Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2024-36950 (GCVE-0-2024-36950)
Vulnerability from cvelistv5 – Published: 2024-05-30 15:35 – Updated: 2026-05-11 20:17| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
a007bb857e0b26f5d8b73c2ff90782d9c0972620 , < b3948c69d60279fce5b2eeda92a07d66296c8130
(git)
Affected: a007bb857e0b26f5d8b73c2ff90782d9c0972620 , < 31279bbca40d2f40cb3bbb6d538ec9620a645dec (git) Affected: a007bb857e0b26f5d8b73c2ff90782d9c0972620 , < fa273f312334246c909475c5868e6daab889cc8c (git) Affected: a007bb857e0b26f5d8b73c2ff90782d9c0972620 , < 4f9cc355c328fc4f41cbd9c4cd58b235184fa420 (git) Affected: a007bb857e0b26f5d8b73c2ff90782d9c0972620 , < 6fafe3661712b143d9c69a7322294bd53f559d5d (git) Affected: a007bb857e0b26f5d8b73c2ff90782d9c0972620 , < 5982887de60c1b84f9c0ca07c835814d07fd1da0 (git) Affected: a007bb857e0b26f5d8b73c2ff90782d9c0972620 , < 8643332aac0576581cfdf01798ea3e4e0d624b61 (git) Affected: a007bb857e0b26f5d8b73c2ff90782d9c0972620 , < 752e3c53de0fa3b7d817a83050b6699b8e9c6ec9 (git) |
guessed | |
| Linux | Linux |
Affected:
2.6.26
Unaffected: 0 , < 2.6.26 (semver) Unaffected: 4.19.314 , ≤ 4.19.* (semver) Unaffected: 5.4.276 , ≤ 5.4.* (semver) Unaffected: 5.10.217 , ≤ 5.10.* (semver) Unaffected: 5.15.159 , ≤ 5.15.* (semver) Unaffected: 6.1.91 , ≤ 6.1.* (semver) Unaffected: 6.6.31 , ≤ 6.6.* (semver) Unaffected: 6.8.10 , ≤ 6.8.* (semver) Unaffected: 6.9 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 4.4,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:H/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2024-36950",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-04T15:34:28.122404Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2025-05-20T14:13:44.582Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
},
{
"providerMetadata": {
"dateUpdated": "2024-08-02T03:43:50.561Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/b3948c69d60279fce5b2eeda92a07d66296c8130"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/31279bbca40d2f40cb3bbb6d538ec9620a645dec"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/fa273f312334246c909475c5868e6daab889cc8c"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/4f9cc355c328fc4f41cbd9c4cd58b235184fa420"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/6fafe3661712b143d9c69a7322294bd53f559d5d"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/5982887de60c1b84f9c0ca07c835814d07fd1da0"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/8643332aac0576581cfdf01798ea3e4e0d624b61"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/752e3c53de0fa3b7d817a83050b6699b8e9c6ec9"
},
{
"tags": [
"x_transferred"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00020.html"
},
{
"tags": [
"x_transferred"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00019.html"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/firewire/ohci.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "b3948c69d60279fce5b2eeda92a07d66296c8130",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "31279bbca40d2f40cb3bbb6d538ec9620a645dec",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "fa273f312334246c909475c5868e6daab889cc8c",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "4f9cc355c328fc4f41cbd9c4cd58b235184fa420",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "6fafe3661712b143d9c69a7322294bd53f559d5d",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "5982887de60c1b84f9c0ca07c835814d07fd1da0",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "8643332aac0576581cfdf01798ea3e4e0d624b61",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "752e3c53de0fa3b7d817a83050b6699b8e9c6ec9",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/firewire/ohci.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.26"
},
{
"lessThan": "2.6.26",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.314",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.276",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.217",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.159",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.91",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.31",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.10",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.9",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.314",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.276",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.217",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.159",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.91",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.31",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.8.10",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.9",
"versionStartIncluding": "2.6.26",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nfirewire: ohci: mask bus reset interrupts between ISR and bottom half\n\nIn the FireWire OHCI interrupt handler, if a bus reset interrupt has\noccurred, mask bus reset interrupts until bus_reset_work has serviced and\ncleared the interrupt.\n\nNormally, we always leave bus reset interrupts masked. We infer the bus\nreset from the self-ID interrupt that happens shortly thereafter. A\nscenario where we unmask bus reset interrupts was introduced in 2008 in\na007bb857e0b26f5d8b73c2ff90782d9c0972620: If\nOHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we\nwill unmask bus reset interrupts so we can log them.\n\nirq_handler logs the bus reset interrupt. However, we can\u0027t clear the bus\nreset event flag in irq_handler, because we won\u0027t service the event until\nlater. irq_handler exits with the event flag still set. If the\ncorresponding interrupt is still unmasked, the first bus reset will\nusually freeze the system due to irq_handler being called again each\ntime it exits. This freeze can be reproduced by loading firewire_ohci\nwith \"modprobe firewire_ohci debug=-1\" (to enable all debugging output).\nApparently there are also some cases where bus_reset_work will get called\nsoon enough to clear the event, and operation will continue normally.\n\nThis freeze was first reported a few months after a007bb85 was committed,\nbut until now it was never fixed. The debug level could safely be set\nto -1 through sysfs after the module was loaded, but this would be\nineffectual in logging bus reset interrupts since they were only\nunmasked during initialization.\n\nirq_handler will now leave the event flag set but mask bus reset\ninterrupts, so irq_handler won\u0027t be called again and there will be no\nfreeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will\nunmask the interrupt after servicing the event, so future interrupts\nwill be caught as desired.\n\nAs a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be\nenabled through sysfs in addition to during initial module loading.\nHowever, when enabled through sysfs, logging of bus reset interrupts will\nbe effective only starting with the second bus reset, after\nbus_reset_work has executed."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T20:17:37.975Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/b3948c69d60279fce5b2eeda92a07d66296c8130"
},
{
"url": "https://git.kernel.org/stable/c/31279bbca40d2f40cb3bbb6d538ec9620a645dec"
},
{
"url": "https://git.kernel.org/stable/c/fa273f312334246c909475c5868e6daab889cc8c"
},
{
"url": "https://git.kernel.org/stable/c/4f9cc355c328fc4f41cbd9c4cd58b235184fa420"
},
{
"url": "https://git.kernel.org/stable/c/6fafe3661712b143d9c69a7322294bd53f559d5d"
},
{
"url": "https://git.kernel.org/stable/c/5982887de60c1b84f9c0ca07c835814d07fd1da0"
},
{
"url": "https://git.kernel.org/stable/c/8643332aac0576581cfdf01798ea3e4e0d624b61"
},
{
"url": "https://git.kernel.org/stable/c/752e3c53de0fa3b7d817a83050b6699b8e9c6ec9"
}
],
"title": "firewire: ohci: mask bus reset interrupts between ISR and bottom half",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-36950",
"datePublished": "2024-05-30T15:35:46.262Z",
"dateReserved": "2024-05-30T15:25:07.079Z",
"dateUpdated": "2026-05-11T20:17:37.975Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2024-36950",
"date": "2026-10-03",
"epss": "0.0026",
"percentile": "0.16116"
},
"fkie_nvd": {
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nfirewire: ohci: mask bus reset interrupts between ISR and bottom half\n\nIn the FireWire OHCI interrupt handler, if a bus reset interrupt has\noccurred, mask bus reset interrupts until bus_reset_work has serviced and\ncleared the interrupt.\n\nNormally, we always leave bus reset interrupts masked. We infer the bus\nreset from the self-ID interrupt that happens shortly thereafter. A\nscenario where we unmask bus reset interrupts was introduced in 2008 in\na007bb857e0b26f5d8b73c2ff90782d9c0972620: If\nOHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we\nwill unmask bus reset interrupts so we can log them.\n\nirq_handler logs the bus reset interrupt. However, we can\u0027t clear the bus\nreset event flag in irq_handler, because we won\u0027t service the event until\nlater. irq_handler exits with the event flag still set. If the\ncorresponding interrupt is still unmasked, the first bus reset will\nusually freeze the system due to irq_handler being called again each\ntime it exits. This freeze can be reproduced by loading firewire_ohci\nwith \"modprobe firewire_ohci debug=-1\" (to enable all debugging output).\nApparently there are also some cases where bus_reset_work will get called\nsoon enough to clear the event, and operation will continue normally.\n\nThis freeze was first reported a few months after a007bb85 was committed,\nbut until now it was never fixed. The debug level could safely be set\nto -1 through sysfs after the module was loaded, but this would be\nineffectual in logging bus reset interrupts since they were only\nunmasked during initialization.\n\nirq_handler will now leave the event flag set but mask bus reset\ninterrupts, so irq_handler won\u0027t be called again and there will be no\nfreeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will\nunmask the interrupt after servicing the event, so future interrupts\nwill be caught as desired.\n\nAs a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be\nenabled through sysfs in addition to during initial module loading.\nHowever, when enabled through sysfs, logging of bus reset interrupts will\nbe effective only starting with the second bus reset, after\nbus_reset_work has executed."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: firewire: ohci: enmascara las interrupciones de reinicio del bus entre ISR y la mitad inferior. En el controlador de interrupciones FireWire OHCI, si se ha producido una interrupci\u00f3n de reinicio del bus, enmascara las interrupciones de reinicio del bus hasta que bus_reset_work haya sido reparado y borrado la interrupci\u00f3n. Normalmente, siempre dejamos enmascaradas las interrupciones de reinicio del bus. Inferimos el reinicio del bus a partir de la interrupci\u00f3n de la autoidentificaci\u00f3n que ocurre poco despu\u00e9s. En 2008 se introdujo un escenario en el que desenmascaramos las interrupciones de reinicio del bus en a007bb857e0b26f5d8b73c2ff90782d9c0972620: Si OHCI_PARAM_DEBUG_BUSRESETS (8) est\u00e1 configurado en la m\u00e1scara de bits del par\u00e1metro de depuraci\u00f3n, desenmascararemos las interrupciones de reinicio del bus para poder registrarlas. irq_handler registra la interrupci\u00f3n de reinicio del bus. Sin embargo, no podemos borrar el indicador de evento de reinicio del bus en irq_handler porque no atenderemos el evento hasta m\u00e1s tarde. irq_handler sale con el indicador de evento a\u00fan configurado. Si la interrupci\u00f3n correspondiente a\u00fan est\u00e1 desenmascarada, el primer reinicio del bus generalmente congelar\u00e1 el sistema debido a que se vuelve a llamar a irq_handler cada vez que sale. Esta congelaci\u00f3n se puede reproducir cargando firewire_ohci con \"modprobe firewire_ohci debug=-1\" (para habilitar todos los resultados de depuraci\u00f3n). Aparentemente, tambi\u00e9n hay algunos casos en los que se llamar\u00e1 a bus_reset_work lo suficientemente pronto como para borrar el evento y la operaci\u00f3n continuar\u00e1 normalmente. Esta congelaci\u00f3n se inform\u00f3 por primera vez unos meses despu\u00e9s del commit a007bb85, pero hasta ahora nunca se hab\u00eda solucionado. El nivel de depuraci\u00f3n podr\u00eda establecerse de forma segura en -1 a trav\u00e9s de sysfs despu\u00e9s de cargar el m\u00f3dulo, pero esto ser\u00eda ineficaz para registrar las interrupciones de reinicio del bus ya que s\u00f3lo se desenmascararon durante la inicializaci\u00f3n. irq_handler ahora dejar\u00e1 establecido el indicador de evento pero enmascarar\u00e1 las interrupciones de reinicio del bus, por lo que no se volver\u00e1 a llamar a irq_handler y no se congelar\u00e1. Si OHCI_PARAM_DEBUG_BUSRESETS est\u00e1 habilitado, bus_reset_work desenmascarar\u00e1 la interrupci\u00f3n despu\u00e9s de atender el evento, por lo que las interrupciones futuras se detectar\u00e1n seg\u00fan se desee. Como efecto secundario de este cambio, OHCI_PARAM_DEBUG_BUSRESETS ahora se puede habilitar a trav\u00e9s de sysfs adem\u00e1s de durante la carga inicial del m\u00f3dulo. Sin embargo, cuando se habilita a trav\u00e9s de sysfs, el registro de interrupciones de reinicio del bus ser\u00e1 efectivo solo a partir del segundo reinicio del bus, despu\u00e9s de que se haya ejecutado bus_reset_work."
}
],
"id": "CVE-2024-36950",
"lastModified": "2024-11-21T09:22:53.400",
"published": "2024-05-30T16:15:18.000",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/31279bbca40d2f40cb3bbb6d538ec9620a645dec"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/4f9cc355c328fc4f41cbd9c4cd58b235184fa420"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/5982887de60c1b84f9c0ca07c835814d07fd1da0"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/6fafe3661712b143d9c69a7322294bd53f559d5d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/752e3c53de0fa3b7d817a83050b6699b8e9c6ec9"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/8643332aac0576581cfdf01798ea3e4e0d624b61"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/b3948c69d60279fce5b2eeda92a07d66296c8130"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/fa273f312334246c909475c5868e6daab889cc8c"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/31279bbca40d2f40cb3bbb6d538ec9620a645dec"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/4f9cc355c328fc4f41cbd9c4cd58b235184fa420"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/5982887de60c1b84f9c0ca07c835814d07fd1da0"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/6fafe3661712b143d9c69a7322294bd53f559d5d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/752e3c53de0fa3b7d817a83050b6699b8e9c6ec9"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/8643332aac0576581cfdf01798ea3e4e0d624b61"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/b3948c69d60279fce5b2eeda92a07d66296c8130"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/fa273f312334246c909475c5868e6daab889cc8c"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00019.html"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00020.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Awaiting Analysis"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/firewire/ohci.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "b3948c69d60279fce5b2eeda92a07d66296c8130",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "31279bbca40d2f40cb3bbb6d538ec9620a645dec",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "fa273f312334246c909475c5868e6daab889cc8c",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "4f9cc355c328fc4f41cbd9c4cd58b235184fa420",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "6fafe3661712b143d9c69a7322294bd53f559d5d",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "5982887de60c1b84f9c0ca07c835814d07fd1da0",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "8643332aac0576581cfdf01798ea3e4e0d624b61",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "752e3c53de0fa3b7d817a83050b6699b8e9c6ec9",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/firewire/ohci.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.26"
},
{
"lessThan": "2.6.26",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.314",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.276",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.217",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.159",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.91",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.31",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.10",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.9",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "1350A539-B5DC-4612-9B61-E5516FD777D5",
"versionEndExcluding": "4.19.314",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "126C6EEC-8874-4233-AE09-634924FCDDF4",
"versionEndExcluding": "5.4.276",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "AC67C71C-2044-40BA-B590-61E562F69F89",
"versionEndExcluding": "5.10.217",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F16678CD-F7C6-4BF6-ABA8-E7600857197B",
"versionEndExcluding": "5.15.159",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "4F8C886C-75AA-469B-A6A9-12BF1A29C0D5",
"versionEndExcluding": "6.1.91",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "CDDB1F69-36AC-41C1-9192-E7CCEF5FFC00",
"versionEndExcluding": "6.6.31",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "6A6B920C-8D8F-4130-86B4-AD334F4CF2E3",
"versionEndExcluding": "6.8.10",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.9:rc1:*:*:*:*:*:*",
"matchCriteriaId": "22BEDD49-2C6D-402D-9DBF-6646F6ECD10B",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.9:rc2:*:*:*:*:*:*",
"matchCriteriaId": "DF73CB2A-DFFD-46FB-9BFE-AA394F27EA37",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
},
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:debian:debian_linux:10.0:*:*:*:*:*:*:*",
"matchCriteriaId": "07B237A9-69A3-4A9C-9DA0-4E06BD37AE73",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nfirewire: ohci: mask bus reset interrupts between ISR and bottom half\n\nIn the FireWire OHCI interrupt handler, if a bus reset interrupt has\noccurred, mask bus reset interrupts until bus_reset_work has serviced and\ncleared the interrupt.\n\nNormally, we always leave bus reset interrupts masked. We infer the bus\nreset from the self-ID interrupt that happens shortly thereafter. A\nscenario where we unmask bus reset interrupts was introduced in 2008 in\na007bb857e0b26f5d8b73c2ff90782d9c0972620: If\nOHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we\nwill unmask bus reset interrupts so we can log them.\n\nirq_handler logs the bus reset interrupt. However, we can\u0027t clear the bus\nreset event flag in irq_handler, because we won\u0027t service the event until\nlater. irq_handler exits with the event flag still set. If the\ncorresponding interrupt is still unmasked, the first bus reset will\nusually freeze the system due to irq_handler being called again each\ntime it exits. This freeze can be reproduced by loading firewire_ohci\nwith \"modprobe firewire_ohci debug=-1\" (to enable all debugging output).\nApparently there are also some cases where bus_reset_work will get called\nsoon enough to clear the event, and operation will continue normally.\n\nThis freeze was first reported a few months after a007bb85 was committed,\nbut until now it was never fixed. The debug level could safely be set\nto -1 through sysfs after the module was loaded, but this would be\nineffectual in logging bus reset interrupts since they were only\nunmasked during initialization.\n\nirq_handler will now leave the event flag set but mask bus reset\ninterrupts, so irq_handler won\u0027t be called again and there will be no\nfreeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will\nunmask the interrupt after servicing the event, so future interrupts\nwill be caught as desired.\n\nAs a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be\nenabled through sysfs in addition to during initial module loading.\nHowever, when enabled through sysfs, logging of bus reset interrupts will\nbe effective only starting with the second bus reset, after\nbus_reset_work has executed."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: firewire: ohci: enmascara las interrupciones de reinicio del bus entre ISR y la mitad inferior. En el controlador de interrupciones FireWire OHCI, si se ha producido una interrupci\u00f3n de reinicio del bus, enmascara las interrupciones de reinicio del bus hasta que bus_reset_work haya sido reparado y borrado la interrupci\u00f3n. Normalmente, siempre dejamos enmascaradas las interrupciones de reinicio del bus. Inferimos el reinicio del bus a partir de la interrupci\u00f3n de la autoidentificaci\u00f3n que ocurre poco despu\u00e9s. En 2008 se introdujo un escenario en el que desenmascaramos las interrupciones de reinicio del bus en a007bb857e0b26f5d8b73c2ff90782d9c0972620: Si OHCI_PARAM_DEBUG_BUSRESETS (8) est\u00e1 configurado en la m\u00e1scara de bits del par\u00e1metro de depuraci\u00f3n, desenmascararemos las interrupciones de reinicio del bus para poder registrarlas. irq_handler registra la interrupci\u00f3n de reinicio del bus. Sin embargo, no podemos borrar el indicador de evento de reinicio del bus en irq_handler porque no atenderemos el evento hasta m\u00e1s tarde. irq_handler sale con el indicador de evento a\u00fan configurado. Si la interrupci\u00f3n correspondiente a\u00fan est\u00e1 desenmascarada, el primer reinicio del bus generalmente congelar\u00e1 el sistema debido a que se vuelve a llamar a irq_handler cada vez que sale. Esta congelaci\u00f3n se puede reproducir cargando firewire_ohci con \"modprobe firewire_ohci debug=-1\" (para habilitar todos los resultados de depuraci\u00f3n). Aparentemente, tambi\u00e9n hay algunos casos en los que se llamar\u00e1 a bus_reset_work lo suficientemente pronto como para borrar el evento y la operaci\u00f3n continuar\u00e1 normalmente. Esta congelaci\u00f3n se inform\u00f3 por primera vez unos meses despu\u00e9s del commit a007bb85, pero hasta ahora nunca se hab\u00eda solucionado. El nivel de depuraci\u00f3n podr\u00eda establecerse de forma segura en -1 a trav\u00e9s de sysfs despu\u00e9s de cargar el m\u00f3dulo, pero esto ser\u00eda ineficaz para registrar las interrupciones de reinicio del bus ya que s\u00f3lo se desenmascararon durante la inicializaci\u00f3n. irq_handler ahora dejar\u00e1 establecido el indicador de evento pero enmascarar\u00e1 las interrupciones de reinicio del bus, por lo que no se volver\u00e1 a llamar a irq_handler y no se congelar\u00e1. Si OHCI_PARAM_DEBUG_BUSRESETS est\u00e1 habilitado, bus_reset_work desenmascarar\u00e1 la interrupci\u00f3n despu\u00e9s de atender el evento, por lo que las interrupciones futuras se detectar\u00e1n seg\u00fan se desee. Como efecto secundario de este cambio, OHCI_PARAM_DEBUG_BUSRESETS ahora se puede habilitar a trav\u00e9s de sysfs adem\u00e1s de durante la carga inicial del m\u00f3dulo. Sin embargo, cuando se habilita a trav\u00e9s de sysfs, el registro de interrupciones de reinicio del bus ser\u00e1 efectivo solo a partir del segundo reinicio del bus, despu\u00e9s de que se haya ejecutado bus_reset_work."
}
],
"id": "CVE-2024-36950",
"lastModified": "2026-06-17T07:37:25.973",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 4.4,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:H/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 0.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 4.4,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:H/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 0.8,
"impactScore": 3.6,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-36950",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-04T15:34:28.122404Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-05-30T16:15:18.000",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/31279bbca40d2f40cb3bbb6d538ec9620a645dec"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4f9cc355c328fc4f41cbd9c4cd58b235184fa420"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5982887de60c1b84f9c0ca07c835814d07fd1da0"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/6fafe3661712b143d9c69a7322294bd53f559d5d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/752e3c53de0fa3b7d817a83050b6699b8e9c6ec9"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8643332aac0576581cfdf01798ea3e4e0d624b61"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b3948c69d60279fce5b2eeda92a07d66296c8130"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/fa273f312334246c909475c5868e6daab889cc8c"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/31279bbca40d2f40cb3bbb6d538ec9620a645dec"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4f9cc355c328fc4f41cbd9c4cd58b235184fa420"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5982887de60c1b84f9c0ca07c835814d07fd1da0"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/6fafe3661712b143d9c69a7322294bd53f559d5d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/752e3c53de0fa3b7d817a83050b6699b8e9c6ec9"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8643332aac0576581cfdf01798ea3e4e0d624b61"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b3948c69d60279fce5b2eeda92a07d66296c8130"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/fa273f312334246c909475c5868e6daab889cc8c"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Third Party Advisory"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00019.html"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Third Party Advisory"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00020.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-noinfo"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Low",
"current_release_date": "2026-06-28T10:59:29+00:00",
"cve": "CVE-2024-36950",
"id": "CVE-2024-36950",
"initial_release_date": "2024-05-30T00:00:00+00:00",
"product_status:fixed": "150",
"product_status:known_affected": "42",
"product_status:known_not_affected": "108",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: firewire: ohci: mask bus reset interrupts between ISR and bottom half",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2024/cve-2024-36950.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-09-30T15:42:39Z",
"cve": "CVE-2024-36950",
"id": "CVE-2024-36950",
"initial_release_date": "2024-06-04T12:14:59Z",
"product_status:known_affected": "481",
"product_status:recommended": "778",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2024-36950",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2024-36950.json",
"version": "109"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T03:43:50.561Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/b3948c69d60279fce5b2eeda92a07d66296c8130"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/31279bbca40d2f40cb3bbb6d538ec9620a645dec"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/fa273f312334246c909475c5868e6daab889cc8c"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/4f9cc355c328fc4f41cbd9c4cd58b235184fa420"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/6fafe3661712b143d9c69a7322294bd53f559d5d"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/5982887de60c1b84f9c0ca07c835814d07fd1da0"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/8643332aac0576581cfdf01798ea3e4e0d624b61"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/752e3c53de0fa3b7d817a83050b6699b8e9c6ec9"
},
{
"tags": [
"x_transferred"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00020.html"
},
{
"tags": [
"x_transferred"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00019.html"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 4.4,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:H/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2024-36950",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-04T15:34:28.122404Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-06-04T15:34:31.682Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/firewire/ohci.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "b3948c69d60279fce5b2eeda92a07d66296c8130",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "31279bbca40d2f40cb3bbb6d538ec9620a645dec",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "fa273f312334246c909475c5868e6daab889cc8c",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "4f9cc355c328fc4f41cbd9c4cd58b235184fa420",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "6fafe3661712b143d9c69a7322294bd53f559d5d",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "5982887de60c1b84f9c0ca07c835814d07fd1da0",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "8643332aac0576581cfdf01798ea3e4e0d624b61",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "752e3c53de0fa3b7d817a83050b6699b8e9c6ec9",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/firewire/ohci.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.26"
},
{
"lessThan": "2.6.26",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.314",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.276",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.217",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.159",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.91",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.31",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.10",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.9",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.314",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.276",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.217",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.159",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.91",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.31",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.8.10",
"versionStartIncluding": "2.6.26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.9",
"versionStartIncluding": "2.6.26",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nfirewire: ohci: mask bus reset interrupts between ISR and bottom half\n\nIn the FireWire OHCI interrupt handler, if a bus reset interrupt has\noccurred, mask bus reset interrupts until bus_reset_work has serviced and\ncleared the interrupt.\n\nNormally, we always leave bus reset interrupts masked. We infer the bus\nreset from the self-ID interrupt that happens shortly thereafter. A\nscenario where we unmask bus reset interrupts was introduced in 2008 in\na007bb857e0b26f5d8b73c2ff90782d9c0972620: If\nOHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we\nwill unmask bus reset interrupts so we can log them.\n\nirq_handler logs the bus reset interrupt. However, we can\u0027t clear the bus\nreset event flag in irq_handler, because we won\u0027t service the event until\nlater. irq_handler exits with the event flag still set. If the\ncorresponding interrupt is still unmasked, the first bus reset will\nusually freeze the system due to irq_handler being called again each\ntime it exits. This freeze can be reproduced by loading firewire_ohci\nwith \"modprobe firewire_ohci debug=-1\" (to enable all debugging output).\nApparently there are also some cases where bus_reset_work will get called\nsoon enough to clear the event, and operation will continue normally.\n\nThis freeze was first reported a few months after a007bb85 was committed,\nbut until now it was never fixed. The debug level could safely be set\nto -1 through sysfs after the module was loaded, but this would be\nineffectual in logging bus reset interrupts since they were only\nunmasked during initialization.\n\nirq_handler will now leave the event flag set but mask bus reset\ninterrupts, so irq_handler won\u0027t be called again and there will be no\nfreeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will\nunmask the interrupt after servicing the event, so future interrupts\nwill be caught as desired.\n\nAs a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be\nenabled through sysfs in addition to during initial module loading.\nHowever, when enabled through sysfs, logging of bus reset interrupts will\nbe effective only starting with the second bus reset, after\nbus_reset_work has executed."
