Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2024-38607 (GCVE-0-2024-38607)
Vulnerability from cvelistv5 – Published: 2024-06-19 13:48 – Updated: 2026-05-11 20:19| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
1da177e4c3f41524e886b7f1b8a0c1fc7321cac2 , < e4ff8bcfb2841fe4e17e5901578b632adb89036d
(git)
Affected: 1da177e4c3f41524e886b7f1b8a0c1fc7321cac2 , < 1e9c3f2caec548cfa7a65416ec4e6006e542f18e (git) Affected: 1da177e4c3f41524e886b7f1b8a0c1fc7321cac2 , < 280619bbdeac186fb320fab3d61122d2a085def8 (git) Affected: 1da177e4c3f41524e886b7f1b8a0c1fc7321cac2 , < 010d4cb19bb13f423e3e746b824f314a9bf3e9a9 (git) Affected: 1da177e4c3f41524e886b7f1b8a0c1fc7321cac2 , < 787fb79efc15b3b86442ecf079b8148f173376d7 (git) Affected: 1da177e4c3f41524e886b7f1b8a0c1fc7321cac2 , < d43a8c7ec0841e0ff91a968770aeca83f0fd4c56 (git) Affected: 1da177e4c3f41524e886b7f1b8a0c1fc7321cac2 , < 5900a88e897e6deb1bdce09ee34167a81c2da89d (git) Affected: 1da177e4c3f41524e886b7f1b8a0c1fc7321cac2 , < 2907d409ce5946390f513976f0454888d37d1058 (git) Affected: 1da177e4c3f41524e886b7f1b8a0c1fc7321cac2 , < d301a71c76ee4c384b4e03cdc320a55f5cf1df05 (git) |
guessed | |
| Linux | Linux |
Affected:
2.6.12
Unaffected: 0 , < 2.6.12 (semver) Unaffected: 4.19.316 , ≤ 4.19.* (semver) Unaffected: 5.4.278 , ≤ 5.4.* (semver) Unaffected: 5.10.219 , ≤ 5.10.* (semver) Unaffected: 5.15.161 , ≤ 5.15.* (semver) Unaffected: 6.1.93 , ≤ 6.1.* (semver) Unaffected: 6.6.33 , ≤ 6.6.* (semver) Unaffected: 6.8.12 , ≤ 6.8.* (semver) Unaffected: 6.9.3 , ≤ 6.9.* (semver) Unaffected: 6.10 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T04:12:26.200Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/e4ff8bcfb2841fe4e17e5901578b632adb89036d"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/1e9c3f2caec548cfa7a65416ec4e6006e542f18e"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/280619bbdeac186fb320fab3d61122d2a085def8"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/010d4cb19bb13f423e3e746b824f314a9bf3e9a9"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/787fb79efc15b3b86442ecf079b8148f173376d7"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/d43a8c7ec0841e0ff91a968770aeca83f0fd4c56"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/5900a88e897e6deb1bdce09ee34167a81c2da89d"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/2907d409ce5946390f513976f0454888d37d1058"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/d301a71c76ee4c384b4e03cdc320a55f5cf1df05"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2024-38607",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T17:13:11.802131Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-09-11T17:34:53.740Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/macintosh/via-macii.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "e4ff8bcfb2841fe4e17e5901578b632adb89036d",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "1e9c3f2caec548cfa7a65416ec4e6006e542f18e",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "280619bbdeac186fb320fab3d61122d2a085def8",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "010d4cb19bb13f423e3e746b824f314a9bf3e9a9",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "787fb79efc15b3b86442ecf079b8148f173376d7",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "d43a8c7ec0841e0ff91a968770aeca83f0fd4c56",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "5900a88e897e6deb1bdce09ee34167a81c2da89d",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "2907d409ce5946390f513976f0454888d37d1058",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "d301a71c76ee4c384b4e03cdc320a55f5cf1df05",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/macintosh/via-macii.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.12"
},
{
"lessThan": "2.6.12",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.316",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.278",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.219",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.161",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.93",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.33",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.316",
"versionStartIncluding": "2.6.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.278",
"versionStartIncluding": "2.6.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.219",
"versionStartIncluding": "2.6.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.161",
"versionStartIncluding": "2.6.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.93",
"versionStartIncluding": "2.6.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.33",
"versionStartIncluding": "2.6.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.8.12",
"versionStartIncluding": "2.6.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.9.3",
"versionStartIncluding": "2.6.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.10",
"versionStartIncluding": "2.6.12",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmacintosh/via-macii: Fix \"BUG: sleeping function called from invalid context\"\n\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0027t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T20:19:59.828Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/e4ff8bcfb2841fe4e17e5901578b632adb89036d"
},
{
"url": "https://git.kernel.org/stable/c/1e9c3f2caec548cfa7a65416ec4e6006e542f18e"
},
{
"url": "https://git.kernel.org/stable/c/280619bbdeac186fb320fab3d61122d2a085def8"
},
{
"url": "https://git.kernel.org/stable/c/010d4cb19bb13f423e3e746b824f314a9bf3e9a9"
},
{
"url": "https://git.kernel.org/stable/c/787fb79efc15b3b86442ecf079b8148f173376d7"
},
{
"url": "https://git.kernel.org/stable/c/d43a8c7ec0841e0ff91a968770aeca83f0fd4c56"
},
{
"url": "https://git.kernel.org/stable/c/5900a88e897e6deb1bdce09ee34167a81c2da89d"
},
{
"url": "https://git.kernel.org/stable/c/2907d409ce5946390f513976f0454888d37d1058"
},
{
"url": "https://git.kernel.org/stable/c/d301a71c76ee4c384b4e03cdc320a55f5cf1df05"
}
],
"title": "macintosh/via-macii: Fix \"BUG: sleeping function called from invalid context\"",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-38607",
"datePublished": "2024-06-19T13:48:17.096Z",
"dateReserved": "2024-06-18T19:36:34.941Z",
"dateUpdated": "2026-05-11T20:19:59.828Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2024-38607",
"date": "2026-09-28",
"epss": "0.00225",
"percentile": "0.11915"
},
"fkie_nvd": {
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmacintosh/via-macii: Fix \"BUG: sleeping function called from invalid context\"\n\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0027t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization."
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: macintosh/via-macii: Correcci\u00f3n \"ERROR: funci\u00f3n de suspensi\u00f3n llamada desde un contexto no v\u00e1lido\" El controlador ADB via-macii llama a request_irq() despu\u00e9s de deshabilitar las interrupciones bruscas. Pero aqu\u00ed no es necesario deshabilitar las interrupciones porque la interrupci\u00f3n del registro de desplazamiento de VIA se enmascar\u00f3 durante la inicializaci\u00f3n de VIA1."
}
],
"id": "CVE-2024-38607",
"lastModified": "2024-11-21T09:26:28.270",
"published": "2024-06-19T14:15:20.650",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/010d4cb19bb13f423e3e746b824f314a9bf3e9a9"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/1e9c3f2caec548cfa7a65416ec4e6006e542f18e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/280619bbdeac186fb320fab3d61122d2a085def8"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/2907d409ce5946390f513976f0454888d37d1058"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/5900a88e897e6deb1bdce09ee34167a81c2da89d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/787fb79efc15b3b86442ecf079b8148f173376d7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/d301a71c76ee4c384b4e03cdc320a55f5cf1df05"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/d43a8c7ec0841e0ff91a968770aeca83f0fd4c56"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/e4ff8bcfb2841fe4e17e5901578b632adb89036d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/010d4cb19bb13f423e3e746b824f314a9bf3e9a9"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/1e9c3f2caec548cfa7a65416ec4e6006e542f18e"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/280619bbdeac186fb320fab3d61122d2a085def8"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/2907d409ce5946390f513976f0454888d37d1058"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/5900a88e897e6deb1bdce09ee34167a81c2da89d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/787fb79efc15b3b86442ecf079b8148f173376d7"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/d301a71c76ee4c384b4e03cdc320a55f5cf1df05"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/d43a8c7ec0841e0ff91a968770aeca83f0fd4c56"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/e4ff8bcfb2841fe4e17e5901578b632adb89036d"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Awaiting Analysis"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/macintosh/via-macii.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "e4ff8bcfb2841fe4e17e5901578b632adb89036d",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "1e9c3f2caec548cfa7a65416ec4e6006e542f18e",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "280619bbdeac186fb320fab3d61122d2a085def8",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "010d4cb19bb13f423e3e746b824f314a9bf3e9a9",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "787fb79efc15b3b86442ecf079b8148f173376d7",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "d43a8c7ec0841e0ff91a968770aeca83f0fd4c56",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "5900a88e897e6deb1bdce09ee34167a81c2da89d",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "2907d409ce5946390f513976f0454888d37d1058",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "d301a71c76ee4c384b4e03cdc320a55f5cf1df05",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/macintosh/via-macii.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.12"
},
{
"lessThan": "2.6.12",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.316",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.278",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.219",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.161",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.93",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.33",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "90428380-A9D6-4FC4-85D4-392E92A80249",
"versionEndExcluding": "4.19.316",
"versionStartIncluding": "2.6.13",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "7FDBF235-DA18-49A1-8690-6C7272FD0701",
"versionEndExcluding": "5.4.278",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E9063AF3-D593-43B7-810D-58B87F82F9F9",
"versionEndExcluding": "5.10.219",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "31130639-53FE-4726-8986-434EE2528CB2",
"versionEndExcluding": "5.15.161",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "EEFB78EE-F990-4197-BF1C-156760A55667",
"versionEndExcluding": "6.1.93",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "FCE796DF-3B50-4DC6-BAE5-95271068FC9E",
"versionEndExcluding": "6.6.33",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "80550309-67AB-4FD1-AC07-3DED5C4F01B2",
"versionEndExcluding": "6.8.12",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E07124C1-19E8-4D21-828D-9932A01D3011",
"versionEndExcluding": "6.9.3",
"versionStartIncluding": "6.9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:2.6.12:-:*:*:*:*:*:*",
"matchCriteriaId": "6F62EECE-8FB1-4D57-85D8-CB9E23CF313C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:2.6.12:rc2:*:*:*:*:*:*",
"matchCriteriaId": "4F76C298-81DC-43E4-8FC9-DC005A2116EF",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:2.6.12:rc3:*:*:*:*:*:*",
"matchCriteriaId": "0AB349B2-3F78-4197-882B-90ADB3BF645A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:2.6.12:rc4:*:*:*:*:*:*",
"matchCriteriaId": "6AC88830-A9BC-4607-B572-A4B502FC9FD0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:2.6.12:rc5:*:*:*:*:*:*",
"matchCriteriaId": "476CB3A5-D022-4F13-AAEF-CB6A5785516A",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmacintosh/via-macii: Fix \"BUG: sleeping function called from invalid context\"\n\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0027t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization."
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: macintosh/via-macii: Correcci\u00f3n \"ERROR: funci\u00f3n de suspensi\u00f3n llamada desde un contexto no v\u00e1lido\" El controlador ADB via-macii llama a request_irq() despu\u00e9s de deshabilitar las interrupciones bruscas. Pero aqu\u00ed no es necesario deshabilitar las interrupciones porque la interrupci\u00f3n del registro de desplazamiento de VIA se enmascar\u00f3 durante la inicializaci\u00f3n de VIA1."
}
],
"id": "CVE-2024-38607",
"lastModified": "2026-06-17T07:40:42.180",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-38607",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T17:13:11.802131Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-06-19T14:15:20.650",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/010d4cb19bb13f423e3e746b824f314a9bf3e9a9"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/1e9c3f2caec548cfa7a65416ec4e6006e542f18e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/280619bbdeac186fb320fab3d61122d2a085def8"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2907d409ce5946390f513976f0454888d37d1058"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5900a88e897e6deb1bdce09ee34167a81c2da89d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/787fb79efc15b3b86442ecf079b8148f173376d7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/d301a71c76ee4c384b4e03cdc320a55f5cf1df05"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/d43a8c7ec0841e0ff91a968770aeca83f0fd4c56"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/e4ff8bcfb2841fe4e17e5901578b632adb89036d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/010d4cb19bb13f423e3e746b824f314a9bf3e9a9"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/1e9c3f2caec548cfa7a65416ec4e6006e542f18e"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/280619bbdeac186fb320fab3d61122d2a085def8"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2907d409ce5946390f513976f0454888d37d1058"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5900a88e897e6deb1bdce09ee34167a81c2da89d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/787fb79efc15b3b86442ecf079b8148f173376d7"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/d301a71c76ee4c384b4e03cdc320a55f5cf1df05"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/d43a8c7ec0841e0ff91a968770aeca83f0fd4c56"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/e4ff8bcfb2841fe4e17e5901578b632adb89036d"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-noinfo"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Low",
"current_release_date": "2025-11-21T10:45:31+00:00",
"cve": "CVE-2024-38607",
"id": "CVE-2024-38607",
"initial_release_date": "2024-06-19T00:00:00+00:00",
"product_status:known_affected": "198",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: macintosh/via-macii: Fix \u0026#34;BUG: sleeping function called from invalid context\u0026#34;",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2024/cve-2024-38607.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-09-02T01:29:02Z",
"cve": "CVE-2024-38607",
"id": "CVE-2024-38607",
"initial_release_date": "2024-06-24T23:15:46Z",
"product_status:known_not_affected": "568",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2024-38607",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2024-38607.json",
"version": "35"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T04:12:26.200Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/e4ff8bcfb2841fe4e17e5901578b632adb89036d"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/1e9c3f2caec548cfa7a65416ec4e6006e542f18e"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/280619bbdeac186fb320fab3d61122d2a085def8"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/010d4cb19bb13f423e3e746b824f314a9bf3e9a9"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/787fb79efc15b3b86442ecf079b8148f173376d7"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/d43a8c7ec0841e0ff91a968770aeca83f0fd4c56"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/5900a88e897e6deb1bdce09ee34167a81c2da89d"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/2907d409ce5946390f513976f0454888d37d1058"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/d301a71c76ee4c384b4e03cdc320a55f5cf1df05"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2024-38607",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T17:13:11.802131Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-09-11T12:42:26.627Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/macintosh/via-macii.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "e4ff8bcfb284",
"status": "affected",
"version": "1da177e4c3f4",
"versionType": "git"
},
{
"lessThan": "1e9c3f2caec5",
"status": "affected",
"version": "1da177e4c3f4",
"versionType": "git"
},
{
"lessThan": "280619bbdeac",
"status": "affected",
"version": "1da177e4c3f4",
"versionType": "git"
},
{
"lessThan": "010d4cb19bb1",
"status": "affected",
"version": "1da177e4c3f4",
"versionType": "git"
},
{
"lessThan": "787fb79efc15",
"status": "affected",
"version": "1da177e4c3f4",
"versionType": "git"
},
{
"lessThan": "d43a8c7ec084",
"status": "affected",
"version": "1da177e4c3f4",
"versionType": "git"
},
{
"lessThan": "5900a88e897e",
"status": "affected",
"version": "1da177e4c3f4",
"versionType": "git"
},
{
"lessThan": "2907d409ce59",
"status": "affected",
"version": "1da177e4c3f4",
"versionType": "git"
},
{
"lessThan": "d301a71c76ee",
"status": "affected",
"version": "1da177e4c3f4",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/macintosh/via-macii.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.12"
},
{
"lessThan": "2.6.12",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.316",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.278",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.219",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.161",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.93",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.33",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmacintosh/via-macii: Fix \"BUG: sleeping function called from invalid context\"\n\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0027t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization."
}
],
"providerMetadata": {
"dateUpdated": "2024-11-05T09:30:51.417Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/e4ff8bcfb2841fe4e17e5901578b632adb89036d"
},
{
"url": "https://git.kernel.org/stable/c/1e9c3f2caec548cfa7a65416ec4e6006e542f18e"
},
{
"url": "https://git.kernel.org/stable/c/280619bbdeac186fb320fab3d61122d2a085def8"
},
{
"url": "https://git.kernel.org/stable/c/010d4cb19bb13f423e3e746b824f314a9bf3e9a9"
},
{
"url": "https://git.kernel.org/stable/c/787fb79efc15b3b86442ecf079b8148f173376d7"
},
{
"url": "https://git.kernel.org/stable/c/d43a8c7ec0841e0ff91a968770aeca83f0fd4c56"
},
{
"url": "https://git.kernel.org/stable/c/5900a88e897e6deb1bdce09ee34167a81c2da89d"
},
{
"url": "https://git.kernel.org/stable/c/2907d409ce5946390f513976f0454888d37d1058"
},
{
"url": "https://git.kernel.org/stable/c/d301a71c76ee4c384b4e03cdc320a55f5cf1df05"
}
],
"title": "macintosh/via-macii: Fix \"BUG: sleeping function called from invalid context\"",
"x_generator": {
"engine": "bippy-9e1c9544281a"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-38607",
"datePublished": "2024-06-19T13:48:17.096Z",
"dateReserved": "2024-06-18T19:36:34.941Z",
"dateUpdated": "2024-11-05T09:30:51.417Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
}
}
CERTFR-2024-AVI-0667
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2023-46343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46343"
},
{
"name": "CVE-2024-25744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25744"
},
{
"name": "CVE-2024-26600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26600"
},
{
"name": "CVE-2023-52436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52436"
},
{
"name": "CVE-2023-52443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52443"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2023-52449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52449"
},
{
"name": "CVE-2023-52444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52444"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26602"
},
{
"name": "CVE-2024-26603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26603"
},
{
"name": "CVE-2024-1151",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1151"
},
{
"name": "CVE-2023-6270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6270"
},
{
"name": "CVE-2024-26593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26593"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2023-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52434"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2024-26667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26667"
},
{
"name": "CVE-2024-0841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0841"
},
{
"name": "CVE-2024-26695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26695"
},
{
"name": "CVE-2024-26717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26717"
},
{
"name": "CVE-2024-26659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26659"
},
{
"name": "CVE-2023-52637",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52637"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-25742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25742"
},
{
"name": "CVE-2024-26664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26664"
},
{
"name": "CVE-2024-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23307"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26707"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2024-26689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26689"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2023-52638",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52638"
},
{
"name": "CVE-2024-26606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26606"
},
{
"name": "CVE-2024-26718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26718"
},
{
"name": "CVE-2024-26702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26702"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-26710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26710"
},
{
"name": "CVE-2024-26803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26803"
},
{
"name": "CVE-2024-26798",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26798"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26712",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26712"
},
{
"name": "CVE-2024-24858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24858"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26723"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2024-26660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26660"
},
{
"name": "CVE-2024-26789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26789"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26688"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26722"
},
{
"name": "CVE-2024-26681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26681"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2023-52620",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52620"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26790"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26792",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26792"
},
{
"name": "CVE-2024-26680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26680"
},
{
"name": "CVE-2024-26736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26736"
},
{
"name": "CVE-2024-26782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26782"
},
{
"name": "CVE-2024-26980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26980"
},
{
"name": "CVE-2024-26917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26917"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2024-26910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26910"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26820"
},
{
"name": "CVE-2024-26936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26936"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-26898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26898"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-26825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26825"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-26926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26926"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2023-52585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52585"
},
{
"name": "CVE-2022-48655",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48655"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2024-26693",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26693"
},
{
"name": "CVE-2024-26694",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26694"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36031"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35983"
},
{
"name": "CVE-2024-35988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35988"
},
{
"name": "CVE-2024-35996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35996"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38612"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38637"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-39292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39292"
},
{
"name": "CVE-2024-26886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26886"
},
{
"name": "CVE-2024-26890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26890"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38545"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-24859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24859"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2024-26662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26662"
},
{
"name": "CVE-2024-26666",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26666"
},
{
"name": "CVE-2024-26677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26677"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2024-26703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26703"
},
{
"name": "CVE-2024-26708",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26708"
},
{
"name": "CVE-2024-26711",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26711"
},
{
"name": "CVE-2024-26716",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26716"
},
{
"name": "CVE-2024-26719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26719"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-26818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26818"
},
{
"name": "CVE-2024-26824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26824"
},
{
"name": "CVE-2024-26831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26831"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38593"
},
{
"name": "CVE-2024-38607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38607"
},
{
"name": "CVE-2024-38613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38613"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39467",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39467"
},
{
"name": "CVE-2024-39480",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39480"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39489"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2022-48674",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48674"
},
{
"name": "CVE-2024-27394",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27394"
},
{
"name": "CVE-2024-35846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35846"
},
{
"name": "CVE-2024-35856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35856"
},
{
"name": "CVE-2024-35858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35858"
},
{
"name": "CVE-2024-35859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35859"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-35987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35987"
},
{
"name": "CVE-2024-35993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35993"
},
{
"name": "CVE-2024-35994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35994"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36001"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36028"
},
{
"name": "CVE-2024-36033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36033"
},
{
"name": "CVE-2024-36881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36881"
},
{
"name": "CVE-2024-36884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36884"
},
{
"name": "CVE-2024-36888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36888"
},
{
"name": "CVE-2024-36892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36892"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36908"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2024-36925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36925"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-36932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36932"
},
{
"name": "CVE-2024-36943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36943"
},
{
"name": "CVE-2024-36948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36948"
},
{
"name": "CVE-2024-36956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36956"
},
{
"name": "CVE-2024-36958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36958"
},
{
"name": "CVE-2024-36961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36961"
},
{
"name": "CVE-2024-36963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36963"
},
{
"name": "CVE-2024-36966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36966"
},
{
"name": "CVE-2024-36968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36968"
},
{
"name": "CVE-2024-36979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36979"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2024-38542",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38542"
},
{
"name": "CVE-2024-38561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38561"
},
{
"name": "CVE-2024-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38563"
},
{
"name": "CVE-2024-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38574"
},
{
"name": "CVE-2024-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38576"
},
{
"name": "CVE-2024-38577",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38577"
},
{
"name": "CVE-2024-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38584"
},
{
"name": "CVE-2024-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38585"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-38606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38606"
},
{
"name": "CVE-2024-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38614"
},
{
"name": "CVE-2024-38620",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38620"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2024-42134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42134"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0667",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-09T00:00:00.000000"
}
],
"risks": [
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
},
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2024-08-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6895-4",
"url": "https://ubuntu.com/security/notices/USN-6895-4"
},
{
"published_at": "2024-08-08",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6951-1",
"url": "https://ubuntu.com/security/notices/USN-6951-1"
},
{
"published_at": "2024-08-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6926-2",
"url": "https://ubuntu.com/security/notices/USN-6926-2"
},
{
"published_at": "2024-08-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6952-1",
"url": "https://ubuntu.com/security/notices/USN-6952-1"
},
{
"published_at": "2024-08-08",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6949-1",
"url": "https://ubuntu.com/security/notices/USN-6949-1"
},
{
"published_at": "2024-08-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6922-2",
"url": "https://ubuntu.com/security/notices/USN-6922-2"
},
{
"published_at": "2024-08-08",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6950-1",
"url": "https://ubuntu.com/security/notices/USN-6950-1"
},
{
"published_at": "2024-08-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6953-1",
"url": "https://ubuntu.com/security/notices/USN-6953-1"
}
]
}
CERTFR-2024-AVI-0694
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 16.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2023-46343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46343"
},
{
"name": "CVE-2024-25744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25744"
},
{
"name": "CVE-2023-52436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52436"
},
{
"name": "CVE-2023-52443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52443"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2023-52449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52449"
},
{
"name": "CVE-2023-52444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52444"
},
{
"name": "CVE-2023-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52434"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-25742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25742"
},
{
"name": "CVE-2024-24858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24858"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2023-52620",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52620"
},
{
"name": "CVE-2024-26980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26980"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26936"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2023-52585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52585"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36031"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35983"
},
{
"name": "CVE-2024-35988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35988"
},
{
"name": "CVE-2024-35996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35996"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38612"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38637"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-39292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39292"
},
{
"name": "CVE-2024-26886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26886"
},
{
"name": "CVE-2024-26952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26952"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38545"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-24859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24859"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38593"
},
{
"name": "CVE-2024-38607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38607"
},
{
"name": "CVE-2024-38613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38613"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39467",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39467"
},
{
"name": "CVE-2024-39480",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39480"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39489"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2022-48674",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48674"
},
{
"name": "CVE-2024-27394",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27394"
},
{
"name": "CVE-2024-35846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35846"
},
{
"name": "CVE-2024-35856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35856"
},
{
"name": "CVE-2024-35858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35858"
},
{
"name": "CVE-2024-35859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35859"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-35987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35987"
},
{
"name": "CVE-2024-35993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35993"
},
{
"name": "CVE-2024-35994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35994"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36001"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36028"
},
{
"name": "CVE-2024-36033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36033"
},
{
"name": "CVE-2024-36881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36881"
},
{
"name": "CVE-2024-36884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36884"
},
{
"name": "CVE-2024-36888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36888"
},
{
"name": "CVE-2024-36892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36892"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36908"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2024-36925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36925"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-36932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36932"
},
{
"name": "CVE-2024-36943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36943"
},
{
"name": "CVE-2024-36948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36948"
},
{
"name": "CVE-2024-36956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36956"
},
{
"name": "CVE-2024-36958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36958"
},
{
"name": "CVE-2024-36961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36961"
},
{
"name": "CVE-2024-36963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36963"
},
{
"name": "CVE-2024-36966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36966"
},
{
"name": "CVE-2024-36968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36968"
},
{
"name": "CVE-2024-36979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36979"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2024-38542",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38542"
},
{
"name": "CVE-2024-38561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38561"
},
{
"name": "CVE-2024-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38563"
},
{
"name": "CVE-2024-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38574"
},
{
"name": "CVE-2024-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38576"
},
{
"name": "CVE-2024-38577",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38577"
},
{
"name": "CVE-2024-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38584"
},
{
"name": "CVE-2024-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38585"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-38606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38606"
},
{
"name": "CVE-2024-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38614"
},
{
"name": "CVE-2024-38620",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38620"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2024-42134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42134"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0694",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-16T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2024-08-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6926-3",
"url": "https://ubuntu.com/security/notices/USN-6926-3"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6950-2",
"url": "https://ubuntu.com/security/notices/USN-6950-2"
},
{
"published_at": "2024-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6955-1",
"url": "https://ubuntu.com/security/notices/USN-6955-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6949-2",
"url": "https://ubuntu.com/security/notices/USN-6949-2"
},
{
"published_at": "2024-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6956-1",
"url": "https://ubuntu.com/security/notices/USN-6956-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6957-1",
"url": "https://ubuntu.com/security/notices/USN-6957-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6950-3",
"url": "https://ubuntu.com/security/notices/USN-6950-3"
},
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6951-2",
"url": "https://ubuntu.com/security/notices/USN-6951-2"
}
]
}
CERTFR-2024-AVI-0716
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 16.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-26886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26886"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2023-52760",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52760"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-39484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39484"
},
{
"name": "CVE-2024-26600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26600"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2021-46904",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46904"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2021-46926",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46926"
},
{
"name": "CVE-2024-26903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26903"
},
{
"name": "CVE-2024-39480",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39480"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-36031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36031"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2023-52585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52585"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2023-52629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52629"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38613"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38612"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39467",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39467"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-26680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26680"
},
{
"name": "CVE-2024-24860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24860"
},
{
"name": "CVE-2022-48674",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48674"
},
{
"name": "CVE-2024-39489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39489"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2021-37159",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37159"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2023-52470",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52470"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2022-48655",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48655"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2023-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52434"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-26980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26980"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-26687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26687"
},
{
"name": "CVE-2024-38637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38637"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2023-52644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52644"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-26936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26936"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-39292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39292"
},
{
"name": "CVE-2024-38607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38607"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0716",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-23T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2024-08-19",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6951-3",
"url": "https://ubuntu.com/security/notices/USN-6951-3"
},
{
"published_at": "2024-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6974-1",
"url": "https://ubuntu.com/security/notices/USN-6974-1"
},
{
"published_at": "2024-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6971-1",
"url": "https://ubuntu.com/security/notices/USN-6971-1"
},
{
"published_at": "2024-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6972-1",
"url": "https://ubuntu.com/security/notices/USN-6972-1"
},
{
"published_at": "2024-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6951-4",
"url": "https://ubuntu.com/security/notices/USN-6951-4"
},
{
"published_at": "2024-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6975-1",
"url": "https://ubuntu.com/security/notices/USN-6975-1"
},
{
"published_at": "2024-08-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6972-2",
"url": "https://ubuntu.com/security/notices/USN-6972-2"
},
{
"published_at": "2024-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6950-4",
"url": "https://ubuntu.com/security/notices/USN-6950-4"
},
{
"published_at": "2024-08-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6979-1",
"url": "https://ubuntu.com/security/notices/USN-6979-1"
},
{
"published_at": "2024-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6973-1",
"url": "https://ubuntu.com/security/notices/USN-6973-1"
}
]
}
CERTFR-2024-AVI-0778
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | |||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-24860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24860"
},
{
"name": "CVE-2021-46926",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46926"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38612"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38637"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-39292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39292"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2023-52760",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52760"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-33847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33847"
},
{
"name": "CVE-2024-34027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34027"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38607"
},
{
"name": "CVE-2024-38613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38613"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-38662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38662"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39298"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39467",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39467"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39480",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39480"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39484"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39489"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39495",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39495"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-39510",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39510"
},
{
"name": "CVE-2024-40899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40899"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40905"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40910"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40913"
},
{
"name": "CVE-2024-40914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40914"
},
{
"name": "CVE-2024-40915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40915"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40920"
},
{
"name": "CVE-2024-40921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40921"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40938"
},
{
"name": "CVE-2024-40939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40939"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40957"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40963"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40968"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40971"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40980"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-40996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40996"
},
{
"name": "CVE-2024-41000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41000"
},
{
"name": "CVE-2024-41001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41001"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2023-52629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52629"
},
{
