Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2024-41095 (GCVE-0-2024-41095)
Vulnerability from cvelistv5 – Published: 2024-07-29 15:48 – Updated: 2026-05-11 20:26| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
6ee738610f41b59733f63718f0bdbcba7d3a3f12 , < 9289cd3450d1da3e271ef4b054d4d2932c41243e
(git)
Affected: 6ee738610f41b59733f63718f0bdbcba7d3a3f12 , < dbd75f32252508ed6c46c3288a282c301a57ceeb (git) Affected: 6ee738610f41b59733f63718f0bdbcba7d3a3f12 , < 259549b2ccf795b7f91f7b5aba47286addcfa389 (git) Affected: 6ee738610f41b59733f63718f0bdbcba7d3a3f12 , < 0d17604f2e44b3df21e218fe8fb3b836d41bac49 (git) Affected: 6ee738610f41b59733f63718f0bdbcba7d3a3f12 , < f95ed0f54b3d3faecae1140ddab854f904a6e7c8 (git) Affected: 6ee738610f41b59733f63718f0bdbcba7d3a3f12 , < cb751e48bbcffd292090f7882b23b215111b3d72 (git) Affected: 6ee738610f41b59733f63718f0bdbcba7d3a3f12 , < bdda5072494f2a7215d94fc4124ad1949a218714 (git) Affected: 6ee738610f41b59733f63718f0bdbcba7d3a3f12 , < 66edf3fb331b6c55439b10f9862987b0916b3726 (git) |
guessed | |
| Linux | Linux |
Affected:
2.6.33
Unaffected: 0 , < 2.6.33 (semver) Unaffected: 4.19.317 , ≤ 4.19.* (semver) Unaffected: 5.4.279 , ≤ 5.4.* (semver) Unaffected: 5.10.221 , ≤ 5.10.* (semver) Unaffected: 5.15.162 , ≤ 5.15.* (semver) Unaffected: 6.1.97 , ≤ 6.1.* (semver) Unaffected: 6.6.37 , ≤ 6.6.* (semver) Unaffected: 6.9.8 , ≤ 6.9.* (semver) Unaffected: 6.10 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2025-11-03T22:00:52.274Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/9289cd3450d1da3e271ef4b054d4d2932c41243e"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/dbd75f32252508ed6c46c3288a282c301a57ceeb"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/259549b2ccf795b7f91f7b5aba47286addcfa389"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/0d17604f2e44b3df21e218fe8fb3b836d41bac49"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/f95ed0f54b3d3faecae1140ddab854f904a6e7c8"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/cb751e48bbcffd292090f7882b23b215111b3d72"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/bdda5072494f2a7215d94fc4124ad1949a218714"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/66edf3fb331b6c55439b10f9862987b0916b3726"
},
{
"url": "https://lists.debian.org/debian-lts-announce/2025/01/msg00001.html"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2024-41095",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T16:20:25.562753Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-09-11T17:33:09.325Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/gpu/drm/nouveau/dispnv04/tvnv17.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "9289cd3450d1da3e271ef4b054d4d2932c41243e",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "dbd75f32252508ed6c46c3288a282c301a57ceeb",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "259549b2ccf795b7f91f7b5aba47286addcfa389",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "0d17604f2e44b3df21e218fe8fb3b836d41bac49",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "f95ed0f54b3d3faecae1140ddab854f904a6e7c8",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "cb751e48bbcffd292090f7882b23b215111b3d72",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "bdda5072494f2a7215d94fc4124ad1949a218714",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "66edf3fb331b6c55439b10f9862987b0916b3726",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/gpu/drm/nouveau/dispnv04/tvnv17.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.33"
},
{
"lessThan": "2.6.33",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.317",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.279",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.221",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.162",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.97",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.37",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.8",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.317",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.279",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.221",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.162",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.97",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.37",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.9.8",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.10",
"versionStartIncluding": "2.6.33",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ndrm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes\n\nIn nv17_tv_get_ld_modes(), the return value of drm_mode_duplicate() is\nassigned to mode, which will lead to a possible NULL pointer dereference\non failure of drm_mode_duplicate(). Add a check to avoid npd."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T20:26:06.867Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/9289cd3450d1da3e271ef4b054d4d2932c41243e"
},
{
"url": "https://git.kernel.org/stable/c/dbd75f32252508ed6c46c3288a282c301a57ceeb"
},
{
"url": "https://git.kernel.org/stable/c/259549b2ccf795b7f91f7b5aba47286addcfa389"
},
{
"url": "https://git.kernel.org/stable/c/0d17604f2e44b3df21e218fe8fb3b836d41bac49"
},
{
"url": "https://git.kernel.org/stable/c/f95ed0f54b3d3faecae1140ddab854f904a6e7c8"
},
{
"url": "https://git.kernel.org/stable/c/cb751e48bbcffd292090f7882b23b215111b3d72"
},
{
"url": "https://git.kernel.org/stable/c/bdda5072494f2a7215d94fc4124ad1949a218714"
},
{
"url": "https://git.kernel.org/stable/c/66edf3fb331b6c55439b10f9862987b0916b3726"
}
],
"title": "drm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-41095",
"datePublished": "2024-07-29T15:48:08.324Z",
"dateReserved": "2024-07-12T12:17:45.637Z",
"dateUpdated": "2026-05-11T20:26:06.867Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2024-41095",
"date": "2026-10-03",
"epss": "0.00236",
"percentile": "0.13239"
},
"fkie_nvd": {
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "AD25C2E5-C116-4160-BA6D-CE9B0D10AE3E",
"versionEndExcluding": "4.19.317",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F4E38E58-1B9F-4DF2-AD3D-A8BEAA2959D8",
"versionEndExcluding": "5.4.279",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "659E1520-6345-41AF-B893-A7C0647585A0",
"versionEndExcluding": "5.10.221",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "10A39ACC-3005-40E8-875C-98A372D1FFD5",
"versionEndExcluding": "5.15.162",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "748B6C4B-1F61-47F9-96CC-8899B8412D84",
"versionEndExcluding": "6.1.97",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "D72E033B-5323-4C4D-8818-36E1EBC3535F",
"versionEndExcluding": "6.6.37",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E95105F2-32E3-4C5F-9D18-7AEFD0E6275C",
"versionEndExcluding": "6.9.8",
"versionStartIncluding": "6.7",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ndrm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes\n\nIn nv17_tv_get_ld_modes(), the return value of drm_mode_duplicate() is\nassigned to mode, which will lead to a possible NULL pointer dereference\non failure of drm_mode_duplicate(). Add a check to avoid npd."
},
{
"lang": "es",
"value": " En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: drm/nouveau/dispnv04: corrige la desreferencia del puntero null en nv17_tv_get_ld_modes En nv17_tv_get_ld_modes(), el valor de retorno de drm_mode_duplicate() se asigna al modo, lo que conducir\u00e1 a una posible desreferencia del puntero NULL en caso de falla de drm_mode_duplicate(). Agregue una marca para evitar npd."
}
],
"id": "CVE-2024-41095",
"lastModified": "2024-11-21T09:32:14.120",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2024-07-29T16:15:04.613",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0d17604f2e44b3df21e218fe8fb3b836d41bac49"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/259549b2ccf795b7f91f7b5aba47286addcfa389"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/66edf3fb331b6c55439b10f9862987b0916b3726"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/9289cd3450d1da3e271ef4b054d4d2932c41243e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/bdda5072494f2a7215d94fc4124ad1949a218714"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/cb751e48bbcffd292090f7882b23b215111b3d72"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/dbd75f32252508ed6c46c3288a282c301a57ceeb"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f95ed0f54b3d3faecae1140ddab854f904a6e7c8"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0d17604f2e44b3df21e218fe8fb3b836d41bac49"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/259549b2ccf795b7f91f7b5aba47286addcfa389"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/66edf3fb331b6c55439b10f9862987b0916b3726"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/9289cd3450d1da3e271ef4b054d4d2932c41243e"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/bdda5072494f2a7215d94fc4124ad1949a218714"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/cb751e48bbcffd292090f7882b23b215111b3d72"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/dbd75f32252508ed6c46c3288a282c301a57ceeb"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f95ed0f54b3d3faecae1140ddab854f904a6e7c8"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"microsoft_vex": {
"current_release_date": "2026-02-19T01:15:17.000Z",
"cve": "CVE-2024-41095",
"id": "msrc_CVE-2024-41095",
"initial_release_date": "2024-07-01T07:00:00.000Z",
"product_status:fixed": "2",
"product_status:known_affected": "2",
"source": "Microsoft CSAF VEX",
"status": "final",
"title": "drm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes",
"url": "https://msrc.microsoft.com/csaf/vex/2024/msrc_cve-2024-41095.json",
"version": "2"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/gpu/drm/nouveau/dispnv04/tvnv17.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "9289cd3450d1da3e271ef4b054d4d2932c41243e",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "dbd75f32252508ed6c46c3288a282c301a57ceeb",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "259549b2ccf795b7f91f7b5aba47286addcfa389",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "0d17604f2e44b3df21e218fe8fb3b836d41bac49",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "f95ed0f54b3d3faecae1140ddab854f904a6e7c8",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "cb751e48bbcffd292090f7882b23b215111b3d72",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "bdda5072494f2a7215d94fc4124ad1949a218714",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "66edf3fb331b6c55439b10f9862987b0916b3726",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/gpu/drm/nouveau/dispnv04/tvnv17.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.33"
},
{
"lessThan": "2.6.33",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.317",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.279",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.221",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.162",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.97",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.37",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.8",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "AD25C2E5-C116-4160-BA6D-CE9B0D10AE3E",
"versionEndExcluding": "4.19.317",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F4E38E58-1B9F-4DF2-AD3D-A8BEAA2959D8",
"versionEndExcluding": "5.4.279",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "659E1520-6345-41AF-B893-A7C0647585A0",
"versionEndExcluding": "5.10.221",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "10A39ACC-3005-40E8-875C-98A372D1FFD5",
"versionEndExcluding": "5.15.162",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "748B6C4B-1F61-47F9-96CC-8899B8412D84",
"versionEndExcluding": "6.1.97",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "D72E033B-5323-4C4D-8818-36E1EBC3535F",
"versionEndExcluding": "6.6.37",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E95105F2-32E3-4C5F-9D18-7AEFD0E6275C",
"versionEndExcluding": "6.9.8",
"versionStartIncluding": "6.7",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ndrm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes\n\nIn nv17_tv_get_ld_modes(), the return value of drm_mode_duplicate() is\nassigned to mode, which will lead to a possible NULL pointer dereference\non failure of drm_mode_duplicate(). Add a check to avoid npd."
},
{
"lang": "es",
"value": " En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: drm/nouveau/dispnv04: corrige la desreferencia del puntero null en nv17_tv_get_ld_modes En nv17_tv_get_ld_modes(), el valor de retorno de drm_mode_duplicate() se asigna al modo, lo que conducir\u00e1 a una posible desreferencia del puntero NULL en caso de falla de drm_mode_duplicate(). Agregue una marca para evitar npd."
}
],
"id": "CVE-2024-41095",
"lastModified": "2026-06-17T07:47:16.470",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-41095",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T16:20:25.562753Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-07-29T16:15:04.613",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0d17604f2e44b3df21e218fe8fb3b836d41bac49"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/259549b2ccf795b7f91f7b5aba47286addcfa389"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/66edf3fb331b6c55439b10f9862987b0916b3726"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/9289cd3450d1da3e271ef4b054d4d2932c41243e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/bdda5072494f2a7215d94fc4124ad1949a218714"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/cb751e48bbcffd292090f7882b23b215111b3d72"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/dbd75f32252508ed6c46c3288a282c301a57ceeb"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f95ed0f54b3d3faecae1140ddab854f904a6e7c8"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0d17604f2e44b3df21e218fe8fb3b836d41bac49"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/259549b2ccf795b7f91f7b5aba47286addcfa389"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/66edf3fb331b6c55439b10f9862987b0916b3726"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/9289cd3450d1da3e271ef4b054d4d2932c41243e"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/bdda5072494f2a7215d94fc4124ad1949a218714"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/cb751e48bbcffd292090f7882b23b215111b3d72"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/dbd75f32252508ed6c46c3288a282c301a57ceeb"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f95ed0f54b3d3faecae1140ddab854f904a6e7c8"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://lists.debian.org/debian-lts-announce/2025/01/msg00001.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2026-06-28T07:54:35+00:00",
"cve": "CVE-2024-41095",
"id": "CVE-2024-41095",
"initial_release_date": "2024-07-29T00:00:00+00:00",
"product_status:fixed": "280",
"product_status:known_affected": "112",
"product_status:known_not_affected": "8",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: drm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2024/cve-2024-41095.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-09-30T15:41:30Z",
"cve": "CVE-2024-41095",
"id": "CVE-2024-41095",
"initial_release_date": "2024-08-06T02:00:57Z",
"product_status:known_affected": "516",
"product_status:known_not_affected": "6",
"product_status:recommended": "727",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2024-41095",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2024-41095.json",
"version": "112"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2025-11-03T22:00:52.274Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/9289cd3450d1da3e271ef4b054d4d2932c41243e"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/dbd75f32252508ed6c46c3288a282c301a57ceeb"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/259549b2ccf795b7f91f7b5aba47286addcfa389"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/0d17604f2e44b3df21e218fe8fb3b836d41bac49"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/f95ed0f54b3d3faecae1140ddab854f904a6e7c8"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/cb751e48bbcffd292090f7882b23b215111b3d72"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/bdda5072494f2a7215d94fc4124ad1949a218714"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/66edf3fb331b6c55439b10f9862987b0916b3726"
},
{
"url": "https://lists.debian.org/debian-lts-announce/2025/01/msg00001.html"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2024-41095",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T16:20:25.562753Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-09-11T12:42:14.805Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/gpu/drm/nouveau/dispnv04/tvnv17.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "9289cd3450d1da3e271ef4b054d4d2932c41243e",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "dbd75f32252508ed6c46c3288a282c301a57ceeb",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "259549b2ccf795b7f91f7b5aba47286addcfa389",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "0d17604f2e44b3df21e218fe8fb3b836d41bac49",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "f95ed0f54b3d3faecae1140ddab854f904a6e7c8",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "cb751e48bbcffd292090f7882b23b215111b3d72",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "bdda5072494f2a7215d94fc4124ad1949a218714",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "66edf3fb331b6c55439b10f9862987b0916b3726",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/gpu/drm/nouveau/dispnv04/tvnv17.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.33"
},
{
"lessThan": "2.6.33",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.317",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.279",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.221",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.162",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.97",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.37",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.8",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.317",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.279",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.221",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.162",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.97",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.37",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.9.8",
"versionStartIncluding": "2.6.33",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.10",
"versionStartIncluding": "2.6.33",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ndrm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes\n\nIn nv17_tv_get_ld_modes(), the return value of drm_mode_duplicate() is\nassigned to mode, which will lead to a possible NULL pointer dereference\non failure of drm_mode_duplicate(). Add a check to avoid npd."
}
],
"providerMetadata": {
"dateUpdated": "2026-01-05T10:51:27.712Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/9289cd3450d1da3e271ef4b054d4d2932c41243e"
},
{
"url": "https://git.kernel.org/stable/c/dbd75f32252508ed6c46c3288a282c301a57ceeb"
},
{
"url": "https://git.kernel.org/stable/c/259549b2ccf795b7f91f7b5aba47286addcfa389"
},
{
"url": "https://git.kernel.org/stable/c/0d17604f2e44b3df21e218fe8fb3b836d41bac49"
},
{
"url": "https://git.kernel.org/stable/c/f95ed0f54b3d3faecae1140ddab854f904a6e7c8"
},
{
"url": "https://git.kernel.org/stable/c/cb751e48bbcffd292090f7882b23b215111b3d72"
},
{
"url": "https://git.kernel.org/stable/c/bdda5072494f2a7215d94fc4124ad1949a218714"
},
{
"url": "https://git.kernel.org/stable/c/66edf3fb331b6c55439b10f9862987b0916b3726"
}
],
"title": "drm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-41095",
"datePublished": "2024-07-29T15:48:08.324Z",
"dateReserved": "2024-07-12T12:17:45.637Z",
"dateUpdated": "2026-01-05T10:51:27.712Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
CERTFR-2024-AVI-1049
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Title | Publication Time | Tags | |||
|---|---|---|---|---|---|
|
|||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 16.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-42310",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42310"
},
{
"name": "CVE-2024-46738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46738"
},
{
"name": "CVE-2024-27397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27397"
},
{
"name": "CVE-2024-46800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46800"
},
{
"name": "CVE-2024-46722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46722"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-44998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44998"
},
{
"name": "CVE-2024-46723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46723"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2024-42309",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42309"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-46757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46757"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-46758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46758"
},
{
"name": "CVE-2024-46756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46756"
},
{
"name": "CVE-2023-52639",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52639"
},
{
"name": "CVE-2023-52599",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52599"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-44942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44942"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2024-46743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46743"
},
{
"name": "CVE-2024-42104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42104"
},
{
"name": "CVE-2024-43882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43882"
},
{
"name": "CVE-2022-48943",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48943"
},
{
"name": "CVE-2024-26668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26668"
},
{
"name": "CVE-2023-52612",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52612"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2023-52578",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52578"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2022-48733",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48733"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2024-46759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46759"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2024-38637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38637"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2023-52531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52531"
},
{
"name": "CVE-2024-44987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44987"
},
{
"name": "CVE-2023-52614",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52614"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2022-48938",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48938"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-1049",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-12-06T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2024-11-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7121-3",
"url": "https://ubuntu.com/security/notices/USN-7121-3"
}
]
}
CERTFR-2024-AVI-1080
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Elles permettent à un attaquant de provoquer un problème de sécurité non spécifié par l'éditeur.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Title | Publication Time | Tags | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 16.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-24448",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24448"
},
{
"name": "CVE-2024-25744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25744"
},
{
"name": "CVE-2023-52599",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52599"
},
{
"name": "CVE-2021-47076",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47076"
},
{
"name": "CVE-2023-52531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52531"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2024-26607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26607"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2023-52639",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52639"
},
{
"name": "CVE-2023-52497",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52497"
},
{
"name": "CVE-2024-26800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26800"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2023-52488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52488"
},
{
"name": "CVE-2021-47055",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47055"
},
{
"name": "CVE-2023-52578",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52578"
},
{
"name": "CVE-2023-52498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52498"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2023-52614",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52614"
},
{
"name": "CVE-2024-27022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27022"
},
{
"name": "CVE-2024-26668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26668"
},
{
"name": "CVE-2024-26669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26669"
},
{
"name": "CVE-2024-26893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26893"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-27397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27397"
},
{
"name": "CVE-2024-26947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26947"
},
{
"name": "CVE-2022-48733",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48733"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-40915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40915"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-36968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36968"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2024-38577",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38577"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
},
{
"name": "CVE-2022-48666",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48666"
},
{
"name": "CVE-2024-36484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36484"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2024-41020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41020"
},
{
"name": "CVE-2024-41022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41022"
},
{
"name": "CVE-2024-41034",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41034"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2024-41046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41046"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2024-41065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41065"
},
{
"name": "CVE-2024-41068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41068"
},
{
"name": "CVE-2024-41077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41077"
},
{
"name": "CVE-2024-42101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42101"
},
{
"name": "CVE-2024-42102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42102"
},
{
"name": "CVE-2024-42104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42104"
},
{
"name": "CVE-2024-42106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42106"
},
{
"name": "CVE-2024-42115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42115"
},
{
"name": "CVE-2024-42121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42121"
},
{
"name": "CVE-2024-42127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42127"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2024-42137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42137"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-42153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42153"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42157"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2024-42110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42110"
},
{
"name": "CVE-2024-41073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41073"
},
{
"name": "CVE-2024-41096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41096"
},
{
"name": "CVE-2024-42082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42082"
},
{
"name": "CVE-2023-52887",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52887"
},
{
"name": "CVE-2024-41027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41027"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2024-42068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42068"
},
{
"name": "CVE-2024-42076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42076"
},
{
"name": "CVE-2024-42077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42077"
},
{
"name": "CVE-2024-42080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42080"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2024-42085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42085"
},
{
"name": "CVE-2024-42086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42086"
},
{
"name": "CVE-2024-42087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42087"
},
{
"name": "CVE-2024-42089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42089"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2024-42092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42092"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2024-42095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42095"
},
{
"name": "CVE-2024-42097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42097"
},
{
"name": "CVE-2024-42098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42098"
},
{
"name": "CVE-2024-42109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42109"
},
{
"name": "CVE-2024-42130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42130"
},
{
"name": "CVE-2024-42140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42140"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2024-42270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42270"
},
{
"name": "CVE-2022-48938",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48938"
},
{
"name": "CVE-2022-48943",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48943"
},
{
"name": "CVE-2023-52889",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52889"
},
{
"name": "CVE-2024-39486",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39486"
},
{
"name": "CVE-2024-41010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41010"
},
{
"name": "CVE-2024-41025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41025"
},
{
"name": "CVE-2024-41028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41028"
},
{
"name": "CVE-2024-41032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41032"
},
{
"name": "CVE-2024-41036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41036"
},
{
"name": "CVE-2024-41037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41037"
},
{
"name": "CVE-2024-41038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41038"
},
{
"name": "CVE-2024-41039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41039"
},
{
"name": "CVE-2024-41042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41042"
},
{
"name": "CVE-2024-41045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41045"
},
{
"name": "CVE-2024-41050",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41050"
},
{
"name": "CVE-2024-41051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41051"
},
{
"name": "CVE-2024-41056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41056"
},
{
"name": "CVE-2024-41061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41061"
},
{
"name": "CVE-2024-41062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41062"
},
{
"name": "CVE-2024-41074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41074"
},
{
"name": "CVE-2024-41075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41075"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2024-41080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41080"
},
{
"name": "CVE-2024-41084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41084"
},
{
"name": "CVE-2024-41088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41088"
},
{
"name": "CVE-2024-41094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41094"
},
{
"name": "CVE-2024-41098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41098"
},
{
"name": "CVE-2024-42064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42064"
},
{
"name": "CVE-2024-42069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42069"
},
{
"name": "CVE-2024-42073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42073"
},
{
"name": "CVE-2024-42074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42074"
},
{
"name": "CVE-2024-42113",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42113"
},
{
"name": "CVE-2024-42114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42114"
},
{
"name": "CVE-2024-42117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42117"
},
{
"name": "CVE-2024-42126",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42126"
},
{
"name": "CVE-2024-42132",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42132"
},
{
"name": "CVE-2024-42133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42133"
},
{
"name": "CVE-2024-42136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42136"
},
{
"name": "CVE-2024-42138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42138"
},
{
"name": "CVE-2024-42141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42141"
},
{
"name": "CVE-2024-42142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42142"
},
{
"name": "CVE-2024-42144",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42144"
},
{
"name": "CVE-2024-42147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42147"
},
{
"name": "CVE-2024-42155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42155"
},
{
"name": "CVE-2024-42156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42156"
},
{
"name": "CVE-2024-42158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42158"
},
{
"name": "CVE-2024-42159",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42159"
},
{
"name": "CVE-2024-42227",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42227"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2024-42237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42237"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2024-42239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42239"
},
{
"name": "CVE-2024-42241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42241"
},
{
"name": "CVE-2024-42245",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42245"
},
{
"name": "CVE-2024-42246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42246"
},
{
"name": "CVE-2024-42250",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42250"
},
{
"name": "CVE-2024-42253",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42253"
},
{
"name": "CVE-2024-42259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42259"
},
{
"name": "CVE-2024-42268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42268"
},
{
"name": "CVE-2024-42269",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42269"
},
{
"name": "CVE-2024-42271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42271"
},
{
"name": "CVE-2024-42274",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42274"
},
{
"name": "CVE-2024-42276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42276"
},
{
"name": "CVE-2024-42277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42277"
},
{
"name": "CVE-2024-42278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42278"
},
{
"name": "CVE-2024-42279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42279"
},
{
"name": "CVE-2024-42280",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42280"
},
{
"name": "CVE-2024-42281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42281"
},
{
"name": "CVE-2024-42283",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42283"
},
{
"name": "CVE-2024-42284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42284"
},
{
"name": "CVE-2024-42285",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42285"
},
{
"name": "CVE-2024-42286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42286"
},
{
"name": "CVE-2024-42287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42287"
},
{
"name": "CVE-2024-42288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42288"
},
{
"name": "CVE-2024-42289",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42289"
},
{
"name": "CVE-2024-42290",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42290"
},
{
"name": "CVE-2024-42291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42291"
},
{
"name": "CVE-2024-42292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42292"
},
{
"name": "CVE-2024-42295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42295"
},
{
"name": "CVE-2024-42298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42298"
},
{
"name": "CVE-2024-42301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42301"
},
{
"name": "CVE-2024-42302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42302"
},
{
"name": "CVE-2024-42303",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42303"
},
{
"name": "CVE-2024-42309",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42309"
},
{
"name": "CVE-2024-42310",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42310"
},
{
"name": "CVE-2024-42311",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42311"
},
{
"name": "CVE-2024-42312",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42312"
},
{
"name": "CVE-2024-42313",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42313"
},
{
"name": "CVE-2024-42314",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42314"
},
{
"name": "CVE-2024-42315",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42315"
},
{
"name": "CVE-2024-42316",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42316"
},
{
"name": "CVE-2024-42318",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42318"
},
{
"name": "CVE-2024-42319",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42319"
},
{
"name": "CVE-2024-42320",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42320"
},
{
"name": "CVE-2024-42322",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42322"
},
{
"name": "CVE-2024-43817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43817"
},
{
"name": "CVE-2024-43818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43818"
},
{
"name": "CVE-2024-43819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43819"
},
{
"name": "CVE-2024-43821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43821"
},
{
"name": "CVE-2024-43823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43823"
},
{
"name": "CVE-2024-43824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43824"
},
{
"name": "CVE-2024-43825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43825"
},
{
"name": "CVE-2024-43826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43826"
},
{
"name": "CVE-2024-43829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43829"
},
{
"name": "CVE-2024-43830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43830"
},
{
"name": "CVE-2024-43831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43831"
},
{
"name": "CVE-2024-43833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43833"
},
{
"name": "CVE-2024-43834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43834"
},
{
"name": "CVE-2024-43837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43837"
},
{
"name": "CVE-2024-43839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43839"
},
{
"name": "CVE-2024-43840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43840"
},
{
"name": "CVE-2024-43841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43841"
},
{
"name": "CVE-2024-43842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43842"
},
{
"name": "CVE-2024-43846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43846"
},
{
"name": "CVE-2024-43847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43847"
},
{
"name": "CVE-2024-43849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43849"
},
{
"name": "CVE-2024-43850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43850"
},
{
"name": "CVE-2024-43853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43853"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-43855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43855"
},
{
"name": "CVE-2024-43856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43856"
},
{
"name": "CVE-2024-43858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43858"
},
{
"name": "CVE-2024-43860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43860"
},
{
"name": "CVE-2024-43861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43861"
},
{
"name": "CVE-2024-43863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43863"
},
{
"name": "CVE-2024-43864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43864"
},
{
"name": "CVE-2024-43866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43866"
},
{
"name": "CVE-2024-43867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43867"
},
{
"name": "CVE-2024-43871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43871"
},
{
"name": "CVE-2024-43873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43873"
},
{
"name": "CVE-2024-43875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43875"
},
{
"name": "CVE-2024-43876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43876"
},
{
"name": "CVE-2024-43877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43877"
},
{
"name": "CVE-2024-43879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43879"
},
{
"name": "CVE-2024-43880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43880"
},
{
"name": "CVE-2024-43881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43881"
},
{
"name": "CVE-2024-43882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43882"
},
{
"name": "CVE-2024-43883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43883"
},
{
"name": "CVE-2024-43884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43884"
},
{
