast valid entry in the array. The debug message at the end of the\nfunction then dereferences this pointer:\r\n\r\n pr_debug(\u0026quot;Failed to hot-remove memory at %llx\\n\u0026quot;,\n lmb-\u0026gt;base_addr);\r\n\r\nThis was found by inspection and confirmed with KASAN:\r\n\r\n pseries-hotplug-mem: Attempting to hot-remove LMB, drc index 1234\n ==================================================================\n BUG: KASAN: slab-out-of-bounds in dlpar_memory+0x298/0x1658\n Read of size 8 at addr c000000364e97fd0 by task bash/949\r\n\r\n dump_stack_lvl+0xa4/0xfc (unreliable)\n print_report+0x214/0x63c\n kasan_report+0x140/0x2e0\n __asan_load8+0xa8/0xe0\n dlpar_memory+0x298/0x1658\n handle_dlpar_errorlog+0x130/0x1d0\n dlpar_store+0x18c/0x3e0\n kobj_attr_store+0x68/0xa0\n sysfs_kf_write+0xc4/0x110\n kernfs_fop_write_iter+0x26c/0x390\n vfs_write+0x2d4/0x4e0\n ksys_write+0xac/0x1a0\n system_call_exception+0x268/0x530\n system_call_vectored_common+0x15c/0x2ec\r\n\r\n Allocated by task 1:\n kasan_save_stack+0x48/0x80\n kasan_set_track+0x34/0x50\n kasan_save_alloc_info+0x34/0x50\n __kasan_kmalloc+0xd0/0x120\n __kmalloc+0x8c/0x320\n kmalloc_array.constprop.0+0x48/0x5c\n drmem_init+0x2a0/0x41c\n do_one_initcall+0xe0/0x5c0\n kernel_init_freeable+0x4ec/0x5a0\n kernel_init+0x30/0x1e0\n ret_from_kernel_user_thread+0x14/0x1c\r\n\r\n The buggy address belongs to the object at c000000364e80000\n which belongs to the cache kmalloc-128k of size 131072\n The buggy address is located 0 bytes to the right of\n allocated 98256-byte region [c000000364e80000, c000000364e97fd0)\r\n\r\n ==================================================================\n pseries-hotplug-mem: Failed to hot-remove memory at 0\r\n\r\nLog failed lookups with a separate message and dereference the\ncursor only when it points to a valid entry.(CVE-2023-52451)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nserial: sc16is7xx: convert from _raw_ to _noinc_ regmap functions for FIFO\r\n\r\nThe SC16IS7XX IC supports a burst mode to access the FIFOs where the\ninitial register address is sent ($00), followed by all the FIFO data\nwithout having to resend the register address each time. In this mode, the\nIC doesn\u0026apos;t increment the register address for each R/W byte.\r\n\r\nThe regmap_raw_read() and regmap_raw_write() are functions which can\nperform IO over multiple registers. They are currently used to read/write\nfrom/to the FIFO, and although they operate correctly in this burst mode on\nthe SPI bus, they would corrupt the regmap cache if it was not disabled\nmanually. The reason is that when the R/W size is more than 1 byte, these\nfunctions assume that the register address is incremented and handle the\ncache accordingly.\r\n\r\nConvert FIFO R/W functions to use the regmap _noinc_ versions in order to\nremove the manual cache control which was a workaround when using the\n_raw_ versions. FIFO registers are properly declared as volatile so\ncache will not be used/updated for FIFO accesses.