"name": "CVE-2024-36484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36484"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2024-41034",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41034"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2024-41046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41046"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2024-42101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42101"
},
{
"name": "CVE-2024-42102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42102"
},
{
"name": "CVE-2024-42104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42104"
},
{
"name": "CVE-2024-42106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42106"
},
{
"name": "CVE-2024-42115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42115"
},
{
"name": "CVE-2024-42121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42121"
},
{
"name": "CVE-2024-42127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42127"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2024-42137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42137"
},
{
"name": "CVE-2024-42148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42148"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-42153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42153"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42157"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2024-40936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40936"
},
{
"name": "CVE-2024-42082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42082"
},
{
"name": "CVE-2023-52887",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52887"
},
{
"name": "CVE-2024-32936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-32936"
},
{
"name": "CVE-2024-34030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34030"
},
{
"name": "CVE-2024-36244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36244"
},
{
"name": "CVE-2024-36481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36481"
},
{
"name": "CVE-2024-37026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37026"
},
{
"name": "CVE-2024-38306",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38306"
},
{
"name": "CVE-2024-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38623"
},
{
"name": "CVE-2024-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38624"
},
{
"name": "CVE-2024-38625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38625"
},
{
"name": "CVE-2024-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38632"
},
{
"name": "CVE-2024-38667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38667"
},
{
"name": "CVE-2024-39461",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39461"
},
{
"name": "CVE-2024-39462",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39462"
},
{
"name": "CVE-2024-39464",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39464"
},
{
"name": "CVE-2024-39465",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39465"
},
{
"name": "CVE-2024-39470",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39470"
},
{
"name": "CVE-2024-39478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39478"
},
{
"name": "CVE-2024-39483",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39483"
},
{
"name": "CVE-2024-39485",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39485"
},
{
"name": "CVE-2024-39491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39491"
},
{
"name": "CVE-2024-39492",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39492"
},
{
"name": "CVE-2024-40917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40917"
},
{
"name": "CVE-2024-40918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40918"
},
{
"name": "CVE-2024-40922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40922"
},
{
"name": "CVE-2024-40926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40926"
},
{
"name": "CVE-2024-40930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40930"
},
{
"name": "CVE-2024-40933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40933"
},
{
"name": "CVE-2024-40944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40944"
},
{
"name": "CVE-2024-40949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40949"
},
{
"name": "CVE-2024-40951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40951"
},
{
"name": "CVE-2024-40952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40952"
},
{
"name": "CVE-2024-40955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40955"
},
{
"name": "CVE-2024-40962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40962"
},
{
"name": "CVE-2024-40964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40964"
},
{
"name": "CVE-2024-40965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40965"
},
{
"name": "CVE-2024-40969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40969"
},
{
"name": "CVE-2024-40973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40973"
},
{
"name": "CVE-2024-40985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40985"
},
{
"name": "CVE-2024-40986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40986"
},
{
"name": "CVE-2024-40992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40992"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-41003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41003"
},
{
"name": "CVE-2024-41027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41027"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2024-42068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42068"
},
{
"name": "CVE-2024-42076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42076"
},
{
"name": "CVE-2024-42077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42077"
},
{
"name": "CVE-2024-42078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42078"
},
{
"name": "CVE-2024-42080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42080"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2024-42085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42085"
},
{
"name": "CVE-2024-42086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42086"
},
{
"name": "CVE-2024-42087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42087"
},
{
"name": "CVE-2024-42089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42089"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2024-42092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42092"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2024-42095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42095"
},
{
"name": "CVE-2024-42097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42097"
},
{
"name": "CVE-2024-42098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42098"
},
{
"name": "CVE-2024-42109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42109"
},
{
"name": "CVE-2024-42130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42130"
},
{
"name": "CVE-2024-42140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42140"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2024-42270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42270"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0778",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-09-13T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2024-09-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7003-3",
"url": "https://ubuntu.com/security/notices/USN-7003-3"
},
{
"published_at": "2024-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7005-1",
"url": "https://ubuntu.com/security/notices/USN-7005-1"
},
{
"published_at": "2024-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7003-1",
"url": "https://ubuntu.com/security/notices/USN-7003-1"
},
{
"published_at": "2024-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7003-2",
"url": "https://ubuntu.com/security/notices/USN-7003-2"
},
{
"published_at": "2024-09-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7007-1",
"url": "https://ubuntu.com/security/notices/USN-7007-1"
},
{
"published_at": "2024-09-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7008-1",
"url": "https://ubuntu.com/security/notices/USN-7008-1"
},
{
"published_at": "2024-09-11",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6999-1",
"url": "https://ubuntu.com/security/notices/USN-6999-1"
},
{
"published_at": "2024-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7006-1",
"url": "https://ubuntu.com/security/notices/USN-7006-1"
},
{
"published_at": "2024-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7004-1",
"url": "https://ubuntu.com/security/notices/USN-7004-1"
}
]
}
CERTFR-2024-AVI-0799
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Title | Publication Time | Tags | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-38096",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-38096"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2024-26629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26629"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-25742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25742"
},
{
"name": "CVE-2024-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23307"
},
{
"name": "CVE-2024-26811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26811"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26810"
},
{
"name": "CVE-2024-26787",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26787"
},
{
"name": "CVE-2024-24858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24858"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2024-26812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26812"
},
{
"name": "CVE-2024-26687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26687"
},
{
"name": "CVE-2024-26680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26680"
},
{
"name": "CVE-2023-52488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52488"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26966"
},
{
"name": "CVE-2024-26980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26980"
},
{
"name": "CVE-2024-26970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26970"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-27009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27009"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26965"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-26936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26936"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26956"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-26955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26955"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-26817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26817"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26969"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-27018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27018"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-26926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26926"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2023-52585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52585"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36031"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-35785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35785"
},
{
"name": "CVE-2024-35805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35805"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35871"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35888"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35897"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35902"
},
{
"name": "CVE-2024-35910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35910"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35934"
},
{
"name": "CVE-2024-35988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35988"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38612"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38637"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-39292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39292"
},
{
"name": "CVE-2024-26886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26886"
},
{
"name": "CVE-2024-26952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26952"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-24859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24859"
},
{
"name": "CVE-2024-26677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26677"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2023-52760",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52760"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-33847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33847"
},
{
"name": "CVE-2024-34027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34027"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38607"
},
{
"name": "CVE-2024-38613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38613"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-38662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38662"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39298"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39467",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39467"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39480",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39480"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39484"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39489"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39495",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39495"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-39510",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39510"
},
{
"name": "CVE-2024-40899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40899"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40905"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40910"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40913"
},
{
"name": "CVE-2024-40914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40914"
},
{
"name": "CVE-2024-40915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40915"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40920"
},
{
"name": "CVE-2024-40921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40921"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40938"
},
{
"name": "CVE-2024-40939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40939"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40957"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40963"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40968"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40971"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40980"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-40996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40996"
},
{
"name": "CVE-2024-41000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41000"
},
{
"name": "CVE-2024-41001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41001"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2022-48808",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48808"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2023-52629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52629"
},
{
"name": "CVE-2024-36484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36484"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2024-41034",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41034"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2024-41046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41046"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2024-42101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42101"
},
{
"name": "CVE-2024-42102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42102"
},
{
"name": "CVE-2024-42104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42104"
},
{
"name": "CVE-2024-42106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42106"
},
{
"name": "CVE-2024-42115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42115"
},
{
"name": "CVE-2024-42121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42121"
},
{
"name": "CVE-2024-42127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42127"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2024-42137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42137"
},
{
"name": "CVE-2024-42148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42148"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-42153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42153"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42157"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2024-40936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40936"
},
{
"name": "CVE-2024-42082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42082"
},
{
"name": "CVE-2023-52887",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52887"
},
{
"name": "CVE-2024-32936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-32936"
},
{
"name": "CVE-2024-34030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34030"
},
{
"name": "CVE-2024-36244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36244"
},
{
"name": "CVE-2024-36481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36481"
},
{
"name": "CVE-2024-37026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37026"
},
{
"name": "CVE-2024-38306",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38306"
},
{
"name": "CVE-2024-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38623"
},
{
"name": "CVE-2024-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38624"
},
{
"name": "CVE-2024-38625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38625"
},
{
"name": "CVE-2024-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38632"
},
{
"name": "CVE-2024-38667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38667"
},
{
"name": "CVE-2024-39461",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39461"
},
{
"name": "CVE-2024-39462",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39462"
},
{
"name": "CVE-2024-39464",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39464"
},
{
"name": "CVE-2024-39465",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39465"
},
{
"name": "CVE-2024-39470",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39470"
},
{
"name": "CVE-2024-39478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39478"
},
{
"name": "CVE-2024-39483",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39483"
},
{
"name": "CVE-2024-39485",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39485"
},
{
"name": "CVE-2024-39491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39491"
},
{
"name": "CVE-2024-39492",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39492"
},
{
"name": "CVE-2024-40917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40917"
},
{
"name": "CVE-2024-40918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40918"
},
{
"name": "CVE-2024-40922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40922"
},
{
"name": "CVE-2024-40926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40926"
},
{
"name": "CVE-2024-40930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40930"
},
{
"name": "CVE-2024-40933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40933"
},
{
"name": "CVE-2024-40944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40944"
},
{
"name": "CVE-2024-40949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40949"
},
{
"name": "CVE-2024-40951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40951"
},
{
"name": "CVE-2024-40952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40952"
},
{
"name": "CVE-2024-40955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40955"
},
{
"name": "CVE-2024-40962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40962"
},
{
"name": "CVE-2024-40964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40964"
},
{
"name": "CVE-2024-40965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40965"
},
{
"name": "CVE-2024-40969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40969"
},
{
"name": "CVE-2024-40973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40973"
},
{
"name": "CVE-2024-40985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40985"
},
{
"name": "CVE-2024-40986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40986"
},
{
"name": "CVE-2024-40992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40992"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-41003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41003"
},
{
"name": "CVE-2024-41027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41027"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2024-42068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42068"
},
{
"name": "CVE-2024-42076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42076"
},
{
"name": "CVE-2024-42077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42077"
},
{
"name": "CVE-2024-42078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42078"
},
{
"name": "CVE-2024-42080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42080"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2024-42085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42085"
},
{
"name": "CVE-2024-42086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42086"
},
{
"name": "CVE-2024-42087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42087"
},
{
"name": "CVE-2024-42089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42089"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2024-42092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42092"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2024-42095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42095"
},
{
"name": "CVE-2024-42097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42097"
},
{
"name": "CVE-2024-42098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42098"
},
{
"name": "CVE-2024-42109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42109"
},
{
"name": "CVE-2024-42130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42130"
},
{
"name": "CVE-2024-42140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42140"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2024-42270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42270"
},
{
"name": "CVE-2024-42159",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42159"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2024-42160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42160"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0799",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-09-20T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2024-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7022-1",
"url": "https://ubuntu.com/security/notices/USN-7022-1"
},
{
"published_at": "2024-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7020-1",
"url": "https://ubuntu.com/security/notices/USN-7020-1"
},
{
"published_at": "2024-09-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7009-1",
"url": "https://ubuntu.com/security/notices/USN-7009-1"
},
{
"published_at": "2024-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7019-1",
"url": "https://ubuntu.com/security/notices/USN-7019-1"
},
{
"published_at": "2024-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7021-1",
"url": "https://ubuntu.com/security/notices/USN-7021-1"
},
{
"published_at": "2024-09-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7005-2",
"url": "https://ubuntu.com/security/notices/USN-7005-2"
}
]
}
CERTFR-2024-AVI-0823
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 16.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-26651",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26651"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2021-47181",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47181"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-26851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26851"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38612"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38637"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-39292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39292"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-26677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26677"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-33847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33847"
},
{
"name": "CVE-2024-34027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34027"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38607"
},
{
"name": "CVE-2024-38613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38613"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-38662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38662"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39298"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39467",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39467"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39480",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39480"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39484"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39489"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39495",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39495"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-39510",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39510"
},
{
"name": "CVE-2024-40899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40899"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40905"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40910"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40913"
},
{
"name": "CVE-2024-40914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40914"
},
{
"name": "CVE-2024-40915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40915"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40920"
},
{
"name": "CVE-2024-40921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40921"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40938"
},
{
"name": "CVE-2024-40939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40939"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40957"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40963"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40968"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40971"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40980"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-40996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40996"
},
{
"name": "CVE-2024-41000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41000"
},
{
"name": "CVE-2024-41001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41001"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48838",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48838"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48851"
},
{
"name": "CVE-2022-48857",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48857"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-36484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36484"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2024-41034",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41034"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2024-41046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41046"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2024-42101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42101"
},
{
"name": "CVE-2024-42102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42102"
},
{
"name": "CVE-2024-42104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42104"
},
{
"name": "CVE-2024-42106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42106"
},
{
"name": "CVE-2024-42115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42115"
},
{
"name": "CVE-2024-42121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42121"
},
{
"name": "CVE-2024-42127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42127"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2024-42137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42137"
},
{
"name": "CVE-2024-42148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42148"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-42153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42153"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42157"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2024-40936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40936"
},
{
"name": "CVE-2024-42082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42082"
},
{
"name": "CVE-2023-52887",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52887"
},
{
"name": "CVE-2024-32936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-32936"
},
{
"name": "CVE-2024-34030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34030"
},
{
"name": "CVE-2024-36244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36244"
},
{
"name": "CVE-2024-36481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36481"
},
{
"name": "CVE-2024-37026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37026"
},
{
"name": "CVE-2024-38306",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38306"
},
{
"name": "CVE-2024-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38623"
},
{
"name": "CVE-2024-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38624"
},
{
"name": "CVE-2024-38625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38625"
},
{
"name": "CVE-2024-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38632"
},
{
"name": "CVE-2024-38667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38667"
},
{
"name": "CVE-2024-39461",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39461"
},
{
"name": "CVE-2024-39462",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39462"
},
{
"name": "CVE-2024-39464",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39464"
},
{
"name": "CVE-2024-39465",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39465"
},
{
"name": "CVE-2024-39470",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39470"
},
{
"name": "CVE-2024-39478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39478"
},
{
"name": "CVE-2024-39483",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39483"
},
{
"name": "CVE-2024-39485",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39485"
},
{
"name": "CVE-2024-39491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39491"
},
{
"name": "CVE-2024-39492",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39492"
},
{
"name": "CVE-2024-40917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40917"
},
{
"name": "CVE-2024-40918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40918"
},
{
"name": "CVE-2024-40922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40922"
},
{
"name": "CVE-2024-40926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40926"
},
{
"name": "CVE-2024-40930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40930"
},
{
"name": "CVE-2024-40933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40933"
},
{
"name": "CVE-2024-40944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40944"
},
{
"name": "CVE-2024-40949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40949"
},
{
"name": "CVE-2024-40951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40951"
},
{
"name": "CVE-2024-40952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40952"
},
{
"name": "CVE-2024-40955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40955"
},
{
"name": "CVE-2024-40962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40962"
},
{
"name": "CVE-2024-40964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40964"
},
{
"name": "CVE-2024-40965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40965"
},
{
"name": "CVE-2024-40969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40969"
},
{
"name": "CVE-2024-40973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40973"
},
{
"name": "CVE-2024-40985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40985"
},
{
"name": "CVE-2024-40986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40986"
},
{
"name": "CVE-2024-40992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40992"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-41003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41003"
},
{
"name": "CVE-2024-41027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41027"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2024-42068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42068"
},
{
"name": "CVE-2024-42076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42076"
},
{
"name": "CVE-2024-42077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42077"
},
{
"name": "CVE-2024-42078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42078"
},
{
"name": "CVE-2024-42080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42080"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2024-42085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42085"
},
{
"name": "CVE-2024-42086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42086"
},
{
"name": "CVE-2024-42087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42087"
},
{
"name": "CVE-2024-42089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42089"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2024-42092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42092"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2024-42095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42095"
},
{
"name": "CVE-2024-42097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42097"
},
{
"name": "CVE-2024-42098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42098"
},
{
"name": "CVE-2024-42109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42109"
},
{
"name": "CVE-2024-42130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42130"
},
{
"name": "CVE-2024-42140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42140"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2024-42270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42270"
},
{
"name": "CVE-2024-42159",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42159"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2024-42160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42160"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0823",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-09-27T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2024-09-26",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7021-3",
"url": "https://ubuntu.com/security/notices/USN-7021-3"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7020-2",
"url": "https://ubuntu.com/security/notices/USN-7020-2"
},
{
"published_at": "2024-09-26",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7039-1",
"url": "https://ubuntu.com/security/notices/USN-7039-1"
},
{
"published_at": "2024-09-26",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7020-3",
"url": "https://ubuntu.com/security/notices/USN-7020-3"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6999-2",
"url": "https://ubuntu.com/security/notices/USN-6999-2"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7007-2",
"url": "https://ubuntu.com/security/notices/USN-7007-2"
},
{
"published_at": "2024-09-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7009-2",
"url": "https://ubuntu.com/security/notices/USN-7009-2"
},
{
"published_at": "2024-09-26",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7003-4",
"url": "https://ubuntu.com/security/notices/USN-7003-4"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7029-1",
"url": "https://ubuntu.com/security/notices/USN-7029-1"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7021-2",
"url": "https://ubuntu.com/security/notices/USN-7021-2"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7007-3",
"url": "https://ubuntu.com/security/notices/USN-7007-3"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7028-1",
"url": "https://ubuntu.com/security/notices/USN-7028-1"
}
]
}
FKIE_CVE-2024-38607
Vulnerability from fkie_nvd - Published: 2024-06-19 14:15 - Updated: 2026-06-17 07:40| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | 2.6.12 | |
| linux | linux_kernel | 2.6.12 | |
| linux | linux_kernel | 2.6.12 | |
| linux | linux_kernel | 2.6.12 | |
| linux | linux_kernel | 2.6.12 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/macintosh/via-macii.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "e4ff8bcfb2841fe4e17e5901578b632adb89036d",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "1e9c3f2caec548cfa7a65416ec4e6006e542f18e",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "280619bbdeac186fb320fab3d61122d2a085def8",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "010d4cb19bb13f423e3e746b824f314a9bf3e9a9",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "787fb79efc15b3b86442ecf079b8148f173376d7",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "d43a8c7ec0841e0ff91a968770aeca83f0fd4c56",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "5900a88e897e6deb1bdce09ee34167a81c2da89d",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "2907d409ce5946390f513976f0454888d37d1058",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
},
{
"lessThan": "d301a71c76ee4c384b4e03cdc320a55f5cf1df05",
"status": "affected",
"version": "1da177e4c3f41524e886b7f1b8a0c1fc7321cac2",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/macintosh/via-macii.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.12"
},
{
"lessThan": "2.6.12",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.316",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.278",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.219",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.161",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.93",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.33",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "90428380-A9D6-4FC4-85D4-392E92A80249",
"versionEndExcluding": "4.19.316",
"versionStartIncluding": "2.6.13",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "7FDBF235-DA18-49A1-8690-6C7272FD0701",
"versionEndExcluding": "5.4.278",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E9063AF3-D593-43B7-810D-58B87F82F9F9",
"versionEndExcluding": "5.10.219",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "31130639-53FE-4726-8986-434EE2528CB2",
"versionEndExcluding": "5.15.161",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "EEFB78EE-F990-4197-BF1C-156760A55667",
"versionEndExcluding": "6.1.93",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "FCE796DF-3B50-4DC6-BAE5-95271068FC9E",
"versionEndExcluding": "6.6.33",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "80550309-67AB-4FD1-AC07-3DED5C4F01B2",
"versionEndExcluding": "6.8.12",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E07124C1-19E8-4D21-828D-9932A01D3011",
"versionEndExcluding": "6.9.3",
"versionStartIncluding": "6.9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:2.6.12:-:*:*:*:*:*:*",
"matchCriteriaId": "6F62EECE-8FB1-4D57-85D8-CB9E23CF313C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:2.6.12:rc2:*:*:*:*:*:*",
"matchCriteriaId": "4F76C298-81DC-43E4-8FC9-DC005A2116EF",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:2.6.12:rc3:*:*:*:*:*:*",
"matchCriteriaId": "0AB349B2-3F78-4197-882B-90ADB3BF645A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:2.6.12:rc4:*:*:*:*:*:*",
"matchCriteriaId": "6AC88830-A9BC-4607-B572-A4B502FC9FD0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:2.6.12:rc5:*:*:*:*:*:*",
"matchCriteriaId": "476CB3A5-D022-4F13-AAEF-CB6A5785516A",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmacintosh/via-macii: Fix \"BUG: sleeping function called from invalid context\"\n\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0027t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization."
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: macintosh/via-macii: Correcci\u00f3n \"ERROR: funci\u00f3n de suspensi\u00f3n llamada desde un contexto no v\u00e1lido\" El controlador ADB via-macii llama a request_irq() despu\u00e9s de deshabilitar las interrupciones bruscas. Pero aqu\u00ed no es necesario deshabilitar las interrupciones porque la interrupci\u00f3n del registro de desplazamiento de VIA se enmascar\u00f3 durante la inicializaci\u00f3n de VIA1."
}
],
"id": "CVE-2024-38607",
"lastModified": "2026-06-17T07:40:42.180",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-38607",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T17:13:11.802131Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-06-19T14:15:20.650",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/010d4cb19bb13f423e3e746b824f314a9bf3e9a9"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/1e9c3f2caec548cfa7a65416ec4e6006e542f18e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/280619bbdeac186fb320fab3d61122d2a085def8"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2907d409ce5946390f513976f0454888d37d1058"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5900a88e897e6deb1bdce09ee34167a81c2da89d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/787fb79efc15b3b86442ecf079b8148f173376d7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/d301a71c76ee4c384b4e03cdc320a55f5cf1df05"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/d43a8c7ec0841e0ff91a968770aeca83f0fd4c56"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/e4ff8bcfb2841fe4e17e5901578b632adb89036d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/010d4cb19bb13f423e3e746b824f314a9bf3e9a9"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/1e9c3f2caec548cfa7a65416ec4e6006e542f18e"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/280619bbdeac186fb320fab3d61122d2a085def8"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2907d409ce5946390f513976f0454888d37d1058"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5900a88e897e6deb1bdce09ee34167a81c2da89d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/787fb79efc15b3b86442ecf079b8148f173376d7"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/d301a71c76ee4c384b4e03cdc320a55f5cf1df05"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/d43a8c7ec0841e0ff91a968770aeca83f0fd4c56"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/e4ff8bcfb2841fe4e17e5901578b632adb89036d"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-noinfo"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-4GVX-P355-QCX5
Vulnerability from github – Published: 2024-06-19 15:30 – Updated: 2025-10-03 15:31In the Linux kernel, the following vulnerability has been resolved:
macintosh/via-macii: Fix "BUG: sleeping function called from invalid context"
The via-macii ADB driver calls request_irq() after disabling hard interrupts. But disabling interrupts isn't necessary here because the VIA shift register interrupt was masked during VIA1 initialization.
{
"affected": [],
"aliases": [
"CVE-2024-38607"
],
"database_specific": {
"cwe_ids": [],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-06-19T14:15:20Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nmacintosh/via-macii: Fix \"BUG: sleeping function called from invalid context\"\n\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0027t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization.",
"id": "GHSA-4gvx-p355-qcx5",
"modified": "2025-10-03T15:31:13Z",
"published": "2024-06-19T15:30:54Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38607"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/010d4cb19bb13f423e3e746b824f314a9bf3e9a9"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/1e9c3f2caec548cfa7a65416ec4e6006e542f18e"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/280619bbdeac186fb320fab3d61122d2a085def8"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/2907d409ce5946390f513976f0454888d37d1058"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/5900a88e897e6deb1bdce09ee34167a81c2da89d"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/787fb79efc15b3b86442ecf079b8148f173376d7"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/d301a71c76ee4c384b4e03cdc320a55f5cf1df05"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/d43a8c7ec0841e0ff91a968770aeca83f0fd4c56"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/e4ff8bcfb2841fe4e17e5901578b632adb89036d"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2024-1767 (CVE-2021-47231)
Vulnerability from osv_openeuler – Published: 2024-06-28 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
can: mcba_usb: fix memory leak in mcba_usb
Syzbot reported memory leak in SocketCAN driver for Microchip CAN BUS Analyzer Tool. The problem was in unfreed usb_coherent.
In mcba_usb_start() 20 coherent buffers are allocated and there is nothing, that frees them:
1) In callback function the urb is resubmitted and that's all 2) In disconnect function urbs are simply killed, but URB_FREE_BUFFER is not set (see mcba_usb_start) and this flag cannot be used with coherent buffers.
Fail log: | [ 1354.053291][ T8413] mcba_usb 1-1:0.0 can0: device disconnected | [ 1367.059384][ T8420] kmemleak: 20 new suspected memory leaks (see /sys/kernel/debug/kmem)
So, all allocated buffers should be freed with usb_free_coherent() explicitly
NOTE: The same pattern for allocating and freeing coherent buffers is used in drivers/net/can/usb/kvaser_usb/kvaser_usb_core.c(CVE-2021-47231)
In the Linux kernel, the following vulnerability has been resolved:
can: j1939: fix Use-after-Free, hold skb ref while in use
This patch fixes a Use-after-Free found by the syzbot.
The problem is that a skb is taken from the per-session skb queue, without incrementing the ref count. This leads to a Use-after-Free if the skb is taken concurrently from the session queue due to a CTS.(CVE-2021-47232)
In the Linux kernel, the following vulnerability has been resolved:
batman-adv: Avoid WARN_ON timing related checks
The soft/batadv interface for a queued OGM can be changed during the time the OGM was queued for transmission and when the OGM is actually transmitted by the worker.
But WARN_ON must be used to denote kernel bugs and not to print simple warnings. A warning can simply be printed using pr_warn.(CVE-2021-47252)
In the Linux kernel, the following vulnerability has been resolved:
media: ngene: Fix out-of-bounds bug in ngene_command_config_free_buf()
Fix an 11-year old bug in ngene_command_config_free_buf() while addressing the following warnings caught with -Warray-bounds:
arch/alpha/include/asm/string.h:22:16: warning: '__builtin_memcpy' offset [12, 16] from the object at 'com' is out of the bounds of referenced subobject 'config' with type 'unsigned char' at offset 10 [-Warray-bounds] arch/x86/include/asm/string_32.h:182:25: warning: '__builtin_memcpy' offset [12, 16] from the object at 'com' is out of the bounds of referenced subobject 'config' with type 'unsigned char' at offset 10 [-Warray-bounds]
The problem is that the original code is trying to copy 6 bytes of data into a one-byte size member config of the wrong structue FW_CONFIGURE_BUFFERS, in a single call to memcpy(). This causes a legitimate compiler warning because memcpy() overruns the length of &com.cmd.ConfigureBuffers.config. It seems that the right structure is FW_CONFIGURE_FREE_BUFFERS, instead, because it contains 6 more members apart from the header hdr. Also, the name of the function ngene_command_config_free_buf() suggests that the actual intention is to ConfigureFreeBuffers, instead of ConfigureBuffers (which takes place in the function ngene_command_config_buf(), above).
Fix this by enclosing those 6 members of struct FW_CONFIGURE_FREE_BUFFERS into new struct config, and use &com.cmd.ConfigureFreeBuffers.config as the destination address, instead of &com.cmd.ConfigureBuffers.config, when calling memcpy().
This also helps with the ongoing efforts to globally enable -Warray-bounds and get us closer to being able to tighten the FORTIFY_SOURCE routines on memcpy().(CVE-2021-47288)
In the Linux kernel, the following vulnerability has been resolved:
coresight: tmc-etf: Fix global-out-of-bounds in tmc_update_etf_buffer()
commit 6f755e85c332 ("coresight: Add helper for inserting synchronization packets") removed trailing '\0' from barrier_pkt array and updated the call sites like etb_update_buffer() to have proper checks for barrier_pkt size before read but missed updating tmc_update_etf_buffer() which still reads barrier_pkt past the array size resulting in KASAN out-of-bounds bug. Fix this by adding a check for barrier_pkt size before accessing like it is done in etb_update_buffer().