}
],
"providerMetadata": {
"dateUpdated": "2026-01-05T10:36:28.444Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/b3948c69d60279fce5b2eeda92a07d66296c8130"
},
{
"url": "https://git.kernel.org/stable/c/31279bbca40d2f40cb3bbb6d538ec9620a645dec"
},
{
"url": "https://git.kernel.org/stable/c/fa273f312334246c909475c5868e6daab889cc8c"
},
{
"url": "https://git.kernel.org/stable/c/4f9cc355c328fc4f41cbd9c4cd58b235184fa420"
},
{
"url": "https://git.kernel.org/stable/c/6fafe3661712b143d9c69a7322294bd53f559d5d"
},
{
"url": "https://git.kernel.org/stable/c/5982887de60c1b84f9c0ca07c835814d07fd1da0"
},
{
"url": "https://git.kernel.org/stable/c/8643332aac0576581cfdf01798ea3e4e0d624b61"
},
{
"url": "https://git.kernel.org/stable/c/752e3c53de0fa3b7d817a83050b6699b8e9c6ec9"
}
],
"title": "firewire: ohci: mask bus reset interrupts between ISR and bottom half",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-36950",
"datePublished": "2024-05-30T15:35:46.262Z",
"dateReserved": "2024-05-30T15:25:07.079Z",
"dateUpdated": "2026-01-05T10:36:28.444Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
CERTFR-2024-AVI-0717
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | Public Cloud Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Software Development Kit 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 12 12-SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP6 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap 15.6 |
| Title | Publication Time | Tags | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Software Development Kit 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 12 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-26558",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26558"
},
{
"name": "CVE-2021-0129",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0129"
},
{
"name": "CVE-2022-20368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20368"
},
{
"name": "CVE-2022-2964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2964"
},
{
"name": "CVE-2022-28748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28748"
},
{
"name": "CVE-2023-1582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1582"
},
{
"name": "CVE-2023-37453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37453"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-51780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51780"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52594"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2023-52612",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52612"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-26659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26659"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26800"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-26737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26737"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2023-52616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52616"
},
{
"name": "CVE-2024-26750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26750"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26816"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2023-52640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52640"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2023-52641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52641"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2023-52635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52635"
},
{
"name": "CVE-2024-26774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26774"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26780"
},
{
"name": "CVE-2024-26731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26731"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2024-26641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26641"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2023-52503",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52503"
},
{
"name": "CVE-2023-52580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52580"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26863"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26861"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26978"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26615"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26883"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26885"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-27030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27030"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2024-27046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27046"
},
{
"name": "CVE-2024-26903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26903"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-27022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27022"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26650"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2024-26623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26623"
},
{
"name": "CVE-2024-26632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26632"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2021-47219",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47219"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2021-47197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47197"
},
{
"name": "CVE-2024-26856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26856"
},
{
"name": "CVE-2024-26881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26881"
},
{
"name": "CVE-2023-52652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52652"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2024-26972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26972"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2024-26836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26836"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26783"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2021-47194",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47194"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52681"
},
{
"name": "CVE-2023-52687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52687"
},
{
"name": "CVE-2023-52695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52695"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2023-52771",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52771"
},
{
"name": "CVE-2023-52772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52772"
},
{
"name": "CVE-2023-6238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6238"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26652",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26652"
},
{
"name": "CVE-2024-26657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26657"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2024-26786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26786"
},
{
"name": "CVE-2024-26794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26794"
},
{
"name": "CVE-2024-26832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26832"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26854"
},
{
"name": "CVE-2024-26858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26858"
},
{
"name": "CVE-2024-26860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26860"
},
{
"name": "CVE-2024-26868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26868"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26909"
},
{
"name": "CVE-2024-26932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26932"
},
{
"name": "CVE-2024-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26945"
},
{
"name": "CVE-2024-26946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26946"
},
{
"name": "CVE-2024-26949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26949"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-26963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26963"
},
{
"name": "CVE-2024-26986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26986"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-26991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26991"
},
{
"name": "CVE-2024-26995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26995"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-27067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27067"
},
{
"name": "CVE-2024-27080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27080"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2024-27411",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27411"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-35786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35786"
},
{
"name": "CVE-2024-35788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35788"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35800"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35841"
},
{
"name": "CVE-2024-35842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35842"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35883"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35909"
},
{
"name": "CVE-2024-35911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35911"
},
{
"name": "CVE-2024-35916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35916"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35921"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35928"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-35953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35953"
},
{
"name": "CVE-2024-35954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35954"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-35972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35972"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35975"
},
{
"name": "CVE-2024-35977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35977"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36018"
},
{
"name": "CVE-2024-36019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36019"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36885"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2023-52672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52672"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2024-35805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35805"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35934"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-26944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26944"
},
{
"name": "CVE-2024-27064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27064"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2021-47103",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47103"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2021-47580",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47580"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2021-47597",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47597"
},
{
"name": "CVE-2021-47600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47600"
},
{
"name": "CVE-2021-47619",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47619"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48730",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48730"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48749",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48749"
},
{
"name": "CVE-2022-48756",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48756"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52869",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52869"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36592"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47547",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47547"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52765"
},
{
"name": "CVE-2023-52767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52767"
},
{
"name": "CVE-2023-52768",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52768"
},
{
"name": "CVE-2023-52769",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52769"
},
{
"name": "CVE-2023-52776",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52776"
},
{
"name": "CVE-2023-52780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52780"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52783",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52783"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52801"
},
{
"name": "CVE-2023-52812",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52812"
},
{
"name": "CVE-2023-52827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52827"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52850"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2023-52862",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52862"
},
{
"name": "CVE-2023-52863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52863"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2023-52874",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52874"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2023-52883",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52883"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38391"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39362",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39362"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2023-52751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52751"
},
{
"name": "CVE-2024-26785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26785"
},
{
"name": "CVE-2024-27402",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27402"
},
{
"name": "CVE-2024-27404",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27404"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2021-47086",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47086"
},
{
"name": "CVE-2021-47126",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47126"
},
{
"name": "CVE-2021-47186",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47186"
},
{
"name": "CVE-2021-47291",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47291"
},
{
"name": "CVE-2021-47295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47295"
},
{
"name": "CVE-2021-47546",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47546"
},
{
"name": "CVE-2021-47588",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47588"
},
{
"name": "CVE-2021-47590",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47590"
},
{
"name": "CVE-2021-47591",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47591"
},
{
"name": "CVE-2021-47593",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47593"
},
{
"name": "CVE-2021-47598",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47598"
},
{
"name": "CVE-2021-47599",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47599"
},
{
"name": "CVE-2021-47606",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47606"
},
{
"name": "CVE-2021-47622",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47622"
},
{
"name": "CVE-2021-47623",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47623"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2022-48774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48774"
},
{
"name": "CVE-2022-48775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48775"
},
{
"name": "CVE-2022-48776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48776"
},
{
"name": "CVE-2022-48777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48777"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48780"
},
{
"name": "CVE-2022-48783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48783"
},
{
"name": "CVE-2022-48784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48784"
},
{
"name": "CVE-2022-48785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48785"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48788",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48788"
},
{
"name": "CVE-2022-48789",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48789"
},
{
"name": "CVE-2022-48790",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48790"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48792",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48792"
},
{
"name": "CVE-2022-48793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48793"
},
{
"name": "CVE-2022-48794",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48794"
},
{
"name": "CVE-2022-48796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48796"
},
{
"name": "CVE-2022-48797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48797"
},
{
"name": "CVE-2022-48798",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48798"
},
{
"name": "CVE-2022-48799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48799"
},
{
"name": "CVE-2022-48800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48800"
},
{
"name": "CVE-2022-48801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48801"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48803"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2022-48805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48805"
},
{
"name": "CVE-2022-48806",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48806"
},
{
"name": "CVE-2022-48807",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48807"
},
{
"name": "CVE-2022-48809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48809"
},
{
"name": "CVE-2022-48810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48810"
},
{
"name": "CVE-2022-48811",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48811"
},
{
"name": "CVE-2022-48812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48812"
},
{
"name": "CVE-2022-48813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48813"
},
{
"name": "CVE-2022-48814",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48814"
},
{
"name": "CVE-2022-48815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48815"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2022-48817",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48817"
},
{
"name": "CVE-2022-48818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48818"
},
{
"name": "CVE-2022-48820",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48820"
},
{
"name": "CVE-2022-48821",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48821"
},
{
"name": "CVE-2022-48822",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48822"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48824"
},
{
"name": "CVE-2022-48825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48825"
},
{
"name": "CVE-2022-48826",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48826"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2022-48828",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48828"
},
{
"name": "CVE-2022-48829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48829"
},
{
"name": "CVE-2022-48830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48830"
},
{
"name": "CVE-2022-48831",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48831"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48838",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48838"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48840"
},
{
"name": "CVE-2022-48841",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48841"
},
{
"name": "CVE-2022-48842",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48842"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48844",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48844"
},
{
"name": "CVE-2022-48846",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48846"
},
{
"name": "CVE-2022-48847",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48847"
},
{
"name": "CVE-2022-48849",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48849"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48851"
},
{
"name": "CVE-2022-48852",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48852"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48855",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48855"
},
{
"name": "CVE-2022-48856",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48856"
},
{
"name": "CVE-2022-48857",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48857"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2022-48859",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48859"
},
{
"name": "CVE-2022-48860",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48860"
},
{
"name": "CVE-2022-48861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48861"
},
{
"name": "CVE-2022-48862",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48862"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2022-48864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48864"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2023-31315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31315"
},
{
"name": "CVE-2023-52573",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52573"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0717",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-23T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-08-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2980-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242980-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2940-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242940-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2944-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242944-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2943-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242943-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2948-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242948-1"
},
{
"published_at": "2024-08-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2973-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242973-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2947-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242947-1"
}
]
}
CERTFR-2024-AVI-0799
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Title | Publication Time | Tags | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-38096",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-38096"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2024-26629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26629"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-25742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25742"
},
{
"name": "CVE-2024-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23307"
},
{
"name": "CVE-2024-26811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26811"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26810"
},
{
"name": "CVE-2024-26787",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26787"
},
{
"name": "CVE-2024-24858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24858"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2024-26812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26812"
},
{
"name": "CVE-2024-26687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26687"
},
{
"name": "CVE-2024-26680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26680"
},
{
"name": "CVE-2023-52488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52488"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26966"
},
{
"name": "CVE-2024-26980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26980"
},
{
"name": "CVE-2024-26970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26970"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-27009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27009"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26965"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-26936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26936"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26956"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-26955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26955"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-26817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26817"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26969"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-27018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27018"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-26926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26926"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2023-52585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52585"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36031"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-35785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35785"
},
{
"name": "CVE-2024-35805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35805"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35871"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35888"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35897"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35902"
},
{
"name": "CVE-2024-35910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35910"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35934"
},
{
"name": "CVE-2024-35988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35988"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38612"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38637"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-39292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39292"
},
{
"name": "CVE-2024-26886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26886"
},
{
"name": "CVE-2024-26952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26952"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-24859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24859"
},
{
"name": "CVE-2024-26677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26677"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2023-52760",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52760"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-33847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33847"
},
{
"name": "CVE-2024-34027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34027"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38607"
},
{
"name": "CVE-2024-38613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38613"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-38662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38662"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39298"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39467",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39467"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39480",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39480"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39484"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39489"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39495",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39495"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-39510",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39510"
},
{
"name": "CVE-2024-40899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40899"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40905"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40910"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40913"
},
{
"name": "CVE-2024-40914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40914"
},
{
"name": "CVE-2024-40915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40915"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40920"
},
{
"name": "CVE-2024-40921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40921"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40938"
},
{
"name": "CVE-2024-40939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40939"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40957"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40963"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40968"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40971"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40980"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-40996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40996"
},
{
"name": "CVE-2024-41000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41000"
},
{
"name": "CVE-2024-41001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41001"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2022-48808",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48808"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2023-52629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52629"
},
{
"name": "CVE-2024-36484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36484"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2024-41034",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41034"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2024-41046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41046"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2024-42101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42101"
},
{
"name": "CVE-2024-42102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42102"
},
{
"name": "CVE-2024-42104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42104"
},
{
"name": "CVE-2024-42106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42106"
},
{
"name": "CVE-2024-42115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42115"
},
{
"name": "CVE-2024-42121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42121"
},
{
"name": "CVE-2024-42127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42127"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2024-42137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42137"
},
{
"name": "CVE-2024-42148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42148"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-42153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42153"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42157"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2024-40936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40936"
},
{
"name": "CVE-2024-42082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42082"
},
{
"name": "CVE-2023-52887",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52887"
},
{
"name": "CVE-2024-32936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-32936"
},
{
"name": "CVE-2024-34030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34030"
},
{
"name": "CVE-2024-36244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36244"
},
{
"name": "CVE-2024-36481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36481"
},
{
"name": "CVE-2024-37026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37026"
},
{
"name": "CVE-2024-38306",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38306"
},
{
"name": "CVE-2024-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38623"
},
{
"name": "CVE-2024-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38624"
},
{
"name": "CVE-2024-38625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38625"
},
{
"name": "CVE-2024-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38632"
},
{
"name": "CVE-2024-38667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38667"
},
{
"name": "CVE-2024-39461",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39461"
},
{
"name": "CVE-2024-39462",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39462"
},
{
"name": "CVE-2024-39464",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39464"
},
{
"name": "CVE-2024-39465",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39465"
},
{
"name": "CVE-2024-39470",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39470"
},
{
"name": "CVE-2024-39478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39478"
},
{
"name": "CVE-2024-39483",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39483"
},
{
"name": "CVE-2024-39485",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39485"
},
{
"name": "CVE-2024-39491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39491"
},
{
"name": "CVE-2024-39492",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39492"
},
{
"name": "CVE-2024-40917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40917"
},
{
"name": "CVE-2024-40918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40918"
},
{
"name": "CVE-2024-40922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40922"
},
{
"name": "CVE-2024-40926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40926"
},
{
"name": "CVE-2024-40930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40930"
},
{
"name": "CVE-2024-40933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40933"
},
{
"name": "CVE-2024-40944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40944"
},
{
"name": "CVE-2024-40949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40949"
},
{
"name": "CVE-2024-40951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40951"
},
{
"name": "CVE-2024-40952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40952"
},
{
"name": "CVE-2024-40955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40955"
},
{
"name": "CVE-2024-40962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40962"
},
{
"name": "CVE-2024-40964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40964"
},
{
"name": "CVE-2024-40965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40965"
},
{
"name": "CVE-2024-40969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40969"
},
{
"name": "CVE-2024-40973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40973"
},
{
"name": "CVE-2024-40985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40985"
},
{
"name": "CVE-2024-40986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40986"
},
{
"name": "CVE-2024-40992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40992"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-41003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41003"
},
{
"name": "CVE-2024-41027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41027"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2024-42068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42068"
},
{
"name": "CVE-2024-42076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42076"
},
{
"name": "CVE-2024-42077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42077"
},
{
"name": "CVE-2024-42078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42078"
},
{
"name": "CVE-2024-42080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42080"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2024-42085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42085"
},
{
"name": "CVE-2024-42086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42086"
},
{
"name": "CVE-2024-42087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42087"
},
{
"name": "CVE-2024-42089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42089"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2024-42092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42092"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2024-42095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42095"
},
{
"name": "CVE-2024-42097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42097"
},
{
"name": "CVE-2024-42098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42098"
},
{
"name": "CVE-2024-42109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42109"
},
{
"name": "CVE-2024-42130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42130"
},
{
"name": "CVE-2024-42140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42140"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2024-42270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42270"
},
{
"name": "CVE-2024-42159",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42159"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2024-42160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42160"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0799",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-09-20T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2024-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7022-1",
"url": "https://ubuntu.com/security/notices/USN-7022-1"
},
{
"published_at": "2024-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7020-1",
"url": "https://ubuntu.com/security/notices/USN-7020-1"
},
{
"published_at": "2024-09-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7009-1",
"url": "https://ubuntu.com/security/notices/USN-7009-1"
},
{
"published_at": "2024-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7019-1",
"url": "https://ubuntu.com/security/notices/USN-7019-1"
},
{
"published_at": "2024-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7021-1",
"url": "https://ubuntu.com/security/notices/USN-7021-1"
},
{
"published_at": "2024-09-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7005-2",
"url": "https://ubuntu.com/security/notices/USN-7005-2"
}
]
}
CERTFR-2024-AVI-0958
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans les produits IBM. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| IBM | Cloud Pak System | Cloud Pak System versions 2.3.4.x antérieures à 2.3.4.1 | ||
| IBM | VIOS | VIOS version 4.1 avec un fichier tcl.base versions antérieures à 8.6.10.1 | ||
| IBM | Security QRadar EDR | Security QRadar EDR versions 3.12.x antérieures à 3.12.13 | ||
| IBM | VIOS | VIOS version 4.1 avec un fichier python3.9.base versions antérieures à 3.9.20.0 | ||
| IBM | AIX | AIX version 7.2 avec un fichier tcl.base versions antérieures à 8.6.10.1 | ||
| IBM | AIX | AIX version 7.3 avec un fichier python3.9.base versions antérieures à 3.9.20.0 | ||
| IBM | AIX | AIX version 7.3 avec un fichier tcl.base versions antérieures à 8.6.10.1 | ||
| IBM | QRadar SIEM | QRadar SIEM versions 7.5.x antérieures à 7.5.0 UP10 IF01 | ||
| IBM | Cloud Pak System | Cloud Pak System versions 2.3.4.0 avec Db2 versions antérieures à 11.5.9 Special Build | ||
| IBM | Sterling Control Center | Sterling Control Center versions 6.3.1.x antérieures à 6.3.1.0 iFix03 | ||
| IBM | VIOS | VIOS version 3.1 avec un fichier tcl.base versions antérieures à 8.6.10.1 | ||
| IBM | Cloud Pak | Cloud Pak for Security versions antérieures à 1.10.27.0 | ||
| IBM | Cloud Transformation Advisor | Cloud Transformation Advisor versions antérieures à 3.10.2 | ||
| IBM | QRadar Suite Software | QRadar Suite Software versions antérieures à 1.10.27.0 | ||
| IBM | Sterling Control Center | Sterling Control Center versions 6.2.1.x antérieures à 6.2.1.0 iFix14 | ||
| IBM | QRadar Deployment Intelligence App | QRadar Deployment Intelligence App versions antérieures à 3.0.15 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Cloud Pak System versions 2.3.4.x ant\u00e9rieures \u00e0 2.3.4.1",
"product": {
"name": "Cloud Pak System",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "VIOS version 4.1 avec un fichier tcl.base versions ant\u00e9rieures \u00e0 8.6.10.1",
"product": {
"name": "VIOS",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Security QRadar EDR versions 3.12.x ant\u00e9rieures \u00e0 3.12.13",
"product": {
"name": "Security QRadar EDR",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "VIOS version 4.1 avec un fichier python3.9.base versions ant\u00e9rieures \u00e0 3.9.20.0",
"product": {
"name": "VIOS",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "AIX version 7.2 avec un fichier tcl.base versions ant\u00e9rieures \u00e0 8.6.10.1",
"product": {
"name": "AIX",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "AIX version 7.3 avec un fichier python3.9.base versions ant\u00e9rieures \u00e0 3.9.20.0",
"product": {
"name": "AIX",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "AIX version 7.3 avec un fichier tcl.base versions ant\u00e9rieures \u00e0 8.6.10.1",
"product": {
"name": "AIX",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar SIEM versions 7.5.x ant\u00e9rieures \u00e0 7.5.0 UP10 IF01",
"product": {
"name": "QRadar SIEM",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Cloud Pak System versions 2.3.4.0 avec Db2 versions ant\u00e9rieures \u00e0 11.5.9 Special Build",
"product": {
"name": "Cloud Pak System",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Control Center versions 6.3.1.x ant\u00e9rieures \u00e0 6.3.1.0 iFix03",
"product": {
"name": "Sterling Control Center",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "VIOS version 3.1 avec un fichier tcl.base versions ant\u00e9rieures \u00e0 8.6.10.1",
"product": {
"name": "VIOS",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Cloud Pak for Security versions ant\u00e9rieures \u00e0 1.10.27.0",
"product": {
"name": "Cloud Pak",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Cloud Transformation Advisor versions ant\u00e9rieures \u00e0 3.10.2 ",
"product": {
"name": "Cloud Transformation Advisor",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar Suite Software versions ant\u00e9rieures \u00e0 1.10.27.0",
"product": {
"name": "QRadar Suite Software",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Control Center versions 6.2.1.x ant\u00e9rieures \u00e0 6.2.1.0 iFix14",
"product": {
"name": "Sterling Control Center",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar Deployment Intelligence App versions ant\u00e9rieures \u00e0 3.0.15",
"product": {
"name": "QRadar Deployment Intelligence App",
"vendor": {
"name": "IBM",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-25659",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-25659"
},
{
"name": "CVE-2020-36242",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36242"
},
{
"name": "CVE-2022-23181",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23181"
},
{
"name": "CVE-2021-42340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42340"
},
{
"name": "CVE-2022-29885",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29885"
},
{
"name": "CVE-2022-34305",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-34305"
},
{
"name": "CVE-2017-7500",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7500"
},
{
"name": "CVE-2022-25762",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25762"
},
{
"name": "CVE-2022-42252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-42252"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2023-0286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0286"
},
{
"name": "CVE-2023-23931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23931"
},
{
"name": "CVE-2023-28708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28708"
},
{
"name": "CVE-2022-24999",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24999"
},
{
"name": "CVE-2023-28322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28322"
},
{
"name": "CVE-2023-3446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3446"
},
{
"name": "CVE-2023-2953",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2953"
},
{
"name": "CVE-2023-37920",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37920"
},
{
"name": "CVE-2023-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44487"
},
{
"name": "CVE-2023-38325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38325"
},
{
"name": "CVE-2023-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38546"
},
{
"name": "CVE-2023-4807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4807"
},
{
"name": "CVE-2023-5678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5678"
},
{
"name": "CVE-2021-43618",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43618"
},
{
"name": "CVE-2023-48795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-48795"
},
{
"name": "CVE-2023-28487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28487"
},
{
"name": "CVE-2022-23471",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23471"
},
{
"name": "CVE-2023-28486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28486"
},
{
"name": "CVE-2023-25153",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25153"
},
{
"name": "CVE-2023-7104",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7104"
},
{
"name": "CVE-2023-6129",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6129"
},
{
"name": "CVE-2023-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46218"
},
{
"name": "CVE-2024-0727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0727"
},
{
"name": "CVE-2023-39325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39325"
},
{
"name": "CVE-2023-25173",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25173"
},
{
"name": "CVE-2022-31030",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31030"
},
{
"name": "CVE-2022-23648",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23648"
},
{
"name": "CVE-2023-28746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28746"
},
{
"name": "CVE-2023-52451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52451"
},
{
"name": "CVE-2023-52584",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52584"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2023-52600",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52600"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2023-52599",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52599"
},
{
"name": "CVE-2023-42465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42465"
},
{
"name": "CVE-2023-52530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52530"
},
{
"name": "CVE-2024-26586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26586"
},
{
"name": "CVE-2023-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27043"
},
{
"name": "CVE-2023-36632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36632"
},
{
"name": "CVE-2023-49083",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-49083"
},
{
"name": "CVE-2023-2253",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2253"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-52609",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52609"
},
{
"name": "CVE-2017-7501",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7501"
},
{
"name": "CVE-2024-25710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25710"
},
{
"name": "CVE-2021-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35939"
},
{
"name": "CVE-2024-26308",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26308"
},
{
"name": "CVE-2024-0553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0553"
},
{
"name": "CVE-2021-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35938"
},
{
"name": "CVE-2023-50782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50782"
},
{
"name": "CVE-2021-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35937"
},
{
"name": "CVE-2023-6597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6597"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26667"
},
{
"name": "CVE-2023-52608",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52608"
},
{
"name": "CVE-2023-52486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52486"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2024-29133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29133"
},
{
"name": "CVE-2024-29131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29131"
},
{
"name": "CVE-2024-26707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26707"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26727"
},
{
"name": "CVE-2024-26718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26718"
},
{
"name": "CVE-2024-26702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26702"
},
{
"name": "CVE-2024-26710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26710"
},
{
"name": "CVE-2024-26810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26810"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2024-26660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26660"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2024-26640",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26640"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26686"
},
{
"name": "CVE-2017-11468",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-11468"
},
{
"name": "CVE-2023-45284",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45284"
},
{
"name": "CVE-2023-52590",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52590"
},
{
"name": "CVE-2021-46939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46939"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-26843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26843"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26820"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2024-26825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26825"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26668"
},
{
"name": "CVE-2024-26669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26669"
},
{
"name": "CVE-2023-52425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52425"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-28182",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28182"
},
{
"name": "CVE-2023-45288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45288"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2024-29025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29025"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-29857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29857"
},
{
"name": "CVE-2024-30171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30171"
},
{
"name": "CVE-2024-30172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30172"
},
{
"name": "CVE-2024-5535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5535"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35897"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35910"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2023-5752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5752"
},
{
"name": "CVE-2024-3651",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3651"
},
{
"name": "CVE-2024-2398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2398"
},
{
"name": "CVE-2024-4032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4032"
},
{
"name": "CVE-2023-52648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52648"
},
{
"name": "CVE-2023-6004",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6004"
},
{
"name": "CVE-2023-6918",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6918"
},
{
"name": "CVE-2024-0450",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0450"
},
{
"name": "CVE-2024-25062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25062"
},
{
"name": "CVE-2024-26458",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26458"
},
{
"name": "CVE-2024-26461",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26461"
},
{
"name": "CVE-2024-28834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28834"
},
{
"name": "CVE-2024-2961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2961"
},
{
"name": "CVE-2024-33599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33599"
},
{
"name": "CVE-2024-33600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33600"
},
{
"name": "CVE-2024-33601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33601"
},
{
"name": "CVE-2024-33602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33602"
},
{
"name": "CVE-2024-34064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34064"
},
{
"name": "CVE-2024-34069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34069"
},
{
"name": "CVE-2024-35195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35195"
},
{
"name": "CVE-2024-4067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4067"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2022-48747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48747"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-22365",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22365"
},
{
"name": "CVE-2024-21131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21131"
},
{
"name": "CVE-2024-21138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21138"
},
{
"name": "CVE-2024-21140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21140"
},
{
"name": "CVE-2024-21144",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21144"
},
{
"name": "CVE-2024-21145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21145"
},
{
"name": "CVE-2024-21147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21147"
},
{
"name": "CVE-2024-26662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26662"
},
{
"name": "CVE-2024-26703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26703"
},
{
"name": "CVE-2024-26818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26818"
},
{
"name": "CVE-2024-26824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26824"
},
{
"name": "CVE-2024-26831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26831"
},
{
"name": "CVE-2024-27010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27010"
},
{
"name": "CVE-2024-27011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27011"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39495",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39495"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-6923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6923"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-36979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36979"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2021-47018",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47018"
},
{
"name": "CVE-2021-47257",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47257"
},
{
"name": "CVE-2021-47304",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47304"
},
{
"name": "CVE-2021-47579",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47579"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2022-48757",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48757"
},
{
"name": "CVE-2023-52471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52471"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2024-37891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37891"
},
{
"name": "CVE-2024-6345",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6345"
},
{
"name": "CVE-2024-38808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38808"
},
{
"name": "CVE-2024-38809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38809"
},
{
"name": "CVE-2024-27267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27267"
},
{
"name": "CVE-2024-38428",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38428"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2023-4692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4692"
},
{
"name": "CVE-2023-4693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4693"
},
{
"name": "CVE-2023-7008",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7008"
},
{
"name": "CVE-2024-1048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1048"
},
{
"name": "CVE-2024-6232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6232"
},
{
"name": "CVE-2024-6119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6119"
},
{
"name": "CVE-2024-39338",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39338"
},
{
"name": "CVE-2024-39689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39689"
},
{
"name": "CVE-2024-45491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45491"
},
{
"name": "CVE-2024-45492",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45492"
},
{
"name": "CVE-2024-38816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38816"
},
{
"name": "CVE-2024-41042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41042"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2024-42259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42259"
},
{
"name": "CVE-2024-43824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43824"
},
{
"name": "CVE-2024-43833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43833"
},
{
"name": "CVE-2024-43858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43858"
},
{
"name": "CVE-2021-42694",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42694"
},
{
"name": "CVE-2023-50314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50314"
},
{
"name": "CVE-2024-34155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34155"
},
{
"name": "CVE-2024-34156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34156"
},
{
"name": "CVE-2024-34158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34158"
},
{
"name": "CVE-2024-42252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42252"
},
{
"name": "CVE-2024-43832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43832"
},
{
"name": "CVE-2024-37370",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37370"
},
{
"name": "CVE-2024-37371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37371"
},
{
"name": "CVE-2024-45296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45296"
},
{
"name": "CVE-2024-42251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42251"
},
{
"name": "CVE-2021-43980",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43980"
},
{
"name": "CVE-2023-20584",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-20584"
},
{
"name": "CVE-2023-31356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31356"
},
{
"name": "CVE-2023-36328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36328"
},
{
"name": "CVE-2023-48161",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-48161"
},
{
"name": "CVE-2023-5115",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5115"
},
{
"name": "CVE-2023-52596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52596"
},
{
"name": "CVE-2023-5764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5764"
},
{
"name": "CVE-2024-21529",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21529"
},
{
"name": "CVE-2024-21534",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21534"
},
{
"name": "CVE-2024-25620",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25620"
},
{
"name": "CVE-2024-26147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26147"
},
{
"name": "CVE-2024-26713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26713"
},
{
"name": "CVE-2024-26721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26721"
},
{
"name": "CVE-2024-26823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26823"
},
{
"name": "CVE-2024-30203",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30203"
},
{
"name": "CVE-2024-30205",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30205"
},
{
"name": "CVE-2024-31882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31882"
},
{
"name": "CVE-2024-34447",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34447"
},
{
"name": "CVE-2024-35136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35136"
},
{
"name": "CVE-2024-35152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35152"
},
{
"name": "CVE-2024-37529",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37529"
},
{
"name": "CVE-2024-38286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38286"
},
{
"name": "CVE-2024-39331",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39331"
},
{
"name": "CVE-2024-42254",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42254"
},
{
"name": "CVE-2024-42255",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42255"
},
{
"name": "CVE-2024-42256",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42256"
},
{
"name": "CVE-2024-42258",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42258"
},
{
"name": "CVE-2024-42460",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42460"
},
{
"name": "CVE-2024-43796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43796"
},
{
"name": "CVE-2024-43799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43799"
},
{
"name": "CVE-2024-43800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43800"
},
{
"name": "CVE-2024-43857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43857"
},
{
"name": "CVE-2024-45490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45490"
},
{
"name": "CVE-2024-45590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45590"
},
{
"name": "CVE-2024-45801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45801"
},
{
"name": "CVE-2024-46982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46982"
},
{
"name": "CVE-2024-47764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47764"
},
{
"name": "CVE-2024-47874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47874"
},
{
"name": "CVE-2024-47875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47875"
},
{
"name": "CVE-2024-7592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7592"
},
{
"name": "CVE-2024-8088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8088"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0958",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-11-08T00:00:00.000000"
}
],
"risks": [
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
},
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Injection de requ\u00eates ill\u00e9gitimes par rebond (CSRF)"
},
{
"description": "Injection de code indirecte \u00e0 distance (XSS)"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits IBM. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits IBM",
"vendor_advisories": [
{
"published_at": "2024-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174802",
"url": "https://www.ibm.com/support/pages/node/7174802"
},
{
"published_at": "2024-11-01",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174634",
"url": "https://www.ibm.com/support/pages/node/7174634"
},
{
"published_at": "2024-11-01",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174639",
"url": "https://www.ibm.com/support/pages/node/7174639"
},
{
"published_at": "2024-11-08",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7175196",
"url": "https://www.ibm.com/support/pages/node/7175196"
},
{
"published_at": "2024-11-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7175086",
"url": "https://www.ibm.com/support/pages/node/7175086"
},
{
"published_at": "2024-11-08",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7175192",
"url": "https://www.ibm.com/support/pages/node/7175192"
},
{
"published_at": "2024-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174799",
"url": "https://www.ibm.com/support/pages/node/7174799"
},
{
"published_at": "2024-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174797",
"url": "https://www.ibm.com/support/pages/node/7174797"
},
{
"published_at": "2024-11-06",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174945",
"url": "https://www.ibm.com/support/pages/node/7174945"
},
{
"published_at": "2024-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174912",
"url": "https://www.ibm.com/support/pages/node/7174912"
},
{
"published_at": "2024-11-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7175166",
"url": "https://www.ibm.com/support/pages/node/7175166"
}
]
}
CERTFR-2026-AVI-1165
Vulnerability from certfr_avis - Published: 2026-09-11 - Updated: 2026-09-11
De multiples vulnérabilités ont été découvertes dans les produits IBM. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| IBM | Db2 | Db2 Common Container sans le correctif de sécurité 1159cn3 | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 15.0.x antérieures à 15.0.1.14 | ||
| IBM | QRadar Hub | QRadar Hub versions antérieures à 3.9.1 | ||
| IBM | WebSphere Application Server | WebSphere Application Server Liberty versions antérieures à 26.0.0.10 (disponibilité prévue pour le quatrième trimestre 2026) | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 12.10 antérieures à InformixHQ 3.3.1 | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 14.10.x antérieures à 14.10.xC14 | ||
| IBM | Db2 | Db2 versions V11.5.x sans le correctif de sécurité DT495924, DT474170, DT495462, DT470425 et DT501356 | ||
| IBM | Sterling Partner Engagement Manager Essentials Edition | Sterling Partner Engagement Manager Essentials Edition versions 6.2.4.x antérieures à 6.2.4.5 | ||
| IBM | Db2 | Db2 Bridge versions antérieures à 1.1.5.2 | ||
| IBM | Db2 | Db2 Warehouse on Cloud Pak for Data versions antérieures à v5.4 patch 6 | ||
| IBM | Sterling Partner Engagement Manager Standard Edition | Sterling Partner Engagement Manager Standard Edition versions 6.2.4.x antérieures à 6.2.4.5 | ||
| IBM | Db2 | Db2 Developer Extension versions 1.1.x antérieures à 1.1.2 | ||
| IBM | Sterling Partner Engagement Manager Essentials Edition | Sterling Partner Engagement Manager Essentials Edition versions 6.3.0.x antérieures à 6.3.0.3 | ||
| IBM | Db2 | Db2 on Cloud Pak for Data versions antérieures à v5.4 patch 6 | ||
| IBM | Db2 | Db2 versions V12.1 sans le correctif de sécurité DT495924, DT495462 et DT474170 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Db2 Common Container sans le correctif de s\u00e9curit\u00e9 1159cn3",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 15.0.x ant\u00e9rieures \u00e0 15.0.1.14",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar Hub versions ant\u00e9rieures \u00e0 3.9.1",
"product": {
"name": "QRadar Hub",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "WebSphere Application Server Liberty versions ant\u00e9rieures \u00e0 26.0.0.10 (disponibilit\u00e9 pr\u00e9vue pour le quatri\u00e8me trimestre 2026)",
"product": {
"name": "WebSphere Application Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 12.10 ant\u00e9rieures \u00e0 InformixHQ 3.3.1",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 14.10.x ant\u00e9rieures \u00e0 14.10.xC14",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 versions V11.5.x sans le correctif de s\u00e9curit\u00e9 DT495924, DT474170, DT495462, DT470425 et DT501356",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Essentials Edition versions 6.2.4.x ant\u00e9rieures \u00e0 6.2.4.5",
"product": {
"name": "Sterling Partner Engagement Manager Essentials Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Bridge versions ant\u00e9rieures \u00e0 1.1.5.2",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Warehouse on Cloud Pak for Data versions ant\u00e9rieures \u00e0 v5.4 patch 6",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Standard Edition versions 6.2.4.x ant\u00e9rieures \u00e0 6.2.4.5",
"product": {
"name": "Sterling Partner Engagement Manager Standard Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Developer Extension versions 1.1.x ant\u00e9rieures \u00e0 1.1.2",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Essentials Edition versions 6.3.0.x ant\u00e9rieures \u00e0 6.3.0.3",
"product": {
"name": "Sterling Partner Engagement Manager Essentials Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 on Cloud Pak for Data versions ant\u00e9rieures \u00e0 v5.4 patch 6",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 versions V12.1 sans le correctif de s\u00e9curit\u00e9 DT495924, DT495462 et DT474170",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-75595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75595"
},
{
"name": "CVE-2026-49978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49978"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2023-52471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52471"
},
{
"name": "CVE-2026-5588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5588"
},
{
"name": "CVE-2021-33036",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33036"
},
{
"name": "CVE-2021-44906",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44906"
},
{
"name": "CVE-2026-54264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54264"
},
{
"name": "CVE-2024-50142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50142"
},
{
"name": "CVE-2026-59651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59651"
},
{
"name": "CVE-2026-45819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45819"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2026-50557",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50557"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2026-59295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59295"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2023-43642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-43642"
},
{
"name": "CVE-2021-21409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21409"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2018-14042",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14042"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2025-2534",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2534"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2026-41254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41254"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2024-42246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42246"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2026-16480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16480"
},
{
"name": "CVE-2018-1334",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1334"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2026-32990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-32990"
},
{
"name": "CVE-2024-26595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26595"
},
{
"name": "CVE-2026-50645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50645"
},
{
"name": "CVE-2026-22610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22610"
},
{
"name": "CVE-2024-42292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42292"
},
{
"name": "CVE-2026-42041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42041"
},
{
"name": "CVE-2014-125087",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-125087"
},
{
"name": "CVE-2026-14686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14686"
},
{
"name": "CVE-2026-68763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68763"
},
{
"name": "CVE-2023-1370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1370"
},
{
"name": "CVE-2026-45416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45416"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-33201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-33201"
},
{
"name": "CVE-2026-10050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10050"
},
{
"name": "CVE-2024-27010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27010"
},
{
"name": "CVE-2024-42284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42284"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2026-53666",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53666"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2026-59648",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59648"
},
{
"name": "CVE-2026-69153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69153"
},
{
"name": "CVE-2026-3621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3621"
},
{
"name": "CVE-2026-43515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43515"
},
{
"name": "CVE-2026-42402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42402"
},
{
"name": "CVE-2021-47304",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47304"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2026-43868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43868"
},
{
"name": "CVE-2026-50560",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50560"
},
{
"name": "CVE-2024-26586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26586"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2015-5237",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-5237"
},
{
"name": "CVE-2026-71290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-71290"
},
{
"name": "CVE-2019-10099",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-10099"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2026-41716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41716"
},
{
"name": "CVE-2018-11760",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11760"
},
{
"name": "CVE-2026-15328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15328"
},
{
"name": "CVE-2026-59645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59645"
},
{
"name": "CVE-2022-45688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45688"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-23944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23944"
},
{
"name": "CVE-2022-33891",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-33891"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2026-13006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13006"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2018-8024",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8024"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2024-27397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27397"
},
{
"name": "CVE-2024-49350",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49350"
},
{
"name": "CVE-2022-48619",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48619"
},
{
"name": "CVE-2024-46679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46679"
},
{
"name": "CVE-2025-66412",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66412"
},
{
"name": "CVE-2025-36131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36131"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2026-54514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54514"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2018-14040",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14040"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-28757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28757"
},
{
"name": "CVE-2026-77414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77414"
},
{
"name": "CVE-2020-11988",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11988"
},
{
"name": "CVE-2021-46939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46939"
},
{
"name": "CVE-2025-56200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-56200"
},
{
"name": "CVE-2024-37071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37071"
},
{
"name": "CVE-2026-77413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77413"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2026-54399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54399"
},
{
"name": "CVE-2026-53668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53668"
},
{
"name": "CVE-2024-41038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41038"
},
{
"name": "CVE-2025-30065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30065"
},
{
"name": "CVE-2026-16243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16243"
},
{
"name": "CVE-2016-4055",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-4055"
},
{
"name": "CVE-2026-9171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9171"
},
{
"name": "CVE-2026-67214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67214"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2024-25638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25638"
},
{
"name": "CVE-2026-12185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12185"
},
{
"name": "CVE-2026-59921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59921"
},
{
"name": "CVE-2024-47118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47118"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2026-47010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47010"
},
{