"name": "CVE-2024-43889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43889"
},
{
"name": "CVE-2024-43892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43892"
},
{
"name": "CVE-2024-43893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43893"
},
{
"name": "CVE-2024-43894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43894"
},
{
"name": "CVE-2024-43895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43895"
},
{
"name": "CVE-2024-43899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43899"
},
{
"name": "CVE-2024-43900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43900"
},
{
"name": "CVE-2024-43902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43902"
},
{
"name": "CVE-2024-43904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43904"
},
{
"name": "CVE-2024-43905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43905"
},
{
"name": "CVE-2024-43906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43906"
},
{
"name": "CVE-2024-43907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43907"
},
{
"name": "CVE-2024-43908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43908"
},
{
"name": "CVE-2024-43909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43909"
},
{
"name": "CVE-2024-43911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43911"
},
{
"name": "CVE-2024-43912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43912"
},
{
"name": "CVE-2024-44931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44931"
},
{
"name": "CVE-2024-44938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44938"
},
{
"name": "CVE-2024-44939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44939"
},
{
"name": "CVE-2024-44947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44947"
},
{
"name": "CVE-2024-41023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41023"
},
{
"name": "CVE-2024-41031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41031"
},
{
"name": "CVE-2024-42243",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42243"
},
{
"name": "CVE-2024-42160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42160"
},
{
"name": "CVE-2024-45003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45003"
},
{
"name": "CVE-2024-43835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43835"
},
{
"name": "CVE-2024-43859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43859"
},
{
"name": "CVE-2024-44940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44940"
},
{
"name": "CVE-2024-44946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44946"
},
{
"name": "CVE-2024-44974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44974"
},
{
"name": "CVE-2024-44977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44977"
},
{
"name": "CVE-2024-44982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44982"
},
{
"name": "CVE-2024-44983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44983"
},
{
"name": "CVE-2024-44985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44985"
},
{
"name": "CVE-2024-44986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44986"
},
{
"name": "CVE-2024-44987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44987"
},
{
"name": "CVE-2024-44988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44988"
},
{
"name": "CVE-2024-44989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44989"
},
{
"name": "CVE-2024-44990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44990"
},
{
"name": "CVE-2024-44991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44991"
},
{
"name": "CVE-2024-44995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44995"
},
{
"name": "CVE-2024-44998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44998"
},
{
"name": "CVE-2024-44999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44999"
},
{
"name": "CVE-2024-45000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45000"
},
{
"name": "CVE-2024-45002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45002"
},
{
"name": "CVE-2024-45006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45006"
},
{
"name": "CVE-2024-45007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45007"
},
{
"name": "CVE-2024-45008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45008"
},
{
"name": "CVE-2024-45009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45009"
},
{
"name": "CVE-2024-45010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45010"
},
{
"name": "CVE-2024-45011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45011"
},
{
"name": "CVE-2024-45016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45016"
},
{
"name": "CVE-2024-45018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45018"
},
{
"name": "CVE-2024-45019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45019"
},
{
"name": "CVE-2024-45021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45021"
},
{
"name": "CVE-2024-45022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45022"
},
{
"name": "CVE-2024-45025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45025"
},
{
"name": "CVE-2024-45026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45026"
},
{
"name": "CVE-2024-45028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45028"
},
{
"name": "CVE-2024-45029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45029"
},
{
"name": "CVE-2024-46673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46673"
},
{
"name": "CVE-2024-46675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46675"
},
{
"name": "CVE-2024-46676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46676"
},
{
"name": "CVE-2024-46677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46677"
},
{
"name": "CVE-2024-46679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46679"
},
{
"name": "CVE-2024-46685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46685"
},
{
"name": "CVE-2024-46686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46686"
},
{
"name": "CVE-2024-46689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46689"
},
{
"name": "CVE-2024-46694",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46694"
},
{
"name": "CVE-2024-46702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46702"
},
{
"name": "CVE-2024-46707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46707"
},
{
"name": "CVE-2024-46711",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46711"
},
{
"name": "CVE-2024-46713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46713"
},
{
"name": "CVE-2024-46714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46714"
},
{
"name": "CVE-2024-46715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46715"
},
{
"name": "CVE-2024-46716",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46716"
},
{
"name": "CVE-2024-46717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46717"
},
{
"name": "CVE-2024-46719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46719"
},
{
"name": "CVE-2024-46720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46720"
},
{
"name": "CVE-2024-46721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46721"
},
{
"name": "CVE-2024-46722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46722"
},
{
"name": "CVE-2024-46723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46723"
},
{
"name": "CVE-2024-46724",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46724"
},
{
"name": "CVE-2024-46725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46725"
},
{
"name": "CVE-2024-46726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46726"
},
{
"name": "CVE-2024-46731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46731"
},
{
"name": "CVE-2024-46732",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46732"
},
{
"name": "CVE-2024-46735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46735"
},
{
"name": "CVE-2024-46737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46737"
},
{
"name": "CVE-2024-46738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46738"
},
{
"name": "CVE-2024-46739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46739"
},
{
"name": "CVE-2024-46740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46740"
},
{
"name": "CVE-2024-46743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46743"
},
{
"name": "CVE-2024-46744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46744"
},
{
"name": "CVE-2024-46745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46745"
},
{
"name": "CVE-2024-46746",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46746"
},
{
"name": "CVE-2024-46747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46747"
},
{
"name": "CVE-2024-46750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46750"
},
{
"name": "CVE-2024-46752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46752"
},
{
"name": "CVE-2024-46755",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46755"
},
{
"name": "CVE-2024-46756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46756"
},
{
"name": "CVE-2024-46757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46757"
},
{
"name": "CVE-2024-46758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46758"
},
{
"name": "CVE-2024-46759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46759"
},
{
"name": "CVE-2024-46761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46761"
},
{
"name": "CVE-2024-46763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46763"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2024-46771",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46771"
},
{
"name": "CVE-2024-46773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46773"
},
{
"name": "CVE-2024-46777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46777"
},
{
"name": "CVE-2024-46780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46780"
},
{
"name": "CVE-2024-46781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46781"
},
{
"name": "CVE-2024-46782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46782"
},
{
"name": "CVE-2024-46783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46783"
},
{
"name": "CVE-2024-46784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46784"
},
{
"name": "CVE-2024-46791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46791"
},
{
"name": "CVE-2024-46794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46794"
},
{
"name": "CVE-2024-46795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46795"
},
{
"name": "CVE-2024-46798",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46798"
},
{
"name": "CVE-2024-46800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46800"
},
{
"name": "CVE-2024-46802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46802"
},
{
"name": "CVE-2024-46804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46804"
},
{
"name": "CVE-2024-46805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46805"
},
{
"name": "CVE-2024-46807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46807"
},
{
"name": "CVE-2024-46810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46810"
},
{
"name": "CVE-2024-46812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46812"
},
{
"name": "CVE-2024-46814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46814"
},
{
"name": "CVE-2024-46815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46815"
},
{
"name": "CVE-2024-46817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46817"
},
{
"name": "CVE-2024-46818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46818"
},
{
"name": "CVE-2024-46819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46819"
},
{
"name": "CVE-2024-46821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46821"
},
{
"name": "CVE-2024-46822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46822"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-46828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46828"
},
{
"name": "CVE-2024-46829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46829"
},
{
"name": "CVE-2024-46830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46830"
},
{
"name": "CVE-2024-46832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46832"
},
{
"name": "CVE-2024-46835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46835"
},
{
"name": "CVE-2024-46836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46836"
},
{
"name": "CVE-2024-46840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46840"
},
{
"name": "CVE-2024-46844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46844"
},
{
"name": "CVE-2024-46846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46846"
},
{
"name": "CVE-2024-46848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46848"
},
{
"name": "CVE-2024-46849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46849"
},
{
"name": "CVE-2024-46852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46852"
},
{
"name": "CVE-2024-46853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46853"
},
{
"name": "CVE-2024-46854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46854"
},
{
"name": "CVE-2024-46855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46855"
},
{
"name": "CVE-2024-46857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46857"
},
{
"name": "CVE-2024-46858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46858"
},
{
"name": "CVE-2024-46859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46859"
},
{
"name": "CVE-2024-42272",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42272"
},
{
"name": "CVE-2024-42297",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42297"
},
{
"name": "CVE-2024-41082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41082"
},
{
"name": "CVE-2024-42252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42252"
},
{
"name": "CVE-2024-42265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42265"
},
{
"name": "CVE-2024-42294",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42294"
},
{
"name": "CVE-2024-42304",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42304"
},
{
"name": "CVE-2024-42305",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42305"
},
{
"name": "CVE-2024-42306",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42306"
},
{
"name": "CVE-2024-43828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43828"
},
{
"name": "CVE-2024-43832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43832"
},
{
"name": "CVE-2024-43845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43845"
},
{
"name": "CVE-2024-43870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43870"
},
{
"name": "CVE-2024-43886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43886"
},
{
"name": "CVE-2024-43890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43890"
},
{
"name": "CVE-2024-43914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43914"
},
{
"name": "CVE-2024-44935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44935"
},
{
"name": "CVE-2024-44944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44944"
},
{
"name": "CVE-2024-44948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44948"
},
{
"name": "CVE-2024-44950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44950"
},
{
"name": "CVE-2024-44954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44954"
},
{
"name": "CVE-2024-44960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44960"
},
{
"name": "CVE-2024-44961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44961"
},
{
"name": "CVE-2024-44962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44962"
},
{
"name": "CVE-2024-44965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44965"
},
{
"name": "CVE-2024-44967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44967"
},
{
"name": "CVE-2024-44969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44969"
},
{
"name": "CVE-2024-44970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44970"
},
{
"name": "CVE-2024-44971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44971"
},
{
"name": "CVE-2024-44972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44972"
},
{
"name": "CVE-2024-44984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44984"
},
{
"name": "CVE-2024-45001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45001"
},
{
"name": "CVE-2024-45005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45005"
},
{
"name": "CVE-2024-45012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45012"
},
{
"name": "CVE-2024-45013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45013"
},
{
"name": "CVE-2024-45015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45015"
},
{
"name": "CVE-2024-45017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45017"
},
{
"name": "CVE-2024-45020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45020"
},
{
"name": "CVE-2024-45030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45030"
},
{
"name": "CVE-2024-46672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46672"
},
{
"name": "CVE-2024-46678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46678"
},
{
"name": "CVE-2024-46687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46687"
},
{
"name": "CVE-2024-46691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46691"
},
{
"name": "CVE-2024-46692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46692"
},
{
"name": "CVE-2024-46693",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46693"
},
{
"name": "CVE-2024-46695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46695"
},
{
"name": "CVE-2024-46706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46706"
},
{
"name": "CVE-2024-46709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46709"
},
{
"name": "CVE-2024-46710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46710"
},
{
"name": "CVE-2024-46727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46727"
},
{
"name": "CVE-2024-46728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46728"
},
{
"name": "CVE-2024-46729",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46729"
},
{
"name": "CVE-2024-46730",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46730"
},
{
"name": "CVE-2024-46741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46741"
},
{
"name": "CVE-2024-46749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46749"
},
{
"name": "CVE-2024-46751",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46751"
},
{
"name": "CVE-2024-46753",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46753"
},
{
"name": "CVE-2024-46760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46760"
},
{
"name": "CVE-2024-46767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46767"
},
{
"name": "CVE-2024-46772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46772"
},
{
"name": "CVE-2024-46774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46774"
},
{
"name": "CVE-2024-46775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46775"
},
{
"name": "CVE-2024-46776",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46776"
},
{
"name": "CVE-2024-46778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46778"
},
{
"name": "CVE-2024-46786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46786"
},
{
"name": "CVE-2024-46787",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46787"
},
{
"name": "CVE-2024-46797",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46797"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2023-52888",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52888"
},
{
"name": "CVE-2023-52918",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52918"
},
{
"name": "CVE-2024-41018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41018"
},
{
"name": "CVE-2024-41019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41019"
},
{
"name": "CVE-2024-41021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41021"
},
{
"name": "CVE-2024-41029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41029"
},
{
"name": "CVE-2024-41030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41030"
},
{
"name": "CVE-2024-41033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41033"
},
{
"name": "CVE-2024-41052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41052"
},
{
"name": "CVE-2024-41053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41053"
},
{
"name": "CVE-2024-41054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41054"
},
{
"name": "CVE-2024-41067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41067"
},
{
"name": "CVE-2024-41083",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41083"
},
{
"name": "CVE-2024-41085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41085"
},
{
"name": "CVE-2024-41086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41086"
},
{
"name": "CVE-2024-42063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42063"
},
{
"name": "CVE-2024-42065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42065"
},
{
"name": "CVE-2024-42066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42066"
},
{
"name": "CVE-2024-42067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42067"
},
{
"name": "CVE-2024-42088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42088"
},
{
"name": "CVE-2024-42091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42091"
},
{
"name": "CVE-2024-42100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42100"
},
{
"name": "CVE-2024-42103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42103"
},
{
"name": "CVE-2024-42108",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42108"
},
{
"name": "CVE-2024-42111",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42111"
},
{
"name": "CVE-2024-42112",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42112"
},
{
"name": "CVE-2024-42118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42118"
},
{
"name": "CVE-2024-42128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42128"
},
{
"name": "CVE-2024-42129",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42129"
},
{
"name": "CVE-2024-42135",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42135"
},
{
"name": "CVE-2024-42146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42146"
},
{
"name": "CVE-2024-42149",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42149"
},
{
"name": "CVE-2024-42150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42150"
},
{
"name": "CVE-2024-42151",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42151"
},
{
"name": "CVE-2024-42231",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42231"
},
{
"name": "CVE-2024-42234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42234"
},
{
"name": "CVE-2024-42235",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42235"
},
{
"name": "CVE-2024-42248",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42248"
},
{
"name": "CVE-2024-42251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42251"
},
{
"name": "CVE-2024-47659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47659"
},
{
"name": "CVE-2024-47663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47663"
},
{
"name": "CVE-2024-47667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47667"
},
{
"name": "CVE-2024-47669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47669"
},
{
"name": "CVE-2024-42258",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42258"
},
{
"name": "CVE-2024-43857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43857"
},
{
"name": "CVE-2024-46754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46754"
},
{
"name": "CVE-2024-46766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46766"
},
{
"name": "CVE-2024-46803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46803"
},
{
"name": "CVE-2024-46806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46806"
},
{
"name": "CVE-2024-46809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46809"
},
{
"name": "CVE-2024-46811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46811"
},
{
"name": "CVE-2024-46813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46813"
},
{
"name": "CVE-2024-46816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46816"
},
{
"name": "CVE-2024-46825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46825"
},
{
"name": "CVE-2024-46827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46827"
},
{
"name": "CVE-2024-46831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46831"
},
{
"name": "CVE-2024-46834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46834"
},
{
"name": "CVE-2024-46841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46841"
},
{
"name": "CVE-2024-46842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46842"
},
{
"name": "CVE-2024-46843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46843"
},
{
"name": "CVE-2024-46851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46851"
},
{
"name": "CVE-2024-46860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46860"
},
{
"name": "CVE-2024-46861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46861"
},
{
"name": "CVE-2024-46864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46864"
},
{
"name": "CVE-2024-46870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46870"
},
{
"name": "CVE-2024-46871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46871"
},
{
"name": "CVE-2024-47658",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47658"
},
{
"name": "CVE-2024-47661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47661"
},
{
"name": "CVE-2024-42267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42267"
},
{
"name": "CVE-2024-42296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42296"
},
{
"name": "CVE-2024-42299",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42299"
},
{
"name": "CVE-2024-43869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43869"
},
{
"name": "CVE-2024-44934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44934"
},
{
"name": "CVE-2024-44958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44958"
},
{
"name": "CVE-2024-44966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44966"
},
{
"name": "CVE-2024-47660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47660"
},
{
"name": "CVE-2024-47665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47665"
},
{
"name": "CVE-2024-47662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47662"
},
{
"name": "CVE-2024-47664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47664"
},
{
"name": "CVE-2024-47674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47674"
},
{
"name": "CVE-2024-46824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46824"
},
{
"name": "CVE-2024-44942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44942"
},
{
"name": "CVE-2024-43868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43868"
},
{
"name": "CVE-2024-42260",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42260"
},
{
"name": "CVE-2024-42261",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42261"
},
{
"name": "CVE-2024-42262",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42262"
},
{
"name": "CVE-2024-42263",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42263"
},
{
"name": "CVE-2024-42264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42264"
},
{
"name": "CVE-2024-42273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42273"
},
{
"name": "CVE-2024-42307",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42307"
},
{
"name": "CVE-2024-42317",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42317"
},
{
"name": "CVE-2024-42321",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42321"
},
{
"name": "CVE-2024-43820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43820"
},
{
"name": "CVE-2024-43827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43827"
},
{
"name": "CVE-2024-43843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43843"
},
{
"name": "CVE-2024-43852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43852"
},
{
"name": "CVE-2024-43887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43887"
},
{
"name": "CVE-2024-43888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43888"
},
{
"name": "CVE-2024-43891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43891"
},
{
"name": "CVE-2024-43910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43910"
},
{
"name": "CVE-2024-43913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43913"
},
{
"name": "CVE-2024-44937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44937"
},
{
"name": "CVE-2024-44941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44941"
},
{
"name": "CVE-2024-44943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44943"
},
{
"name": "CVE-2024-44953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44953"
},
{
"name": "CVE-2024-44956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44956"
},
{
"name": "CVE-2024-44957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44957"
},
{
"name": "CVE-2024-44959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44959"
},
{
"name": "CVE-2024-44963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44963"
},
{
"name": "CVE-2024-44973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44973"
},
{
"name": "CVE-2024-44975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44975"
},
{
"name": "CVE-2024-44978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44978"
},
{
"name": "CVE-2024-44979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44979"
},
{
"name": "CVE-2024-44980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44980"
},
{
"name": "CVE-2024-44993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44993"
},
{
"name": "CVE-2024-44996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44996"
},
{
"name": "CVE-2024-45027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45027"
},
{
"name": "CVE-2024-46680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46680"
},
{
"name": "CVE-2024-46681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46681"
},
{
"name": "CVE-2024-46683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46683"
},
{
"name": "CVE-2024-46697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46697"
},
{
"name": "CVE-2024-46698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46698"
},
{
"name": "CVE-2024-46701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46701"
},
{
"name": "CVE-2024-46703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46703"
},
{
"name": "CVE-2024-46705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46705"
},
{
"name": "CVE-2024-46708",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46708"
},
{
"name": "CVE-2024-46718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46718"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2024-46762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46762"
},
{
"name": "CVE-2024-46765",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46765"
},
{
"name": "CVE-2024-46768",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46768"
},
{
"name": "CVE-2024-46779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46779"
},
{
"name": "CVE-2024-46785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46785"
},
{
"name": "CVE-2024-46788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46788"
},
{
"name": "CVE-2024-46792",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46792"
},
{
"name": "CVE-2024-46793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46793"
},
{
"name": "CVE-2024-46808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46808"
},
{
"name": "CVE-2024-46823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46823"
},
{
"name": "CVE-2024-46838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46838"
},
{
"name": "CVE-2024-46845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46845"
},
{
"name": "CVE-2024-46847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46847"
},
{
"name": "CVE-2024-46850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46850"
},
{
"name": "CVE-2024-46866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46866"
},
{
"name": "CVE-2024-46867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46867"
},
{
"name": "CVE-2024-46868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46868"
},
{
"name": "CVE-2024-47666",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47666"
},
{
"name": "CVE-2024-47683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47683"
},
{
"name": "CVE-2024-49984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49984"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-1080",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-12-13T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Elles permettent \u00e0 un attaquant de provoquer un probl\u00e8me de s\u00e9curit\u00e9 non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2024-12-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7144-1",
"url": "https://ubuntu.com/security/notices/USN-7144-1"
},
{
"published_at": "2024-12-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7159-1",
"url": "https://ubuntu.com/security/notices/USN-7159-1"
},
{
"published_at": "2024-12-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7155-1",
"url": "https://ubuntu.com/security/notices/USN-7155-1"
},
{
"published_at": "2024-12-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7154-1",
"url": "https://ubuntu.com/security/notices/USN-7154-1"
},
{
"published_at": "2024-12-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7148-1",
"url": "https://ubuntu.com/security/notices/USN-7148-1"
},
{
"published_at": "2024-12-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7156-1",
"url": "https://ubuntu.com/security/notices/USN-7156-1"
}
]
}
CERTFR-2025-AVI-0002
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de Debian LTS. Elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et un déni de service.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | |||
|---|---|---|---|---|---|
|
|||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Debian LTS bullseye versions ant\u00e9rieures \u00e0 6.1.119-1~deb11u1",
"product": {
"name": "Debian",
"vendor": {
"name": "Debian",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-45888",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45888"
},
{
"name": "CVE-2023-31083",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31083"
},
{
"name": "CVE-2024-27072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27072"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-27397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27397"
},
{
"name": "CVE-2024-26952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26952"
},
{
"name": "CVE-2024-26954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26954"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2023-52760",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52760"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-39298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39298"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39484"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39495",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39495"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-39510",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39510"
},
{
"name": "CVE-2024-40899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40899"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40905"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40910"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40913"
},
{
"name": "CVE-2024-40914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40914"
},
{
"name": "CVE-2024-40915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40915"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40920"
},
{
"name": "CVE-2024-40921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40921"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40938"
},
{
"name": "CVE-2024-40939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40939"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40957"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40963"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40968"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40971"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40980"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40993"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-40996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40996"
},
{
"name": "CVE-2024-41000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41000"
},
{
"name": "CVE-2024-41001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41001"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-52812",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52812"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2024-41020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41020"
},
{
"name": "CVE-2024-41022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41022"
},
{
"name": "CVE-2024-41034",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41034"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2024-41046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41046"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2024-41065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41065"
},
{
"name": "CVE-2024-41068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41068"
},
{
"name": "CVE-2024-41077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41077"
},
{
"name": "CVE-2024-42101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42101"
},
{
"name": "CVE-2024-42102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42102"
},
{
"name": "CVE-2024-42104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42104"
},
{
"name": "CVE-2024-42106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42106"
},
{
"name": "CVE-2024-42115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42115"
},
{
"name": "CVE-2024-42121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42121"
},
{
"name": "CVE-2024-42127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42127"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2024-42137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42137"
},
{
"name": "CVE-2024-42148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42148"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-42153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42153"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42157"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2024-42110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42110"
},
{
"name": "CVE-2024-41073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41073"
},
{
"name": "CVE-2024-41096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41096"
},
{
"name": "CVE-2024-42082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42082"
},
{
"name": "CVE-2023-52887",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52887"
},
{
"name": "CVE-2024-36244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36244"
},
{
"name": "CVE-2024-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38632"
},
{
"name": "CVE-2024-41027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41027"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2024-42068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42068"
},
{
"name": "CVE-2024-42076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42076"
},
{
"name": "CVE-2024-42077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42077"
},
{
"name": "CVE-2024-42080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42080"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2024-42085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42085"
},
{
"name": "CVE-2024-42086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42086"
},
{
"name": "CVE-2024-42087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42087"
},
{
"name": "CVE-2024-42089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42089"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2024-42092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42092"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2024-42095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42095"
},
{
"name": "CVE-2024-42097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42097"
},
{
"name": "CVE-2024-42098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42098"
},
{
"name": "CVE-2024-42109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42109"
},
{
"name": "CVE-2024-42130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42130"
},
{
"name": "CVE-2024-42140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42140"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2024-42270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42270"
},
{
"name": "CVE-2023-52889",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52889"
},
{
"name": "CVE-2024-41028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41028"
},
{
"name": "CVE-2024-41036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41036"
},
{
"name": "CVE-2024-41038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41038"
},
{
"name": "CVE-2024-41039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41039"
},
{
"name": "CVE-2024-41042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41042"
},
{
"name": "CVE-2024-41050",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41050"
},
{
"name": "CVE-2024-41051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41051"
},
{
"name": "CVE-2024-41056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41056"
},
{
"name": "CVE-2024-41062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41062"
},
{
"name": "CVE-2024-41074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41074"
},
{
"name": "CVE-2024-41075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41075"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2024-41080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41080"
},
{
"name": "CVE-2024-41088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41088"
},
{
"name": "CVE-2024-41098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41098"
},
{
"name": "CVE-2024-42073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42073"
},
{
"name": "CVE-2024-42114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42114"
},
{
"name": "CVE-2024-42126",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42126"
},
{
"name": "CVE-2024-42136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42136"