BUG: KASAN: global-out-of-bounds in tmc_update_etf_buffer+0x4b8/0x698 Read of size 4 at addr ffffffd05b7d1030 by task perf/2629
Call trace: dump_backtrace+0x0/0x27c show_stack+0x20/0x2c dump_stack+0x11c/0x188 print_address_description+0x3c/0x4a4 __kasan_report+0x140/0x164 kasan_report+0x10/0x18 __asan_report_load4_noabort+0x1c/0x24 tmc_update_etf_buffer+0x4b8/0x698 etm_event_stop+0x248/0x2d8 etm_event_del+0x20/0x2c event_sched_out+0x214/0x6f0 group_sched_out+0xd0/0x270 ctx_sched_out+0x2ec/0x518 __perf_event_task_sched_out+0x4fc/0xe6c __schedule+0x1094/0x16a0 preempt_schedule_irq+0x88/0x170 arm64_preempt_schedule_irq+0xf0/0x18c el1_irq+0xe8/0x180 perf_event_exec+0x4d8/0x56c setup_new_exec+0x204/0x400 load_elf_binary+0x72c/0x18c0 search_binary_handler+0x13c/0x420 load_script+0x500/0x6c4 search_binary_handler+0x13c/0x420 exec_binprm+0x118/0x654 __do_execve_file+0x77c/0xba4 __arm64_compat_sys_execve+0x98/0xac el0_svc_common+0x1f8/0x5e0 el0_svc_compat_handler+0x84/0xb0 el0_svc_compat+0x10/0x50
The buggy address belongs to the variable: barrier_pkt+0x10/0x40
Memory state around the buggy address: ffffffd05b7d0f00: fa fa fa fa 04 fa fa fa fa fa fa fa 00 00 00 00 ffffffd05b7d0f80: 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 >ffffffd05b7d1000: 00 00 00 00 00 00 fa fa fa fa fa fa 00 00 00 03 ^ ffffffd05b7d1080: fa fa fa fa 00 02 fa fa fa fa fa fa 03 fa fa fa ffffffd05b7d1100: fa fa fa fa 00 00 00 00 05 fa fa fa fa fa fa fa ==================================================================(CVE-2021-47346)
In the Linux kernel, the following vulnerability has been resolved:
wl1251: Fix possible buffer overflow in wl1251_cmd_scan
Function wl1251_cmd_scan calls memcpy without checking the length. Harden by checking the length is within the maximum allowed size.(CVE-2021-47347)
In the Linux kernel, the following vulnerability has been resolved:
xhci: Fix command ring pointer corruption while aborting a command
The command ring pointer is located at [6:63] bits of the command ring control register (CRCR). All the control bits like command stop, abort are located at [0:3] bits. While aborting a command, we read the CRCR and set the abort bit and write to the CRCR. The read will always give command ring pointer as all zeros. So we essentially write only the control bits. Since we split the 64 bit write into two 32 bit writes, there is a possibility of xHC command ring stopped before the upper dword (all zeros) is written. If that happens, xHC updates the upper dword of its internal command ring pointer with all zeros. Next time, when the command ring is restarted, we see xHC memory access failures. Fix this issue by only writing to the lower dword of CRCR where all control bits are located.(CVE-2021-47434)
In the Linux kernel, the following vulnerability has been resolved:
mm, slub: fix potential memoryleak in kmem_cache_open()
In error path, the random_seq of slub cache might be leaked. Fix this by using __kmem_cache_release() to release all the relevant resources.(CVE-2021-47466)
In the Linux kernel, the following vulnerability has been resolved:
spi: Fix deadlock when adding SPI controllers on SPI buses
Currently we have a global spi_add_lock which we take when adding new devices so that we can check that we're not trying to reuse a chip select that's already controlled. This means that if the SPI device is itself a SPI controller and triggers the instantiation of further SPI devices we trigger a deadlock as we try to register and instantiate those devices while in the process of doing so for the parent controller and hence already holding the global spi_add_lock. Since we only care about concurrency within a single SPI bus move the lock to be per controller, avoiding the deadlock.
This can be easily triggered in the case of spi-mux.(CVE-2021-47469)
In the Linux kernel, the following vulnerability has been resolved:
ocfs2: fix race between searching chunks and release journal_head from buffer_head
Encountered a race between ocfs2_test_bg_bit_allocatable() and jbd2_journal_put_journal_head() resulting in the below vmcore.
PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: "loop3" Call trace: panic oops_end no_context __bad_area_nosemaphore bad_area_nosemaphore __do_page_fault do_page_fault page_fault [exception RIP: ocfs2_block_group_find_clear_bits+316] ocfs2_block_group_find_clear_bits [ocfs2] ocfs2_cluster_group_search [ocfs2] ocfs2_search_chain [ocfs2] ocfs2_claim_suballoc_bits [ocfs2] __ocfs2_claim_clusters [ocfs2] ocfs2_claim_clusters [ocfs2] ocfs2_local_alloc_slide_window [ocfs2] ocfs2_reserve_local_alloc_bits [ocfs2] ocfs2_reserve_clusters_with_limit [ocfs2] ocfs2_reserve_clusters [ocfs2] ocfs2_lock_refcount_allocators [ocfs2] ocfs2_make_clusters_writable [ocfs2] ocfs2_replace_cow [ocfs2] ocfs2_refcount_cow [ocfs2] ocfs2_file_write_iter [ocfs2] lo_rw_aio loop_queue_work kthread_worker_fn kthread ret_from_fork
When ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the bg_bh->b_private NULL as jbd2_journal_put_journal_head() raced and released the jounal head from the buffer head. Needed to take bit lock for the bit 'BH_JournalHead' to fix this race.(CVE-2021-47493)
In the Linux kernel, the following vulnerability has been resolved:
iio: mma8452: Fix trigger reference couting
The mma8452 driver directly assigns a trigger to the struct iio_dev. The
IIO core when done using this trigger will call iio_trigger_put() to drop
the reference count by 1.
Without the matching iio_trigger_get() in the driver the reference count
can reach 0 too early, the trigger gets freed while still in use and a
use-after-free occurs.
Fix this by getting a reference to the trigger before assigning it to the IIO device.(CVE-2021-47500)
In the Linux kernel, the following vulnerability has been resolved:
can: sja1000: fix use after free in ems_pcmcia_add_card()
If the last channel is not available then "dev" is freed. Fortunately, we can just use "pdev->irq" instead.
Also we should check if at least one channel was set up.(CVE-2021-47521)
In the Linux kernel, the following vulnerability has been resolved:
scsi: mpt3sas: Fix kernel panic during drive powercycle test
While looping over shost's sdev list it is possible that one of the drives is getting removed and its sas_target object is freed but its sdev object remains intact.
Consequently, a kernel panic can occur while the driver is trying to access the sas_address field of sas_target object without also checking the sas_target object for NULL.(CVE-2021-47565)
In the Linux kernel, the following vulnerability has been resolved:
inet_diag: fix kernel-infoleak for UDP sockets
KMSAN reported a kernel-infoleak [1], that can exploited by unpriv users.
After analysis it turned out UDP was not initializing r->idiag_expires. Other users of inet_sk_diag_fill() might make the same mistake in the future, so fix this in inet_sk_diag_fill().
[1] BUG: KMSAN: kernel-infoleak in instrument_copy_to_user include/linux/instrumented.h:121 [inline] BUG: KMSAN: kernel-infoleak in copyout lib/iov_iter.c:156 [inline] BUG: KMSAN: kernel-infoleak in _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670 instrument_copy_to_user include/linux/instrumented.h:121 [inline] copyout lib/iov_iter.c:156 [inline] _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670 copy_to_iter include/linux/uio.h:155 [inline] simple_copy_to_iter+0xf3/0x140 net/core/datagram.c:519 __skb_datagram_iter+0x2cb/0x1280 net/core/datagram.c:425 skb_copy_datagram_iter+0xdc/0x270 net/core/datagram.c:533 skb_copy_datagram_msg include/linux/skbuff.h:3657 [inline] netlink_recvmsg+0x660/0x1c60 net/netlink/af_netlink.c:1974 sock_recvmsg_nosec net/socket.c:944 [inline] sock_recvmsg net/socket.c:962 [inline] sock_read_iter+0x5a9/0x630 net/socket.c:1035 call_read_iter include/linux/fs.h:2156 [inline] new_sync_read fs/read_write.c:400 [inline] vfs_read+0x1631/0x1980 fs/read_write.c:481 ksys_read+0x28c/0x520 fs/read_write.c:619 __do_sys_read fs/read_write.c:629 [inline] __se_sys_read fs/read_write.c:627 [inline] __x64_sys_read+0xdb/0x120 fs/read_write.c:627 do_syscall_x64 arch/x86/entry/common.c:51 [inline] do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82 entry_SYSCALL_64_after_hwframe+0x44/0xae
Uninit was created at: slab_post_alloc_hook mm/slab.h:524 [inline] slab_alloc_node mm/slub.c:3251 [inline] __kmalloc_node_track_caller+0xe0c/0x1510 mm/slub.c:4974 kmalloc_reserve net/core/skbuff.c:354 [inline] __alloc_skb+0x545/0xf90 net/core/skbuff.c:426 alloc_skb include/linux/skbuff.h:1126 [inline] netlink_dump+0x3d5/0x16a0 net/netlink/af_netlink.c:2245 __netlink_dump_start+0xd1c/0xee0 net/netlink/af_netlink.c:2370 netlink_dump_start include/linux/netlink.h:254 [inline] inet_diag_handler_cmd+0x2e7/0x400 net/ipv4/inet_diag.c:1343 sock_diag_rcv_msg+0x24a/0x620 netlink_rcv_skb+0x447/0x800 net/netlink/af_netlink.c:2491 sock_diag_rcv+0x63/0x80 net/core/sock_diag.c:276 netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline] netlink_unicast+0x1095/0x1360 net/netlink/af_netlink.c:1345 netlink_sendmsg+0x16f3/0x1870 net/netlink/af_netlink.c:1916 sock_sendmsg_nosec net/socket.c:704 [inline] sock_sendmsg net/socket.c:724 [inline] sock_write_iter+0x594/0x690 net/socket.c:1057 do_iter_readv_writev+0xa7f/0xc70 do_iter_write+0x52c/0x1500 fs/read_write.c:851 vfs_writev fs/read_write.c:924 [inline] do_writev+0x63f/0xe30 fs/read_write.c:967 __do_sys_writev fs/read_write.c:1040 [inline] __se_sys_writev fs/read_write.c:1037 [inline] __x64_sys_writev+0xe5/0x120 fs/read_write.c:1037 do_syscall_x64 arch/x86/entry/common.c:51 [inline] do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82 entry_SYSCALL_64_after_hwframe+0x44/0xae
Bytes 68-71 of 312 are uninitialized Memory access of size 312 starts at ffff88812ab54000 Data copied to user address 0000000020001440
CPU: 1 PID: 6365 Comm: syz-executor801 Not tainted 5.16.0-rc3-syzkaller #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/01/2011(CVE-2021-47597)
In the Linux kernel, the following vulnerability has been resolved:
firmware: arm_scpi: Fix string overflow in SCPI genpd driver
Without the bound checks for scpi_pd->name, it could result in the buffer overflow when copying the SCPI device name from the corresponding device tree node as the name string is set at maximum size of 30.
Let us fix it by using devm_kasprintf so that the string buffer is allocated dynamically.(CVE-2021-47609)
In the Linux kernel, the following vulnerability has been resolved:
ASoC: ops: Reject out of bounds values in snd_soc_put_volsw_sx()
We don't currently validate that the values being set are within the range we advertised to userspace as being valid, do so and reject any values that are out of range.(CVE-2022-48737)
In the Linux kernel, the following vulnerability has been resolved:
powerpc64/bpf: Limit 'ldbrx' to processors compliant with ISA v2.06
Johan reported the below crash with test_bpf on ppc64 e5500:
test_bpf: #296 ALU_END_FROM_LE 64: 0x0123456789abcdef -> 0x67452301 jited:1 Oops: Exception in kernel mode, sig: 4 [#1] BE PAGE_SIZE=4K SMP NR_CPUS=24 QEMU e500 Modules linked in: test_bpf(+) CPU: 0 PID: 76 Comm: insmod Not tainted 5.14.0-03771-g98c2059e008a-dirty #1 NIP: 8000000000061c3c LR: 80000000006dea64 CTR: 8000000000061c18 REGS: c0000000032d3420 TRAP: 0700 Not tainted (5.14.0-03771-g98c2059e008a-dirty) MSR: 0000000080089000 <EE,ME> CR: 88002822 XER: 20000000 IRQMASK: 0 <...> NIP [8000000000061c3c] 0x8000000000061c3c LR [80000000006dea64] .__run_one+0x104/0x17c [test_bpf] Call Trace: .__run_one+0x60/0x17c [test_bpf] (unreliable) .test_bpf_init+0x6a8/0xdc8 [test_bpf] .do_one_initcall+0x6c/0x28c .do_init_module+0x68/0x28c .load_module+0x2460/0x2abc .__do_sys_init_module+0x120/0x18c .system_call_exception+0x110/0x1b8 system_call_common+0xf0/0x210 --- interrupt: c00 at 0x101d0acc <...> ---[ end trace 47b2bf19090bb3d0 ]---
Illegal instruction
The illegal instruction turned out to be 'ldbrx' emitted for BPF_FROM_[L|B]E, which was only introduced in ISA v2.06. Guard use of the same and implement an alternative approach for older processors.(CVE-2022-48755)
In the Linux kernel, the following vulnerability has been resolved:
drm/msm/dsi: invalid parameter check in msm_dsi_phy_enable
The function performs a check on the "phy" input parameter, however, it is used before the check.
Initialize the "dev" variable after the sanity check to avoid a possible NULL pointer dereference.
Addresses-Coverity-ID: 1493860 ("Null pointer dereference")(CVE-2022-48756)
In the Linux kernel, the following vulnerability has been resolved:
rpmsg: virtio: Free driver_override when rpmsg_remove()
Free driver_override when rpmsg_remove(), otherwise the following memory leak will occur:
unreferenced object 0xffff0000d55d7080 (size 128): comm "kworker/u8:2", pid 56, jiffies 4294893188 (age 214.272s) hex dump (first 32 bytes): 72 70 6d 73 67 5f 6e 73 00 00 00 00 00 00 00 00 rpmsg_ns........ 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................ backtrace: [<000000009c94c9c1>] __kmem_cache_alloc_node+0x1f8/0x320 [<000000002300d89b>] __kmalloc_node_track_caller+0x44/0x70 [<00000000228a60c3>] kstrndup+0x4c/0x90 [<0000000077158695>] driver_set_override+0xd0/0x164 [<000000003e9c4ea5>] rpmsg_register_device_override+0x98/0x170 [<000000001c0c89a8>] rpmsg_ns_register_device+0x24/0x30 [<000000008bbf8fa2>] rpmsg_probe+0x2e0/0x3ec [<00000000e65a68df>] virtio_dev_probe+0x1c0/0x280 [<00000000443331cc>] really_probe+0xbc/0x2dc [<00000000391064b1>] __driver_probe_device+0x78/0xe0 [<00000000a41c9a5b>] driver_probe_device+0xd8/0x160 [<000000009c3bd5df>] __device_attach_driver+0xb8/0x140 [<0000000043cd7614>] bus_for_each_drv+0x7c/0xd4 [<000000003b929a36>] __device_attach+0x9c/0x19c [<00000000a94e0ba8>] device_initial_probe+0x14/0x20 [<000000003c999637>] bus_probe_device+0xa0/0xac(CVE-2023-52670)
In the Linux kernel, the following vulnerability has been resolved:
Fix page corruption caused by racy check in __free_pages
When we upgraded our kernel, we started seeing some page corruption like the following consistently:
BUG: Bad page state in process ganesha.nfsd pfn:1304ca page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca flags: 0x17ffffc0000000() raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000 raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000 page dumped because: nonzero mapcount CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1 Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016 Call Trace: dump_stack+0x74/0x96 bad_page.cold+0x63/0x94 check_new_page_bad+0x6d/0x80 rmqueue+0x46e/0x970 get_page_from_freelist+0xcb/0x3f0 ? _cond_resched+0x19/0x40 __alloc_pages_nodemask+0x164/0x300 alloc_pages_current+0x87/0xf0 skb_page_frag_refill+0x84/0x110 ...
Sometimes, it would also show up as corruption in the free list pointer and cause crashes.
After bisecting the issue, we found the issue started from commit e320d3012d25 ("mm/page_alloc.c: fix freeing non-compound pages"):
if (put_page_testzero(page))
free_the_page(page, order);
else if (!PageHead(page))
while (order-- > 0)
free_the_page(page + (1 << order), order);
So the problem is the check PageHead is racy because at this point we already dropped our reference to the page. So even if we came in with compound page, the page can already be freed and PageHead can return false and we will end up freeing all the tail pages causing double free.(CVE-2023-52739)
In the Linux kernel, the following vulnerability has been resolved:
atl1c: Work around the DMA RX overflow issue
This is based on alx driver commit 881d0327db37 ("net: alx: Work around the DMA RX overflow issue").
The alx and atl1c drivers had RX overflow error which was why a custom allocator was created to avoid certain addresses. The simpler workaround then created for alx driver, but not for atl1c due to lack of tester.
Instead of using a custom allocator, check the allocated skb address and use skb_reserve() to move away from problematic 0x...fc0 address.
Tested on AR8131 on Acer 4540.(CVE-2023-52834)
In the Linux kernel, the following vulnerability has been resolved:
hid: cp2112: Fix duplicate workqueue initialization
Previously the cp2112 driver called INIT_DELAYED_WORK within cp2112_gpio_irq_startup, resulting in duplicate initilizations of the workqueue on subsequent IRQ startups following an initial request. This resulted in a warning in set_work_data in workqueue.c, as well as a rare NULL dereference within process_one_work in workqueue.c.
Initialize the workqueue within _probe instead.(CVE-2023-52853)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: usb-audio: Stop parsing channels bits when all channels are found.
If a usb audio device sets more bits than the amount of channels it could write outside of the map array.(CVE-2024-27436)
In the Linux kernel, the following vulnerability has been resolved:
media: tc358743: register v4l2 async device only after successful setup
Ensure the device has been setup correctly before registering the v4l2 async device, thus allowing userspace to access.(CVE-2024-35830)
In the Linux kernel, the following vulnerability has been resolved:
usb: gadget: f_fs: Fix race between aio_cancel() and AIO request complete
FFS based applications can utilize the aio_cancel() callback to dequeue pending USB requests submitted to the UDC. There is a scenario where the FFS application issues an AIO cancel call, while the UDC is handling a soft disconnect. For a DWC3 based implementation, the callstack looks like the following:
DWC3 Gadget FFS Application
dwc3_gadget_soft_disconnect() ... --> dwc3_stop_active_transfers() --> dwc3_gadget_giveback(-ESHUTDOWN) --> ffs_epfile_async_io_complete() ffs_aio_cancel() --> usb_ep_free_request() --> usb_ep_dequeue()
There is currently no locking implemented between the AIO completion handler and AIO cancel, so the issue occurs if the completion routine is running in parallel to an AIO cancel call coming from the FFS application. As the completion call frees the USB request (io_data->req) the FFS application is also referencing it for the usb_ep_dequeue() call. This can lead to accessing a stale/hanging pointer.
commit b566d38857fc ("usb: gadget: f_fs: use io_data->status consistently") relocated the usb_ep_free_request() into ffs_epfile_async_io_complete(). However, in order to properly implement locking to mitigate this issue, the spinlock can't be added to ffs_epfile_async_io_complete(), as usb_ep_dequeue() (if successfully dequeuing a USB request) will call the function driver's completion handler in the same context. Hence, leading into a deadlock.
Fix this issue by moving the usb_ep_free_request() back to ffs_user_copy_worker(), and ensuring that it explicitly sets io_data->req to NULL after freeing it within the ffs->eps_lock. This resolves the race condition above, as the ffs_aio_cancel() routine will not continue attempting to dequeue a request that has already been freed, or the ffs_user_copy_work() not freeing the USB request until the AIO cancel is done referencing it.
This fix depends on commit b566d38857fc ("usb: gadget: f_fs: use io_data->status consistently")(CVE-2024-36894)
In the Linux kernel, the following vulnerability has been resolved:
wifi: nl80211: don't free NULL coalescing rule
If the parsing fails, we can dereference a NULL pointer here.(CVE-2024-36941)
In the Linux kernel, the following vulnerability has been resolved:
firewire: ohci: mask bus reset interrupts between ISR and bottom half
In the FireWire OHCI interrupt handler, if a bus reset interrupt has occurred, mask bus reset interrupts until bus_reset_work has serviced and cleared the interrupt.
Normally, we always leave bus reset interrupts masked. We infer the bus reset from the self-ID interrupt that happens shortly thereafter. A scenario where we unmask bus reset interrupts was introduced in 2008 in a007bb857e0b26f5d8b73c2ff90782d9c0972620: If OHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we will unmask bus reset interrupts so we can log them.
irq_handler logs the bus reset interrupt. However, we can't clear the bus reset event flag in irq_handler, because we won't service the event until later. irq_handler exits with the event flag still set. If the corresponding interrupt is still unmasked, the first bus reset will usually freeze the system due to irq_handler being called again each time it exits. This freeze can be reproduced by loading firewire_ohci with "modprobe firewire_ohci debug=-1" (to enable all debugging output). Apparently there are also some cases where bus_reset_work will get called soon enough to clear the event, and operation will continue normally.
This freeze was first reported a few months after a007bb85 was committed, but until now it was never fixed. The debug level could safely be set to -1 through sysfs after the module was loaded, but this would be ineffectual in logging bus reset interrupts since they were only unmasked during initialization.
irq_handler will now leave the event flag set but mask bus reset interrupts, so irq_handler won't be called again and there will be no freeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will unmask the interrupt after servicing the event, so future interrupts will be caught as desired.
As a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be enabled through sysfs in addition to during initial module loading. However, when enabled through sysfs, logging of bus reset interrupts will be effective only starting with the second bus reset, after bus_reset_work has executed.(CVE-2024-36950)
In the Linux kernel, the following vulnerability has been resolved:
net: fix __dst_negative_advice() race
__dst_negative_advice() does not enforce proper RCU rules when sk->dst_cache must be cleared, leading to possible UAF.
RCU rules are that we must first clear sk->sk_dst_cache, then call dst_release(old_dst).
Note that sk_dst_reset(sk) is implementing this protocol correctly, while __dst_negative_advice() uses the wrong order.
Given that ip6_negative_advice() has special logic against RTF_CACHE, this means each of the three ->negative_advice() existing methods must perform the sk_dst_reset() themselves.
Note the check against NULL dst is centralized in __dst_negative_advice(), there is no need to duplicate it in various callbacks.
Many thanks to Clement Lecigne for tracking this issue.
This old bug became visible after the blamed commit, using UDP sockets.(CVE-2024-36971)
In the Linux kernel, the following vulnerability has been resolved:
net: bridge: xmit: make sure we have at least eth header len bytes
syzbot triggered an uninit value[1] error in bridge device's xmit path by sending a short (less than ETH_HLEN bytes) skb. To fix it check if we can actually pull that amount instead of assuming.
Tested with dropwatch: drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3) origin: software timestamp: Mon May 13 11:31:53 2024 778214037 nsec protocol: 0x88a8 length: 2 original length: 2 drop reason: PKT_TOO_SMALL
[1] BUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 __netdev_start_xmit include/linux/netdevice.h:4903 [inline] netdev_start_xmit include/linux/netdevice.h:4917 [inline] xmit_one net/core/dev.c:3531 [inline] dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547 __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341 dev_queue_xmit include/linux/netdevice.h:3091 [inline] __bpf_tx_skb net/core/filter.c:2136 [inline] __bpf_redirect_common net/core/filter.c:2180 [inline] __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187 _bpfclone_redirect net/core/filter.c:2460 [inline] bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432 _bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997 __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238 bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline] __bpf_prog_run include/linux/filter.h:657 [inline] bpf_prog_run include/linux/filter.h:664 [inline] bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425 bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058 bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269 __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678 __do_sys_bpf kernel/bpf/syscall.c:5767 [inline] __se_sys_bpf kernel/bpf/syscall.c:5765 [inline] __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765 x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)
In the Linux kernel, the following vulnerability has been resolved:
of: module: add buffer overflow check in of_modalias()
In of_modalias(), if the buffer happens to be too small even for the 1st snprintf() call, the len parameter will become negative and str parameter (if not NULL initially) will point beyond the buffer's end. Add the buffer overflow check after the 1st snprintf() call and fix such check after the strlen() call (accounting for the terminating NUL char).(CVE-2024-38541)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix potential index out of bounds in color transformation function
Fixes index out of bounds issue in the color transformation function. The issue could occur when the index 'i' exceeds the number of transfer function points (TRANSFER_FUNC_POINTS).
The fix adds a check to ensure 'i' is within bounds before accessing the transfer function points. If 'i' is out of bounds, an error message is logged and the function returns false to indicate an error.
Reported by smatch: drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:405 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.red' 1025 <= s32max drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:406 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.green' 1025 <= s32max drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:407 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.blue' 1025 <= s32max(CVE-2024-38552)
In the Linux kernel, the following vulnerability has been resolved:
ftrace: Fix possible use-after-free issue in ftrace_location()
KASAN reports a bug:
BUG: KASAN: use-after-free in ftrace_location+0x90/0x120 Read of size 8 at addr ffff888141d40010 by task insmod/424 CPU: 8 PID: 424 Comm: insmod Tainted: G W 6.9.0-rc2+ [...] Call Trace: <TASK> dump_stack_lvl+0x68/0xa0 print_report+0xcf/0x610 kasan_report+0xb5/0xe0 ftrace_location+0x90/0x120 register_kprobe+0x14b/0xa40 kprobe_init+0x2d/0xff0 [kprobe_example] do_one_initcall+0x8f/0x2d0 do_init_module+0x13a/0x3c0 load_module+0x3082/0x33d0 init_module_from_file+0xd2/0x130 __x64_sys_finit_module+0x306/0x440 do_syscall_64+0x68/0x140 entry_SYSCALL_64_after_hwframe+0x71/0x79
The root cause is that, in lookup_rec(), ftrace record of some address is being searched in ftrace pages of some module, but those ftrace pages at the same time is being freed in ftrace_release_mod() as the corresponding module is being deleted:
CPU1 | CPU2
register_kprobes() { | delete_module() { check_kprobe_address_safe() { | arch_check_ftrace_location() { | ftrace_location() { | lookup_rec() // USE! | ftrace_release_mod() // Free!
To fix this issue: 1. Hold rcu lock as accessing ftrace pages in ftrace_location_range(); 2. Use ftrace_location_range() instead of lookup_rec() in ftrace_location(); 3. Call synchronize_rcu() before freeing any ftrace pages both in ftrace_process_locs()/ftrace_release_mod()/ftrace_free_mem().(CVE-2024-38588)
In the Linux kernel, the following vulnerability has been resolved:
af_unix: Fix data races in unix_release_sock/unix_stream_sendmsg
A data-race condition has been identified in af_unix. In one data path, the write function unix_release_sock() atomically writes to sk->sk_shutdown using WRITE_ONCE. However, on the reader side, unix_stream_sendmsg() does not read it atomically. Consequently, this issue is causing the following KCSAN splat to occur:
BUG: KCSAN: data-race in unix_release_sock / unix_stream_sendmsg
write (marked) to 0xffff88867256ddbb of 1 bytes by task 7270 on cpu 28:
unix_release_sock (net/unix/af_unix.c:640)
unix_release (net/unix/af_unix.c:1050)
sock_close (net/socket.c:659 net/socket.c:1421)
__fput (fs/file_table.c:422)
__fput_sync (fs/file_table.c:508)
__se_sys_close (fs/open.c:1559 fs/open.c:1541)
__x64_sys_close (fs/open.c:1541)
x64_sys_call (arch/x86/entry/syscall_64.c:33)
do_syscall_64 (arch/x86/entry/common.c:?)
entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
read to 0xffff88867256ddbb of 1 bytes by task 989 on cpu 14:
unix_stream_sendmsg (net/unix/af_unix.c:2273)
__sock_sendmsg (net/socket.c:730 net/socket.c:745)
____sys_sendmsg (net/socket.c:2584)
__sys_sendmmsg (net/socket.c:2638 net/socket.c:2724)
__x64_sys_sendmmsg (net/socket.c:2753 net/socket.c:2750 net/socket.c:2750)
x64_sys_call (arch/x86/entry/syscall_64.c:33)
do_syscall_64 (arch/x86/entry/common.c:?)
entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
value changed: 0x01 -> 0x03
The line numbers are related to commit dd5a440a31fa ("Linux 6.9-rc7").