(CVE-2023-52488)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: imon: fix access to invalid resource for the second interface\r\n\r\nimon driver probes two USB interfaces, and at the probe of the second\ninterface, the driver assumes blindly that the first interface got\nbound with the same imon driver. It\u0026apos;s usually true, but it\u0026apos;s still\npossible that the first interface is bound with another driver via a\nmalformed descriptor. Then it may lead to a memory corruption, as\nspotted by syzkaller; imon driver accesses the data from drvdata as\nstruct imon_context object although it\u0026apos;s a completely different one\nthat was assigned by another driver.\r\n\r\nThis patch adds a sanity check -- whether the first interface is\nreally bound with the imon driver or not -- for avoiding the problem\nabove at the probe time.(CVE-2023-52754)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nusb: dwc2: fix possible NULL pointer dereference caused by driver concurrency\r\n\r\nIn _dwc2_hcd_urb_enqueue(), \u0026quot;urb-\u0026gt;hcpriv = NULL\u0026quot; is executed without\nholding the lock \u0026quot;hsotg-\u0026gt;lock\u0026quot;. In _dwc2_hcd_urb_dequeue():\r\n\r\n spin_lock_irqsave(\u0026amp;hsotg-\u0026gt;lock, flags);\n ...\n\tif (!urb-\u0026gt;hcpriv) {\n\t\tdev_dbg(hsotg-\u0026gt;dev, \u0026quot;## urb-\u0026gt;hcpriv is NULL ##\\n\u0026quot;);\n\t\tgoto out;\n\t}\n rc = dwc2_hcd_urb_dequeue(hsotg, urb-\u0026gt;hcpriv); // Use urb-\u0026gt;hcpriv\n ...\nout:\n spin_unlock_irqrestore(\u0026amp;hsotg-\u0026gt;lock, flags);\r\n\r\nWhen _dwc2_hcd_urb_enqueue() and _dwc2_hcd_urb_dequeue() are\nconcurrently executed, the NULL check of \u0026quot;urb-\u0026gt;hcpriv\u0026quot; can be executed\nbefore \u0026quot;urb-\u0026gt;hcpriv = NULL\u0026quot;. After urb-\u0026gt;hcpriv is NULL, it can be used\nin the function call to dwc2_hcd_urb_dequeue(), which can cause a NULL\npointer dereference.\r\n\r\nThis possible bug is found by an experimental static analysis tool\ndeveloped by myself. This tool analyzes the locking APIs to extract\nfunction pairs that can be concurrently executed, and then analyzes the\ninstructions in the paired functions to identify possible concurrency\nbugs including data races and atomicity violations. The above possible\nbug is reported, when my tool analyzes the source code of Linux 6.5.\r\n\r\nTo fix this possible bug, \u0026quot;urb-\u0026gt;hcpriv = NULL\u0026quot; should be executed with\nholding the lock \u0026quot;hsotg-\u0026gt;lock\u0026quot;. After using this patch, my tool never\nreports the possible bug, with the kernelconfiguration allyesconfig for\nx86_64. Because I have no associated hardware, I cannot test the patch\nin runtime testing, and just verify it according to the code logic.(CVE-2023-52855)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbna: ensure the copied buf is NUL terminated\r\n\r\nCurrently, we allocate a nbytes-sized kernel buffer and copy nbytes from\nuserspace to that buffer. Later, we use sscanf on this buffer but we don\u0026apos;t\nensure that the string is terminated inside the buffer, this can lead to\nOOB read when using sscanf. Fix this issue by using memdup_user_nul\ninstead of memdup_user.(CVE-2024-36934)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnvme-pci: add missing condition check for existence of mapped data\r\n\r\nnvme_map_data() is called when request has physical segments, hence\nthe nvme_unmap_data() should have same condition to avoid dereference.