"name": "CVE-2023-45853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45853"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2023-45288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45288"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2026-14685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14685"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-45178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45178"
},
{
"name": "CVE-2026-54171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54171"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2022-31160",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31160"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2020-10683",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10683"
},
{
"name": "CVE-2018-1273",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1273"
},
{
"name": "CVE-2026-41239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41239"
},
{
"name": "CVE-2024-26600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26600"
},
{
"name": "CVE-2026-33814",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33814"
},
{
"name": "CVE-2023-28746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28746"
},
{
"name": "CVE-2026-47891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47891"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2024-42114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42114"
},
{
"name": "CVE-2020-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26945"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2026-68569",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68569"
},
{
"name": "CVE-2026-59084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59084"
},
{
"name": "CVE-2026-65183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65183"
},
{
"name": "CVE-2024-35897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35897"
},
{
"name": "CVE-2026-14257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14257"
},
{
"name": "CVE-2026-41901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41901"
},
{
"name": "CVE-2026-73088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73088"
},
{
"name": "CVE-2023-52478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52478"
},
{
"name": "CVE-2024-23945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23945"
},
{
"name": "CVE-2021-41182",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41182"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2022-25647",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25647"
},
{
"name": "CVE-2026-9072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9072"
},
{
"name": "CVE-2022-26612",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26612"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2026-18097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18097"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2023-52492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52492"
},
{
"name": "CVE-2022-36364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36364"
},
{
"name": "CVE-2026-73089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73089"
},
{
"name": "CVE-2023-34610",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34610"
},
{
"name": "CVE-2026-47057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47057"
},
{
"name": "CVE-2024-47561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47561"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-31881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31881"
},
{
"name": "CVE-2019-11358",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-11358"
},
{
"name": "CVE-2026-69152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69152"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2026-68525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68525"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2026-59901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59901"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-35839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35839"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2026-14525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14525"
},
{
"name": "CVE-2026-67313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67313"
},
{
"name": "CVE-2020-13955",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-13955"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2026-8858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8858"
},
{
"name": "CVE-2026-42580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42580"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2026-41691",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41691"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-43889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43889"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2026-65637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65637"
},
{
"name": "CVE-2018-8009",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8009"
},
{
"name": "CVE-2026-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50163"
},
{
"name": "CVE-2026-67315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67315"
},
{
"name": "CVE-2026-54516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54516"
},
{
"name": "CVE-2026-55223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55223"
},
{
"name": "CVE-2025-7962",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7962"
},
{
"name": "CVE-2026-18499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18499"
},
{
"name": "CVE-2019-20444",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20444"
},
{
"name": "CVE-2026-54515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54515"
},
{
"name": "CVE-2026-5516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5516"
},
{
"name": "CVE-2023-34462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34462"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2026-41721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41721"
},
{
"name": "CVE-2018-1313",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1313"
},
{
"name": "CVE-2026-16221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16221"
},
{
"name": "CVE-2023-34454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34454"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2022-46337",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-46337"
},
{
"name": "CVE-2026-6790",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6790"
},
{
"name": "CVE-2026-65911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65911"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2026-18401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18401"
},
{
"name": "CVE-2021-35516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35516"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26686"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2023-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44487"
},
{
"name": "CVE-2024-29857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29857"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-26645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26645"
},
{
"name": "CVE-2026-66143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66143"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2026-66144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66144"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2026-44494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44494"
},
{
"name": "CVE-2023-26049",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26049"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2026-42585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42585"
},
{
"name": "CVE-2024-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50192"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-45018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45018"
},
{
"name": "CVE-2026-12860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12860"
},
{
"name": "CVE-2026-10571",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10571"
},
{
"name": "CVE-2024-34447",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34447"
},
{
"name": "CVE-2026-65901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65901"
},
{
"name": "CVE-2026-11541",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11541"
},
{
"name": "CVE-2014-3578",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-3578"
},
{
"name": "CVE-2026-41635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41635"
},
{
"name": "CVE-2024-43871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43871"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2024-31880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31880"
},
{
"name": "CVE-2024-29025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29025"
},
{
"name": "CVE-2024-43880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43880"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2026-11546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11546"
},
{
"name": "CVE-2026-42036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42036"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2026-64607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64607"
},
{
"name": "CVE-2026-59652",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59652"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2023-34453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34453"
},
{
"name": "CVE-2024-26669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26669"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27043"
},
{
"name": "CVE-2024-41761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41761"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2026-65903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65903"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2026-65900",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65900"
},
{
"name": "CVE-2026-66010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66010"
},
{
"name": "CVE-2026-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52746"
},
{
"name": "CVE-2024-28762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28762"
},
{
"name": "CVE-2023-3635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3635"
},
{
"name": "CVE-2026-43827",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43827"
},
{
"name": "CVE-2026-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50184"
},
{
"name": "CVE-2026-47885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47885"
},
{
"name": "CVE-2026-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50169"
},
{
"name": "CVE-2021-47287",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47287"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2026-47065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47065"
},
{
"name": "CVE-2026-55831",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55831"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2023-5072",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5072"
},
{
"name": "CVE-2026-47841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47841"
},
{
"name": "CVE-2021-23337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-23337"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2026-41707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41707"
},
{
"name": "CVE-2021-23369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-23369"
},
{
"name": "CVE-2026-77415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77415"
},
{
"name": "CVE-2026-42403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42403"
},
{
"name": "CVE-2024-41056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41056"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2022-31777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31777"
},
{
"name": "CVE-2019-14893",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-14893"
},
{
"name": "CVE-2026-10534",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10534"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2026-59880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59880"
},
{
"name": "CVE-2026-65432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65432"
},
{
"name": "CVE-2026-59894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59894"
},
{
"name": "CVE-2019-0231",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-0231"
},
{
"name": "CVE-2023-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50298"
},
{
"name": "CVE-2026-15057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15057"
},
{
"name": "CVE-2026-41607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41607"
},
{
"name": "CVE-2024-26308",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26308"
},
{
"name": "CVE-2025-1992",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1992"
},
{
"name": "CVE-2026-44248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44248"
},
{
"name": "CVE-2018-20676",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-20676"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-31141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31141"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2025-13755",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13755"
},
{
"name": "CVE-2025-62718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62718"
},
{
"name": "CVE-2025-36136",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36136"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2026-49458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49458"
},
{
"name": "CVE-2026-4800",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-4800"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2026-42584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42584"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2026-4410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-4410"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2026-44249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44249"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2026-41284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41284"
},
{
"name": "CVE-2025-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36008"
},
{
"name": "CVE-2026-59647",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59647"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2021-35517",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35517"
},
{
"name": "CVE-2024-30172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30172"
},
{
"name": "CVE-2026-42577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42577"
},
{
"name": "CVE-2026-58059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58059"
},
{
"name": "CVE-2026-48978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48978"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2026-75596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75596"
},
{
"name": "CVE-2026-8484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8484"
},
{
"name": "CVE-2026-8763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8763"
},
{
"name": "CVE-2026-6051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6051"
},
{
"name": "CVE-2026-44598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44598"
},
{
"name": "CVE-2023-52486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52486"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2025-14917",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14917"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2026-15325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15325"
},
{
"name": "CVE-2021-47073",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47073"
},
{
"name": "CVE-2026-69247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69247"
},
{
"name": "CVE-2026-49268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49268"
},
{
"name": "CVE-2024-36124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36124"
},
{
"name": "CVE-2021-47579",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47579"
},
{
"name": "CVE-2026-33671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33671"
},
{
"name": "CVE-2026-14976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14976"
},
{
"name": "CVE-2026-5598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5598"
},
{
"name": "CVE-2025-68470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68470"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2026-65182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65182"
},
{
"name": "CVE-2018-11087",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11087"
},
{
"name": "CVE-2026-42033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42033"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2026-42035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42035"
},
{
"name": "CVE-2024-26804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26804"
},
{
"name": "CVE-2026-18446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18446"
},
{
"name": "CVE-2026-44495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44495"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2026-41695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41695"
},
{
"name": "CVE-2024-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23454"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2026-22740",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22740"
},
{
"name": "CVE-2026-47890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47890"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2022-3510",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3510"
},
{
"name": "CVE-2026-59903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59903"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2022-3509",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3509"
},
{
"name": "CVE-2026-14684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14684"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2026-56746",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56746"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2021-37137",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37137"
},
{
"name": "CVE-2026-10842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10842"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2023-51074",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51074"
},
{
"name": "CVE-2024-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53122"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2026-9496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9496"
},
{
"name": "CVE-2026-34478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34478"
},
{
"name": "CVE-2026-42586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42586"
},
{
"name": "CVE-2026-35091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-35091"
},
{
"name": "CVE-2024-57807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57807"
},
{
"name": "CVE-2025-30474",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30474"
},
{
"name": "CVE-2024-41008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41008"
},
{
"name": "CVE-2026-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40984"
},
{
"name": "CVE-2021-41973",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41973"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2024-8184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8184"
},
{
"name": "CVE-2026-54428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54428"
},
{
"name": "CVE-2026-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50162"
},
{
"name": "CVE-2026-42043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42043"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2025-11143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11143"
},
{
"name": "CVE-2026-15055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15055"
},
{
"name": "CVE-2026-8646",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8646"
},
{
"name": "CVE-2026-45822",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45822"
},
{
"name": "CVE-2025-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36006"
},
{
"name": "CVE-2026-40477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40477"
},
{
"name": "CVE-2023-35701",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-35701"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2026-47834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47834"
},
{
"name": "CVE-2026-34480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34480"
},
{
"name": "CVE-2026-14682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14682"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2018-20677",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-20677"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2026-84305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-84305"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2026-73180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73180"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2026-59869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59869"
},
{
"name": "CVE-2026-47887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47887"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2025-36186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36186"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2026-62243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-62243"
},
{
"name": "CVE-2023-22946",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22946"
},
{
"name": "CVE-2026-65904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65904"
},
{
"name": "CVE-2026-58061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58061"
},
{
"name": "CVE-2025-12758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12758"
},
{
"name": "CVE-2026-40175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40175"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2026-69151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69151"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-44935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44935"
},
{
"name": "CVE-2026-27970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27970"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2026-9320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9320"
},
{
"name": "CVE-2026-49459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49459"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2021-36090",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36090"
},
{
"name": "CVE-2021-27568",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-27568"
},
{
"name": "CVE-2026-6053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6053"
},
{
"name": "CVE-2024-41039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41039"
},
{
"name": "CVE-2024-23953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23953"
},
{
"name": "CVE-2026-54265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54265"
},
{
"name": "CVE-2025-68161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68161"
},
{
"name": "CVE-2023-52451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52451"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2021-38296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-38296"
},
{
"name": "CVE-2025-21785",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21785"
},
{
"name": "CVE-2022-24823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24823"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-26649",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26649"
},
{
"name": "CVE-2026-56624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56624"
},
{
"name": "CVE-2023-34455",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34455"
},
{
"name": "CVE-2021-41184",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41184"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-29131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29131"
},
{
"name": "CVE-2021-41183",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41183"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-29869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29869"
},
{
"name": "CVE-2026-41240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41240"
},
{
"name": "CVE-2026-67317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67317"
},
{
"name": "CVE-2026-40478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40478"
},
{
"name": "CVE-2026-22748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22748"
},
{
"name": "CVE-2025-33012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-33012"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2026-34479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34479"
},
{
"name": "CVE-2024-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52804"
},
{
"name": "CVE-2026-43828",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43828"
},
{
"name": "CVE-2026-42040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42040"
},
{
"name": "CVE-2023-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36478"
},
{
"name": "CVE-2021-37136",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37136"
},
{
"name": "CVE-2018-1330",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1330"
},
{
"name": "CVE-2026-47027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47027"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2026-47058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47058"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2026-16441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16441"
},
{
"name": "CVE-2024-6763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6763"
},
{
"name": "CVE-2026-6052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6052"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53088"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2026-14981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14981"
},
{
"name": "CVE-2026-58060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58060"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2021-21295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21295"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2026-42778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42778"
},
{
"name": "CVE-2026-14683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14683"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2026-14529",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14529"
},
{
"name": "CVE-2019-0204",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-0204"
},
{
"name": "CVE-2024-26851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26851"
},
{
"name": "CVE-2022-2047",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2047"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2018-11793",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11793"
},
{
"name": "CVE-2026-22741",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22741"
},
{
"name": "CVE-2023-39410",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39410"
},
{
"name": "CVE-2024-35888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35888"
},
{
"name": "CVE-2024-25710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25710"
},
{
"name": "CVE-2026-12802",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12802"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2024-7254",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7254"
},
{
"name": "CVE-2024-46695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46695"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2020-9492",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-9492"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2026-40181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40181"
},
{
"name": "CVE-2023-52700",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52700"
},
{
"name": "CVE-2025-14923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14923"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2026-10649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10649"
},
{
"name": "CVE-2026-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50020"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-29133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29133"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2026-54512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54512"
},
{
"name": "CVE-2026-58063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58063"
},
{
"name": "CVE-2026-57819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-57819"
},
{
"name": "CVE-2026-42578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42578"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2024-35910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35910"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2022-48757",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48757"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2026-65899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65899"
},
{
"name": "CVE-2026-43514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43514"
},
{
"name": "CVE-2026-45773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45773"
},
{
"name": "CVE-2026-67319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67319"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2026-10532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10532"
},
{
"name": "CVE-2023-52470",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52470"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2022-24785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24785"
},
{
"name": "CVE-2025-2518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2518"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46120"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-57979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57979"
},
{
"name": "CVE-2024-52046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52046"
},
{
"name": "CVE-2021-43797",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43797"
},
{
"name": "CVE-2026-70907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-70907"
},
{
"name": "CVE-2026-48589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48589"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2021-37404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37404"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2026-42404",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42404"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2022-45787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45787"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2018-1199",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1199"
},
{
"name": "CVE-2024-14041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-14041"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2022-48754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48754"
},
{
"name": "CVE-2026-41586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41586"
},
{
"name": "CVE-2026-16192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16192"
},
{
"name": "CVE-2024-5569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5569"
},
{
"name": "CVE-2026-2950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2950"
},
{
"name": "CVE-2016-6811",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-6811"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2026-68945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68945"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2023-44981",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44981"
},
{
"name": "CVE-2026-40895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40895"
},
{
"name": "CVE-2026-47063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47063"
},
{
"name": "CVE-2025-1493",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1493"
},
{
"name": "CVE-2026-12816",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12816"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-43830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43830"
},
{
"name": "CVE-2026-59083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59083"
},
{
"name": "CVE-2025-27553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27553"
},
{
"name": "CVE-2024-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47535"
},
{
"name": "CVE-2026-45772",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45772"
},
{
"name": "CVE-2023-52428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52428"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2026-41606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41606"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2026-59888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59888"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2026-10543",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10543"
},
{
"name": "CVE-2023-6040",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6040"
},
{
"name": "CVE-2026-13149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13149"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2026-47021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47021"
},
{
"name": "CVE-2024-41042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41042"
},
{
"name": "CVE-2024-6485",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6485"
},
{
"name": "CVE-2026-47842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47842"
},
{
"name": "CVE-2025-3050",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-3050"
},
{
"name": "CVE-2023-40167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40167"
},
{
"name": "CVE-2018-1274",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1274"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2026-59898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59898"
},
{
"name": "CVE-2026-16440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16440"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2026-64958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64958"
},
{
"name": "CVE-2024-9823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9823"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2026-66422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66422"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2021-22569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22569"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-41762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41762"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2023-6378",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6378"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2026-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41006"
},
{
"name": "CVE-2026-41711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41711"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2026-45205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45205"
},
{
"name": "CVE-2026-27830",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27830"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47018",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47018"
},
{
"name": "CVE-2026-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44487"
},
{
"name": "CVE-2026-13506",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13506"
},
{
"name": "CVE-2024-26640",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26640"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2026-2482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2482"
},
{
"name": "CVE-2026-11897",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11897"
},
{
"name": "CVE-2026-35092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-35092"
},
{
"name": "CVE-2026-42038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42038"
},
{
"name": "CVE-2026-49844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49844"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2021-46972",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46972"
},
{
"name": "CVE-2026-18096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18096"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2022-34169",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-34169"
},
{
"name": "CVE-2026-2332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2332"
},
{
"name": "CVE-2026-1561",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1561"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2026-42039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42039"
},
{
"name": "CVE-2026-59879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59879"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2026-46968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46968"
},
{
"name": "CVE-2026-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40972"
},
{
"name": "CVE-2024-43892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43892"
},
{
"name": "CVE-2026-50010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50010"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2023-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36479"
},
{
"name": "CVE-2024-50256",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50256"
},
{
"name": "CVE-2026-59296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59296"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2026-33672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33672"
},
{
"name": "CVE-2026-75838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75838"
},
{
"name": "CVE-2018-14041",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14041"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2026-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40983"
},
{
"name": "CVE-2024-24549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24549"
},
{
"name": "CVE-2026-42581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42581"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2025-0915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0915"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2023-29267",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29267"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2026-42779",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42779"
},
{
"name": "CVE-2021-47097",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47097"
},
{
"name": "CVE-2024-42322",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42322"
},
{
"name": "CVE-2026-43513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43513"
},
{
"name": "CVE-2023-28370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28370"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2026-54517",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54517"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26843"
},
{
"name": "CVE-2022-48747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48747"
},
{
"name": "CVE-2026-25639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25639"
},
{
"name": "CVE-2026-40973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40973"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2020-11022",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11022"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2026-15064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15064"
},
{
"name": "CVE-2026-42044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42044"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2021-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-31684"
},
{
"name": "CVE-2025-25193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25193"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2026-8620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8620"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2026-65905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65905"
},
{
"name": "CVE-2026-16439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16439"
},
{
"name": "CVE-2025-14915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14915"
},
{
"name": "CVE-2026-56745",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56745"
},
{
"name": "CVE-2018-16487",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-16487"
},
{
"name": "CVE-2026-8633",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8633"
},
{
"name": "CVE-2022-31159",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31159"
},
{
"name": "CVE-2026-11714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11714"
},
{
"name": "CVE-2016-10735",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-10735"
},
{
"name": "CVE-2024-52903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52903"
},
{
"name": "CVE-2026-47838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47838"
},
{
"name": "CVE-2021-42550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42550"
},
{
"name": "CVE-2017-18214",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-18214"
},
{
"name": "CVE-2025-22870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22870"
},
{
"name": "CVE-2026-59642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59642"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2024-40679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40679"
},
{
"name": "CVE-2026-42034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42034"
},
{
"name": "CVE-2026-47884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47884"
},
{
"name": "CVE-2026-41417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41417"
},
{
"name": "CVE-2026-61308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-61308"
},
{
"name": "CVE-2025-23215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23215"
},
{
"name": "CVE-2026-48043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48043"
},
{
"name": "CVE-2026-9322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9322"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2026-87958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-87958"
},
{
"name": "CVE-2026-22745",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22745"
},
{
"name": "CVE-2024-30171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30171"
},
{
"name": "CVE-2026-42587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42587"
},
{
"name": "CVE-2026-54513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54513"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2025-14914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14914"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2023-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52922"
},
{
"name": "CVE-2026-65927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65927"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2026-9563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9563"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2026-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54518"
},
{
"name": "CVE-2020-9480",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-9480"
},
{
"name": "CVE-2024-36114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36114"
},
{
"name": "CVE-2026-47244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47244"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2026-13676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13676"
},
{
"name": "CVE-2024-26759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26759"
},
{
"name": "CVE-2026-54297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54297"
},
{
"name": "CVE-2026-53434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53434"
},
{
"name": "CVE-2011-4969",
"url": "https://www.cve.org/CVERecord?id=CVE-2011-4969"
},
{
"name": "CVE-2026-60589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-60589"
},
{
"name": "CVE-2026-67312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67312"
},
{
"name": "CVE-2026-6938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6938"
},
{
"name": "CVE-2025-8916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8916"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2026-66142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66142"
},
{
"name": "CVE-2025-8885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8885"
},
{
"name": "CVE-2023-52464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52464"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2026-10051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10051"
},
{
"name": "CVE-2026-53669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53669"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2026-41409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41409"
},
{
"name": "CVE-2018-1259",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1259"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2026-6322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6322"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2026-8400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8400"
},
{
"name": "CVE-2026-45623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45623"
},
{
"name": "CVE-2026-14980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14980"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2023-24998",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24998"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2026-58062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58062"
},
{
"name": "CVE-2024-41023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41023"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2026-12143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12143"
},
{
"name": "CVE-2026-67318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67318"
},
{
"name": "CVE-2026-59893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59893"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-26660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26660"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2021-21290",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21290"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2023-52560",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52560"
},
{
"name": "CVE-2026-50151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50151"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-41065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41065"
},
{
"name": "CVE-2026-44486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44486"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2026-42264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42264"
},
{
"name": "CVE-2026-12803",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12803"
},
{
"name": "CVE-2021-47069",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47069"
},
{
"name": "CVE-2026-8384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8384"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2023-2976",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2976"
},
{
"name": "CVE-2026-59650",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59650"
},
{
"name": "CVE-2025-1000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1000"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2026-44496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44496"
},
{
"name": "CVE-2018-8023",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8023"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2026-44492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44492"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2026-54225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54225"
},
{
"name": "CVE-2026-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-39865"
},
{
"name": "CVE-2026-41238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41238"
},
{
"name": "CVE-2026-47877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47877"
},
{
"name": "CVE-2023-52522",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52522"
},
{
"name": "CVE-2026-43512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43512"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2020-26555",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26555"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2024-26717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26717"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2021-22570",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22570"
},
{
"name": "CVE-2026-47883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47883"
},
{
"name": "CVE-2021-35515",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35515"
},
{
"name": "CVE-2024-44990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44990"
},
{
"name": "CVE-2026-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41007"
},
{
"name": "CVE-2026-42037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42037"
},
{
"name": "CVE-2022-40898",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40898"
},
{
"name": "CVE-2024-42265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42265"
},
{
"name": "CVE-2021-46984",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46984"
},
{
"name": "CVE-2026-55760",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55760"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-26048",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26048"
},
{
"name": "CVE-2026-42498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42498"
},
{
"name": "CVE-2026-42042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42042"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2026-9071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9071"
},
{
"name": "CVE-2017-7669",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7669"
},
{
"name": "CVE-2026-67213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67213"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2026-55833",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55833"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2024-45663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45663"
},
{
"name": "CVE-2026-13586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13586"
},
{
"name": "CVE-2025-33134",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-33134"
},
{
"name": "CVE-2021-47101",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47101"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2023-26112",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26112"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2026-9370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9370"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2023-52626",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52626"
},
{
"name": "CVE-2024-36979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36979"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2026-11806",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11806"
},
{
"name": "CVE-2023-52476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52476"
},
{
"name": "CVE-2024-42301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42301"
},
{
"name": "CVE-2026-12590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12590"
},
{
"name": "CVE-2026-34477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34477"
},
{
"name": "CVE-2026-65902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65902"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2026-56819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56819"
},
{
"name": "CVE-2026-54284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54284"
},
{
"name": "CVE-2026-6321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6321"
},
{
"name": "CVE-2022-3171",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3171"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2026-44490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44490"
},
{
"name": "CVE-2016-7103",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-7103"
},
{
"name": "CVE-2015-9251",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-9251"
},
{
"name": "CVE-2026-59639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59639"
},
{
"name": "CVE-2026-86093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-86093"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2026-10852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10852"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2026-28338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28338"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2010-5312",
"url": "https://www.cve.org/CVERecord?id=CVE-2010-5312"
},
{
"name": "CVE-2026-68494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68494"
},
{
"name": "CVE-2024-26810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26810"
},
{
"name": "CVE-2023-52530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52530"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2012-6708",
"url": "https://www.cve.org/CVERecord?id=CVE-2012-6708"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2020-7656",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-7656"
},
{
"name": "CVE-2018-8013",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8013"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2026-29063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-29063"
},
{
"name": "CVE-2026-60147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-60147"
},
{
"name": "CVE-2026-47889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47889"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2019-16869",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-16869"
},
{
"name": "CVE-2023-52648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52648"
},
{
"name": "CVE-2026-15280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15280"
},
{
"name": "CVE-2026-67316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67316"
},
{
"name": "CVE-2025-14813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14813"
},
{
"name": "CVE-2022-41881",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-41881"
},
{
"name": "CVE-2025-13465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13465"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2026-44488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44488"
},
{
"name": "CVE-2024-42237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42237"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2026-59899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59899"
},
{
"name": "CVE-2026-1718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1718"
},
{
"name": "CVE-2026-71491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-71491"
},
{
"name": "CVE-2026-34481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34481"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-27011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27011"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2021-47257",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47257"
},
{
"name": "CVE-2026-38969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-38969"
},
{
"name": "CVE-2026-19880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-19880"
},
{
"name": "CVE-2024-46858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46858"
},
{
"name": "CVE-2026-47059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47059"
},
{
"name": "CVE-2022-25168",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25168"
},
{
"name": "CVE-2026-41293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41293"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-44989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44989"
},
{
"name": "CVE-2024-6345",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6345"
},
{
"name": "CVE-2026-77310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77310"
},
{
"name": "CVE-2024-57699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57699"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2026-65898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65898"
},
{
"name": "CVE-2020-11023",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11023"
},
{
"name": "CVE-2023-5090",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5090"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2021-46909",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46909"
},
{
"name": "CVE-2019-8331",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-8331"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2018-1000632",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1000632"
},
{
"name": "CVE-2019-20445",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20445"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2026-59889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59889"
},
{
"name": "CVE-2025-36185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36185"
},
{
"name": "CVE-2025-11226",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11226"
}
],
"initial_release_date": "2026-09-11T00:00:00",
"last_revision_date": "2026-09-11T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-1165",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-09-11T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Injection de code indirecte \u00e0 distance (XSS)"
},
{
"description": "Injection de requ\u00eates ill\u00e9gitimes par rebond (CSRF)"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Falsification de requ\u00eates c\u00f4t\u00e9 serveur (SSRF)"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits IBM. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits IBM",
"vendor_advisories": [
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286777",
"url": "https://www.ibm.com/support/pages/node/7286777"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286776",
"url": "https://www.ibm.com/support/pages/node/7286776"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286990",
"url": "https://www.ibm.com/support/pages/node/7286990"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286976",
"url": "https://www.ibm.com/support/pages/node/7286976"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286993",
"url": "https://www.ibm.com/support/pages/node/7286993"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286782",
"url": "https://www.ibm.com/support/pages/node/7286782"
},
{
"published_at": "2026-09-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286515",
"url": "https://www.ibm.com/support/pages/node/7286515"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286646",
"url": "https://www.ibm.com/support/pages/node/7286646"
},
{
"published_at": "2026-09-11",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7287136",
"url": "https://www.ibm.com/support/pages/node/7287136"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286986",
"url": "https://www.ibm.com/support/pages/node/7286986"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286982",
"url": "https://www.ibm.com/support/pages/node/7286982"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286775",
"url": "https://www.ibm.com/support/pages/node/7286775"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286987",
"url": "https://www.ibm.com/support/pages/node/7286987"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286910",
"url": "https://www.ibm.com/support/pages/node/7286910"
},
{
"published_at": "2026-09-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286516",
"url": "https://www.ibm.com/support/pages/node/7286516"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286909",
"url": "https://www.ibm.com/support/pages/node/7286909"
}
]
}
FKIE_CVE-2024-36950
Vulnerability from fkie_nvd - Published: 2024-05-30 16:15 - Updated: 2026-06-17 07:374.4 (Medium) - CVSS:3.1/
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | 6.9 | |
| linux | linux_kernel | 6.9 | |
| debian | debian_linux | 10.0 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/firewire/ohci.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "b3948c69d60279fce5b2eeda92a07d66296c8130",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "31279bbca40d2f40cb3bbb6d538ec9620a645dec",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "fa273f312334246c909475c5868e6daab889cc8c",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "4f9cc355c328fc4f41cbd9c4cd58b235184fa420",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "6fafe3661712b143d9c69a7322294bd53f559d5d",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "5982887de60c1b84f9c0ca07c835814d07fd1da0",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "8643332aac0576581cfdf01798ea3e4e0d624b61",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
},
{
"lessThan": "752e3c53de0fa3b7d817a83050b6699b8e9c6ec9",
"status": "affected",
"version": "a007bb857e0b26f5d8b73c2ff90782d9c0972620",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/firewire/ohci.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.26"
},
{
"lessThan": "2.6.26",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.314",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.276",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.217",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.159",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.91",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.31",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.10",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.9",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "1350A539-B5DC-4612-9B61-E5516FD777D5",
"versionEndExcluding": "4.19.314",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "126C6EEC-8874-4233-AE09-634924FCDDF4",
"versionEndExcluding": "5.4.276",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "AC67C71C-2044-40BA-B590-61E562F69F89",
"versionEndExcluding": "5.10.217",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F16678CD-F7C6-4BF6-ABA8-E7600857197B",
"versionEndExcluding": "5.15.159",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "4F8C886C-75AA-469B-A6A9-12BF1A29C0D5",
"versionEndExcluding": "6.1.91",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "CDDB1F69-36AC-41C1-9192-E7CCEF5FFC00",
"versionEndExcluding": "6.6.31",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "6A6B920C-8D8F-4130-86B4-AD334F4CF2E3",
"versionEndExcluding": "6.8.10",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.9:rc1:*:*:*:*:*:*",
"matchCriteriaId": "22BEDD49-2C6D-402D-9DBF-6646F6ECD10B",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.9:rc2:*:*:*:*:*:*",
"matchCriteriaId": "DF73CB2A-DFFD-46FB-9BFE-AA394F27EA37",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
},
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:debian:debian_linux:10.0:*:*:*:*:*:*:*",
"matchCriteriaId": "07B237A9-69A3-4A9C-9DA0-4E06BD37AE73",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nfirewire: ohci: mask bus reset interrupts between ISR and bottom half\n\nIn the FireWire OHCI interrupt handler, if a bus reset interrupt has\noccurred, mask bus reset interrupts until bus_reset_work has serviced and\ncleared the interrupt.\n\nNormally, we always leave bus reset interrupts masked. We infer the bus\nreset from the self-ID interrupt that happens shortly thereafter. A\nscenario where we unmask bus reset interrupts was introduced in 2008 in\na007bb857e0b26f5d8b73c2ff90782d9c0972620: If\nOHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we\nwill unmask bus reset interrupts so we can log them.\n\nirq_handler logs the bus reset interrupt. However, we can\u0027t clear the bus\nreset event flag in irq_handler, because we won\u0027t service the event until\nlater. irq_handler exits with the event flag still set. If the\ncorresponding interrupt is still unmasked, the first bus reset will\nusually freeze the system due to irq_handler being called again each\ntime it exits. This freeze can be reproduced by loading firewire_ohci\nwith \"modprobe firewire_ohci debug=-1\" (to enable all debugging output).\nApparently there are also some cases where bus_reset_work will get called\nsoon enough to clear the event, and operation will continue normally.\n\nThis freeze was first reported a few months after a007bb85 was committed,\nbut until now it was never fixed. The debug level could safely be set\nto -1 through sysfs after the module was loaded, but this would be\nineffectual in logging bus reset interrupts since they were only\nunmasked during initialization.\n\nirq_handler will now leave the event flag set but mask bus reset\ninterrupts, so irq_handler won\u0027t be called again and there will be no\nfreeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will\nunmask the interrupt after servicing the event, so future interrupts\nwill be caught as desired.\n\nAs a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be\nenabled through sysfs in addition to during initial module loading.\nHowever, when enabled through sysfs, logging of bus reset interrupts will\nbe effective only starting with the second bus reset, after\nbus_reset_work has executed."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: firewire: ohci: enmascara las interrupciones de reinicio del bus entre ISR y la mitad inferior. En el controlador de interrupciones FireWire OHCI, si se ha producido una interrupci\u00f3n de reinicio del bus, enmascara las interrupciones de reinicio del bus hasta que bus_reset_work haya sido reparado y borrado la interrupci\u00f3n. Normalmente, siempre dejamos enmascaradas las interrupciones de reinicio del bus. Inferimos el reinicio del bus a partir de la interrupci\u00f3n de la autoidentificaci\u00f3n que ocurre poco despu\u00e9s. En 2008 se introdujo un escenario en el que desenmascaramos las interrupciones de reinicio del bus en a007bb857e0b26f5d8b73c2ff90782d9c0972620: Si OHCI_PARAM_DEBUG_BUSRESETS (8) est\u00e1 configurado en la m\u00e1scara de bits del par\u00e1metro de depuraci\u00f3n, desenmascararemos las interrupciones de reinicio del bus para poder registrarlas. irq_handler registra la interrupci\u00f3n de reinicio del bus. Sin embargo, no podemos borrar el indicador de evento de reinicio del bus en irq_handler porque no atenderemos el evento hasta m\u00e1s tarde. irq_handler sale con el indicador de evento a\u00fan configurado. Si la interrupci\u00f3n correspondiente a\u00fan est\u00e1 desenmascarada, el primer reinicio del bus generalmente congelar\u00e1 el sistema debido a que se vuelve a llamar a irq_handler cada vez que sale. Esta congelaci\u00f3n se puede reproducir cargando firewire_ohci con \"modprobe firewire_ohci debug=-1\" (para habilitar todos los resultados de depuraci\u00f3n). Aparentemente, tambi\u00e9n hay algunos casos en los que se llamar\u00e1 a bus_reset_work lo suficientemente pronto como para borrar el evento y la operaci\u00f3n continuar\u00e1 normalmente. Esta congelaci\u00f3n se inform\u00f3 por primera vez unos meses despu\u00e9s del commit a007bb85, pero hasta ahora nunca se hab\u00eda solucionado. El nivel de depuraci\u00f3n podr\u00eda establecerse de forma segura en -1 a trav\u00e9s de sysfs despu\u00e9s de cargar el m\u00f3dulo, pero esto ser\u00eda ineficaz para registrar las interrupciones de reinicio del bus ya que s\u00f3lo se desenmascararon durante la inicializaci\u00f3n. irq_handler ahora dejar\u00e1 establecido el indicador de evento pero enmascarar\u00e1 las interrupciones de reinicio del bus, por lo que no se volver\u00e1 a llamar a irq_handler y no se congelar\u00e1. Si OHCI_PARAM_DEBUG_BUSRESETS est\u00e1 habilitado, bus_reset_work desenmascarar\u00e1 la interrupci\u00f3n despu\u00e9s de atender el evento, por lo que las interrupciones futuras se detectar\u00e1n seg\u00fan se desee. Como efecto secundario de este cambio, OHCI_PARAM_DEBUG_BUSRESETS ahora se puede habilitar a trav\u00e9s de sysfs adem\u00e1s de durante la carga inicial del m\u00f3dulo. Sin embargo, cuando se habilita a trav\u00e9s de sysfs, el registro de interrupciones de reinicio del bus ser\u00e1 efectivo solo a partir del segundo reinicio del bus, despu\u00e9s de que se haya ejecutado bus_reset_work."
}
],
"id": "CVE-2024-36950",
"lastModified": "2026-06-17T07:37:25.973",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 4.4,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:H/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 0.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 4.4,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:H/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 0.8,
"impactScore": 3.6,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-36950",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-04T15:34:28.122404Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-05-30T16:15:18.000",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/31279bbca40d2f40cb3bbb6d538ec9620a645dec"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4f9cc355c328fc4f41cbd9c4cd58b235184fa420"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5982887de60c1b84f9c0ca07c835814d07fd1da0"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/6fafe3661712b143d9c69a7322294bd53f559d5d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/752e3c53de0fa3b7d817a83050b6699b8e9c6ec9"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8643332aac0576581cfdf01798ea3e4e0d624b61"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b3948c69d60279fce5b2eeda92a07d66296c8130"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/fa273f312334246c909475c5868e6daab889cc8c"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/31279bbca40d2f40cb3bbb6d538ec9620a645dec"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4f9cc355c328fc4f41cbd9c4cd58b235184fa420"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5982887de60c1b84f9c0ca07c835814d07fd1da0"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/6fafe3661712b143d9c69a7322294bd53f559d5d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/752e3c53de0fa3b7d817a83050b6699b8e9c6ec9"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8643332aac0576581cfdf01798ea3e4e0d624b61"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b3948c69d60279fce5b2eeda92a07d66296c8130"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/fa273f312334246c909475c5868e6daab889cc8c"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Third Party Advisory"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00019.html"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Third Party Advisory"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00020.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-noinfo"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
OESA-2024-1765 (CVE-2021-47469)
Vulnerability from osv_openeuler – Published: 2024-06-28 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
spi: Fix deadlock when adding SPI controllers on SPI buses
Currently we have a global spi_add_lock which we take when adding new devices so that we can check that we're not trying to reuse a chip select that's already controlled. This means that if the SPI device is itself a SPI controller and triggers the instantiation of further SPI devices we trigger a deadlock as we try to register and instantiate those devices while in the process of doing so for the parent controller and hence already holding the global spi_add_lock. Since we only care about concurrency within a single SPI bus move the lock to be per controller, avoiding the deadlock.
This can be easily triggered in the case of spi-mux.(CVE-2021-47469)
(CVE-2023-39180)
In the Linux kernel, the following vulnerability has been resolved:
hid: cp2112: Fix duplicate workqueue initialization
Previously the cp2112 driver called INIT_DELAYED_WORK within cp2112_gpio_irq_startup, resulting in duplicate initilizations of the workqueue on subsequent IRQ startups following an initial request. This resulted in a warning in set_work_data in workqueue.c, as well as a rare NULL dereference within process_one_work in workqueue.c.
Initialize the workqueue within _probe instead.(CVE-2023-52853)
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: fix UAF issue in ksmbd_tcp_new_connection()
The race is between the handling of a new TCP connection and
its disconnection. It leads to UAF on struct tcp_transport in
ksmbd_tcp_new_connection() function.(CVE-2024-26592)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_tables: release mutex after nft_gc_seq_end from abort path
The commit mutex should not be released during the critical section between nft_gc_seq_begin() and nft_gc_seq_end(), otherwise, async GC worker could collect expired objects and get the released commit lock within the same GC sequence.
nf_tables_module_autoload() temporarily releases the mutex to load module dependencies, then it goes back to replay the transaction again. Move it at the end of the abort phase after nft_gc_seq_end() is called.(CVE-2024-26925)
In the Linux kernel, the following vulnerability has been resolved:
wifi: wilc1000: fix RCU usage in connect path
With lockdep enabled, calls to the connect function from cfg802.11 layer lead to the following warning:
============================= WARNING: suspicious RCU usage 6.7.0-rc1-wt+ #333 Not tainted
drivers/net/wireless/microchip/wilc1000/hif.c:386 suspicious rcu_dereference_check() usage! [...] stack backtrace: CPU: 0 PID: 100 Comm: wpa_supplicant Not tainted 6.7.0-rc1-wt+ #333 Hardware name: Atmel SAMA5 unwind_backtrace from show_stack+0x18/0x1c show_stack from dump_stack_lvl+0x34/0x48 dump_stack_lvl from wilc_parse_join_bss_param+0x7dc/0x7f4 wilc_parse_join_bss_param from connect+0x2c4/0x648 connect from cfg80211_connect+0x30c/0xb74 cfg80211_connect from nl80211_connect+0x860/0xa94 nl80211_connect from genl_rcv_msg+0x3fc/0x59c genl_rcv_msg from netlink_rcv_skb+0xd0/0x1f8 netlink_rcv_skb from genl_rcv+0x2c/0x3c genl_rcv from netlink_unicast+0x3b0/0x550 netlink_unicast from netlink_sendmsg+0x368/0x688 netlink_sendmsg from _syssendmsg+0x190/0x430 __sys_sendmsg from syssendmsg+0x110/0x158 _sys_sendmsg from sys_sendmsg+0xe8/0x150 sys_sendmsg from ret_fast_syscall+0x0/0x1c
This warning is emitted because in the connect path, when trying to parse target BSS parameters, we dereference a RCU pointer whithout being in RCU critical section. Fix RCU dereference usage by moving it to a RCU read critical section. To avoid wrapping the whole wilc_parse_join_bss_param under the critical section, just use the critical section to copy ies data(CVE-2024-27053)
In the Linux kernel, the following vulnerability has been resolved:
media: tc358743: register v4l2 async device only after successful setup
Ensure the device has been setup correctly before registering the v4l2 async device, thus allowing userspace to access.(CVE-2024-35830)
In the Linux kernel, the following vulnerability has been resolved:
net/rds: fix possible cp null dereference
cp might be null, calling cp->cp_conn would produce null dereference
[Simon Horman adds:]
Analysis:
-
cp is a parameter of __rds_rdma_map and is not reassigned.
-
The following call-sites pass a NULL cp argument to __rds_rdma_map()
-
rds_get_mr()
-
rds_get_mr_for_dest
-
Prior to the code above, the following assumes that cp may be NULL (which is indicative, but could itself be unnecessary)
trans_private = rs->rs_transport->get_mr( sg, nents, rs, &mr->r_key, cp ? cp->cp_conn : NULL, args->vec.addr, args->vec.bytes, need_odp ? ODP_ZEROBASED : ODP_NOT_NEEDED);
-
The code modified by this patch is guarded by IS_ERR(trans_private), where trans_private is assigned as per the previous point in this analysis.