},
{
"name": "CVE-2024-42138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42138"
},
{
"name": "CVE-2024-42142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42142"
},
{
"name": "CVE-2024-42147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42147"
},
{
"name": "CVE-2024-42159",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42159"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2024-42237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42237"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2024-42245",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42245"
},
{
"name": "CVE-2024-42246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42246"
},
{
"name": "CVE-2024-42250",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42250"
},
{
"name": "CVE-2024-42253",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42253"
},
{
"name": "CVE-2024-42259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42259"
},
{
"name": "CVE-2024-42268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42268"
},
{
"name": "CVE-2024-42269",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42269"
},
{
"name": "CVE-2024-42271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42271"
},
{
"name": "CVE-2024-42274",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42274"
},
{
"name": "CVE-2024-42276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42276"
},
{
"name": "CVE-2024-42277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42277"
},
{
"name": "CVE-2024-42280",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42280"
},
{
"name": "CVE-2024-42281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42281"
},
{
"name": "CVE-2024-42283",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42283"
},
{
"name": "CVE-2024-42284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42284"
},
{
"name": "CVE-2024-42285",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42285"
},
{
"name": "CVE-2024-42286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42286"
},
{
"name": "CVE-2024-42287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42287"
},
{
"name": "CVE-2024-42288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42288"
},
{
"name": "CVE-2024-42289",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42289"
},
{
"name": "CVE-2024-42290",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42290"
},
{
"name": "CVE-2024-42291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42291"
},
{
"name": "CVE-2024-42292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42292"
},
{
"name": "CVE-2024-42295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42295"
},
{
"name": "CVE-2024-42301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42301"
},
{
"name": "CVE-2024-42302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42302"
},
{
"name": "CVE-2024-42309",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42309"
},
{
"name": "CVE-2024-42310",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42310"
},
{
"name": "CVE-2024-42311",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42311"
},
{
"name": "CVE-2024-42312",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42312"
},
{
"name": "CVE-2024-42313",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42313"
},
{
"name": "CVE-2024-42314",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42314"
},
{
"name": "CVE-2024-42316",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42316"
},
{
"name": "CVE-2024-42318",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42318"
},
{
"name": "CVE-2024-42320",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42320"
},
{
"name": "CVE-2024-42322",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42322"
},
{
"name": "CVE-2024-43817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43817"
},
{
"name": "CVE-2024-43818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43818"
},
{
"name": "CVE-2024-43823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43823"
},
{
"name": "CVE-2024-43829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43829"
},
{
"name": "CVE-2024-43830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43830"
},
{
"name": "CVE-2024-43833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43833"
},
{
"name": "CVE-2024-43834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43834"
},
{
"name": "CVE-2024-43837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43837"
},
{
"name": "CVE-2024-43839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43839"
},
{
"name": "CVE-2024-43841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43841"
},
{
"name": "CVE-2024-43842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43842"
},
{
"name": "CVE-2024-43846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43846"
},
{
"name": "CVE-2024-43849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43849"
},
{
"name": "CVE-2024-43851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43851"
},
{
"name": "CVE-2024-43853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43853"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-43855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43855"
},
{
"name": "CVE-2024-43856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43856"
},
{
"name": "CVE-2024-43858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43858"
},
{
"name": "CVE-2024-43860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43860"
},
{
"name": "CVE-2024-43861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43861"
},
{
"name": "CVE-2024-43863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43863"
},
{
"name": "CVE-2024-43866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43866"
},
{
"name": "CVE-2024-43867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43867"
},
{
"name": "CVE-2024-43871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43871"
},
{
"name": "CVE-2024-43873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43873"
},
{
"name": "CVE-2024-43875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43875"
},
{
"name": "CVE-2024-43876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43876"
},
{
"name": "CVE-2024-43877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43877"
},
{
"name": "CVE-2024-43879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43879"
},
{
"name": "CVE-2024-43880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43880"
},
{
"name": "CVE-2024-43882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43882"
},
{
"name": "CVE-2024-43883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43883"
},
{
"name": "CVE-2024-43884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43884"
},
{
"name": "CVE-2024-43889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43889"
},
{
"name": "CVE-2024-43892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43892"
},
{
"name": "CVE-2024-43893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43893"
},
{
"name": "CVE-2024-43894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43894"
},
{
"name": "CVE-2024-43895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43895"
},
{
"name": "CVE-2024-43897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43897"
},
{
"name": "CVE-2024-43900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43900"
},
{
"name": "CVE-2024-43902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43902"
},
{
"name": "CVE-2024-43904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43904"
},
{
"name": "CVE-2024-43905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43905"
},
{
"name": "CVE-2024-43907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43907"
},
{
"name": "CVE-2024-43908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43908"
},
{
"name": "CVE-2024-43909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43909"
},
{
"name": "CVE-2024-43911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43911"
},
{
"name": "CVE-2024-43912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43912"
},
{
"name": "CVE-2024-44931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44931"
},
{
"name": "CVE-2024-44938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44938"
},
{
"name": "CVE-2024-44939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44939"
},
{
"name": "CVE-2024-44947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44947"
},
{
"name": "CVE-2024-42160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42160"
},
{
"name": "CVE-2024-45003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45003"
},
{
"name": "CVE-2024-43835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43835"
},
{
"name": "CVE-2024-43859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43859"
},
{
"name": "CVE-2024-44940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44940"
},
{
"name": "CVE-2024-44946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44946"
},
{
"name": "CVE-2024-44974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44974"
},
{
"name": "CVE-2024-44977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44977"
},
{
"name": "CVE-2024-44982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44982"
},
{
"name": "CVE-2024-44983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44983"
},
{
"name": "CVE-2024-44985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44985"
},
{
"name": "CVE-2024-44986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44986"
},
{
"name": "CVE-2024-44987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44987"
},
{
"name": "CVE-2024-44988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44988"
},
{
"name": "CVE-2024-44989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44989"
},
{
"name": "CVE-2024-44990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44990"
},
{
"name": "CVE-2024-44991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44991"
},
{
"name": "CVE-2024-44995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44995"
},
{
"name": "CVE-2024-44998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44998"
},
{
"name": "CVE-2024-44999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44999"
},
{
"name": "CVE-2024-45000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45000"
},
{
"name": "CVE-2024-45002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45002"
},
{
"name": "CVE-2024-45006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45006"
},
{
"name": "CVE-2024-45007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45007"
},
{
"name": "CVE-2024-45008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45008"
},
{
"name": "CVE-2024-45009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45009"
},
{
"name": "CVE-2024-45010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45010"
},
{
"name": "CVE-2024-45011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45011"
},
{
"name": "CVE-2024-45016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45016"
},
{
"name": "CVE-2024-45018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45018"
},
{
"name": "CVE-2024-45019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45019"
},
{
"name": "CVE-2024-45021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45021"
},
{
"name": "CVE-2024-45022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45022"
},
{
"name": "CVE-2024-45025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45025"
},
{
"name": "CVE-2024-45026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45026"
},
{
"name": "CVE-2024-45028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45028"
},
{
"name": "CVE-2024-45029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45029"
},
{
"name": "CVE-2024-46673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46673"
},
{
"name": "CVE-2024-46674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46674"
},
{
"name": "CVE-2024-46675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46675"
},
{
"name": "CVE-2024-46676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46676"
},
{
"name": "CVE-2024-46677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46677"
},
{
"name": "CVE-2024-46679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46679"
},
{
"name": "CVE-2024-46685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46685"
},
{
"name": "CVE-2024-46686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46686"
},
{
"name": "CVE-2024-46689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46689"
},
{
"name": "CVE-2024-46694",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46694"
},
{
"name": "CVE-2024-46702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46702"
},
{
"name": "CVE-2024-46707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46707"
},
{
"name": "CVE-2024-46711",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46711"
},
{
"name": "CVE-2024-46713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46713"
},
{
"name": "CVE-2024-46714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46714"
},
{
"name": "CVE-2024-46715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46715"
},
{
"name": "CVE-2024-46716",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46716"
},
{
"name": "CVE-2024-46717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46717"
},
{
"name": "CVE-2024-46719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46719"
},
{
"name": "CVE-2024-46720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46720"
},
{
"name": "CVE-2024-46721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46721"
},
{
"name": "CVE-2024-46722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46722"
},
{
"name": "CVE-2024-46723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46723"
},
{
"name": "CVE-2024-46724",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46724"
},
{
"name": "CVE-2024-46725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46725"
},
{
"name": "CVE-2024-46726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46726"
},
{
"name": "CVE-2024-46731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46731"
},
{
"name": "CVE-2024-46732",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46732"
},
{
"name": "CVE-2024-46734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46734"
},
{
"name": "CVE-2024-46735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46735"
},
{
"name": "CVE-2024-46737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46737"
},
{
"name": "CVE-2024-46738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46738"
},
{
"name": "CVE-2024-46739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46739"
},
{
"name": "CVE-2024-46740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46740"
},
{
"name": "CVE-2024-46743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46743"
},
{
"name": "CVE-2024-46744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46744"
},
{
"name": "CVE-2024-46745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46745"
},
{
"name": "CVE-2024-46746",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46746"
},
{
"name": "CVE-2024-46747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46747"
},
{
"name": "CVE-2024-46750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46750"
},
{
"name": "CVE-2024-46752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46752"
},
{
"name": "CVE-2024-46755",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46755"
},
{
"name": "CVE-2024-46756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46756"
},
{
"name": "CVE-2024-46757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46757"
},
{
"name": "CVE-2024-46758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46758"
},
{
"name": "CVE-2024-46759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46759"
},
{
"name": "CVE-2024-46761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46761"
},
{
"name": "CVE-2024-46763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46763"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2024-46771",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46771"
},
{
"name": "CVE-2024-46773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46773"
},
{
"name": "CVE-2024-46777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46777"
},
{
"name": "CVE-2024-46780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46780"
},
{
"name": "CVE-2024-46781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46781"
},
{
"name": "CVE-2024-46782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46782"
},
{
"name": "CVE-2024-46783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46783"
},
{
"name": "CVE-2024-46784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46784"
},
{
"name": "CVE-2024-46791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46791"
},
{
"name": "CVE-2024-46794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46794"
},
{
"name": "CVE-2024-46795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46795"
},
{
"name": "CVE-2024-46798",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46798"
},
{
"name": "CVE-2024-46800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46800"
},
{
"name": "CVE-2024-46802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46802"
},
{
"name": "CVE-2024-46804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46804"
},
{
"name": "CVE-2024-46805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46805"
},
{
"name": "CVE-2024-46807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46807"
},
{
"name": "CVE-2024-46810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46810"
},
{
"name": "CVE-2024-46812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46812"
},
{
"name": "CVE-2024-46814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46814"
},
{
"name": "CVE-2024-46815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46815"
},
{
"name": "CVE-2024-46817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46817"
},
{
"name": "CVE-2024-46818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46818"
},
{
"name": "CVE-2024-46819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46819"
},
{
"name": "CVE-2024-46821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46821"
},
{
"name": "CVE-2024-46822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46822"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-46828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46828"
},
{
"name": "CVE-2024-46829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46829"
},
{
"name": "CVE-2024-46830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46830"
},
{
"name": "CVE-2024-46832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46832"
},
{
"name": "CVE-2024-46835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46835"
},
{
"name": "CVE-2024-46836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46836"
},
{
"name": "CVE-2024-46840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46840"
},
{
"name": "CVE-2024-46844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46844"
},
{
"name": "CVE-2024-46846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46846"
},
{
"name": "CVE-2024-46848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46848"
},
{
"name": "CVE-2024-46849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46849"
},
{
"name": "CVE-2024-46852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46852"
},
{
"name": "CVE-2024-46853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46853"
},
{
"name": "CVE-2024-46854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46854"
},
{
"name": "CVE-2024-46855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46855"
},
{
"name": "CVE-2024-46857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46857"
},
{
"name": "CVE-2024-46858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46858"
},
{
"name": "CVE-2024-46859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46859"
},
{
"name": "CVE-2024-46865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46865"
},
{
"name": "CVE-2024-42272",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42272"
},
{
"name": "CVE-2024-42297",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42297"
},
{
"name": "CVE-2024-44968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44968"
},
{
"name": "CVE-2024-42265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42265"
},
{
"name": "CVE-2024-42304",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42304"
},
{
"name": "CVE-2024-42305",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42305"
},
{
"name": "CVE-2024-42306",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42306"
},
{
"name": "CVE-2024-43828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43828"
},
{
"name": "CVE-2024-43832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43832"
},
{
"name": "CVE-2024-43870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43870"
},
{
"name": "CVE-2024-43890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43890"
},
{
"name": "CVE-2024-43914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43914"
},
{
"name": "CVE-2024-44935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44935"
},
{
"name": "CVE-2024-44944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44944"
},
{
"name": "CVE-2024-44948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44948"
},
{
"name": "CVE-2024-44954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44954"
},
{
"name": "CVE-2024-44960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44960"
},
{
"name": "CVE-2024-44965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44965"
},
{
"name": "CVE-2024-44967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44967"
},
{
"name": "CVE-2024-44969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44969"
},
{
"name": "CVE-2024-44970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44970"
},
{
"name": "CVE-2024-44971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44971"
},
{
"name": "CVE-2024-46695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46695"
},
{
"name": "CVE-2024-46710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46710"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2023-52918",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52918"
},
{
"name": "CVE-2024-41019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41019"
},
{
"name": "CVE-2024-41030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41030"
},
{
"name": "CVE-2024-42063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42063"
},
{
"name": "CVE-2024-42103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42103"
},
{
"name": "CVE-2024-47659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47659"
},
{
"name": "CVE-2024-47663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47663"
},
{
"name": "CVE-2024-47667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47667"
},
{
"name": "CVE-2024-47669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47669"
},
{
"name": "CVE-2024-42258",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42258"
},
{
"name": "CVE-2023-52917",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52917"
},
{
"name": "CVE-2024-46871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46871"
},
{
"name": "CVE-2024-42267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42267"
},
{
"name": "CVE-2024-42296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42296"
},
{
"name": "CVE-2024-42299",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42299"
},
{
"name": "CVE-2024-43869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43869"
},
{
"name": "CVE-2024-44934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44934"
},
{
"name": "CVE-2024-44958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44958"
},
{
"name": "CVE-2024-44966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44966"
},
{
"name": "CVE-2024-47660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47660"
},
{
"name": "CVE-2024-47665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47665"
},
{
"name": "CVE-2024-47670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47670"
},
{
"name": "CVE-2024-47671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47671"
},
{
"name": "CVE-2024-47672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47672"
},
{
"name": "CVE-2024-47673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47673"
},
{
"name": "CVE-2024-47674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47674"
},
{
"name": "CVE-2024-47682",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47682"
},
{
"name": "CVE-2024-47684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47684"
},
{
"name": "CVE-2024-47685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47685"
},
{
"name": "CVE-2024-47686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47686"
},
{
"name": "CVE-2024-47692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47692"
},
{
"name": "CVE-2024-47693",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47693"
},
{
"name": "CVE-2024-47695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47695"
},
{
"name": "CVE-2024-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47696"
},
{
"name": "CVE-2024-47697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47697"
},
{
"name": "CVE-2024-47698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47698"
},
{
"name": "CVE-2024-47699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47699"
},
{
"name": "CVE-2024-47705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47705"
},
{
"name": "CVE-2024-47706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47706"
},
{
"name": "CVE-2024-47707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47707"
},
{
"name": "CVE-2024-47709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47709"
},
{
"name": "CVE-2024-47710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47710"
},
{
"name": "CVE-2024-47712",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47712"
},
{
"name": "CVE-2024-47713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47713"
},
{
"name": "CVE-2024-47718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47718"
},
{
"name": "CVE-2024-47720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47720"
},
{
"name": "CVE-2024-47723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47723"
},
{
"name": "CVE-2024-47727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47727"
},
{
"name": "CVE-2024-47728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47728"
},
{
"name": "CVE-2024-47730",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47730"
},
{
"name": "CVE-2024-47731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47731"
},
{
"name": "CVE-2024-47735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47735"
},
{
"name": "CVE-2024-47737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47737"
},
{
"name": "CVE-2024-47738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47738"
},
{
"name": "CVE-2024-47739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47739"
},
{
"name": "CVE-2024-47742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47742"
},
{
"name": "CVE-2024-47743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47743"
},
{
"name": "CVE-2024-47747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47747"
},
{
"name": "CVE-2024-47748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47748"
},
{
"name": "CVE-2024-47749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47749"
},
{
"name": "CVE-2024-47750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47750"
},
{
"name": "CVE-2024-47751",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47751"
},
{
"name": "CVE-2024-47756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47756"
},
{
"name": "CVE-2024-47757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47757"
},
{
"name": "CVE-2024-49850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49850"
},
{
"name": "CVE-2024-49851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49851"
},
{
"name": "CVE-2024-49852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49852"
},
{
"name": "CVE-2024-49853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49853"
},
{
"name": "CVE-2024-49855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49855"
},
{
"name": "CVE-2024-49858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49858"
},
{
"name": "CVE-2024-49860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49860"
},
{
"name": "CVE-2024-49863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49863"
},
{
"name": "CVE-2024-49866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49866"
},
{
"name": "CVE-2024-49867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49867"
},
{
"name": "CVE-2024-49870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49870"
},
{
"name": "CVE-2024-49871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49871"
},
{
"name": "CVE-2024-49875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49875"
},
{
"name": "CVE-2024-49877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49877"
},
{
"name": "CVE-2024-49878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49878"
},
{
"name": "CVE-2024-49879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49879"
},
{
"name": "CVE-2024-49881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49881"
},
{
"name": "CVE-2024-49882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49882"
},
{
"name": "CVE-2024-49883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49883"
},
{
"name": "CVE-2024-49886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49886"
},
{
"name": "CVE-2024-49890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49890"
},
{
"name": "CVE-2024-49892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49892"
},
{
"name": "CVE-2024-49894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49894"
},
{
"name": "CVE-2024-49895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49895"
},
{
"name": "CVE-2024-49896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49896"
},
{
"name": "CVE-2024-49900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49900"
},
{
"name": "CVE-2024-49902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49902"
},
{
"name": "CVE-2024-49903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49903"
},
{
"name": "CVE-2024-49907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49907"
},
{
"name": "CVE-2024-49912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49912"
},
{
"name": "CVE-2024-49913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49913"
},
{
"name": "CVE-2024-49930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49930"
},
{
"name": "CVE-2024-49933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49933"
},
{
"name": "CVE-2024-49935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49935"
},
{
"name": "CVE-2024-49936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49936"
},
{
"name": "CVE-2024-49937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49937"
},
{
"name": "CVE-2024-49938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49938"
},
{
"name": "CVE-2024-49946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49946"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2024-49950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49950"
},
{
"name": "CVE-2024-49954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49954"
},
{
"name": "CVE-2024-49955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49955"
},
{
"name": "CVE-2024-49957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49957"
},
{
"name": "CVE-2024-49958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49958"
},
{
"name": "CVE-2024-49959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49959"
},
{
"name": "CVE-2024-49960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49960"
},
{
"name": "CVE-2024-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49961"
},
{
"name": "CVE-2024-49962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49962"
},
{
"name": "CVE-2024-49963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49963"
},
{
"name": "CVE-2024-49965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49965"
},
{
"name": "CVE-2024-49966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49966"
},
{
"name": "CVE-2024-49967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49967"
},
{
"name": "CVE-2024-49969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49969"
},
{
"name": "CVE-2024-49973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49973"
},
{
"name": "CVE-2024-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49974"
},
{
"name": "CVE-2024-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49975"
},
{
"name": "CVE-2024-49981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49981"
},
{
"name": "CVE-2024-49982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49982"
},
{
"name": "CVE-2024-49985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49985"
},
{
"name": "CVE-2024-49986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49986"
},
{
"name": "CVE-2024-49991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49991"
},
{
"name": "CVE-2024-49995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49995"
},
{
"name": "CVE-2024-50000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50000"
},
{
"name": "CVE-2024-50001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50001"
},
{
"name": "CVE-2024-50002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50002"
},
{
"name": "CVE-2024-50006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50006"
},
{
"name": "CVE-2024-50007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50007"
},
{
"name": "CVE-2024-50008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50008"
},
{
"name": "CVE-2024-50013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50013"
},
{
"name": "CVE-2024-50015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50015"
},
{
"name": "CVE-2024-50019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50019"
},
{
"name": "CVE-2024-50022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50022"
},
{
"name": "CVE-2024-50024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50024"
},
{
"name": "CVE-2024-50031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50031"
},
{
"name": "CVE-2024-50033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50033"
},
{
"name": "CVE-2024-50035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50035"
},
{
"name": "CVE-2024-50040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50040"
},
{
"name": "CVE-2024-50041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50041"
},
{
"name": "CVE-2024-50044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50044"
},
{
"name": "CVE-2024-50045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50045"
},
{
"name": "CVE-2024-50046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50046"
},
{
"name": "CVE-2024-50048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50048"
},
{
"name": "CVE-2024-50049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50049"
},
{
"name": "CVE-2024-50058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50058"
},
{
"name": "CVE-2024-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50059"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2024-50062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50062"
},
{
"name": "CVE-2024-50069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50069"
},
{
"name": "CVE-2024-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50073"
},
{
"name": "CVE-2024-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50074"
},
{
"name": "CVE-2024-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50077"
},
{
"name": "CVE-2024-50078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50078"
},
{
"name": "CVE-2024-43868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43868"
},
{
"name": "CVE-2024-44949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44949"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2024-50036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50036"
},
{
"name": "CVE-2024-50067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50067"
},
{
"name": "CVE-2024-50072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50072"
},
{
"name": "CVE-2024-50126",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50126"
},
{
"name": "CVE-2024-50215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50215"
},
{
"name": "CVE-2024-50218",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50218"
},
{
"name": "CVE-2024-50229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50229"
},
{
"name": "CVE-2024-50230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50230"
},
{
"name": "CVE-2024-50232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50232"
},
{
"name": "CVE-2024-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50233"
},
{
"name": "CVE-2024-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50234"
},
{
"name": "CVE-2024-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50235"
},
{
"name": "CVE-2024-50236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50236"
},
{
"name": "CVE-2024-50237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50237"
},
{
"name": "CVE-2024-50242",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50242"
},
{
"name": "CVE-2024-50243",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50243"
},
{
"name": "CVE-2024-50244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50244"
},
{
"name": "CVE-2024-50245",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50245"
},
{
"name": "CVE-2024-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50247"
},
{
"name": "CVE-2024-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50249"
},
{
"name": "CVE-2024-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50250"
},
{
"name": "CVE-2024-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50251"
},
{
"name": "CVE-2024-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50252"
},
{
"name": "CVE-2024-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50255"
},
{
"name": "CVE-2024-50256",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50256"
},
{
"name": "CVE-2024-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50257"
},
{
"name": "CVE-2024-50259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50259"
},
{
"name": "CVE-2024-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50261"
},
{
"name": "CVE-2024-50262",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50262"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50265"
},
{
"name": "CVE-2024-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50267"
},
{
"name": "CVE-2024-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50268"
},
{
"name": "CVE-2024-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50269"
},
{
"name": "CVE-2024-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50271"
},
{
"name": "CVE-2024-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50272"
},
{
"name": "CVE-2024-50273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50273"
},
{
"name": "CVE-2024-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50276"
},
{
"name": "CVE-2024-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50278"
},
{
"name": "CVE-2024-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50279"
},
{
"name": "CVE-2024-50280",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50280"
},
{
"name": "CVE-2024-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50282"
},
{
"name": "CVE-2024-50283",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50283"
},
{
"name": "CVE-2024-50284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50284"
},
{
"name": "CVE-2024-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50286"
},
{
"name": "CVE-2024-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50287"
},
{
"name": "CVE-2024-50290",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50290"
},
{
"name": "CVE-2024-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50292"
},
{
"name": "CVE-2024-50295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50295"
},
{
"name": "CVE-2024-50296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50296"
},
{
"name": "CVE-2024-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50299"
},
{
"name": "CVE-2024-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50301"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2024-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53042"
},
{
"name": "CVE-2024-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53043"
},
{
"name": "CVE-2024-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53052"
},
{
"name": "CVE-2024-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53055"
},
{
"name": "CVE-2024-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53057"
},
{
"name": "CVE-2024-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53058"
},
{
"name": "CVE-2024-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53059"
},
{
"name": "CVE-2024-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53060"
},
{
"name": "CVE-2024-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53061"
},
{
"name": "CVE-2024-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53063"
},
{
"name": "CVE-2024-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53066"
},
{
"name": "CVE-2024-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53070"
},
{
"name": "CVE-2024-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53072"
},
{
"name": "CVE-2024-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53081"
},
{
"name": "CVE-2024-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53082"
},
{
"name": "CVE-2024-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53088"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2024-50208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50208"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2024-50142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50142"
},
{
"name": "CVE-2024-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50192"
},
{
"name": "CVE-2024-42273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42273"
},
{
"name": "CVE-2024-42307",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42307"
},
{
"name": "CVE-2024-42321",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42321"
},
{
"name": "CVE-2024-47683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47683"
},
{
"name": "CVE-2024-47679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47679"