(CVE-2024-42276)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhfs: fix to initialize fields of hfs_inode_info after hfs_alloc_inode()\r\n\r\nSyzbot reports uninitialized value access issue as below:\r\n\r\nloop0: detected capacity change from 0 to 64\n=====================================================\nBUG: KMSAN: uninit-value in hfs_revalidate_dentry+0x307/0x3f0 fs/hfs/sysdep.c:30\n hfs_revalidate_dentry+0x307/0x3f0 fs/hfs/sysdep.c:30\n d_revalidate fs/namei.c:862 [inline]\n lookup_fast+0x89e/0x8e0 fs/namei.c:1649\n walk_component fs/namei.c:2001 [inline]\n link_path_walk+0x817/0x1480 fs/namei.c:2332\n path_lookupat+0xd9/0x6f0 fs/namei.c:2485\n filename_lookup+0x22e/0x740 fs/namei.c:2515\n user_path_at_empty+0x8b/0x390 fs/namei.c:2924\n user_path_at include/linux/namei.h:57 [inline]\n do_mount fs/namespace.c:3689 [inline]\n __do_sys_mount fs/namespace.c:3898 [inline]\n __se_sys_mount+0x66b/0x810 fs/namespace.c:3875\n __x64_sys_mount+0xe4/0x140 fs/namespace.c:3875\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x63/0x6b\r\n\r\nBUG: KMSAN: uninit-value in hfs_ext_read_extent fs/hfs/extent.c:196 [inline]\nBUG: KMSAN: uninit-value in hfs_get_block+0x92d/0x1620 fs/hfs/extent.c:366\n hfs_ext_read_extent fs/hfs/extent.c:196 [inline]\n hfs_get_block+0x92d/0x1620 fs/hfs/extent.c:366\n block_read_full_folio+0x4ff/0x11b0 fs/buffer.c:2271\n hfs_read_folio+0x55/0x60 fs/hfs/inode.c:39\n filemap_read_folio+0x148/0x4f0 mm/filemap.c:2426\n do_read_cache_folio+0x7c8/0xd90 mm/filemap.c:3553\n do_read_cache_page mm/filemap.c:3595 [inline]\n read_cache_page+0xfb/0x2f0 mm/filemap.c:3604\n read_mapping_page include/linux/pagemap.h:755 [inline]\n hfs_btree_open+0x928/0x1ae0 fs/hfs/btree.c:78\n hfs_mdb_get+0x260c/0x3000 fs/hfs/mdb.c:204\n hfs_fill_super+0x1fb1/0x2790 fs/hfs/super.c:406\n mount_bdev+0x628/0x920 fs/super.c:1359\n hfs_mount+0xcd/0xe0 fs/hfs/super.c:456\n legacy_get_tree+0x167/0x2e0 fs/fs_context.c:610\n vfs_get_tree+0xdc/0x5d0 fs/super.c:1489\n do_new_mount+0x7a9/0x16f0 fs/namespace.c:3145\n path_mount+0xf98/0x26a0 fs/namespace.c:3475\n do_mount fs/namespace.c:3488 [inline]\n __do_sys_mount fs/namespace.c:3697 [inline]\n __se_sys_mount+0x919/0x9e0 fs/namespace.c:3674\n __ia32_sys_mount+0x15b/0x1b0 fs/namespace.c:3674\n do_syscall_32_irqs_on arch/x86/entry/common.c:112 [inline]\n __do_fast_syscall_32+0xa2/0x100 arch/x86/entry/common.c:178\n do_fast_syscall_32+0x37/0x80 arch/x86/entry/common.c:203\n do_SYSENTER_32+0x1f/0x30 arch/x86/entry/common.c:246\n entry_SYSENTER_compat_after_hwframe+0x70/0x82\r\n\r\nUninit was created at:\n __alloc_pages+0x9a6/0xe00 mm/page_alloc.c:4590\n __alloc_pages_node include/linux/gfp.h:238 [inline]\n alloc_pages_node include/linux/gfp.h:261 [inline]\n alloc_slab_page mm/slub.c:2190 [inline]\n allocate_slab mm/slub.c:2354 [inline]\n new_slab+0x2d7/0x1400 mm/slub.c:2407\n ___slab_alloc+0x16b5/0x3970 mm/slub.c:3540\n __slab_alloc mm/slub.c:3625 [inline]\n __slab_alloc_node mm/slub.c:3678 [inline]\n slab_alloc_node mm/slub.c:3850 [inline]\n kmem_cache_alloc_lru+0x64d/0xb30 mm/slub.c:3879\n alloc_inode_sb include/linux/fs.h:3018 [inline]\n hfs_alloc_inode+0x5a/0xc0 fs/hfs/super.c:165\n alloc_inode+0x83/0x440 fs/inode.c:260\n new_inode_pseudo fs/inode.c:1005 [inline]\n new_inode+0x38/0x4f0 fs/inode.c:1031\n hfs_new_inode+0x61/0x1010 fs/hfs/inode.c:186\n hfs_mkdir+0x54/0x250 fs/hfs/dir.c:228\n vfs_mkdir+0x49a/0x700 fs/namei.c:4126\n do_mkdirat+0x529/0x810 fs/namei.c:4149\n __do_sys_mkdirat fs/namei.c:4164 [inline]\n __se_sys_mkdirat fs/namei.c:4162 [inline]\n __x64_sys_mkdirat+0xc8/0x120 fs/namei.c:4162\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x63/0x6b\r\n\r\nIt missed to initialize .tz_secondswest, .cached_start and .cached_blocks\nfields in struct hfs_inode_info after hfs_alloc_inode(), fix it.