Commit e1d09c2c2f57 ("af_unix: Fix data races around sk->sk_shutdown.") addressed a comparable issue in the past regarding sk->sk_shutdown. However, it overlooked resolving this particular data path. This patch only offending unix_stream_sendmsg() function, since the other reads seem to be protected by unix_state_lock() as discussed in(CVE-2024-38596)
In the Linux kernel, the following vulnerability has been resolved:
macintosh/via-macii: Fix "BUG: sleeping function called from invalid context"
The via-macii ADB driver calls request_irq() after disabling hard interrupts. But disabling interrupts isn't necessary here because the VIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"bpftool-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2406.4.0.0283.oe2003sp4.src.rpm"
],
"x86_64": [
"perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"bpftool-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2406.4.0.0283.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: mcba_usb: fix memory leak in mcba_usb\r\n\r\nSyzbot reported memory leak in SocketCAN driver for Microchip CAN BUS\nAnalyzer Tool. The problem was in unfreed usb_coherent.\r\n\r\nIn mcba_usb_start() 20 coherent buffers are allocated and there is\nnothing, that frees them:\r\n\r\n1) In callback function the urb is resubmitted and that\u0026apos;s all\n2) In disconnect function urbs are simply killed, but URB_FREE_BUFFER\n is not set (see mcba_usb_start) and this flag cannot be used with\n coherent buffers.\r\n\r\nFail log:\n| [ 1354.053291][ T8413] mcba_usb 1-1:0.0 can0: device disconnected\n| [ 1367.059384][ T8420] kmemleak: 20 new suspected memory leaks (see /sys/kernel/debug/kmem)\r\n\r\nSo, all allocated buffers should be freed with usb_free_coherent()\nexplicitly\r\n\r\nNOTE:\nThe same pattern for allocating and freeing coherent buffers\nis used in drivers/net/can/usb/kvaser_usb/kvaser_usb_core.c(CVE-2021-47231)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: j1939: fix Use-after-Free, hold skb ref while in use\r\n\r\nThis patch fixes a Use-after-Free found by the syzbot.\r\n\r\nThe problem is that a skb is taken from the per-session skb queue,\nwithout incrementing the ref count. This leads to a Use-after-Free if\nthe skb is taken concurrently from the session queue due to a CTS.(CVE-2021-47232)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbatman-adv: Avoid WARN_ON timing related checks\r\n\r\nThe soft/batadv interface for a queued OGM can be changed during the time\nthe OGM was queued for transmission and when the OGM is actually\ntransmitted by the worker.\r\n\r\nBut WARN_ON must be used to denote kernel bugs and not to print simple\nwarnings. A warning can simply be printed using pr_warn.(CVE-2021-47252)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: ngene: Fix out-of-bounds bug in ngene_command_config_free_buf()\r\n\r\nFix an 11-year old bug in ngene_command_config_free_buf() while\naddressing the following warnings caught with -Warray-bounds:\r\n\r\narch/alpha/include/asm/string.h:22:16: warning: \u0026apos;__builtin_memcpy\u0026apos; offset [12, 16] from the object at \u0026apos;com\u0026apos; is out of the bounds of referenced subobject \u0026apos;config\u0026apos; with type \u0026apos;unsigned char\u0026apos; at offset 10 [-Warray-bounds]\narch/x86/include/asm/string_32.h:182:25: warning: \u0026apos;__builtin_memcpy\u0026apos; offset [12, 16] from the object at \u0026apos;com\u0026apos; is out of the bounds of referenced subobject \u0026apos;config\u0026apos; with type \u0026apos;unsigned char\u0026apos; at offset 10 [-Warray-bounds]\r\n\r\nThe problem is that the original code is trying to copy 6 bytes of\ndata into a one-byte size member _config_ of the wrong structue\nFW_CONFIGURE_BUFFERS, in a single call to memcpy(). This causes a\nlegitimate compiler warning because memcpy() overruns the length\nof \u0026amp;com.cmd.ConfigureBuffers.config. It seems that the right\nstructure is FW_CONFIGURE_FREE_BUFFERS, instead, because it contains\n6 more members apart from the header _hdr_. Also, the name of\nthe function ngene_command_config_free_buf() suggests that the actual\nintention is to ConfigureFreeBuffers, instead of ConfigureBuffers\n(which takes place in the function ngene_command_config_buf(), above).\r\n\r\nFix this by enclosing those 6 members of struct FW_CONFIGURE_FREE_BUFFERS\ninto new struct config, and use \u0026amp;com.cmd.ConfigureFreeBuffers.config as\nthe destination address, instead of \u0026amp;com.cmd.ConfigureBuffers.config,\nwhen calling memcpy().\r\n\r\nThis also helps with the ongoing efforts to globally enable\n-Warray-bounds and get us closer to being able to tighten the\nFORTIFY_SOURCE routines on memcpy().(CVE-2021-47288)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncoresight: tmc-etf: Fix global-out-of-bounds in tmc_update_etf_buffer()\r\n\r\ncommit 6f755e85c332 (\u0026quot;coresight: Add helper for inserting synchronization\npackets\u0026quot;) removed trailing \u0026apos;\\0\u0026apos; from barrier_pkt array and updated the\ncall sites like etb_update_buffer() to have proper checks for barrier_pkt\nsize before read but missed updating tmc_update_etf_buffer() which still\nreads barrier_pkt past the array size resulting in KASAN out-of-bounds\nbug. Fix this by adding a check for barrier_pkt size before accessing\nlike it is done in etb_update_buffer().\r\n\r\n BUG: KASAN: global-out-of-bounds in tmc_update_etf_buffer+0x4b8/0x698\n Read of size 4 at addr ffffffd05b7d1030 by task perf/2629\r\n\r\n Call trace:\n dump_backtrace+0x0/0x27c\n show_stack+0x20/0x2c\n dump_stack+0x11c/0x188\n print_address_description+0x3c/0x4a4\n __kasan_report+0x140/0x164\n kasan_report+0x10/0x18\n __asan_report_load4_noabort+0x1c/0x24\n tmc_update_etf_buffer+0x4b8/0x698\n etm_event_stop+0x248/0x2d8\n etm_event_del+0x20/0x2c\n event_sched_out+0x214/0x6f0\n group_sched_out+0xd0/0x270\n ctx_sched_out+0x2ec/0x518\n __perf_event_task_sched_out+0x4fc/0xe6c\n __schedule+0x1094/0x16a0\n preempt_schedule_irq+0x88/0x170\n arm64_preempt_schedule_irq+0xf0/0x18c\n el1_irq+0xe8/0x180\n perf_event_exec+0x4d8/0x56c\n setup_new_exec+0x204/0x400\n load_elf_binary+0x72c/0x18c0\n search_binary_handler+0x13c/0x420\n load_script+0x500/0x6c4\n search_binary_handler+0x13c/0x420\n exec_binprm+0x118/0x654\n __do_execve_file+0x77c/0xba4\n __arm64_compat_sys_execve+0x98/0xac\n el0_svc_common+0x1f8/0x5e0\n el0_svc_compat_handler+0x84/0xb0\n el0_svc_compat+0x10/0x50\r\n\r\n The buggy address belongs to the variable:\n barrier_pkt+0x10/0x40\r\n\r\n Memory state around the buggy address:\n ffffffd05b7d0f00: fa fa fa fa 04 fa fa fa fa fa fa fa 00 00 00 00\n ffffffd05b7d0f80: 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00\n \u0026gt;ffffffd05b7d1000: 00 00 00 00 00 00 fa fa fa fa fa fa 00 00 00 03\n ^\n ffffffd05b7d1080: fa fa fa fa 00 02 fa fa fa fa fa fa 03 fa fa fa\n ffffffd05b7d1100: fa fa fa fa 00 00 00 00 05 fa fa fa fa fa fa fa\n ==================================================================(CVE-2021-47346)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwl1251: Fix possible buffer overflow in wl1251_cmd_scan\r\n\r\nFunction wl1251_cmd_scan calls memcpy without checking the length.\nHarden by checking the length is within the maximum allowed size.(CVE-2021-47347)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nxhci: Fix command ring pointer corruption while aborting a command\r\n\r\nThe command ring pointer is located at [6:63] bits of the command\nring control register (CRCR). All the control bits like command stop,\nabort are located at [0:3] bits. While aborting a command, we read the\nCRCR and set the abort bit and write to the CRCR. The read will always\ngive command ring pointer as all zeros. So we essentially write only\nthe control bits. Since we split the 64 bit write into two 32 bit writes,\nthere is a possibility of xHC command ring stopped before the upper\ndword (all zeros) is written. If that happens, xHC updates the upper\ndword of its internal command ring pointer with all zeros. Next time,\nwhen the command ring is restarted, we see xHC memory access failures.\nFix this issue by only writing to the lower dword of CRCR where all\ncontrol bits are located.(CVE-2021-47434)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmm, slub: fix potential memoryleak in kmem_cache_open()\r\n\r\nIn error path, the random_seq of slub cache might be leaked. Fix this\nby using __kmem_cache_release() to release all the relevant resources.(CVE-2021-47466)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nspi: Fix deadlock when adding SPI controllers on SPI buses\r\n\r\nCurrently we have a global spi_add_lock which we take when adding new\ndevices so that we can check that we\u0026apos;re not trying to reuse a chip\nselect that\u0026apos;s already controlled. This means that if the SPI device is\nitself a SPI controller and triggers the instantiation of further SPI\ndevices we trigger a deadlock as we try to register and instantiate\nthose devices while in the process of doing so for the parent controller\nand hence already holding the global spi_add_lock. Since we only care\nabout concurrency within a single SPI bus move the lock to be per\ncontroller, avoiding the deadlock.\r\n\r\nThis can be easily triggered in the case of spi-mux.(CVE-2021-47469)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nocfs2: fix race between searching chunks and release journal_head from buffer_head\r\n\r\nEncountered a race between ocfs2_test_bg_bit_allocatable() and\njbd2_journal_put_journal_head() resulting in the below vmcore.\r\n\r\n PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: \u0026quot;loop3\u0026quot;\n Call trace:\n panic\n oops_end\n no_context\n __bad_area_nosemaphore\n bad_area_nosemaphore\n __do_page_fault\n do_page_fault\n page_fault\n [exception RIP: ocfs2_block_group_find_clear_bits+316]\n ocfs2_block_group_find_clear_bits [ocfs2]\n ocfs2_cluster_group_search [ocfs2]\n ocfs2_search_chain [ocfs2]\n ocfs2_claim_suballoc_bits [ocfs2]\n __ocfs2_claim_clusters [ocfs2]\n ocfs2_claim_clusters [ocfs2]\n ocfs2_local_alloc_slide_window [ocfs2]\n ocfs2_reserve_local_alloc_bits [ocfs2]\n ocfs2_reserve_clusters_with_limit [ocfs2]\n ocfs2_reserve_clusters [ocfs2]\n ocfs2_lock_refcount_allocators [ocfs2]\n ocfs2_make_clusters_writable [ocfs2]\n ocfs2_replace_cow [ocfs2]\n ocfs2_refcount_cow [ocfs2]\n ocfs2_file_write_iter [ocfs2]\n lo_rw_aio\n loop_queue_work\n kthread_worker_fn\n kthread\n ret_from_fork\r\n\r\nWhen ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the\nbg_bh-\u0026gt;b_private NULL as jbd2_journal_put_journal_head() raced and\nreleased the jounal head from the buffer head. Needed to take bit lock\nfor the bit \u0026apos;BH_JournalHead\u0026apos; to fix this race.(CVE-2021-47493)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\niio: mma8452: Fix trigger reference couting\r\n\r\nThe mma8452 driver directly assigns a trigger to the struct iio_dev. The\nIIO core when done using this trigger will call `iio_trigger_put()` to drop\nthe reference count by 1.\r\n\r\nWithout the matching `iio_trigger_get()` in the driver the reference count\ncan reach 0 too early, the trigger gets freed while still in use and a\nuse-after-free occurs.\r\n\r\nFix this by getting a reference to the trigger before assigning it to the\nIIO device.(CVE-2021-47500)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: sja1000: fix use after free in ems_pcmcia_add_card()\r\n\r\nIf the last channel is not available then \u0026quot;dev\u0026quot; is freed. Fortunately,\nwe can just use \u0026quot;pdev-\u0026gt;irq\u0026quot; instead.\r\n\r\nAlso we should check if at least one channel was set up.(CVE-2021-47521)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: mpt3sas: Fix kernel panic during drive powercycle test\r\n\r\nWhile looping over shost\u0026apos;s sdev list it is possible that one\nof the drives is getting removed and its sas_target object is\nfreed but its sdev object remains intact.\r\n\r\nConsequently, a kernel panic can occur while the driver is trying to access\nthe sas_address field of sas_target object without also checking the\nsas_target object for NULL.(CVE-2021-47565)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ninet_diag: fix kernel-infoleak for UDP sockets\r\n\r\nKMSAN reported a kernel-infoleak [1], that can exploited\nby unpriv users.\r\n\r\nAfter analysis it turned out UDP was not initializing\nr-\u0026gt;idiag_expires. Other users of inet_sk_diag_fill()\nmight make the same mistake in the future, so fix this\nin inet_sk_diag_fill().\r\n\r\n[1]\nBUG: KMSAN: kernel-infoleak in instrument_copy_to_user include/linux/instrumented.h:121 [inline]\nBUG: KMSAN: kernel-infoleak in copyout lib/iov_iter.c:156 [inline]\nBUG: KMSAN: kernel-infoleak in _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670\n instrument_copy_to_user include/linux/instrumented.h:121 [inline]\n copyout lib/iov_iter.c:156 [inline]\n _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670\n copy_to_iter include/linux/uio.h:155 [inline]\n simple_copy_to_iter+0xf3/0x140 net/core/datagram.c:519\n __skb_datagram_iter+0x2cb/0x1280 net/core/datagram.c:425\n skb_copy_datagram_iter+0xdc/0x270 net/core/datagram.c:533\n skb_copy_datagram_msg include/linux/skbuff.h:3657 [inline]\n netlink_recvmsg+0x660/0x1c60 net/netlink/af_netlink.c:1974\n sock_recvmsg_nosec net/socket.c:944 [inline]\n sock_recvmsg net/socket.c:962 [inline]\n sock_read_iter+0x5a9/0x630 net/socket.c:1035\n call_read_iter include/linux/fs.h:2156 [inline]\n new_sync_read fs/read_write.c:400 [inline]\n vfs_read+0x1631/0x1980 fs/read_write.c:481\n ksys_read+0x28c/0x520 fs/read_write.c:619\n __do_sys_read fs/read_write.c:629 [inline]\n __se_sys_read fs/read_write.c:627 [inline]\n __x64_sys_read+0xdb/0x120 fs/read_write.c:627\n do_syscall_x64 arch/x86/entry/common.c:51 [inline]\n do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82\n entry_SYSCALL_64_after_hwframe+0x44/0xae\r\n\r\nUninit was created at:\n slab_post_alloc_hook mm/slab.h:524 [inline]\n slab_alloc_node mm/slub.c:3251 [inline]\n __kmalloc_node_track_caller+0xe0c/0x1510 mm/slub.c:4974\n kmalloc_reserve net/core/skbuff.c:354 [inline]\n __alloc_skb+0x545/0xf90 net/core/skbuff.c:426\n alloc_skb include/linux/skbuff.h:1126 [inline]\n netlink_dump+0x3d5/0x16a0 net/netlink/af_netlink.c:2245\n __netlink_dump_start+0xd1c/0xee0 net/netlink/af_netlink.c:2370\n netlink_dump_start include/linux/netlink.h:254 [inline]\n inet_diag_handler_cmd+0x2e7/0x400 net/ipv4/inet_diag.c:1343\n sock_diag_rcv_msg+0x24a/0x620\n netlink_rcv_skb+0x447/0x800 net/netlink/af_netlink.c:2491\n sock_diag_rcv+0x63/0x80 net/core/sock_diag.c:276\n netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline]\n netlink_unicast+0x1095/0x1360 net/netlink/af_netlink.c:1345\n netlink_sendmsg+0x16f3/0x1870 net/netlink/af_netlink.c:1916\n sock_sendmsg_nosec net/socket.c:704 [inline]\n sock_sendmsg net/socket.c:724 [inline]\n sock_write_iter+0x594/0x690 net/socket.c:1057\n do_iter_readv_writev+0xa7f/0xc70\n do_iter_write+0x52c/0x1500 fs/read_write.c:851\n vfs_writev fs/read_write.c:924 [inline]\n do_writev+0x63f/0xe30 fs/read_write.c:967\n __do_sys_writev fs/read_write.c:1040 [inline]\n __se_sys_writev fs/read_write.c:1037 [inline]\n __x64_sys_writev+0xe5/0x120 fs/read_write.c:1037\n do_syscall_x64 arch/x86/entry/common.c:51 [inline]\n do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82\n entry_SYSCALL_64_after_hwframe+0x44/0xae\r\n\r\nBytes 68-71 of 312 are uninitialized\nMemory access of size 312 starts at ffff88812ab54000\nData copied to user address 0000000020001440\r\n\r\nCPU: 1 PID: 6365 Comm: syz-executor801 Not tainted 5.16.0-rc3-syzkaller #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/01/2011(CVE-2021-47597)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfirmware: arm_scpi: Fix string overflow in SCPI genpd driver\r\n\r\nWithout the bound checks for scpi_pd-\u0026gt;name, it could result in the buffer\noverflow when copying the SCPI device name from the corresponding device\ntree node as the name string is set at maximum size of 30.\r\n\r\nLet us fix it by using devm_kasprintf so that the string buffer is\nallocated dynamically.(CVE-2021-47609)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nASoC: ops: Reject out of bounds values in snd_soc_put_volsw_sx()\r\n\r\nWe don\u0026apos;t currently validate that the values being set are within the range\nwe advertised to userspace as being valid, do so and reject any values\nthat are out of range.(CVE-2022-48737)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npowerpc64/bpf: Limit \u0026apos;ldbrx\u0026apos; to processors compliant with ISA v2.06\r\n\r\nJohan reported the below crash with test_bpf on ppc64 e5500:\r\n\r\n test_bpf: #296 ALU_END_FROM_LE 64: 0x0123456789abcdef -\u0026gt; 0x67452301 jited:1\n Oops: Exception in kernel mode, sig: 4 [#1]\n BE PAGE_SIZE=4K SMP NR_CPUS=24 QEMU e500\n Modules linked in: test_bpf(+)\n CPU: 0 PID: 76 Comm: insmod Not tainted 5.14.0-03771-g98c2059e008a-dirty #1\n NIP: 8000000000061c3c LR: 80000000006dea64 CTR: 8000000000061c18\n REGS: c0000000032d3420 TRAP: 0700 Not tainted (5.14.0-03771-g98c2059e008a-dirty)\n MSR: 0000000080089000 \u0026lt;EE,ME\u0026gt; CR: 88002822 XER: 20000000 IRQMASK: 0\n \u0026lt;...\u0026gt;\n NIP [8000000000061c3c] 0x8000000000061c3c\n LR [80000000006dea64] .__run_one+0x104/0x17c [test_bpf]\n Call Trace:\n .__run_one+0x60/0x17c [test_bpf] (unreliable)\n .test_bpf_init+0x6a8/0xdc8 [test_bpf]\n .do_one_initcall+0x6c/0x28c\n .do_init_module+0x68/0x28c\n .load_module+0x2460/0x2abc\n .__do_sys_init_module+0x120/0x18c\n .system_call_exception+0x110/0x1b8\n system_call_common+0xf0/0x210\n --- interrupt: c00 at 0x101d0acc\n \u0026lt;...\u0026gt;\n ---[ end trace 47b2bf19090bb3d0 ]---\r\n\r\n Illegal instruction\r\n\r\nThe illegal instruction turned out to be \u0026apos;ldbrx\u0026apos; emitted for\nBPF_FROM_[L|B]E, which was only introduced in ISA v2.06. Guard use of\nthe same and implement an alternative approach for older processors.(CVE-2022-48755)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/msm/dsi: invalid parameter check in msm_dsi_phy_enable\r\n\r\nThe function performs a check on the \u0026quot;phy\u0026quot; input parameter, however, it\nis used before the check.\r\n\r\nInitialize the \u0026quot;dev\u0026quot; variable after the sanity check to avoid a possible\nNULL pointer dereference.\r\n\r\nAddresses-Coverity-ID: 1493860 (\u0026quot;Null pointer dereference\u0026quot;)(CVE-2022-48756)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nrpmsg: virtio: Free driver_override when rpmsg_remove()\r\n\r\nFree driver_override when rpmsg_remove(), otherwise\nthe following memory leak will occur:\r\n\r\nunreferenced object 0xffff0000d55d7080 (size 128):\n comm \u0026quot;kworker/u8:2\u0026quot;, pid 56, jiffies 4294893188 (age 214.272s)\n hex dump (first 32 bytes):\n 72 70 6d 73 67 5f 6e 73 00 00 00 00 00 00 00 00 rpmsg_ns........\n 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................\n backtrace:\n [\u0026lt;000000009c94c9c1\u0026gt;] __kmem_cache_alloc_node+0x1f8/0x320\n [\u0026lt;000000002300d89b\u0026gt;] __kmalloc_node_track_caller+0x44/0x70\n [\u0026lt;00000000228a60c3\u0026gt;] kstrndup+0x4c/0x90\n [\u0026lt;0000000077158695\u0026gt;] driver_set_override+0xd0/0x164\n [\u0026lt;000000003e9c4ea5\u0026gt;] rpmsg_register_device_override+0x98/0x170\n [\u0026lt;000000001c0c89a8\u0026gt;] rpmsg_ns_register_device+0x24/0x30\n [\u0026lt;000000008bbf8fa2\u0026gt;] rpmsg_probe+0x2e0/0x3ec\n [\u0026lt;00000000e65a68df\u0026gt;] virtio_dev_probe+0x1c0/0x280\n [\u0026lt;00000000443331cc\u0026gt;] really_probe+0xbc/0x2dc\n [\u0026lt;00000000391064b1\u0026gt;] __driver_probe_device+0x78/0xe0\n [\u0026lt;00000000a41c9a5b\u0026gt;] driver_probe_device+0xd8/0x160\n [\u0026lt;000000009c3bd5df\u0026gt;] __device_attach_driver+0xb8/0x140\n [\u0026lt;0000000043cd7614\u0026gt;] bus_for_each_drv+0x7c/0xd4\n [\u0026lt;000000003b929a36\u0026gt;] __device_attach+0x9c/0x19c\n [\u0026lt;00000000a94e0ba8\u0026gt;] device_initial_probe+0x14/0x20\n [\u0026lt;000000003c999637\u0026gt;] bus_probe_device+0xa0/0xac(CVE-2023-52670)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nFix page corruption caused by racy check in __free_pages\r\n\r\nWhen we upgraded our kernel, we started seeing some page corruption like\nthe following consistently:\r\n\r\n BUG: Bad page state in process ganesha.nfsd pfn:1304ca\n page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca\n flags: 0x17ffffc0000000()\n raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000\n raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000\n page dumped because: nonzero mapcount\n CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1\n Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016\n Call Trace:\n dump_stack+0x74/0x96\n bad_page.cold+0x63/0x94\n check_new_page_bad+0x6d/0x80\n rmqueue+0x46e/0x970\n get_page_from_freelist+0xcb/0x3f0\n ? _cond_resched+0x19/0x40\n __alloc_pages_nodemask+0x164/0x300\n alloc_pages_current+0x87/0xf0\n skb_page_frag_refill+0x84/0x110\n ...\r\n\r\nSometimes, it would also show up as corruption in the free list pointer\nand cause crashes.\r\n\r\nAfter bisecting the issue, we found the issue started from commit\ne320d3012d25 (\u0026quot;mm/page_alloc.c: fix freeing non-compound pages\u0026quot;):\r\n\r\n\tif (put_page_testzero(page))\n\t\tfree_the_page(page, order);\n\telse if (!PageHead(page))\n\t\twhile (order-- \u0026gt; 0)\n\t\t\tfree_the_page(page + (1 \u0026lt;\u0026lt; order), order);\r\n\r\nSo the problem is the check PageHead is racy because at this point we\nalready dropped our reference to the page. So even if we came in with\ncompound page, the page can already be freed and PageHead can return\nfalse and we will end up freeing all the tail pages causing double free.(CVE-2023-52739)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\natl1c: Work around the DMA RX overflow issue\r\n\r\nThis is based on alx driver commit 881d0327db37 (\u0026quot;net: alx: Work around\nthe DMA RX overflow issue\u0026quot;).\r\n\r\nThe alx and atl1c drivers had RX overflow error which was why a custom\nallocator was created to avoid certain addresses. The simpler workaround\nthen created for alx driver, but not for atl1c due to lack of tester.\r\n\r\nInstead of using a custom allocator, check the allocated skb address and\nuse skb_reserve() to move away from problematic 0x...fc0 address.\r\n\r\nTested on AR8131 on Acer 4540.(CVE-2023-52834)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhid: cp2112: Fix duplicate workqueue initialization\r\n\r\nPreviously the cp2112 driver called INIT_DELAYED_WORK within\ncp2112_gpio_irq_startup, resulting in duplicate initilizations of the\nworkqueue on subsequent IRQ startups following an initial request. This\nresulted in a warning in set_work_data in workqueue.c, as well as a rare\nNULL dereference within process_one_work in workqueue.c.\r\n\r\nInitialize the workqueue within _probe instead.(CVE-2023-52853)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nALSA: usb-audio: Stop parsing channels bits when all channels are found.\r\n\r\nIf a usb audio device sets more bits than the amount of channels\nit could write outside of the map array.(CVE-2024-27436)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: tc358743: register v4l2 async device only after successful setup\r\n\r\nEnsure the device has been setup correctly before registering the v4l2\nasync device, thus allowing userspace to access.(CVE-2024-35830)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nusb: gadget: f_fs: Fix race between aio_cancel() and AIO request complete\r\n\r\nFFS based applications can utilize the aio_cancel() callback to dequeue\npending USB requests submitted to the UDC. There is a scenario where the\nFFS application issues an AIO cancel call, while the UDC is handling a\nsoft disconnect. For a DWC3 based implementation, the callstack looks\nlike the following:\r\n\r\n DWC3 Gadget FFS Application\ndwc3_gadget_soft_disconnect() ...\n --\u0026gt; dwc3_stop_active_transfers()\n --\u0026gt; dwc3_gadget_giveback(-ESHUTDOWN)\n --\u0026gt; ffs_epfile_async_io_complete() ffs_aio_cancel()\n --\u0026gt; usb_ep_free_request() --\u0026gt; usb_ep_dequeue()\r\n\r\nThere is currently no locking implemented between the AIO completion\nhandler and AIO cancel, so the issue occurs if the completion routine is\nrunning in parallel to an AIO cancel call coming from the FFS application.\nAs the completion call frees the USB request (io_data-\u0026gt;req) the FFS\napplication is also referencing it for the usb_ep_dequeue() call. This can\nlead to accessing a stale/hanging pointer.\r\n\r\ncommit b566d38857fc (\u0026quot;usb: gadget: f_fs: use io_data-\u0026gt;status consistently\u0026quot;)\nrelocated the usb_ep_free_request() into ffs_epfile_async_io_complete().\nHowever, in order to properly implement locking to mitigate this issue, the\nspinlock can\u0026apos;t be added to ffs_epfile_async_io_complete(), as\nusb_ep_dequeue() (if successfully dequeuing a USB request) will call the\nfunction driver\u0026apos;s completion handler in the same context. Hence, leading\ninto a deadlock.\r\n\r\nFix this issue by moving the usb_ep_free_request() back to\nffs_user_copy_worker(), and ensuring that it explicitly sets io_data-\u0026gt;req\nto NULL after freeing it within the ffs-\u0026gt;eps_lock. This resolves the race\ncondition above, as the ffs_aio_cancel() routine will not continue\nattempting to dequeue a request that has already been freed, or the\nffs_user_copy_work() not freeing the USB request until the AIO cancel is\ndone referencing it.\r\n\r\nThis fix depends on\n commit b566d38857fc (\u0026quot;usb: gadget: f_fs: use io_data-\u0026gt;status\n consistently\u0026quot;)(CVE-2024-36894)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: nl80211: don\u0026apos;t free NULL coalescing rule\r\n\r\nIf the parsing fails, we can dereference a NULL pointer here.(CVE-2024-36941)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfirewire: ohci: mask bus reset interrupts between ISR and bottom half\r\n\r\nIn the FireWire OHCI interrupt handler, if a bus reset interrupt has\noccurred, mask bus reset interrupts until bus_reset_work has serviced and\ncleared the interrupt.\r\n\r\nNormally, we always leave bus reset interrupts masked. We infer the bus\nreset from the self-ID interrupt that happens shortly thereafter. A\nscenario where we unmask bus reset interrupts was introduced in 2008 in\na007bb857e0b26f5d8b73c2ff90782d9c0972620: If\nOHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we\nwill unmask bus reset interrupts so we can log them.\r\n\r\nirq_handler logs the bus reset interrupt. However, we can\u0026apos;t clear the bus\nreset event flag in irq_handler, because we won\u0026apos;t service the event until\nlater. irq_handler exits with the event flag still set. If the\ncorresponding interrupt is still unmasked, the first bus reset will\nusually freeze the system due to irq_handler being called again each\ntime it exits. This freeze can be reproduced by loading firewire_ohci\nwith \u0026quot;modprobe firewire_ohci debug=-1\u0026quot; (to enable all debugging output).\nApparently there are also some cases where bus_reset_work will get called\nsoon enough to clear the event, and operation will continue normally.\r\n\r\nThis freeze was first reported a few months after a007bb85 was committed,\nbut until now it was never fixed. The debug level could safely be set\nto -1 through sysfs after the module was loaded, but this would be\nineffectual in logging bus reset interrupts since they were only\nunmasked during initialization.\r\n\r\nirq_handler will now leave the event flag set but mask bus reset\ninterrupts, so irq_handler won\u0026apos;t be called again and there will be no\nfreeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will\nunmask the interrupt after servicing the event, so future interrupts\nwill be caught as desired.\r\n\r\nAs a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be\nenabled through sysfs in addition to during initial module loading.\nHowever, when enabled through sysfs, logging of bus reset interrupts will\nbe effective only starting with the second bus reset, after\nbus_reset_work has executed.(CVE-2024-36950)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: fix __dst_negative_advice() race\r\n\r\n__dst_negative_advice() does not enforce proper RCU rules when\nsk-\u0026gt;dst_cache must be cleared, leading to possible UAF.\r\n\r\nRCU rules are that we must first clear sk-\u0026gt;sk_dst_cache,\nthen call dst_release(old_dst).\r\n\r\nNote that sk_dst_reset(sk) is implementing this protocol correctly,\nwhile __dst_negative_advice() uses the wrong order.\r\n\r\nGiven that ip6_negative_advice() has special logic\nagainst RTF_CACHE, this means each of the three -\u0026gt;negative_advice()\nexisting methods must perform the sk_dst_reset() themselves.\r\n\r\nNote the check against NULL dst is centralized in\n__dst_negative_advice(), there is no need to duplicate\nit in various callbacks.\r\n\r\nMany thanks to Clement Lecigne for tracking this issue.\r\n\r\nThis old bug became visible after the blamed commit, using UDP sockets.(CVE-2024-36971)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: bridge: xmit: make sure we have at least eth header len bytes\r\n\r\nsyzbot triggered an uninit value[1] error in bridge device\u0026apos;s xmit path\nby sending a short (less than ETH_HLEN bytes) skb. To fix it check if\nwe can actually pull that amount instead of assuming.\r\n\r\nTested with dropwatch:\n drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3)\n origin: software\n timestamp: Mon May 13 11:31:53 2024 778214037 nsec\n protocol: 0x88a8\n length: 2\n original length: 2\n drop reason: PKT_TOO_SMALL\r\n\r\n[1]\nBUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n __netdev_start_xmit include/linux/netdevice.h:4903 [inline]\n netdev_start_xmit include/linux/netdevice.h:4917 [inline]\n xmit_one net/core/dev.c:3531 [inline]\n dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547\n __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341\n dev_queue_xmit include/linux/netdevice.h:3091 [inline]\n __bpf_tx_skb net/core/filter.c:2136 [inline]\n __bpf_redirect_common net/core/filter.c:2180 [inline]\n __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187\n ____bpf_clone_redirect net/core/filter.c:2460 [inline]\n bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432\n ___bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997\n __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238\n bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline]\n __bpf_prog_run include/linux/filter.h:657 [inline]\n bpf_prog_run include/linux/filter.h:664 [inline]\n bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425\n bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058\n bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269\n __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678\n __do_sys_bpf kernel/bpf/syscall.c:5767 [inline]\n __se_sys_bpf kernel/bpf/syscall.c:5765 [inline]\n __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765\n x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nof: module: add buffer overflow check in of_modalias()\r\n\r\nIn of_modalias(), if the buffer happens to be too small even for the 1st\nsnprintf() call, the len parameter will become negative and str parameter\n(if not NULL initially) will point beyond the buffer\u0026apos;s end. Add the buffer\noverflow check after the 1st snprintf() call and fix such check after the\nstrlen() call (accounting for the terminating NUL char).(CVE-2024-38541)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix potential index out of bounds in color transformation function\r\n\r\nFixes index out of bounds issue in the color transformation function.\nThe issue could occur when the index \u0026apos;i\u0026apos; exceeds the number of transfer\nfunction points (TRANSFER_FUNC_POINTS).\r\n\r\nThe fix adds a check to ensure \u0026apos;i\u0026apos; is within bounds before accessing the\ntransfer function points. If \u0026apos;i\u0026apos; is out of bounds, an error message is\nlogged and the function returns false to indicate an error.\r\n\r\nReported by smatch:\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:405 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.red\u0026apos; 1025 \u0026lt;= s32max\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:406 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.green\u0026apos; 1025 \u0026lt;= s32max\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:407 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.blue\u0026apos; 1025 \u0026lt;= s32max(CVE-2024-38552)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nftrace: Fix possible use-after-free issue in ftrace_location()\r\n\r\nKASAN reports a bug:\r\n\r\n BUG: KASAN: use-after-free in ftrace_location+0x90/0x120\n Read of size 8 at addr ffff888141d40010 by task insmod/424\n CPU: 8 PID: 424 Comm: insmod Tainted: G W 6.9.0-rc2+\n [...]\n Call Trace:\n \u0026lt;TASK\u0026gt;\n dump_stack_lvl+0x68/0xa0\n print_report+0xcf/0x610\n kasan_report+0xb5/0xe0\n ftrace_location+0x90/0x120\n register_kprobe+0x14b/0xa40\n kprobe_init+0x2d/0xff0 [kprobe_example]\n do_one_initcall+0x8f/0x2d0\n do_init_module+0x13a/0x3c0\n load_module+0x3082/0x33d0\n init_module_from_file+0xd2/0x130\n __x64_sys_finit_module+0x306/0x440\n do_syscall_64+0x68/0x140\n entry_SYSCALL_64_after_hwframe+0x71/0x79\r\n\r\nThe root cause is that, in lookup_rec(), ftrace record of some address\nis being searched in ftrace pages of some module, but those ftrace pages\nat the same time is being freed in ftrace_release_mod() as the\ncorresponding module is being deleted:\r\n\r\n CPU1 | CPU2\n register_kprobes() { | delete_module() {\n check_kprobe_address_safe() { |\n arch_check_ftrace_location() { |\n ftrace_location() { |\n lookup_rec() // USE! | ftrace_release_mod() // Free!\r\n\r\nTo fix this issue:\n 1. Hold rcu lock as accessing ftrace pages in ftrace_location_range();\n 2. Use ftrace_location_range() instead of lookup_rec() in\n ftrace_location();\n 3. Call synchronize_rcu() before freeing any ftrace pages both in\n ftrace_process_locs()/ftrace_release_mod()/ftrace_free_mem().(CVE-2024-38588)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\naf_unix: Fix data races in unix_release_sock/unix_stream_sendmsg\r\n\r\nA data-race condition has been identified in af_unix. In one data path,\nthe write function unix_release_sock() atomically writes to\nsk-\u0026gt;sk_shutdown using WRITE_ONCE. However, on the reader side,\nunix_stream_sendmsg() does not read it atomically. Consequently, this\nissue is causing the following KCSAN splat to occur:\r\n\r\n\tBUG: KCSAN: data-race in unix_release_sock / unix_stream_sendmsg\r\n\r\n\twrite (marked) to 0xffff88867256ddbb of 1 bytes by task 7270 on cpu 28:\n\tunix_release_sock (net/unix/af_unix.c:640)\n\tunix_release (net/unix/af_unix.c:1050)\n\tsock_close (net/socket.c:659 net/socket.c:1421)\n\t__fput (fs/file_table.c:422)\n\t__fput_sync (fs/file_table.c:508)\n\t__se_sys_close (fs/open.c:1559 fs/open.c:1541)\n\t__x64_sys_close (fs/open.c:1541)\n\tx64_sys_call (arch/x86/entry/syscall_64.c:33)\n\tdo_syscall_64 (arch/x86/entry/common.c:?)\n\tentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\n\tread to 0xffff88867256ddbb of 1 bytes by task 989 on cpu 14:\n\tunix_stream_sendmsg (net/unix/af_unix.c:2273)\n\t__sock_sendmsg (net/socket.c:730 net/socket.c:745)\n\t____sys_sendmsg (net/socket.c:2584)\n\t__sys_sendmmsg (net/socket.c:2638 net/socket.c:2724)\n\t__x64_sys_sendmmsg (net/socket.c:2753 net/socket.c:2750 net/socket.c:2750)\n\tx64_sys_call (arch/x86/entry/syscall_64.c:33)\n\tdo_syscall_64 (arch/x86/entry/common.c:?)\n\tentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\n\tvalue changed: 0x01 -\u0026gt; 0x03\r\n\r\nThe line numbers are related to commit dd5a440a31fa (\u0026quot;Linux 6.9-rc7\u0026quot;).\r\n\r\nCommit e1d09c2c2f57 (\u0026quot;af_unix: Fix data races around sk-\u0026gt;sk_shutdown.\u0026quot;)\naddressed a comparable issue in the past regarding sk-\u0026gt;sk_shutdown.\nHowever, it overlooked resolving this particular data path.\nThis patch only offending unix_stream_sendmsg() function, since the\nother reads seem to be protected by unix_state_lock() as discussed in(CVE-2024-38596)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmacintosh/via-macii: Fix \u0026quot;BUG: sleeping function called from invalid context\u0026quot;\r\n\r\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0026apos;t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)",
"id": "OESA-2024-1767",
"modified": "2026-08-06T11:07:14Z",
"published": "2024-06-28T11:07:14Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1767"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47231"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47232"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47252"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47288"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47346"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47347"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47434"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47466"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47469"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47493"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47500"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47521"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47565"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47597"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47609"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48737"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48755"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48756"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52670"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52739"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52834"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52853"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27436"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35830"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36894"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36941"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36950"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36971"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38538"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38541"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38552"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38588"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38596"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38607"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47231",
"CVE-2021-47232",
"CVE-2021-47252",
"CVE-2021-47288",
"CVE-2021-47346",
"CVE-2021-47347",
"CVE-2021-47434",
"CVE-2021-47466",
"CVE-2021-47469",
"CVE-2021-47493",
"CVE-2021-47500",
"CVE-2021-47521",
"CVE-2021-47565",
"CVE-2021-47597",
"CVE-2021-47609",
"CVE-2022-48737",
"CVE-2022-48755",
"CVE-2022-48756",
"CVE-2023-52670",
"CVE-2023-52739",
"CVE-2023-52834",
"CVE-2023-52853",
"CVE-2024-27436",
"CVE-2024-35830",
"CVE-2024-36894",
"CVE-2024-36941",
"CVE-2024-36950",
"CVE-2024-36971",
"CVE-2024-38538",
"CVE-2024-38541",
"CVE-2024-38552",
"CVE-2024-38588",
"CVE-2024-38596",
"CVE-2024-38607"
]
}
OESA-2024-1941 (CVE-2021-47205)
Vulnerability from osv_openeuler – Published: 2024-08-02 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
clk: sunxi-ng: Unregister clocks/resets when unbinding
Currently, unbinding a CCU driver unmaps the device's MMIO region, while leaving its clocks/resets and their providers registered. This can cause a page fault later when some clock operation tries to perform MMIO. Fix this by separating the CCU initialization from the memory allocation, and then using a devres callback to unregister the clocks and resets.