},
{
"name": "CVE-2024-47690",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47690"
},
{
"name": "CVE-2024-47701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47701"
},
{
"name": "CVE-2024-47734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47734"
},
{
"name": "CVE-2024-47740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47740"
},
{
"name": "CVE-2024-49856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49856"
},
{
"name": "CVE-2024-49868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49868"
},
{
"name": "CVE-2024-49884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49884"
},
{
"name": "CVE-2024-49889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49889"
},
{
"name": "CVE-2024-49905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49905"
},
{
"name": "CVE-2024-49924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49924"
},
{
"name": "CVE-2024-49927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49927"
},
{
"name": "CVE-2024-49944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49944"
},
{
"name": "CVE-2024-49948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49948"
},
{
"name": "CVE-2024-49952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49952"
},
{
"name": "CVE-2024-49977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49977"
},
{
"name": "CVE-2024-49983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49983"
},
{
"name": "CVE-2024-49997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49997"
},
{
"name": "CVE-2024-50003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50003"
},
{
"name": "CVE-2024-50038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50038"
},
{
"name": "CVE-2024-50039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50039"
},
{
"name": "CVE-2024-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50093"
},
{
"name": "CVE-2024-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50095"
},
{
"name": "CVE-2024-50096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50096"
},
{
"name": "CVE-2024-50179",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50179"
},
{
"name": "CVE-2024-50180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50180"
},
{
"name": "CVE-2024-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50181"
},
{
"name": "CVE-2024-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50184"
},
{
"name": "CVE-2024-50186",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50186"
},
{
"name": "CVE-2024-50188",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50188"
},
{
"name": "CVE-2024-50189",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50189"
},
{
"name": "CVE-2024-50191",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50191"
},
{
"name": "CVE-2024-50026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50026"
},
{
"name": "CVE-2024-50087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50087"
},
{
"name": "CVE-2024-50088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50088"
},
{
"name": "CVE-2024-50098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50098"
},
{
"name": "CVE-2024-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50101"
},
{
"name": "CVE-2024-50103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50103"
},
{
"name": "CVE-2024-50108",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50108"
},
{
"name": "CVE-2024-50115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50115"
},
{
"name": "CVE-2024-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50116"
},
{
"name": "CVE-2024-50117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50117"
},
{
"name": "CVE-2024-50124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50124"
},
{
"name": "CVE-2024-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50125"
},
{
"name": "CVE-2024-50127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50127"
},
{
"name": "CVE-2024-50128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50128"
},
{
"name": "CVE-2024-50131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50131"
},
{
"name": "CVE-2024-50134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50134"
},
{
"name": "CVE-2024-50136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50136"
},
{
"name": "CVE-2024-50138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50138"
},
{
"name": "CVE-2024-50141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50141"
},
{
"name": "CVE-2024-50145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50145"
},
{
"name": "CVE-2024-50147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50147"
},
{
"name": "CVE-2024-50148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50148"
},
{
"name": "CVE-2024-50150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50150"
},
{
"name": "CVE-2024-50153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50153"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2024-50155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50155"
},
{
"name": "CVE-2024-50156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50156"
},
{
"name": "CVE-2024-50160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50160"
},
{
"name": "CVE-2024-50167",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50167"
},
{
"name": "CVE-2024-50171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50171"
},
{
"name": "CVE-2024-50176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50176"
},
{
"name": "CVE-2024-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50182"
},
{
"name": "CVE-2024-50183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50183"
},
{
"name": "CVE-2024-50187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50187"
},
{
"name": "CVE-2024-50194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50194"
},
{
"name": "CVE-2024-50195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50195"
},
{
"name": "CVE-2024-50196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50196"
},
{
"name": "CVE-2024-50198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50198"
},
{
"name": "CVE-2024-50200",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50200"
},
{
"name": "CVE-2024-50201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50201"
},
{
"name": "CVE-2024-50205",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50205"
},
{
"name": "CVE-2024-50209",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50209"
},
{
"name": "CVE-2024-50210",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50210"
},
{
"name": "CVE-2024-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53096"
},
{
"name": "CVE-2024-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53100"
},
{
"name": "CVE-2024-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53101"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2024-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53106"
},
{
"name": "CVE-2024-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53110"
},
{
"name": "CVE-2024-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53112"
},
{
"name": "CVE-2024-53121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53121"
},
{
"name": "CVE-2024-53138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53138"
},
{
"name": "CVE-2023-45896",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45896"
},
{
"name": "CVE-2024-47678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47678"
},
{
"name": "CVE-2024-49854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49854"
},
{
"name": "CVE-2024-49859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49859"
},
{
"name": "CVE-2024-49978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49978"
},
{
"name": "CVE-2024-49992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49992"
},
{
"name": "CVE-2024-50010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50010"
},
{
"name": "CVE-2024-50083",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50083"
},
{
"name": "CVE-2024-50085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50085"
},
{
"name": "CVE-2024-50086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50086"
},
{
"name": "CVE-2024-50133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50133"
},
{
"name": "CVE-2024-50143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50143"
},
{
"name": "CVE-2024-50151",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50151"
},
{
"name": "CVE-2024-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50162"
},
{
"name": "CVE-2024-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50163"
},
{
"name": "CVE-2024-50168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50168"
},
{
"name": "CVE-2024-50185",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50185"
},
{
"name": "CVE-2024-50193",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50193"
},
{
"name": "CVE-2024-50199",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50199"
},
{
"name": "CVE-2024-50202",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50202"
},
{
"name": "CVE-2024-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53097"
},
{
"name": "CVE-2024-53103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53103"
},
{
"name": "CVE-2024-53113",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53113"
},
{
"name": "CVE-2024-53119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53119"
},
{
"name": "CVE-2024-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53120"
},
{
"name": "CVE-2024-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53122"
},
{
"name": "CVE-2024-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53123"
},
{
"name": "CVE-2024-53127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53127"
},
{
"name": "CVE-2024-53129",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53129"
},
{
"name": "CVE-2024-53130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53130"
},
{
"name": "CVE-2024-53131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53131"
},
{
"name": "CVE-2024-53135",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53135"
},
{
"name": "CVE-2024-53136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53136"
},
{
"name": "CVE-2024-53140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53140"
},
{
"name": "CVE-2024-53144",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53144"
},
{
"name": "CVE-2024-8805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8805"
}
],
"links": [],
"reference": "CERTFR-2025-AVI-0002",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-01-03T00:00:00.000000"
},
{
"description": "Changement r\u00e9f\u00e9rence ",
"revision_date": "2025-01-06T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de Debian LTS. Elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et un d\u00e9ni de service.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de Debian LTS",
"vendor_advisories": [
{
"published_at": "2025-01-05",
"title": "Bulletin de s\u00e9curit\u00e9 Debian LTS DLA-4008-1",
"url": "https://lists.debian.org/debian-lts-announce/2025/01/msg00001.html"
}
]
}
CERTFR-2025-AVI-0677
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans les produits Siemens. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| Siemens | N/A | SIMATIC PCS neo V6.0 versions antérieures à V6.0 SP1 | ||
| Siemens | N/A | SIMATIC WinCC V17, v18 et V20 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | SIMATIC Control Function Library (CFL) toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIPROTEC 5 versions antérieures à 10.0 | ||
| Siemens | N/A | SIMATIC MTP Integrator toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC ProSave V17 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Unified Line Coordination toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC TeleControl toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC OA V3.19 versions antérieures à V3.19 P020 | ||
| Siemens | N/A | SIMATIC WinCC flexible ES toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM V17 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2024-54678. | ||
| Siemens | N/A | SIMATIC S7-Fail-safe Configuration Tool (S7-FCT) versions antérieures à 4.0.1 | ||
| Siemens | N/A | SIMATIC PCS neo V6.0 toutes versions pour la vulnérabilité CVE-2024-54678 | ||
| Siemens | N/A | SIMATIC eaSie Core Package (6DL5424-0AX00-0AV8) toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC MTP CREATOR V2.x et V3.x toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC WinCC OA V3.18 versions antérieures à V3.18 P032 | ||
| Siemens | N/A | TIA Portal Cloud V19 versions antérieures à 5.2.1.1 | ||
| Siemens | N/A | SIMATIC D7-SYS toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC BATCH V10.0 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC ODK 1500S toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Process Historian 2020 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour les vulnérabilités CVE-2025-30033 et CVE-2025-47809 | ||
| Siemens | N/A | SIMATIC S7-1500 Software Controller V2 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | TIA Portal Cloud Connector toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Unified Sequence toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM V17 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40759. | ||
| Siemens | N/A | SIMATIC WinCC Runtime Advanced toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Logon V2.0 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC ProSave V19 versions antérieures à V19 Update 4 | ||
| Siemens | N/A | SIMATIC PDM Maintenance Station V5.0 toutes versions pour les vulnérabilités CVE-2025-30033 et CVE-2025-47809 | ||
| Siemens | N/A | SIMATIC Safety Matrix toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Management Console toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SCALANCE XCM-/XRM-/XCH-/XRH-300 family versions antérieures à 3.2 | ||
| Siemens | N/A | SIMATIC BATCH V9.1 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC Process Function Library (PFL) V4.0 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC S7-1500 Software Controller V3 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC STEP 7 CFC V20 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC NET PC Software toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Route Control V9.1 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Process Historian 2022 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC OA V3.20 versions antérieures à V3.20 P008 | ||
| Siemens | N/A | SIMATIC RTLS Locating Manager versions antérieures à 3.3 | ||
| Siemens | N/A | Siprotec 4 7SA6, 7SD5 et 7SD610 versions antérieures à 4.78 | ||
| Siemens | N/A | SIMATIC Automation Tool toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | TIA Portal Cloud V18 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | SIMATIC PDM V9.2 et V9.3 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Runtime Professional toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Visualization Architect (SiVArc) toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC eaSie Workflow Skills toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC STEP 7 CFC V19 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC WinCC V19 versions antérieures à V19 Update 4 | ||
| Siemens | N/A | SIMATIC Management Agent toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC V7.5 et V8.0 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC STEP 7 V5.7 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Automation Tool SDK Windows toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Process Historian 2022 toutes versions pour la vulnérabilité CVE-2025-47809 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM V20 versions antérieures à V20 Update 1 | ||
| Siemens | N/A | TIA Portal Cloud V17 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | SIMATIC Energy Suite toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC PCS 7 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Process Historian 2024 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC STEP 7 V19 versions antérieures à V19 Update 4 | ||
| Siemens | N/A | TIA Portal Test Suite V17, v18, v19 et v20 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC S7-PCT toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Target toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC ProSave V18 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC Logon V1.6 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC STEP 7 V17 et V18 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | SIMATIC RTLS Locating Manager versions antérieures à 3.2 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM Advanced versions antérieures à V7.0 Update 1 | ||
| Siemens | N/A | SIMATIC PCS neo V5.0 toutes versions pour la vulnérabilité CVE-2024-54678 | ||
| Siemens | N/A | SIMATIC STEP 7 V20 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | TIA Portal Cloud V20 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | Siprotec 4 toutes versions et tous modèles exceptés 7SA6, 7SD5, 7SD610 pour la vulnérabilité CVE-2024-52504. | ||
| Siemens | N/A | SIMATIC eaSie PCS 7 Skill Package (6DL5424-0BX00-0AV8) toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SCALANCE XC-300/XR-300/XC-400/XR-500WG/XR-500 versions antérieures à 3.2 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM V17, V18 et V19 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Unified PC Runtime V18, V19 et V20 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC PCS 7 Advanced Process Faceplates V9.1 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC S7 F Systems V6.4 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Information Server toutes versions pour la vulnérabilité CVE-2025-47809 | ||
| Siemens | N/A | SIMATIC S7 F Systems V6.3 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC ProSave V20 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC PCS 7 Logic Matrix V9.1 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | WinCC Panel Image Setup toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC PCS neo V4.1 et V5.0 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2024-54678. | ||
| Siemens | N/A | SIMATIC Route Control V10.0 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC V8.1 versions antérieures à V8.1 Update 3 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SIMATIC PCS neo V6.0 versions ant\u00e9rieures \u00e0 V6.0 SP1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC V17, v18 et V20 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Control Function Library (CFL) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPROTEC 5 versions ant\u00e9rieures \u00e0 10.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC MTP Integrator toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ProSave V17 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Unified Line Coordination toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC TeleControl toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC OA V3.19 versions ant\u00e9rieures \u00e0 V3.19 P020",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC flexible ES toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM V17 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2024-54678.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-Fail-safe Configuration Tool (S7-FCT) versions ant\u00e9rieures \u00e0 4.0.1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS neo V6.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2024-54678",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC eaSie Core Package (6DL5424-0AX00-0AV8) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC MTP CREATOR V2.x et V3.x toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC OA V3.18 versions ant\u00e9rieures \u00e0 V3.18 P032",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud V19 versions ant\u00e9rieures \u00e0 5.2.1.1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC D7-SYS toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC BATCH V10.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ODK 1500S toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Historian 2020 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour les vuln\u00e9rabilit\u00e9s CVE-2025-30033 et CVE-2025-47809",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 Software Controller V2 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud Connector toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Unified Sequence toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM V17 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40759.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Runtime Advanced toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Logon V2.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ProSave V19 versions ant\u00e9rieures \u00e0 V19 Update 4",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PDM Maintenance Station V5.0 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2025-30033 et CVE-2025-47809",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Safety Matrix toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Management Console toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XCM-/XRM-/XCH-/XRH-300 family versions ant\u00e9rieures \u00e0 3.2",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC BATCH V9.1 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Function Library (PFL) V4.0 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 Software Controller V3 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 CFC V20 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC NET PC Software toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Route Control V9.1 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Historian 2022 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC OA V3.20 versions ant\u00e9rieures \u00e0 V3.20 P008",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC RTLS Locating Manager versions ant\u00e9rieures \u00e0 3.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "Siprotec 4 7SA6, 7SD5 et 7SD610 versions ant\u00e9rieures \u00e0 4.78",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Automation Tool toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud V18 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PDM V9.2 et V9.3 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Runtime Professional toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Visualization Architect (SiVArc) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC eaSie Workflow Skills toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 CFC V19 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC V19 versions ant\u00e9rieures \u00e0 V19 Update 4",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Management Agent toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC V7.5 et V8.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 V5.7 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Automation Tool SDK Windows toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Historian 2022 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-47809",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM V20 versions ant\u00e9rieures \u00e0 V20 Update 1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud V17 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Energy Suite toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS 7 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Historian 2024 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 V19 versions ant\u00e9rieures \u00e0 V19 Update 4",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Test Suite V17, v18, v19 et v20 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PCT toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Target toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ProSave V18 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Logon V1.6 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 V17 et V18 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC RTLS Locating Manager versions ant\u00e9rieures \u00e0 3.2",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM Advanced versions ant\u00e9rieures \u00e0 V7.0 Update 1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS neo V5.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2024-54678",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 V20 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud V20 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "Siprotec 4 toutes versions et tous mod\u00e8les except\u00e9s 7SA6, 7SD5, 7SD610 pour la vuln\u00e9rabilit\u00e9 CVE-2024-52504. ",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC eaSie PCS 7 Skill Package (6DL5424-0BX00-0AV8) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XC-300/XR-300/XC-400/XR-500WG/XR-500 versions ant\u00e9rieures \u00e0 3.2",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM V17, V18 et V19 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Unified PC Runtime V18, V19 et V20 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS 7 Advanced Process Faceplates V9.1 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7 F Systems V6.4 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Information Server toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-47809",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7 F Systems V6.3 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ProSave V20 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS 7 Logic Matrix V9.1 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "WinCC Panel Image Setup toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS neo V4.1 et V5.0 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2024-54678.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Route Control V10.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC V8.1 versions ant\u00e9rieures \u00e0 V8.1 Update 3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2023-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-35827"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-56596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56596"
},
{
"name": "CVE-2024-43907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43907"
},
{
"name": "CVE-2024-56645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56645"
},
{
"name": "CVE-2024-56659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56659"
},
{
"name": "CVE-2024-46755",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46755"
},
{
"name": "CVE-2024-47748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47748"
},
{
"name": "CVE-2024-26825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26825"
},
{
"name": "CVE-2024-49863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49863"
},
{
"name": "CVE-2024-41022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41022"
},
{
"name": "CVE-2024-49907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49907"
},
{
"name": "CVE-2024-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53061"
},
{
"name": "CVE-2024-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53052"
},
{
"name": "CVE-2023-52477",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52477"
},
{
"name": "CVE-2024-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53097"
},
{
"name": "CVE-2024-46713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46713"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-9681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9681"
},
{
"name": "CVE-2024-46844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46844"
},
{
"name": "CVE-2024-43914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43914"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-56670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56670"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-47697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47697"
},
{
"name": "CVE-2024-46815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46815"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2025-40759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40759"
},
{
"name": "CVE-2022-48666",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48666"
},
{
"name": "CVE-2024-49890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49890"
},
{
"name": "CVE-2024-50262",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50262"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50268"
},
{
"name": "CVE-2024-49903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49903"
},
{
"name": "CVE-2024-49969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49969"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-46676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46676"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-46740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46740"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2021-44879",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44879"
},
{
"name": "CVE-2024-46798",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46798"
},
{
"name": "CVE-2024-50195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50195"
},
{
"name": "CVE-2024-53172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53172"
},
{
"name": "CVE-2024-46707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46707"
},
{
"name": "CVE-2024-49967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49967"
},
{
"name": "CVE-2024-41000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41000"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2024-56606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56606"
},
{
"name": "CVE-2023-52637",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52637"
},
{
"name": "CVE-2024-46747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46747"
},
{
"name": "CVE-2024-49858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49858"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2024-49948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49948"
},
{
"name": "CVE-2024-56594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56594"
},
{
"name": "CVE-2024-26754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26754"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2024-46738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46738"
},
{
"name": "CVE-2023-45863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45863"
},
{
"name": "CVE-2024-56756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56756"
},
{
"name": "CVE-2024-52332",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52332"
},
{
"name": "CVE-2024-46679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46679"
},
{
"name": "CVE-2024-56724",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56724"
},
{
"name": "CVE-2024-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53194"
},
{
"name": "CVE-2024-49878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49878"
},
{
"name": "CVE-2023-51782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51782"
},
{
"name": "CVE-2024-46673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46673"
},
{
"name": "CVE-2024-41034",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41034"
},
{
"name": "CVE-2024-56723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56723"
},
{
"name": "CVE-2024-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53226"
},
{
"name": "CVE-2024-49884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49884"
},
{
"name": "CVE-2024-46724",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46724"
},
{
"name": "CVE-2024-56569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56569"
},
{
"name": "CVE-2024-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50074"
},
{
"name": "CVE-2024-26790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26790"
},
{
"name": "CVE-2024-46791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46791"
},
{
"name": "CVE-2024-50024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50024"
},
{
"name": "CVE-2024-47684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47684"
},
{
"name": "CVE-2024-49965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49965"
},
{
"name": "CVE-2024-44969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44969"
},
{
"name": "CVE-2024-56634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56634"
},
{
"name": "CVE-2024-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43098"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-56548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56548"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-50202",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50202"
},
{
"name": "CVE-2023-5178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5178"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-46800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46800"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2024-46750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46750"
},
{
"name": "CVE-2024-39484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39484"
},
{
"name": "CVE-2024-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53181"
},
{
"name": "CVE-2024-46722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46722"
},
{
"name": "CVE-2024-26600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26600"
},
{
"name": "CVE-2024-47701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47701"
},
{
"name": "CVE-2024-40971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40971"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2024-0646",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0646"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2024-47713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47713"
},
{
"name": "CVE-2024-49936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49936"
},
{
"name": "CVE-2024-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50267"
},
{
"name": "CVE-2024-56637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56637"
},
{
"name": "CVE-2024-47663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47663"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-49881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49881"
},
{
"name": "CVE-2023-52478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52478"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-46343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46343"
},
{
"name": "CVE-2024-46745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46745"
},
{
"name": "CVE-2024-46819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46819"
},
{
"name": "CVE-2024-49896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49896"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2024-49959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49959"
},
{
"name": "CVE-2024-49913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49913"
},
{
"name": "CVE-2024-56691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56691"
},
{
"name": "CVE-2024-46721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46721"
},
{
"name": "CVE-2024-50045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50045"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-42153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42153"
},
{
"name": "CVE-2024-46822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46822"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-49995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49995"
},
{
"name": "CVE-2024-56643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56643"
},
{
"name": "CVE-2025-40570",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40570"
},
{
"name": "CVE-2024-56661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56661"
},
{
"name": "CVE-2024-49977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49977"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-49900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49900"
},
{
"name": "CVE-2024-46685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46685"
},
{
"name": "CVE-2024-47679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47679"
},
{
"name": "CVE-2024-36484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36484"
},
{
"name": "CVE-2024-43889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43889"
},
{
"name": "CVE-2024-44998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44998"
},
{
"name": "CVE-2024-46723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46723"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-46828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46828"
},
{
"name": "CVE-2024-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50269"
},
{
"name": "CVE-2024-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53150"
},
{
"name": "CVE-2024-47735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47735"
},
{
"name": "CVE-2024-49952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49952"
},
{
"name": "CVE-2024-49981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49981"
},
{
"name": "CVE-2024-56595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56595"
},
{
"name": "CVE-2024-42086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42086"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2022-48935",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48935"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-56601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56601"
},
{
"name": "CVE-2023-52600",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52600"
},
{
"name": "CVE-2024-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53057"
},
{
"name": "CVE-2024-26910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26910"
},
{
"name": "CVE-2024-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50181"
},
{
"name": "CVE-2023-52507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52507"
},
{
"name": "CVE-2024-56571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56571"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52587",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52587"
},
{
"name": "CVE-2023-52887",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52887"
},
{
"name": "CVE-2024-46675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46675"
},
{
"name": "CVE-2024-26645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26645"
},
{
"name": "CVE-2024-26702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26702"
},
{
"name": "CVE-2024-46783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46783"
},
{
"name": "CVE-2023-51779",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51779"
},
{
"name": "CVE-2024-42076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42076"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-49997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49997"
},
{
"name": "CVE-2024-42092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42092"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2024-0584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0584"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2024-43871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43871"
},
{
"name": "CVE-2024-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53066"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2024-43880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43880"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-56629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56629"
},
{
"name": "CVE-2024-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50304"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-26615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26615"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2024-46689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46689"
},
{
"name": "CVE-2024-50295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50295"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-50051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50051"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53063"
},
{
"name": "CVE-2024-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53171"
},
{
"name": "CVE-2024-56602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56602"
},
{
"name": "CVE-2024-46781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46781"
},
{
"name": "CVE-2024-56770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56770"
},
{
"name": "CVE-2024-53157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53157"
},
{
"name": "CVE-2025-30034",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30034"
},
{
"name": "CVE-2024-46777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46777"
},
{
"name": "CVE-2023-52340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52340"
},
{
"name": "CVE-2024-50199",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50199"
},
{
"name": "CVE-2024-26779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26779"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-0193",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0193"
},
{
"name": "CVE-2023-52604",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52604"
},
{
"name": "CVE-2024-50040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50040"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-56739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56739"
},
{
"name": "CVE-2024-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50292"
},
{
"name": "CVE-2024-53103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53103"
},
{
"name": "CVE-2024-46714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46714"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2025-40746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40746"
},
{
"name": "CVE-2024-49983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49983"
},
{
"name": "CVE-2023-52601",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52601"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-44960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44960"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2024-26722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26722"
},
{
"name": "CVE-2024-54678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54678"
},
{