(CVE-2024-42311)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nsoc: qcom: pdr: protect locator_addr with the main mutex\r\n\r\nIf the service locator server is restarted fast enough, the PDR can\nrewrite locator_addr fields concurrently. Protect them by placing\nmodification of those fields under the main pdr-\u0026gt;lock.(CVE-2024-43849)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndma: fix call order in dmam_free_coherent\r\n\r\ndmam_free_coherent() frees a DMA allocation, which makes the\nfreed vaddr available for reuse, then calls devres_destroy()\nto remove and free the data structure used to track the DMA\nallocation. Between the two calls, it is possible for a\nconcurrent task to make an allocation with the same vaddr\nand add it to the devres list.\r\n\r\nIf this happens, there will be two entries in the devres list\nwith the same vaddr and devres_destroy() can free the wrong\nentry, triggering the WARN_ON() in dmam_match.\r\n\r\nFix by destroying the devres entry before freeing the DMA\nallocation.\r\n\r\n kokonut //net/encryption\n http://sponge2/b9145fe6-0f72-4325-ac2f-a84d81075b03(CVE-2024-43856)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix null pointer deref in dcn20_resource.c\r\n\r\nFixes a hang thats triggered when MPV is run on a DCN401 dGPU:\r\n\r\nmpv --hwdec=vaapi --vo=gpu --hwdec-codecs=all\r\n\r\nand then enabling fullscreen playback (double click on the video)\r\n\r\nThe following calltrace will be seen:\r\n\r\n[ 181.843989] BUG: kernel NULL pointer dereference, address: 0000000000000000\n[ 181.843997] #PF: supervisor instruction fetch in kernel mode\n[ 181.844003] #PF: error_code(0x0010) - not-present page\n[ 181.844009] PGD 0 P4D 0\n[ 181.844020] Oops: 0010 [#1] PREEMPT SMP NOPTI\n[ 181.844028] CPU: 6 PID: 1892 Comm: gnome-shell Tainted: G W OE 6.5.0-41-generic #41~22.04.2-Ubuntu\n[ 181.844038] Hardware name: System manufacturer System Product Name/CROSSHAIR VI HERO, BIOS 6302 10/23/2018\n[ 181.844044] RIP: 0010:0x0\n[ 181.844079] Code: Unable to access opcode bytes at 0xffffffffffffffd6.\n[ 181.844084] RSP: 0018:ffffb593c2b8f7b0 EFLAGS: 00010246\n[ 181.844093] RAX: 0000000000000000 RBX: 0000000000000000 RCX: 0000000000000004\n[ 181.844099] RDX: ffffb593c2b8f804 RSI: ffffb593c2b8f7e0 RDI: ffff9e3c8e758400\n[ 181.844105] RBP: ffffb593c2b8f7b8 R08: ffffb593c2b8f9c8 R09: ffffb593c2b8f96c\n[ 181.844110] R10: 0000000000000000 R11: 0000000000000000 R12: ffffb593c2b8f9c8\n[ 181.844115] R13: 0000000000000001 R14: ffff9e3c88000000 R15: 0000000000000005\n[ 181.844121] FS: 00007c6e323bb5c0(0000) GS:ffff9e3f85f80000(0000) knlGS:0000000000000000\n[ 181.844128] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 181.844134] CR2: ffffffffffffffd6 CR3: 0000000140fbe000 CR4: 00000000003506e0\n[ 181.844141] Call Trace:\n[ 181.844146] \u0026lt;TASK\u0026gt;\n[ 181.844153] ? show_regs+0x6d/0x80\n[ 181.844167] ? __die+0x24/0x80\n[ 181.844179] ? page_fault_oops+0x99/0x1b0\n[ 181.844192] ? do_user_addr_fault+0x31d/0x6b0\n[ 181.844204] ? exc_page_fault+0x83/0x1b0\n[ 