This also fixes a memory leak of the struct ccu_reset, and uses the
correct owner (the specific platform driver) for the clocks and resets.
Early OF clock providers are never unregistered, and limited error handling is possible, so they are mostly unchanged. The error reporting is made more consistent by moving the message inside of_sunxi_ccu_probe.(CVE-2021-47205)
In the Linux kernel, the following vulnerability has been resolved:
thermal/int340x_thermal: handle data_vault when the value is ZERO_SIZE_PTR
In some case, the GDDV returns a package with a buffer which has zero length. It causes that kmemdup() returns ZERO_SIZE_PTR (0x10).
Then the data_vault_read() got NULL point dereference problem when accessing the 0x10 value in data_vault.
[ 71.024560] BUG: kernel NULL pointer dereference, address: 0000000000000010
This patch uses ZERO_OR_NULL_PTR() for checking ZERO_SIZE_PTR or NULL value in data_vault.(CVE-2022-48703)
In the Linux kernel, the following vulnerability has been resolved:
net/smc: Avoid overwriting the copies of clcsock callback functions
The callback functions of clcsock will be saved and replaced during the fallback. But if the fallback happens more than once, then the copies of these callback functions will be overwritten incorrectly, resulting in a loop call issue:
clcsk->sk_error_report |- smc_fback_error_report() <------------------------------| |- smc_fback_forward_wakeup() | (loop) |- clcsock_callback() (incorrectly overwritten) | |- smc->clcsk_error_report() ------------------|
So this patch fixes the issue by saving these function pointers only once in the fallback and avoiding overwriting.(CVE-2022-48780)
In the Linux kernel, the following vulnerability has been resolved:
net: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr
This node pointer is returned by of_find_compatible_node() with refcount incremented. Calling of_node_put() to aovid the refcount leak.(CVE-2022-48859)
In the Linux kernel, the following vulnerability has been resolved:
of: Fix double free in of_parse_phandle_with_args_map
In of_parse_phandle_with_args_map() the inner loop that iterates through the map entries calls of_node_put(new) to free the reference acquired by the previous iteration of the inner loop. This assumes that the value of "new" is NULL on the first iteration of the inner loop.
Make sure that this is true in all iterations of the outer loop by setting "new" to NULL after its value is assigned to "cur".
Extend the unittest to detect the double free and add an additional test case that actually triggers this path.(CVE-2023-52679)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nft_set_pipapo: do not free live element
Pablo reports a crash with large batches of elements with a back-to-back add/remove pattern. Quoting Pablo:
add_elem("00000000") timeout 100 ms ... add_elem("0000000X") timeout 100 ms del_elem("0000000X") <---------------- delete one that was just added ... add_elem("00005000") timeout 100 ms
1) nft_pipapo_remove() removes element 0000000X Then, KASAN shows a splat.
Looking at the remove function there is a chance that we will drop a rule that maps to a non-deactivated element.
Removal happens in two steps, first we do a lookup for key k and return the to-be-removed element and mark it as inactive in the next generation. Then, in a second step, the element gets removed from the set/map.
The _remove function does not work correctly if we have more than one element that share the same key.
This can happen if we insert an element into a set when the set already holds an element with same key, but the element mapping to the existing key has timed out or is not active in the next generation.
In such case its possible that removal will unmap the wrong element. If this happens, we will leak the non-deactivated element, it becomes unreachable.
The element that got deactivated (and will be freed later) will remain reachable in the set data structure, this can result in a crash when such an element is retrieved during lookup (stale pointer).
Add a check that the fully matching key does in fact map to the element that we have marked as inactive in the deactivation step. If not, we need to continue searching.
Add a bug/warn trap at the end of the function as well, the remove function must not ever be called with an invisible/unreachable/non-existent element.
v2: avoid uneeded temporary variable (Stefano)(CVE-2024-26924)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_tables: release mutex after nft_gc_seq_end from abort path
The commit mutex should not be released during the critical section between nft_gc_seq_begin() and nft_gc_seq_end(), otherwise, async GC worker could collect expired objects and get the released commit lock within the same GC sequence.
nf_tables_module_autoload() temporarily releases the mutex to load module dependencies, then it goes back to replay the transaction again. Move it at the end of the abort phase after nft_gc_seq_end() is called.(CVE-2024-26925)
In the Linux kernel, the following vulnerability has been resolved:
net/sched: Fix mirred deadlock on device recursion
When the mirred action is used on a classful egress qdisc and a packet is mirrored or redirected to self we hit a qdisc lock deadlock. See trace below.
[..... other info removed for brevity....] [ 82.890906] [ 82.890906] ============================================ [ 82.890906] WARNING: possible recursive locking detected [ 82.890906] 6.8.0-05205-g77fadd89fe2d-dirty #213 Tainted: G W [ 82.890906] -------------------------------------------- [ 82.890906] ping/418 is trying to acquire lock: [ 82.890906] ffff888006994110 (&sch->q.lock){+.-.}-{3:3}, at: __dev_queue_xmit+0x1778/0x3550 [ 82.890906] [ 82.890906] but task is already holding lock: [ 82.890906] ffff888006994110 (&sch->q.lock){+.-.}-{3:3}, at: __dev_queue_xmit+0x1778/0x3550 [ 82.890906] [ 82.890906] other info that might help us debug this: [ 82.890906] Possible unsafe locking scenario: [ 82.890906] [ 82.890906] CPU0 [ 82.890906] ---- [ 82.890906] lock(&sch->q.lock); [ 82.890906] lock(&sch->q.lock); [ 82.890906] [ 82.890906] *** DEADLOCK *** [ 82.890906] [..... other info removed for brevity....]
Example setup (eth0->eth0) to recreate tc qdisc add dev eth0 root handle 1: htb default 30 tc filter add dev eth0 handle 1: protocol ip prio 2 matchall \ action mirred egress redirect dev eth0
Another example(eth0->eth1->eth0) to recreate tc qdisc add dev eth0 root handle 1: htb default 30 tc filter add dev eth0 handle 1: protocol ip prio 2 matchall \ action mirred egress redirect dev eth1
tc qdisc add dev eth1 root handle 1: htb default 30 tc filter add dev eth1 handle 1: protocol ip prio 2 matchall \ action mirred egress redirect dev eth0
We fix this by adding an owner field (CPU id) to struct Qdisc set after root qdisc is entered. When the softirq enters it a second time, if the qdisc owner is the same CPU, the packet is dropped to break the loop.(CVE-2024-27010)
In the Linux kernel, the following vulnerability has been resolved:
dma-mapping: benchmark: fix node id validation
While validating node ids in map_benchmark_ioctl(), node_possible() may be provided with invalid argument outside of [0,MAX_NUMNODES-1] range leading to:
BUG: KASAN: wild-memory-access in map_benchmark_ioctl (kernel/dma/map_benchmark.c:214) Read of size 8 at addr 1fffffff8ccb6398 by task dma_map_benchma/971 CPU: 7 PID: 971 Comm: dma_map_benchma Not tainted 6.9.0-rc6 #37 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996) Call Trace: <TASK> dump_stack_lvl (lib/dump_stack.c:117) kasan_report (mm/kasan/report.c:603) kasan_check_range (mm/kasan/generic.c:189) variable_test_bit (arch/x86/include/asm/bitops.h:227) [inline] arch_test_bit (arch/x86/include/asm/bitops.h:239) [inline] _test_bit at (include/asm-generic/bitops/instrumented-non-atomic.h:142) [inline] node_state (include/linux/nodemask.h:423) [inline] map_benchmark_ioctl (kernel/dma/map_benchmark.c:214) full_proxy_unlocked_ioctl (fs/debugfs/file.c:333) __x64_sys_ioctl (fs/ioctl.c:890) do_syscall_64 (arch/x86/entry/common.c:83) entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
Compare node ids with sane bounds first. NUMA_NO_NODE is considered a special valid case meaning that benchmarking kthreads won't be bound to a cpuset of a given node.
Found by Linux Verification Center (linuxtesting.org).(CVE-2024-34777)
In the Linux kernel, the following vulnerability has been resolved:
md/dm-raid: don't call md_reap_sync_thread() directly
Currently md_reap_sync_thread() is called from raid_message() directly without holding 'reconfig_mutex', this is definitely unsafe because md_reap_sync_thread() can change many fields that is protected by 'reconfig_mutex'.
However, hold 'reconfig_mutex' here is still problematic because this will cause deadlock, for example, commit 130443d60b1b ("md: refactor idle/frozen_sync_thread() to fix deadlock").
Fix this problem by using stop_sync_thread() to unregister sync_thread, like md/raid did.(CVE-2024-35808)
In the Linux kernel, the following vulnerability has been resolved:
net: mvpp2: clear BM pool before initialization
Register value persist after booting the kernel using kexec which results in kernel panic. Thus clear the BM pool registers before initialisation to fix the issue.(CVE-2024-35837)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_tables: flush pending destroy work before exit_net release
Similar to 2c9f0293280e ("netfilter: nf_tables: flush pending destroy work before netlink notifier") to address a race between exit_net and the destroy workqueue.
The trace below shows an element to be released via destroy workqueue while exit_net path (triggered via module removal) has already released the set that is used in such transaction.
[ 1360.547789] BUG: KASAN: slab-use-after-free in nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables] [ 1360.547861] Read of size 8 at addr ffff888140500cc0 by task kworker/4:1/152465 [ 1360.547870] CPU: 4 PID: 152465 Comm: kworker/4:1 Not tainted 6.8.0+ #359 [ 1360.547882] Workqueue: events nf_tables_trans_destroy_work [nf_tables] [ 1360.547984] Call Trace: [ 1360.547991] <TASK> [ 1360.547998] dump_stack_lvl+0x53/0x70 [ 1360.548014] print_report+0xc4/0x610 [ 1360.548026] ? __virt_addr_valid+0xba/0x160 [ 1360.548040] ? __pfx__raw_spin_lock_irqsave+0x10/0x10 [ 1360.548054] ? nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables] [ 1360.548176] kasan_report+0xae/0xe0 [ 1360.548189] ? nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables] [ 1360.548312] nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables] [ 1360.548447] ? __pfx_nf_tables_trans_destroy_work+0x10/0x10 [nf_tables] [ 1360.548577] ? _raw_spin_unlock_irq+0x18/0x30 [ 1360.548591] process_one_work+0x2f1/0x670 [ 1360.548610] worker_thread+0x4d3/0x760 [ 1360.548627] ? __pfx_worker_thread+0x10/0x10 [ 1360.548640] kthread+0x16b/0x1b0 [ 1360.548653] ? __pfx_kthread+0x10/0x10 [ 1360.548665] ret_from_fork+0x2f/0x50 [ 1360.548679] ? __pfx_kthread+0x10/0x10 [ 1360.548690] ret_from_fork_asm+0x1a/0x30 [ 1360.548707] </TASK>
[ 1360.548719] Allocated by task 192061: [ 1360.548726] kasan_save_stack+0x20/0x40 [ 1360.548739] kasan_save_track+0x14/0x30 [ 1360.548750] __kasan_kmalloc+0x8f/0xa0 [ 1360.548760] __kmalloc_node+0x1f1/0x450 [ 1360.548771] nf_tables_newset+0x10c7/0x1b50 [nf_tables] [ 1360.548883] nfnetlink_rcv_batch+0xbc4/0xdc0 [nfnetlink] [ 1360.548909] nfnetlink_rcv+0x1a8/0x1e0 [nfnetlink] [ 1360.548927] netlink_unicast+0x367/0x4f0 [ 1360.548935] netlink_sendmsg+0x34b/0x610 [ 1360.548944] _syssendmsg+0x4d4/0x510 [ 1360.548953] _sys_sendmsg+0xc9/0x120 [ 1360.548961] __sys_sendmsg+0xbe/0x140 [ 1360.548971] do_syscall_64+0x55/0x120 [ 1360.548982] entry_SYSCALL_64_after_hwframe+0x55/0x5d
[ 1360.548994] Freed by task 192222: [ 1360.548999] kasan_save_stack+0x20/0x40 [ 1360.549009] kasan_save_track+0x14/0x30 [ 1360.549019] kasan_save_free_info+0x3b/0x60 [ 1360.549028] poison_slab_object+0x100/0x180 [ 1360.549036] __kasan_slab_free+0x14/0x30 [ 1360.549042] kfree+0xb6/0x260 [ 1360.549049] __nft_release_table+0x473/0x6a0 [nf_tables] [ 1360.549131] nf_tables_exit_net+0x170/0x240 [nf_tables] [ 1360.549221] ops_exit_list+0x50/0xa0 [ 1360.549229] free_exit_list+0x101/0x140 [ 1360.549236] unregister_pernet_operations+0x107/0x160 [ 1360.549245] unregister_pernet_subsys+0x1c/0x30 [ 1360.549254] nf_tables_module_exit+0x43/0x80 [nf_tables] [ 1360.549345] __do_sys_delete_module+0x253/0x370 [ 1360.549352] do_syscall_64+0x55/0x120 [ 1360.549360] entry_SYSCALL_64_after_hwframe+0x55/0x5d
(gdb) list *__nft_release_table+0x473 0x1e033 is in __nft_release_table (net/netfilter/nf_tables_api.c:11354). 11349 list_for_each_entry_safe(flowtable, nf, &table->flowtables, list) { 11350 list_del(&flowtable->list); 11351 nft_use_dec(&table->use); 11352 nf_tables_flowtable_destroy(flowtable); 11353 } 11354 list_for_each_entry_safe(set, ns, &table->sets, list) { 11355 list_del(&set->list); 11356 nft_use_dec(&table->use); 11357 if (set->flags & (NFT_SET_MAP | NFT_SET_OBJECT)) 11358 nft_map_deactivat ---truncated---(CVE-2024-35899)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu: Skip do PCI error slot reset during RAS recovery
Why: The PCI error slot reset maybe triggered after inject ue to UMC multi times, this caused system hang. [ 557.371857] amdgpu 0000:af:00.0: amdgpu: GPU reset succeeded, trying to resume [ 557.373718] [drm] PCIE GART of 512M enabled. [ 557.373722] [drm] PTB located at 0x0000031FED700000 [ 557.373788] [drm] VRAM is lost due to GPU reset! [ 557.373789] [drm] PSP is resuming... [ 557.547012] mlx5_core 0000:55:00.0: mlx5_pci_err_detected Device state = 1 pci_status: 0. Exit, result = 3, need reset [ 557.547067] [drm] PCI error: detected callback, state(1)!! [ 557.547069] [drm] No support for XGMI hive yet... [ 557.548125] mlx5_core 0000:55:00.0: mlx5_pci_slot_reset Device state = 1 pci_status: 0. Enter [ 557.607763] mlx5_core 0000:55:00.0: wait vital counter value 0x16b5b after 1 iterations [ 557.607777] mlx5_core 0000:55:00.0: mlx5_pci_slot_reset Device state = 1 pci_status: 1. Exit, err = 0, result = 5, recovered [ 557.610492] [drm] PCI error: slot reset callback!! ... [ 560.689382] amdgpu 0000:3f:00.0: amdgpu: GPU reset(2) succeeded! [ 560.689546] amdgpu 0000:5a:00.0: amdgpu: GPU reset(2) succeeded! [ 560.689562] general protection fault, probably for non-canonical address 0x5f080b54534f611f: 0000 [#1] SMP NOPTI [ 560.701008] CPU: 16 PID: 2361 Comm: kworker/u448:9 Tainted: G OE 5.15.0-91-generic #101-Ubuntu [ 560.712057] Hardware name: Microsoft C278A/C278A, BIOS C2789.5.BS.1C11.AG.1 11/08/2023 [ 560.720959] Workqueue: amdgpu-reset-hive amdgpu_ras_do_recovery [amdgpu] [ 560.728887] RIP: 0010:amdgpu_device_gpu_recover.cold+0xbf1/0xcf5 [amdgpu] [ 560.736891] Code: ff 41 89 c6 e9 1b ff ff ff 44 0f b6 45 b0 e9 4f ff ff ff be 01 00 00 00 4c 89 e7 e8 76 c9 8b ff 44 0f b6 45 b0 e9 3c fd ff ff <48> 83 ba 18 02 00 00 00 0f 84 6a f8 ff ff 48 8d 7a 78 be 01 00 00 [ 560.757967] RSP: 0018:ffa0000032e53d80 EFLAGS: 00010202 [ 560.763848] RAX: ffa00000001dfd10 RBX: ffa0000000197090 RCX: ffa0000032e53db0 [ 560.771856] RDX: 5f080b54534f5f07 RSI: 0000000000000000 RDI: ff11000128100010 [ 560.779867] RBP: ffa0000032e53df0 R08: 0000000000000000 R09: ffffffffffe77f08 [ 560.787879] R10: 0000000000ffff0a R11: 0000000000000001 R12: 0000000000000000 [ 560.795889] R13: ffa0000032e53e00 R14: 0000000000000000 R15: 0000000000000000 [ 560.803889] FS: 0000000000000000(0000) GS:ff11007e7e800000(0000) knlGS:0000000000000000 [ 560.812973] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 560.819422] CR2: 000055a04c118e68 CR3: 0000000007410005 CR4: 0000000000771ee0 [ 560.827433] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 [ 560.835433] DR3: 0000000000000000 DR6: 00000000fffe07f0 DR7: 0000000000000400 [ 560.843444] PKRU: 55555554 [ 560.846480] Call Trace: [ 560.849225] <TASK> [ 560.851580] ? show_trace_log_lvl+0x1d6/0x2ea [ 560.856488] ? show_trace_log_lvl+0x1d6/0x2ea [ 560.861379] ? amdgpu_ras_do_recovery+0x1b2/0x210 [amdgpu] [ 560.867778] ? show_regs.part.0+0x23/0x29 [ 560.872293] ? __die_body.cold+0x8/0xd [ 560.876502] ? die_addr+0x3e/0x60 [ 560.880238] ? exc_general_protection+0x1c5/0x410 [ 560.885532] ? asm_exc_general_protection+0x27/0x30 [ 560.891025] ? amdgpu_device_gpu_recover.cold+0xbf1/0xcf5 [amdgpu] [ 560.898323] amdgpu_ras_do_recovery+0x1b2/0x210 [amdgpu] [ 560.904520] process_one_work+0x228/0x3d0 How: In RAS recovery, mode-1 reset is issued from RAS fatal error handling and expected all the nodes in a hive to be reset. no need to issue another mode-1 during this procedure.(CVE-2024-35931)
In the Linux kernel, the following vulnerability has been resolved:
fs/9p: fix uninitialized values during inode evict
If an iget fails due to not being able to retrieve information from the server then the inode structure is only partially initialized. When the inode gets evicted, references to uninitialized structures (like fscache cookies) were being made.
This patch checks for a bad_inode before doing anything other than clearing the inode from the cache. Since the inode is bad, it shouldn't have any state associated with it that needs to be written back (and there really isn't a way to complete those anyways).(CVE-2024-36923)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: fix potential kernel bug due to lack of writeback flag waiting
Destructive writes to a block device on which nilfs2 is mounted can cause a kernel bug in the folio/page writeback start routine or writeback end routine (__folio_start_writeback in the log below):
kernel BUG at mm/page-writeback.c:3070! Oops: invalid opcode: 0000 [#1] PREEMPT SMP KASAN PTI ... RIP: 0010:__folio_start_writeback+0xbaa/0x10e0 Code: 25 ff 0f 00 00 0f 84 18 01 00 00 e8 40 ca c6 ff e9 17 f6 ff ff e8 36 ca c6 ff 4c 89 f7 48 c7 c6 80 c0 12 84 e8 e7 b3 0f 00 90 <0f> 0b e8 1f ca c6 ff 4c 89 f7 48 c7 c6 a0 c6 12 84 e8 d0 b3 0f 00 ... Call Trace: <TASK> nilfs_segctor_do_construct+0x4654/0x69d0 [nilfs2] nilfs_segctor_construct+0x181/0x6b0 [nilfs2] nilfs_segctor_thread+0x548/0x11c0 [nilfs2] kthread+0x2f0/0x390 ret_from_fork+0x4b/0x80 ret_from_fork_asm+0x1a/0x30 </TASK>
This is because when the log writer starts a writeback for segment summary blocks or a super root block that use the backing device's page cache, it does not wait for the ongoing folio/page writeback, resulting in an inconsistent writeback state.
Fix this issue by waiting for ongoing writebacks when putting folios/pages on the backing device into writeback state.(CVE-2024-37078)
In the Linux kernel, the following vulnerability has been resolved:
drm: bridge: cdns-mhdp8546: Fix possible null pointer dereference
In cdns_mhdp_atomic_enable(), the return value of drm_mode_duplicate() is assigned to mhdp_state->current_mode, and there is a dereference of it in drm_mode_set_name(), which will lead to a NULL pointer dereference on failure of drm_mode_duplicate().
Fix this bug add a check of mhdp_state->current_mode.(CVE-2024-38548)
In the Linux kernel, the following vulnerability has been resolved:
wifi: carl9170: add a proper sanity check for endpoints
Syzkaller reports [1] hitting a warning which is caused by presence of a wrong endpoint type at the URB sumbitting stage. While there was a check for a specific 4th endpoint, since it can switch types between bulk and interrupt, other endpoints are trusted implicitly. Similar warning is triggered in a couple of other syzbot issues [2].
Fix the issue by doing a comprehensive check of all endpoints taking into account difference between high- and full-speed configuration.