The only implementation of get_mr that I could locate is rds_ib_get_mr() which can return an ERR_PTR if the conn (4th) argument is NULL.
- ret is set to PTR_ERR(trans_private). rds_ib_get_mr can return ERR_PTR(-ENODEV) if the conn (4th) argument is NULL. Thus ret may be -ENODEV in which case the code in question will execute.
Conclusion: * cp may be NULL at the point where this patch adds a check; this patch does seem to address a possible bug(CVE-2024-35902)
In the Linux kernel, the following vulnerability has been resolved:
kprobes: Fix possible use-after-free issue on kprobe registration
When unloading a module, its state is changing MODULE_STATE_LIVE ->
MODULE_STATE_GOING -> MODULE_STATE_UNFORMED. Each change will take
a time. is_module_text_address() and __module_text_address()
works with MODULE_STATE_LIVE and MODULE_STATE_GOING.
If we use is_module_text_address() and __module_text_address()
separately, there is a chance that the first one is succeeded but the
next one is failed because module->state becomes MODULE_STATE_UNFORMED
between those operations.
In check_kprobe_address_safe(), if the second __module_text_address()
is failed, that is ignored because it expected a kernel_text address.
But it may have failed simply because module->state has been changed
to MODULE_STATE_UNFORMED. In this case, arm_kprobe() will try to modify
non-exist module text address (use-after-free).
To fix this problem, we should not use separated is_module_text_address()
and __module_text_address(), but use only __module_text_address()
once and do try_module_get(module) which is only available with
MODULE_STATE_LIVE.(CVE-2024-35955)
In the Linux kernel, the following vulnerability has been resolved:
firewire: ohci: mask bus reset interrupts between ISR and bottom half
In the FireWire OHCI interrupt handler, if a bus reset interrupt has occurred, mask bus reset interrupts until bus_reset_work has serviced and cleared the interrupt.
Normally, we always leave bus reset interrupts masked. We infer the bus reset from the self-ID interrupt that happens shortly thereafter. A scenario where we unmask bus reset interrupts was introduced in 2008 in a007bb857e0b26f5d8b73c2ff90782d9c0972620: If OHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we will unmask bus reset interrupts so we can log them.
irq_handler logs the bus reset interrupt. However, we can't clear the bus reset event flag in irq_handler, because we won't service the event until later. irq_handler exits with the event flag still set. If the corresponding interrupt is still unmasked, the first bus reset will usually freeze the system due to irq_handler being called again each time it exits. This freeze can be reproduced by loading firewire_ohci with "modprobe firewire_ohci debug=-1" (to enable all debugging output). Apparently there are also some cases where bus_reset_work will get called soon enough to clear the event, and operation will continue normally.
This freeze was first reported a few months after a007bb85 was committed, but until now it was never fixed. The debug level could safely be set to -1 through sysfs after the module was loaded, but this would be ineffectual in logging bus reset interrupts since they were only unmasked during initialization.
irq_handler will now leave the event flag set but mask bus reset interrupts, so irq_handler won't be called again and there will be no freeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will unmask the interrupt after servicing the event, so future interrupts will be caught as desired.
As a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be enabled through sysfs in addition to during initial module loading. However, when enabled through sysfs, logging of bus reset interrupts will be effective only starting with the second bus reset, after bus_reset_work has executed.(CVE-2024-36950)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix division by zero in setup_dsc_config
When slice_height is 0, the division by slice_height in the calculation of the number of slices will cause a division by zero driver crash. This leaves the kernel in a state that requires a reboot. This patch adds a check to avoid the division by zero.
The stack trace below is for the 6.8.4 Kernel. I reproduced the issue on a Z16 Gen 2 Lenovo Thinkpad with a Apple Studio Display monitor connected via Thunderbolt. The amdgpu driver crashed with this exception when I rebooted the system with the monitor connected.
kernel: ? die (arch/x86/kernel/dumpstack.c:421 arch/x86/kernel/dumpstack.c:434 arch/x86/kernel/dumpstack.c:447) kernel: ? do_trap (arch/x86/kernel/traps.c:113 arch/x86/kernel/traps.c:154) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: ? do_error_trap (./arch/x86/include/asm/traps.h:58 arch/x86/kernel/traps.c:175) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: ? exc_divide_error (arch/x86/kernel/traps.c:194 (discriminator 2)) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: ? asm_exc_divide_error (./arch/x86/include/asm/idtentry.h:548) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: dc_dsc_compute_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1109) amdgpu
After applying this patch, the driver no longer crashes when the monitor is connected and the system is rebooted. I believe this is the same issue reported for 3113.(CVE-2024-36969)
In the Linux kernel, the following vulnerability has been resolved:
net: sched: sch_multiq: fix possible OOB write in multiq_tune()
q->bands will be assigned to qopt->bands to execute subsequent code logic after kmalloc. So the old q->bands should not be used in kmalloc. Otherwise, an out-of-bounds write will occur.(CVE-2024-36978)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/hns: Fix UAF for cq async event
The refcount of CQ is not protected by locks. When CQ asynchronous events and CQ destruction are concurrent, CQ may have been released, which will cause UAF.
Use the xa_lock() to protect the CQ refcount.(CVE-2024-38545)
In the Linux kernel, the following vulnerability has been resolved:
ftrace: Fix possible use-after-free issue in ftrace_location()
KASAN reports a bug:
BUG: KASAN: use-after-free in ftrace_location+0x90/0x120 Read of size 8 at addr ffff888141d40010 by task insmod/424 CPU: 8 PID: 424 Comm: insmod Tainted: G W 6.9.0-rc2+ [...] Call Trace: <TASK> dump_stack_lvl+0x68/0xa0 print_report+0xcf/0x610 kasan_report+0xb5/0xe0 ftrace_location+0x90/0x120 register_kprobe+0x14b/0xa40 kprobe_init+0x2d/0xff0 [kprobe_example] do_one_initcall+0x8f/0x2d0 do_init_module+0x13a/0x3c0 load_module+0x3082/0x33d0 init_module_from_file+0xd2/0x130 __x64_sys_finit_module+0x306/0x440 do_syscall_64+0x68/0x140 entry_SYSCALL_64_after_hwframe+0x71/0x79
The root cause is that, in lookup_rec(), ftrace record of some address is being searched in ftrace pages of some module, but those ftrace pages at the same time is being freed in ftrace_release_mod() as the corresponding module is being deleted:
CPU1 | CPU2
register_kprobes() { | delete_module() { check_kprobe_address_safe() { | arch_check_ftrace_location() { | ftrace_location() { | lookup_rec() // USE! | ftrace_release_mod() // Free!
To fix this issue: 1. Hold rcu lock as accessing ftrace pages in ftrace_location_range(); 2. Use ftrace_location_range() instead of lookup_rec() in ftrace_location(); 3. Call synchronize_rcu() before freeing any ftrace pages both in ftrace_process_locs()/ftrace_release_mod()/ftrace_free_mem().(CVE-2024-38588)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/hns: Fix deadlock on SRQ async events.
xa_lock for SRQ table may be required in AEQ. Use xa_store_irq()/ xa_erase_irq() to avoid deadlock.(CVE-2024-38591)
In the Linux kernel, the following vulnerability has been resolved:
af_unix: Fix data races in unix_release_sock/unix_stream_sendmsg
A data-race condition has been identified in af_unix. In one data path, the write function unix_release_sock() atomically writes to sk->sk_shutdown using WRITE_ONCE. However, on the reader side, unix_stream_sendmsg() does not read it atomically. Consequently, this issue is causing the following KCSAN splat to occur:
BUG: KCSAN: data-race in unix_release_sock / unix_stream_sendmsg
write (marked) to 0xffff88867256ddbb of 1 bytes by task 7270 on cpu 28:
unix_release_sock (net/unix/af_unix.c:640)
unix_release (net/unix/af_unix.c:1050)
sock_close (net/socket.c:659 net/socket.c:1421)
__fput (fs/file_table.c:422)
__fput_sync (fs/file_table.c:508)
__se_sys_close (fs/open.c:1559 fs/open.c:1541)
__x64_sys_close (fs/open.c:1541)
x64_sys_call (arch/x86/entry/syscall_64.c:33)
do_syscall_64 (arch/x86/entry/common.c:?)
entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
read to 0xffff88867256ddbb of 1 bytes by task 989 on cpu 14:
unix_stream_sendmsg (net/unix/af_unix.c:2273)
__sock_sendmsg (net/socket.c:730 net/socket.c:745)
____sys_sendmsg (net/socket.c:2584)
__sys_sendmmsg (net/socket.c:2638 net/socket.c:2724)
__x64_sys_sendmmsg (net/socket.c:2753 net/socket.c:2750 net/socket.c:2750)
x64_sys_call (arch/x86/entry/syscall_64.c:33)
do_syscall_64 (arch/x86/entry/common.c:?)
entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
value changed: 0x01 -> 0x03
The line numbers are related to commit dd5a440a31fa ("Linux 6.9-rc7").
Commit e1d09c2c2f57 ("af_unix: Fix data races around sk->sk_shutdown.") addressed a comparable issue in the past regarding sk->sk_shutdown. However, it overlooked resolving this particular data path. This patch only offending unix_stream_sendmsg() function, since the other reads seem to be protected by unix_state_lock() as discussed in(CVE-2024-38596)
In the Linux kernel, the following vulnerability has been resolved:
ring-buffer: Fix a race between readers and resize checks
The reader code in rb_get_reader_page() swaps a new reader page into the ring buffer by doing cmpxchg on old->list.prev->next to point it to the new page. Following that, if the operation is successful, old->list.next->prev gets updated too. This means the underlying doubly-linked list is temporarily inconsistent, page->prev->next or page->next->prev might not be equal back to page for some page in the ring buffer.
The resize operation in ring_buffer_resize() can be invoked in parallel. It calls rb_check_pages() which can detect the described inconsistency and stop further tracing:
[ 190.271762] ------------[ cut here ]------------ [ 190.271771] WARNING: CPU: 1 PID: 6186 at kernel/trace/ring_buffer.c:1467 rb_check_pages.isra.0+0x6a/0xa0 [ 190.271789] Modules linked in: [...] [ 190.271991] Unloaded tainted modules: intel_uncore_frequency(E):1 skx_edac(E):1 [ 190.272002] CPU: 1 PID: 6186 Comm: cmd.sh Kdump: loaded Tainted: G E 6.9.0-rc6-default #5 158d3e1e6d0b091c34c3b96bfd99a1c58306d79f [ 190.272011] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.16.0-0-gd239552c-rebuilt.opensuse.org 04/01/2014 [ 190.272015] RIP: 0010:rb_check_pages.isra.0+0x6a/0xa0 [ 190.272023] Code: [...] [ 190.272028] RSP: 0018:ffff9c37463abb70 EFLAGS: 00010206 [ 190.272034] RAX: ffff8eba04b6cb80 RBX: 0000000000000007 RCX: ffff8eba01f13d80 [ 190.272038] RDX: ffff8eba01f130c0 RSI: ffff8eba04b6cd00 RDI: ffff8eba0004c700 [ 190.272042] RBP: ffff8eba0004c700 R08: 0000000000010002 R09: 0000000000000000 [ 190.272045] R10: 00000000ffff7f52 R11: ffff8eba7f600000 R12: ffff8eba0004c720 [ 190.272049] R13: ffff8eba00223a00 R14: 0000000000000008 R15: ffff8eba067a8000 [ 190.272053] FS: 00007f1bd64752c0(0000) GS:ffff8eba7f680000(0000) knlGS:0000000000000000 [ 190.272057] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 190.272061] CR2: 00007f1bd6662590 CR3: 000000010291e001 CR4: 0000000000370ef0 [ 190.272070] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 [ 190.272073] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 [ 190.272077] Call Trace: [ 190.272098] <TASK> [ 190.272189] ring_buffer_resize+0x2ab/0x460 [ 190.272199] __tracing_resize_ring_buffer.part.0+0x23/0xa0 [ 190.272206] tracing_resize_ring_buffer+0x65/0x90 [ 190.272216] tracing_entries_write+0x74/0xc0 [ 190.272225] vfs_write+0xf5/0x420 [ 190.272248] ksys_write+0x67/0xe0 [ 190.272256] do_syscall_64+0x82/0x170 [ 190.272363] entry_SYSCALL_64_after_hwframe+0x76/0x7e [ 190.272373] RIP: 0033:0x7f1bd657d263 [ 190.272381] Code: [...] [ 190.272385] RSP: 002b:00007ffe72b643f8 EFLAGS: 00000246 ORIG_RAX: 0000000000000001 [ 190.272391] RAX: ffffffffffffffda RBX: 0000000000000002 RCX: 00007f1bd657d263 [ 190.272395] RDX: 0000000000000002 RSI: 0000555a6eb538e0 RDI: 0000000000000001 [ 190.272398] RBP: 0000555a6eb538e0 R08: 000000000000000a R09: 0000000000000000 [ 190.272401] R10: 0000555a6eb55190 R11: 0000000000000246 R12: 00007f1bd6662500 [ 190.272404] R13: 0000000000000002 R14: 00007f1bd6667c00 R15: 0000000000000002 [ 190.272412] </TASK> [ 190.272414] ---[ end trace 0000000000000000 ]---
Note that ring_buffer_resize() calls rb_check_pages() only if the parent trace_buffer has recording disabled. Recent commit d78ab792705c ("tracing: Stop current tracer when resizing buffer") causes that it is now always the case which makes it more likely to experience this issue.
The window to hit this race is nonetheless very small. To help reproducing it, one can add a delay loop in rb_get_reader_page():
ret = rb_head_page_replace(reader, cpu_buffer->reader_page); if (!ret) goto spin; for (unsigned i = 0; i < 1U << 26; i++) / inserted delay loop / asm volatile ("" : : : "memory"); rb_list_head(reader->list.next)->prev = &cpu_buffer->reader_page->list;
.. ---truncated---(CVE-2024-38601)
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"perf-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm",
"kernel-headers-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm",
"kernel-tools-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm",
"kernel-source-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm",
"kernel-devel-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm",
"kernel-debugsource-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm",
"python3-perf-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm",
"kernel-tools-devel-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm",
"kernel-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm",
"perf-debuginfo-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm",
"kernel-debuginfo-5.10.0-215.0.0.119.oe2203sp3.aarch64.rpm"
],
"src": [
"kernel-5.10.0-215.0.0.119.oe2203sp3.src.rpm"
],
"x86_64": [
"kernel-devel-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm",
"kernel-tools-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm",
"kernel-headers-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm",
"kernel-debugsource-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm",
"kernel-tools-devel-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm",
"python3-perf-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm",
"kernel-debuginfo-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm",
"kernel-source-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm",
"perf-debuginfo-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm",
"kernel-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm",
"perf-5.10.0-215.0.0.119.oe2203sp3.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP3",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP3"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-215.0.0.119.oe2203sp3"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nspi: Fix deadlock when adding SPI controllers on SPI buses\r\n\r\nCurrently we have a global spi_add_lock which we take when adding new\ndevices so that we can check that we\u0026apos;re not trying to reuse a chip\nselect that\u0026apos;s already controlled. This means that if the SPI device is\nitself a SPI controller and triggers the instantiation of further SPI\ndevices we trigger a deadlock as we try to register and instantiate\nthose devices while in the process of doing so for the parent controller\nand hence already holding the global spi_add_lock. Since we only care\nabout concurrency within a single SPI bus move the lock to be per\ncontroller, avoiding the deadlock.\r\n\r\nThis can be easily triggered in the case of spi-mux.(CVE-2021-47469)\r\n\r\n(CVE-2023-39180)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhid: cp2112: Fix duplicate workqueue initialization\r\n\r\nPreviously the cp2112 driver called INIT_DELAYED_WORK within\ncp2112_gpio_irq_startup, resulting in duplicate initilizations of the\nworkqueue on subsequent IRQ startups following an initial request. This\nresulted in a warning in set_work_data in workqueue.c, as well as a rare\nNULL dereference within process_one_work in workqueue.c.\r\n\r\nInitialize the workqueue within _probe instead.(CVE-2023-52853)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nksmbd: fix UAF issue in ksmbd_tcp_new_connection()\r\n\r\nThe race is between the handling of a new TCP connection and\nits disconnection. It leads to UAF on `struct tcp_transport` in\nksmbd_tcp_new_connection() function.(CVE-2024-26592)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nf_tables: release mutex after nft_gc_seq_end from abort path\r\n\r\nThe commit mutex should not be released during the critical section\nbetween nft_gc_seq_begin() and nft_gc_seq_end(), otherwise, async GC\nworker could collect expired objects and get the released commit lock\nwithin the same GC sequence.\r\n\r\nnf_tables_module_autoload() temporarily releases the mutex to load\nmodule dependencies, then it goes back to replay the transaction again.\nMove it at the end of the abort phase after nft_gc_seq_end() is called.(CVE-2024-26925)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: wilc1000: fix RCU usage in connect path\r\n\r\nWith lockdep enabled, calls to the connect function from cfg802.11 layer\nlead to the following warning:\r\n\r\n=============================\nWARNING: suspicious RCU usage\n6.7.0-rc1-wt+ #333 Not tainted\n-----------------------------\ndrivers/net/wireless/microchip/wilc1000/hif.c:386\nsuspicious rcu_dereference_check() usage!\n[...]\nstack backtrace:\nCPU: 0 PID: 100 Comm: wpa_supplicant Not tainted 6.7.0-rc1-wt+ #333\nHardware name: Atmel SAMA5\n unwind_backtrace from show_stack+0x18/0x1c\n show_stack from dump_stack_lvl+0x34/0x48\n dump_stack_lvl from wilc_parse_join_bss_param+0x7dc/0x7f4\n wilc_parse_join_bss_param from connect+0x2c4/0x648\n connect from cfg80211_connect+0x30c/0xb74\n cfg80211_connect from nl80211_connect+0x860/0xa94\n nl80211_connect from genl_rcv_msg+0x3fc/0x59c\n genl_rcv_msg from netlink_rcv_skb+0xd0/0x1f8\n netlink_rcv_skb from genl_rcv+0x2c/0x3c\n genl_rcv from netlink_unicast+0x3b0/0x550\n netlink_unicast from netlink_sendmsg+0x368/0x688\n netlink_sendmsg from ____sys_sendmsg+0x190/0x430\n ____sys_sendmsg from ___sys_sendmsg+0x110/0x158\n ___sys_sendmsg from sys_sendmsg+0xe8/0x150\n sys_sendmsg from ret_fast_syscall+0x0/0x1c\r\n\r\nThis warning is emitted because in the connect path, when trying to parse\ntarget BSS parameters, we dereference a RCU pointer whithout being in RCU\ncritical section.\nFix RCU dereference usage by moving it to a RCU read critical section. To\navoid wrapping the whole wilc_parse_join_bss_param under the critical\nsection, just use the critical section to copy ies data(CVE-2024-27053)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: tc358743: register v4l2 async device only after successful setup\r\n\r\nEnsure the device has been setup correctly before registering the v4l2\nasync device, thus allowing userspace to access.(CVE-2024-35830)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/rds: fix possible cp null dereference\r\n\r\ncp might be null, calling cp-\u0026gt;cp_conn would produce null dereference\r\n\r\n[Simon Horman adds:]\r\n\r\nAnalysis:\r\n\r\n* cp is a parameter of __rds_rdma_map and is not reassigned.\r\n\r\n* The following call-sites pass a NULL cp argument to __rds_rdma_map()\r\n\r\n - rds_get_mr()\n - rds_get_mr_for_dest\r\n\r\n* Prior to the code above, the following assumes that cp may be NULL\n (which is indicative, but could itself be unnecessary)\r\n\r\n\ttrans_private = rs-\u0026gt;rs_transport-\u0026gt;get_mr(\n\t\tsg, nents, rs, \u0026amp;mr-\u0026gt;r_key, cp ? cp-\u0026gt;cp_conn : NULL,\n\t\targs-\u0026gt;vec.addr, args-\u0026gt;vec.bytes,\n\t\tneed_odp ? ODP_ZEROBASED : ODP_NOT_NEEDED);\r\n\r\n* The code modified by this patch is guarded by IS_ERR(trans_private),\n where trans_private is assigned as per the previous point in this analysis.\r\n\r\n The only implementation of get_mr that I could locate is rds_ib_get_mr()\n which can return an ERR_PTR if the conn (4th) argument is NULL.\r\n\r\n* ret is set to PTR_ERR(trans_private).\n rds_ib_get_mr can return ERR_PTR(-ENODEV) if the conn (4th) argument is NULL.\n Thus ret may be -ENODEV in which case the code in question will execute.\r\n\r\nConclusion:\n* cp may be NULL at the point where this patch adds a check;\n this patch does seem to address a possible bug(CVE-2024-35902)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nkprobes: Fix possible use-after-free issue on kprobe registration\r\n\r\nWhen unloading a module, its state is changing MODULE_STATE_LIVE -\u0026gt;\n MODULE_STATE_GOING -\u0026gt; MODULE_STATE_UNFORMED. Each change will take\na time. `is_module_text_address()` and `__module_text_address()`\nworks with MODULE_STATE_LIVE and MODULE_STATE_GOING.\nIf we use `is_module_text_address()` and `__module_text_address()`\nseparately, there is a chance that the first one is succeeded but the\nnext one is failed because module-\u0026gt;state becomes MODULE_STATE_UNFORMED\nbetween those operations.\r\n\r\nIn `check_kprobe_address_safe()`, if the second `__module_text_address()`\nis failed, that is ignored because it expected a kernel_text address.\nBut it may have failed simply because module-\u0026gt;state has been changed\nto MODULE_STATE_UNFORMED. In this case, arm_kprobe() will try to modify\nnon-exist module text address (use-after-free).\r\n\r\nTo fix this problem, we should not use separated `is_module_text_address()`\nand `__module_text_address()`, but use only `__module_text_address()`\nonce and do `try_module_get(module)` which is only available with\nMODULE_STATE_LIVE.(CVE-2024-35955)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfirewire: ohci: mask bus reset interrupts between ISR and bottom half\r\n\r\nIn the FireWire OHCI interrupt handler, if a bus reset interrupt has\noccurred, mask bus reset interrupts until bus_reset_work has serviced and\ncleared the interrupt.\r\n\r\nNormally, we always leave bus reset interrupts masked. We infer the bus\nreset from the self-ID interrupt that happens shortly thereafter. A\nscenario where we unmask bus reset interrupts was introduced in 2008 in\na007bb857e0b26f5d8b73c2ff90782d9c0972620: If\nOHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we\nwill unmask bus reset interrupts so we can log them.\r\n\r\nirq_handler logs the bus reset interrupt. However, we can\u0026apos;t clear the bus\nreset event flag in irq_handler, because we won\u0026apos;t service the event until\nlater. irq_handler exits with the event flag still set. If the\ncorresponding interrupt is still unmasked, the first bus reset will\nusually freeze the system due to irq_handler being called again each\ntime it exits. This freeze can be reproduced by loading firewire_ohci\nwith \u0026quot;modprobe firewire_ohci debug=-1\u0026quot; (to enable all debugging output).\nApparently there are also some cases where bus_reset_work will get called\nsoon enough to clear the event, and operation will continue normally.\r\n\r\nThis freeze was first reported a few months after a007bb85 was committed,\nbut until now it was never fixed. The debug level could safely be set\nto -1 through sysfs after the module was loaded, but this would be\nineffectual in logging bus reset interrupts since they were only\nunmasked during initialization.\r\n\r\nirq_handler will now leave the event flag set but mask bus reset\ninterrupts, so irq_handler won\u0026apos;t be called again and there will be no\nfreeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will\nunmask the interrupt after servicing the event, so future interrupts\nwill be caught as desired.\r\n\r\nAs a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be\nenabled through sysfs in addition to during initial module loading.\nHowever, when enabled through sysfs, logging of bus reset interrupts will\nbe effective only starting with the second bus reset, after\nbus_reset_work has executed.(CVE-2024-36950)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix division by zero in setup_dsc_config\r\n\r\nWhen slice_height is 0, the division by slice_height in the calculation\nof the number of slices will cause a division by zero driver crash. This\nleaves the kernel in a state that requires a reboot. This patch adds a\ncheck to avoid the division by zero.\r\n\r\nThe stack trace below is for the 6.8.4 Kernel. I reproduced the issue on\na Z16 Gen 2 Lenovo Thinkpad with a Apple Studio Display monitor\nconnected via Thunderbolt. The amdgpu driver crashed with this exception\nwhen I rebooted the system with the monitor connected.\r\n\r\nkernel: ? die (arch/x86/kernel/dumpstack.c:421 arch/x86/kernel/dumpstack.c:434 arch/x86/kernel/dumpstack.c:447)\nkernel: ? do_trap (arch/x86/kernel/traps.c:113 arch/x86/kernel/traps.c:154)\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: ? do_error_trap (./arch/x86/include/asm/traps.h:58 arch/x86/kernel/traps.c:175)\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: ? exc_divide_error (arch/x86/kernel/traps.c:194 (discriminator 2))\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: ? asm_exc_divide_error (./arch/x86/include/asm/idtentry.h:548)\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: dc_dsc_compute_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1109) amdgpu\r\n\r\nAfter applying this patch, the driver no longer crashes when the monitor\nis connected and the system is rebooted. I believe this is the same\nissue reported for 3113.(CVE-2024-36969)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: sched: sch_multiq: fix possible OOB write in multiq_tune()\r\n\r\nq-\u0026gt;bands will be assigned to qopt-\u0026gt;bands to execute subsequent code logic\nafter kmalloc. So the old q-\u0026gt;bands should not be used in kmalloc.\nOtherwise, an out-of-bounds write will occur.(CVE-2024-36978)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nRDMA/hns: Fix UAF for cq async event\r\n\r\nThe refcount of CQ is not protected by locks. When CQ asynchronous\nevents and CQ destruction are concurrent, CQ may have been released,\nwhich will cause UAF.\r\n\r\nUse the xa_lock() to protect the CQ refcount.(CVE-2024-38545)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nftrace: Fix possible use-after-free issue in ftrace_location()\r\n\r\nKASAN reports a bug:\r\n\r\n BUG: KASAN: use-after-free in ftrace_location+0x90/0x120\n Read of size 8 at addr ffff888141d40010 by task insmod/424\n CPU: 8 PID: 424 Comm: insmod Tainted: G W 6.9.0-rc2+\n [...]\n Call Trace:\n \u0026lt;TASK\u0026gt;\n dump_stack_lvl+0x68/0xa0\n print_report+0xcf/0x610\n kasan_report+0xb5/0xe0\n ftrace_location+0x90/0x120\n register_kprobe+0x14b/0xa40\n kprobe_init+0x2d/0xff0 [kprobe_example]\n do_one_initcall+0x8f/0x2d0\n do_init_module+0x13a/0x3c0\n load_module+0x3082/0x33d0\n init_module_from_file+0xd2/0x130\n __x64_sys_finit_module+0x306/0x440\n do_syscall_64+0x68/0x140\n entry_SYSCALL_64_after_hwframe+0x71/0x79\r\n\r\nThe root cause is that, in lookup_rec(), ftrace record of some address\nis being searched in ftrace pages of some module, but those ftrace pages\nat the same time is being freed in ftrace_release_mod() as the\ncorresponding module is being deleted:\r\n\r\n CPU1 | CPU2\n register_kprobes() { | delete_module() {\n check_kprobe_address_safe() { |\n arch_check_ftrace_location() { |\n ftrace_location() { |\n lookup_rec() // USE! | ftrace_release_mod() // Free!\r\n\r\nTo fix this issue:\n 1. Hold rcu lock as accessing ftrace pages in ftrace_location_range();\n 2. Use ftrace_location_range() instead of lookup_rec() in\n ftrace_location();\n 3. Call synchronize_rcu() before freeing any ftrace pages both in\n ftrace_process_locs()/ftrace_release_mod()/ftrace_free_mem().(CVE-2024-38588)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nRDMA/hns: Fix deadlock on SRQ async events.\r\n\r\nxa_lock for SRQ table may be required in AEQ. Use xa_store_irq()/\nxa_erase_irq() to avoid deadlock.(CVE-2024-38591)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\naf_unix: Fix data races in unix_release_sock/unix_stream_sendmsg\r\n\r\nA data-race condition has been identified in af_unix. In one data path,\nthe write function unix_release_sock() atomically writes to\nsk-\u0026gt;sk_shutdown using WRITE_ONCE. However, on the reader side,\nunix_stream_sendmsg() does not read it atomically. Consequently, this\nissue is causing the following KCSAN splat to occur:\r\n\r\n\tBUG: KCSAN: data-race in unix_release_sock / unix_stream_sendmsg\r\n\r\n\twrite (marked) to 0xffff88867256ddbb of 1 bytes by task 7270 on cpu 28:\n\tunix_release_sock (net/unix/af_unix.c:640)\n\tunix_release (net/unix/af_unix.c:1050)\n\tsock_close (net/socket.c:659 net/socket.c:1421)\n\t__fput (fs/file_table.c:422)\n\t__fput_sync (fs/file_table.c:508)\n\t__se_sys_close (fs/open.c:1559 fs/open.c:1541)\n\t__x64_sys_close (fs/open.c:1541)\n\tx64_sys_call (arch/x86/entry/syscall_64.c:33)\n\tdo_syscall_64 (arch/x86/entry/common.c:?)\n\tentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\n\tread to 0xffff88867256ddbb of 1 bytes by task 989 on cpu 14:\n\tunix_stream_sendmsg (net/unix/af_unix.c:2273)\n\t__sock_sendmsg (net/socket.c:730 net/socket.c:745)\n\t____sys_sendmsg (net/socket.c:2584)\n\t__sys_sendmmsg (net/socket.c:2638 net/socket.c:2724)\n\t__x64_sys_sendmmsg (net/socket.c:2753 net/socket.c:2750 net/socket.c:2750)\n\tx64_sys_call (arch/x86/entry/syscall_64.c:33)\n\tdo_syscall_64 (arch/x86/entry/common.c:?)\n\tentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\n\tvalue changed: 0x01 -\u0026gt; 0x03\r\n\r\nThe line numbers are related to commit dd5a440a31fa (\u0026quot;Linux 6.9-rc7\u0026quot;).\r\n\r\nCommit e1d09c2c2f57 (\u0026quot;af_unix: Fix data races around sk-\u0026gt;sk_shutdown.\u0026quot;)\naddressed a comparable issue in the past regarding sk-\u0026gt;sk_shutdown.\nHowever, it overlooked resolving this particular data path.\nThis patch only offending unix_stream_sendmsg() function, since the\nother reads seem to be protected by unix_state_lock() as discussed in(CVE-2024-38596)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nring-buffer: Fix a race between readers and resize checks\r\n\r\nThe reader code in rb_get_reader_page() swaps a new reader page into the\nring buffer by doing cmpxchg on old-\u0026gt;list.prev-\u0026gt;next to point it to the\nnew page. Following that, if the operation is successful,\nold-\u0026gt;list.next-\u0026gt;prev gets updated too. This means the underlying\ndoubly-linked list is temporarily inconsistent, page-\u0026gt;prev-\u0026gt;next or\npage-\u0026gt;next-\u0026gt;prev might not be equal back to page for some page in the\nring buffer.\r\n\r\nThe resize operation in ring_buffer_resize() can be invoked in parallel.\nIt calls rb_check_pages() which can detect the described inconsistency\nand stop further tracing:\r\n\r\n[ 190.271762] ------------[ cut here ]------------\n[ 190.271771] WARNING: CPU: 1 PID: 6186 at kernel/trace/ring_buffer.c:1467 rb_check_pages.isra.0+0x6a/0xa0\n[ 190.271789] Modules linked in: [...]\n[ 190.271991] Unloaded tainted modules: intel_uncore_frequency(E):1 skx_edac(E):1\n[ 190.272002] CPU: 1 PID: 6186 Comm: cmd.sh Kdump: loaded Tainted: G E 6.9.0-rc6-default #5 158d3e1e6d0b091c34c3b96bfd99a1c58306d79f\n[ 190.272011] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.16.0-0-gd239552c-rebuilt.opensuse.org 04/01/2014\n[ 190.272015] RIP: 0010:rb_check_pages.isra.0+0x6a/0xa0\n[ 190.272023] Code: [...]\n[ 190.272028] RSP: 0018:ffff9c37463abb70 EFLAGS: 00010206\n[ 190.272034] RAX: ffff8eba04b6cb80 RBX: 0000000000000007 RCX: ffff8eba01f13d80\n[ 190.272038] RDX: ffff8eba01f130c0 RSI: ffff8eba04b6cd00 RDI: ffff8eba0004c700\n[ 190.272042] RBP: ffff8eba0004c700 R08: 0000000000010002 R09: 0000000000000000\n[ 190.272045] R10: 00000000ffff7f52 R11: ffff8eba7f600000 R12: ffff8eba0004c720\n[ 190.272049] R13: ffff8eba00223a00 R14: 0000000000000008 R15: ffff8eba067a8000\n[ 190.272053] FS: 00007f1bd64752c0(0000) GS:ffff8eba7f680000(0000) knlGS:0000000000000000\n[ 190.272057] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 190.272061] CR2: 00007f1bd6662590 CR3: 000000010291e001 CR4: 0000000000370ef0\n[ 190.272070] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n[ 190.272073] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n[ 190.272077] Call Trace:\n[ 190.272098] \u0026lt;TASK\u0026gt;\n[ 190.272189] ring_buffer_resize+0x2ab/0x460\n[ 190.272199] __tracing_resize_ring_buffer.part.0+0x23/0xa0\n[ 190.272206] tracing_resize_ring_buffer+0x65/0x90\n[ 190.272216] tracing_entries_write+0x74/0xc0\n[ 190.272225] vfs_write+0xf5/0x420\n[ 190.272248] ksys_write+0x67/0xe0\n[ 190.272256] do_syscall_64+0x82/0x170\n[ 190.272363] entry_SYSCALL_64_after_hwframe+0x76/0x7e\n[ 190.272373] RIP: 0033:0x7f1bd657d263\n[ 190.272381] Code: [...]\n[ 190.272385] RSP: 002b:00007ffe72b643f8 EFLAGS: 00000246 ORIG_RAX: 0000000000000001\n[ 190.272391] RAX: ffffffffffffffda RBX: 0000000000000002 RCX: 00007f1bd657d263\n[ 190.272395] RDX: 0000000000000002 RSI: 0000555a6eb538e0 RDI: 0000000000000001\n[ 190.272398] RBP: 0000555a6eb538e0 R08: 000000000000000a R09: 0000000000000000\n[ 190.272401] R10: 0000555a6eb55190 R11: 0000000000000246 R12: 00007f1bd6662500\n[ 190.272404] R13: 0000000000000002 R14: 00007f1bd6667c00 R15: 0000000000000002\n[ 190.272412] \u0026lt;/TASK\u0026gt;\n[ 190.272414] ---[ end trace 0000000000000000 ]---\r\n\r\nNote that ring_buffer_resize() calls rb_check_pages() only if the parent\ntrace_buffer has recording disabled. Recent commit d78ab792705c\n(\u0026quot;tracing: Stop current tracer when resizing buffer\u0026quot;) causes that it is\nnow always the case which makes it more likely to experience this issue.\r\n\r\nThe window to hit this race is nonetheless very small. To help\nreproducing it, one can add a delay loop in rb_get_reader_page():\r\n\r\n ret = rb_head_page_replace(reader, cpu_buffer-\u0026gt;reader_page);\n if (!ret)\n \tgoto spin;\n for (unsigned i = 0; i \u0026lt; 1U \u0026lt;\u0026lt; 26; i++) /* inserted delay loop */\n \t__asm__ __volatile__ (\u0026quot;\u0026quot; : : : \u0026quot;memory\u0026quot;);\n rb_list_head(reader-\u0026gt;list.next)-\u0026gt;prev = \u0026amp;cpu_buffer-\u0026gt;reader_page-\u0026gt;list;\r\n\r\n.. \n---truncated---(CVE-2024-38601)",
"id": "OESA-2024-1765",
"modified": "2026-08-06T11:07:13Z",
"published": "2024-06-28T11:07:13Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1765"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47469"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-39180"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52853"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26592"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26925"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27053"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35830"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35902"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35955"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36950"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36969"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36978"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38545"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38588"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38591"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38596"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38601"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47469",
"CVE-2023-39180",
"CVE-2023-52853",
"CVE-2024-26592",
"CVE-2024-26925",
"CVE-2024-27053",
"CVE-2024-35830",
"CVE-2024-35902",
"CVE-2024-35955",
"CVE-2024-36950",
"CVE-2024-36969",
"CVE-2024-36978",
"CVE-2024-38545",
"CVE-2024-38588",
"CVE-2024-38591",
"CVE-2024-38596",
"CVE-2024-38601"
]
}
OESA-2024-1767 (CVE-2021-47231)
Vulnerability from osv_openeuler – Published: 2024-06-28 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
can: mcba_usb: fix memory leak in mcba_usb
Syzbot reported memory leak in SocketCAN driver for Microchip CAN BUS Analyzer Tool. The problem was in unfreed usb_coherent.