"name": "CVE-2024-26598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26598"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-26763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26763"
},
{
"name": "CVE-2024-49889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49889"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2024-40980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40980"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2024-56779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56779"
},
{
"name": "CVE-2024-26749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26749"
},
{
"name": "CVE-2024-44971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44971"
},
{
"name": "CVE-2023-52603",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52603"
},
{
"name": "CVE-2024-43894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43894"
},
{
"name": "CVE-2023-52486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52486"
},
{
"name": "CVE-2024-43867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52475"
},
{
"name": "CVE-2024-50013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50013"
},
{
"name": "CVE-2024-50185",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50185"
},
{
"name": "CVE-2024-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53239"
},
{
"name": "CVE-2023-52617",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52617"
},
{
"name": "CVE-2024-49957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49957"
},
{
"name": "CVE-2024-49962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49962"
},
{
"name": "CVE-2024-46731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46731"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-46674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46674"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2024-26804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26804"
},
{
"name": "CVE-2024-26593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26593"
},
{
"name": "CVE-2024-26751",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26751"
},
{
"name": "CVE-2024-49958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49958"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2024-47723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47723"
},
{
"name": "CVE-2024-49955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49955"
},
{
"name": "CVE-2024-42087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42087"
},
{
"name": "CVE-2024-44944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44944"
},
{
"name": "CVE-2024-43893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43893"
},
{
"name": "CVE-2024-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50095"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2024-50296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50296"
},
{
"name": "CVE-2024-57874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57874"
},
{
"name": "CVE-2024-53145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53145"
},
{
"name": "CVE-2024-50006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50006"
},
{
"name": "CVE-2022-49034",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49034"
},
{
"name": "CVE-2024-50049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50049"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-56642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56642"
},
{
"name": "CVE-2024-50007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50007"
},
{
"name": "CVE-2024-56586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56586"
},
{
"name": "CVE-2023-39198",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39198"
},
{
"name": "CVE-2024-40963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40963"
},
{
"name": "CVE-2025-40752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40752"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-50096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50096"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2024-49868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49868"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-53173",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53173"
},
{
"name": "CVE-2024-50237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50237"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2024-44995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44995"
},
{
"name": "CVE-2024-46757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46757"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-47699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47699"
},
{
"name": "CVE-2024-56581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56581"
},
{
"name": "CVE-2024-46677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46677"
},
{
"name": "CVE-2024-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50059"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-26606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26606"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-43883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43883"
},
{
"name": "CVE-2024-56623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56623"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2024-44935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44935"
},
{
"name": "CVE-2024-44999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44999"
},
{
"name": "CVE-2024-47712",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47712"
},
{
"name": "CVE-2024-56610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56610"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-49963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49963"
},
{
"name": "CVE-2024-49971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49971"
},
{
"name": "CVE-2024-56562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56562"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2024-49875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49875"
},
{
"name": "CVE-2024-47739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47739"
},
{
"name": "CVE-2024-47705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47705"
},
{
"name": "CVE-2024-53161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53161"
},
{
"name": "CVE-2023-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52919"
},
{
"name": "CVE-2024-50035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50035"
},
{
"name": "CVE-2024-56600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56600"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-44988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44988"
},
{
"name": "CVE-2024-47660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47660"
},
{
"name": "CVE-2024-56690",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56690"
},
{
"name": "CVE-2024-56597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56597"
},
{
"name": "CVE-2024-40905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40905"
},
{
"name": "CVE-2024-56574",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56574"
},
{
"name": "CVE-2024-47740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47740"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-49924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49924"
},
{
"name": "CVE-2024-46758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46758"
},
{
"name": "CVE-2024-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53217"
},
{
"name": "CVE-2024-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53183"
},
{
"name": "CVE-2024-49938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49938"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-47756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47756"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-47667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47667"
},
{
"name": "CVE-2024-46756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46756"
},
{
"name": "CVE-2024-56615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56615"
},
{
"name": "CVE-2024-47737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47737"
},
{
"name": "CVE-2024-46739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46739"
},
{
"name": "CVE-2024-47669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47669"
},
{
"name": "CVE-2024-56705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56705"
},
{
"name": "CVE-2024-50290",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50290"
},
{
"name": "CVE-2024-50008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50008"
},
{
"name": "CVE-2024-42082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42082"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-56704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56704"
},
{
"name": "CVE-2024-45006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45006"
},
{
"name": "CVE-2024-46725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46725"
},
{
"name": "CVE-2024-46829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46829"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2023-52599",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52599"
},
{
"name": "CVE-2024-56589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56589"
},
{
"name": "CVE-2024-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50265"
},
{
"name": "CVE-2024-56636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56636"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-56567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56567"
},
{
"name": "CVE-2024-44954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44954"
},
{
"name": "CVE-2024-43908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43908"
},
{
"name": "CVE-2023-3567",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3567"
},
{
"name": "CVE-2024-50033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50033"
},
{
"name": "CVE-2024-43890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43890"
},
{
"name": "CVE-2024-26688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26688"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2024-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49901"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-56688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56688"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-50180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50180"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50282"
},
{
"name": "CVE-2024-50273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50273"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2024-56532",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56532"
},
{
"name": "CVE-2024-41077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41077"
},
{
"name": "CVE-2024-47143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47143"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2023-52509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52509"
},
{
"name": "CVE-2024-44952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44952"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2024-50046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50046"
},
{
"name": "CVE-2023-52583",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52583"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-50193",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50193"
},
{
"name": "CVE-2024-46743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46743"
},
{
"name": "CVE-2024-49944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49944"
},
{
"name": "CVE-2023-52602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52602"
},
{
"name": "CVE-2024-50198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50198"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2024-56746",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56746"
},
{
"name": "CVE-2024-47749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47749"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2024-49966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49966"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2024-42095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42095"
},
{
"name": "CVE-2024-49902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49902"
},
{
"name": "CVE-2024-47757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47757"
},
{
"name": "CVE-2025-30033",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30033"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-48881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48881"
},
{
"name": "CVE-2024-47692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47692"
},
{
"name": "CVE-2024-46744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46744"
},
{
"name": "CVE-2024-0841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0841"
},
{
"name": "CVE-2025-40753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40753"
},
{
"name": "CVE-2024-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50184"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-52504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52504"
},
{
"name": "CVE-2024-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50287"
},
{
"name": "CVE-2024-56747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56747"
},
{
"name": "CVE-2024-49851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49851"
},
{
"name": "CVE-2023-6040",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6040"
},
{
"name": "CVE-2023-52510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52510"
},
{
"name": "CVE-2023-51781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51781"
},
{
"name": "CVE-2024-56603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56603"
},
{
"name": "CVE-2024-53158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53158"
},
{
"name": "CVE-2024-43882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43882"
},
{
"name": "CVE-2024-41068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41068"
},
{
"name": "CVE-2024-56644",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56644"
},
{
"name": "CVE-2024-46780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46780"
},
{
"name": "CVE-2024-46817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46817"
},
{
"name": "CVE-2024-42101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42101"
},
{
"name": "CVE-2025-40751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40751"
},
{
"name": "CVE-2024-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50278"
},
{
"name": "CVE-2024-50201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50201"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-56701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56701"
},
{
"name": "CVE-2024-42077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42077"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-49933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49933"
},
{
"name": "CVE-2024-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53184"
},
{
"name": "CVE-2024-47685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47685"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2022-48829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48829"
},
{
"name": "CVE-2024-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53174"
},
{
"name": "CVE-2024-49879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49879"
},
{
"name": "CVE-2024-39495",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39495"
},
{
"name": "CVE-2024-50044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50044"
},
{
"name": "CVE-2024-49894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49894"
},
{
"name": "CVE-2024-56700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56700"
},
{
"name": "CVE-2024-47718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47718"
},
{
"name": "CVE-2024-49867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49867"
},
{
"name": "CVE-2023-51780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51780"
},
{
"name": "CVE-2024-49985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49985"
},
{
"name": "CVE-2024-50001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50001"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-49993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49993"
},
{
"name": "CVE-2024-56728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56728"
},
{
"name": "CVE-2024-43861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43861"
},
{
"name": "CVE-2024-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53241"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2024-47710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47710"
},
{
"name": "CVE-2024-46771",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46771"
},
{
"name": "CVE-2024-50083",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50083"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2024-56531",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56531"
},
{
"name": "CVE-2024-49892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49892"
},
{
"name": "CVE-2024-49930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49930"
},
{
"name": "CVE-2024-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53148"
},
{
"name": "CVE-2024-47698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47698"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2024-56681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56681"
},
{
"name": "CVE-2024-26602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26602"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-50039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50039"
},
{
"name": "CVE-2024-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50251"
},
{
"name": "CVE-2024-56754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56754"
},
{
"name": "CVE-2024-49973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49973"
},
{
"name": "CVE-2024-53214",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53214"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2024-46804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46804"
},
{
"name": "CVE-2024-56619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56619"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2024-49883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49883"
},
{
"name": "CVE-2024-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53165"
},
{
"name": "CVE-2024-50236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50236"
},
{
"name": "CVE-2024-46840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46840"
},
{
"name": "CVE-2022-48828",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48828"
},
{
"name": "CVE-2024-56568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56568"
},
{
"name": "CVE-2024-46763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46763"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2024-53146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53146"
},
{
"name": "CVE-2024-46759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46759"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2023-52598",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52598"
},
{
"name": "CVE-2024-46737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46737"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2023-6606",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6606"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-56539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56539"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2024-56662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56662"
},
{
"name": "CVE-2024-46814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46814"
},
{
"name": "CVE-2024-56572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56572"
},
{
"name": "CVE-2024-56570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56570"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-46818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46818"
},
{
"name": "CVE-2023-6932",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6932"
},
{
"name": "CVE-2024-50602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50602"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2023-52594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52594"
},
{
"name": "CVE-2024-53198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53198"
},
{
"name": "CVE-2024-44965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44965"
},
{
"name": "CVE-2024-49860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49860"
},
{
"name": "CVE-2024-45003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45003"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2023-52595",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52595"
},
{
"name": "CVE-2025-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47809"
},
{
"name": "CVE-2024-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50234"
},
{
"name": "CVE-2024-56720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56720"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-53155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53155"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-50194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50194"
},
{
"name": "CVE-2024-46832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46832"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2024-49895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49895"
},
{
"name": "CVE-2024-56785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56785"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2024-26736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26736"
},
{
"name": "CVE-2024-56587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56587"
},
{
"name": "CVE-2024-45021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45021"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2024-49882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49882"
},
{
"name": "CVE-2024-47659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47659"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2024-56741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56741"
},
{
"name": "CVE-2023-52504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52504"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-40968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40968"
},
{
"name": "CVE-2024-45025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45025"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2024-56748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56748"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2024-56648",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56648"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-42143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42143"
},
{
"name": "CVE-2021-47316",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47316"
},
{
"name": "CVE-2024-56558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56558"
},
{
"name": "CVE-2024-41065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41065"
},
{
"name": "CVE-2024-43879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43879"
},
{
"name": "CVE-2024-46761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46761"
},
{
"name": "CVE-2023-52606",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52606"
},
{
"name": "CVE-2024-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50301"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49975"
},
{
"name": "CVE-2024-53240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53240"
},
{
"name": "CVE-2024-50179",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50179"
},
{
"name": "CVE-2024-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53101"
},
{
"name": "CVE-2024-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47696"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2024-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53156"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-50015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50015"
},
{
"name": "CVE-2023-52597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52597"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-45008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45008"
},
{
"name": "CVE-2024-50188",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50188"
},
{
"name": "CVE-2024-56533",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56533"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2023-52917",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52917"
},
{
"name": "CVE-2024-56598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56598"
},
{
"name": "CVE-2024-1086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1086"
},
{
"name": "CVE-2024-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53060"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2024-44990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44990"
},
{
"name": "CVE-2024-44987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44987"
},
{
"name": "CVE-2024-56781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56781"
},
{
"name": "CVE-2024-41046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41046"
},
{
"name": "CVE-2024-50089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50089"
},
{
"name": "CVE-2024-56630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56630"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-49982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49982"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2024-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53059"
},
{
"name": "CVE-2024-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50299"
},
{
"name": "CVE-2024-50218",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50218"
},
{
"name": "CVE-2024-42148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42148"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-56633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56633"
},
{
"name": "CVE-2024-56593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56593"
},
{
"name": "CVE-2024-56605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56605"
},
{
"name": "CVE-2024-53680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53680"
},
{
"name": "CVE-2024-26835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26835"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2024-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50279"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-56698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56698"
},
{
"name": "CVE-2024-47742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47742"
},
{
"name": "CVE-2024-47709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47709"
},
{
"name": "CVE-2024-41020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41020"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-46782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46782"
},
{
"name": "CVE-2024-56780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56780"
},
{
"name": "CVE-2024-47706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47706"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-46702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46702"
},
{
"name": "CVE-2023-5717",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5717"
},
{
"name": "CVE-2024-47747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47747"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-26766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26766"
},
{
"name": "CVE-2023-5678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5678"
},
{
"name": "CVE-2024-26664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26664"
},
{
"name": "CVE-2024-46719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46719"
},
{
"name": "CVE-2024-49877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49877"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2024-44949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44949"
},
{
"name": "CVE-2023-6121",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6121"
},
{
"name": "CVE-2023-52607",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52607"
},
{
"name": "CVE-2024-56650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56650"
},
{
"name": "CVE-2024-44989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44989"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53237"
},
{
"name": "CVE-2023-6931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6931"
},
{
"name": "CVE-2024-56576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56576"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-53227",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53227"
}
],
"links": [],
"reference": "CERTFR-2025-AVI-0677",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-08-12T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits Siemens. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits Siemens",
"vendor_advisories": [
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-707630",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-707630.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-331739",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-331739.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-693808",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-693808.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-613116",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-613116.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-493396",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-493396.html"
},
{
"published_at": "2025-08-11",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens ssa-400089",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-400089.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-493787",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-493787.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-894058",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-894058.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-355557",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-355557.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-529291",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-529291.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-282044",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-282044.html"
}
]
}
FKIE_CVE-2024-41095
Vulnerability from fkie_nvd - Published: 2024-07-29 16:15 - Updated: 2026-06-17 07:47| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/gpu/drm/nouveau/dispnv04/tvnv17.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "9289cd3450d1da3e271ef4b054d4d2932c41243e",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "dbd75f32252508ed6c46c3288a282c301a57ceeb",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "259549b2ccf795b7f91f7b5aba47286addcfa389",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "0d17604f2e44b3df21e218fe8fb3b836d41bac49",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "f95ed0f54b3d3faecae1140ddab854f904a6e7c8",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "cb751e48bbcffd292090f7882b23b215111b3d72",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "bdda5072494f2a7215d94fc4124ad1949a218714",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
},
{
"lessThan": "66edf3fb331b6c55439b10f9862987b0916b3726",
"status": "affected",
"version": "6ee738610f41b59733f63718f0bdbcba7d3a3f12",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/gpu/drm/nouveau/dispnv04/tvnv17.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.33"
},
{
"lessThan": "2.6.33",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.317",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.279",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.221",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.162",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.97",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.37",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.8",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "AD25C2E5-C116-4160-BA6D-CE9B0D10AE3E",
"versionEndExcluding": "4.19.317",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F4E38E58-1B9F-4DF2-AD3D-A8BEAA2959D8",
"versionEndExcluding": "5.4.279",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "659E1520-6345-41AF-B893-A7C0647585A0",
"versionEndExcluding": "5.10.221",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "10A39ACC-3005-40E8-875C-98A372D1FFD5",
"versionEndExcluding": "5.15.162",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "748B6C4B-1F61-47F9-96CC-8899B8412D84",
"versionEndExcluding": "6.1.97",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "D72E033B-5323-4C4D-8818-36E1EBC3535F",
"versionEndExcluding": "6.6.37",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E95105F2-32E3-4C5F-9D18-7AEFD0E6275C",
"versionEndExcluding": "6.9.8",
"versionStartIncluding": "6.7",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ndrm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes\n\nIn nv17_tv_get_ld_modes(), the return value of drm_mode_duplicate() is\nassigned to mode, which will lead to a possible NULL pointer dereference\non failure of drm_mode_duplicate(). Add a check to avoid npd."
},
{
"lang": "es",
"value": " En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: drm/nouveau/dispnv04: corrige la desreferencia del puntero null en nv17_tv_get_ld_modes En nv17_tv_get_ld_modes(), el valor de retorno de drm_mode_duplicate() se asigna al modo, lo que conducir\u00e1 a una posible desreferencia del puntero NULL en caso de falla de drm_mode_duplicate(). Agregue una marca para evitar npd."
}
],
"id": "CVE-2024-41095",
"lastModified": "2026-06-17T07:47:16.470",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-41095",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T16:20:25.562753Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-07-29T16:15:04.613",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0d17604f2e44b3df21e218fe8fb3b836d41bac49"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/259549b2ccf795b7f91f7b5aba47286addcfa389"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/66edf3fb331b6c55439b10f9862987b0916b3726"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/9289cd3450d1da3e271ef4b054d4d2932c41243e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/bdda5072494f2a7215d94fc4124ad1949a218714"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/cb751e48bbcffd292090f7882b23b215111b3d72"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/dbd75f32252508ed6c46c3288a282c301a57ceeb"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f95ed0f54b3d3faecae1140ddab854f904a6e7c8"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0d17604f2e44b3df21e218fe8fb3b836d41bac49"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/259549b2ccf795b7f91f7b5aba47286addcfa389"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/66edf3fb331b6c55439b10f9862987b0916b3726"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/9289cd3450d1da3e271ef4b054d4d2932c41243e"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/bdda5072494f2a7215d94fc4124ad1949a218714"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/cb751e48bbcffd292090f7882b23b215111b3d72"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/dbd75f32252508ed6c46c3288a282c301a57ceeb"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f95ed0f54b3d3faecae1140ddab854f904a6e7c8"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://lists.debian.org/debian-lts-announce/2025/01/msg00001.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-X274-3J7P-QFPP
Vulnerability from github – Published: 2024-07-29 18:30 – Updated: 2025-11-04 00:31In the Linux kernel, the following vulnerability has been resolved:
drm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes
In nv17_tv_get_ld_modes(), the return value of drm_mode_duplicate() is assigned to mode, which will lead to a possible NULL pointer dereference on failure of drm_mode_duplicate(). Add a check to avoid npd.
{
"affected": [],
"aliases": [
"CVE-2024-41095"
],
"database_specific": {
"cwe_ids": [
"CWE-476"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-07-29T16:15:04Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\ndrm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes\n\nIn nv17_tv_get_ld_modes(), the return value of drm_mode_duplicate() is\nassigned to mode, which will lead to a possible NULL pointer dereference\non failure of drm_mode_duplicate(). Add a check to avoid npd.",
"id": "GHSA-x274-3j7p-qfpp",
"modified": "2025-11-04T00:31:04Z",
"published": "2024-07-29T18:30:38Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41095"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/0d17604f2e44b3df21e218fe8fb3b836d41bac49"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/259549b2ccf795b7f91f7b5aba47286addcfa389"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/66edf3fb331b6c55439b10f9862987b0916b3726"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/9289cd3450d1da3e271ef4b054d4d2932c41243e"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/bdda5072494f2a7215d94fc4124ad1949a218714"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/cb751e48bbcffd292090f7882b23b215111b3d72"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/dbd75f32252508ed6c46c3288a282c301a57ceeb"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/f95ed0f54b3d3faecae1140ddab854f904a6e7c8"
},
{
"type": "WEB",
"url": "https://lists.debian.org/debian-lts-announce/2025/01/msg00001.html"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
ICSA-25-226-07
Vulnerability from csaf_cisa - Published: 2025-08-12 00:00 - Updated: 2026-02-25 07:00MSRC_CVE-2024-41095
Vulnerability from csaf_microsoft - Published: 2024-07-01 07:00 - Updated: 2026-02-19 01:15OESA-2024-1963 (CVE-2021-47202)
Vulnerability from osv_openeuler – Published: 2024-08-09 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
thermal: Fix NULL pointer dereferences in of_thermal_ functions
of_parse_thermal_zones() parses the thermal-zones node and registers a thermal_zone device for each subnode. However, if a thermal zone is consuming a thermal sensor and that thermal sensor device hasn't probed yet, an attempt to set trip_point_*_temp for that thermal zone device can cause a NULL pointer dereference. Fix it.
console:/sys/class/thermal/thermal_zone87 # echo 120000 > trip_point_0_temp ... Unable to handle kernel NULL pointer dereference at virtual address 0000000000000020 ... Call trace: of_thermal_set_trip_temp+0x40/0xc4 trip_point_temp_store+0xc0/0x1dc dev_attr_store+0x38/0x88 sysfs_kf_write+0x64/0xc0 kernfs_fop_write_iter+0x108/0x1d0 vfs_write+0x2f4/0x368 ksys_write+0x7c/0xec __arm64_sys_write+0x20/0x30 el0_svc_common.llvm.7279915941325364641+0xbc/0x1bc do_el0_svc+0x28/0xa0 el0_svc+0x14/0x24 el0_sync_handler+0x88/0xec el0_sync+0x1c0/0x200
While at it, fix the possible NULL pointer dereference in other functions as well: of_thermal_get_temp(), of_thermal_set_emul_temp(), of_thermal_get_trend().(CVE-2021-47202)
In the Linux kernel, the following vulnerability has been resolved:
ipvlan: Dont Use skb->sk in ipvlan_process_v{4,6}_outbound
Raw packet from PF_PACKET socket ontop of an IPv6-backed ipvlan device will hit WARN_ON_ONCE() in sk_mc_loop() through sch_direct_xmit() path.
WARNING: CPU: 2 PID: 0 at net/core/sock.c:775 sk_mc_loop+0x2d/0x70 Modules linked in: sch_netem ipvlan rfkill cirrus drm_shmem_helper sg drm_kms_helper CPU: 2 PID: 0 Comm: swapper/2 Kdump: loaded Not tainted 6.9.0+ #279 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014 RIP: 0010:sk_mc_loop+0x2d/0x70 Code: fa 0f 1f 44 00 00 65 0f b7 15 f7 96 a3 4f 31 c0 66 85 d2 75 26 48 85 ff 74 1c RSP: 0018:ffffa9584015cd78 EFLAGS: 00010212 RAX: 0000000000000011 RBX: ffff91e585793e00 RCX: 0000000002c6a001 RDX: 0000000000000000 RSI: 0000000000000040 RDI: ffff91e589c0f000 RBP: ffff91e5855bd100 R08: 0000000000000000 R09: 3d00545216f43d00 R10: ffff91e584fdcc50 R11: 00000060dd8616f4 R12: ffff91e58132d000 R13: ffff91e584fdcc68 R14: ffff91e5869ce800 R15: ffff91e589c0f000 FS: 0000000000000000(0000) GS:ffff91e898100000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007f788f7c44c0 CR3: 0000000008e1a000 CR4: 00000000000006f0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <IRQ> ? __warn (kernel/panic.c:693) ? sk_mc_loop (net/core/sock.c:760) ? report_bug (lib/bug.c:201 lib/bug.c:219) ? handle_bug (arch/x86/kernel/traps.c:239) ? exc_invalid_op (arch/x86/kernel/traps.c:260 (discriminator 1)) ? asm_exc_invalid_op (./arch/x86/include/asm/idtentry.h:621) ? sk_mc_loop (net/core/sock.c:760) ip6_finish_output2 (net/ipv6/ip6_output.c:83 (discriminator 1)) ? nf_hook_slow (net/netfilter/core.c:626) ip6_finish_output (net/ipv6/ip6_output.c:222) ? __pfx_ip6_finish_output (net/ipv6/ip6_output.c:215) ipvlan_xmit_mode_l3 (drivers/net/ipvlan/ipvlan_core.c:602) ipvlan ipvlan_start_xmit (drivers/net/ipvlan/ipvlan_main.c:226) ipvlan dev_hard_start_xmit (net/core/dev.c:3594) sch_direct_xmit (net/sched/sch_generic.c:343) __qdisc_run (net/sched/sch_generic.c:416) net_tx_action (net/core/dev.c:5286) handle_softirqs (kernel/softirq.c:555) __irq_exit_rcu (kernel/softirq.c:589) sysvec_apic_timer_interrupt (arch/x86/kernel/apic/apic.c:1043)
The warning triggers as this: packet_sendmsg packet_snd //skb->sk is packet sk __dev_queue_xmit __dev_xmit_skb //q->enqueue is not NULL __qdisc_run sch_direct_xmit dev_hard_start_xmit ipvlan_start_xmit ipvlan_xmit_mode_l3 //l3 mode ipvlan_process_outbound //vepa flag ipvlan_process_v6_outbound ip6_local_out __ip6_finish_output ip6_finish_output2 //multicast packet sk_mc_loop //sk->sk_family is AF_PACKET
Call ip{6}_local_out() with NULL sk in ipvlan as other tunnels to fix this.(CVE-2024-33621)
In the Linux kernel, the following vulnerability has been resolved:
jfs: xattr: fix buffer overflow for invalid xattr
When an xattr size is not what is expected, it is printed out to the kernel log in hex format as a form of debugging. But when that xattr size is bigger than the expected size, printing it out can cause an access off the end of the buffer.