181.844216] ? asm_exc_page_fault+0x27/0x30\n[ 181.844237] dcn20_get_dcc_compression_cap+0x23/0x30 [amdgpu]\n[ 181.845115] amdgpu_dm_plane_validate_dcc.constprop.0+0xe5/0x180 [amdgpu]\n[ 181.845985] amdgpu_dm_plane_fill_plane_buffer_attributes+0x300/0x580 [amdgpu]\n[ 181.846848] fill_dc_plane_info_and_addr+0x258/0x350 [amdgpu]\n[ 181.847734] fill_dc_plane_attributes+0x162/0x350 [amdgpu]\n[ 181.848748] dm_update_plane_state.constprop.0+0x4e3/0x6b0 [amdgpu]\n[ 181.849791] ? dm_update_plane_state.constprop.0+0x4e3/0x6b0 [amdgpu]\n[ 181.850840] amdgpu_dm_atomic_check+0xdfe/0x1760 [amdgpu](CVE-2024-43899)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu/pm: Fix the null pointer dereference in apply_state_adjust_rules\r\n\r\nCheck the pointer value to fix potential null pointer\ndereference(CVE-2024-43907)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmd/raid5: avoid BUG_ON() while continue reshape after reassembling\r\n\r\nCurrently, mdadm support --revert-reshape to abort the reshape while\nreassembling, as the test 07revert-grow. However, following BUG_ON()\ncan be triggerred by the test:\r\n\r\nkernel BUG at drivers/md/raid5.c:6278!\ninvalid opcode: 0000 [#1] PREEMPT SMP PTI\nirq event stamp: 158985\nCPU: 6 PID: 891 Comm: md0_reshape Not tainted 6.9.0-03335-g7592a0b0049a #94\nRIP: 0010:reshape_request+0x3f1/0xe60\nCall Trace:\n \u0026lt;TASK\u0026gt;\n raid5_sync_request+0x43d/0x550\n md_do_sync+0xb7a/0x2110\n md_thread+0x294/0x2b0\n kthread+0x147/0x1c0\n ret_from_fork+0x59/0x70\n ret_from_fork_asm+0x1a/0x30\n \u0026lt;/TASK\u0026gt;\r\n\r\nRoot cause is that --revert-reshape update the raid_disks from 5 to 4,\nwhile reshape position is still set, and after reassembling the array,\nreshape position will be read from super block, then during reshape the\nchecking of \u0026apos;writepos\u0026apos; that is caculated by old reshape position will\nfail.\r\n\r\nFix this panic the easy way first, by converting the BUG_ON() to\nWARN_ON(), and stop the reshape if checkings fail.\r\n\r\nNoted that mdadm must fix --revert-shape as well, and probably md/raid\nshould enhance metadata validation as well, however this means\nreassemble will fail and there must be user tools to fix the wrong\nmetadata.(CVE-2024-43914)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nsctp: Fix null-ptr-deref in reuseport_add_sock().\r\n\r\nsyzbot reported a null-ptr-deref while accessing sk2-\u0026gt;sk_reuseport_cb in\nreuseport_add_sock(). [0]\r\n\r\nThe repro first creates a listener with SO_REUSEPORT. Then, it creates\nanother listener on the same port and concurrently closes the first\nlistener.\r\n\r\nThe second listen() calls reuseport_add_sock() with the first listener as\nsk2, where sk2-\u0026gt;sk_reuseport_cb is not expected to be cleared concurrently,\nbut the close() does clear it by reuseport_detach_sock().\r\n\r\nThe problem is SCTP does not properly synchronise reuseport_alloc(),\nreuseport_add_sock(), and reuseport_detach_sock().\r\n\r\nThe caller of reuseport_alloc() and reuseport_{add,detach}_sock() must\nprovide synchronisation for sockets that are classified into the same\nreuseport group.\r\n\r\nOtherwise, such sockets form multiple identical reuseport groups, and\nall groups except one would be silently dead.