In mcba_usb_start() 20 coherent buffers are allocated and there is nothing, that frees them:
1) In callback function the urb is resubmitted and that's all 2) In disconnect function urbs are simply killed, but URB_FREE_BUFFER is not set (see mcba_usb_start) and this flag cannot be used with coherent buffers.
Fail log: | [ 1354.053291][ T8413] mcba_usb 1-1:0.0 can0: device disconnected | [ 1367.059384][ T8420] kmemleak: 20 new suspected memory leaks (see /sys/kernel/debug/kmem)
So, all allocated buffers should be freed with usb_free_coherent() explicitly
NOTE: The same pattern for allocating and freeing coherent buffers is used in drivers/net/can/usb/kvaser_usb/kvaser_usb_core.c(CVE-2021-47231)
In the Linux kernel, the following vulnerability has been resolved:
can: j1939: fix Use-after-Free, hold skb ref while in use
This patch fixes a Use-after-Free found by the syzbot.
The problem is that a skb is taken from the per-session skb queue, without incrementing the ref count. This leads to a Use-after-Free if the skb is taken concurrently from the session queue due to a CTS.(CVE-2021-47232)
In the Linux kernel, the following vulnerability has been resolved:
batman-adv: Avoid WARN_ON timing related checks
The soft/batadv interface for a queued OGM can be changed during the time the OGM was queued for transmission and when the OGM is actually transmitted by the worker.
But WARN_ON must be used to denote kernel bugs and not to print simple warnings. A warning can simply be printed using pr_warn.(CVE-2021-47252)
In the Linux kernel, the following vulnerability has been resolved:
media: ngene: Fix out-of-bounds bug in ngene_command_config_free_buf()
Fix an 11-year old bug in ngene_command_config_free_buf() while addressing the following warnings caught with -Warray-bounds:
arch/alpha/include/asm/string.h:22:16: warning: '__builtin_memcpy' offset [12, 16] from the object at 'com' is out of the bounds of referenced subobject 'config' with type 'unsigned char' at offset 10 [-Warray-bounds] arch/x86/include/asm/string_32.h:182:25: warning: '__builtin_memcpy' offset [12, 16] from the object at 'com' is out of the bounds of referenced subobject 'config' with type 'unsigned char' at offset 10 [-Warray-bounds]
The problem is that the original code is trying to copy 6 bytes of data into a one-byte size member config of the wrong structue FW_CONFIGURE_BUFFERS, in a single call to memcpy(). This causes a legitimate compiler warning because memcpy() overruns the length of &com.cmd.ConfigureBuffers.config. It seems that the right structure is FW_CONFIGURE_FREE_BUFFERS, instead, because it contains 6 more members apart from the header hdr. Also, the name of the function ngene_command_config_free_buf() suggests that the actual intention is to ConfigureFreeBuffers, instead of ConfigureBuffers (which takes place in the function ngene_command_config_buf(), above).
Fix this by enclosing those 6 members of struct FW_CONFIGURE_FREE_BUFFERS into new struct config, and use &com.cmd.ConfigureFreeBuffers.config as the destination address, instead of &com.cmd.ConfigureBuffers.config, when calling memcpy().
This also helps with the ongoing efforts to globally enable -Warray-bounds and get us closer to being able to tighten the FORTIFY_SOURCE routines on memcpy().(CVE-2021-47288)
In the Linux kernel, the following vulnerability has been resolved:
coresight: tmc-etf: Fix global-out-of-bounds in tmc_update_etf_buffer()
commit 6f755e85c332 ("coresight: Add helper for inserting synchronization packets") removed trailing '\0' from barrier_pkt array and updated the call sites like etb_update_buffer() to have proper checks for barrier_pkt size before read but missed updating tmc_update_etf_buffer() which still reads barrier_pkt past the array size resulting in KASAN out-of-bounds bug. Fix this by adding a check for barrier_pkt size before accessing like it is done in etb_update_buffer().
BUG: KASAN: global-out-of-bounds in tmc_update_etf_buffer+0x4b8/0x698 Read of size 4 at addr ffffffd05b7d1030 by task perf/2629
Call trace: dump_backtrace+0x0/0x27c show_stack+0x20/0x2c dump_stack+0x11c/0x188 print_address_description+0x3c/0x4a4 __kasan_report+0x140/0x164 kasan_report+0x10/0x18 __asan_report_load4_noabort+0x1c/0x24 tmc_update_etf_buffer+0x4b8/0x698 etm_event_stop+0x248/0x2d8 etm_event_del+0x20/0x2c event_sched_out+0x214/0x6f0 group_sched_out+0xd0/0x270 ctx_sched_out+0x2ec/0x518 __perf_event_task_sched_out+0x4fc/0xe6c __schedule+0x1094/0x16a0 preempt_schedule_irq+0x88/0x170 arm64_preempt_schedule_irq+0xf0/0x18c el1_irq+0xe8/0x180 perf_event_exec+0x4d8/0x56c setup_new_exec+0x204/0x400 load_elf_binary+0x72c/0x18c0 search_binary_handler+0x13c/0x420 load_script+0x500/0x6c4 search_binary_handler+0x13c/0x420 exec_binprm+0x118/0x654 __do_execve_file+0x77c/0xba4 __arm64_compat_sys_execve+0x98/0xac el0_svc_common+0x1f8/0x5e0 el0_svc_compat_handler+0x84/0xb0 el0_svc_compat+0x10/0x50
The buggy address belongs to the variable: barrier_pkt+0x10/0x40
Memory state around the buggy address: ffffffd05b7d0f00: fa fa fa fa 04 fa fa fa fa fa fa fa 00 00 00 00 ffffffd05b7d0f80: 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 >ffffffd05b7d1000: 00 00 00 00 00 00 fa fa fa fa fa fa 00 00 00 03 ^ ffffffd05b7d1080: fa fa fa fa 00 02 fa fa fa fa fa fa 03 fa fa fa ffffffd05b7d1100: fa fa fa fa 00 00 00 00 05 fa fa fa fa fa fa fa ==================================================================(CVE-2021-47346)
In the Linux kernel, the following vulnerability has been resolved:
wl1251: Fix possible buffer overflow in wl1251_cmd_scan
Function wl1251_cmd_scan calls memcpy without checking the length. Harden by checking the length is within the maximum allowed size.(CVE-2021-47347)
In the Linux kernel, the following vulnerability has been resolved:
xhci: Fix command ring pointer corruption while aborting a command
The command ring pointer is located at [6:63] bits of the command ring control register (CRCR). All the control bits like command stop, abort are located at [0:3] bits. While aborting a command, we read the CRCR and set the abort bit and write to the CRCR. The read will always give command ring pointer as all zeros. So we essentially write only the control bits. Since we split the 64 bit write into two 32 bit writes, there is a possibility of xHC command ring stopped before the upper dword (all zeros) is written. If that happens, xHC updates the upper dword of its internal command ring pointer with all zeros. Next time, when the command ring is restarted, we see xHC memory access failures. Fix this issue by only writing to the lower dword of CRCR where all control bits are located.(CVE-2021-47434)
In the Linux kernel, the following vulnerability has been resolved:
mm, slub: fix potential memoryleak in kmem_cache_open()
In error path, the random_seq of slub cache might be leaked. Fix this by using __kmem_cache_release() to release all the relevant resources.(CVE-2021-47466)
In the Linux kernel, the following vulnerability has been resolved:
spi: Fix deadlock when adding SPI controllers on SPI buses
Currently we have a global spi_add_lock which we take when adding new devices so that we can check that we're not trying to reuse a chip select that's already controlled. This means that if the SPI device is itself a SPI controller and triggers the instantiation of further SPI devices we trigger a deadlock as we try to register and instantiate those devices while in the process of doing so for the parent controller and hence already holding the global spi_add_lock. Since we only care about concurrency within a single SPI bus move the lock to be per controller, avoiding the deadlock.
This can be easily triggered in the case of spi-mux.(CVE-2021-47469)
In the Linux kernel, the following vulnerability has been resolved:
ocfs2: fix race between searching chunks and release journal_head from buffer_head
Encountered a race between ocfs2_test_bg_bit_allocatable() and jbd2_journal_put_journal_head() resulting in the below vmcore.
PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: "loop3" Call trace: panic oops_end no_context __bad_area_nosemaphore bad_area_nosemaphore __do_page_fault do_page_fault page_fault [exception RIP: ocfs2_block_group_find_clear_bits+316] ocfs2_block_group_find_clear_bits [ocfs2] ocfs2_cluster_group_search [ocfs2] ocfs2_search_chain [ocfs2] ocfs2_claim_suballoc_bits [ocfs2] __ocfs2_claim_clusters [ocfs2] ocfs2_claim_clusters [ocfs2] ocfs2_local_alloc_slide_window [ocfs2] ocfs2_reserve_local_alloc_bits [ocfs2] ocfs2_reserve_clusters_with_limit [ocfs2] ocfs2_reserve_clusters [ocfs2] ocfs2_lock_refcount_allocators [ocfs2] ocfs2_make_clusters_writable [ocfs2] ocfs2_replace_cow [ocfs2] ocfs2_refcount_cow [ocfs2] ocfs2_file_write_iter [ocfs2] lo_rw_aio loop_queue_work kthread_worker_fn kthread ret_from_fork
When ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the bg_bh->b_private NULL as jbd2_journal_put_journal_head() raced and released the jounal head from the buffer head. Needed to take bit lock for the bit 'BH_JournalHead' to fix this race.(CVE-2021-47493)
In the Linux kernel, the following vulnerability has been resolved:
iio: mma8452: Fix trigger reference couting
The mma8452 driver directly assigns a trigger to the struct iio_dev. The
IIO core when done using this trigger will call iio_trigger_put() to drop
the reference count by 1.
Without the matching iio_trigger_get() in the driver the reference count
can reach 0 too early, the trigger gets freed while still in use and a
use-after-free occurs.
Fix this by getting a reference to the trigger before assigning it to the IIO device.(CVE-2021-47500)
In the Linux kernel, the following vulnerability has been resolved:
can: sja1000: fix use after free in ems_pcmcia_add_card()
If the last channel is not available then "dev" is freed. Fortunately, we can just use "pdev->irq" instead.
Also we should check if at least one channel was set up.(CVE-2021-47521)
In the Linux kernel, the following vulnerability has been resolved:
scsi: mpt3sas: Fix kernel panic during drive powercycle test
While looping over shost's sdev list it is possible that one of the drives is getting removed and its sas_target object is freed but its sdev object remains intact.
Consequently, a kernel panic can occur while the driver is trying to access the sas_address field of sas_target object without also checking the sas_target object for NULL.(CVE-2021-47565)
In the Linux kernel, the following vulnerability has been resolved:
inet_diag: fix kernel-infoleak for UDP sockets
KMSAN reported a kernel-infoleak [1], that can exploited by unpriv users.
After analysis it turned out UDP was not initializing r->idiag_expires. Other users of inet_sk_diag_fill() might make the same mistake in the future, so fix this in inet_sk_diag_fill().
[1] BUG: KMSAN: kernel-infoleak in instrument_copy_to_user include/linux/instrumented.h:121 [inline] BUG: KMSAN: kernel-infoleak in copyout lib/iov_iter.c:156 [inline] BUG: KMSAN: kernel-infoleak in _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670 instrument_copy_to_user include/linux/instrumented.h:121 [inline] copyout lib/iov_iter.c:156 [inline] _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670 copy_to_iter include/linux/uio.h:155 [inline] simple_copy_to_iter+0xf3/0x140 net/core/datagram.c:519 __skb_datagram_iter+0x2cb/0x1280 net/core/datagram.c:425 skb_copy_datagram_iter+0xdc/0x270 net/core/datagram.c:533 skb_copy_datagram_msg include/linux/skbuff.h:3657 [inline] netlink_recvmsg+0x660/0x1c60 net/netlink/af_netlink.c:1974 sock_recvmsg_nosec net/socket.c:944 [inline] sock_recvmsg net/socket.c:962 [inline] sock_read_iter+0x5a9/0x630 net/socket.c:1035 call_read_iter include/linux/fs.h:2156 [inline] new_sync_read fs/read_write.c:400 [inline] vfs_read+0x1631/0x1980 fs/read_write.c:481 ksys_read+0x28c/0x520 fs/read_write.c:619 __do_sys_read fs/read_write.c:629 [inline] __se_sys_read fs/read_write.c:627 [inline] __x64_sys_read+0xdb/0x120 fs/read_write.c:627 do_syscall_x64 arch/x86/entry/common.c:51 [inline] do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82 entry_SYSCALL_64_after_hwframe+0x44/0xae
Uninit was created at: slab_post_alloc_hook mm/slab.h:524 [inline] slab_alloc_node mm/slub.c:3251 [inline] __kmalloc_node_track_caller+0xe0c/0x1510 mm/slub.c:4974 kmalloc_reserve net/core/skbuff.c:354 [inline] __alloc_skb+0x545/0xf90 net/core/skbuff.c:426 alloc_skb include/linux/skbuff.h:1126 [inline] netlink_dump+0x3d5/0x16a0 net/netlink/af_netlink.c:2245 __netlink_dump_start+0xd1c/0xee0 net/netlink/af_netlink.c:2370 netlink_dump_start include/linux/netlink.h:254 [inline] inet_diag_handler_cmd+0x2e7/0x400 net/ipv4/inet_diag.c:1343 sock_diag_rcv_msg+0x24a/0x620 netlink_rcv_skb+0x447/0x800 net/netlink/af_netlink.c:2491 sock_diag_rcv+0x63/0x80 net/core/sock_diag.c:276 netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline] netlink_unicast+0x1095/0x1360 net/netlink/af_netlink.c:1345 netlink_sendmsg+0x16f3/0x1870 net/netlink/af_netlink.c:1916 sock_sendmsg_nosec net/socket.c:704 [inline] sock_sendmsg net/socket.c:724 [inline] sock_write_iter+0x594/0x690 net/socket.c:1057 do_iter_readv_writev+0xa7f/0xc70 do_iter_write+0x52c/0x1500 fs/read_write.c:851 vfs_writev fs/read_write.c:924 [inline] do_writev+0x63f/0xe30 fs/read_write.c:967 __do_sys_writev fs/read_write.c:1040 [inline] __se_sys_writev fs/read_write.c:1037 [inline] __x64_sys_writev+0xe5/0x120 fs/read_write.c:1037 do_syscall_x64 arch/x86/entry/common.c:51 [inline] do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82 entry_SYSCALL_64_after_hwframe+0x44/0xae
Bytes 68-71 of 312 are uninitialized Memory access of size 312 starts at ffff88812ab54000 Data copied to user address 0000000020001440
CPU: 1 PID: 6365 Comm: syz-executor801 Not tainted 5.16.0-rc3-syzkaller #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/01/2011(CVE-2021-47597)
In the Linux kernel, the following vulnerability has been resolved:
firmware: arm_scpi: Fix string overflow in SCPI genpd driver
Without the bound checks for scpi_pd->name, it could result in the buffer overflow when copying the SCPI device name from the corresponding device tree node as the name string is set at maximum size of 30.
Let us fix it by using devm_kasprintf so that the string buffer is allocated dynamically.(CVE-2021-47609)
In the Linux kernel, the following vulnerability has been resolved:
ASoC: ops: Reject out of bounds values in snd_soc_put_volsw_sx()
We don't currently validate that the values being set are within the range we advertised to userspace as being valid, do so and reject any values that are out of range.(CVE-2022-48737)
In the Linux kernel, the following vulnerability has been resolved:
powerpc64/bpf: Limit 'ldbrx' to processors compliant with ISA v2.06
Johan reported the below crash with test_bpf on ppc64 e5500:
test_bpf: #296 ALU_END_FROM_LE 64: 0x0123456789abcdef -> 0x67452301 jited:1 Oops: Exception in kernel mode, sig: 4 [#1] BE PAGE_SIZE=4K SMP NR_CPUS=24 QEMU e500 Modules linked in: test_bpf(+) CPU: 0 PID: 76 Comm: insmod Not tainted 5.14.0-03771-g98c2059e008a-dirty #1 NIP: 8000000000061c3c LR: 80000000006dea64 CTR: 8000000000061c18 REGS: c0000000032d3420 TRAP: 0700 Not tainted (5.14.0-03771-g98c2059e008a-dirty) MSR: 0000000080089000 <EE,ME> CR: 88002822 XER: 20000000 IRQMASK: 0 <...> NIP [8000000000061c3c] 0x8000000000061c3c LR [80000000006dea64] .__run_one+0x104/0x17c [test_bpf] Call Trace: .__run_one+0x60/0x17c [test_bpf] (unreliable) .test_bpf_init+0x6a8/0xdc8 [test_bpf] .do_one_initcall+0x6c/0x28c .do_init_module+0x68/0x28c .load_module+0x2460/0x2abc .__do_sys_init_module+0x120/0x18c .system_call_exception+0x110/0x1b8 system_call_common+0xf0/0x210 --- interrupt: c00 at 0x101d0acc <...> ---[ end trace 47b2bf19090bb3d0 ]---
Illegal instruction
The illegal instruction turned out to be 'ldbrx' emitted for BPF_FROM_[L|B]E, which was only introduced in ISA v2.06. Guard use of the same and implement an alternative approach for older processors.(CVE-2022-48755)
In the Linux kernel, the following vulnerability has been resolved:
drm/msm/dsi: invalid parameter check in msm_dsi_phy_enable
The function performs a check on the "phy" input parameter, however, it is used before the check.
Initialize the "dev" variable after the sanity check to avoid a possible NULL pointer dereference.
Addresses-Coverity-ID: 1493860 ("Null pointer dereference")(CVE-2022-48756)
In the Linux kernel, the following vulnerability has been resolved:
rpmsg: virtio: Free driver_override when rpmsg_remove()
Free driver_override when rpmsg_remove(), otherwise the following memory leak will occur:
unreferenced object 0xffff0000d55d7080 (size 128): comm "kworker/u8:2", pid 56, jiffies 4294893188 (age 214.272s) hex dump (first 32 bytes): 72 70 6d 73 67 5f 6e 73 00 00 00 00 00 00 00 00 rpmsg_ns........ 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................ backtrace: [<000000009c94c9c1>] __kmem_cache_alloc_node+0x1f8/0x320 [<000000002300d89b>] __kmalloc_node_track_caller+0x44/0x70 [<00000000228a60c3>] kstrndup+0x4c/0x90 [<0000000077158695>] driver_set_override+0xd0/0x164 [<000000003e9c4ea5>] rpmsg_register_device_override+0x98/0x170 [<000000001c0c89a8>] rpmsg_ns_register_device+0x24/0x30 [<000000008bbf8fa2>] rpmsg_probe+0x2e0/0x3ec [<00000000e65a68df>] virtio_dev_probe+0x1c0/0x280 [<00000000443331cc>] really_probe+0xbc/0x2dc [<00000000391064b1>] __driver_probe_device+0x78/0xe0 [<00000000a41c9a5b>] driver_probe_device+0xd8/0x160 [<000000009c3bd5df>] __device_attach_driver+0xb8/0x140 [<0000000043cd7614>] bus_for_each_drv+0x7c/0xd4 [<000000003b929a36>] __device_attach+0x9c/0x19c [<00000000a94e0ba8>] device_initial_probe+0x14/0x20 [<000000003c999637>] bus_probe_device+0xa0/0xac(CVE-2023-52670)
In the Linux kernel, the following vulnerability has been resolved:
Fix page corruption caused by racy check in __free_pages
When we upgraded our kernel, we started seeing some page corruption like the following consistently:
BUG: Bad page state in process ganesha.nfsd pfn:1304ca page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca flags: 0x17ffffc0000000() raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000 raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000 page dumped because: nonzero mapcount CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1 Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016 Call Trace: dump_stack+0x74/0x96 bad_page.cold+0x63/0x94 check_new_page_bad+0x6d/0x80 rmqueue+0x46e/0x970 get_page_from_freelist+0xcb/0x3f0 ? _cond_resched+0x19/0x40 __alloc_pages_nodemask+0x164/0x300 alloc_pages_current+0x87/0xf0 skb_page_frag_refill+0x84/0x110 ...
Sometimes, it would also show up as corruption in the free list pointer and cause crashes.
After bisecting the issue, we found the issue started from commit e320d3012d25 ("mm/page_alloc.c: fix freeing non-compound pages"):
if (put_page_testzero(page))
free_the_page(page, order);
else if (!PageHead(page))
while (order-- > 0)
free_the_page(page + (1 << order), order);
So the problem is the check PageHead is racy because at this point we already dropped our reference to the page. So even if we came in with compound page, the page can already be freed and PageHead can return false and we will end up freeing all the tail pages causing double free.(CVE-2023-52739)
In the Linux kernel, the following vulnerability has been resolved:
atl1c: Work around the DMA RX overflow issue
This is based on alx driver commit 881d0327db37 ("net: alx: Work around the DMA RX overflow issue").
The alx and atl1c drivers had RX overflow error which was why a custom allocator was created to avoid certain addresses. The simpler workaround then created for alx driver, but not for atl1c due to lack of tester.
Instead of using a custom allocator, check the allocated skb address and use skb_reserve() to move away from problematic 0x...fc0 address.
Tested on AR8131 on Acer 4540.(CVE-2023-52834)
In the Linux kernel, the following vulnerability has been resolved:
hid: cp2112: Fix duplicate workqueue initialization
Previously the cp2112 driver called INIT_DELAYED_WORK within cp2112_gpio_irq_startup, resulting in duplicate initilizations of the workqueue on subsequent IRQ startups following an initial request. This resulted in a warning in set_work_data in workqueue.c, as well as a rare NULL dereference within process_one_work in workqueue.c.
Initialize the workqueue within _probe instead.(CVE-2023-52853)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: usb-audio: Stop parsing channels bits when all channels are found.
If a usb audio device sets more bits than the amount of channels it could write outside of the map array.(CVE-2024-27436)
In the Linux kernel, the following vulnerability has been resolved:
media: tc358743: register v4l2 async device only after successful setup
Ensure the device has been setup correctly before registering the v4l2 async device, thus allowing userspace to access.(CVE-2024-35830)
In the Linux kernel, the following vulnerability has been resolved:
usb: gadget: f_fs: Fix race between aio_cancel() and AIO request complete
FFS based applications can utilize the aio_cancel() callback to dequeue pending USB requests submitted to the UDC. There is a scenario where the FFS application issues an AIO cancel call, while the UDC is handling a soft disconnect. For a DWC3 based implementation, the callstack looks like the following:
DWC3 Gadget FFS Application
dwc3_gadget_soft_disconnect() ... --> dwc3_stop_active_transfers() --> dwc3_gadget_giveback(-ESHUTDOWN) --> ffs_epfile_async_io_complete() ffs_aio_cancel() --> usb_ep_free_request() --> usb_ep_dequeue()
There is currently no locking implemented between the AIO completion handler and AIO cancel, so the issue occurs if the completion routine is running in parallel to an AIO cancel call coming from the FFS application. As the completion call frees the USB request (io_data->req) the FFS application is also referencing it for the usb_ep_dequeue() call. This can lead to accessing a stale/hanging pointer.
commit b566d38857fc ("usb: gadget: f_fs: use io_data->status consistently") relocated the usb_ep_free_request() into ffs_epfile_async_io_complete(). However, in order to properly implement locking to mitigate this issue, the spinlock can't be added to ffs_epfile_async_io_complete(), as usb_ep_dequeue() (if successfully dequeuing a USB request) will call the function driver's completion handler in the same context. Hence, leading into a deadlock.
Fix this issue by moving the usb_ep_free_request() back to ffs_user_copy_worker(), and ensuring that it explicitly sets io_data->req to NULL after freeing it within the ffs->eps_lock. This resolves the race condition above, as the ffs_aio_cancel() routine will not continue attempting to dequeue a request that has already been freed, or the ffs_user_copy_work() not freeing the USB request until the AIO cancel is done referencing it.
This fix depends on commit b566d38857fc ("usb: gadget: f_fs: use io_data->status consistently")(CVE-2024-36894)
In the Linux kernel, the following vulnerability has been resolved:
wifi: nl80211: don't free NULL coalescing rule
If the parsing fails, we can dereference a NULL pointer here.(CVE-2024-36941)
In the Linux kernel, the following vulnerability has been resolved:
firewire: ohci: mask bus reset interrupts between ISR and bottom half
In the FireWire OHCI interrupt handler, if a bus reset interrupt has occurred, mask bus reset interrupts until bus_reset_work has serviced and cleared the interrupt.
Normally, we always leave bus reset interrupts masked. We infer the bus reset from the self-ID interrupt that happens shortly thereafter. A scenario where we unmask bus reset interrupts was introduced in 2008 in a007bb857e0b26f5d8b73c2ff90782d9c0972620: If OHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we will unmask bus reset interrupts so we can log them.
irq_handler logs the bus reset interrupt. However, we can't clear the bus reset event flag in irq_handler, because we won't service the event until later. irq_handler exits with the event flag still set. If the corresponding interrupt is still unmasked, the first bus reset will usually freeze the system due to irq_handler being called again each time it exits. This freeze can be reproduced by loading firewire_ohci with "modprobe firewire_ohci debug=-1" (to enable all debugging output). Apparently there are also some cases where bus_reset_work will get called soon enough to clear the event, and operation will continue normally.
This freeze was first reported a few months after a007bb85 was committed, but until now it was never fixed. The debug level could safely be set to -1 through sysfs after the module was loaded, but this would be ineffectual in logging bus reset interrupts since they were only unmasked during initialization.
irq_handler will now leave the event flag set but mask bus reset interrupts, so irq_handler won't be called again and there will be no freeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will unmask the interrupt after servicing the event, so future interrupts will be caught as desired.
As a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be enabled through sysfs in addition to during initial module loading. However, when enabled through sysfs, logging of bus reset interrupts will be effective only starting with the second bus reset, after bus_reset_work has executed.(CVE-2024-36950)
In the Linux kernel, the following vulnerability has been resolved:
net: fix __dst_negative_advice() race
__dst_negative_advice() does not enforce proper RCU rules when sk->dst_cache must be cleared, leading to possible UAF.
RCU rules are that we must first clear sk->sk_dst_cache, then call dst_release(old_dst).
Note that sk_dst_reset(sk) is implementing this protocol correctly, while __dst_negative_advice() uses the wrong order.
Given that ip6_negative_advice() has special logic against RTF_CACHE, this means each of the three ->negative_advice() existing methods must perform the sk_dst_reset() themselves.
Note the check against NULL dst is centralized in __dst_negative_advice(), there is no need to duplicate it in various callbacks.
Many thanks to Clement Lecigne for tracking this issue.
This old bug became visible after the blamed commit, using UDP sockets.(CVE-2024-36971)
In the Linux kernel, the following vulnerability has been resolved:
net: bridge: xmit: make sure we have at least eth header len bytes
syzbot triggered an uninit value[1] error in bridge device's xmit path by sending a short (less than ETH_HLEN bytes) skb. To fix it check if we can actually pull that amount instead of assuming.
Tested with dropwatch: drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3) origin: software timestamp: Mon May 13 11:31:53 2024 778214037 nsec protocol: 0x88a8 length: 2 original length: 2 drop reason: PKT_TOO_SMALL
[1] BUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 __netdev_start_xmit include/linux/netdevice.h:4903 [inline] netdev_start_xmit include/linux/netdevice.h:4917 [inline] xmit_one net/core/dev.c:3531 [inline] dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547 __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341 dev_queue_xmit include/linux/netdevice.h:3091 [inline] __bpf_tx_skb net/core/filter.c:2136 [inline] __bpf_redirect_common net/core/filter.c:2180 [inline] __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187 _bpfclone_redirect net/core/filter.c:2460 [inline] bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432 _bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997 __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238 bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline] __bpf_prog_run include/linux/filter.h:657 [inline] bpf_prog_run include/linux/filter.h:664 [inline] bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425 bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058 bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269 __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678 __do_sys_bpf kernel/bpf/syscall.c:5767 [inline] __se_sys_bpf kernel/bpf/syscall.c:5765 [inline] __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765 x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)
In the Linux kernel, the following vulnerability has been resolved:
of: module: add buffer overflow check in of_modalias()
In of_modalias(), if the buffer happens to be too small even for the 1st snprintf() call, the len parameter will become negative and str parameter (if not NULL initially) will point beyond the buffer's end. Add the buffer overflow check after the 1st snprintf() call and fix such check after the strlen() call (accounting for the terminating NUL char).(CVE-2024-38541)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix potential index out of bounds in color transformation function
Fixes index out of bounds issue in the color transformation function. The issue could occur when the index 'i' exceeds the number of transfer function points (TRANSFER_FUNC_POINTS).
The fix adds a check to ensure 'i' is within bounds before accessing the transfer function points. If 'i' is out of bounds, an error message is logged and the function returns false to indicate an error.
Reported by smatch: drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:405 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.red' 1025 <= s32max drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:406 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.green' 1025 <= s32max drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:407 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.blue' 1025 <= s32max(CVE-2024-38552)
In the Linux kernel, the following vulnerability has been resolved:
ftrace: Fix possible use-after-free issue in ftrace_location()
KASAN reports a bug:
BUG: KASAN: use-after-free in ftrace_location+0x90/0x120 Read of size 8 at addr ffff888141d40010 by task insmod/424 CPU: 8 PID: 424 Comm: insmod Tainted: G W 6.9.0-rc2+ [...] Call Trace: <TASK> dump_stack_lvl+0x68/0xa0 print_report+0xcf/0x610 kasan_report+0xb5/0xe0 ftrace_location+0x90/0x120 register_kprobe+0x14b/0xa40 kprobe_init+0x2d/0xff0 [kprobe_example] do_one_initcall+0x8f/0x2d0 do_init_module+0x13a/0x3c0 load_module+0x3082/0x33d0 init_module_from_file+0xd2/0x130 __x64_sys_finit_module+0x306/0x440 do_syscall_64+0x68/0x140 entry_SYSCALL_64_after_hwframe+0x71/0x79
The root cause is that, in lookup_rec(), ftrace record of some address is being searched in ftrace pages of some module, but those ftrace pages at the same time is being freed in ftrace_release_mod() as the corresponding module is being deleted:
CPU1 | CPU2
register_kprobes() { | delete_module() { check_kprobe_address_safe() { | arch_check_ftrace_location() { | ftrace_location() { | lookup_rec() // USE! | ftrace_release_mod() // Free!
To fix this issue: 1. Hold rcu lock as accessing ftrace pages in ftrace_location_range(); 2. Use ftrace_location_range() instead of lookup_rec() in ftrace_location(); 3. Call synchronize_rcu() before freeing any ftrace pages both in ftrace_process_locs()/ftrace_release_mod()/ftrace_free_mem().(CVE-2024-38588)
In the Linux kernel, the following vulnerability has been resolved:
af_unix: Fix data races in unix_release_sock/unix_stream_sendmsg
A data-race condition has been identified in af_unix. In one data path, the write function unix_release_sock() atomically writes to sk->sk_shutdown using WRITE_ONCE. However, on the reader side, unix_stream_sendmsg() does not read it atomically. Consequently, this issue is causing the following KCSAN splat to occur:
BUG: KCSAN: data-race in unix_release_sock / unix_stream_sendmsg
write (marked) to 0xffff88867256ddbb of 1 bytes by task 7270 on cpu 28:
unix_release_sock (net/unix/af_unix.c:640)
unix_release (net/unix/af_unix.c:1050)
sock_close (net/socket.c:659 net/socket.c:1421)
__fput (fs/file_table.c:422)
__fput_sync (fs/file_table.c:508)
__se_sys_close (fs/open.c:1559 fs/open.c:1541)
__x64_sys_close (fs/open.c:1541)
x64_sys_call (arch/x86/entry/syscall_64.c:33)
do_syscall_64 (arch/x86/entry/common.c:?)
entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
read to 0xffff88867256ddbb of 1 bytes by task 989 on cpu 14:
unix_stream_sendmsg (net/unix/af_unix.c:2273)
__sock_sendmsg (net/socket.c:730 net/socket.c:745)
____sys_sendmsg (net/socket.c:2584)
__sys_sendmmsg (net/socket.c:2638 net/socket.c:2724)
__x64_sys_sendmmsg (net/socket.c:2753 net/socket.c:2750 net/socket.c:2750)
x64_sys_call (arch/x86/entry/syscall_64.c:33)
do_syscall_64 (arch/x86/entry/common.c:?)
entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
value changed: 0x01 -> 0x03
The line numbers are related to commit dd5a440a31fa ("Linux 6.9-rc7").