Fix this all up by properly restricting the size of the debug hex dump in the kernel log.(CVE-2024-40902)
In the Linux kernel, the following vulnerability has been resolved:
xfrm6: check ip6_dst_idev() return value in xfrm6_get_saddr()
ip6_dst_idev() can return NULL, xfrm6_get_saddr() must act accordingly.
syzbot reported:
Oops: general protection fault, probably for non-canonical address 0xdffffc0000000000: 0000 [#1] PREEMPT SMP KASAN PTI KASAN: null-ptr-deref in range [0x0000000000000000-0x0000000000000007] CPU: 1 PID: 12 Comm: kworker/u8:1 Not tainted 6.10.0-rc2-syzkaller-00383-gb8481381d4e2 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024 Workqueue: wg-kex-wg1 wg_packet_handshake_send_worker RIP: 0010:xfrm6_get_saddr+0x93/0x130 net/ipv6/xfrm6_policy.c:64 Code: df 48 89 fa 48 c1 ea 03 80 3c 02 00 0f 85 97 00 00 00 4c 8b ab d8 00 00 00 48 b8 00 00 00 00 00 fc ff df 4c 89 ea 48 c1 ea 03 <80> 3c 02 00 0f 85 86 00 00 00 4d 8b 6d 00 e8 ca 13 47 01 48 b8 00 RSP: 0018:ffffc90000117378 EFLAGS: 00010246 RAX: dffffc0000000000 RBX: ffff88807b079dc0 RCX: ffffffff89a0d6d7 RDX: 0000000000000000 RSI: ffffffff89a0d6e9 RDI: ffff88807b079e98 RBP: ffff88807ad73248 R08: 0000000000000007 R09: fffffffffffff000 R10: ffff88807b079dc0 R11: 0000000000000007 R12: ffffc90000117480 R13: 0000000000000000 R14: 0000000000000000 R15: 0000000000000000 FS: 0000000000000000(0000) GS:ffff8880b9300000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007f4586d00440 CR3: 0000000079042000 CR4: 00000000003506f0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> xfrm_get_saddr net/xfrm/xfrm_policy.c:2452 [inline] xfrm_tmpl_resolve_one net/xfrm/xfrm_policy.c:2481 [inline] xfrm_tmpl_resolve+0xa26/0xf10 net/xfrm/xfrm_policy.c:2541 xfrm_resolve_and_create_bundle+0x140/0x2570 net/xfrm/xfrm_policy.c:2835 xfrm_bundle_lookup net/xfrm/xfrm_policy.c:3070 [inline] xfrm_lookup_with_ifid+0x4d1/0x1e60 net/xfrm/xfrm_policy.c:3201 xfrm_lookup net/xfrm/xfrm_policy.c:3298 [inline] xfrm_lookup_route+0x3b/0x200 net/xfrm/xfrm_policy.c:3309 ip6_dst_lookup_flow+0x15c/0x1d0 net/ipv6/ip6_output.c:1256 send6+0x611/0xd20 drivers/net/wireguard/socket.c:139 wg_socket_send_skb_to_peer+0xf9/0x220 drivers/net/wireguard/socket.c:178 wg_socket_send_buffer_to_peer+0x12b/0x190 drivers/net/wireguard/socket.c:200 wg_packet_send_handshake_initiation+0x227/0x360 drivers/net/wireguard/send.c:40 wg_packet_handshake_send_worker+0x1c/0x30 drivers/net/wireguard/send.c:51 process_one_work+0x9fb/0x1b60 kernel/workqueue.c:3231 process_scheduled_works kernel/workqueue.c:3312 [inline] worker_thread+0x6c8/0xf70 kernel/workqueue.c:3393 kthread+0x2c1/0x3a0 kernel/kthread.c:389 ret_from_fork+0x45/0x80 arch/x86/kernel/process.c:147 ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:244(CVE-2024-40959)
In the Linux kernel, the following vulnerability has been resolved:
netrom: Fix a memory leak in nr_heartbeat_expiry()
syzbot reported a memory leak in nr_create() 0.
Commit 409db27e3a2e ("netrom: Fix use-after-free of a listening socket.") added sock_hold() to the nr_heartbeat_expiry() function, where a) a socket has a SOCK_DESTROY flag or b) a listening socket has a SOCK_DEAD flag.
But in the case "a," when the SOCK_DESTROY flag is set, the file descriptor has already been closed and the nr_release() function has been called. So it makes no sense to hold the reference count because no one will call another nr_destroy_socket() and put it as in the case "b."
nr_connect nr_establish_data_link nr_start_heartbeat
nr_release switch (nr->state) case NR_STATE_3 nr->state = NR_STATE_2 sock_set_flag(sk, SOCK_DESTROY);
nr_rx_frame
nr_process_rx_frame
switch (nr->state)
case NR_STATE_2
nr_state2_machine()
nr_disconnect()
nr_sk(sk)->state = NR_STATE_0
sock_set_flag(sk, SOCK_DEAD)
nr_heartbeat_expiry
switch (nr->state)
case NR_STATE_0
if (sock_flag(sk, SOCK_DESTROY) ||
(sk->sk_state == TCP_LISTEN
&& sock_flag(sk, SOCK_DEAD)))
sock_hold() // ( !!! )
nr_destroy_socket()
To fix the memory leak, let's call sock_hold() only for a listening socket.
Found by InfoTeCS on behalf of Linux Verification Center (linuxtesting.org) with Syzkaller.
In the Linux kernel, the following vulnerability has been resolved:
xfs: add bounds checking to xlog_recover_process_data
There is a lack of verification of the space occupied by fixed members of xlog_op_header in the xlog_recover_process_data.
We can create a crafted image to trigger an out of bounds read by following these steps: 1) Mount an image of xfs, and do some file operations to leave records 2) Before umounting, copy the image for subsequent steps to simulate abnormal exit. Because umount will ensure that tail_blk and head_blk are the same, which will result in the inability to enter xlog_recover_process_data 3) Write a tool to parse and modify the copied image in step 2 4) Make the end of the xlog_op_header entries only 1 byte away from xlog_rec_header->h_size 5) xlog_rec_header->h_num_logops++ 6) Modify xlog_rec_header->h_crc
Fix: Add a check to make sure there is sufficient space to access fixed members of xlog_op_header.(CVE-2024-41014)
In the Linux kernel, the following vulnerability has been resolved:
jfs: don't walk off the end of ealist
Add a check before visiting the members of ea to make sure each ea stays within the ealist.(CVE-2024-41017)
In the Linux kernel, the following vulnerability has been resolved:
filelock: Fix fcntl/close race recovery compat path
When I wrote commit 3cad1bc01041 ("filelock: Remove locks reliably when fcntl/close race is detected"), I missed that there are two copies of the code I was patching: The normal version, and the version for 64-bit offsets on 32-bit kernels. Thanks to Greg KH for stumbling over this while doing the stable backport...
Apply exactly the same fix to the compat path for 32-bit kernels.(CVE-2024-41020)
In the Linux kernel, the following vulnerability has been resolved:
ppp: reject claimed-as-LCP but actually malformed packets
Since 'ppp_async_encode()' assumes valid LCP packets (with code from 1 to 7 inclusive), add 'ppp_check_packet()' to ensure that LCP packet has an actual body beyond PPP_LCP header bytes, and reject claimed-as-LCP but actually malformed data otherwise.(CVE-2024-41044)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: hci_core: cancel all works upon hci_unregister_dev()
syzbot is reporting that calling hci_release_dev() from hci_error_reset() due to hci_dev_put() from hci_error_reset() can cause deadlock at destroy_workqueue(), for hci_error_reset() is called from hdev->req_workqueue which destroy_workqueue() needs to flush.
We need to make sure that hdev->{rx_work,cmd_work,tx_work} which are queued into hdev->workqueue and hdev->{power_on,error_reset} which are queued into hdev->req_workqueue are no longer running by the moment
destroy_workqueue(hdev->workqueue);
destroy_workqueue(hdev->req_workqueue);
are called from hci_release_dev().
Call cancel_work_sync() on these work items from hci_unregister_dev() as soon as hdev->list is removed from hci_dev_list.(CVE-2024-41063)
In the Linux kernel, the following vulnerability has been resolved:
ASoC: topology: Fix references to freed memory
Most users after parsing a topology file, release memory used by it, so having pointer references directly into topology file contents is wrong. Use devm_kmemdup(), to allocate memory as needed.(CVE-2024-41069)
In the Linux kernel, the following vulnerability has been resolved:
wifi: cfg80211: wext: add extra SIOCSIWSCAN data check
In 'cfg80211_wext_siwscan()', add extra check whether number of channels passed via 'ioctl(sock, SIOCSIWSCAN, ...)' doesn't exceed IW_MAX_FREQUENCIES and reject invalid request with -EINVAL otherwise.(CVE-2024-41072)
In the Linux kernel, the following vulnerability has been resolved:
ila: block BH in ila_output()
As explained in commit 1378817486d6 ("tipc: block BH before using dst_cache"), net/core/dst_cache.c helpers need to be called with BH disabled.
ila_output() is called from lwtunnel_output() possibly from process context, and under rcu_read_lock().
We might be interrupted by a softirq, re-enter ila_output() and corrupt dst_cache data structures.
Fix the race by using local_bh_disable().(CVE-2024-41081)
In the Linux kernel, the following vulnerability has been resolved:
drm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_hd_modes
In nv17_tv_get_hd_modes(), the return value of drm_mode_duplicate() is assigned to mode, which will lead to a possible NULL pointer dereference on failure of drm_mode_duplicate(). The same applies to drm_cvt_mode(). Add a check to avoid null pointer dereference.(CVE-2024-41089)
In the Linux kernel, the following vulnerability has been resolved:
drm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes
In nv17_tv_get_ld_modes(), the return value of drm_mode_duplicate() is assigned to mode, which will lead to a possible NULL pointer dereference on failure of drm_mode_duplicate(). Add a check to avoid npd.(CVE-2024-41095)
In the Linux kernel, the following vulnerability has been resolved:
usb: atm: cxacru: fix endpoint checking in cxacru_bind()
Syzbot is still reporting quite an old issue 1 that occurs due to incomplete checking of present usb endpoints. As such, wrong endpoints types may be used at urb sumbitting stage which in turn triggers a warning in usb_submit_urb().
Fix the issue by verifying that required endpoint types are present for both in and out endpoints, taking into account cmd endpoint type.
Unfortunately, this patch has not been tested on real hardware.
1 Syzbot report: usb 1-1: BOGUS urb xfer, pipe 1 != type 3 WARNING: CPU: 0 PID: 8667 at drivers/usb/core/urb.c:502 usb_submit_urb+0xed2/0x18a0 drivers/usb/core/urb.c:502 Modules linked in: CPU: 0 PID: 8667 Comm: kworker/0:4 Not tainted 5.14.0-rc4-syzkaller #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/01/2011 Workqueue: usb_hub_wq hub_event RIP: 0010:usb_submit_urb+0xed2/0x18a0 drivers/usb/core/urb.c:502 ... Call Trace: cxacru_cm+0x3c0/0x8e0 drivers/usb/atm/cxacru.c:649 cxacru_card_status+0x22/0xd0 drivers/usb/atm/cxacru.c:760 cxacru_bind+0x7ac/0x11a0 drivers/usb/atm/cxacru.c:1209 usbatm_usb_probe+0x321/0x1ae0 drivers/usb/atm/usbatm.c:1055 cxacru_usb_probe+0xdf/0x1e0 drivers/usb/atm/cxacru.c:1363 usb_probe_interface+0x315/0x7f0 drivers/usb/core/driver.c:396 call_driver_probe drivers/base/dd.c:517 [inline] really_probe+0x23c/0xcd0 drivers/base/dd.c:595 __driver_probe_device+0x338/0x4d0 drivers/base/dd.c:747 driver_probe_device+0x4c/0x1a0 drivers/base/dd.c:777 __device_attach_driver+0x20b/0x2f0 drivers/base/dd.c:894 bus_for_each_drv+0x15f/0x1e0 drivers/base/bus.c:427 __device_attach+0x228/0x4a0 drivers/base/dd.c:965 bus_probe_device+0x1e4/0x290 drivers/base/bus.c:487 device_add+0xc2f/0x2180 drivers/base/core.c:3354 usb_set_configuration+0x113a/0x1910 drivers/usb/core/message.c:2170 usb_generic_driver_probe+0xba/0x100 drivers/usb/core/generic.c:238 usb_probe_device+0xd9/0x2c0 drivers/usb/core/driver.c:293(CVE-2024-41097)
In the Linux kernel, the following vulnerability has been resolved:
ocfs2: fix DIO failure due to insufficient transaction credits
The code in ocfs2_dio_end_io_write() estimates number of necessary transaction credits using ocfs2_calc_extend_credits(). This however does not take into account that the IO could be arbitrarily large and can contain arbitrary number of extents.
Extent tree manipulations do often extend the current transaction but not in all of the cases. For example if we have only single block extents in the tree, ocfs2_mark_extent_written() will end up calling ocfs2_replace_extent_rec() all the time and we will never extend the current transaction and eventually exhaust all the transaction credits if the IO contains many single block extents. Once that happens a WARN_ON(jbd2_handle_buffer_credits(handle) <= 0) is triggered in jbd2_journal_dirty_metadata() and subsequently OCFS2 aborts in response to this error. This was actually triggered by one of our customers on a heavily fragmented OCFS2 filesystem.
To fix the issue make sure the transaction always has enough credits for one extent insert before each call of ocfs2_mark_extent_written().
Heming Zhao said:
PANIC: "Kernel panic - not syncing: OCFS2: (device dm-1): panic forced after error"
PID: xxx TASK: xxxx CPU: 5 COMMAND: "SubmitThread-CA" #0 machine_kexec at ffffffff8c069932 #1 __crash_kexec at ffffffff8c1338fa #2 panic at ffffffff8c1d69b9 #3 ocfs2_handle_error at ffffffffc0c86c0c [ocfs2] #4 __ocfs2_abort at ffffffffc0c88387 [ocfs2] #5 ocfs2_journal_dirty at ffffffffc0c51e98 [ocfs2] #6 ocfs2_split_extent at ffffffffc0c27ea3 [ocfs2] #7 ocfs2_change_extent_flag at ffffffffc0c28053 [ocfs2] #8 ocfs2_mark_extent_written at ffffffffc0c28347 [ocfs2] #9 ocfs2_dio_end_io_write at ffffffffc0c2bef9 [ocfs2]
10 ocfs2_dio_end_io at ffffffffc0c2c0f5 [ocfs2]
11 dio_complete at ffffffff8c2b9fa7
12 do_blockdev_direct_IO at ffffffff8c2bc09f
13 ocfs2_direct_IO at ffffffffc0c2b653 [ocfs2]
14 generic_file_direct_write at ffffffff8c1dcf14
15 __generic_file_write_iter at ffffffff8c1dd07b
16 ocfs2_file_write_iter at ffffffffc0c49f1f [ocfs2]
17 aio_write at ffffffff8c2cc72e
18 kmem_cache_alloc at ffffffff8c248dde
19 do_io_submit at ffffffff8c2ccada
20 do_syscall_64 at ffffffff8c004984
21 entry_SYSCALL_64_after_hwframe at ffffffff8c8000ba(CVE-2024-42077)
In the Linux kernel, the following vulnerability has been resolved:
iio: chemical: bme680: Fix overflows in compensate() functions
There are cases in the compensate functions of the driver that there could be overflows of variables due to bit shifting ops. These implications were initially discussed here 1 and they were mentioned in log message of Commit 1b3bd8592780 ("iio: chemical: Add support for Bosch BME680 sensor").
In the Linux kernel, the following vulnerability has been resolved:
pinctrl: fix deadlock in create_pinctrl() when handling -EPROBE_DEFER
In create_pinctrl(), pinctrl_maps_mutex is acquired before calling add_setting(). If add_setting() returns -EPROBE_DEFER, create_pinctrl() calls pinctrl_free(). However, pinctrl_free() attempts to acquire pinctrl_maps_mutex, which is already held by create_pinctrl(), leading to a potential deadlock.
This patch resolves the issue by releasing pinctrl_maps_mutex before calling pinctrl_free(), preventing the deadlock.
This bug was discovered and resolved using Coverity Static Analysis Security Testing (SAST) by Synopsys, Inc.(CVE-2024-42090)
In the Linux kernel, the following vulnerability has been resolved:
gpio: davinci: Validate the obtained number of IRQs
Value of pdata->gpio_unbanked is taken from Device Tree. In case of broken DT due to any error this value can be any. Without this value validation there can be out of chips->irqs array boundaries access in davinci_gpio_probe().
Validate the obtained nirq value so that it won't exceed the maximum number of IRQs per bank.
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-42092)
In the Linux kernel, the following vulnerability has been resolved:
net/iucv: Avoid explicit cpumask var allocation on stack
For CONFIG_CPUMASK_OFFSTACK=y kernel, explicit allocation of cpumask variable on stack is not recommended since it can cause potential stack overflow.
Instead, kernel code should always use *cpumask_var API(s) to allocate cpumask var in config-neutral way, leaving allocation strategy to CONFIG_CPUMASK_OFFSTACK.
Use *cpumask_var API(s) to address it.(CVE-2024-42094)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: emux: improve patch ioctl data validation
In load_data(), make the validation of and skipping over the main info block match that in load_guspatch().
In load_guspatch(), add checking that the specified patch length matches the actually supplied data, like load_data() already did.(CVE-2024-42097)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: add missing check for inode numbers on directory entries
Syzbot reported that mounting and unmounting a specific pattern of corrupted nilfs2 filesystem images causes a use-after-free of metadata file inodes, which triggers a kernel bug in lru_add_fn().
As Jan Kara pointed out, this is because the link count of a metadata file gets corrupted to 0, and nilfs_evict_inode(), which is called from iput(), tries to delete that inode (ifile inode in this case).
The inconsistency occurs because directories containing the inode numbers of these metadata files that should not be visible in the namespace are read without checking.
Fix this issue by treating the inode numbers of these internal files as errors in the sanity check helper when reading directory folios/pages.
Also thanks to Hillf Danton and Matthew Wilcox for their initial mm-layer analysis.(CVE-2024-42104)
In the Linux kernel, the following vulnerability has been resolved:
inet_diag: Initialize pad field in struct inet_diag_req_v2
KMSAN reported uninit-value access in raw_lookup() 1. Diag for raw sockets uses the pad field in struct inet_diag_req_v2 for the underlying protocol. This field corresponds to the sdiag_raw_protocol field in struct inet_diag_req_raw.
inet_diag_get_exact_compat() converts inet_diag_req to inet_diag_req_v2, but leaves the pad field uninitialized. So the issue occurs when raw_lookup() accesses the sdiag_raw_protocol field.
Fix this by initializing the pad field in inet_diag_get_exact_compat(). Also, do the same fix in inet_diag_dump_compat() to avoid the similar issue in the future.
1 BUG: KMSAN: uninit-value in raw_lookup net/ipv4/raw_diag.c:49 [inline] BUG: KMSAN: uninit-value in raw_sock_get+0x657/0x800 net/ipv4/raw_diag.c:71 raw_lookup net/ipv4/raw_diag.c:49 [inline] raw_sock_get+0x657/0x800 net/ipv4/raw_diag.c:71 raw_diag_dump_one+0xa1/0x660 net/ipv4/raw_diag.c:99 inet_diag_cmd_exact+0x7d9/0x980 inet_diag_get_exact_compat net/ipv4/inet_diag.c:1404 [inline] inet_diag_rcv_msg_compat+0x469/0x530 net/ipv4/inet_diag.c:1426 sock_diag_rcv_msg+0x23d/0x740 net/core/sock_diag.c:282 netlink_rcv_skb+0x537/0x670 net/netlink/af_netlink.c:2564 sock_diag_rcv+0x35/0x40 net/core/sock_diag.c:297 netlink_unicast_kernel net/netlink/af_netlink.c:1335 [inline] netlink_unicast+0xe74/0x1240 net/netlink/af_netlink.c:1361 netlink_sendmsg+0x10c6/0x1260 net/netlink/af_netlink.c:1905 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg+0x332/0x3d0 net/socket.c:745 _syssendmsg+0x7f0/0xb70 net/socket.c:2585 _sys_sendmsg+0x271/0x3b0 net/socket.c:2639 __sys_sendmsg net/socket.c:2668 [inline] __do_sys_sendmsg net/socket.c:2677 [inline] __se_sys_sendmsg net/socket.c:2675 [inline] __x64_sys_sendmsg+0x27e/0x4a0 net/socket.c:2675 x64_sys_call+0x135e/0x3ce0 arch/x86/include/generated/asm/syscalls_64.h:47 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xd9/0x1e0 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f
Uninit was stored to memory at: raw_sock_get+0x650/0x800 net/ipv4/raw_diag.c:71 raw_diag_dump_one+0xa1/0x660 net/ipv4/raw_diag.c:99 inet_diag_cmd_exact+0x7d9/0x980 inet_diag_get_exact_compat net/ipv4/inet_diag.c:1404 [inline] inet_diag_rcv_msg_compat+0x469/0x530 net/ipv4/inet_diag.c:1426 sock_diag_rcv_msg+0x23d/0x740 net/core/sock_diag.c:282 netlink_rcv_skb+0x537/0x670 net/netlink/af_netlink.c:2564 sock_diag_rcv+0x35/0x40 net/core/sock_diag.c:297 netlink_unicast_kernel net/netlink/af_netlink.c:1335 [inline] netlink_unicast+0xe74/0x1240 net/netlink/af_netlink.c:1361 netlink_sendmsg+0x10c6/0x1260 net/netlink/af_netlink.c:1905 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg+0x332/0x3d0 net/socket.c:745 _syssendmsg+0x7f0/0xb70 net/socket.c:2585 _sys_sendmsg+0x271/0x3b0 net/socket.c:2639 __sys_sendmsg net/socket.c:2668 [inline] __do_sys_sendmsg net/socket.c:2677 [inline] __se_sys_sendmsg net/socket.c:2675 [inline] __x64_sys_sendmsg+0x27e/0x4a0 net/socket.c:2675 x64_sys_call+0x135e/0x3ce0 arch/x86/include/generated/asm/syscalls_64.h:47 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xd9/0x1e0 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f
Local variable req.i created at: inet_diag_get_exact_compat net/ipv4/inet_diag.c:1396 [inline] inet_diag_rcv_msg_compat+0x2a6/0x530 net/ipv4/inet_diag.c:1426 sock_diag_rcv_msg+0x23d/0x740 net/core/sock_diag.c:282
CPU: 1 PID: 8888 Comm: syz-executor.6 Not tainted 6.10.0-rc4-00217-g35bb670d65fc #32 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-2.fc40 04/01/2014(CVE-2024-42106)
In the Linux kernel, the following vulnerability has been resolved:
jffs2: Fix potential illegal address access in jffs2_free_inode
During the stress testing of the jffs2 file system,the following abnormal printouts were found: [ 2430.649000] Unable to handle kernel paging request at virtual address 0069696969696948 [ 2430.649622] Mem abort info: [ 2430.649829] ESR = 0x96000004 [ 2430.650115] EC = 0x25: DABT (current EL), IL = 32 bits [ 2430.650564] SET = 0, FnV = 0 [ 2430.650795] EA = 0, S1PTW = 0 [ 2430.651032] FSC = 0x04: level 0 translation fault [ 2430.651446] Data abort info: [ 2430.651683] ISV = 0, ISS = 0x00000004 [ 2430.652001] CM = 0, WnR = 0 [ 2430.652558] [0069696969696948] address between user and kernel address ranges [ 2430.653265] Internal error: Oops: 96000004 [#1] PREEMPT SMP [ 2430.654512] CPU: 2 PID: 20919 Comm: cat Not tainted 5.15.25-g512f31242bf6 #33 [ 2430.655008] Hardware name: linux,dummy-virt (DT) [ 2430.655517] pstate: 20000005 (nzCv daif -PAN -UAO -TCO -DIT -SSBS BTYPE=--) [ 2430.656142] pc : kfree+0x78/0x348 [ 2430.656630] lr : jffs2_free_inode+0x24/0x48 [ 2430.657051] sp : ffff800009eebd10 [ 2430.657355] x29: ffff800009eebd10 x28: 0000000000000001 x27: 0000000000000000 [ 2430.658327] x26: ffff000038f09d80 x25: 0080000000000000 x24: ffff800009d38000 [ 2430.658919] x23: 5a5a5a5a5a5a5a5a x22: ffff000038f09d80 x21: ffff8000084f0d14 [ 2430.659434] x20: ffff0000bf9a6ac0 x19: 0169696969696940 x18: 0000000000000000 [ 2430.659969] x17: ffff8000b6506000 x16: ffff800009eec000 x15: 0000000000004000 [ 2430.660637] x14: 0000000000000000 x13: 00000001000820a1 x12: 00000000000d1b19 [ 2430.661345] x11: 0004000800000000 x10: 0000000000000001 x9 : ffff8000084f0d14 [ 2430.662025] x8 : ffff0000bf9a6b40 x7 : ffff0000bf9a6b48 x6 : 0000000003470302 [ 2430.662695] x5 : ffff00002e41dcc0 x4 : ffff0000bf9aa3b0 x3 : 0000000003470342 [ 2430.663486] x2 : 0000000000000000 x1 : ffff8000084f0d14 x0 : fffffc0000000000 [ 2430.664217] Call trace: [ 2430.664528] kfree+0x78/0x348 [ 2430.664855] jffs2_free_inode+0x24/0x48 [ 2430.665233] i_callback+0x24/0x50 [ 2430.665528] rcu_do_batch+0x1ac/0x448 [ 2430.665892] rcu_core+0x28c/0x3c8 [ 2430.666151] rcu_core_si+0x18/0x28 [ 2430.666473] __do_softirq+0x138/0x3cc [ 2430.666781] irq_exit+0xf0/0x110 [ 2430.667065] handle_domain_irq+0x6c/0x98 [ 2430.667447] gic_handle_irq+0xac/0xe8 [ 2430.667739] call_on_irq_stack+0x28/0x54 The parameter passed to kfree was 5a5a5a5a, which corresponds to the target field of the jffs_inode_info structure. It was found that all variables in the jffs_inode_info structure were 5a5a5a5a, except for the first member sem. It is suspected that these variables are not initialized because they were set to 5a5a5a5a during memory testing, which is meant to detect uninitialized memory.The sem variable is initialized in the function jffs2_i_init_once, while other members are initialized in the function jffs2_init_inode_info.