[1] Syzkaller report: ... WARNING: CPU: 0 PID: 4721 at drivers/usb/core/urb.c:504 usb_submit_urb+0xed6/0x1880 drivers/usb/core/urb.c:504 ... Call Trace: <TASK> carl9170_usb_send_rx_irq_urb+0x273/0x340 drivers/net/wireless/ath/carl9170/usb.c:504 carl9170_usb_init_device drivers/net/wireless/ath/carl9170/usb.c:939 [inline] carl9170_usb_firmware_finish drivers/net/wireless/ath/carl9170/usb.c:999 [inline] carl9170_usb_firmware_step2+0x175/0x240 drivers/net/wireless/ath/carl9170/usb.c:1028 request_firmware_work_func+0x130/0x240 drivers/base/firmware_loader/main.c:1107 process_one_work+0x9bf/0x1710 kernel/workqueue.c:2289 worker_thread+0x669/0x1090 kernel/workqueue.c:2436 kthread+0x2e8/0x3a0 kernel/kthread.c:376 ret_from_fork+0x1f/0x30 arch/x86/entry/entry_64.S:308 </TASK>
[2] Related syzkaller crashes:(CVE-2024-38567)
In the Linux kernel, the following vulnerability has been resolved:
macintosh/via-macii: Fix "BUG: sleeping function called from invalid context"
The via-macii ADB driver calls request_irq() after disabling hard interrupts. But disabling interrupts isn't necessary here because the VIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)
In the Linux kernel, the following vulnerability has been resolved:
media: i2c: et8ek8: Don't strip remove function when driver is builtin
Using __exit for the remove function results in the remove callback being discarded with CONFIG_VIDEO_ET8EK8=y. When such a device gets unbound (e.g. using sysfs or hotplug), the driver is just removed without the cleanup being performed. This results in resource leaks. Fix it by compiling in the remove callback unconditionally.
This also fixes a W=1 modpost warning:
WARNING: modpost: drivers/media/i2c/et8ek8/et8ek8: section mismatch in reference: et8ek8_i2c_driver+0x10 (section: .data) -> et8ek8_remove (section: .exit.text)(CVE-2024-38611)
In the Linux kernel, the following vulnerability has been resolved:
media: stk1160: fix bounds checking in stk1160_copy_video()
The subtract in this condition is reversed. The ->length is the length of the buffer. The ->bytesused is how many bytes we have copied thus far. When the condition is reversed that means the result of the subtraction is always negative but since it's unsigned then the result is a very high positive value. That means the overflow check is never true.
Additionally, the ->bytesused doesn't actually work for this purpose because we're not writing to "buf->mem + buf->bytesused". Instead, the math to calculate the destination where we are writing is a bit involved. You calculate the number of full lines already written, multiply by two, skip a line if necessary so that we start on an odd numbered line, and add the offset into the line.
To fix this buffer overflow, just take the actual destination where we are writing, if the offset is already out of bounds print an error and return. Otherwise, write up to buf->length bytes.(CVE-2024-38621)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: savage: Handle err return when savagefb_check_var failed
The commit 04e5eac8f3ab("fbdev: savage: Error out if pixclock equals zero") checks the value of pixclock to avoid divide-by-zero error. However the function savagefb_probe doesn't handle the error return of savagefb_check_var. When pixclock is 0, it will cause divide-by-zero error.(CVE-2024-39475)
In the Linux kernel, the following vulnerability has been resolved:
md/raid5: fix deadlock that raid5d() wait for itself to clear MD_SB_CHANGE_PENDING
Xiao reported that lvm2 test lvconvert-raid-takeover.sh can hang with small possibility, the root cause is exactly the same as commit bed9e27baf52 ("Revert "md/raid5: Wait for MD_SB_CHANGE_PENDING in raid5d"")
However, Dan reported another hang after that, and junxiao investigated the problem and found out that this is caused by plugged bio can't issue from raid5d().
Current implementation in raid5d() has a weird dependence:
1) md_check_recovery() from raid5d() must hold 'reconfig_mutex' to clear MD_SB_CHANGE_PENDING; 2) raid5d() handles IO in a deadloop, until all IO are issued; 3) IO from raid5d() must wait for MD_SB_CHANGE_PENDING to be cleared;
This behaviour is introduce before v2.6, and for consequence, if other context hold 'reconfig_mutex', and md_check_recovery() can't update super_block, then raid5d() will waste one cpu 100% by the deadloop, until 'reconfig_mutex' is released.
Refer to the implementation from raid1 and raid10, fix this problem by skipping issue IO if MD_SB_CHANGE_PENDING is still set after md_check_recovery(), daemon thread will be woken up when 'reconfig_mutex' is released. Meanwhile, the hang problem will be fixed as well.(CVE-2024-39476)
In the Linux kernel, the following vulnerability has been resolved:
mmc: davinci: Don't strip remove function when driver is builtin
Using __exit for the remove function results in the remove callback being discarded with CONFIG_MMC_DAVINCI=y. When such a device gets unbound (e.g. using sysfs or hotplug), the driver is just removed without the cleanup being performed. This results in resource leaks. Fix it by compiling in the remove callback unconditionally.
This also fixes a W=1 modpost warning:
WARNING: modpost: drivers/mmc/host/davinci_mmc: section mismatch in reference: davinci_mmcsd_driver+0x10 (section: .data) -> davinci_mmcsd_remove (section: .exit.text)(CVE-2024-39484)
In the Linux kernel, the following vulnerability has been resolved:
liquidio: Adjust a NULL pointer handling path in lio_vf_rep_copy_packet
In lio_vf_rep_copy_packet() pg_info->page is compared to a NULL value, but then it is unconditionally passed to skb_add_rx_frag() which looks strange and could lead to null pointer dereference.
lio_vf_rep_copy_packet() call trace looks like: octeon_droq_process_packets octeon_droq_fast_process_packets octeon_droq_dispatch_pkt octeon_create_recv_info ...search in the dispatch_list... ->disp_fn(rdisp->rinfo, ...) lio_vf_rep_pkt_recv(struct octeon_recv_info *recv_info, ...) In this path there is no code which sets pg_info->page to NULL. So this check looks unneeded and doesn't solve potential problem. But I guess the author had reason to add a check and I have no such card and can't do real test. In addition, the code in the function liquidio_push_packet() in liquidio/lio_core.c does exactly the same.
Based on this, I consider the most acceptable compromise solution to adjust this issue by moving skb_add_rx_frag() into conditional scope.
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-39506)
In the Linux kernel, the following vulnerability has been resolved:
io_uring/io-wq: Use set_bit() and test_bit() at worker->flags
Utilize set_bit() and test_bit() on worker->flags within io_uring/io-wq to address potential data races.
The structure io_worker->flags may be accessed through various data paths, leading to concurrency issues. When KCSAN is enabled, it reveals data races occurring in io_worker_handle_work and io_wq_activate_free_worker functions.
BUG: KCSAN: data-race in io_worker_handle_work / io_wq_activate_free_worker
write to 0xffff8885c4246404 of 4 bytes by task 49071 on cpu 28:
io_worker_handle_work (io_uring/io-wq.c:434 io_uring/io-wq.c:569)
io_wq_worker (io_uring/io-wq.c:?)
<snip>
read to 0xffff8885c4246404 of 4 bytes by task 49024 on cpu 5:
io_wq_activate_free_worker (io_uring/io-wq.c:? io_uring/io-wq.c:285)
io_wq_enqueue (io_uring/io-wq.c:947)
io_queue_iowq (io_uring/io_uring.c:524)
io_req_task_submit (io_uring/io_uring.c:1511)
io_handle_tw_list (io_uring/io_uring.c:1198)
<snip>
Line numbers against commit 18daea77cca6 ("Merge tag 'for-linus' of git://git.kernel.org/pub/scm/virt/kvm/kvm").
These races involve writes and reads to the same memory location by different tasks running on different CPUs. To mitigate this, refactor the code to use atomic operations such as set_bit(), test_bit(), and clear_bit() instead of basic "and" and "or" operations. This ensures thread-safe manipulation of worker flags.
Also, move create_index to avoid holes in the structure.(CVE-2024-39508)
In the Linux kernel, the following vulnerability has been resolved:
riscv: rewrite __kernel_map_pages() to fix sleeping in invalid context
__kernel_map_pages() is a debug function which clears the valid bit in page table entry for deallocated pages to detect illegal memory accesses to freed pages.
This function set/clear the valid bit using __set_memory(). __set_memory() acquires init_mm's semaphore, and this operation may sleep. This is problematic, because __kernel_map_pages() can be called in atomic context, and thus is illegal to sleep. An example warning that this causes:
BUG: sleeping function called from invalid context at kernel/locking/rwsem.c:1578 in_atomic(): 1, irqs_disabled(): 0, non_block: 0, pid: 2, name: kthreadd preempt_count: 2, expected: 0 CPU: 0 PID: 2 Comm: kthreadd Not tainted 6.9.0-g1d4c6d784ef6 #37 Hardware name: riscv-virtio,qemu (DT) Call Trace: [<ffffffff800060dc>] dump_backtrace+0x1c/0x24 [<ffffffff8091ef6e>] show_stack+0x2c/0x38 [<ffffffff8092baf8>] dump_stack_lvl+0x5a/0x72 [<ffffffff8092bb24>] dump_stack+0x14/0x1c [<ffffffff8003b7ac>] __might_resched+0x104/0x10e [<ffffffff8003b7f4>] __might_sleep+0x3e/0x62 [<ffffffff8093276a>] down_write+0x20/0x72 [<ffffffff8000cf00>] __set_memory+0x82/0x2fa [<ffffffff8000d324>] __kernel_map_pages+0x5a/0xd4 [<ffffffff80196cca>] __alloc_pages_bulk+0x3b2/0x43a [<ffffffff8018ee82>] __vmalloc_node_range+0x196/0x6ba [<ffffffff80011904>] copy_process+0x72c/0x17ec [<ffffffff80012ab4>] kernel_clone+0x60/0x2fe [<ffffffff80012f62>] kernel_thread+0x82/0xa0 [<ffffffff8003552c>] kthreadd+0x14a/0x1be [<ffffffff809357de>] ret_from_fork+0xe/0x1c
Rewrite this function with apply_to_existing_page_range(). It is fine to not have any locking, because __kernel_map_pages() works with pages being allocated/deallocated and those pages are not changed by anyone else in the meantime.(CVE-2024-40915)
In the Linux kernel, the following vulnerability has been resolved:
iommu: Return right value in iommu_sva_bind_device()
iommu_sva_bind_device() should return either a sva bond handle or an ERR_PTR value in error cases. Existing drivers (idxd and uacce) only check the return value with IS_ERR(). This could potentially lead to a kernel NULL pointer dereference issue if the function returns NULL instead of an error pointer.
In reality, this doesn't cause any problems because iommu_sva_bind_device() only returns NULL when the kernel is not configured with CONFIG_IOMMU_SVA. In this case, iommu_dev_enable_feature(dev, IOMMU_DEV_FEAT_SVA) will return an error, and the device drivers won't call iommu_sva_bind_device() at all.(CVE-2024-40945)
In the Linux kernel, the following vulnerability has been resolved:
ima: Avoid blocking in RCU read-side critical section
A panic happens in ima_match_policy:
BUG: unable to handle kernel NULL pointer dereference at 0000000000000010 PGD 42f873067 P4D 0 Oops: 0000 [#1] SMP NOPTI CPU: 5 PID: 1286325 Comm: kubeletmonit.sh Kdump: loaded Tainted: P Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 0.0.0 02/06/2015 RIP: 0010:ima_match_policy+0x84/0x450 Code: 49 89 fc 41 89 cf 31 ed 89 44 24 14 eb 1c 44 39 7b 18 74 26 41 83 ff 05 74 20 48 8b 1b 48 3b 1d f2 b9 f4 00 0f 84 9c 01 00 00 <44> 85 73 10 74 ea 44 8b 6b 14 41 f6 c5 01 75 d4 41 f6 c5 02 74 0f RSP: 0018:ff71570009e07a80 EFLAGS: 00010207 RAX: 0000000000000000 RBX: 0000000000000000 RCX: 0000000000000200 RDX: ffffffffad8dc7c0 RSI: 0000000024924925 RDI: ff3e27850dea2000 RBP: 0000000000000000 R08: 0000000000000000 R09: ffffffffabfce739 R10: ff3e27810cc42400 R11: 0000000000000000 R12: ff3e2781825ef970 R13: 00000000ff3e2785 R14: 000000000000000c R15: 0000000000000001 FS: 00007f5195b51740(0000) GS:ff3e278b12d40000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000000000000010 CR3: 0000000626d24002 CR4: 0000000000361ee0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: ima_get_action+0x22/0x30 process_measurement+0xb0/0x830 ? page_add_file_rmap+0x15/0x170 ? alloc_set_pte+0x269/0x4c0 ? prep_new_page+0x81/0x140 ? simple_xattr_get+0x75/0xa0 ? selinux_file_open+0x9d/0xf0 ima_file_check+0x64/0x90 path_openat+0x571/0x1720 do_filp_open+0x9b/0x110 ? page_counter_try_charge+0x57/0xc0 ? files_cgroup_alloc_fd+0x38/0x60 ? __alloc_fd+0xd4/0x250 ? do_sys_open+0x1bd/0x250 do_sys_open+0x1bd/0x250 do_syscall_64+0x5d/0x1d0 entry_SYSCALL_64_after_hwframe+0x65/0xca
Commit c7423dbdbc9e ("ima: Handle -ESTALE returned by ima_filter_rule_match()") introduced call to ima_lsm_copy_rule within a RCU read-side critical section which contains kmalloc with GFP_KERNEL. This implies a possible sleep and violates limitations of RCU read-side critical sections on non-PREEMPT systems.
Sleeping within RCU read-side critical section might cause synchronize_rcu() returning early and break RCU protection, allowing a UAF to happen.
The root cause of this issue could be described as follows: | Thread A | Thread B | | |ima_match_policy | | | rcu_read_lock | |ima_lsm_update_rule | | | synchronize_rcu | | | | kmalloc(GFP_KERNEL)| | | sleep | ==> synchronize_rcu returns early | kfree(entry) | | | | entry = entry->next| ==> UAF happens and entry now becomes NULL (or could be anything). | | entry->action | ==> Accessing entry might cause panic.
To fix this issue, we are converting all kmalloc that is called within RCU read-side critical section to use GFP_ATOMIC.
PM: fixed missing comment, long lines, !CONFIG_IMA_LSM_RULES case
In the Linux kernel, the following vulnerability has been resolved:
dmaengine: idxd: Fix possible Use-After-Free in irq_process_work_list
Use list_for_each_entry_safe() to allow iterating through the list and deleting the entry in the iteration process. The descriptor is freed via idxd_desc_complete() and there's a slight chance may cause issue for the list iterator when the descriptor is reused by another thread without it being deleted from the list.(CVE-2024-40956)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: prevent possible NULL dereference in rt6_probe()
syzbot caught a NULL dereference in rt6_probe() [1]
Bail out if __in6_dev_get() returns NULL.
[1] Oops: general protection fault, probably for non-canonical address 0xdffffc00000000cb: 0000 [#1] PREEMPT SMP KASAN PTI KASAN: null-ptr-deref in range [0x0000000000000658-0x000000000000065f] CPU: 1 PID: 22444 Comm: syz-executor.0 Not tainted 6.10.0-rc2-syzkaller-00383-gb8481381d4e2 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024 RIP: 0010:rt6_probe net/ipv6/route.c:656 [inline] RIP: 0010:find_match+0x8c4/0xf50 net/ipv6/route.c:758 Code: 14 fd f7 48 8b 85 38 ff ff ff 48 c7 45 b0 00 00 00 00 48 8d b8 5c 06 00 00 48 b8 00 00 00 00 00 fc ff df 48 89 fa 48 c1 ea 03 <0f> b6 14 02 48 89 f8 83 e0 07 83 c0 03 38 d0 7c 08 84 d2 0f 85 19 RSP: 0018:ffffc900034af070 EFLAGS: 00010203 RAX: dffffc0000000000 RBX: 0000000000000000 RCX: ffffc90004521000 RDX: 00000000000000cb RSI: ffffffff8990d0cd RDI: 000000000000065c RBP: ffffc900034af150 R08: 0000000000000005 R09: 0000000000000000 R10: 0000000000000001 R11: 0000000000000002 R12: 000000000000000a R13: 1ffff92000695e18 R14: ffff8880244a1d20 R15: 0000000000000000 FS: 00007f4844a5a6c0(0000) GS:ffff8880b9300000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000001b31b27000 CR3: 000000002d42c000 CR4: 00000000003506f0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> rt6_nh_find_match+0xfa/0x1a0 net/ipv6/route.c:784 nexthop_for_each_fib6_nh+0x26d/0x4a0 net/ipv4/nexthop.c:1496 __find_rr_leaf+0x6e7/0xe00 net/ipv6/route.c:825 find_rr_leaf net/ipv6/route.c:853 [inline] rt6_select net/ipv6/route.c:897 [inline] fib6_table_lookup+0x57e/0xa30 net/ipv6/route.c:2195 ip6_pol_route+0x1cd/0x1150 net/ipv6/route.c:2231 pol_lookup_func include/net/ip6_fib.h:616 [inline] fib6_rule_lookup+0x386/0x720 net/ipv6/fib6_rules.c:121 ip6_route_output_flags_noref net/ipv6/route.c:2639 [inline] ip6_route_output_flags+0x1d0/0x640 net/ipv6/route.c:2651 ip6_dst_lookup_tail.constprop.0+0x961/0x1760 net/ipv6/ip6_output.c:1147 ip6_dst_lookup_flow+0x99/0x1d0 net/ipv6/ip6_output.c:1250 rawv6_sendmsg+0xdab/0x4340 net/ipv6/raw.c:898 inet_sendmsg+0x119/0x140 net/ipv4/af_inet.c:853 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg net/socket.c:745 [inline] sock_write_iter+0x4b8/0x5c0 net/socket.c:1160 new_sync_write fs/read_write.c:497 [inline] vfs_write+0x6b6/0x1140 fs/read_write.c:590 ksys_write+0x1f8/0x260 fs/read_write.c:643 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcd/0x250 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-40960)
In the Linux kernel, the following vulnerability has been resolved:
serial: imx: Introduce timeout when waiting on transmitter empty
By waiting at most 1 second for USR2_TXDC to be set, we avoid a potential deadlock.
In case of the timeout, there is not much we can do, so we simply ignore the transmitter state and optimistically try to continue.(CVE-2024-40967)
In the Linux kernel, the following vulnerability has been resolved:
ext4: do not create EA inode under buffer lock
ext4_xattr_set_entry() creates new EA inodes while holding buffer lock on the external xattr block. This is problematic as it nests all the allocation locking (which acquires locks on other buffers) under the buffer lock. This can even deadlock when the filesystem is corrupted and e.g. quota file is setup to contain xattr block as data block. Move the allocation of EA inode out of ext4_xattr_set_entry() into the callers.(CVE-2024-40972)
In the Linux kernel, the following vulnerability has been resolved:
drop_monitor: replace spin_lock by raw_spin_lock
trace_drop_common() is called with preemption disabled, and it acquires a spin_lock. This is problematic for RT kernels because spin_locks are sleeping locks in this configuration, which causes the following splat:
BUG: sleeping function called from invalid context at kernel/locking/spinlock_rt.c:48 in_atomic(): 1, irqs_disabled(): 1, non_block: 0, pid: 449, name: rcuc/47 preempt_count: 1, expected: 0 RCU nest depth: 2, expected: 2 5 locks held by rcuc/47/449: #0: ff1100086ec30a60 ((softirq_ctrl.lock)){+.+.}-{2:2}, at: __local_bh_disable_ip+0x105/0x210 #1: ffffffffb394a280 (rcu_read_lock){....}-{1:2}, at: rt_spin_lock+0xbf/0x130 #2: ffffffffb394a280 (rcu_read_lock){....}-{1:2}, at: __local_bh_disable_ip+0x11c/0x210 #3: ffffffffb394a160 (rcu_callback){....}-{0:0}, at: rcu_do_batch+0x360/0xc70 #4: ff1100086ee07520 (&data->lock){+.+.}-{2:2}, at: trace_drop_common.constprop.0+0xb5/0x290 irq event stamp: 139909 hardirqs last enabled at (139908): [<ffffffffb1df2b33>] _raw_spin_unlock_irqrestore+0x63/0x80 hardirqs last disabled at (139909): [<ffffffffb19bd03d>] trace_drop_common.constprop.0+0x26d/0x290 softirqs last enabled at (139892): [<ffffffffb07a1083>] __local_bh_enable_ip+0x103/0x170 softirqs last disabled at (139898): [<ffffffffb0909b33>] rcu_cpu_kthread+0x93/0x1f0 Preemption disabled at: [<ffffffffb1de786b>] rt_mutex_slowunlock+0xab/0x2e0 CPU: 47 PID: 449 Comm: rcuc/47 Not tainted 6.9.0-rc2-rt1+ #7 Hardware name: Dell Inc. PowerEdge R650/0Y2G81, BIOS 1.6.5 04/15/2022 Call Trace: <TASK> dump_stack_lvl+0x8c/0xd0 dump_stack+0x14/0x20 __might_resched+0x21e/0x2f0 rt_spin_lock+0x5e/0x130 ? trace_drop_common.constprop.0+0xb5/0x290 ? skb_queue_purge_reason.part.0+0x1bf/0x230 trace_drop_common.constprop.0+0xb5/0x290 ? preempt_count_sub+0x1c/0xd0 ? _raw_spin_unlock_irqrestore+0x4a/0x80 ? __pfx_trace_drop_common.constprop.0+0x10/0x10 ? rt_mutex_slowunlock+0x26a/0x2e0 ? skb_queue_purge_reason.part.0+0x1bf/0x230 ? __pfx_rt_mutex_slowunlock+0x10/0x10 ? skb_queue_purge_reason.part.0+0x1bf/0x230 trace_kfree_skb_hit+0x15/0x20 trace_kfree_skb+0xe9/0x150 kfree_skb_reason+0x7b/0x110 skb_queue_purge_reason.part.0+0x1bf/0x230 ? __pfx_skb_queue_purge_reason.part.0+0x10/0x10 ? mark_lock.part.0+0x8a/0x520 ...
trace_drop_common() also disables interrupts, but this is a minor issue because we could easily replace it with a local_lock.
Replace the spin_lock with raw_spin_lock to avoid sleeping in atomic context.(CVE-2024-40980)
In the Linux kernel, the following vulnerability has been resolved:
batman-adv: bypass empty buckets in batadv_purge_orig_ref()
Many syzbot reports are pointing to soft lockups in batadv_purge_orig_ref() [1]
Root cause is unknown, but we can avoid spending too much time there and perhaps get more interesting reports.
[1]
watchdog: BUG: soft lockup - CPU#0 stuck for 27s! [kworker/u4:6:621] Modules linked in: irq event stamp: 6182794 hardirqs last enabled at (6182793): [<ffff8000801dae10>] __local_bh_enable_ip+0x224/0x44c kernel/softirq.c:386 hardirqs last disabled at (6182794): [<ffff80008ad66a78>] __el1_irq arch/arm64/kernel/entry-common.c:533 [inline] hardirqs last disabled at (6182794): [<ffff80008ad66a78>] el1_interrupt+0x24/0x68 arch/arm64/kernel/entry-common.c:551 softirqs last enabled at (6182792): [<ffff80008aab71c4>] spin_unlock_bh include/linux/spinlock.h:396 [inline] softirqs last enabled at (6182792): [<ffff80008aab71c4>] batadv_purge_orig_ref+0x114c/0x1228 net/batman-adv/originator.c:1287 softirqs last disabled at (6182790): [<ffff80008aab61dc>] spin_lock_bh include/linux/spinlock.h:356 [inline] softirqs last disabled at (6182790): [<ffff80008aab61dc>] batadv_purge_orig_ref+0x164/0x1228 net/batman-adv/originator.c:1271 CPU: 0 PID: 621 Comm: kworker/u4:6 Not tainted 6.8.0-rc7-syzkaller-g707081b61156 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/29/2024 Workqueue: bat_events batadv_purge_orig pstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--) pc : should_resched arch/arm64/include/asm/preempt.h:79 [inline] pc : __local_bh_enable_ip+0x228/0x44c kernel/softirq.c:388 lr : __local_bh_enable_ip+0x224/0x44c kernel/softirq.c:386 sp : ffff800099007970 x29: ffff800099007980 x28: 1fffe00018fce1bd x27: dfff800000000000 x26: ffff0000d2620008 x25: ffff0000c7e70de8 x24: 0000000000000001 x23: 1fffe00018e57781 x22: dfff800000000000 x21: ffff80008aab71c4 x20: ffff0001b40136c0 x19: ffff0000c72bbc08 x18: 1fffe0001a817bb0 x17: ffff800125414000 x16: ffff80008032116c x15: 0000000000000001 x14: 1fffe0001ee9d610 x13: 0000000000000000 x12: 0000000000000003 x11: 0000000000000000 x10: 0000000000ff0100 x9 : 0000000000000000 x8 : 00000000005e5789 x7 : ffff80008aab61dc x6 : 0000000000000000 x5 : 0000000000000000 x4 : 0000000000000001 x3 : 0000000000000000 x2 : 0000000000000006 x1 : 0000000000000080 x0 : ffff800125414000 Call trace: __daif_local_irq_enable arch/arm64/include/asm/irqflags.h:27 [inline] arch_local_irq_enable arch/arm64/include/asm/irqflags.h:49 [inline] __local_bh_enable_ip+0x228/0x44c kernel/softirq.c:386 __raw_spin_unlock_bh include/linux/spinlock_api_smp.h:167 [inline] _raw_spin_unlock_bh+0x3c/0x4c kernel/locking/spinlock.c:210 spin_unlock_bh include/linux/spinlock.h:396 [inline] batadv_purge_orig_ref+0x114c/0x1228 net/batman-adv/originator.c:1287 batadv_purge_orig+0x20/0x70 net/batman-adv/originator.c:1300 process_one_work+0x694/0x1204 kernel/workqueue.c:2633 process_scheduled_works kernel/workqueue.c:2706 [inline] worker_thread+0x938/0xef4 kernel/workqueue.c:2787 kthread+0x288/0x310 kernel/kthread.c:388 ret_from_fork+0x10/0x20 arch/arm64/kernel/entry.S:860 Sending NMI from CPU 0 to CPUs 1: NMI backtrace for cpu 1 CPU: 1 PID: 0 Comm: swapper/1 Not tainted 6.8.0-rc7-syzkaller-g707081b61156 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/29/2024 pstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--) pc : arch_local_irq_enable+0x8/0xc arch/arm64/include/asm/irqflags.h:51 lr : default_idle_call+0xf8/0x128 kernel/sched/idle.c:103 sp : ffff800093a17d30 x29: ffff800093a17d30 x28: dfff800000000000 x27: 1ffff00012742fb4 x26: ffff80008ec9d000 x25: 0000000000000000 x24: 0000000000000002 x23: 1ffff00011d93a74 x22: ffff80008ec9d3a0 x21: 0000000000000000 x20: ffff0000c19dbc00 x19: ffff8000802d0fd8 x18: 1fffe00036804396 x17: ffff80008ec9d000 x16: ffff8000802d089c x15: 0000000000000001 ---truncated---(CVE-2024-40981)
In the Linux kernel, the following vulnerability has been resolved:
net/sched: act_api: fix possible infinite loop in tcf_idr_check_alloc()
syzbot found hanging tasks waiting on rtnl_lock [1]
A reproducer is available in the syzbot bug.
When a request to add multiple actions with the same index is sent, the second request will block forever on the first request. This holds rtnl_lock, and causes tasks to hang.
Return -EAGAIN to prevent infinite looping, while keeping documented behavior.