\r\n\r\n 1. Two sockets call listen() concurrently\n 2. No socket in the same group found in sctp_ep_hashtable[]\n 3. Two sockets call reuseport_alloc() and form two reuseport groups\n 4. Only one group hit first in __sctp_rcv_lookup_endpoint() receives\n incoming packets\r\n\r\nAlso, the reported null-ptr-deref could occur.\r\n\r\nTCP/UDP guarantees that would not happen by holding the hash bucket lock.\r\n\r\nLet\u0026apos;s apply the locking strategy to __sctp_hash_endpoint() and\n__sctp_unhash_endpoint().\r\n\r\n[0]:\nOops: general protection fault, probably for non-canonical address 0xdffffc0000000002: 0000 [#1] PREEMPT SMP KASAN PTI\nKASAN: null-ptr-deref in range [0x0000000000000010-0x0000000000000017]\nCPU: 1 UID: 0 PID: 10230 Comm: syz-executor119 Not tainted 6.10.0-syzkaller-12585-g301927d2d2eb #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 06/27/2024\nRIP: 0010:reuseport_add_sock+0x27e/0x5e0 net/core/sock_reuseport.c:350\nCode: 00 0f b7 5d 00 bf 01 00 00 00 89 de e8 1b a4 ff f7 83 fb 01 0f 85 a3 01 00 00 e8 6d a0 ff f7 49 8d 7e 12 48 89 f8 48 c1 e8 03 \u0026lt;42\u0026gt; 0f b6 04 28 84 c0 0f 85 4b 02 00 00 41 0f b7 5e 12 49 8d 7e 14\nRSP: 0018:ffffc9000b947c98 EFLAGS: 00010202\nRAX: 0000000000000002 RBX: ffff8880252ddf98 RCX: ffff888079478000\nRDX: 0000000000000000 RSI: 0000000000000001 RDI: 0000000000000012\nRBP: 0000000000000001 R08: ffffffff8993e18d R09: 1ffffffff1fef385\nR10: dffffc0000000000 R11: fffffbfff1fef386 R12: ffff8880252ddac0\nR13: dffffc0000000000 R14: 0000000000000000 R15: 0000000000000000\nFS: 00007f24e45b96c0(0000) GS:ffff8880b9300000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00007ffcced5f7b8 CR3: 00000000241be000 CR4: 00000000003506f0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __sctp_hash_endpoint net/sctp/input.c:762 [inline]\n sctp_hash_endpoint+0x52a/0x600 net/sctp/input.c:790\n sctp_listen_start net/sctp/socket.c:8570 [inline]\n sctp_inet_listen+0x767/0xa20 net/sctp/socket.c:8625\n __sys_listen_socket net/socket.c:1883 [inline]\n __sys_listen+0x1b7/0x230 net/socket.c:1894\n __do_sys_listen net/socket.c:1902 [inline]\n __se_sys_listen net/socket.c:1900 [inline]\n __x64_sys_listen+0x5a/0x70 net/socket.c:1900\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xf3/0x230 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\nRIP: 0033:0x7f24e46039b9\nCode: 28 00 00 00 75 05 48 83 c4 28 c3 e8 91 1a 00 00 90 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48\nRSP: 002b:00007f24e45b9228 EFLAGS: 00000246 ORIG_RAX: 0000000000000032\nRAX: ffffffffffffffda RBX: 00007f24e468e428 RCX: 00007f24e46039b9\nRDX: 00007f24e46039b9 RSI: 0000000000000003 RDI: 0000000000000004\nRBP: 00007f24e468e420 R08: 00007f24e45b96c0 R09: 00007f24e45b96c0\nR10: 00007f24e45b96c0 R11: 0000000000000246 R12: 00007f24e468e42c\nR13:\n---truncated---(CVE-2024-44935)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfuse: Initialize beyond-EOF page contents before setting uptodate\r\n\r\nfuse_notify_store(), unlike fuse_do_readpage(), does not enable page\nzeroing (because it can be used to change partial page contents).\r\n\r\nSo fuse_notify_store() must be more careful to fully initialize page\ncontents (including parts of the page that are beyond end-of-file)\nbefore marking the page uptodate.\r\n\r\nThe current code can leave beyond-EOF page contents uninitialized, which\nmakes these uninitialized page contents visible to userspace via mmap().