The function jffs2_init_inode_info is called after iget_locked, but in the iget_locked function, the destroy_inode process is triggered, which releases the inode and consequently, the target member of the inode is not initialized.In concurrent high pressure scenarios, iget_locked may enter the destroy_inode branch as described in the code.
Since the destroy_inode functionality of jffs2 only releases the target, the fix method is to set target to NULL in jffs2_i_init_once.(CVE-2024-42115)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Skip finding free audio for unknown engine_id
[WHY] ENGINE_ID_UNKNOWN = -1 and can not be used as an array index. Plus, it also means it is uninitialized and does not need free audio.
[HOW] Skip and return NULL.
This fixes 2 OVERRUN issues reported by Coverity.(CVE-2024-42119)
In the Linux kernel, the following vulnerability has been resolved:
IB/core: Implement a limit on UMAD receive List
The existing behavior of ib_umad, which maintains received MAD packets in an unbounded list, poses a risk of uncontrolled growth. As user-space applications extract packets from this list, the rate of extraction may not match the rate of incoming packets, leading to potential list overflow.
To address this, we introduce a limit to the size of the list. After considering typical scenarios, such as OpenSM processing, which can handle approximately 100k packets per second, and the 1-second retry timeout for most packets, we set the list size limit to 200k. Packets received beyond this limit are dropped, assuming they are likely timed out by the time they are handled by user-space.
Notably, packets queued on the receive list due to reasons like timed-out sends are preserved even when the list is full.(CVE-2024-42145)
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: mv88e6xxx: Correct check for empty list
Since commit a3c53be55c95 ("net: dsa: mv88e6xxx: Support multiple MDIO busses") mv88e6xxx_default_mdio_bus() has checked that the return value of list_first_entry() is non-NULL.
This appears to be intended to guard against the list chip->mdios being empty. However, it is not the correct check as the implementation of list_first_entry is not designed to return NULL for empty lists.
Instead, use list_first_entry_or_null() which does return NULL if the list is empty.
Flagged by Smatch. Compile tested only.(CVE-2024-42224)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu: Using uninitialized value *size when calling amdgpu_vce_cs_reloc
Initialize the size before calling amdgpu_vce_cs_reloc, such as case 0x03000001. V2: To really improve the handling we would actually need to have a separate value of 0xffffffff.(Christian)(CVE-2024-42228)
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"perf-debuginfo-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2408.2.0.0289.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2408.2.0.0289.oe2003sp4.src.rpm"
],
"x86_64": [
"bpftool-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"perf-debuginfo-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2408.2.0.0289.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2408.2.0.0289.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nthermal: Fix NULL pointer dereferences in of_thermal_ functions\r\n\r\nof_parse_thermal_zones() parses the thermal-zones node and registers a\nthermal_zone device for each subnode. However, if a thermal zone is\nconsuming a thermal sensor and that thermal sensor device hasn\u0026apos;t probed\nyet, an attempt to set trip_point_*_temp for that thermal zone device\ncan cause a NULL pointer dereference. Fix it.\r\n\r\n console:/sys/class/thermal/thermal_zone87 # echo 120000 \u0026gt; trip_point_0_temp\n ...\n Unable to handle kernel NULL pointer dereference at virtual address 0000000000000020\n ...\n Call trace:\n of_thermal_set_trip_temp+0x40/0xc4\n trip_point_temp_store+0xc0/0x1dc\n dev_attr_store+0x38/0x88\n sysfs_kf_write+0x64/0xc0\n kernfs_fop_write_iter+0x108/0x1d0\n vfs_write+0x2f4/0x368\n ksys_write+0x7c/0xec\n __arm64_sys_write+0x20/0x30\n el0_svc_common.llvm.7279915941325364641+0xbc/0x1bc\n do_el0_svc+0x28/0xa0\n el0_svc+0x14/0x24\n el0_sync_handler+0x88/0xec\n el0_sync+0x1c0/0x200\r\n\r\nWhile at it, fix the possible NULL pointer dereference in other\nfunctions as well: of_thermal_get_temp(), of_thermal_set_emul_temp(),\nof_thermal_get_trend().(CVE-2021-47202)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipvlan: Dont Use skb-\u0026gt;sk in ipvlan_process_v{4,6}_outbound\r\n\r\nRaw packet from PF_PACKET socket ontop of an IPv6-backed ipvlan device will\nhit WARN_ON_ONCE() in sk_mc_loop() through sch_direct_xmit() path.\r\n\r\nWARNING: CPU: 2 PID: 0 at net/core/sock.c:775 sk_mc_loop+0x2d/0x70\nModules linked in: sch_netem ipvlan rfkill cirrus drm_shmem_helper sg drm_kms_helper\nCPU: 2 PID: 0 Comm: swapper/2 Kdump: loaded Not tainted 6.9.0+ #279\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014\nRIP: 0010:sk_mc_loop+0x2d/0x70\nCode: fa 0f 1f 44 00 00 65 0f b7 15 f7 96 a3 4f 31 c0 66 85 d2 75 26 48 85 ff 74 1c\nRSP: 0018:ffffa9584015cd78 EFLAGS: 00010212\nRAX: 0000000000000011 RBX: ffff91e585793e00 RCX: 0000000002c6a001\nRDX: 0000000000000000 RSI: 0000000000000040 RDI: ffff91e589c0f000\nRBP: ffff91e5855bd100 R08: 0000000000000000 R09: 3d00545216f43d00\nR10: ffff91e584fdcc50 R11: 00000060dd8616f4 R12: ffff91e58132d000\nR13: ffff91e584fdcc68 R14: ffff91e5869ce800 R15: ffff91e589c0f000\nFS: 0000000000000000(0000) GS:ffff91e898100000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00007f788f7c44c0 CR3: 0000000008e1a000 CR4: 00000000000006f0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n\u0026lt;IRQ\u0026gt;\n ? __warn (kernel/panic.c:693)\n ? sk_mc_loop (net/core/sock.c:760)\n ? report_bug (lib/bug.c:201 lib/bug.c:219)\n ? handle_bug (arch/x86/kernel/traps.c:239)\n ? exc_invalid_op (arch/x86/kernel/traps.c:260 (discriminator 1))\n ? asm_exc_invalid_op (./arch/x86/include/asm/idtentry.h:621)\n ? sk_mc_loop (net/core/sock.c:760)\n ip6_finish_output2 (net/ipv6/ip6_output.c:83 (discriminator 1))\n ? nf_hook_slow (net/netfilter/core.c:626)\n ip6_finish_output (net/ipv6/ip6_output.c:222)\n ? __pfx_ip6_finish_output (net/ipv6/ip6_output.c:215)\n ipvlan_xmit_mode_l3 (drivers/net/ipvlan/ipvlan_core.c:602) ipvlan\n ipvlan_start_xmit (drivers/net/ipvlan/ipvlan_main.c:226) ipvlan\n dev_hard_start_xmit (net/core/dev.c:3594)\n sch_direct_xmit (net/sched/sch_generic.c:343)\n __qdisc_run (net/sched/sch_generic.c:416)\n net_tx_action (net/core/dev.c:5286)\n handle_softirqs (kernel/softirq.c:555)\n __irq_exit_rcu (kernel/softirq.c:589)\n sysvec_apic_timer_interrupt (arch/x86/kernel/apic/apic.c:1043)\r\n\r\nThe warning triggers as this:\npacket_sendmsg\n packet_snd //skb-\u0026gt;sk is packet sk\n __dev_queue_xmit\n __dev_xmit_skb //q-\u0026gt;enqueue is not NULL\n __qdisc_run\n sch_direct_xmit\n dev_hard_start_xmit\n ipvlan_start_xmit\n ipvlan_xmit_mode_l3 //l3 mode\n ipvlan_process_outbound //vepa flag\n ipvlan_process_v6_outbound\n ip6_local_out\n __ip6_finish_output\n ip6_finish_output2 //multicast packet\n sk_mc_loop //sk-\u0026gt;sk_family is AF_PACKET\r\n\r\nCall ip{6}_local_out() with NULL sk in ipvlan as other tunnels to fix this.(CVE-2024-33621)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\njfs: xattr: fix buffer overflow for invalid xattr\r\n\r\nWhen an xattr size is not what is expected, it is printed out to the\nkernel log in hex format as a form of debugging. But when that xattr\nsize is bigger than the expected size, printing it out can cause an\naccess off the end of the buffer.\r\n\r\nFix this all up by properly restricting the size of the debug hex dump\nin the kernel log.(CVE-2024-40902)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nxfrm6: check ip6_dst_idev() return value in xfrm6_get_saddr()\r\n\r\nip6_dst_idev() can return NULL, xfrm6_get_saddr() must act accordingly.\r\n\r\nsyzbot reported:\r\n\r\nOops: general protection fault, probably for non-canonical address 0xdffffc0000000000: 0000 [#1] PREEMPT SMP KASAN PTI\nKASAN: null-ptr-deref in range [0x0000000000000000-0x0000000000000007]\nCPU: 1 PID: 12 Comm: kworker/u8:1 Not tainted 6.10.0-rc2-syzkaller-00383-gb8481381d4e2 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024\nWorkqueue: wg-kex-wg1 wg_packet_handshake_send_worker\n RIP: 0010:xfrm6_get_saddr+0x93/0x130 net/ipv6/xfrm6_policy.c:64\nCode: df 48 89 fa 48 c1 ea 03 80 3c 02 00 0f 85 97 00 00 00 4c 8b ab d8 00 00 00 48 b8 00 00 00 00 00 fc ff df 4c 89 ea 48 c1 ea 03 \u0026lt;80\u0026gt; 3c 02 00 0f 85 86 00 00 00 4d 8b 6d 00 e8 ca 13 47 01 48 b8 00\nRSP: 0018:ffffc90000117378 EFLAGS: 00010246\nRAX: dffffc0000000000 RBX: ffff88807b079dc0 RCX: ffffffff89a0d6d7\nRDX: 0000000000000000 RSI: ffffffff89a0d6e9 RDI: ffff88807b079e98\nRBP: ffff88807ad73248 R08: 0000000000000007 R09: fffffffffffff000\nR10: ffff88807b079dc0 R11: 0000000000000007 R12: ffffc90000117480\nR13: 0000000000000000 R14: 0000000000000000 R15: 0000000000000000\nFS: 0000000000000000(0000) GS:ffff8880b9300000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00007f4586d00440 CR3: 0000000079042000 CR4: 00000000003506f0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n \u0026lt;TASK\u0026gt;\n xfrm_get_saddr net/xfrm/xfrm_policy.c:2452 [inline]\n xfrm_tmpl_resolve_one net/xfrm/xfrm_policy.c:2481 [inline]\n xfrm_tmpl_resolve+0xa26/0xf10 net/xfrm/xfrm_policy.c:2541\n xfrm_resolve_and_create_bundle+0x140/0x2570 net/xfrm/xfrm_policy.c:2835\n xfrm_bundle_lookup net/xfrm/xfrm_policy.c:3070 [inline]\n xfrm_lookup_with_ifid+0x4d1/0x1e60 net/xfrm/xfrm_policy.c:3201\n xfrm_lookup net/xfrm/xfrm_policy.c:3298 [inline]\n xfrm_lookup_route+0x3b/0x200 net/xfrm/xfrm_policy.c:3309\n ip6_dst_lookup_flow+0x15c/0x1d0 net/ipv6/ip6_output.c:1256\n send6+0x611/0xd20 drivers/net/wireguard/socket.c:139\n wg_socket_send_skb_to_peer+0xf9/0x220 drivers/net/wireguard/socket.c:178\n wg_socket_send_buffer_to_peer+0x12b/0x190 drivers/net/wireguard/socket.c:200\n wg_packet_send_handshake_initiation+0x227/0x360 drivers/net/wireguard/send.c:40\n wg_packet_handshake_send_worker+0x1c/0x30 drivers/net/wireguard/send.c:51\n process_one_work+0x9fb/0x1b60 kernel/workqueue.c:3231\n process_scheduled_works kernel/workqueue.c:3312 [inline]\n worker_thread+0x6c8/0xf70 kernel/workqueue.c:3393\n kthread+0x2c1/0x3a0 kernel/kthread.c:389\n ret_from_fork+0x45/0x80 arch/x86/kernel/process.c:147\n ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:244(CVE-2024-40959)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetrom: Fix a memory leak in nr_heartbeat_expiry()\r\n\r\nsyzbot reported a memory leak in nr_create() [0].\r\n\r\nCommit 409db27e3a2e (\u0026quot;netrom: Fix use-after-free of a listening socket.\u0026quot;)\nadded sock_hold() to the nr_heartbeat_expiry() function, where\na) a socket has a SOCK_DESTROY flag or\nb) a listening socket has a SOCK_DEAD flag.\r\n\r\nBut in the case \u0026quot;a,\u0026quot; when the SOCK_DESTROY flag is set, the file descriptor\nhas already been closed and the nr_release() function has been called.\nSo it makes no sense to hold the reference count because no one will\ncall another nr_destroy_socket() and put it as in the case \u0026quot;b.\u0026quot;\r\n\r\nnr_connect\n nr_establish_data_link\n nr_start_heartbeat\r\n\r\nnr_release\n switch (nr-\u0026gt;state)\n case NR_STATE_3\n nr-\u0026gt;state = NR_STATE_2\n sock_set_flag(sk, SOCK_DESTROY);\r\n\r\n nr_rx_frame\n nr_process_rx_frame\n switch (nr-\u0026gt;state)\n case NR_STATE_2\n nr_state2_machine()\n nr_disconnect()\n nr_sk(sk)-\u0026gt;state = NR_STATE_0\n sock_set_flag(sk, SOCK_DEAD)\r\n\r\n nr_heartbeat_expiry\n switch (nr-\u0026gt;state)\n case NR_STATE_0\n if (sock_flag(sk, SOCK_DESTROY) ||\n (sk-\u0026gt;sk_state == TCP_LISTEN\n \u0026amp;\u0026amp; sock_flag(sk, SOCK_DEAD)))\n sock_hold() // ( !!! )\n nr_destroy_socket()\r\n\r\nTo fix the memory leak, let\u0026apos;s call sock_hold() only for a listening socket.\r\n\r\nFound by InfoTeCS on behalf of Linux Verification Center\n(linuxtesting.org) with Syzkaller.\r\n\r\n[0]: https://syzkaller.appspot.com/bug?extid=d327a1f3b12e1e206c16(CVE-2024-41006)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nxfs: add bounds checking to xlog_recover_process_data\r\n\r\nThere is a lack of verification of the space occupied by fixed members\nof xlog_op_header in the xlog_recover_process_data.\r\n\r\nWe can create a crafted image to trigger an out of bounds read by\nfollowing these steps:\n 1) Mount an image of xfs, and do some file operations to leave records\n 2) Before umounting, copy the image for subsequent steps to simulate\n abnormal exit. Because umount will ensure that tail_blk and\n head_blk are the same, which will result in the inability to enter\n xlog_recover_process_data\n 3) Write a tool to parse and modify the copied image in step 2\n 4) Make the end of the xlog_op_header entries only 1 byte away from\n xlog_rec_header-\u0026gt;h_size\n 5) xlog_rec_header-\u0026gt;h_num_logops++\n 6) Modify xlog_rec_header-\u0026gt;h_crc\r\n\r\nFix:\nAdd a check to make sure there is sufficient space to access fixed members\nof xlog_op_header.(CVE-2024-41014)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\njfs: don\u0026apos;t walk off the end of ealist\r\n\r\nAdd a check before visiting the members of ea to\nmake sure each ea stays within the ealist.(CVE-2024-41017)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfilelock: Fix fcntl/close race recovery compat path\r\n\r\nWhen I wrote commit 3cad1bc01041 (\u0026quot;filelock: Remove locks reliably when\nfcntl/close race is detected\u0026quot;), I missed that there are two copies of the\ncode I was patching: The normal version, and the version for 64-bit offsets\non 32-bit kernels.\nThanks to Greg KH for stumbling over this while doing the stable\nbackport...\r\n\r\nApply exactly the same fix to the compat path for 32-bit kernels.(CVE-2024-41020)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nppp: reject claimed-as-LCP but actually malformed packets\r\n\r\nSince \u0026apos;ppp_async_encode()\u0026apos; assumes valid LCP packets (with code\nfrom 1 to 7 inclusive), add \u0026apos;ppp_check_packet()\u0026apos; to ensure that\nLCP packet has an actual body beyond PPP_LCP header bytes, and\nreject claimed-as-LCP but actually malformed data otherwise.(CVE-2024-41044)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: hci_core: cancel all works upon hci_unregister_dev()\r\n\r\nsyzbot is reporting that calling hci_release_dev() from hci_error_reset()\ndue to hci_dev_put() from hci_error_reset() can cause deadlock at\ndestroy_workqueue(), for hci_error_reset() is called from\nhdev-\u0026gt;req_workqueue which destroy_workqueue() needs to flush.\r\n\r\nWe need to make sure that hdev-\u0026gt;{rx_work,cmd_work,tx_work} which are\nqueued into hdev-\u0026gt;workqueue and hdev-\u0026gt;{power_on,error_reset} which are\nqueued into hdev-\u0026gt;req_workqueue are no longer running by the moment\r\n\r\n destroy_workqueue(hdev-\u0026gt;workqueue);\n destroy_workqueue(hdev-\u0026gt;req_workqueue);\r\n\r\nare called from hci_release_dev().\r\n\r\nCall cancel_work_sync() on these work items from hci_unregister_dev()\nas soon as hdev-\u0026gt;list is removed from hci_dev_list.(CVE-2024-41063)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nASoC: topology: Fix references to freed memory\r\n\r\nMost users after parsing a topology file, release memory used by it, so\nhaving pointer references directly into topology file contents is wrong.\nUse devm_kmemdup(), to allocate memory as needed.(CVE-2024-41069)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: cfg80211: wext: add extra SIOCSIWSCAN data check\r\n\r\nIn \u0026apos;cfg80211_wext_siwscan()\u0026apos;, add extra check whether number of\nchannels passed via \u0026apos;ioctl(sock, SIOCSIWSCAN, ...)\u0026apos; doesn\u0026apos;t exceed\nIW_MAX_FREQUENCIES and reject invalid request with -EINVAL otherwise.(CVE-2024-41072)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nila: block BH in ila_output()\r\n\r\nAs explained in commit 1378817486d6 (\u0026quot;tipc: block BH\nbefore using dst_cache\u0026quot;), net/core/dst_cache.c\nhelpers need to be called with BH disabled.\r\n\r\nila_output() is called from lwtunnel_output()\npossibly from process context, and under rcu_read_lock().\r\n\r\nWe might be interrupted by a softirq, re-enter ila_output()\nand corrupt dst_cache data structures.\r\n\r\nFix the race by using local_bh_disable().(CVE-2024-41081)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_hd_modes\r\n\r\nIn nv17_tv_get_hd_modes(), the return value of drm_mode_duplicate() is\nassigned to mode, which will lead to a possible NULL pointer dereference\non failure of drm_mode_duplicate(). The same applies to drm_cvt_mode().\nAdd a check to avoid null pointer dereference.(CVE-2024-41089)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes\r\n\r\nIn nv17_tv_get_ld_modes(), the return value of drm_mode_duplicate() is\nassigned to mode, which will lead to a possible NULL pointer dereference\non failure of drm_mode_duplicate(). Add a check to avoid npd.(CVE-2024-41095)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nusb: atm: cxacru: fix endpoint checking in cxacru_bind()\r\n\r\nSyzbot is still reporting quite an old issue [1] that occurs due to\nincomplete checking of present usb endpoints. As such, wrong\nendpoints types may be used at urb sumbitting stage which in turn\ntriggers a warning in usb_submit_urb().\r\n\r\nFix the issue by verifying that required endpoint types are present\nfor both in and out endpoints, taking into account cmd endpoint type.\r\n\r\nUnfortunately, this patch has not been tested on real hardware.\r\n\r\n[1] Syzbot report:\nusb 1-1: BOGUS urb xfer, pipe 1 != type 3\nWARNING: CPU: 0 PID: 8667 at drivers/usb/core/urb.c:502 usb_submit_urb+0xed2/0x18a0 drivers/usb/core/urb.c:502\nModules linked in:\nCPU: 0 PID: 8667 Comm: kworker/0:4 Not tainted 5.14.0-rc4-syzkaller #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/01/2011\nWorkqueue: usb_hub_wq hub_event\nRIP: 0010:usb_submit_urb+0xed2/0x18a0 drivers/usb/core/urb.c:502\n...\nCall Trace:\n cxacru_cm+0x3c0/0x8e0 drivers/usb/atm/cxacru.c:649\n cxacru_card_status+0x22/0xd0 drivers/usb/atm/cxacru.c:760\n cxacru_bind+0x7ac/0x11a0 drivers/usb/atm/cxacru.c:1209\n usbatm_usb_probe+0x321/0x1ae0 drivers/usb/atm/usbatm.c:1055\n cxacru_usb_probe+0xdf/0x1e0 drivers/usb/atm/cxacru.c:1363\n usb_probe_interface+0x315/0x7f0 drivers/usb/core/driver.c:396\n call_driver_probe drivers/base/dd.c:517 [inline]\n really_probe+0x23c/0xcd0 drivers/base/dd.c:595\n __driver_probe_device+0x338/0x4d0 drivers/base/dd.c:747\n driver_probe_device+0x4c/0x1a0 drivers/base/dd.c:777\n __device_attach_driver+0x20b/0x2f0 drivers/base/dd.c:894\n bus_for_each_drv+0x15f/0x1e0 drivers/base/bus.c:427\n __device_attach+0x228/0x4a0 drivers/base/dd.c:965\n bus_probe_device+0x1e4/0x290 drivers/base/bus.c:487\n device_add+0xc2f/0x2180 drivers/base/core.c:3354\n usb_set_configuration+0x113a/0x1910 drivers/usb/core/message.c:2170\n usb_generic_driver_probe+0xba/0x100 drivers/usb/core/generic.c:238\n usb_probe_device+0xd9/0x2c0 drivers/usb/core/driver.c:293(CVE-2024-41097)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nocfs2: fix DIO failure due to insufficient transaction credits\r\n\r\nThe code in ocfs2_dio_end_io_write() estimates number of necessary\ntransaction credits using ocfs2_calc_extend_credits(). This however does\nnot take into account that the IO could be arbitrarily large and can\ncontain arbitrary number of extents.\r\n\r\nExtent tree manipulations do often extend the current transaction but not\nin all of the cases. For example if we have only single block extents in\nthe tree, ocfs2_mark_extent_written() will end up calling\nocfs2_replace_extent_rec() all the time and we will never extend the\ncurrent transaction and eventually exhaust all the transaction credits if\nthe IO contains many single block extents. Once that happens a\nWARN_ON(jbd2_handle_buffer_credits(handle) \u0026lt;= 0) is triggered in\njbd2_journal_dirty_metadata() and subsequently OCFS2 aborts in response to\nthis error. This was actually triggered by one of our customers on a\nheavily fragmented OCFS2 filesystem.\r\n\r\nTo fix the issue make sure the transaction always has enough credits for\none extent insert before each call of ocfs2_mark_extent_written().\r\n\r\nHeming Zhao said:\r\n\r\n------\nPANIC: \u0026quot;Kernel panic - not syncing: OCFS2: (device dm-1): panic forced after error\u0026quot;\r\n\r\nPID: xxx TASK: xxxx CPU: 5 COMMAND: \u0026quot;SubmitThread-CA\u0026quot;\n #0 machine_kexec at ffffffff8c069932\n #1 __crash_kexec at ffffffff8c1338fa\n #2 panic at ffffffff8c1d69b9\n #3 ocfs2_handle_error at ffffffffc0c86c0c [ocfs2]\n #4 __ocfs2_abort at ffffffffc0c88387 [ocfs2]\n #5 ocfs2_journal_dirty at ffffffffc0c51e98 [ocfs2]\n #6 ocfs2_split_extent at ffffffffc0c27ea3 [ocfs2]\n #7 ocfs2_change_extent_flag at ffffffffc0c28053 [ocfs2]\n #8 ocfs2_mark_extent_written at ffffffffc0c28347 [ocfs2]\n #9 ocfs2_dio_end_io_write at ffffffffc0c2bef9 [ocfs2]\n#10 ocfs2_dio_end_io at ffffffffc0c2c0f5 [ocfs2]\n#11 dio_complete at ffffffff8c2b9fa7\n#12 do_blockdev_direct_IO at ffffffff8c2bc09f\n#13 ocfs2_direct_IO at ffffffffc0c2b653 [ocfs2]\n#14 generic_file_direct_write at ffffffff8c1dcf14\n#15 __generic_file_write_iter at ffffffff8c1dd07b\n#16 ocfs2_file_write_iter at ffffffffc0c49f1f [ocfs2]\n#17 aio_write at ffffffff8c2cc72e\n#18 kmem_cache_alloc at ffffffff8c248dde\n#19 do_io_submit at ffffffff8c2ccada\n#20 do_syscall_64 at ffffffff8c004984\n#21 entry_SYSCALL_64_after_hwframe at ffffffff8c8000ba(CVE-2024-42077)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\niio: chemical: bme680: Fix overflows in compensate() functions\r\n\r\nThere are cases in the compensate functions of the driver that\nthere could be overflows of variables due to bit shifting ops.\nThese implications were initially discussed here [1] and they\nwere mentioned in log message of Commit 1b3bd8592780 (\u0026quot;iio:\nchemical: Add support for Bosch BME680 sensor\u0026quot;).\r\n\r\n[1]: https://lore.kernel.org/linux-iio/20180728114028.3c1bbe81@archlinux/(CVE-2024-42086)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npinctrl: fix deadlock in create_pinctrl() when handling -EPROBE_DEFER\r\n\r\nIn create_pinctrl(), pinctrl_maps_mutex is acquired before calling\nadd_setting(). If add_setting() returns -EPROBE_DEFER, create_pinctrl()\ncalls pinctrl_free(). However, pinctrl_free() attempts to acquire\npinctrl_maps_mutex, which is already held by create_pinctrl(), leading to\na potential deadlock.