[1]
INFO: task kworker/1:0:5088 blocked for more than 143 seconds. Not tainted 6.9.0-rc4-syzkaller-00173-g3cdb45594619 #0 "echo 0 > /proc/sys/kernel/hung_task_timeout_secs" disables this message. task:kworker/1:0 state:D stack:23744 pid:5088 tgid:5088 ppid:2 flags:0x00004000 Workqueue: events_power_efficient reg_check_chans_work Call Trace: <TASK> context_switch kernel/sched/core.c:5409 [inline] __schedule+0xf15/0x5d00 kernel/sched/core.c:6746 __schedule_loop kernel/sched/core.c:6823 [inline] schedule+0xe7/0x350 kernel/sched/core.c:6838 schedule_preempt_disabled+0x13/0x30 kernel/sched/core.c:6895 __mutex_lock_common kernel/locking/mutex.c:684 [inline] __mutex_lock+0x5b8/0x9c0 kernel/locking/mutex.c:752 wiphy_lock include/net/cfg80211.h:5953 [inline] reg_leave_invalid_chans net/wireless/reg.c:2466 [inline] reg_check_chans_work+0x10a/0x10e0 net/wireless/reg.c:2481(CVE-2024-40995)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdkfd: don't allow mapping the MMIO HDP page with large pages
We don't get the right offset in that case. The GPU has an unused 4K area of the register BAR space into which you can remap registers. We remap the HDP flush registers into this space to allow userspace (CPU or GPU) to flush the HDP when it updates VRAM. However, on systems with >4K pages, we end up exposing PAGE_SIZE of MMIO space.(CVE-2024-41011)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"python3-perf-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-debugsource-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-source-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-tools-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-headers-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-tools-devel-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"perf-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-devel-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-debuginfo-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"perf-debuginfo-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm"
],
"src": [
"kernel-5.10.0-136.87.0.168.oe2203sp1.src.rpm"
],
"x86_64": [
"python3-perf-debuginfo-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-devel-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"perf-debuginfo-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"perf-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-debuginfo-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-source-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-headers-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-tools-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-tools-devel-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"python3-perf-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-debugsource-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-136.87.0.168.oe2203sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: sunxi-ng: Unregister clocks/resets when unbinding\r\n\r\nCurrently, unbinding a CCU driver unmaps the device\u0026apos;s MMIO region, while\nleaving its clocks/resets and their providers registered. This can cause\na page fault later when some clock operation tries to perform MMIO. Fix\nthis by separating the CCU initialization from the memory allocation,\nand then using a devres callback to unregister the clocks and resets.\r\n\r\nThis also fixes a memory leak of the `struct ccu_reset`, and uses the\ncorrect owner (the specific platform driver) for the clocks and resets.\r\n\r\nEarly OF clock providers are never unregistered, and limited error\nhandling is possible, so they are mostly unchanged. The error reporting\nis made more consistent by moving the message inside of_sunxi_ccu_probe.(CVE-2021-47205)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nthermal/int340x_thermal: handle data_vault when the value is ZERO_SIZE_PTR\r\n\r\nIn some case, the GDDV returns a package with a buffer which has\nzero length. It causes that kmemdup() returns ZERO_SIZE_PTR (0x10).\r\n\r\nThen the data_vault_read() got NULL point dereference problem when\naccessing the 0x10 value in data_vault.\r\n\r\n[ 71.024560] BUG: kernel NULL pointer dereference, address:\n0000000000000010\r\n\r\nThis patch uses ZERO_OR_NULL_PTR() for checking ZERO_SIZE_PTR or\nNULL value in data_vault.(CVE-2022-48703)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/smc: Avoid overwriting the copies of clcsock callback functions\r\n\r\nThe callback functions of clcsock will be saved and replaced during\nthe fallback. But if the fallback happens more than once, then the\ncopies of these callback functions will be overwritten incorrectly,\nresulting in a loop call issue:\r\n\r\nclcsk-\u0026gt;sk_error_report\n |- smc_fback_error_report() \u0026lt;------------------------------|\n |- smc_fback_forward_wakeup() | (loop)\n |- clcsock_callback() (incorrectly overwritten) |\n |- smc-\u0026gt;clcsk_error_report() ------------------|\r\n\r\nSo this patch fixes the issue by saving these function pointers only\nonce in the fallback and avoiding overwriting.(CVE-2022-48780)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr\r\n\r\nThis node pointer is returned by of_find_compatible_node() with\nrefcount incremented. Calling of_node_put() to aovid the refcount leak.(CVE-2022-48859)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nof: Fix double free in of_parse_phandle_with_args_map\r\n\r\nIn of_parse_phandle_with_args_map() the inner loop that\niterates through the map entries calls of_node_put(new)\nto free the reference acquired by the previous iteration\nof the inner loop. This assumes that the value of \u0026quot;new\u0026quot; is\nNULL on the first iteration of the inner loop.\r\n\r\nMake sure that this is true in all iterations of the outer\nloop by setting \u0026quot;new\u0026quot; to NULL after its value is assigned to \u0026quot;cur\u0026quot;.\r\n\r\nExtend the unittest to detect the double free and add an additional\ntest case that actually triggers this path.(CVE-2023-52679)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nft_set_pipapo: do not free live element\r\n\r\nPablo reports a crash with large batches of elements with a\nback-to-back add/remove pattern. Quoting Pablo:\r\n\r\n add_elem(\u0026quot;00000000\u0026quot;) timeout 100 ms\n ...\n add_elem(\u0026quot;0000000X\u0026quot;) timeout 100 ms\n del_elem(\u0026quot;0000000X\u0026quot;) \u0026lt;---------------- delete one that was just added\n ...\n add_elem(\u0026quot;00005000\u0026quot;) timeout 100 ms\r\n\r\n 1) nft_pipapo_remove() removes element 0000000X\n Then, KASAN shows a splat.\r\n\r\nLooking at the remove function there is a chance that we will drop a\nrule that maps to a non-deactivated element.\r\n\r\nRemoval happens in two steps, first we do a lookup for key k and return the\nto-be-removed element and mark it as inactive in the next generation.\nThen, in a second step, the element gets removed from the set/map.\r\n\r\nThe _remove function does not work correctly if we have more than one\nelement that share the same key.\r\n\r\nThis can happen if we insert an element into a set when the set already\nholds an element with same key, but the element mapping to the existing\nkey has timed out or is not active in the next generation.\r\n\r\nIn such case its possible that removal will unmap the wrong element.\nIf this happens, we will leak the non-deactivated element, it becomes\nunreachable.\r\n\r\nThe element that got deactivated (and will be freed later) will\nremain reachable in the set data structure, this can result in\na crash when such an element is retrieved during lookup (stale\npointer).\r\n\r\nAdd a check that the fully matching key does in fact map to the element\nthat we have marked as inactive in the deactivation step.\nIf not, we need to continue searching.\r\n\r\nAdd a bug/warn trap at the end of the function as well, the remove\nfunction must not ever be called with an invisible/unreachable/non-existent\nelement.\r\n\r\nv2: avoid uneeded temporary variable (Stefano)(CVE-2024-26924)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nf_tables: release mutex after nft_gc_seq_end from abort path\r\n\r\nThe commit mutex should not be released during the critical section\nbetween nft_gc_seq_begin() and nft_gc_seq_end(), otherwise, async GC\nworker could collect expired objects and get the released commit lock\nwithin the same GC sequence.\r\n\r\nnf_tables_module_autoload() temporarily releases the mutex to load\nmodule dependencies, then it goes back to replay the transaction again.\nMove it at the end of the abort phase after nft_gc_seq_end() is called.(CVE-2024-26925)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/sched: Fix mirred deadlock on device recursion\r\n\r\nWhen the mirred action is used on a classful egress qdisc and a packet is\nmirrored or redirected to self we hit a qdisc lock deadlock.\nSee trace below.\r\n\r\n[..... other info removed for brevity....]\n[ 82.890906]\n[ 82.890906] ============================================\n[ 82.890906] WARNING: possible recursive locking detected\n[ 82.890906] 6.8.0-05205-g77fadd89fe2d-dirty #213 Tainted: G W\n[ 82.890906] --------------------------------------------\n[ 82.890906] ping/418 is trying to acquire lock:\n[ 82.890906] ffff888006994110 (\u0026amp;sch-\u0026gt;q.lock){+.-.}-{3:3}, at:\n__dev_queue_xmit+0x1778/0x3550\n[ 82.890906]\n[ 82.890906] but task is already holding lock:\n[ 82.890906] ffff888006994110 (\u0026amp;sch-\u0026gt;q.lock){+.-.}-{3:3}, at:\n__dev_queue_xmit+0x1778/0x3550\n[ 82.890906]\n[ 82.890906] other info that might help us debug this:\n[ 82.890906] Possible unsafe locking scenario:\n[ 82.890906]\n[ 82.890906] CPU0\n[ 82.890906] ----\n[ 82.890906] lock(\u0026amp;sch-\u0026gt;q.lock);\n[ 82.890906] lock(\u0026amp;sch-\u0026gt;q.lock);\n[ 82.890906]\n[ 82.890906] *** DEADLOCK ***\n[ 82.890906]\n[..... other info removed for brevity....]\r\n\r\nExample setup (eth0-\u0026gt;eth0) to recreate\ntc qdisc add dev eth0 root handle 1: htb default 30\ntc filter add dev eth0 handle 1: protocol ip prio 2 matchall \\\n action mirred egress redirect dev eth0\r\n\r\nAnother example(eth0-\u0026gt;eth1-\u0026gt;eth0) to recreate\ntc qdisc add dev eth0 root handle 1: htb default 30\ntc filter add dev eth0 handle 1: protocol ip prio 2 matchall \\\n action mirred egress redirect dev eth1\r\n\r\ntc qdisc add dev eth1 root handle 1: htb default 30\ntc filter add dev eth1 handle 1: protocol ip prio 2 matchall \\\n action mirred egress redirect dev eth0\r\n\r\nWe fix this by adding an owner field (CPU id) to struct Qdisc set after\nroot qdisc is entered. When the softirq enters it a second time, if the\nqdisc owner is the same CPU, the packet is dropped to break the loop.(CVE-2024-27010)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndma-mapping: benchmark: fix node id validation\r\n\r\nWhile validating node ids in map_benchmark_ioctl(), node_possible() may\nbe provided with invalid argument outside of [0,MAX_NUMNODES-1] range\nleading to:\r\n\r\nBUG: KASAN: wild-memory-access in map_benchmark_ioctl (kernel/dma/map_benchmark.c:214)\nRead of size 8 at addr 1fffffff8ccb6398 by task dma_map_benchma/971\nCPU: 7 PID: 971 Comm: dma_map_benchma Not tainted 6.9.0-rc6 #37\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996)\nCall Trace:\n \u0026lt;TASK\u0026gt;\ndump_stack_lvl (lib/dump_stack.c:117)\nkasan_report (mm/kasan/report.c:603)\nkasan_check_range (mm/kasan/generic.c:189)\nvariable_test_bit (arch/x86/include/asm/bitops.h:227) [inline]\narch_test_bit (arch/x86/include/asm/bitops.h:239) [inline]\n_test_bit at (include/asm-generic/bitops/instrumented-non-atomic.h:142) [inline]\nnode_state (include/linux/nodemask.h:423) [inline]\nmap_benchmark_ioctl (kernel/dma/map_benchmark.c:214)\nfull_proxy_unlocked_ioctl (fs/debugfs/file.c:333)\n__x64_sys_ioctl (fs/ioctl.c:890)\ndo_syscall_64 (arch/x86/entry/common.c:83)\nentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\nCompare node ids with sane bounds first. NUMA_NO_NODE is considered a\nspecial valid case meaning that benchmarking kthreads won\u0026apos;t be bound to a\ncpuset of a given node.\r\n\r\nFound by Linux Verification Center (linuxtesting.org).(CVE-2024-34777)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmd/dm-raid: don\u0026apos;t call md_reap_sync_thread() directly\r\n\r\nCurrently md_reap_sync_thread() is called from raid_message() directly\nwithout holding \u0026apos;reconfig_mutex\u0026apos;, this is definitely unsafe because\nmd_reap_sync_thread() can change many fields that is protected by\n\u0026apos;reconfig_mutex\u0026apos;.\r\n\r\nHowever, hold \u0026apos;reconfig_mutex\u0026apos; here is still problematic because this\nwill cause deadlock, for example, commit 130443d60b1b (\u0026quot;md: refactor\nidle/frozen_sync_thread() to fix deadlock\u0026quot;).\r\n\r\nFix this problem by using stop_sync_thread() to unregister sync_thread,\nlike md/raid did.(CVE-2024-35808)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: mvpp2: clear BM pool before initialization\r\n\r\nRegister value persist after booting the kernel using\nkexec which results in kernel panic. Thus clear the\nBM pool registers before initialisation to fix the issue.(CVE-2024-35837)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nf_tables: flush pending destroy work before exit_net release\r\n\r\nSimilar to 2c9f0293280e (\u0026quot;netfilter: nf_tables: flush pending destroy\nwork before netlink notifier\u0026quot;) to address a race between exit_net and\nthe destroy workqueue.\r\n\r\nThe trace below shows an element to be released via destroy workqueue\nwhile exit_net path (triggered via module removal) has already released\nthe set that is used in such transaction.\r\n\r\n[ 1360.547789] BUG: KASAN: slab-use-after-free in nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables]\n[ 1360.547861] Read of size 8 at addr ffff888140500cc0 by task kworker/4:1/152465\n[ 1360.547870] CPU: 4 PID: 152465 Comm: kworker/4:1 Not tainted 6.8.0+ #359\n[ 1360.547882] Workqueue: events nf_tables_trans_destroy_work [nf_tables]\n[ 1360.547984] Call Trace:\n[ 1360.547991] \u0026lt;TASK\u0026gt;\n[ 1360.547998] dump_stack_lvl+0x53/0x70\n[ 1360.548014] print_report+0xc4/0x610\n[ 1360.548026] ? __virt_addr_valid+0xba/0x160\n[ 1360.548040] ? __pfx__raw_spin_lock_irqsave+0x10/0x10\n[ 1360.548054] ? nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables]\n[ 1360.548176] kasan_report+0xae/0xe0\n[ 1360.548189] ? nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables]\n[ 1360.548312] nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables]\n[ 1360.548447] ? __pfx_nf_tables_trans_destroy_work+0x10/0x10 [nf_tables]\n[ 1360.548577] ? _raw_spin_unlock_irq+0x18/0x30\n[ 1360.548591] process_one_work+0x2f1/0x670\n[ 1360.548610] worker_thread+0x4d3/0x760\n[ 1360.548627] ? __pfx_worker_thread+0x10/0x10\n[ 1360.548640] kthread+0x16b/0x1b0\n[ 1360.548653] ? __pfx_kthread+0x10/0x10\n[ 1360.548665] ret_from_fork+0x2f/0x50\n[ 1360.548679] ? __pfx_kthread+0x10/0x10\n[ 1360.548690] ret_from_fork_asm+0x1a/0x30\n[ 1360.548707] \u0026lt;/TASK\u0026gt;\r\n\r\n[ 1360.548719] Allocated by task 192061:\n[ 1360.548726] kasan_save_stack+0x20/0x40\n[ 1360.548739] kasan_save_track+0x14/0x30\n[ 1360.548750] __kasan_kmalloc+0x8f/0xa0\n[ 1360.548760] __kmalloc_node+0x1f1/0x450\n[ 1360.548771] nf_tables_newset+0x10c7/0x1b50 [nf_tables]\n[ 1360.548883] nfnetlink_rcv_batch+0xbc4/0xdc0 [nfnetlink]\n[ 1360.548909] nfnetlink_rcv+0x1a8/0x1e0 [nfnetlink]\n[ 1360.548927] netlink_unicast+0x367/0x4f0\n[ 1360.548935] netlink_sendmsg+0x34b/0x610\n[ 1360.548944] ____sys_sendmsg+0x4d4/0x510\n[ 1360.548953] ___sys_sendmsg+0xc9/0x120\n[ 1360.548961] __sys_sendmsg+0xbe/0x140\n[ 1360.548971] do_syscall_64+0x55/0x120\n[ 1360.548982] entry_SYSCALL_64_after_hwframe+0x55/0x5d\r\n\r\n[ 1360.548994] Freed by task 192222:\n[ 1360.548999] kasan_save_stack+0x20/0x40\n[ 1360.549009] kasan_save_track+0x14/0x30\n[ 1360.549019] kasan_save_free_info+0x3b/0x60\n[ 1360.549028] poison_slab_object+0x100/0x180\n[ 1360.549036] __kasan_slab_free+0x14/0x30\n[ 1360.549042] kfree+0xb6/0x260\n[ 1360.549049] __nft_release_table+0x473/0x6a0 [nf_tables]\n[ 1360.549131] nf_tables_exit_net+0x170/0x240 [nf_tables]\n[ 1360.549221] ops_exit_list+0x50/0xa0\n[ 1360.549229] free_exit_list+0x101/0x140\n[ 1360.549236] unregister_pernet_operations+0x107/0x160\n[ 1360.549245] unregister_pernet_subsys+0x1c/0x30\n[ 1360.549254] nf_tables_module_exit+0x43/0x80 [nf_tables]\n[ 1360.549345] __do_sys_delete_module+0x253/0x370\n[ 1360.549352] do_syscall_64+0x55/0x120\n[ 1360.549360] entry_SYSCALL_64_after_hwframe+0x55/0x5d\r\n\r\n(gdb) list *__nft_release_table+0x473\n0x1e033 is in __nft_release_table (net/netfilter/nf_tables_api.c:11354).\n11349 list_for_each_entry_safe(flowtable, nf, \u0026amp;table-\u0026gt;flowtables, list) {\n11350 list_del(\u0026amp;flowtable-\u0026gt;list);\n11351 nft_use_dec(\u0026amp;table-\u0026gt;use);\n11352 nf_tables_flowtable_destroy(flowtable);\n11353 }\n11354 list_for_each_entry_safe(set, ns, \u0026amp;table-\u0026gt;sets, list) {\n11355 list_del(\u0026amp;set-\u0026gt;list);\n11356 nft_use_dec(\u0026amp;table-\u0026gt;use);\n11357 if (set-\u0026gt;flags \u0026amp; (NFT_SET_MAP | NFT_SET_OBJECT))\n11358 nft_map_deactivat\n---truncated---(CVE-2024-35899)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu: Skip do PCI error slot reset during RAS recovery\r\n\r\nWhy:\n The PCI error slot reset maybe triggered after inject ue to UMC multi times, this\n caused system hang.\n [ 557.371857] amdgpu 0000:af:00.0: amdgpu: GPU reset succeeded, trying to resume\n [ 557.373718] [drm] PCIE GART of 512M enabled.\n [ 557.373722] [drm] PTB located at 0x0000031FED700000\n [ 557.373788] [drm] VRAM is lost due to GPU reset!\n [ 557.373789] [drm] PSP is resuming...\n [ 557.547012] mlx5_core 0000:55:00.0: mlx5_pci_err_detected Device state = 1 pci_status: 0. Exit, result = 3, need reset\n [ 557.547067] [drm] PCI error: detected callback, state(1)!!\n [ 557.547069] [drm] No support for XGMI hive yet...\n [ 557.548125] mlx5_core 0000:55:00.0: mlx5_pci_slot_reset Device state = 1 pci_status: 0. Enter\n [ 557.607763] mlx5_core 0000:55:00.0: wait vital counter value 0x16b5b after 1 iterations\n [ 557.607777] mlx5_core 0000:55:00.0: mlx5_pci_slot_reset Device state = 1 pci_status: 1. Exit, err = 0, result = 5, recovered\n [ 557.610492] [drm] PCI error: slot reset callback!!\n ...\n [ 560.689382] amdgpu 0000:3f:00.0: amdgpu: GPU reset(2) succeeded!\n [ 560.689546] amdgpu 0000:5a:00.0: amdgpu: GPU reset(2) succeeded!\n [ 560.689562] general protection fault, probably for non-canonical address 0x5f080b54534f611f: 0000 [#1] SMP NOPTI\n [ 560.701008] CPU: 16 PID: 2361 Comm: kworker/u448:9 Tainted: G OE 5.15.0-91-generic #101-Ubuntu\n [ 560.712057] Hardware name: Microsoft C278A/C278A, BIOS C2789.5.BS.1C11.AG.1 11/08/2023\n [ 560.720959] Workqueue: amdgpu-reset-hive amdgpu_ras_do_recovery [amdgpu]\n [ 560.728887] RIP: 0010:amdgpu_device_gpu_recover.cold+0xbf1/0xcf5 [amdgpu]\n [ 560.736891] Code: ff 41 89 c6 e9 1b ff ff ff 44 0f b6 45 b0 e9 4f ff ff ff be 01 00 00 00 4c 89 e7 e8 76 c9 8b ff 44 0f b6 45 b0 e9 3c fd ff ff \u0026lt;48\u0026gt; 83 ba 18 02 00 00 00 0f 84 6a f8 ff ff 48 8d 7a 78 be 01 00 00\n [ 560.757967] RSP: 0018:ffa0000032e53d80 EFLAGS: 00010202\n [ 560.763848] RAX: ffa00000001dfd10 RBX: ffa0000000197090 RCX: ffa0000032e53db0\n [ 560.771856] RDX: 5f080b54534f5f07 RSI: 0000000000000000 RDI: ff11000128100010\n [ 560.779867] RBP: ffa0000032e53df0 R08: 0000000000000000 R09: ffffffffffe77f08\n [ 560.787879] R10: 0000000000ffff0a R11: 0000000000000001 R12: 0000000000000000\n [ 560.795889] R13: ffa0000032e53e00 R14: 0000000000000000 R15: 0000000000000000\n [ 560.803889] FS: 0000000000000000(0000) GS:ff11007e7e800000(0000) knlGS:0000000000000000\n [ 560.812973] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n [ 560.819422] CR2: 000055a04c118e68 CR3: 0000000007410005 CR4: 0000000000771ee0\n [ 560.827433] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n [ 560.835433] DR3: 0000000000000000 DR6: 00000000fffe07f0 DR7: 0000000000000400\n [ 560.843444] PKRU: 55555554\n [ 560.846480] Call Trace:\n [ 560.849225] \u0026lt;TASK\u0026gt;\n [ 560.851580] ? show_trace_log_lvl+0x1d6/0x2ea\n [ 560.856488] ? show_trace_log_lvl+0x1d6/0x2ea\n [ 560.861379] ? amdgpu_ras_do_recovery+0x1b2/0x210 [amdgpu]\n [ 560.867778] ? show_regs.part.0+0x23/0x29\n [ 560.872293] ? __die_body.cold+0x8/0xd\n [ 560.876502] ? die_addr+0x3e/0x60\n [ 560.880238] ? exc_general_protection+0x1c5/0x410\n [ 560.885532] ? asm_exc_general_protection+0x27/0x30\n [ 560.891025] ? amdgpu_device_gpu_recover.cold+0xbf1/0xcf5 [amdgpu]\n [ 560.898323] amdgpu_ras_do_recovery+0x1b2/0x210 [amdgpu]\n [ 560.904520] process_one_work+0x228/0x3d0\nHow:\n In RAS recovery, mode-1 reset is issued from RAS fatal error handling and expected\n all the nodes in a hive to be reset. no need to issue another mode-1 during this procedure.(CVE-2024-35931)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/9p: fix uninitialized values during inode evict\r\n\r\nIf an iget fails due to not being able to retrieve information\nfrom the server then the inode structure is only partially\ninitialized. When the inode gets evicted, references to\nuninitialized structures (like fscache cookies) were being\nmade.\r\n\r\nThis patch checks for a bad_inode before doing anything other\nthan clearing the inode from the cache. Since the inode is\nbad, it shouldn\u0026apos;t have any state associated with it that needs\nto be written back (and there really isn\u0026apos;t a way to complete\nthose anyways).(CVE-2024-36923)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: fix potential kernel bug due to lack of writeback flag waiting\r\n\r\nDestructive writes to a block device on which nilfs2 is mounted can cause\na kernel bug in the folio/page writeback start routine or writeback end\nroutine (__folio_start_writeback in the log below):\r\n\r\n kernel BUG at mm/page-writeback.c:3070!\n Oops: invalid opcode: 0000 [#1] PREEMPT SMP KASAN PTI\n ...\n RIP: 0010:__folio_start_writeback+0xbaa/0x10e0\n Code: 25 ff 0f 00 00 0f 84 18 01 00 00 e8 40 ca c6 ff e9 17 f6 ff ff\n e8 36 ca c6 ff 4c 89 f7 48 c7 c6 80 c0 12 84 e8 e7 b3 0f 00 90 \u0026lt;0f\u0026gt;\n 0b e8 1f ca c6 ff 4c 89 f7 48 c7 c6 a0 c6 12 84 e8 d0 b3 0f 00\n ...\n Call Trace:\n \u0026lt;TASK\u0026gt;\n nilfs_segctor_do_construct+0x4654/0x69d0 [nilfs2]\n nilfs_segctor_construct+0x181/0x6b0 [nilfs2]\n nilfs_segctor_thread+0x548/0x11c0 [nilfs2]\n kthread+0x2f0/0x390\n ret_from_fork+0x4b/0x80\n ret_from_fork_asm+0x1a/0x30\n \u0026lt;/TASK\u0026gt;\r\n\r\nThis is because when the log writer starts a writeback for segment summary\nblocks or a super root block that use the backing device\u0026apos;s page cache, it\ndoes not wait for the ongoing folio/page writeback, resulting in an\ninconsistent writeback state.\r\n\r\nFix this issue by waiting for ongoing writebacks when putting\nfolios/pages on the backing device into writeback state.(CVE-2024-37078)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm: bridge: cdns-mhdp8546: Fix possible null pointer dereference\r\n\r\nIn cdns_mhdp_atomic_enable(), the return value of drm_mode_duplicate() is\nassigned to mhdp_state-\u0026gt;current_mode, and there is a dereference of it in\ndrm_mode_set_name(), which will lead to a NULL pointer dereference on\nfailure of drm_mode_duplicate().\r\n\r\nFix this bug add a check of mhdp_state-\u0026gt;current_mode.(CVE-2024-38548)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: carl9170: add a proper sanity check for endpoints\r\n\r\nSyzkaller reports [1] hitting a warning which is caused by presence\nof a wrong endpoint type at the URB sumbitting stage. While there\nwas a check for a specific 4th endpoint, since it can switch types\nbetween bulk and interrupt, other endpoints are trusted implicitly.\nSimilar warning is triggered in a couple of other syzbot issues [2].\r\n\r\nFix the issue by doing a comprehensive check of all endpoints\ntaking into account difference between high- and full-speed\nconfiguration.\r\n\r\n[1] Syzkaller report:\n...\nWARNING: CPU: 0 PID: 4721 at drivers/usb/core/urb.c:504 usb_submit_urb+0xed6/0x1880 drivers/usb/core/urb.c:504\n...\nCall Trace:\n \u0026lt;TASK\u0026gt;\n carl9170_usb_send_rx_irq_urb+0x273/0x340 drivers/net/wireless/ath/carl9170/usb.c:504\n carl9170_usb_init_device drivers/net/wireless/ath/carl9170/usb.c:939 [inline]\n carl9170_usb_firmware_finish drivers/net/wireless/ath/carl9170/usb.c:999 [inline]\n carl9170_usb_firmware_step2+0x175/0x240 drivers/net/wireless/ath/carl9170/usb.c:1028\n request_firmware_work_func+0x130/0x240 drivers/base/firmware_loader/main.c:1107\n process_one_work+0x9bf/0x1710 kernel/workqueue.c:2289\n worker_thread+0x669/0x1090 kernel/workqueue.c:2436\n kthread+0x2e8/0x3a0 kernel/kthread.c:376\n ret_from_fork+0x1f/0x30 arch/x86/entry/entry_64.S:308\n \u0026lt;/TASK\u0026gt;\r\n\r\n[2] Related syzkaller crashes:(CVE-2024-38567)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmacintosh/via-macii: Fix \u0026quot;BUG: sleeping function called from invalid context\u0026quot;\r\n\r\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0026apos;t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: i2c: et8ek8: Don\u0026apos;t strip remove function when driver is builtin\r\n\r\nUsing __exit for the remove function results in the remove callback\nbeing discarded with CONFIG_VIDEO_ET8EK8=y. When such a device gets\nunbound (e.g. using sysfs or hotplug), the driver is just removed\nwithout the cleanup being performed. This results in resource leaks. Fix\nit by compiling in the remove callback unconditionally.\r\n\r\nThis also fixes a W=1 modpost warning:\r\n\r\n\tWARNING: modpost: drivers/media/i2c/et8ek8/et8ek8: section mismatch in reference: et8ek8_i2c_driver+0x10 (section: .data) -\u0026gt; et8ek8_remove (section: .exit.text)(CVE-2024-38611)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: stk1160: fix bounds checking in stk1160_copy_video()\r\n\r\nThe subtract in this condition is reversed. The -\u0026gt;length is the length\nof the buffer. The -\u0026gt;bytesused is how many bytes we have copied thus\nfar. When the condition is reversed that means the result of the\nsubtraction is always negative but since it\u0026apos;s unsigned then the result\nis a very high positive value. That means the overflow check is never\ntrue.\r\n\r\nAdditionally, the -\u0026gt;bytesused doesn\u0026apos;t actually work for this purpose\nbecause we\u0026apos;re not writing to \u0026quot;buf-\u0026gt;mem + buf-\u0026gt;bytesused\u0026quot;. Instead, the\nmath to calculate the destination where we are writing is a bit\ninvolved. You calculate the number of full lines already written,\nmultiply by two, skip a line if necessary so that we start on an odd\nnumbered line, and add the offset into the line.\r\n\r\nTo fix this buffer overflow, just take the actual destination where we\nare writing, if the offset is already out of bounds print an error and\nreturn. Otherwise, write up to buf-\u0026gt;length bytes.(CVE-2024-38621)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfbdev: savage: Handle err return when savagefb_check_var failed\r\n\r\nThe commit 04e5eac8f3ab(\u0026quot;fbdev: savage: Error out if pixclock equals zero\u0026quot;)\nchecks the value of pixclock to avoid divide-by-zero error. However\nthe function savagefb_probe doesn\u0026apos;t handle the error return of\nsavagefb_check_var. When pixclock is 0, it will cause divide-by-zero error.