\r\n\r\nThis is an information leak, but only affects systems which do not\nenable init-on-alloc (via CONFIG_INIT_ON_ALLOC_DEFAULT_ON=y or the\ncorresponding kernel command line parameter).(CVE-2024-44947)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: dsa: bcm_sf2: Fix a possible memory leak in bcm_sf2_mdio_register()\r\n\r\nbcm_sf2_mdio_register() calls of_phy_find_device() and then\nphy_device_remove() in a loop to remove existing PHY devices.\nof_phy_find_device() eventually calls bus_find_device(), which calls\nget_device() on the returned struct device * to increment the refcount.\nThe current implementation does not decrement the refcount, which causes\nmemory leak.\r\n\r\nThis commit adds the missing phy_device_free() call to decrement the\nrefcount via put_device() to balance the refcount.(CVE-2024-44971)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmptcp: pm: avoid possible UaF when selecting endp\r\n\r\nselect_local_address() and select_signal_address() both select an\nendpoint entry from the list inside an RCU protected section, but return\na reference to it, to be read later on. If the entry is dereferenced\nafter the RCU unlock, reading info could cause a Use-after-Free.\r\n\r\nA simple solution is to copy the required info while inside the RCU\nprotected section to avoid any risk of UaF later. The address ID might\nneed to be modified later to handle the ID0 case later, so a copy seems\nOK to deal with.(CVE-2024-44974)",
"id": "OESA-2024-2126",
"modified": "2026-08-06T11:07:36Z",
"published": "2024-09-14T11:07:36Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2024-2126"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48867"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48887"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48901"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48902"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-45896"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52451"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52488"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52754"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52855"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36934"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42276"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42311"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43849"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43856"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43899"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43907"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43914"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-44935"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-44947"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-44971"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-44974"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2022-48867",
"CVE-2022-48887",
"CVE-2022-48901",
"CVE-2022-48902",
"CVE-2023-45896",
"CVE-2023-52451",
"CVE-2023-52488",
"CVE-2023-52754",
"CVE-2023-52855",
"CVE-2024-36934",
"CVE-2024-42276",
"CVE-2024-42311",
"CVE-2024-43849",
"CVE-2024-43856",
"CVE-2024-43899",
"CVE-2024-43907",
"CVE-2024-43914",
"CVE-2024-44935",
"CVE-2024-44947",
"CVE-2024-44971",
"CVE-2024-44974"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.