Commit e1d09c2c2f57 ("af_unix: Fix data races around sk->sk_shutdown.") addressed a comparable issue in the past regarding sk->sk_shutdown. However, it overlooked resolving this particular data path. This patch only offending unix_stream_sendmsg() function, since the other reads seem to be protected by unix_state_lock() as discussed in(CVE-2024-38596)
In the Linux kernel, the following vulnerability has been resolved:
macintosh/via-macii: Fix "BUG: sleeping function called from invalid context"
The via-macii ADB driver calls request_irq() after disabling hard interrupts. But disabling interrupts isn't necessary here because the VIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"bpftool-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2406.4.0.0283.oe2003sp4.src.rpm"
],
"x86_64": [
"perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"bpftool-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2406.4.0.0283.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: mcba_usb: fix memory leak in mcba_usb\r\n\r\nSyzbot reported memory leak in SocketCAN driver for Microchip CAN BUS\nAnalyzer Tool. The problem was in unfreed usb_coherent.\r\n\r\nIn mcba_usb_start() 20 coherent buffers are allocated and there is\nnothing, that frees them:\r\n\r\n1) In callback function the urb is resubmitted and that\u0026apos;s all\n2) In disconnect function urbs are simply killed, but URB_FREE_BUFFER\n is not set (see mcba_usb_start) and this flag cannot be used with\n coherent buffers.\r\n\r\nFail log:\n| [ 1354.053291][ T8413] mcba_usb 1-1:0.0 can0: device disconnected\n| [ 1367.059384][ T8420] kmemleak: 20 new suspected memory leaks (see /sys/kernel/debug/kmem)\r\n\r\nSo, all allocated buffers should be freed with usb_free_coherent()\nexplicitly\r\n\r\nNOTE:\nThe same pattern for allocating and freeing coherent buffers\nis used in drivers/net/can/usb/kvaser_usb/kvaser_usb_core.c(CVE-2021-47231)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: j1939: fix Use-after-Free, hold skb ref while in use\r\n\r\nThis patch fixes a Use-after-Free found by the syzbot.\r\n\r\nThe problem is that a skb is taken from the per-session skb queue,\nwithout incrementing the ref count. This leads to a Use-after-Free if\nthe skb is taken concurrently from the session queue due to a CTS.(CVE-2021-47232)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbatman-adv: Avoid WARN_ON timing related checks\r\n\r\nThe soft/batadv interface for a queued OGM can be changed during the time\nthe OGM was queued for transmission and when the OGM is actually\ntransmitted by the worker.\r\n\r\nBut WARN_ON must be used to denote kernel bugs and not to print simple\nwarnings. A warning can simply be printed using pr_warn.(CVE-2021-47252)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: ngene: Fix out-of-bounds bug in ngene_command_config_free_buf()\r\n\r\nFix an 11-year old bug in ngene_command_config_free_buf() while\naddressing the following warnings caught with -Warray-bounds:\r\n\r\narch/alpha/include/asm/string.h:22:16: warning: \u0026apos;__builtin_memcpy\u0026apos; offset [12, 16] from the object at \u0026apos;com\u0026apos; is out of the bounds of referenced subobject \u0026apos;config\u0026apos; with type \u0026apos;unsigned char\u0026apos; at offset 10 [-Warray-bounds]\narch/x86/include/asm/string_32.h:182:25: warning: \u0026apos;__builtin_memcpy\u0026apos; offset [12, 16] from the object at \u0026apos;com\u0026apos; is out of the bounds of referenced subobject \u0026apos;config\u0026apos; with type \u0026apos;unsigned char\u0026apos; at offset 10 [-Warray-bounds]\r\n\r\nThe problem is that the original code is trying to copy 6 bytes of\ndata into a one-byte size member _config_ of the wrong structue\nFW_CONFIGURE_BUFFERS, in a single call to memcpy(). This causes a\nlegitimate compiler warning because memcpy() overruns the length\nof \u0026amp;com.cmd.ConfigureBuffers.config. It seems that the right\nstructure is FW_CONFIGURE_FREE_BUFFERS, instead, because it contains\n6 more members apart from the header _hdr_. Also, the name of\nthe function ngene_command_config_free_buf() suggests that the actual\nintention is to ConfigureFreeBuffers, instead of ConfigureBuffers\n(which takes place in the function ngene_command_config_buf(), above).\r\n\r\nFix this by enclosing those 6 members of struct FW_CONFIGURE_FREE_BUFFERS\ninto new struct config, and use \u0026amp;com.cmd.ConfigureFreeBuffers.config as\nthe destination address, instead of \u0026amp;com.cmd.ConfigureBuffers.config,\nwhen calling memcpy().\r\n\r\nThis also helps with the ongoing efforts to globally enable\n-Warray-bounds and get us closer to being able to tighten the\nFORTIFY_SOURCE routines on memcpy().(CVE-2021-47288)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncoresight: tmc-etf: Fix global-out-of-bounds in tmc_update_etf_buffer()\r\n\r\ncommit 6f755e85c332 (\u0026quot;coresight: Add helper for inserting synchronization\npackets\u0026quot;) removed trailing \u0026apos;\\0\u0026apos; from barrier_pkt array and updated the\ncall sites like etb_update_buffer() to have proper checks for barrier_pkt\nsize before read but missed updating tmc_update_etf_buffer() which still\nreads barrier_pkt past the array size resulting in KASAN out-of-bounds\nbug. Fix this by adding a check for barrier_pkt size before accessing\nlike it is done in etb_update_buffer().\r\n\r\n BUG: KASAN: global-out-of-bounds in tmc_update_etf_buffer+0x4b8/0x698\n Read of size 4 at addr ffffffd05b7d1030 by task perf/2629\r\n\r\n Call trace:\n dump_backtrace+0x0/0x27c\n show_stack+0x20/0x2c\n dump_stack+0x11c/0x188\n print_address_description+0x3c/0x4a4\n __kasan_report+0x140/0x164\n kasan_report+0x10/0x18\n __asan_report_load4_noabort+0x1c/0x24\n tmc_update_etf_buffer+0x4b8/0x698\n etm_event_stop+0x248/0x2d8\n etm_event_del+0x20/0x2c\n event_sched_out+0x214/0x6f0\n group_sched_out+0xd0/0x270\n ctx_sched_out+0x2ec/0x518\n __perf_event_task_sched_out+0x4fc/0xe6c\n __schedule+0x1094/0x16a0\n preempt_schedule_irq+0x88/0x170\n arm64_preempt_schedule_irq+0xf0/0x18c\n el1_irq+0xe8/0x180\n perf_event_exec+0x4d8/0x56c\n setup_new_exec+0x204/0x400\n load_elf_binary+0x72c/0x18c0\n search_binary_handler+0x13c/0x420\n load_script+0x500/0x6c4\n search_binary_handler+0x13c/0x420\n exec_binprm+0x118/0x654\n __do_execve_file+0x77c/0xba4\n __arm64_compat_sys_execve+0x98/0xac\n el0_svc_common+0x1f8/0x5e0\n el0_svc_compat_handler+0x84/0xb0\n el0_svc_compat+0x10/0x50\r\n\r\n The buggy address belongs to the variable:\n barrier_pkt+0x10/0x40\r\n\r\n Memory state around the buggy address:\n ffffffd05b7d0f00: fa fa fa fa 04 fa fa fa fa fa fa fa 00 00 00 00\n ffffffd05b7d0f80: 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00\n \u0026gt;ffffffd05b7d1000: 00 00 00 00 00 00 fa fa fa fa fa fa 00 00 00 03\n ^\n ffffffd05b7d1080: fa fa fa fa 00 02 fa fa fa fa fa fa 03 fa fa fa\n ffffffd05b7d1100: fa fa fa fa 00 00 00 00 05 fa fa fa fa fa fa fa\n ==================================================================(CVE-2021-47346)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwl1251: Fix possible buffer overflow in wl1251_cmd_scan\r\n\r\nFunction wl1251_cmd_scan calls memcpy without checking the length.\nHarden by checking the length is within the maximum allowed size.(CVE-2021-47347)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nxhci: Fix command ring pointer corruption while aborting a command\r\n\r\nThe command ring pointer is located at [6:63] bits of the command\nring control register (CRCR). All the control bits like command stop,\nabort are located at [0:3] bits. While aborting a command, we read the\nCRCR and set the abort bit and write to the CRCR. The read will always\ngive command ring pointer as all zeros. So we essentially write only\nthe control bits. Since we split the 64 bit write into two 32 bit writes,\nthere is a possibility of xHC command ring stopped before the upper\ndword (all zeros) is written. If that happens, xHC updates the upper\ndword of its internal command ring pointer with all zeros. Next time,\nwhen the command ring is restarted, we see xHC memory access failures.\nFix this issue by only writing to the lower dword of CRCR where all\ncontrol bits are located.(CVE-2021-47434)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmm, slub: fix potential memoryleak in kmem_cache_open()\r\n\r\nIn error path, the random_seq of slub cache might be leaked. Fix this\nby using __kmem_cache_release() to release all the relevant resources.(CVE-2021-47466)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nspi: Fix deadlock when adding SPI controllers on SPI buses\r\n\r\nCurrently we have a global spi_add_lock which we take when adding new\ndevices so that we can check that we\u0026apos;re not trying to reuse a chip\nselect that\u0026apos;s already controlled. This means that if the SPI device is\nitself a SPI controller and triggers the instantiation of further SPI\ndevices we trigger a deadlock as we try to register and instantiate\nthose devices while in the process of doing so for the parent controller\nand hence already holding the global spi_add_lock. Since we only care\nabout concurrency within a single SPI bus move the lock to be per\ncontroller, avoiding the deadlock.\r\n\r\nThis can be easily triggered in the case of spi-mux.(CVE-2021-47469)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nocfs2: fix race between searching chunks and release journal_head from buffer_head\r\n\r\nEncountered a race between ocfs2_test_bg_bit_allocatable() and\njbd2_journal_put_journal_head() resulting in the below vmcore.\r\n\r\n PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: \u0026quot;loop3\u0026quot;\n Call trace:\n panic\n oops_end\n no_context\n __bad_area_nosemaphore\n bad_area_nosemaphore\n __do_page_fault\n do_page_fault\n page_fault\n [exception RIP: ocfs2_block_group_find_clear_bits+316]\n ocfs2_block_group_find_clear_bits [ocfs2]\n ocfs2_cluster_group_search [ocfs2]\n ocfs2_search_chain [ocfs2]\n ocfs2_claim_suballoc_bits [ocfs2]\n __ocfs2_claim_clusters [ocfs2]\n ocfs2_claim_clusters [ocfs2]\n ocfs2_local_alloc_slide_window [ocfs2]\n ocfs2_reserve_local_alloc_bits [ocfs2]\n ocfs2_reserve_clusters_with_limit [ocfs2]\n ocfs2_reserve_clusters [ocfs2]\n ocfs2_lock_refcount_allocators [ocfs2]\n ocfs2_make_clusters_writable [ocfs2]\n ocfs2_replace_cow [ocfs2]\n ocfs2_refcount_cow [ocfs2]\n ocfs2_file_write_iter [ocfs2]\n lo_rw_aio\n loop_queue_work\n kthread_worker_fn\n kthread\n ret_from_fork\r\n\r\nWhen ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the\nbg_bh-\u0026gt;b_private NULL as jbd2_journal_put_journal_head() raced and\nreleased the jounal head from the buffer head. Needed to take bit lock\nfor the bit \u0026apos;BH_JournalHead\u0026apos; to fix this race.(CVE-2021-47493)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\niio: mma8452: Fix trigger reference couting\r\n\r\nThe mma8452 driver directly assigns a trigger to the struct iio_dev. The\nIIO core when done using this trigger will call `iio_trigger_put()` to drop\nthe reference count by 1.\r\n\r\nWithout the matching `iio_trigger_get()` in the driver the reference count\ncan reach 0 too early, the trigger gets freed while still in use and a\nuse-after-free occurs.\r\n\r\nFix this by getting a reference to the trigger before assigning it to the\nIIO device.(CVE-2021-47500)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: sja1000: fix use after free in ems_pcmcia_add_card()\r\n\r\nIf the last channel is not available then \u0026quot;dev\u0026quot; is freed. Fortunately,\nwe can just use \u0026quot;pdev-\u0026gt;irq\u0026quot; instead.\r\n\r\nAlso we should check if at least one channel was set up.(CVE-2021-47521)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: mpt3sas: Fix kernel panic during drive powercycle test\r\n\r\nWhile looping over shost\u0026apos;s sdev list it is possible that one\nof the drives is getting removed and its sas_target object is\nfreed but its sdev object remains intact.\r\n\r\nConsequently, a kernel panic can occur while the driver is trying to access\nthe sas_address field of sas_target object without also checking the\nsas_target object for NULL.(CVE-2021-47565)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ninet_diag: fix kernel-infoleak for UDP sockets\r\n\r\nKMSAN reported a kernel-infoleak [1], that can exploited\nby unpriv users.\r\n\r\nAfter analysis it turned out UDP was not initializing\nr-\u0026gt;idiag_expires. Other users of inet_sk_diag_fill()\nmight make the same mistake in the future, so fix this\nin inet_sk_diag_fill().\r\n\r\n[1]\nBUG: KMSAN: kernel-infoleak in instrument_copy_to_user include/linux/instrumented.h:121 [inline]\nBUG: KMSAN: kernel-infoleak in copyout lib/iov_iter.c:156 [inline]\nBUG: KMSAN: kernel-infoleak in _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670\n instrument_copy_to_user include/linux/instrumented.h:121 [inline]\n copyout lib/iov_iter.c:156 [inline]\n _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670\n copy_to_iter include/linux/uio.h:155 [inline]\n simple_copy_to_iter+0xf3/0x140 net/core/datagram.c:519\n __skb_datagram_iter+0x2cb/0x1280 net/core/datagram.c:425\n skb_copy_datagram_iter+0xdc/0x270 net/core/datagram.c:533\n skb_copy_datagram_msg include/linux/skbuff.h:3657 [inline]\n netlink_recvmsg+0x660/0x1c60 net/netlink/af_netlink.c:1974\n sock_recvmsg_nosec net/socket.c:944 [inline]\n sock_recvmsg net/socket.c:962 [inline]\n sock_read_iter+0x5a9/0x630 net/socket.c:1035\n call_read_iter include/linux/fs.h:2156 [inline]\n new_sync_read fs/read_write.c:400 [inline]\n vfs_read+0x1631/0x1980 fs/read_write.c:481\n ksys_read+0x28c/0x520 fs/read_write.c:619\n __do_sys_read fs/read_write.c:629 [inline]\n __se_sys_read fs/read_write.c:627 [inline]\n __x64_sys_read+0xdb/0x120 fs/read_write.c:627\n do_syscall_x64 arch/x86/entry/common.c:51 [inline]\n do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82\n entry_SYSCALL_64_after_hwframe+0x44/0xae\r\n\r\nUninit was created at:\n slab_post_alloc_hook mm/slab.h:524 [inline]\n slab_alloc_node mm/slub.c:3251 [inline]\n __kmalloc_node_track_caller+0xe0c/0x1510 mm/slub.c:4974\n kmalloc_reserve net/core/skbuff.c:354 [inline]\n __alloc_skb+0x545/0xf90 net/core/skbuff.c:426\n alloc_skb include/linux/skbuff.h:1126 [inline]\n netlink_dump+0x3d5/0x16a0 net/netlink/af_netlink.c:2245\n __netlink_dump_start+0xd1c/0xee0 net/netlink/af_netlink.c:2370\n netlink_dump_start include/linux/netlink.h:254 [inline]\n inet_diag_handler_cmd+0x2e7/0x400 net/ipv4/inet_diag.c:1343\n sock_diag_rcv_msg+0x24a/0x620\n netlink_rcv_skb+0x447/0x800 net/netlink/af_netlink.c:2491\n sock_diag_rcv+0x63/0x80 net/core/sock_diag.c:276\n netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline]\n netlink_unicast+0x1095/0x1360 net/netlink/af_netlink.c:1345\n netlink_sendmsg+0x16f3/0x1870 net/netlink/af_netlink.c:1916\n sock_sendmsg_nosec net/socket.c:704 [inline]\n sock_sendmsg net/socket.c:724 [inline]\n sock_write_iter+0x594/0x690 net/socket.c:1057\n do_iter_readv_writev+0xa7f/0xc70\n do_iter_write+0x52c/0x1500 fs/read_write.c:851\n vfs_writev fs/read_write.c:924 [inline]\n do_writev+0x63f/0xe30 fs/read_write.c:967\n __do_sys_writev fs/read_write.c:1040 [inline]\n __se_sys_writev fs/read_write.c:1037 [inline]\n __x64_sys_writev+0xe5/0x120 fs/read_write.c:1037\n do_syscall_x64 arch/x86/entry/common.c:51 [inline]\n do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82\n entry_SYSCALL_64_after_hwframe+0x44/0xae\r\n\r\nBytes 68-71 of 312 are uninitialized\nMemory access of size 312 starts at ffff88812ab54000\nData copied to user address 0000000020001440\r\n\r\nCPU: 1 PID: 6365 Comm: syz-executor801 Not tainted 5.16.0-rc3-syzkaller #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/01/2011(CVE-2021-47597)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfirmware: arm_scpi: Fix string overflow in SCPI genpd driver\r\n\r\nWithout the bound checks for scpi_pd-\u0026gt;name, it could result in the buffer\noverflow when copying the SCPI device name from the corresponding device\ntree node as the name string is set at maximum size of 30.\r\n\r\nLet us fix it by using devm_kasprintf so that the string buffer is\nallocated dynamically.(CVE-2021-47609)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nASoC: ops: Reject out of bounds values in snd_soc_put_volsw_sx()\r\n\r\nWe don\u0026apos;t currently validate that the values being set are within the range\nwe advertised to userspace as being valid, do so and reject any values\nthat are out of range.(CVE-2022-48737)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npowerpc64/bpf: Limit \u0026apos;ldbrx\u0026apos; to processors compliant with ISA v2.06\r\n\r\nJohan reported the below crash with test_bpf on ppc64 e5500:\r\n\r\n test_bpf: #296 ALU_END_FROM_LE 64: 0x0123456789abcdef -\u0026gt; 0x67452301 jited:1\n Oops: Exception in kernel mode, sig: 4 [#1]\n BE PAGE_SIZE=4K SMP NR_CPUS=24 QEMU e500\n Modules linked in: test_bpf(+)\n CPU: 0 PID: 76 Comm: insmod Not tainted 5.14.0-03771-g98c2059e008a-dirty #1\n NIP: 8000000000061c3c LR: 80000000006dea64 CTR: 8000000000061c18\n REGS: c0000000032d3420 TRAP: 0700 Not tainted (5.14.0-03771-g98c2059e008a-dirty)\n MSR: 0000000080089000 \u0026lt;EE,ME\u0026gt; CR: 88002822 XER: 20000000 IRQMASK: 0\n \u0026lt;...\u0026gt;\n NIP [8000000000061c3c] 0x8000000000061c3c\n LR [80000000006dea64] .__run_one+0x104/0x17c [test_bpf]\n Call Trace:\n .__run_one+0x60/0x17c [test_bpf] (unreliable)\n .test_bpf_init+0x6a8/0xdc8 [test_bpf]\n .do_one_initcall+0x6c/0x28c\n .do_init_module+0x68/0x28c\n .load_module+0x2460/0x2abc\n .__do_sys_init_module+0x120/0x18c\n .system_call_exception+0x110/0x1b8\n system_call_common+0xf0/0x210\n --- interrupt: c00 at 0x101d0acc\n \u0026lt;...\u0026gt;\n ---[ end trace 47b2bf19090bb3d0 ]---\r\n\r\n Illegal instruction\r\n\r\nThe illegal instruction turned out to be \u0026apos;ldbrx\u0026apos; emitted for\nBPF_FROM_[L|B]E, which was only introduced in ISA v2.06. Guard use of\nthe same and implement an alternative approach for older processors.(CVE-2022-48755)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/msm/dsi: invalid parameter check in msm_dsi_phy_enable\r\n\r\nThe function performs a check on the \u0026quot;phy\u0026quot; input parameter, however, it\nis used before the check.\r\n\r\nInitialize the \u0026quot;dev\u0026quot; variable after the sanity check to avoid a possible\nNULL pointer dereference.\r\n\r\nAddresses-Coverity-ID: 1493860 (\u0026quot;Null pointer dereference\u0026quot;)(CVE-2022-48756)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nrpmsg: virtio: Free driver_override when rpmsg_remove()\r\n\r\nFree driver_override when rpmsg_remove(), otherwise\nthe following memory leak will occur:\r\n\r\nunreferenced object 0xffff0000d55d7080 (size 128):\n comm \u0026quot;kworker/u8:2\u0026quot;, pid 56, jiffies 4294893188 (age 214.272s)\n hex dump (first 32 bytes):\n 72 70 6d 73 67 5f 6e 73 00 00 00 00 00 00 00 00 rpmsg_ns........\n 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................\n backtrace:\n [\u0026lt;000000009c94c9c1\u0026gt;] __kmem_cache_alloc_node+0x1f8/0x320\n [\u0026lt;000000002300d89b\u0026gt;] __kmalloc_node_track_caller+0x44/0x70\n [\u0026lt;00000000228a60c3\u0026gt;] kstrndup+0x4c/0x90\n [\u0026lt;0000000077158695\u0026gt;] driver_set_override+0xd0/0x164\n [\u0026lt;000000003e9c4ea5\u0026gt;] rpmsg_register_device_override+0x98/0x170\n [\u0026lt;000000001c0c89a8\u0026gt;] rpmsg_ns_register_device+0x24/0x30\n [\u0026lt;000000008bbf8fa2\u0026gt;] rpmsg_probe+0x2e0/0x3ec\n [\u0026lt;00000000e65a68df\u0026gt;] virtio_dev_probe+0x1c0/0x280\n [\u0026lt;00000000443331cc\u0026gt;] really_probe+0xbc/0x2dc\n [\u0026lt;00000000391064b1\u0026gt;] __driver_probe_device+0x78/0xe0\n [\u0026lt;00000000a41c9a5b\u0026gt;] driver_probe_device+0xd8/0x160\n [\u0026lt;000000009c3bd5df\u0026gt;] __device_attach_driver+0xb8/0x140\n [\u0026lt;0000000043cd7614\u0026gt;] bus_for_each_drv+0x7c/0xd4\n [\u0026lt;000000003b929a36\u0026gt;] __device_attach+0x9c/0x19c\n [\u0026lt;00000000a94e0ba8\u0026gt;] device_initial_probe+0x14/0x20\n [\u0026lt;000000003c999637\u0026gt;] bus_probe_device+0xa0/0xac(CVE-2023-52670)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nFix page corruption caused by racy check in __free_pages\r\n\r\nWhen we upgraded our kernel, we started seeing some page corruption like\nthe following consistently:\r\n\r\n BUG: Bad page state in process ganesha.nfsd pfn:1304ca\n page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca\n flags: 0x17ffffc0000000()\n raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000\n raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000\n page dumped because: nonzero mapcount\n CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1\n Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016\n Call Trace:\n dump_stack+0x74/0x96\n bad_page.cold+0x63/0x94\n check_new_page_bad+0x6d/0x80\n rmqueue+0x46e/0x970\n get_page_from_freelist+0xcb/0x3f0\n ? _cond_resched+0x19/0x40\n __alloc_pages_nodemask+0x164/0x300\n alloc_pages_current+0x87/0xf0\n skb_page_frag_refill+0x84/0x110\n ...\r\n\r\nSometimes, it would also show up as corruption in the free list pointer\nand cause crashes.\r\n\r\nAfter bisecting the issue, we found the issue started from commit\ne320d3012d25 (\u0026quot;mm/page_alloc.c: fix freeing non-compound pages\u0026quot;):\r\n\r\n\tif (put_page_testzero(page))\n\t\tfree_the_page(page, order);\n\telse if (!PageHead(page))\n\t\twhile (order-- \u0026gt; 0)\n\t\t\tfree_the_page(page + (1 \u0026lt;\u0026lt; order), order);\r\n\r\nSo the problem is the check PageHead is racy because at this point we\nalready dropped our reference to the page. So even if we came in with\ncompound page, the page can already be freed and PageHead can return\nfalse and we will end up freeing all the tail pages causing double free.(CVE-2023-52739)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\natl1c: Work around the DMA RX overflow issue\r\n\r\nThis is based on alx driver commit 881d0327db37 (\u0026quot;net: alx: Work around\nthe DMA RX overflow issue\u0026quot;).\r\n\r\nThe alx and atl1c drivers had RX overflow error which was why a custom\nallocator was created to avoid certain addresses. The simpler workaround\nthen created for alx driver, but not for atl1c due to lack of tester.\r\n\r\nInstead of using a custom allocator, check the allocated skb address and\nuse skb_reserve() to move away from problematic 0x...fc0 address.\r\n\r\nTested on AR8131 on Acer 4540.(CVE-2023-52834)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhid: cp2112: Fix duplicate workqueue initialization\r\n\r\nPreviously the cp2112 driver called INIT_DELAYED_WORK within\ncp2112_gpio_irq_startup, resulting in duplicate initilizations of the\nworkqueue on subsequent IRQ startups following an initial request. This\nresulted in a warning in set_work_data in workqueue.c, as well as a rare\nNULL dereference within process_one_work in workqueue.c.\r\n\r\nInitialize the workqueue within _probe instead.(CVE-2023-52853)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nALSA: usb-audio: Stop parsing channels bits when all channels are found.\r\n\r\nIf a usb audio device sets more bits than the amount of channels\nit could write outside of the map array.(CVE-2024-27436)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: tc358743: register v4l2 async device only after successful setup\r\n\r\nEnsure the device has been setup correctly before registering the v4l2\nasync device, thus allowing userspace to access.(CVE-2024-35830)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nusb: gadget: f_fs: Fix race between aio_cancel() and AIO request complete\r\n\r\nFFS based applications can utilize the aio_cancel() callback to dequeue\npending USB requests submitted to the UDC. There is a scenario where the\nFFS application issues an AIO cancel call, while the UDC is handling a\nsoft disconnect. For a DWC3 based implementation, the callstack looks\nlike the following:\r\n\r\n DWC3 Gadget FFS Application\ndwc3_gadget_soft_disconnect() ...\n --\u0026gt; dwc3_stop_active_transfers()\n --\u0026gt; dwc3_gadget_giveback(-ESHUTDOWN)\n --\u0026gt; ffs_epfile_async_io_complete() ffs_aio_cancel()\n --\u0026gt; usb_ep_free_request() --\u0026gt; usb_ep_dequeue()\r\n\r\nThere is currently no locking implemented between the AIO completion\nhandler and AIO cancel, so the issue occurs if the completion routine is\nrunning in parallel to an AIO cancel call coming from the FFS application.\nAs the completion call frees the USB request (io_data-\u0026gt;req) the FFS\napplication is also referencing it for the usb_ep_dequeue() call. This can\nlead to accessing a stale/hanging pointer.\r\n\r\ncommit b566d38857fc (\u0026quot;usb: gadget: f_fs: use io_data-\u0026gt;status consistently\u0026quot;)\nrelocated the usb_ep_free_request() into ffs_epfile_async_io_complete().\nHowever, in order to properly implement locking to mitigate this issue, the\nspinlock can\u0026apos;t be added to ffs_epfile_async_io_complete(), as\nusb_ep_dequeue() (if successfully dequeuing a USB request) will call the\nfunction driver\u0026apos;s completion handler in the same context. Hence, leading\ninto a deadlock.\r\n\r\nFix this issue by moving the usb_ep_free_request() back to\nffs_user_copy_worker(), and ensuring that it explicitly sets io_data-\u0026gt;req\nto NULL after freeing it within the ffs-\u0026gt;eps_lock. This resolves the race\ncondition above, as the ffs_aio_cancel() routine will not continue\nattempting to dequeue a request that has already been freed, or the\nffs_user_copy_work() not freeing the USB request until the AIO cancel is\ndone referencing it.\r\n\r\nThis fix depends on\n commit b566d38857fc (\u0026quot;usb: gadget: f_fs: use io_data-\u0026gt;status\n consistently\u0026quot;)(CVE-2024-36894)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: nl80211: don\u0026apos;t free NULL coalescing rule\r\n\r\nIf the parsing fails, we can dereference a NULL pointer here.(CVE-2024-36941)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfirewire: ohci: mask bus reset interrupts between ISR and bottom half\r\n\r\nIn the FireWire OHCI interrupt handler, if a bus reset interrupt has\noccurred, mask bus reset interrupts until bus_reset_work has serviced and\ncleared the interrupt.\r\n\r\nNormally, we always leave bus reset interrupts masked. We infer the bus\nreset from the self-ID interrupt that happens shortly thereafter. A\nscenario where we unmask bus reset interrupts was introduced in 2008 in\na007bb857e0b26f5d8b73c2ff90782d9c0972620: If\nOHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we\nwill unmask bus reset interrupts so we can log them.\r\n\r\nirq_handler logs the bus reset interrupt. However, we can\u0026apos;t clear the bus\nreset event flag in irq_handler, because we won\u0026apos;t service the event until\nlater. irq_handler exits with the event flag still set. If the\ncorresponding interrupt is still unmasked, the first bus reset will\nusually freeze the system due to irq_handler being called again each\ntime it exits. This freeze can be reproduced by loading firewire_ohci\nwith \u0026quot;modprobe firewire_ohci debug=-1\u0026quot; (to enable all debugging output).\nApparently there are also some cases where bus_reset_work will get called\nsoon enough to clear the event, and operation will continue normally.\r\n\r\nThis freeze was first reported a few months after a007bb85 was committed,\nbut until now it was never fixed. The debug level could safely be set\nto -1 through sysfs after the module was loaded, but this would be\nineffectual in logging bus reset interrupts since they were only\nunmasked during initialization.\r\n\r\nirq_handler will now leave the event flag set but mask bus reset\ninterrupts, so irq_handler won\u0026apos;t be called again and there will be no\nfreeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will\nunmask the interrupt after servicing the event, so future interrupts\nwill be caught as desired.\r\n\r\nAs a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be\nenabled through sysfs in addition to during initial module loading.\nHowever, when enabled through sysfs, logging of bus reset interrupts will\nbe effective only starting with the second bus reset, after\nbus_reset_work has executed.(CVE-2024-36950)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: fix __dst_negative_advice() race\r\n\r\n__dst_negative_advice() does not enforce proper RCU rules when\nsk-\u0026gt;dst_cache must be cleared, leading to possible UAF.\r\n\r\nRCU rules are that we must first clear sk-\u0026gt;sk_dst_cache,\nthen call dst_release(old_dst).\r\n\r\nNote that sk_dst_reset(sk) is implementing this protocol correctly,\nwhile __dst_negative_advice() uses the wrong order.\r\n\r\nGiven that ip6_negative_advice() has special logic\nagainst RTF_CACHE, this means each of the three -\u0026gt;negative_advice()\nexisting methods must perform the sk_dst_reset() themselves.\r\n\r\nNote the check against NULL dst is centralized in\n__dst_negative_advice(), there is no need to duplicate\nit in various callbacks.\r\n\r\nMany thanks to Clement Lecigne for tracking this issue.\r\n\r\nThis old bug became visible after the blamed commit, using UDP sockets.(CVE-2024-36971)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: bridge: xmit: make sure we have at least eth header len bytes\r\n\r\nsyzbot triggered an uninit value[1] error in bridge device\u0026apos;s xmit path\nby sending a short (less than ETH_HLEN bytes) skb. To fix it check if\nwe can actually pull that amount instead of assuming.\r\n\r\nTested with dropwatch:\n drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3)\n origin: software\n timestamp: Mon May 13 11:31:53 2024 778214037 nsec\n protocol: 0x88a8\n length: 2\n original length: 2\n drop reason: PKT_TOO_SMALL\r\n\r\n[1]\nBUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n __netdev_start_xmit include/linux/netdevice.h:4903 [inline]\n netdev_start_xmit include/linux/netdevice.h:4917 [inline]\n xmit_one net/core/dev.c:3531 [inline]\n dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547\n __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341\n dev_queue_xmit include/linux/netdevice.h:3091 [inline]\n __bpf_tx_skb net/core/filter.c:2136 [inline]\n __bpf_redirect_common net/core/filter.c:2180 [inline]\n __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187\n ____bpf_clone_redirect net/core/filter.c:2460 [inline]\n bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432\n ___bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997\n __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238\n bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline]\n __bpf_prog_run include/linux/filter.h:657 [inline]\n bpf_prog_run include/linux/filter.h:664 [inline]\n bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425\n bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058\n bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269\n __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678\n __do_sys_bpf kernel/bpf/syscall.c:5767 [inline]\n __se_sys_bpf kernel/bpf/syscall.c:5765 [inline]\n __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765\n x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nof: module: add buffer overflow check in of_modalias()\r\n\r\nIn of_modalias(), if the buffer happens to be too small even for the 1st\nsnprintf() call, the len parameter will become negative and str parameter\n(if not NULL initially) will point beyond the buffer\u0026apos;s end. Add the buffer\noverflow check after the 1st snprintf() call and fix such check after the\nstrlen() call (accounting for the terminating NUL char).(CVE-2024-38541)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix potential index out of bounds in color transformation function\r\n\r\nFixes index out of bounds issue in the color transformation function.\nThe issue could occur when the index \u0026apos;i\u0026apos; exceeds the number of transfer\nfunction points (TRANSFER_FUNC_POINTS).\r\n\r\nThe fix adds a check to ensure \u0026apos;i\u0026apos; is within bounds before accessing the\ntransfer function points. If \u0026apos;i\u0026apos; is out of bounds, an error message is\nlogged and the function returns false to indicate an error.\r\n\r\nReported by smatch:\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:405 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.red\u0026apos; 1025 \u0026lt;= s32max\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:406 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.green\u0026apos; 1025 \u0026lt;= s32max\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:407 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.blue\u0026apos; 1025 \u0026lt;= s32max(CVE-2024-38552)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nftrace: Fix possible use-after-free issue in ftrace_location()\r\n\r\nKASAN reports a bug:\r\n\r\n BUG: KASAN: use-after-free in ftrace_location+0x90/0x120\n Read of size 8 at addr ffff888141d40010 by task insmod/424\n CPU: 8 PID: 424 Comm: insmod Tainted: G W 6.9.0-rc2+\n [...]\n Call Trace:\n \u0026lt;TASK\u0026gt;\n dump_stack_lvl+0x68/0xa0\n print_report+0xcf/0x610\n kasan_report+0xb5/0xe0\n ftrace_location+0x90/0x120\n register_kprobe+0x14b/0xa40\n kprobe_init+0x2d/0xff0 [kprobe_example]\n do_one_initcall+0x8f/0x2d0\n do_init_module+0x13a/0x3c0\n load_module+0x3082/0x33d0\n init_module_from_file+0xd2/0x130\n __x64_sys_finit_module+0x306/0x440\n do_syscall_64+0x68/0x140\n entry_SYSCALL_64_after_hwframe+0x71/0x79\r\n\r\nThe root cause is that, in lookup_rec(), ftrace record of some address\nis being searched in ftrace pages of some module, but those ftrace pages\nat the same time is being freed in ftrace_release_mod() as the\ncorresponding module is being deleted:\r\n\r\n CPU1 | CPU2\n register_kprobes() { | delete_module() {\n check_kprobe_address_safe() { |\n arch_check_ftrace_location() { |\n ftrace_location() { |\n lookup_rec() // USE! | ftrace_release_mod() // Free!\r\n\r\nTo fix this issue:\n 1. Hold rcu lock as accessing ftrace pages in ftrace_location_range();\n 2. Use ftrace_location_range() instead of lookup_rec() in\n ftrace_location();\n 3. Call synchronize_rcu() before freeing any ftrace pages both in\n ftrace_process_locs()/ftrace_release_mod()/ftrace_free_mem().(CVE-2024-38588)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\naf_unix: Fix data races in unix_release_sock/unix_stream_sendmsg\r\n\r\nA data-race condition has been identified in af_unix. In one data path,\nthe write function unix_release_sock() atomically writes to\nsk-\u0026gt;sk_shutdown using WRITE_ONCE. However, on the reader side,\nunix_stream_sendmsg() does not read it atomically. Consequently, this\nissue is causing the following KCSAN splat to occur:\r\n\r\n\tBUG: KCSAN: data-race in unix_release_sock / unix_stream_sendmsg\r\n\r\n\twrite (marked) to 0xffff88867256ddbb of 1 bytes by task 7270 on cpu 28:\n\tunix_release_sock (net/unix/af_unix.c:640)\n\tunix_release (net/unix/af_unix.c:1050)\n\tsock_close (net/socket.c:659 net/socket.c:1421)\n\t__fput (fs/file_table.c:422)\n\t__fput_sync (fs/file_table.c:508)\n\t__se_sys_close (fs/open.c:1559 fs/open.c:1541)\n\t__x64_sys_close (fs/open.c:1541)\n\tx64_sys_call (arch/x86/entry/syscall_64.c:33)\n\tdo_syscall_64 (arch/x86/entry/common.c:?)\n\tentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\n\tread to 0xffff88867256ddbb of 1 bytes by task 989 on cpu 14:\n\tunix_stream_sendmsg (net/unix/af_unix.c:2273)\n\t__sock_sendmsg (net/socket.c:730 net/socket.c:745)\n\t____sys_sendmsg (net/socket.c:2584)\n\t__sys_sendmmsg (net/socket.c:2638 net/socket.c:2724)\n\t__x64_sys_sendmmsg (net/socket.c:2753 net/socket.c:2750 net/socket.c:2750)\n\tx64_sys_call (arch/x86/entry/syscall_64.c:33)\n\tdo_syscall_64 (arch/x86/entry/common.c:?)\n\tentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\n\tvalue changed: 0x01 -\u0026gt; 0x03\r\n\r\nThe line numbers are related to commit dd5a440a31fa (\u0026quot;Linux 6.9-rc7\u0026quot;).\r\n\r\nCommit e1d09c2c2f57 (\u0026quot;af_unix: Fix data races around sk-\u0026gt;sk_shutdown.\u0026quot;)\naddressed a comparable issue in the past regarding sk-\u0026gt;sk_shutdown.\nHowever, it overlooked resolving this particular data path.\nThis patch only offending unix_stream_sendmsg() function, since the\nother reads seem to be protected by unix_state_lock() as discussed in(CVE-2024-38596)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmacintosh/via-macii: Fix \u0026quot;BUG: sleeping function called from invalid context\u0026quot;\r\n\r\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0026apos;t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)",
"id": "OESA-2024-1767",
"modified": "2026-08-06T11:07:14Z",
"published": "2024-06-28T11:07:14Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1767"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47231"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47232"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47252"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47288"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47346"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47347"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47434"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47466"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47469"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47493"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47500"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47521"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47565"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47597"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47609"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48737"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48755"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48756"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52670"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52739"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52834"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52853"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27436"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35830"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36894"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36941"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36950"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36971"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38538"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38541"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38552"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38588"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38596"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38607"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47231",
"CVE-2021-47232",
"CVE-2021-47252",
"CVE-2021-47288",
"CVE-2021-47346",
"CVE-2021-47347",
"CVE-2021-47434",
"CVE-2021-47466",
"CVE-2021-47469",
"CVE-2021-47493",
"CVE-2021-47500",
"CVE-2021-47521",
"CVE-2021-47565",
"CVE-2021-47597",
"CVE-2021-47609",
"CVE-2022-48737",
"CVE-2022-48755",
"CVE-2022-48756",
"CVE-2023-52670",
"CVE-2023-52739",
"CVE-2023-52834",
"CVE-2023-52853",
"CVE-2024-27436",
"CVE-2024-35830",
"CVE-2024-36894",
"CVE-2024-36941",
"CVE-2024-36950",
"CVE-2024-36971",
"CVE-2024-38538",
"CVE-2024-38541",
"CVE-2024-38552",
"CVE-2024-38588",
"CVE-2024-38596",
"CVE-2024-38607"
]
}
OESA-2024-1794 (CVE-2023-52882)
Vulnerability from osv_openeuler – Published: 2024-07-05 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
clk: sunxi-ng: h6: Reparent CPUX during PLL CPUX rate change
While PLL CPUX clock rate change when CPU is running from it works in vast majority of cases, now and then it causes instability. This leads to system crashes and other undefined behaviour. After a lot of testing (30+ hours) while also doing a lot of frequency switches, we can't observe any instability issues anymore when doing reparenting to stable clock like 24 MHz oscillator.(CVE-2023-52882)
In the Linux kernel, the following vulnerability has been resolved:
usb: gadget: uvc: use correct buffer size when parsing configfs lists
This commit fixes uvc gadget support on 32-bit platforms.