(CVE-2024-39475)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmd/raid5: fix deadlock that raid5d() wait for itself to clear MD_SB_CHANGE_PENDING\r\n\r\nXiao reported that lvm2 test lvconvert-raid-takeover.sh can hang with\nsmall possibility, the root cause is exactly the same as commit\nbed9e27baf52 (\u0026quot;Revert \u0026quot;md/raid5: Wait for MD_SB_CHANGE_PENDING in raid5d\u0026quot;\u0026quot;)\r\n\r\nHowever, Dan reported another hang after that, and junxiao investigated\nthe problem and found out that this is caused by plugged bio can\u0026apos;t issue\nfrom raid5d().\r\n\r\nCurrent implementation in raid5d() has a weird dependence:\r\n\r\n1) md_check_recovery() from raid5d() must hold \u0026apos;reconfig_mutex\u0026apos; to clear\n MD_SB_CHANGE_PENDING;\n2) raid5d() handles IO in a deadloop, until all IO are issued;\n3) IO from raid5d() must wait for MD_SB_CHANGE_PENDING to be cleared;\r\n\r\nThis behaviour is introduce before v2.6, and for consequence, if other\ncontext hold \u0026apos;reconfig_mutex\u0026apos;, and md_check_recovery() can\u0026apos;t update\nsuper_block, then raid5d() will waste one cpu 100% by the deadloop, until\n\u0026apos;reconfig_mutex\u0026apos; is released.\r\n\r\nRefer to the implementation from raid1 and raid10, fix this problem by\nskipping issue IO if MD_SB_CHANGE_PENDING is still set after\nmd_check_recovery(), daemon thread will be woken up when \u0026apos;reconfig_mutex\u0026apos;\nis released. Meanwhile, the hang problem will be fixed as well.(CVE-2024-39476)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmmc: davinci: Don\u0026apos;t strip remove function when driver is builtin\r\n\r\nUsing __exit for the remove function results in the remove callback being\ndiscarded with CONFIG_MMC_DAVINCI=y. When such a device gets unbound (e.g.\nusing sysfs or hotplug), the driver is just removed without the cleanup\nbeing performed. This results in resource leaks. Fix it by compiling in the\nremove callback unconditionally.\r\n\r\nThis also fixes a W=1 modpost warning:\r\n\r\nWARNING: modpost: drivers/mmc/host/davinci_mmc: section mismatch in\nreference: davinci_mmcsd_driver+0x10 (section: .data) -\u0026gt;\ndavinci_mmcsd_remove (section: .exit.text)(CVE-2024-39484)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nliquidio: Adjust a NULL pointer handling path in lio_vf_rep_copy_packet\r\n\r\nIn lio_vf_rep_copy_packet() pg_info-\u0026gt;page is compared to a NULL value,\nbut then it is unconditionally passed to skb_add_rx_frag() which looks\nstrange and could lead to null pointer dereference.\r\n\r\nlio_vf_rep_copy_packet() call trace looks like:\n\tocteon_droq_process_packets\n\t octeon_droq_fast_process_packets\n\t octeon_droq_dispatch_pkt\n\t octeon_create_recv_info\n\t ...search in the dispatch_list...\n\t -\u0026gt;disp_fn(rdisp-\u0026gt;rinfo, ...)\n\t lio_vf_rep_pkt_recv(struct octeon_recv_info *recv_info, ...)\nIn this path there is no code which sets pg_info-\u0026gt;page to NULL.\nSo this check looks unneeded and doesn\u0026apos;t solve potential problem.\nBut I guess the author had reason to add a check and I have no such card\nand can\u0026apos;t do real test.\nIn addition, the code in the function liquidio_push_packet() in\nliquidio/lio_core.c does exactly the same.\r\n\r\nBased on this, I consider the most acceptable compromise solution to\nadjust this issue by moving skb_add_rx_frag() into conditional scope.\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-39506)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nio_uring/io-wq: Use set_bit() and test_bit() at worker-\u0026gt;flags\r\n\r\nUtilize set_bit() and test_bit() on worker-\u0026gt;flags within io_uring/io-wq\nto address potential data races.\r\n\r\nThe structure io_worker-\u0026gt;flags may be accessed through various data\npaths, leading to concurrency issues. When KCSAN is enabled, it reveals\ndata races occurring in io_worker_handle_work and\nio_wq_activate_free_worker functions.\r\n\r\n\t BUG: KCSAN: data-race in io_worker_handle_work / io_wq_activate_free_worker\n\t write to 0xffff8885c4246404 of 4 bytes by task 49071 on cpu 28:\n\t io_worker_handle_work (io_uring/io-wq.c:434 io_uring/io-wq.c:569)\n\t io_wq_worker (io_uring/io-wq.c:?)\n\u0026lt;snip\u0026gt;\r\n\r\n\t read to 0xffff8885c4246404 of 4 bytes by task 49024 on cpu 5:\n\t io_wq_activate_free_worker (io_uring/io-wq.c:? io_uring/io-wq.c:285)\n\t io_wq_enqueue (io_uring/io-wq.c:947)\n\t io_queue_iowq (io_uring/io_uring.c:524)\n\t io_req_task_submit (io_uring/io_uring.c:1511)\n\t io_handle_tw_list (io_uring/io_uring.c:1198)\n\u0026lt;snip\u0026gt;\r\n\r\nLine numbers against commit 18daea77cca6 (\u0026quot;Merge tag \u0026apos;for-linus\u0026apos; of\ngit://git.kernel.org/pub/scm/virt/kvm/kvm\u0026quot;).\r\n\r\nThese races involve writes and reads to the same memory location by\ndifferent tasks running on different CPUs. To mitigate this, refactor\nthe code to use atomic operations such as set_bit(), test_bit(), and\nclear_bit() instead of basic \u0026quot;and\u0026quot; and \u0026quot;or\u0026quot; operations. This ensures\nthread-safe manipulation of worker flags.\r\n\r\nAlso, move `create_index` to avoid holes in the structure.(CVE-2024-39508)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nriscv: rewrite __kernel_map_pages() to fix sleeping in invalid context\r\n\r\n__kernel_map_pages() is a debug function which clears the valid bit in page\ntable entry for deallocated pages to detect illegal memory accesses to\nfreed pages.\r\n\r\nThis function set/clear the valid bit using __set_memory(). __set_memory()\nacquires init_mm\u0026apos;s semaphore, and this operation may sleep. This is\nproblematic, because __kernel_map_pages() can be called in atomic context,\nand thus is illegal to sleep. An example warning that this causes:\r\n\r\nBUG: sleeping function called from invalid context at kernel/locking/rwsem.c:1578\nin_atomic(): 1, irqs_disabled(): 0, non_block: 0, pid: 2, name: kthreadd\npreempt_count: 2, expected: 0\nCPU: 0 PID: 2 Comm: kthreadd Not tainted 6.9.0-g1d4c6d784ef6 #37\nHardware name: riscv-virtio,qemu (DT)\nCall Trace:\n[\u0026lt;ffffffff800060dc\u0026gt;] dump_backtrace+0x1c/0x24\n[\u0026lt;ffffffff8091ef6e\u0026gt;] show_stack+0x2c/0x38\n[\u0026lt;ffffffff8092baf8\u0026gt;] dump_stack_lvl+0x5a/0x72\n[\u0026lt;ffffffff8092bb24\u0026gt;] dump_stack+0x14/0x1c\n[\u0026lt;ffffffff8003b7ac\u0026gt;] __might_resched+0x104/0x10e\n[\u0026lt;ffffffff8003b7f4\u0026gt;] __might_sleep+0x3e/0x62\n[\u0026lt;ffffffff8093276a\u0026gt;] down_write+0x20/0x72\n[\u0026lt;ffffffff8000cf00\u0026gt;] __set_memory+0x82/0x2fa\n[\u0026lt;ffffffff8000d324\u0026gt;] __kernel_map_pages+0x5a/0xd4\n[\u0026lt;ffffffff80196cca\u0026gt;] __alloc_pages_bulk+0x3b2/0x43a\n[\u0026lt;ffffffff8018ee82\u0026gt;] __vmalloc_node_range+0x196/0x6ba\n[\u0026lt;ffffffff80011904\u0026gt;] copy_process+0x72c/0x17ec\n[\u0026lt;ffffffff80012ab4\u0026gt;] kernel_clone+0x60/0x2fe\n[\u0026lt;ffffffff80012f62\u0026gt;] kernel_thread+0x82/0xa0\n[\u0026lt;ffffffff8003552c\u0026gt;] kthreadd+0x14a/0x1be\n[\u0026lt;ffffffff809357de\u0026gt;] ret_from_fork+0xe/0x1c\r\n\r\nRewrite this function with apply_to_existing_page_range(). It is fine to\nnot have any locking, because __kernel_map_pages() works with pages being\nallocated/deallocated and those pages are not changed by anyone else in the\nmeantime.(CVE-2024-40915)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\niommu: Return right value in iommu_sva_bind_device()\r\n\r\niommu_sva_bind_device() should return either a sva bond handle or an\nERR_PTR value in error cases. Existing drivers (idxd and uacce) only\ncheck the return value with IS_ERR(). This could potentially lead to\na kernel NULL pointer dereference issue if the function returns NULL\ninstead of an error pointer.\r\n\r\nIn reality, this doesn\u0026apos;t cause any problems because iommu_sva_bind_device()\nonly returns NULL when the kernel is not configured with CONFIG_IOMMU_SVA.\nIn this case, iommu_dev_enable_feature(dev, IOMMU_DEV_FEAT_SVA) will\nreturn an error, and the device drivers won\u0026apos;t call iommu_sva_bind_device()\nat all.(CVE-2024-40945)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nima: Avoid blocking in RCU read-side critical section\r\n\r\nA panic happens in ima_match_policy:\r\n\r\nBUG: unable to handle kernel NULL pointer dereference at 0000000000000010\nPGD 42f873067 P4D 0\nOops: 0000 [#1] SMP NOPTI\nCPU: 5 PID: 1286325 Comm: kubeletmonit.sh\nKdump: loaded Tainted: P\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996),\n BIOS 0.0.0 02/06/2015\nRIP: 0010:ima_match_policy+0x84/0x450\nCode: 49 89 fc 41 89 cf 31 ed 89 44 24 14 eb 1c 44 39\n 7b 18 74 26 41 83 ff 05 74 20 48 8b 1b 48 3b 1d\n f2 b9 f4 00 0f 84 9c 01 00 00 \u0026lt;44\u0026gt; 85 73 10 74 ea\n 44 8b 6b 14 41 f6 c5 01 75 d4 41 f6 c5 02 74 0f\nRSP: 0018:ff71570009e07a80 EFLAGS: 00010207\nRAX: 0000000000000000 RBX: 0000000000000000 RCX: 0000000000000200\nRDX: ffffffffad8dc7c0 RSI: 0000000024924925 RDI: ff3e27850dea2000\nRBP: 0000000000000000 R08: 0000000000000000 R09: ffffffffabfce739\nR10: ff3e27810cc42400 R11: 0000000000000000 R12: ff3e2781825ef970\nR13: 00000000ff3e2785 R14: 000000000000000c R15: 0000000000000001\nFS: 00007f5195b51740(0000)\nGS:ff3e278b12d40000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000000000000010 CR3: 0000000626d24002 CR4: 0000000000361ee0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n ima_get_action+0x22/0x30\n process_measurement+0xb0/0x830\n ? page_add_file_rmap+0x15/0x170\n ? alloc_set_pte+0x269/0x4c0\n ? prep_new_page+0x81/0x140\n ? simple_xattr_get+0x75/0xa0\n ? selinux_file_open+0x9d/0xf0\n ima_file_check+0x64/0x90\n path_openat+0x571/0x1720\n do_filp_open+0x9b/0x110\n ? page_counter_try_charge+0x57/0xc0\n ? files_cgroup_alloc_fd+0x38/0x60\n ? __alloc_fd+0xd4/0x250\n ? do_sys_open+0x1bd/0x250\n do_sys_open+0x1bd/0x250\n do_syscall_64+0x5d/0x1d0\n entry_SYSCALL_64_after_hwframe+0x65/0xca\r\n\r\nCommit c7423dbdbc9e (\u0026quot;ima: Handle -ESTALE returned by\nima_filter_rule_match()\u0026quot;) introduced call to ima_lsm_copy_rule within a\nRCU read-side critical section which contains kmalloc with GFP_KERNEL.\nThis implies a possible sleep and violates limitations of RCU read-side\ncritical sections on non-PREEMPT systems.\r\n\r\nSleeping within RCU read-side critical section might cause\nsynchronize_rcu() returning early and break RCU protection, allowing a\nUAF to happen.\r\n\r\nThe root cause of this issue could be described as follows:\n|\tThread A\t|\tThread B\t|\n|\t\t\t|ima_match_policy\t|\n|\t\t\t| rcu_read_lock\t|\n|ima_lsm_update_rule\t|\t\t\t|\n| synchronize_rcu\t|\t\t\t|\n|\t\t\t| kmalloc(GFP_KERNEL)|\n|\t\t\t| sleep\t\t|\n==\u0026gt; synchronize_rcu returns early\n| kfree(entry)\t\t|\t\t\t|\n|\t\t\t| entry = entry-\u0026gt;next|\n==\u0026gt; UAF happens and entry now becomes NULL (or could be anything).\n|\t\t\t| entry-\u0026gt;action\t|\n==\u0026gt; Accessing entry might cause panic.\r\n\r\nTo fix this issue, we are converting all kmalloc that is called within\nRCU read-side critical section to use GFP_ATOMIC.\r\n\r\n[PM: fixed missing comment, long lines, !CONFIG_IMA_LSM_RULES case](CVE-2024-40947)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndmaengine: idxd: Fix possible Use-After-Free in irq_process_work_list\r\n\r\nUse list_for_each_entry_safe() to allow iterating through the list and\ndeleting the entry in the iteration process. The descriptor is freed via\nidxd_desc_complete() and there\u0026apos;s a slight chance may cause issue for\nthe list iterator when the descriptor is reused by another thread\nwithout it being deleted from the list.(CVE-2024-40956)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: prevent possible NULL dereference in rt6_probe()\r\n\r\nsyzbot caught a NULL dereference in rt6_probe() [1]\r\n\r\nBail out if __in6_dev_get() returns NULL.\r\n\r\n[1]\nOops: general protection fault, probably for non-canonical address 0xdffffc00000000cb: 0000 [#1] PREEMPT SMP KASAN PTI\nKASAN: null-ptr-deref in range [0x0000000000000658-0x000000000000065f]\nCPU: 1 PID: 22444 Comm: syz-executor.0 Not tainted 6.10.0-rc2-syzkaller-00383-gb8481381d4e2 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024\n RIP: 0010:rt6_probe net/ipv6/route.c:656 [inline]\n RIP: 0010:find_match+0x8c4/0xf50 net/ipv6/route.c:758\nCode: 14 fd f7 48 8b 85 38 ff ff ff 48 c7 45 b0 00 00 00 00 48 8d b8 5c 06 00 00 48 b8 00 00 00 00 00 fc ff df 48 89 fa 48 c1 ea 03 \u0026lt;0f\u0026gt; b6 14 02 48 89 f8 83 e0 07 83 c0 03 38 d0 7c 08 84 d2 0f 85 19\nRSP: 0018:ffffc900034af070 EFLAGS: 00010203\nRAX: dffffc0000000000 RBX: 0000000000000000 RCX: ffffc90004521000\nRDX: 00000000000000cb RSI: ffffffff8990d0cd RDI: 000000000000065c\nRBP: ffffc900034af150 R08: 0000000000000005 R09: 0000000000000000\nR10: 0000000000000001 R11: 0000000000000002 R12: 000000000000000a\nR13: 1ffff92000695e18 R14: ffff8880244a1d20 R15: 0000000000000000\nFS: 00007f4844a5a6c0(0000) GS:ffff8880b9300000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000001b31b27000 CR3: 000000002d42c000 CR4: 00000000003506f0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n \u0026lt;TASK\u0026gt;\n rt6_nh_find_match+0xfa/0x1a0 net/ipv6/route.c:784\n nexthop_for_each_fib6_nh+0x26d/0x4a0 net/ipv4/nexthop.c:1496\n __find_rr_leaf+0x6e7/0xe00 net/ipv6/route.c:825\n find_rr_leaf net/ipv6/route.c:853 [inline]\n rt6_select net/ipv6/route.c:897 [inline]\n fib6_table_lookup+0x57e/0xa30 net/ipv6/route.c:2195\n ip6_pol_route+0x1cd/0x1150 net/ipv6/route.c:2231\n pol_lookup_func include/net/ip6_fib.h:616 [inline]\n fib6_rule_lookup+0x386/0x720 net/ipv6/fib6_rules.c:121\n ip6_route_output_flags_noref net/ipv6/route.c:2639 [inline]\n ip6_route_output_flags+0x1d0/0x640 net/ipv6/route.c:2651\n ip6_dst_lookup_tail.constprop.0+0x961/0x1760 net/ipv6/ip6_output.c:1147\n ip6_dst_lookup_flow+0x99/0x1d0 net/ipv6/ip6_output.c:1250\n rawv6_sendmsg+0xdab/0x4340 net/ipv6/raw.c:898\n inet_sendmsg+0x119/0x140 net/ipv4/af_inet.c:853\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg net/socket.c:745 [inline]\n sock_write_iter+0x4b8/0x5c0 net/socket.c:1160\n new_sync_write fs/read_write.c:497 [inline]\n vfs_write+0x6b6/0x1140 fs/read_write.c:590\n ksys_write+0x1f8/0x260 fs/read_write.c:643\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcd/0x250 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-40960)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nserial: imx: Introduce timeout when waiting on transmitter empty\r\n\r\nBy waiting at most 1 second for USR2_TXDC to be set, we avoid a potential\ndeadlock.\r\n\r\nIn case of the timeout, there is not much we can do, so we simply ignore\nthe transmitter state and optimistically try to continue.(CVE-2024-40967)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\next4: do not create EA inode under buffer lock\r\n\r\next4_xattr_set_entry() creates new EA inodes while holding buffer lock\non the external xattr block. This is problematic as it nests all the\nallocation locking (which acquires locks on other buffers) under the\nbuffer lock. This can even deadlock when the filesystem is corrupted and\ne.g. quota file is setup to contain xattr block as data block. Move the\nallocation of EA inode out of ext4_xattr_set_entry() into the callers.(CVE-2024-40972)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrop_monitor: replace spin_lock by raw_spin_lock\r\n\r\ntrace_drop_common() is called with preemption disabled, and it acquires\na spin_lock. This is problematic for RT kernels because spin_locks are\nsleeping locks in this configuration, which causes the following splat:\r\n\r\nBUG: sleeping function called from invalid context at kernel/locking/spinlock_rt.c:48\nin_atomic(): 1, irqs_disabled(): 1, non_block: 0, pid: 449, name: rcuc/47\npreempt_count: 1, expected: 0\nRCU nest depth: 2, expected: 2\n5 locks held by rcuc/47/449:\n #0: ff1100086ec30a60 ((softirq_ctrl.lock)){+.+.}-{2:2}, at: __local_bh_disable_ip+0x105/0x210\n #1: ffffffffb394a280 (rcu_read_lock){....}-{1:2}, at: rt_spin_lock+0xbf/0x130\n #2: ffffffffb394a280 (rcu_read_lock){....}-{1:2}, at: __local_bh_disable_ip+0x11c/0x210\n #3: ffffffffb394a160 (rcu_callback){....}-{0:0}, at: rcu_do_batch+0x360/0xc70\n #4: ff1100086ee07520 (\u0026amp;data-\u0026gt;lock){+.+.}-{2:2}, at: trace_drop_common.constprop.0+0xb5/0x290\nirq event stamp: 139909\nhardirqs last enabled at (139908): [\u0026lt;ffffffffb1df2b33\u0026gt;] _raw_spin_unlock_irqrestore+0x63/0x80\nhardirqs last disabled at (139909): [\u0026lt;ffffffffb19bd03d\u0026gt;] trace_drop_common.constprop.0+0x26d/0x290\nsoftirqs last enabled at (139892): [\u0026lt;ffffffffb07a1083\u0026gt;] __local_bh_enable_ip+0x103/0x170\nsoftirqs last disabled at (139898): [\u0026lt;ffffffffb0909b33\u0026gt;] rcu_cpu_kthread+0x93/0x1f0\nPreemption disabled at:\n[\u0026lt;ffffffffb1de786b\u0026gt;] rt_mutex_slowunlock+0xab/0x2e0\nCPU: 47 PID: 449 Comm: rcuc/47 Not tainted 6.9.0-rc2-rt1+ #7\nHardware name: Dell Inc. PowerEdge R650/0Y2G81, BIOS 1.6.5 04/15/2022\nCall Trace:\n \u0026lt;TASK\u0026gt;\n dump_stack_lvl+0x8c/0xd0\n dump_stack+0x14/0x20\n __might_resched+0x21e/0x2f0\n rt_spin_lock+0x5e/0x130\n ? trace_drop_common.constprop.0+0xb5/0x290\n ? skb_queue_purge_reason.part.0+0x1bf/0x230\n trace_drop_common.constprop.0+0xb5/0x290\n ? preempt_count_sub+0x1c/0xd0\n ? _raw_spin_unlock_irqrestore+0x4a/0x80\n ? __pfx_trace_drop_common.constprop.0+0x10/0x10\n ? rt_mutex_slowunlock+0x26a/0x2e0\n ? skb_queue_purge_reason.part.0+0x1bf/0x230\n ? __pfx_rt_mutex_slowunlock+0x10/0x10\n ? skb_queue_purge_reason.part.0+0x1bf/0x230\n trace_kfree_skb_hit+0x15/0x20\n trace_kfree_skb+0xe9/0x150\n kfree_skb_reason+0x7b/0x110\n skb_queue_purge_reason.part.0+0x1bf/0x230\n ? __pfx_skb_queue_purge_reason.part.0+0x10/0x10\n ? mark_lock.part.0+0x8a/0x520\n...\r\n\r\ntrace_drop_common() also disables interrupts, but this is a minor issue\nbecause we could easily replace it with a local_lock.\r\n\r\nReplace the spin_lock with raw_spin_lock to avoid sleeping in atomic\ncontext.(CVE-2024-40980)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbatman-adv: bypass empty buckets in batadv_purge_orig_ref()\r\n\r\nMany syzbot reports are pointing to soft lockups in\nbatadv_purge_orig_ref() [1]\r\n\r\nRoot cause is unknown, but we can avoid spending too much\ntime there and perhaps get more interesting reports.\r\n\r\n[1]\r\n\r\nwatchdog: BUG: soft lockup - CPU#0 stuck for 27s! [kworker/u4:6:621]\nModules linked in:\nirq event stamp: 6182794\n hardirqs last enabled at (6182793): [\u0026lt;ffff8000801dae10\u0026gt;] __local_bh_enable_ip+0x224/0x44c kernel/softirq.c:386\n hardirqs last disabled at (6182794): [\u0026lt;ffff80008ad66a78\u0026gt;] __el1_irq arch/arm64/kernel/entry-common.c:533 [inline]\n hardirqs last disabled at (6182794): [\u0026lt;ffff80008ad66a78\u0026gt;] el1_interrupt+0x24/0x68 arch/arm64/kernel/entry-common.c:551\n softirqs last enabled at (6182792): [\u0026lt;ffff80008aab71c4\u0026gt;] spin_unlock_bh include/linux/spinlock.h:396 [inline]\n softirqs last enabled at (6182792): [\u0026lt;ffff80008aab71c4\u0026gt;] batadv_purge_orig_ref+0x114c/0x1228 net/batman-adv/originator.c:1287\n softirqs last disabled at (6182790): [\u0026lt;ffff80008aab61dc\u0026gt;] spin_lock_bh include/linux/spinlock.h:356 [inline]\n softirqs last disabled at (6182790): [\u0026lt;ffff80008aab61dc\u0026gt;] batadv_purge_orig_ref+0x164/0x1228 net/batman-adv/originator.c:1271\nCPU: 0 PID: 621 Comm: kworker/u4:6 Not tainted 6.8.0-rc7-syzkaller-g707081b61156 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/29/2024\nWorkqueue: bat_events batadv_purge_orig\npstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n pc : should_resched arch/arm64/include/asm/preempt.h:79 [inline]\n pc : __local_bh_enable_ip+0x228/0x44c kernel/softirq.c:388\n lr : __local_bh_enable_ip+0x224/0x44c kernel/softirq.c:386\nsp : ffff800099007970\nx29: ffff800099007980 x28: 1fffe00018fce1bd x27: dfff800000000000\nx26: ffff0000d2620008 x25: ffff0000c7e70de8 x24: 0000000000000001\nx23: 1fffe00018e57781 x22: dfff800000000000 x21: ffff80008aab71c4\nx20: ffff0001b40136c0 x19: ffff0000c72bbc08 x18: 1fffe0001a817bb0\nx17: ffff800125414000 x16: ffff80008032116c x15: 0000000000000001\nx14: 1fffe0001ee9d610 x13: 0000000000000000 x12: 0000000000000003\nx11: 0000000000000000 x10: 0000000000ff0100 x9 : 0000000000000000\nx8 : 00000000005e5789 x7 : ffff80008aab61dc x6 : 0000000000000000\nx5 : 0000000000000000 x4 : 0000000000000001 x3 : 0000000000000000\nx2 : 0000000000000006 x1 : 0000000000000080 x0 : ffff800125414000\nCall trace:\n __daif_local_irq_enable arch/arm64/include/asm/irqflags.h:27 [inline]\n arch_local_irq_enable arch/arm64/include/asm/irqflags.h:49 [inline]\n __local_bh_enable_ip+0x228/0x44c kernel/softirq.c:386\n __raw_spin_unlock_bh include/linux/spinlock_api_smp.h:167 [inline]\n _raw_spin_unlock_bh+0x3c/0x4c kernel/locking/spinlock.c:210\n spin_unlock_bh include/linux/spinlock.h:396 [inline]\n batadv_purge_orig_ref+0x114c/0x1228 net/batman-adv/originator.c:1287\n batadv_purge_orig+0x20/0x70 net/batman-adv/originator.c:1300\n process_one_work+0x694/0x1204 kernel/workqueue.c:2633\n process_scheduled_works kernel/workqueue.c:2706 [inline]\n worker_thread+0x938/0xef4 kernel/workqueue.c:2787\n kthread+0x288/0x310 kernel/kthread.c:388\n ret_from_fork+0x10/0x20 arch/arm64/kernel/entry.S:860\nSending NMI from CPU 0 to CPUs 1:\nNMI backtrace for cpu 1\nCPU: 1 PID: 0 Comm: swapper/1 Not tainted 6.8.0-rc7-syzkaller-g707081b61156 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/29/2024\npstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n pc : arch_local_irq_enable+0x8/0xc arch/arm64/include/asm/irqflags.h:51\n lr : default_idle_call+0xf8/0x128 kernel/sched/idle.c:103\nsp : ffff800093a17d30\nx29: ffff800093a17d30 x28: dfff800000000000 x27: 1ffff00012742fb4\nx26: ffff80008ec9d000 x25: 0000000000000000 x24: 0000000000000002\nx23: 1ffff00011d93a74 x22: ffff80008ec9d3a0 x21: 0000000000000000\nx20: ffff0000c19dbc00 x19: ffff8000802d0fd8 x18: 1fffe00036804396\nx17: ffff80008ec9d000 x16: ffff8000802d089c x15: 0000000000000001\n---truncated---(CVE-2024-40981)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/sched: act_api: fix possible infinite loop in tcf_idr_check_alloc()\r\n\r\nsyzbot found hanging tasks waiting on rtnl_lock [1]\r\n\r\nA reproducer is available in the syzbot bug.\r\n\r\nWhen a request to add multiple actions with the same index is sent, the\nsecond request will block forever on the first request. This holds\nrtnl_lock, and causes tasks to hang.\r\n\r\nReturn -EAGAIN to prevent infinite looping, while keeping documented\nbehavior.\r\n\r\n[1]\r\n\r\nINFO: task kworker/1:0:5088 blocked for more than 143 seconds.\nNot tainted 6.9.0-rc4-syzkaller-00173-g3cdb45594619 #0\n\u0026quot;echo 0 \u0026gt; /proc/sys/kernel/hung_task_timeout_secs\u0026quot; disables this message.\ntask:kworker/1:0 state:D stack:23744 pid:5088 tgid:5088 ppid:2 flags:0x00004000\nWorkqueue: events_power_efficient reg_check_chans_work\nCall Trace:\n\u0026lt;TASK\u0026gt;\ncontext_switch kernel/sched/core.c:5409 [inline]\n__schedule+0xf15/0x5d00 kernel/sched/core.c:6746\n__schedule_loop kernel/sched/core.c:6823 [inline]\nschedule+0xe7/0x350 kernel/sched/core.c:6838\nschedule_preempt_disabled+0x13/0x30 kernel/sched/core.c:6895\n__mutex_lock_common kernel/locking/mutex.c:684 [inline]\n__mutex_lock+0x5b8/0x9c0 kernel/locking/mutex.c:752\nwiphy_lock include/net/cfg80211.h:5953 [inline]\nreg_leave_invalid_chans net/wireless/reg.c:2466 [inline]\nreg_check_chans_work+0x10a/0x10e0 net/wireless/reg.c:2481(CVE-2024-40995)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdkfd: don\u0026apos;t allow mapping the MMIO HDP page with large pages\r\n\r\nWe don\u0026apos;t get the right offset in that case. The GPU has\nan unused 4K area of the register BAR space into which you can\nremap registers. We remap the HDP flush registers into this\nspace to allow userspace (CPU or GPU) to flush the HDP when it\nupdates VRAM. However, on systems with \u0026gt;4K pages, we end up\nexposing PAGE_SIZE of MMIO space.(CVE-2024-41011)",
"id": "OESA-2024-1941",
"modified": "2026-08-06T11:07:24Z",
"published": "2024-08-02T11:07:24Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/security-bulletins/detail?id=openEuler-SA-2024-1941"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47205"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48703"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48780"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48859"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52679"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26924"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26925"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27010"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-34777"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35808"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35837"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35899"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35931"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36923"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-37078"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38548"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38567"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38607"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38611"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38621"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39475"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39476"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39484"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39506"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39508"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40915"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40945"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40947"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40956"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40960"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40967"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40972"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40980"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40981"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40995"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41011"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47205",
"CVE-2022-48703",
"CVE-2022-48780",
"CVE-2022-48859",
"CVE-2023-52679",
"CVE-2024-26924",
"CVE-2024-26925",
"CVE-2024-27010",
"CVE-2024-34777",
"CVE-2024-35808",
"CVE-2024-35837",
"CVE-2024-35899",
"CVE-2024-35931",
"CVE-2024-36923",
"CVE-2024-37078",
"CVE-2024-38548",
"CVE-2024-38567",
"CVE-2024-38607",
"CVE-2024-38611",
"CVE-2024-38621",
"CVE-2024-39475",
"CVE-2024-39476",
"CVE-2024-39484",
"CVE-2024-39506",
"CVE-2024-39508",
"CVE-2024-40915",
"CVE-2024-40945",
"CVE-2024-40947",
"CVE-2024-40956",
"CVE-2024-40960",
"CVE-2024-40967",
"CVE-2024-40972",
"CVE-2024-40980",
"CVE-2024-40981",
"CVE-2024-40995",
"CVE-2024-41011"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.