Commit 0df28607c5cb ("usb: gadget: uvc: Generalise helper functions for reuse") introduced a helper function __uvcg_iter_item_entries() to aid with parsing lists of items on configfs attributes stores. This function is a generalization of another very similar function, which used a stack-allocated temporary buffer of fixed size for each item in the list and used the sizeof() operator to check for potential buffer overruns. The new function was changed to allocate the now variably sized temp buffer on heap, but wasn't properly updated to also check for max buffer size using the computed size instead of sizeof() operator.
As a result, the maximum item size was 7 (plus null terminator) on 64-bit platforms, and 3 on 32-bit ones. While 7 is accidentally just barely enough, 3 is definitely too small for some of UVC configfs attributes. For example, dwFrameInteval, specified in 100ns units, usually has 6-digit item values, e.g. 166666 for 60fps.(CVE-2024-36895)
In the Linux kernel, the following vulnerability has been resolved:
firewire: ohci: mask bus reset interrupts between ISR and bottom half
In the FireWire OHCI interrupt handler, if a bus reset interrupt has occurred, mask bus reset interrupts until bus_reset_work has serviced and cleared the interrupt.
Normally, we always leave bus reset interrupts masked. We infer the bus reset from the self-ID interrupt that happens shortly thereafter. A scenario where we unmask bus reset interrupts was introduced in 2008 in a007bb857e0b26f5d8b73c2ff90782d9c0972620: If OHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we will unmask bus reset interrupts so we can log them.
irq_handler logs the bus reset interrupt. However, we can't clear the bus reset event flag in irq_handler, because we won't service the event until later. irq_handler exits with the event flag still set. If the corresponding interrupt is still unmasked, the first bus reset will usually freeze the system due to irq_handler being called again each time it exits. This freeze can be reproduced by loading firewire_ohci with "modprobe firewire_ohci debug=-1" (to enable all debugging output). Apparently there are also some cases where bus_reset_work will get called soon enough to clear the event, and operation will continue normally.
This freeze was first reported a few months after a007bb85 was committed, but until now it was never fixed. The debug level could safely be set to -1 through sysfs after the module was loaded, but this would be ineffectual in logging bus reset interrupts since they were only unmasked during initialization.
irq_handler will now leave the event flag set but mask bus reset interrupts, so irq_handler won't be called again and there will be no freeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will unmask the interrupt after servicing the event, so future interrupts will be caught as desired.
As a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be enabled through sysfs in addition to during initial module loading. However, when enabled through sysfs, logging of bus reset interrupts will be effective only starting with the second bus reset, after bus_reset_work has executed.(CVE-2024-36950)
| URL | Type | |
|---|---|---|
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"bpftool-debuginfo-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"kernel-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"kernel-debuginfo-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"kernel-debugsource-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"kernel-devel-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"kernel-headers-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"kernel-source-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"kernel-tools-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"kernel-tools-debuginfo-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"kernel-tools-devel-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"perf-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"perf-debuginfo-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"python3-perf-6.6.0-31.0.0.39.oe2403.aarch64.rpm",
"python3-perf-debuginfo-6.6.0-31.0.0.39.oe2403.aarch64.rpm"
],
"src": [
"kernel-6.6.0-31.0.0.39.oe2403.src.rpm"
],
"x86_64": [
"bpftool-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"bpftool-debuginfo-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"kernel-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"kernel-debuginfo-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"kernel-debugsource-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"kernel-devel-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"kernel-headers-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"kernel-source-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"kernel-tools-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"kernel-tools-debuginfo-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"kernel-tools-devel-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"perf-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"perf-debuginfo-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"python3-perf-6.6.0-31.0.0.39.oe2403.x86_64.rpm",
"python3-perf-debuginfo-6.6.0-31.0.0.39.oe2403.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:24.03-LTS",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-24.03-LTS"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "6.6.0-31.0.0.39.oe2403"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Medium"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: sunxi-ng: h6: Reparent CPUX during PLL CPUX rate change\r\n\r\nWhile PLL CPUX clock rate change when CPU is running from it works in\nvast majority of cases, now and then it causes instability. This leads\nto system crashes and other undefined behaviour. After a lot of testing\n(30+ hours) while also doing a lot of frequency switches, we can\u0026apos;t\nobserve any instability issues anymore when doing reparenting to stable\nclock like 24 MHz oscillator.(CVE-2023-52882)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nusb: gadget: uvc: use correct buffer size when parsing configfs lists\r\n\r\nThis commit fixes uvc gadget support on 32-bit platforms.\r\n\r\nCommit 0df28607c5cb (\u0026quot;usb: gadget: uvc: Generalise helper functions for\nreuse\u0026quot;) introduced a helper function __uvcg_iter_item_entries() to aid\nwith parsing lists of items on configfs attributes stores. This function\nis a generalization of another very similar function, which used a\nstack-allocated temporary buffer of fixed size for each item in the list\nand used the sizeof() operator to check for potential buffer overruns.\nThe new function was changed to allocate the now variably sized temp\nbuffer on heap, but wasn\u0026apos;t properly updated to also check for max buffer\nsize using the computed size instead of sizeof() operator.\r\n\r\nAs a result, the maximum item size was 7 (plus null terminator) on\n64-bit platforms, and 3 on 32-bit ones. While 7 is accidentally just\nbarely enough, 3 is definitely too small for some of UVC configfs\nattributes. For example, dwFrameInteval, specified in 100ns units,\nusually has 6-digit item values, e.g. 166666 for 60fps.(CVE-2024-36895)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfirewire: ohci: mask bus reset interrupts between ISR and bottom half\r\n\r\nIn the FireWire OHCI interrupt handler, if a bus reset interrupt has\noccurred, mask bus reset interrupts until bus_reset_work has serviced and\ncleared the interrupt.\r\n\r\nNormally, we always leave bus reset interrupts masked. We infer the bus\nreset from the self-ID interrupt that happens shortly thereafter. A\nscenario where we unmask bus reset interrupts was introduced in 2008 in\na007bb857e0b26f5d8b73c2ff90782d9c0972620: If\nOHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we\nwill unmask bus reset interrupts so we can log them.\r\n\r\nirq_handler logs the bus reset interrupt. However, we can\u0026apos;t clear the bus\nreset event flag in irq_handler, because we won\u0026apos;t service the event until\nlater. irq_handler exits with the event flag still set. If the\ncorresponding interrupt is still unmasked, the first bus reset will\nusually freeze the system due to irq_handler being called again each\ntime it exits. This freeze can be reproduced by loading firewire_ohci\nwith \u0026quot;modprobe firewire_ohci debug=-1\u0026quot; (to enable all debugging output).\nApparently there are also some cases where bus_reset_work will get called\nsoon enough to clear the event, and operation will continue normally.\r\n\r\nThis freeze was first reported a few months after a007bb85 was committed,\nbut until now it was never fixed. The debug level could safely be set\nto -1 through sysfs after the module was loaded, but this would be\nineffectual in logging bus reset interrupts since they were only\nunmasked during initialization.\r\n\r\nirq_handler will now leave the event flag set but mask bus reset\ninterrupts, so irq_handler won\u0026apos;t be called again and there will be no\nfreeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will\nunmask the interrupt after servicing the event, so future interrupts\nwill be caught as desired.\r\n\r\nAs a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be\nenabled through sysfs in addition to during initial module loading.\nHowever, when enabled through sysfs, logging of bus reset interrupts will\nbe effective only starting with the second bus reset, after\nbus_reset_work has executed.(CVE-2024-36950)",
"id": "OESA-2024-1794",
"modified": "2026-08-06T11:07:15Z",
"published": "2024-07-05T11:07:15Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2024-1794"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52882"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36895"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36950"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2023-52882",
"CVE-2024-36895",
"CVE-2024-36950"
]
}
OESA-2024-2445 (CVE-2022-48878)
Vulnerability from osv_openeuler – Published: 2024-11-22 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: hci_qca: Fix driver shutdown on closed serdev
The driver shutdown callback (which sends EDL_SOC_RESET to the device over serdev) should not be invoked when HCI device is not open (e.g. if hci_dev_open_sync() failed), because the serdev and its TTY are not open either. Also skip this step if device is powered off (qca_power_shutdown()).
The shutdown callback causes use-after-free during system reboot with Qualcomm Atheros Bluetooth:
Unable to handle kernel paging request at virtual address 0072662f67726fd7 ... CPU: 6 PID: 1 Comm: systemd-shutdow Tainted: G W 6.1.0-rt5-00325-g8a5f56bcfcca #8 Hardware name: Qualcomm Technologies, Inc. Robotics RB5 (DT) Call trace: tty_driver_flush_buffer+0x4/0x30 serdev_device_write_flush+0x24/0x34 qca_serdev_shutdown+0x80/0x130 [hci_uart] device_shutdown+0x15c/0x260 kernel_restart+0x48/0xac
KASAN report:
BUG: KASAN: use-after-free in tty_driver_flush_buffer+0x1c/0x50 Read of size 8 at addr ffff16270c2e0018 by task systemd-shutdow/1
CPU: 7 PID: 1 Comm: systemd-shutdow Not tainted 6.1.0-next-20221220-00014-gb85aaf97fb01-dirty #28 Hardware name: Qualcomm Technologies, Inc. Robotics RB5 (DT) Call trace: dump_backtrace.part.0+0xdc/0xf0 show_stack+0x18/0x30 dump_stack_lvl+0x68/0x84 print_report+0x188/0x488 kasan_report+0xa4/0xf0 __asan_load8+0x80/0xac tty_driver_flush_buffer+0x1c/0x50 ttyport_write_flush+0x34/0x44 serdev_device_write_flush+0x48/0x60 qca_serdev_shutdown+0x124/0x274 device_shutdown+0x1e8/0x350 kernel_restart+0x48/0xb0 __do_sys_reboot+0x244/0x2d0 __arm64_sys_reboot+0x54/0x70 invoke_syscall+0x60/0x190 el0_svc_common.constprop.0+0x7c/0x160 do_el0_svc+0x44/0xf0 el0_svc+0x2c/0x6c el0t_64_sync_handler+0xbc/0x140 el0t_64_sync+0x190/0x194(CVE-2022-48878)
In the Linux kernel, the following vulnerability has been resolved: rtc: cmos: Fix event handler registration ordering issue Because acpi_install_fixed_event_handler() enables the event automatically on success, it is incorrect to call it before the handler routine passed to it is ready to handle events. Unfortunately, the rtc-cmos driver does exactly the incorrect thing by calling cmos_wake_setup(), which passes rtc_handler() to acpi_install_fixed_event_handler(), before cmos_do_probe(), because rtc_handler() uses dev_get_drvdata() to get to the cmos object pointer and the driver data pointer is only populated in cmos_do_probe(). This leads to a NULL pointer dereference in rtc_handler() on boot if the RTC fixed event happens to be active at the init time. To address this issue, change the initialization ordering of the driver so that cmos_wake_setup() is always called after a successful cmos_do_probe() call. While at it, change cmos_pnp_probe() to call cmos_do_probe() after the initial if () statement used for computing the IRQ argument to be passed to cmos_do_probe() which is cleaner than calling it in each branch of that if () (local variable "irq" can be of type int, because it is passed to that function as an argument of type int). Note that commit 6492fed7d8c9 ("rtc: rtc-cmos: Do not check ACPI_FADT_LOW_POWER_S0") caused this issue to affect a larger number of systems, because previously it only affected systems with ACPI_FADT_LOW_POWER_S0 set, but it is present regardless of that commit.(CVE-2022-48953)
In the Linux kernel, the following vulnerability has been resolved: e100: Fix possible use after free in e100_xmit_prepare In e100_xmit_prepare(), if we can't map the skb, then return -ENOMEM, so e100_xmit_frame() will return NETDEV_TX_BUSY and the upper layer will resend the skb. But the skb is already freed, which will cause UAF bug when the upper layer resends the skb. Remove the harmful free.(CVE-2022-49026)
In the Linux kernel, the following vulnerability has been resolved:
dmaengine: fsl-qdma: Fix a memory leak related to the queue command DMA
This dma_alloc_coherent() is undone neither in the remove function, nor in the error handling path of fsl_qdma_probe().
Switch to the managed version to fix both issues.(CVE-2024-35833)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_tables: honor table dormant flag from netdev release event path
Check for table dormant flag otherwise netdev release event path tries to unregister an already unregistered hook.
[524854.857999] ------------[ cut here ]------------ [524854.858010] WARNING: CPU: 0 PID: 3386599 at net/netfilter/core.c:501 __nf_unregister_net_hook+0x21a/0x260 [...] [524854.858848] CPU: 0 PID: 3386599 Comm: kworker/u32:2 Not tainted 6.9.0-rc3+ #365 [524854.858869] Workqueue: netns cleanup_net [524854.858886] RIP: 0010:__nf_unregister_net_hook+0x21a/0x260 [524854.858903] Code: 24 e8 aa 73 83 ff 48 63 43 1c 83 f8 01 0f 85 3d ff ff ff e8 98 d1 f0 ff 48 8b 3c 24 e8 8f 73 83 ff 48 63 43 1c e9 26 ff ff ff <0f> 0b 48 83 c4 18 48 c7 c7 00 68 e9 82 5b 5d 41 5c 41 5d 41 5e 41 [524854.858914] RSP: 0018:ffff8881e36d79e0 EFLAGS: 00010246 [524854.858926] RAX: 0000000000000000 RBX: ffff8881339ae790 RCX: ffffffff81ba524a [524854.858936] RDX: dffffc0000000000 RSI: 0000000000000008 RDI: ffff8881c8a16438 [524854.858945] RBP: ffff8881c8a16438 R08: 0000000000000001 R09: ffffed103c6daf34 [524854.858954] R10: ffff8881e36d79a7 R11: 0000000000000000 R12: 0000000000000005 [524854.858962] R13: ffff8881c8a16000 R14: 0000000000000000 R15: ffff8881351b5a00 [524854.858971] FS: 0000000000000000(0000) GS:ffff888390800000(0000) knlGS:0000000000000000 [524854.858982] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [524854.858991] CR2: 00007fc9be0f16f4 CR3: 00000001437cc004 CR4: 00000000001706f0 [524854.859000] Call Trace: [524854.859006] <TASK> [524854.859013] ? __warn+0x9f/0x1a0 [524854.859027] ? __nf_unregister_net_hook+0x21a/0x260 [524854.859044] ? report_bug+0x1b1/0x1e0 [524854.859060] ? handle_bug+0x3c/0x70 [524854.859071] ? exc_invalid_op+0x17/0x40 [524854.859083] ? asm_exc_invalid_op+0x1a/0x20 [524854.859100] ? __nf_unregister_net_hook+0x6a/0x260 [524854.859116] ? __nf_unregister_net_hook+0x21a/0x260 [524854.859135] nf_tables_netdev_event+0x337/0x390 [nf_tables] [524854.859304] ? __pfx_nf_tables_netdev_event+0x10/0x10 [nf_tables] [524854.859461] ? packet_notifier+0xb3/0x360 [524854.859476] ? _raw_spin_unlock_irqrestore+0x11/0x40 [524854.859489] ? dcbnl_netdevice_event+0x35/0x140 [524854.859507] ? __pfx_nf_tables_netdev_event+0x10/0x10 [nf_tables] [524854.859661] notifier_call_chain+0x7d/0x140 [524854.859677] unregister_netdevice_many_notify+0x5e1/0xae0(CVE-2024-36005)
In the Linux kernel, the following vulnerability has been resolved:
firewire: ohci: mask bus reset interrupts between ISR and bottom half
In the FireWire OHCI interrupt handler, if a bus reset interrupt has occurred, mask bus reset interrupts until bus_reset_work has serviced and cleared the interrupt.
Normally, we always leave bus reset interrupts masked. We infer the bus reset from the self-ID interrupt that happens shortly thereafter. A scenario where we unmask bus reset interrupts was introduced in 2008 in a007bb857e0b26f5d8b73c2ff90782d9c0972620: If OHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we will unmask bus reset interrupts so we can log them.
irq_handler logs the bus reset interrupt. However, we can't clear the bus reset event flag in irq_handler, because we won't service the event until later. irq_handler exits with the event flag still set. If the corresponding interrupt is still unmasked, the first bus reset will usually freeze the system due to irq_handler being called again each time it exits. This freeze can be reproduced by loading firewire_ohci with "modprobe firewire_ohci debug=-1" (to enable all debugging output). Apparently there are also some cases where bus_reset_work will get called soon enough to clear the event, and operation will continue normally.
This freeze was first reported a few months after a007bb85 was committed, but until now it was never fixed. The debug level could safely be set to -1 through sysfs after the module was loaded, but this would be ineffectual in logging bus reset interrupts since they were only unmasked during initialization.
irq_handler will now leave the event flag set but mask bus reset interrupts, so irq_handler won't be called again and there will be no freeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will unmask the interrupt after servicing the event, so future interrupts will be caught as desired.
As a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be enabled through sysfs in addition to during initial module loading. However, when enabled through sysfs, logging of bus reset interrupts will be effective only starting with the second bus reset, after bus_reset_work has executed.(CVE-2024-36950)
In the Linux kernel, the following vulnerability has been resolved:
wifi: mac80211: fix NULL dereference at band check in starting tx ba session
In MLD connection, link_data/link_conf are dynamically allocated. They don't point to vif->bss_conf. So, there will be no chanreq assigned to vif->bss_conf and then the chan will be NULL. Tweak the code to check ht_supported/vht_supported/has_he/has_eht on sta deflink.
Crash log (with rtw89 version under MLO development): [ 9890.526087] BUG: kernel NULL pointer dereference, address: 0000000000000000 [ 9890.526102] #PF: supervisor read access in kernel mode [ 9890.526105] #PF: error_code(0x0000) - not-present page [ 9890.526109] PGD 0 P4D 0 [ 9890.526114] Oops: 0000 [#1] PREEMPT SMP PTI [ 9890.526119] CPU: 2 PID: 6367 Comm: kworker/u16:2 Kdump: loaded Tainted: G OE 6.9.0 #1 [ 9890.526123] Hardware name: LENOVO 2356AD1/2356AD1, BIOS G7ETB3WW (2.73 ) 11/28/2018 [ 9890.526126] Workqueue: phy2 rtw89_core_ba_work [rtw89_core] [ 9890.526203] RIP: 0010:ieee80211_start_tx_ba_session (net/mac80211/agg-tx.c:618 (discriminator 1)) mac80211 [ 9890.526279] Code: f7 e8 d5 93 3e ea 48 83 c4 28 89 d8 5b 41 5c 41 5d 41 5e 41 5f 5d c3 cc cc cc cc 49 8b 84 24 e0 f1 ff ff 48 8b 80 90 1b 00 00 <83> 38 03 0f 84 37 fe ff ff bb ea ff ff ff eb cc 49 8b 84 24 10 f3 All code ======== 0: f7 e8 imul %eax 2: d5 (bad) 3: 93 xchg %eax,%ebx 4: 3e ea ds (bad) 6: 48 83 c4 28 add $0x28,%rsp a: 89 d8 mov %ebx,%eax c: 5b pop %rbx d: 41 5c pop %r12 f: 41 5d pop %r13 11: 41 5e pop %r14 13: 41 5f pop %r15 15: 5d pop %rbp 16: c3 retq 17: cc int3 18: cc int3 19: cc int3 1a: cc int3 1b: 49 8b 84 24 e0 f1 ff mov -0xe20(%r12),%rax 22: ff 23: 48 8b 80 90 1b 00 00 mov 0x1b90(%rax),%rax 2a:* 83 38 03 cmpl $0x3,(%rax) <-- trapping instruction 2d: 0f 84 37 fe ff ff je 0xfffffffffffffe6a 33: bb ea ff ff ff mov $0xffffffea,%ebx 38: eb cc jmp 0x6 3a: 49 rex.WB 3b: 8b .byte 0x8b 3c: 84 24 10 test %ah,(%rax,%rdx,1) 3f: f3 repz
Code starting with the faulting instruction
0: 83 38 03 cmpl $0x3,(%rax) 3: 0f 84 37 fe ff ff je 0xfffffffffffffe40 9: bb ea ff ff ff mov $0xffffffea,%ebx e: eb cc jmp 0xffffffffffffffdc 10: 49 rex.WB 11: 8b .byte 0x8b 12: 84 24 10 test %ah,(%rax,%rdx,1) 15: f3 repz [ 9890.526285] RSP: 0018:ffffb8db09013d68 EFLAGS: 00010246 [ 9890.526291] RAX: 0000000000000000 RBX: 0000000000000000 RCX: ffff9308e0d656c8 [ 9890.526295] RDX: 0000000000000000 RSI: ffffffffab99460b RDI: ffffffffab9a7685 [ 9890.526300] RBP: ffffb8db09013db8 R08: 0000000000000000 R09: 0000000000000873 [ 9890.526304] R10: ffff9308e0d64800 R11: 0000000000000002 R12: ffff9308e5ff6e70 [ 9890.526308] R13: ffff930952500e20 R14: ffff9309192a8c00 R15: 0000000000000000 [ 9890.526313] FS: 0000000000000000(0000) GS:ffff930b4e700000(0000) knlGS:0000000000000000 [ 9890.526316] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 9890.526318] CR2: 0000000000000000 CR3: 0000000391c58005 CR4: 00000000001706f0 [ 9890.526321] Call Trace: [ 9890.526324] <TASK> [ 9890.526327] ? show_regs (arch/x86/kernel/dumpstack.c:479) [ 9890.526335] ? __die (arch/x86/kernel/dumpstack.c:421 arch/x86/kernel/dumpstack.c:434) [ 9890.526340] ? page_fault_oops (arch/x86/mm/fault.c:713) [ 9890.526347] ? search_module_extables (kernel/module/main.c:3256 (discriminator ---truncated---(CVE-2024-43911)
In the Linux kernel, the following vulnerability has been resolved:
staging: iio: frequency: ad9834: Validate frequency parameter value
In ad9834_write_frequency() clk_get_rate() can return 0. In such case ad9834_calc_freqreg() call will lead to division by zero. Checking 'if (fout > (clk_freq / 2))' doesn't protect in case of 'fout' is 0. ad9834_write_frequency() is called from ad9834_write(), where fout is taken from text buffer, which can contain any value.
Modify parameters checking.
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-47663)
In the Linux kernel, the following vulnerability has been resolved:
scsi: pm80xx: Set phy->enable_completion only when we wait for it
pm8001_phy_control() populates the enable_completion pointer with a stack address, sends a PHY_LINK_RESET / PHY_HARD_RESET, waits 300 ms, and returns. The problem arises when a phy control response comes late. After 300 ms the pm8001_phy_control() function returns and the passed enable_completion stack address is no longer valid. Late phy control response invokes complete() on a dangling enable_completion pointer which leads to a kernel crash.(CVE-2024-47666)
In the Linux kernel, the following vulnerability has been resolved: bpf: Zero former ARG_PTR_TO_{LONG,INT} args in case of error For all non-tracing helpers which formerly had ARG_PTR_TO_{LONG,INT} as input arguments, zero the value for the case of an error as otherwise it could leak memory. For tracing, it is not needed given CAP_PERFMON can already read all kernel memory anyway hence bpf_get_func_arg() and bpf_get_func_ret() is skipped in here. Also, the MTU helpers mtu_len pointer value is being written but also read. Technically, the MEM_UNINIT should not be there in order to always force init. Removing MEM_UNINIT needs more verifier rework though: MEM_UNINIT right now implies two things actually: i) write into memory, ii) memory does not have to be initialized. If we lift MEM_UNINIT, it then becomes: i) read into memory, ii) memory must be initialized. This means that for bpf__check_mtu() we're readding the issue we're trying to fix, that is, it would then be able to write back into things like .rodata BPF maps. Follow-up work will rework the MEM_UNINIT semantics such that the intent can be better expressed. For now just clear the mtu_len on error path which can be lifted later again.(CVE-2024-47728)
In the Linux kernel, the following vulnerability has been resolved: drm/amd/display: Add null check for pipe_ctx->plane_state in dcn20_program_pipe This commit addresses a null pointer dereference issue in the dcn20_program_pipe function. The issue could occur when pipe_ctx->plane_state is null. The fix adds a check to ensure pipe_ctx->plane_state is not null before accessing. This prevents a null pointer dereference. Reported by smatch: drivers/gpu/drm/amd/amdgpu/../display/dc/hwss/dcn20/dcn20_hwseq.c:1925 dcn20_program_pipe() error: we previously assumed 'pipe_ctx->plane_state' could be null (see line 1877)(CVE-2024-49914)
In the Linux kernel, the following vulnerability has been resolved: net/ncsi: Disable the ncsi work before freeing the associated structure The work function can run after the ncsi device is freed, resulting in use-after-free bugs or kernel panic.(CVE-2024-49945)
In the Linux kernel, the following vulnerability has been resolved: mailbox: bcm2835: Fix timeout during suspend mode During noirq suspend phase the Raspberry Pi power driver suffer of firmware property timeouts. The reason is that the IRQ of the underlying BCM2835 mailbox is disabled and rpi_firmware_property_list() will always run into a timeout [1]. Since the VideoCore side isn't consider as a wakeup source, set the IRQF_NO_SUSPEND flag for the mailbox IRQ in order to keep it enabled during suspend-resume cycle. [1] PM: late suspend of devices complete after 1.754 msecs WARNING: CPU: 0 PID: 438 at drivers/firmware/raspberrypi.c:128 rpi_firmware_property_list+0x204/0x22c Firmware transaction 0x00028001 timeout Modules linked in: CPU: 0 PID: 438 Comm: bash Tainted: G C 6.9.3-dirty #17 Hardware name: BCM2835 Call trace: unwind_backtrace from show_stack+0x18/0x1c show_stack from dump_stack_lvl+0x34/0x44 dump_stack_lvl from __warn+0x88/0xec __warn from warn_slowpath_fmt+0x7c/0xb0 warn_slowpath_fmt from rpi_firmware_property_list+0x204/0x22c rpi_firmware_property_list from rpi_firmware_property+0x68/0x8c rpi_firmware_property from rpi_firmware_set_power+0x54/0xc0 rpi_firmware_set_power from _genpd_power_off+0xe4/0x148 _genpd_power_off from genpd_sync_power_off+0x7c/0x11c genpd_sync_power_off from genpd_finish_suspend+0xcc/0xe0 genpd_finish_suspend from dpm_run_callback+0x78/0xd0 dpm_run_callback from device_suspend_noirq+0xc0/0x238 device_suspend_noirq from dpm_suspend_noirq+0xb0/0x168 dpm_suspend_noirq from suspend_devices_and_enter+0x1b8/0x5ac suspend_devices_and_enter from pm_suspend+0x254/0x2e4 pm_suspend from state_store+0xa8/0xd4 state_store from kernfs_fop_write_iter+0x154/0x1a0 kernfs_fop_write_iter from vfs_write+0x12c/0x184 vfs_write from ksys_write+0x78/0xc0 ksys_write from ret_fast_syscall+0x0/0x54 Exception stack(0xcc93dfa8 to 0xcc93dff0) [...] PM: noirq suspend of devices complete after 3095.584 msecs(CVE-2024-49963)
In the Linux kernel, the following vulnerability has been resolved: aoe: fix the potential use-after-free problem in more places For fixing CVE-2023-6270, f98364e92662 ("aoe: fix the potential use-after-free problem in aoecmd_cfg_pkts") makes tx() calling dev_put() instead of doing in aoecmd_cfg_pkts(). It avoids that the tx() runs into use-after-free. Then Nicolai Stange found more places in aoe have potential use-after-free problem with tx(). e.g. revalidate(), aoecmd_ata_rw(), resend(), probe() and aoecmd_cfg_rsp(). Those functions also use aoenet_xmit() to push packet to tx queue. So they should also use dev_hold() to increase the refcnt of skb->dev. On the other hand, moving dev_put() to tx() causes that the refcnt of skb->dev be reduced to a negative value, because corresponding dev_hold() are not called in revalidate(), aoecmd_ata_rw(), resend(), probe(), and aoecmd_cfg_rsp(). This patch fixed this issue.(CVE-2024-49982)
In the Linux kernel, the following vulnerability has been resolved: arm64: probes: Remove broken LDR (literal) uprobe support The simulate_ldr_literal() and simulate_ldrsw_literal() functions are unsafe to use for uprobes. Both functions were originally written for use with kprobes, and access memory with plain C accesses. When uprobes was added, these were reused unmodified even though they cannot safely access user memory. There are three key problems: 1) The plain C accesses do not have corresponding extable entries, and thus if they encounter a fault the kernel will treat these as unintentional accesses to user memory, resulting in a BUG() which will kill the kernel thread, and likely lead to further issues (e.g. lockup or panic()). 2) The plain C accesses are subject to HW PAN and SW PAN, and so when either is in use, any attempt to simulate an access to user memory will fault. Thus neither simulate_ldr_literal() nor simulate_ldrsw_literal() can do anything useful when simulating a user instruction on any system with HW PAN or SW PAN. 3) The plain C accesses are privileged, as they run in kernel context, and in practice can access a small range of kernel virtual addresses. The instructions they simulate have a range of +/-1MiB, and since the simulated instructions must itself be a user instructions in the TTBR0 address range, these can address the final 1MiB of the TTBR1 acddress range by wrapping downwards from an address in the first 1MiB of the TTBR0 address range. In contemporary kernels the last 8MiB of TTBR1 address range is reserved, and accesses to this will always fault, meaning this is no worse than (1). Historically, it was theoretically possible for the linear map or vmemmap to spill into the final 8MiB of the TTBR1 address range, but in practice this is extremely unlikely to occur as this would require either: * Having enough physical memory to fill the entire linear map all the way to the final 1MiB of the TTBR1 address range. * Getting unlucky with KASLR randomization of the linear map such that the populated region happens to overlap with the last 1MiB of the TTBR address range. ... and in either case if we were to spill into the final page there would be larger problems as the final page would alias with error pointers. Practically speaking, (1) and (2) are the big issues. Given there have been no reports of problems since the broken code was introduced, it appears that no-one is relying on probing these instructions with uprobes. Avoid these issues by not allowing uprobes on LDR (literal) and LDRSW (literal), limiting the use of simulate_ldr_literal() and simulate_ldrsw_literal() to kprobes. Attempts to place uprobes on LDR (literal) and LDRSW (literal) will be rejected as arm_probe_decode_insn() will return INSN_REJECTED. In future we can consider introducing working uprobes support for these instructions, but this will require more significant work.(CVE-2024-50099)
In the Linux kernel, the following vulnerability has been resolved: KVM: nSVM: Ignore nCR3[4:0] when loading PDPTEs from memory Ignore nCR3[4:0] when loading PDPTEs from memory for nested SVM, as bits 4:0 of CR3 are ignored when PAE paging is used, and thus VMRUN doesn't enforce 32-byte alignment of nCR3. In the absolute worst case scenario, failure to ignore bits 4:0 can result in an out-of-bounds read, e.g. if the target page is at the end of a memslot, and the VMM isn't using guard pages. Per the APM: The CR3 register points to the base address of the page-directory-pointer table. The page-directory-pointer table is aligned on a 32-byte boundary, with the low 5 address bits 4:0 assumed to be 0. And the SDM's much more explicit: 4:0 Ignored Note, KVM gets this right when loading PDPTRs, it's only the nSVM flow that is broken.(CVE-2024-50115)
In the Linux kernel, the following vulnerability has been resolved: bpf: Use raw_spinlock_t in ringbuf The function __bpf_ringbuf_reserve is invoked from a tracepoint, which disables preemption. Using spinlock_t in this context can lead to a "sleep in atomic" warning in the RT variant. This issue is illustrated in the example below: BUG: sleeping function called from invalid context at kernel/locking/spinlock_rt.c:48 in_atomic(): 1, irqs_disabled(): 0, non_block: 0, pid: 556208, name: test_progs preempt_count: 1, expected: 0 RCU nest depth: 1, expected: 1 INFO: lockdep is turned off. Preemption disabled at: [<ffffd33a5c88ea44>] migrate_enable+0xc0/0x39c CPU: 7 PID: 556208 Comm: test_progs Tainted: G Hardware name: Qualcomm SA8775P Ride (DT) Call trace: dump_backtrace+0xac/0x130 show_stack+0x1c/0x30 dump_stack_lvl+0xac/0xe8 dump_stack+0x18/0x30 __might_resched+0x3bc/0x4fc rt_spin_lock+0x8c/0x1a4 __bpf_ringbuf_reserve+0xc4/0x254 bpf_ringbuf_reserve_dynptr+0x5c/0xdc bpf_prog_ac3d15160d62622a_test_read_write+0x104/0x238 trace_call_bpf+0x238/0x774 perf_call_bpf_enter.isra.0+0x104/0x194 perf_syscall_enter+0x2f8/0x510 trace_sys_enter+0x39c/0x564 syscall_trace_enter+0x220/0x3c0 do_el0_svc+0x138/0x1dc el0_svc+0x54/0x130 el0t_64_sync_handler+0x134/0x150 el0t_64_sync+0x17c/0x180 Switch the spinlock to raw_spinlock_t to avoid this error.(CVE-2024-50138)
In the Linux kernel, the following vulnerability has been resolved: virtio_pmem: Check device status before requesting flush If a pmem device is in a bad status, the driver side could wait for host ack forever in virtio_pmem_flush(), causing the system to hang. So add a status check in the beginning of virtio_pmem_flush() to return early if the device is not activated.(CVE-2024-50184)
In the Linux kernel, the following vulnerability has been resolved: posix-clock: Fix missing timespec64 check in pc_clock_settime() As Andrew pointed out, it will make sense that the PTP core checked timespec64 struct's tv_sec and tv_nsec range before calling ptp->info->settime64(). As the man manual of clock_settime() said, if tp.tv_sec is negative or tp.tv_nsec is outside the range [0..999,999,999], it should return EINVAL, which include dynamic clocks which handles PTP clock, and the condition is consistent with timespec64_valid(). As Thomas suggested, timespec64_valid() only check the timespec is valid, but not ensure that the time is in a valid range, so check it ahead using timespec64_valid_strict() in pc_clock_settime() and return -EINVAL if not valid. There are some drivers that use tp->tv_sec and tp->tv_nsec directly to write registers without validity checks and assume that the higher layer has checked it, which is dangerous and will benefit from this, such as hclge_ptp_settime(), igb_ptp_settime_i210(), _rcar_gen4_ptp_settime(), and some drivers can remove the checks of itself.(CVE-2024-50195)
In the Linux kernel, the following vulnerability has been resolved: iio: light: veml6030: fix IIO device retrieval from embedded device The dev pointer that is received as an argument in the in_illuminance_period_available_show function references the device embedded in the IIO device, not in the i2c client. dev_to_iio_dev() must be used to accessthe right data. The current implementation leads to a segmentation fault on every attempt to read the attribute because indio_dev gets a NULL assignment. This bug has been present since the first appearance of the driver, apparently since the last version (V6) before getting applied. A constant attribute was used until then, and the last modifications might have not been tested again.(CVE-2024-50198)
In the Linux kernel, the following vulnerability has been resolved: wifi: mac80211: do not pass a stopped vif to the driver in .get_txpower Avoid potentially crashing in the driver because of uninitialized private data(CVE-2024-50237)
In the Linux kernel, the following vulnerability has been resolved: fs/ntfs3: Additional check in ntfs_file_release(CVE-2024-50242)
In the Linux kernel, the following vulnerability has been resolved: fs/ntfs3: Fix possible deadlock in mi_read Mutex lock with another subclass used in ni_lock_dir().(CVE-2024-50245)
In the Linux kernel, the following vulnerability has been resolved: fs/ntfs3: Add rough attr alloc_size check(CVE-2024-50246)
In the Linux kernel, the following vulnerability has been resolved: fs/ntfs3: Check if more than chunk-size bytes are written A incorrectly formatted chunk may decompress into more than LZNT_CHUNK_SIZE bytes and a index out of bounds will occur in s_max_off.(CVE-2024-50247)
| URL | Type | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm",
"kernel-debuginfo-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm",
"kernel-debugsource-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm",
"kernel-devel-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm",
"kernel-headers-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm",
"kernel-source-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm",
"kernel-tools-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm",
"kernel-tools-devel-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm",
"perf-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm",
"perf-debuginfo-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm",
"python3-perf-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-136.102.0.183.oe2203sp1.aarch64.rpm"
],
"src": [
"kernel-5.10.0-136.102.0.183.oe2203sp1.src.rpm"
],
"x86_64": [
"kernel-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm",
"kernel-debuginfo-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm",
"kernel-debugsource-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm",
"kernel-devel-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm",
"kernel-headers-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm",
"kernel-source-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm",
"kernel-tools-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm",
"kernel-tools-devel-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm",
"perf-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm",
"perf-debuginfo-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm",
"python3-perf-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-136.102.0.183.oe2203sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-136.102.0.183.oe2203sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: hci_qca: Fix driver shutdown on closed serdev\r\n\r\nThe driver shutdown callback (which sends EDL_SOC_RESET to the device\nover serdev) should not be invoked when HCI device is not open (e.g. if\nhci_dev_open_sync() failed), because the serdev and its TTY are not open\neither. Also skip this step if device is powered off\n(qca_power_shutdown()).\r\n\r\nThe shutdown callback causes use-after-free during system reboot with\nQualcomm Atheros Bluetooth:\r\n\r\n Unable to handle kernel paging request at virtual address\n 0072662f67726fd7\n ...\n CPU: 6 PID: 1 Comm: systemd-shutdow Tainted: G W\n 6.1.0-rt5-00325-g8a5f56bcfcca #8\n Hardware name: Qualcomm Technologies, Inc. Robotics RB5 (DT)\n Call trace:\n tty_driver_flush_buffer+0x4/0x30\n serdev_device_write_flush+0x24/0x34\n qca_serdev_shutdown+0x80/0x130 [hci_uart]\n device_shutdown+0x15c/0x260\n kernel_restart+0x48/0xac\r\n\r\nKASAN report:\r\n\r\n BUG: KASAN: use-after-free in tty_driver_flush_buffer+0x1c/0x50\n Read of size 8 at addr ffff16270c2e0018 by task systemd-shutdow/1\r\n\r\n CPU: 7 PID: 1 Comm: systemd-shutdow Not tainted\n 6.1.0-next-20221220-00014-gb85aaf97fb01-dirty #28\n Hardware name: Qualcomm Technologies, Inc. Robotics RB5 (DT)\n Call trace:\n dump_backtrace.part.0+0xdc/0xf0\n show_stack+0x18/0x30\n dump_stack_lvl+0x68/0x84\n print_report+0x188/0x488\n kasan_report+0xa4/0xf0\n __asan_load8+0x80/0xac\n tty_driver_flush_buffer+0x1c/0x50\n ttyport_write_flush+0x34/0x44\n serdev_device_write_flush+0x48/0x60\n qca_serdev_shutdown+0x124/0x274\n device_shutdown+0x1e8/0x350\n kernel_restart+0x48/0xb0\n __do_sys_reboot+0x244/0x2d0\n __arm64_sys_reboot+0x54/0x70\n invoke_syscall+0x60/0x190\n el0_svc_common.constprop.0+0x7c/0x160\n do_el0_svc+0x44/0xf0\n el0_svc+0x2c/0x6c\n el0t_64_sync_handler+0xbc/0x140\n el0t_64_sync+0x190/0x194(CVE-2022-48878)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: rtc: cmos: Fix event handler registration ordering issue Because acpi_install_fixed_event_handler() enables the event automatically on success, it is incorrect to call it before the handler routine passed to it is ready to handle events. Unfortunately, the rtc-cmos driver does exactly the incorrect thing by calling cmos_wake_setup(), which passes rtc_handler() to acpi_install_fixed_event_handler(), before cmos_do_probe(), because rtc_handler() uses dev_get_drvdata() to get to the cmos object pointer and the driver data pointer is only populated in cmos_do_probe(). This leads to a NULL pointer dereference in rtc_handler() on boot if the RTC fixed event happens to be active at the init time. To address this issue, change the initialization ordering of the driver so that cmos_wake_setup() is always called after a successful cmos_do_probe() call. While at it, change cmos_pnp_probe() to call cmos_do_probe() after the initial if () statement used for computing the IRQ argument to be passed to cmos_do_probe() which is cleaner than calling it in each branch of that if () (local variable \u0026quot;irq\u0026quot; can be of type int, because it is passed to that function as an argument of type int). Note that commit 6492fed7d8c9 (\u0026quot;rtc: rtc-cmos: Do not check ACPI_FADT_LOW_POWER_S0\u0026quot;) caused this issue to affect a larger number of systems, because previously it only affected systems with ACPI_FADT_LOW_POWER_S0 set, but it is present regardless of that commit.(CVE-2022-48953)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: e100: Fix possible use after free in e100_xmit_prepare In e100_xmit_prepare(), if we can\u0026apos;t map the skb, then return -ENOMEM, so e100_xmit_frame() will return NETDEV_TX_BUSY and the upper layer will resend the skb. But the skb is already freed, which will cause UAF bug when the upper layer resends the skb. Remove the harmful free.(CVE-2022-49026)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndmaengine: fsl-qdma: Fix a memory leak related to the queue command DMA\r\n\r\nThis dma_alloc_coherent() is undone neither in the remove function, nor in\nthe error handling path of fsl_qdma_probe().\r\n\r\nSwitch to the managed version to fix both issues.(CVE-2024-35833)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nf_tables: honor table dormant flag from netdev release event path\r\n\r\nCheck for table dormant flag otherwise netdev release event path tries\nto unregister an already unregistered hook.\r\n\r\n[524854.857999] ------------[ cut here ]------------\n[524854.858010] WARNING: CPU: 0 PID: 3386599 at net/netfilter/core.c:501 __nf_unregister_net_hook+0x21a/0x260\n[...]\n[524854.858848] CPU: 0 PID: 3386599 Comm: kworker/u32:2 Not tainted 6.9.0-rc3+ #365\n[524854.858869] Workqueue: netns cleanup_net\n[524854.858886] RIP: 0010:__nf_unregister_net_hook+0x21a/0x260\n[524854.858903] Code: 24 e8 aa 73 83 ff 48 63 43 1c 83 f8 01 0f 85 3d ff ff ff e8 98 d1 f0 ff 48 8b 3c 24 e8 8f 73 83 ff 48 63 43 1c e9 26 ff ff ff \u0026lt;0f\u0026gt; 0b 48 83 c4 18 48 c7 c7 00 68 e9 82 5b 5d 41 5c 41 5d 41 5e 41\n[524854.858914] RSP: 0018:ffff8881e36d79e0 EFLAGS: 00010246\n[524854.858926] RAX: 0000000000000000 RBX: ffff8881339ae790 RCX: ffffffff81ba524a\n[524854.858936] RDX: dffffc0000000000 RSI: 0000000000000008 RDI: ffff8881c8a16438\n[524854.858945] RBP: ffff8881c8a16438 R08: 0000000000000001 R09: ffffed103c6daf34\n[524854.858954] R10: ffff8881e36d79a7 R11: 0000000000000000 R12: 0000000000000005\n[524854.858962] R13: ffff8881c8a16000 R14: 0000000000000000 R15: ffff8881351b5a00\n[524854.858971] FS: 0000000000000000(0000) GS:ffff888390800000(0000) knlGS:0000000000000000\n[524854.858982] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[524854.858991] CR2: 00007fc9be0f16f4 CR3: 00000001437cc004 CR4: 00000000001706f0\n[524854.859000] Call Trace:\n[524854.859006] \u0026lt;TASK\u0026gt;\n[524854.859013] ? __warn+0x9f/0x1a0\n[524854.859027] ? __nf_unregister_net_hook+0x21a/0x260\n[524854.859044] ? report_bug+0x1b1/0x1e0\n[524854.859060] ? handle_bug+0x3c/0x70\n[524854.859071] ? exc_invalid_op+0x17/0x40\n[524854.859083] ? asm_exc_invalid_op+0x1a/0x20\n[524854.859100] ? __nf_unregister_net_hook+0x6a/0x260\n[524854.859116] ? __nf_unregister_net_hook+0x21a/0x260\n[524854.859135] nf_tables_netdev_event+0x337/0x390 [nf_tables]\n[524854.859304] ? __pfx_nf_tables_netdev_event+0x10/0x10 [nf_tables]\n[524854.859461] ? packet_notifier+0xb3/0x360\n[524854.859476] ? _raw_spin_unlock_irqrestore+0x11/0x40\n[524854.859489] ? dcbnl_netdevice_event+0x35/0x140\n[524854.859507] ? __pfx_nf_tables_netdev_event+0x10/0x10 [nf_tables]\n[524854.859661] notifier_call_chain+0x7d/0x140\n[524854.859677] unregister_netdevice_many_notify+0x5e1/0xae0(CVE-2024-36005)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfirewire: ohci: mask bus reset interrupts between ISR and bottom half\r\n\r\nIn the FireWire OHCI interrupt handler, if a bus reset interrupt has\noccurred, mask bus reset interrupts until bus_reset_work has serviced and\ncleared the interrupt.\r\n\r\nNormally, we always leave bus reset interrupts masked. We infer the bus\nreset from the self-ID interrupt that happens shortly thereafter. A\nscenario where we unmask bus reset interrupts was introduced in 2008 in\na007bb857e0b26f5d8b73c2ff90782d9c0972620: If\nOHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we\nwill unmask bus reset interrupts so we can log them.\r\n\r\nirq_handler logs the bus reset interrupt. However, we can\u0026apos;t clear the bus\nreset event flag in irq_handler, because we won\u0026apos;t service the event until\nlater. irq_handler exits with the event flag still set. If the\ncorresponding interrupt is still unmasked, the first bus reset will\nusually freeze the system due to irq_handler being called again each\ntime it exits. This freeze can be reproduced by loading firewire_ohci\nwith \u0026quot;modprobe firewire_ohci debug=-1\u0026quot; (to enable all debugging output).\nApparently there are also some cases where bus_reset_work will get called\nsoon enough to clear the event, and operation will continue normally.\r\n\r\nThis freeze was first reported a few months after a007bb85 was committed,\nbut until now it was never fixed. The debug level could safely be set\nto -1 through sysfs after the module was loaded, but this would be\nineffectual in logging bus reset interrupts since they were only\nunmasked during initialization.\r\n\r\nirq_handler will now leave the event flag set but mask bus reset\ninterrupts, so irq_handler won\u0026apos;t be called again and there will be no\nfreeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will\nunmask the interrupt after servicing the event, so future interrupts\nwill be caught as desired.\r\n\r\nAs a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be\nenabled through sysfs in addition to during initial module loading.\nHowever, when enabled through sysfs, logging of bus reset interrupts will\nbe effective only starting with the second bus reset, after\nbus_reset_work has executed.(CVE-2024-36950)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: mac80211: fix NULL dereference at band check in starting tx ba session\r\n\r\nIn MLD connection, link_data/link_conf are dynamically allocated. They\ndon\u0026apos;t point to vif-\u0026gt;bss_conf. So, there will be no chanreq assigned to\nvif-\u0026gt;bss_conf and then the chan will be NULL. Tweak the code to check\nht_supported/vht_supported/has_he/has_eht on sta deflink.\r\n\r\nCrash log (with rtw89 version under MLO development):\n[ 9890.526087] BUG: kernel NULL pointer dereference, address: 0000000000000000\n[ 9890.526102] #PF: supervisor read access in kernel mode\n[ 9890.526105] #PF: error_code(0x0000) - not-present page\n[ 9890.526109] PGD 0 P4D 0\n[ 9890.526114] Oops: 0000 [#1] PREEMPT SMP PTI\n[ 9890.526119] CPU: 2 PID: 6367 Comm: kworker/u16:2 Kdump: loaded Tainted: G OE 6.9.0 #1\n[ 9890.526123] Hardware name: LENOVO 2356AD1/2356AD1, BIOS G7ETB3WW (2.73 ) 11/28/2018\n[ 9890.526126] Workqueue: phy2 rtw89_core_ba_work [rtw89_core]\n[ 9890.526203] RIP: 0010:ieee80211_start_tx_ba_session (net/mac80211/agg-tx.c:618 (discriminator 1)) mac80211\n[ 9890.526279] Code: f7 e8 d5 93 3e ea 48 83 c4 28 89 d8 5b 41 5c 41 5d 41 5e 41 5f 5d c3 cc cc cc cc 49 8b 84 24 e0 f1 ff ff 48 8b 80 90 1b 00 00 \u0026lt;83\u0026gt; 38 03 0f 84 37 fe ff ff bb ea ff ff ff eb cc 49 8b 84 24 10 f3\nAll code\n========\n 0:\tf7 e8 \timul %eax\n 2:\td5 \t(bad)\n 3:\t93 \txchg %eax,%ebx\n 4:\t3e ea \tds (bad)\n 6:\t48 83 c4 28 \tadd $0x28,%rsp\n a:\t89 d8 \tmov %ebx,%eax\n c:\t5b \tpop %rbx\n d:\t41 5c \tpop %r12\n f:\t41 5d \tpop %r13\n 11:\t41 5e \tpop %r14\n 13:\t41 5f \tpop %r15\n 15:\t5d \tpop %rbp\n 16:\tc3 \tretq\n 17:\tcc \tint3\n 18:\tcc \tint3\n 19:\tcc \tint3\n 1a:\tcc \tint3\n 1b:\t49 8b 84 24 e0 f1 ff \tmov -0xe20(%r12),%rax\n 22:\tff\n 23:\t48 8b 80 90 1b 00 00 \tmov 0x1b90(%rax),%rax\n 2a:*\t83 38 03 \tcmpl $0x3,(%rax)\t\t\u0026lt;-- trapping instruction\n 2d:\t0f 84 37 fe ff ff \tje 0xfffffffffffffe6a\n 33:\tbb ea ff ff ff \tmov $0xffffffea,%ebx\n 38:\teb cc \tjmp 0x6\n 3a:\t49 \trex.WB\n 3b:\t8b \t.byte 0x8b\n 3c:\t84 24 10 \ttest %ah,(%rax,%rdx,1)\n 3f:\tf3 \trepz\r\n\r\nCode starting with the faulting instruction\n===========================================\n 0:\t83 38 03 \tcmpl $0x3,(%rax)\n 3:\t0f 84 37 fe ff ff \tje 0xfffffffffffffe40\n 9:\tbb ea ff ff ff \tmov $0xffffffea,%ebx\n e:\teb cc \tjmp 0xffffffffffffffdc\n 10:\t49 \trex.WB\n 11:\t8b \t.byte 0x8b\n 12:\t84 24 10 \ttest %ah,(%rax,%rdx,1)\n 15:\tf3 \trepz\n[ 9890.526285] RSP: 0018:ffffb8db09013d68 EFLAGS: 00010246\n[ 9890.526291] RAX: 0000000000000000 RBX: 0000000000000000 RCX: ffff9308e0d656c8\n[ 9890.526295] RDX: 0000000000000000 RSI: ffffffffab99460b RDI: ffffffffab9a7685\n[ 9890.526300] RBP: ffffb8db09013db8 R08: 0000000000000000 R09: 0000000000000873\n[ 9890.526304] R10: ffff9308e0d64800 R11: 0000000000000002 R12: ffff9308e5ff6e70\n[ 9890.526308] R13: ffff930952500e20 R14: ffff9309192a8c00 R15: 0000000000000000\n[ 9890.526313] FS: 0000000000000000(0000) GS:ffff930b4e700000(0000) knlGS:0000000000000000\n[ 9890.526316] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 9890.526318] CR2: 0000000000000000 CR3: 0000000391c58005 CR4: 00000000001706f0\n[ 9890.526321] Call Trace:\n[ 9890.526324] \u0026lt;TASK\u0026gt;\n[ 9890.526327] ? show_regs (arch/x86/kernel/dumpstack.c:479)\n[ 9890.526335] ? __die (arch/x86/kernel/dumpstack.c:421 arch/x86/kernel/dumpstack.c:434)\n[ 9890.526340] ? page_fault_oops (arch/x86/mm/fault.c:713)\n[ 9890.526347] ? search_module_extables (kernel/module/main.c:3256 (discriminator\n---truncated---(CVE-2024-43911)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nstaging: iio: frequency: ad9834: Validate frequency parameter value\r\n\r\nIn ad9834_write_frequency() clk_get_rate() can return 0. In such case\nad9834_calc_freqreg() call will lead to division by zero. Checking\n\u0026apos;if (fout \u0026gt; (clk_freq / 2))\u0026apos; doesn\u0026apos;t protect in case of \u0026apos;fout\u0026apos; is 0.\nad9834_write_frequency() is called from ad9834_write(), where fout is\ntaken from text buffer, which can contain any value.\r\n\r\nModify parameters checking.\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-47663)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: pm80xx: Set phy-\u0026gt;enable_completion only when we wait for it\r\n\r\npm8001_phy_control() populates the enable_completion pointer with a stack\naddress, sends a PHY_LINK_RESET / PHY_HARD_RESET, waits 300 ms, and\nreturns. The problem arises when a phy control response comes late. After\n300 ms the pm8001_phy_control() function returns and the passed\nenable_completion stack address is no longer valid. Late phy control\nresponse invokes complete() on a dangling enable_completion pointer which\nleads to a kernel crash.(CVE-2024-47666)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: bpf: Zero former ARG_PTR_TO_{LONG,INT} args in case of error For all non-tracing helpers which formerly had ARG_PTR_TO_{LONG,INT} as input arguments, zero the value for the case of an error as otherwise it could leak memory. For tracing, it is not needed given CAP_PERFMON can already read all kernel memory anyway hence bpf_get_func_arg() and bpf_get_func_ret() is skipped in here. Also, the MTU helpers mtu_len pointer value is being written but also read. Technically, the MEM_UNINIT should not be there in order to always force init. Removing MEM_UNINIT needs more verifier rework though: MEM_UNINIT right now implies two things actually: i) write into memory, ii) memory does not have to be initialized. If we lift MEM_UNINIT, it then becomes: i) read into memory, ii) memory must be initialized. This means that for bpf_*_check_mtu() we\u0026apos;re readding the issue we\u0026apos;re trying to fix, that is, it would then be able to write back into things like .rodata BPF maps. Follow-up work will rework the MEM_UNINIT semantics such that the intent can be better expressed. For now just clear the *mtu_len on error path which can be lifted later again.(CVE-2024-47728)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: drm/amd/display: Add null check for pipe_ctx-\u0026gt;plane_state in dcn20_program_pipe This commit addresses a null pointer dereference issue in the `dcn20_program_pipe` function. The issue could occur when `pipe_ctx-\u0026gt;plane_state` is null. The fix adds a check to ensure `pipe_ctx-\u0026gt;plane_state` is not null before accessing. This prevents a null pointer dereference. Reported by smatch: drivers/gpu/drm/amd/amdgpu/../display/dc/hwss/dcn20/dcn20_hwseq.c:1925 dcn20_program_pipe() error: we previously assumed \u0026apos;pipe_ctx-\u0026gt;plane_state\u0026apos; could be null (see line 1877)(CVE-2024-49914)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: net/ncsi: Disable the ncsi work before freeing the associated structure The work function can run after the ncsi device is freed, resulting in use-after-free bugs or kernel panic.(CVE-2024-49945)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: mailbox: bcm2835: Fix timeout during suspend mode During noirq suspend phase the Raspberry Pi power driver suffer of firmware property timeouts. The reason is that the IRQ of the underlying BCM2835 mailbox is disabled and rpi_firmware_property_list() will always run into a timeout [1]. Since the VideoCore side isn\u0026apos;t consider as a wakeup source, set the IRQF_NO_SUSPEND flag for the mailbox IRQ in order to keep it enabled during suspend-resume cycle. [1] PM: late suspend of devices complete after 1.754 msecs WARNING: CPU: 0 PID: 438 at drivers/firmware/raspberrypi.c:128 rpi_firmware_property_list+0x204/0x22c Firmware transaction 0x00028001 timeout Modules linked in: CPU: 0 PID: 438 Comm: bash Tainted: G C 6.9.3-dirty #17 Hardware name: BCM2835 Call trace: unwind_backtrace from show_stack+0x18/0x1c show_stack from dump_stack_lvl+0x34/0x44 dump_stack_lvl from __warn+0x88/0xec __warn from warn_slowpath_fmt+0x7c/0xb0 warn_slowpath_fmt from rpi_firmware_property_list+0x204/0x22c rpi_firmware_property_list from rpi_firmware_property+0x68/0x8c rpi_firmware_property from rpi_firmware_set_power+0x54/0xc0 rpi_firmware_set_power from _genpd_power_off+0xe4/0x148 _genpd_power_off from genpd_sync_power_off+0x7c/0x11c genpd_sync_power_off from genpd_finish_suspend+0xcc/0xe0 genpd_finish_suspend from dpm_run_callback+0x78/0xd0 dpm_run_callback from device_suspend_noirq+0xc0/0x238 device_suspend_noirq from dpm_suspend_noirq+0xb0/0x168 dpm_suspend_noirq from suspend_devices_and_enter+0x1b8/0x5ac suspend_devices_and_enter from pm_suspend+0x254/0x2e4 pm_suspend from state_store+0xa8/0xd4 state_store from kernfs_fop_write_iter+0x154/0x1a0 kernfs_fop_write_iter from vfs_write+0x12c/0x184 vfs_write from ksys_write+0x78/0xc0 ksys_write from ret_fast_syscall+0x0/0x54 Exception stack(0xcc93dfa8 to 0xcc93dff0) [...] PM: noirq suspend of devices complete after 3095.584 msecs(CVE-2024-49963)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: aoe: fix the potential use-after-free problem in more places For fixing CVE-2023-6270, f98364e92662 (\u0026quot;aoe: fix the potential use-after-free problem in aoecmd_cfg_pkts\u0026quot;) makes tx() calling dev_put() instead of doing in aoecmd_cfg_pkts(). It avoids that the tx() runs into use-after-free. Then Nicolai Stange found more places in aoe have potential use-after-free problem with tx(). e.g. revalidate(), aoecmd_ata_rw(), resend(), probe() and aoecmd_cfg_rsp(). Those functions also use aoenet_xmit() to push packet to tx queue. So they should also use dev_hold() to increase the refcnt of skb-\u0026gt;dev. On the other hand, moving dev_put() to tx() causes that the refcnt of skb-\u0026gt;dev be reduced to a negative value, because corresponding dev_hold() are not called in revalidate(), aoecmd_ata_rw(), resend(), probe(), and aoecmd_cfg_rsp(). This patch fixed this issue.(CVE-2024-49982)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: arm64: probes: Remove broken LDR (literal) uprobe support The simulate_ldr_literal() and simulate_ldrsw_literal() functions are unsafe to use for uprobes. Both functions were originally written for use with kprobes, and access memory with plain C accesses. When uprobes was added, these were reused unmodified even though they cannot safely access user memory. There are three key problems: 1) The plain C accesses do not have corresponding extable entries, and thus if they encounter a fault the kernel will treat these as unintentional accesses to user memory, resulting in a BUG() which will kill the kernel thread, and likely lead to further issues (e.g. lockup or panic()). 2) The plain C accesses are subject to HW PAN and SW PAN, and so when either is in use, any attempt to simulate an access to user memory will fault. Thus neither simulate_ldr_literal() nor simulate_ldrsw_literal() can do anything useful when simulating a user instruction on any system with HW PAN or SW PAN. 3) The plain C accesses are privileged, as they run in kernel context, and in practice can access a small range of kernel virtual addresses. The instructions they simulate have a range of +/-1MiB, and since the simulated instructions must itself be a user instructions in the TTBR0 address range, these can address the final 1MiB of the TTBR1 acddress range by wrapping downwards from an address in the first 1MiB of the TTBR0 address range. In contemporary kernels the last 8MiB of TTBR1 address range is reserved, and accesses to this will always fault, meaning this is no worse than (1). Historically, it was theoretically possible for the linear map or vmemmap to spill into the final 8MiB of the TTBR1 address range, but in practice this is extremely unlikely to occur as this would require either: * Having enough physical memory to fill the entire linear map all the way to the final 1MiB of the TTBR1 address range. * Getting unlucky with KASLR randomization of the linear map such that the populated region happens to overlap with the last 1MiB of the TTBR address range. ... and in either case if we were to spill into the final page there would be larger problems as the final page would alias with error pointers. Practically speaking, (1) and (2) are the big issues. Given there have been no reports of problems since the broken code was introduced, it appears that no-one is relying on probing these instructions with uprobes. Avoid these issues by not allowing uprobes on LDR (literal) and LDRSW (literal), limiting the use of simulate_ldr_literal() and simulate_ldrsw_literal() to kprobes. Attempts to place uprobes on LDR (literal) and LDRSW (literal) will be rejected as arm_probe_decode_insn() will return INSN_REJECTED. In future we can consider introducing working uprobes support for these instructions, but this will require more significant work.(CVE-2024-50099)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: KVM: nSVM: Ignore nCR3[4:0] when loading PDPTEs from memory Ignore nCR3[4:0] when loading PDPTEs from memory for nested SVM, as bits 4:0 of CR3 are ignored when PAE paging is used, and thus VMRUN doesn\u0026apos;t enforce 32-byte alignment of nCR3. In the absolute worst case scenario, failure to ignore bits 4:0 can result in an out-of-bounds read, e.g. if the target page is at the end of a memslot, and the VMM isn\u0026apos;t using guard pages. Per the APM: The CR3 register points to the base address of the page-directory-pointer table. The page-directory-pointer table is aligned on a 32-byte boundary, with the low 5 address bits 4:0 assumed to be 0. And the SDM\u0026apos;s much more explicit: 4:0 Ignored Note, KVM gets this right when loading PDPTRs, it\u0026apos;s only the nSVM flow that is broken.(CVE-2024-50115)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: bpf: Use raw_spinlock_t in ringbuf The function __bpf_ringbuf_reserve is invoked from a tracepoint, which disables preemption. Using spinlock_t in this context can lead to a \u0026quot;sleep in atomic\u0026quot; warning in the RT variant. This issue is illustrated in the example below: BUG: sleeping function called from invalid context at kernel/locking/spinlock_rt.c:48 in_atomic(): 1, irqs_disabled(): 0, non_block: 0, pid: 556208, name: test_progs preempt_count: 1, expected: 0 RCU nest depth: 1, expected: 1 INFO: lockdep is turned off. Preemption disabled at: [\u0026lt;ffffd33a5c88ea44\u0026gt;] migrate_enable+0xc0/0x39c CPU: 7 PID: 556208 Comm: test_progs Tainted: G Hardware name: Qualcomm SA8775P Ride (DT) Call trace: dump_backtrace+0xac/0x130 show_stack+0x1c/0x30 dump_stack_lvl+0xac/0xe8 dump_stack+0x18/0x30 __might_resched+0x3bc/0x4fc rt_spin_lock+0x8c/0x1a4 __bpf_ringbuf_reserve+0xc4/0x254 bpf_ringbuf_reserve_dynptr+0x5c/0xdc bpf_prog_ac3d15160d62622a_test_read_write+0x104/0x238 trace_call_bpf+0x238/0x774 perf_call_bpf_enter.isra.0+0x104/0x194 perf_syscall_enter+0x2f8/0x510 trace_sys_enter+0x39c/0x564 syscall_trace_enter+0x220/0x3c0 do_el0_svc+0x138/0x1dc el0_svc+0x54/0x130 el0t_64_sync_handler+0x134/0x150 el0t_64_sync+0x17c/0x180 Switch the spinlock to raw_spinlock_t to avoid this error.(CVE-2024-50138)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: virtio_pmem: Check device status before requesting flush If a pmem device is in a bad status, the driver side could wait for host ack forever in virtio_pmem_flush(), causing the system to hang. So add a status check in the beginning of virtio_pmem_flush() to return early if the device is not activated.(CVE-2024-50184)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: posix-clock: Fix missing timespec64 check in pc_clock_settime() As Andrew pointed out, it will make sense that the PTP core checked timespec64 struct\u0026apos;s tv_sec and tv_nsec range before calling ptp-\u0026gt;info-\u0026gt;settime64(). As the man manual of clock_settime() said, if tp.tv_sec is negative or tp.tv_nsec is outside the range [0..999,999,999], it should return EINVAL, which include dynamic clocks which handles PTP clock, and the condition is consistent with timespec64_valid(). As Thomas suggested, timespec64_valid() only check the timespec is valid, but not ensure that the time is in a valid range, so check it ahead using timespec64_valid_strict() in pc_clock_settime() and return -EINVAL if not valid. There are some drivers that use tp-\u0026gt;tv_sec and tp-\u0026gt;tv_nsec directly to write registers without validity checks and assume that the higher layer has checked it, which is dangerous and will benefit from this, such as hclge_ptp_settime(), igb_ptp_settime_i210(), _rcar_gen4_ptp_settime(), and some drivers can remove the checks of itself.(CVE-2024-50195)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: iio: light: veml6030: fix IIO device retrieval from embedded device The dev pointer that is received as an argument in the in_illuminance_period_available_show function references the device embedded in the IIO device, not in the i2c client. dev_to_iio_dev() must be used to accessthe right data. The current implementation leads to a segmentation fault on every attempt to read the attribute because indio_dev gets a NULL assignment. This bug has been present since the first appearance of the driver, apparently since the last version (V6) before getting applied. A constant attribute was used until then, and the last modifications might have not been tested again.(CVE-2024-50198)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: wifi: mac80211: do not pass a stopped vif to the driver in .get_txpower Avoid potentially crashing in the driver because of uninitialized private data(CVE-2024-50237)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: fs/ntfs3: Additional check in ntfs_file_release(CVE-2024-50242)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: fs/ntfs3: Fix possible deadlock in mi_read Mutex lock with another subclass used in ni_lock_dir().(CVE-2024-50245)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: fs/ntfs3: Add rough attr alloc_size check(CVE-2024-50246)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: fs/ntfs3: Check if more than chunk-size bytes are written A incorrectly formatted chunk may decompress into more than LZNT_CHUNK_SIZE bytes and a index out of bounds will occur in s_max_off.(CVE-2024-50247)",
"id": "OESA-2024-2445",
"modified": "2026-08-06T11:07:55Z",
"published": "2024-11-22T11:07:55Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2024-2445"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48878"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48953"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-49026"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35833"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36005"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36950"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43911"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-47663"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-47666"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-47728"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-49914"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-49945"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-49963"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-49982"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50099"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50115"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50138"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50184"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50195"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50198"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50237"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50242"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50245"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50246"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50247"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2022-48878",
"CVE-2022-48953",
"CVE-2022-49026",
"CVE-2024-35833",
"CVE-2024-36005",
"CVE-2024-36950",
"CVE-2024-43911",
"CVE-2024-47663",
"CVE-2024-47666",
"CVE-2024-47728",
"CVE-2024-49914",
"CVE-2024-49945",
"CVE-2024-49963",
"CVE-2024-49982",
"CVE-2024-50099",
"CVE-2024-50115",
"CVE-2024-50138",
"CVE-2024-50184",
"CVE-2024-50195",
"CVE-2024-50198",
"CVE-2024-50237",
"CVE-2024-50242",
"CVE-2024-50245",
"CVE-2024-50246",
"CVE-2024-50247"
]
}
RHSA-2024:5101
Vulnerability from csaf_opensuse - Published: 2024-08-08 04:53 - Updated: 2026-10-02 17:10In the Linux kernel, the following vulnerability has been resolved: firewire: ohci: mask bus reset interrupts between ISR and bottom half In the FireWire OHCI interrupt handler, if a bus reset interrupt has occurred, mask bus reset interrupts until bus_reset_work has serviced and cleared the interrupt. Normally, we always leave bus reset interrupts masked. We infer the bus reset from the self-ID interrupt that happens shortly thereafter. A scenario where we unmask bus reset interrupts was introduced in 2008 in a007bb857e0b26f5d8b73c2ff90782d9c0972620: If OHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we will unmask bus reset interrupts so we can log them. irq_handler logs the bus reset interrupt. However, we can't clear the bus reset event flag in irq_handler, because we won't service the event until later. irq_handler exits with the event flag still set. If the corresponding interrupt is still unmasked, the first bus reset will usually freeze the system due to irq_handler being called again each time it exits. This freeze can be reproduced by loading firewire_ohci with "modprobe firewire_ohci debug=-1" (to enable all debugging output). Apparently there are also some cases where bus_reset_work will get called soon enough to clear the event, and operation will continue normally. This freeze was first reported a few months after a007bb85 was committed, but until now it was never fixed. The debug level could safely be set to -1 through sysfs after the module was loaded, but this would be ineffectual in logging bus reset interrupts since they were only unmasked during initialization. irq_handler will now leave the event flag set but mask bus reset interrupts, so irq_handler won't be called again and there will be no freeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will unmask the interrupt after servicing the event, so future interrupts will be caught as desired. As a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be enabled through sysfs in addition to during initial module loading. However, when enabled through sysfs, logging of bus reset interrupts will be effective only starting with the second bus reset, after bus_reset_work has executed.
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.