\r\n\r\nThis patch resolves the issue by releasing pinctrl_maps_mutex before\ncalling pinctrl_free(), preventing the deadlock.\r\n\r\nThis bug was discovered and resolved using Coverity Static Analysis\nSecurity Testing (SAST) by Synopsys, Inc.(CVE-2024-42090)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ngpio: davinci: Validate the obtained number of IRQs\r\n\r\nValue of pdata-\u0026gt;gpio_unbanked is taken from Device Tree. In case of broken\nDT due to any error this value can be any. Without this value validation\nthere can be out of chips-\u0026gt;irqs array boundaries access in\ndavinci_gpio_probe().\r\n\r\nValidate the obtained nirq value so that it won\u0026apos;t exceed the maximum\nnumber of IRQs per bank.\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-42092)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/iucv: Avoid explicit cpumask var allocation on stack\r\n\r\nFor CONFIG_CPUMASK_OFFSTACK=y kernel, explicit allocation of cpumask\nvariable on stack is not recommended since it can cause potential stack\noverflow.\r\n\r\nInstead, kernel code should always use *cpumask_var API(s) to allocate\ncpumask var in config-neutral way, leaving allocation strategy to\nCONFIG_CPUMASK_OFFSTACK.\r\n\r\nUse *cpumask_var API(s) to address it.(CVE-2024-42094)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nALSA: emux: improve patch ioctl data validation\r\n\r\nIn load_data(), make the validation of and skipping over the main info\nblock match that in load_guspatch().\r\n\r\nIn load_guspatch(), add checking that the specified patch length matches\nthe actually supplied data, like load_data() already did.(CVE-2024-42097)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: add missing check for inode numbers on directory entries\r\n\r\nSyzbot reported that mounting and unmounting a specific pattern of\ncorrupted nilfs2 filesystem images causes a use-after-free of metadata\nfile inodes, which triggers a kernel bug in lru_add_fn().\r\n\r\nAs Jan Kara pointed out, this is because the link count of a metadata file\ngets corrupted to 0, and nilfs_evict_inode(), which is called from iput(),\ntries to delete that inode (ifile inode in this case).\r\n\r\nThe inconsistency occurs because directories containing the inode numbers\nof these metadata files that should not be visible in the namespace are\nread without checking.\r\n\r\nFix this issue by treating the inode numbers of these internal files as\nerrors in the sanity check helper when reading directory folios/pages.\r\n\r\nAlso thanks to Hillf Danton and Matthew Wilcox for their initial mm-layer\nanalysis.(CVE-2024-42104)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ninet_diag: Initialize pad field in struct inet_diag_req_v2\r\n\r\nKMSAN reported uninit-value access in raw_lookup() [1]. Diag for raw\nsockets uses the pad field in struct inet_diag_req_v2 for the\nunderlying protocol. This field corresponds to the sdiag_raw_protocol\nfield in struct inet_diag_req_raw.\r\n\r\ninet_diag_get_exact_compat() converts inet_diag_req to\ninet_diag_req_v2, but leaves the pad field uninitialized. So the issue\noccurs when raw_lookup() accesses the sdiag_raw_protocol field.\r\n\r\nFix this by initializing the pad field in\ninet_diag_get_exact_compat(). Also, do the same fix in\ninet_diag_dump_compat() to avoid the similar issue in the future.\r\n\r\n[1]\nBUG: KMSAN: uninit-value in raw_lookup net/ipv4/raw_diag.c:49 [inline]\nBUG: KMSAN: uninit-value in raw_sock_get+0x657/0x800 net/ipv4/raw_diag.c:71\n raw_lookup net/ipv4/raw_diag.c:49 [inline]\n raw_sock_get+0x657/0x800 net/ipv4/raw_diag.c:71\n raw_diag_dump_one+0xa1/0x660 net/ipv4/raw_diag.c:99\n inet_diag_cmd_exact+0x7d9/0x980\n inet_diag_get_exact_compat net/ipv4/inet_diag.c:1404 [inline]\n inet_diag_rcv_msg_compat+0x469/0x530 net/ipv4/inet_diag.c:1426\n sock_diag_rcv_msg+0x23d/0x740 net/core/sock_diag.c:282\n netlink_rcv_skb+0x537/0x670 net/netlink/af_netlink.c:2564\n sock_diag_rcv+0x35/0x40 net/core/sock_diag.c:297\n netlink_unicast_kernel net/netlink/af_netlink.c:1335 [inline]\n netlink_unicast+0xe74/0x1240 net/netlink/af_netlink.c:1361\n netlink_sendmsg+0x10c6/0x1260 net/netlink/af_netlink.c:1905\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg+0x332/0x3d0 net/socket.c:745\n ____sys_sendmsg+0x7f0/0xb70 net/socket.c:2585\n ___sys_sendmsg+0x271/0x3b0 net/socket.c:2639\n __sys_sendmsg net/socket.c:2668 [inline]\n __do_sys_sendmsg net/socket.c:2677 [inline]\n __se_sys_sendmsg net/socket.c:2675 [inline]\n __x64_sys_sendmsg+0x27e/0x4a0 net/socket.c:2675\n x64_sys_call+0x135e/0x3ce0 arch/x86/include/generated/asm/syscalls_64.h:47\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xd9/0x1e0 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\r\n\r\nUninit was stored to memory at:\n raw_sock_get+0x650/0x800 net/ipv4/raw_diag.c:71\n raw_diag_dump_one+0xa1/0x660 net/ipv4/raw_diag.c:99\n inet_diag_cmd_exact+0x7d9/0x980\n inet_diag_get_exact_compat net/ipv4/inet_diag.c:1404 [inline]\n inet_diag_rcv_msg_compat+0x469/0x530 net/ipv4/inet_diag.c:1426\n sock_diag_rcv_msg+0x23d/0x740 net/core/sock_diag.c:282\n netlink_rcv_skb+0x537/0x670 net/netlink/af_netlink.c:2564\n sock_diag_rcv+0x35/0x40 net/core/sock_diag.c:297\n netlink_unicast_kernel net/netlink/af_netlink.c:1335 [inline]\n netlink_unicast+0xe74/0x1240 net/netlink/af_netlink.c:1361\n netlink_sendmsg+0x10c6/0x1260 net/netlink/af_netlink.c:1905\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg+0x332/0x3d0 net/socket.c:745\n ____sys_sendmsg+0x7f0/0xb70 net/socket.c:2585\n ___sys_sendmsg+0x271/0x3b0 net/socket.c:2639\n __sys_sendmsg net/socket.c:2668 [inline]\n __do_sys_sendmsg net/socket.c:2677 [inline]\n __se_sys_sendmsg net/socket.c:2675 [inline]\n __x64_sys_sendmsg+0x27e/0x4a0 net/socket.c:2675\n x64_sys_call+0x135e/0x3ce0 arch/x86/include/generated/asm/syscalls_64.h:47\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xd9/0x1e0 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\r\n\r\nLocal variable req.i created at:\n inet_diag_get_exact_compat net/ipv4/inet_diag.c:1396 [inline]\n inet_diag_rcv_msg_compat+0x2a6/0x530 net/ipv4/inet_diag.c:1426\n sock_diag_rcv_msg+0x23d/0x740 net/core/sock_diag.c:282\r\n\r\nCPU: 1 PID: 8888 Comm: syz-executor.6 Not tainted 6.10.0-rc4-00217-g35bb670d65fc #32\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-2.fc40 04/01/2014(CVE-2024-42106)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\njffs2: Fix potential illegal address access in jffs2_free_inode\r\n\r\nDuring the stress testing of the jffs2 file system,the following\nabnormal printouts were found:\n[ 2430.649000] Unable to handle kernel paging request at virtual address 0069696969696948\n[ 2430.649622] Mem abort info:\n[ 2430.649829] ESR = 0x96000004\n[ 2430.650115] EC = 0x25: DABT (current EL), IL = 32 bits\n[ 2430.650564] SET = 0, FnV = 0\n[ 2430.650795] EA = 0, S1PTW = 0\n[ 2430.651032] FSC = 0x04: level 0 translation fault\n[ 2430.651446] Data abort info:\n[ 2430.651683] ISV = 0, ISS = 0x00000004\n[ 2430.652001] CM = 0, WnR = 0\n[ 2430.652558] [0069696969696948] address between user and kernel address ranges\n[ 2430.653265] Internal error: Oops: 96000004 [#1] PREEMPT SMP\n[ 2430.654512] CPU: 2 PID: 20919 Comm: cat Not tainted 5.15.25-g512f31242bf6 #33\n[ 2430.655008] Hardware name: linux,dummy-virt (DT)\n[ 2430.655517] pstate: 20000005 (nzCv daif -PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n[ 2430.656142] pc : kfree+0x78/0x348\n[ 2430.656630] lr : jffs2_free_inode+0x24/0x48\n[ 2430.657051] sp : ffff800009eebd10\n[ 2430.657355] x29: ffff800009eebd10 x28: 0000000000000001 x27: 0000000000000000\n[ 2430.658327] x26: ffff000038f09d80 x25: 0080000000000000 x24: ffff800009d38000\n[ 2430.658919] x23: 5a5a5a5a5a5a5a5a x22: ffff000038f09d80 x21: ffff8000084f0d14\n[ 2430.659434] x20: ffff0000bf9a6ac0 x19: 0169696969696940 x18: 0000000000000000\n[ 2430.659969] x17: ffff8000b6506000 x16: ffff800009eec000 x15: 0000000000004000\n[ 2430.660637] x14: 0000000000000000 x13: 00000001000820a1 x12: 00000000000d1b19\n[ 2430.661345] x11: 0004000800000000 x10: 0000000000000001 x9 : ffff8000084f0d14\n[ 2430.662025] x8 : ffff0000bf9a6b40 x7 : ffff0000bf9a6b48 x6 : 0000000003470302\n[ 2430.662695] x5 : ffff00002e41dcc0 x4 : ffff0000bf9aa3b0 x3 : 0000000003470342\n[ 2430.663486] x2 : 0000000000000000 x1 : ffff8000084f0d14 x0 : fffffc0000000000\n[ 2430.664217] Call trace:\n[ 2430.664528] kfree+0x78/0x348\n[ 2430.664855] jffs2_free_inode+0x24/0x48\n[ 2430.665233] i_callback+0x24/0x50\n[ 2430.665528] rcu_do_batch+0x1ac/0x448\n[ 2430.665892] rcu_core+0x28c/0x3c8\n[ 2430.666151] rcu_core_si+0x18/0x28\n[ 2430.666473] __do_softirq+0x138/0x3cc\n[ 2430.666781] irq_exit+0xf0/0x110\n[ 2430.667065] handle_domain_irq+0x6c/0x98\n[ 2430.667447] gic_handle_irq+0xac/0xe8\n[ 2430.667739] call_on_irq_stack+0x28/0x54\nThe parameter passed to kfree was 5a5a5a5a, which corresponds to the target field of\nthe jffs_inode_info structure. It was found that all variables in the jffs_inode_info\nstructure were 5a5a5a5a, except for the first member sem. It is suspected that these\nvariables are not initialized because they were set to 5a5a5a5a during memory testing,\nwhich is meant to detect uninitialized memory.The sem variable is initialized in the\nfunction jffs2_i_init_once, while other members are initialized in\nthe function jffs2_init_inode_info.\r\n\r\nThe function jffs2_init_inode_info is called after iget_locked,\nbut in the iget_locked function, the destroy_inode process is triggered,\nwhich releases the inode and consequently, the target member of the inode\nis not initialized.In concurrent high pressure scenarios, iget_locked\nmay enter the destroy_inode branch as described in the code.\r\n\r\nSince the destroy_inode functionality of jffs2 only releases the target,\nthe fix method is to set target to NULL in jffs2_i_init_once.(CVE-2024-42115)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Skip finding free audio for unknown engine_id\r\n\r\n[WHY]\nENGINE_ID_UNKNOWN = -1 and can not be used as an array index. Plus, it\nalso means it is uninitialized and does not need free audio.\r\n\r\n[HOW]\nSkip and return NULL.\r\n\r\nThis fixes 2 OVERRUN issues reported by Coverity.(CVE-2024-42119)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nIB/core: Implement a limit on UMAD receive List\r\n\r\nThe existing behavior of ib_umad, which maintains received MAD\npackets in an unbounded list, poses a risk of uncontrolled growth.\nAs user-space applications extract packets from this list, the rate\nof extraction may not match the rate of incoming packets, leading\nto potential list overflow.\r\n\r\nTo address this, we introduce a limit to the size of the list. After\nconsidering typical scenarios, such as OpenSM processing, which can\nhandle approximately 100k packets per second, and the 1-second retry\ntimeout for most packets, we set the list size limit to 200k. Packets\nreceived beyond this limit are dropped, assuming they are likely timed\nout by the time they are handled by user-space.\r\n\r\nNotably, packets queued on the receive list due to reasons like\ntimed-out sends are preserved even when the list is full.(CVE-2024-42145)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: dsa: mv88e6xxx: Correct check for empty list\r\n\r\nSince commit a3c53be55c95 (\u0026quot;net: dsa: mv88e6xxx: Support multiple MDIO\nbusses\u0026quot;) mv88e6xxx_default_mdio_bus() has checked that the\nreturn value of list_first_entry() is non-NULL.\r\n\r\nThis appears to be intended to guard against the list chip-\u0026gt;mdios being\nempty. However, it is not the correct check as the implementation of\nlist_first_entry is not designed to return NULL for empty lists.\r\n\r\nInstead, use list_first_entry_or_null() which does return NULL if the\nlist is empty.\r\n\r\nFlagged by Smatch.\nCompile tested only.(CVE-2024-42224)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu: Using uninitialized value *size when calling amdgpu_vce_cs_reloc\r\n\r\nInitialize the size before calling amdgpu_vce_cs_reloc, such as case 0x03000001.\nV2: To really improve the handling we would actually\n need to have a separate value of 0xffffffff.(Christian)(CVE-2024-42228)",
"id": "OESA-2024-1963",
"modified": "2026-08-06T11:07:26Z",
"published": "2024-08-09T11:07:26Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2024-1963"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47202"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-33621"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40902"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40959"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41006"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41014"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41017"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41020"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41044"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41063"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41069"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41072"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41081"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41089"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41095"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41097"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42077"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42086"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42090"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42092"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42094"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42097"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42104"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42106"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42115"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42119"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42145"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42224"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42228"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47202",
"CVE-2024-33621",
"CVE-2024-40902",
"CVE-2024-40959",
"CVE-2024-41006",
"CVE-2024-41014",
"CVE-2024-41017",
"CVE-2024-41020",
"CVE-2024-41044",
"CVE-2024-41063",
"CVE-2024-41069",
"CVE-2024-41072",
"CVE-2024-41081",
"CVE-2024-41089",
"CVE-2024-41095",
"CVE-2024-41097",
"CVE-2024-42077",
"CVE-2024-42086",
"CVE-2024-42090",
"CVE-2024-42092",
"CVE-2024-42094",
"CVE-2024-42097",
"CVE-2024-42104",
"CVE-2024-42106",
"CVE-2024-42115",
"CVE-2024-42119",
"CVE-2024-42145",
"CVE-2024-42224",
"CVE-2024-42228"
]
}
OESA-2024-2216 (CVE-2024-27436)
Vulnerability from osv_openeuler – Published: 2024-10-12 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
ALSA: usb-audio: Stop parsing channels bits when all channels are found.
If a usb audio device sets more bits than the amount of channels it could write outside of the map array.(CVE-2024-27436)
In the Linux kernel, the following vulnerability has been resolved:
usb: gadget: f_fs: Fix race between aio_cancel() and AIO request complete
FFS based applications can utilize the aio_cancel() callback to dequeue pending USB requests submitted to the UDC. There is a scenario where the FFS application issues an AIO cancel call, while the UDC is handling a soft disconnect. For a DWC3 based implementation, the callstack looks like the following:
DWC3 Gadget FFS Application
dwc3_gadget_soft_disconnect() ... --> dwc3_stop_active_transfers() --> dwc3_gadget_giveback(-ESHUTDOWN) --> ffs_epfile_async_io_complete() ffs_aio_cancel() --> usb_ep_free_request() --> usb_ep_dequeue()
There is currently no locking implemented between the AIO completion handler and AIO cancel, so the issue occurs if the completion routine is running in parallel to an AIO cancel call coming from the FFS application. As the completion call frees the USB request (io_data->req) the FFS application is also referencing it for the usb_ep_dequeue() call. This can lead to accessing a stale/hanging pointer.
commit b566d38857fc ("usb: gadget: f_fs: use io_data->status consistently") relocated the usb_ep_free_request() into ffs_epfile_async_io_complete(). However, in order to properly implement locking to mitigate this issue, the spinlock can't be added to ffs_epfile_async_io_complete(), as usb_ep_dequeue() (if successfully dequeuing a USB request) will call the function driver's completion handler in the same context. Hence, leading into a deadlock.
Fix this issue by moving the usb_ep_free_request() back to ffs_user_copy_worker(), and ensuring that it explicitly sets io_data->req to NULL after freeing it within the ffs->eps_lock. This resolves the race condition above, as the ffs_aio_cancel() routine will not continue attempting to dequeue a request that has already been freed, or the ffs_user_copy_work() not freeing the USB request until the AIO cancel is done referencing it.
This fix depends on commit b566d38857fc ("usb: gadget: f_fs: use io_data->status consistently")(CVE-2024-36894)
In the Linux kernel, the following vulnerability has been resolved:
scsi: bfa: Ensure the copied buf is NUL terminated
Currently, we allocate a nbytes-sized kernel buffer and copy nbytes from userspace to that buffer. Later, we use sscanf on this buffer but we don't ensure that the string is terminated inside the buffer, this can lead to OOB read when using sscanf. Fix this issue by using memdup_user_nul instead of memdup_user.(CVE-2024-38560)
In the Linux kernel, the following vulnerability has been resolved:
enic: Validate length of nl attributes in enic_set_vf_port
enic_set_vf_port assumes that the nl attribute IFLA_PORT_PROFILE is of length PORT_PROFILE_MAX and that the nl attributes IFLA_PORT_INSTANCE_UUID, IFLA_PORT_HOST_UUID are of length PORT_UUID_MAX. These attributes are validated (in the function do_setlink in rtnetlink.c) using the nla_policy ifla_port_policy. The policy defines IFLA_PORT_PROFILE as NLA_STRING, IFLA_PORT_INSTANCE_UUID as NLA_BINARY and IFLA_PORT_HOST_UUID as NLA_STRING. That means that the length validation using the policy is for the max size of the attributes and not on exact size so the length of these attributes might be less than the sizes that enic_set_vf_port expects. This might cause an out of bands read access in the memcpys of the data of these attributes in enic_set_vf_port.(CVE-2024-38659)
In the Linux kernel, the following vulnerability has been resolved:
bcache: fix variable length array abuse in btree_iter
btree_iter is used in two ways: either allocated on the stack with a fixed size MAX_BSETS, or from a mempool with a dynamic size based on the specific cache set. Previously, the struct had a fixed-length array of size MAX_BSETS which was indexed out-of-bounds for the dynamically-sized iterators, which causes UBSAN to complain.
This patch uses the same approach as in bcachefs's sort_iter and splits the iterator into a btree_iter with a flexible array member and a btree_iter_stack which embeds a btree_iter as well as a fixed-length data array.(CVE-2024-39482)
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: discard write access to the directory open
may_open() does not allow a directory to be opened with the write access. However, some writing flags set by client result in adding write access on server, making ksmbd incompatible with FUSE file system. Simply, let's discard the write access when opening a directory.
list_add corruption. next is NULL. ------------[ cut here ]------------ kernel BUG at lib/list_debug.c:26! pc : __list_add_valid+0x88/0xbc lr : __list_add_valid+0x88/0xbc Call trace: __list_add_valid+0x88/0xbc fuse_finish_open+0x11c/0x170 fuse_open_common+0x284/0x5e8 fuse_dir_open+0x14/0x24 do_dentry_open+0x2a4/0x4e0 dentry_open+0x50/0x80 smb2_open+0xbe4/0x15a4 handle_ksmbd_work+0x478/0x5ec process_one_work+0x1b4/0x448 worker_thread+0x25c/0x430 kthread+0x104/0x1d4 ret_from_fork+0x10/0x20(CVE-2024-41030)
In the Linux kernel, the following vulnerability has been resolved:
drm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes
In nv17_tv_get_ld_modes(), the return value of drm_mode_duplicate() is assigned to mode, which will lead to a possible NULL pointer dereference on failure of drm_mode_duplicate(). Add a check to avoid npd.(CVE-2024-41095)
In the Linux kernel, the following vulnerability has been resolved:
media: xc2028: avoid use-after-free in load_firmware_cb()
syzkaller reported use-after-free in load_firmware_cb() 1. The reason is because the module allocated a struct tuner in tuner_probe(), and then the module initialization failed, the struct tuner was released. A worker which created during module initialization accesses this struct tuner later, it caused use-after-free.
The process is as follows:
task-6504 worker_thread tuner_probe <= alloc dvb_frontend [2] ... request_firmware_nowait <= create a worker ... tuner_remove <= free dvb_frontend ... request_firmware_work_func <= the firmware is ready load_firmware_cb <= but now the dvb_frontend has been freed
To fix the issue, check the dvd_frontend in load_firmware_cb(), if it is null, report a warning and just return.
BUG: KASAN: use-after-free in load_firmware_cb+0x1310/0x17a0
Read of size 8 at addr ffff8000d7ca2308 by task kworker/2:3/6504
Call trace:
load_firmware_cb+0x1310/0x17a0
request_firmware_work_func+0x128/0x220
process_one_work+0x770/0x1824
worker_thread+0x488/0xea0
kthread+0x300/0x430
ret_from_fork+0x10/0x20
Allocated by task 6504:
kzalloc
tuner_probe+0xb0/0x1430
i2c_device_probe+0x92c/0xaf0
really_probe+0x678/0xcd0
driver_probe_device+0x280/0x370
__device_attach_driver+0x220/0x330
bus_for_each_drv+0x134/0x1c0
__device_attach+0x1f4/0x410
device_initial_probe+0x20/0x30
bus_probe_device+0x184/0x200
device_add+0x924/0x12c0
device_register+0x24/0x30
i2c_new_device+0x4e0/0xc44
v4l2_i2c_new_subdev_board+0xbc/0x290
v4l2_i2c_new_subdev+0xc8/0x104
em28xx_v4l2_init+0x1dd0/0x3770
Freed by task 6504:
kfree+0x238/0x4e4
tuner_remove+0x144/0x1c0
i2c_device_remove+0xc8/0x290
__device_release_driver+0x314/0x5fc
device_release_driver+0x30/0x44
bus_remove_device+0x244/0x490
device_del+0x350/0x900
device_unregister+0x28/0xd0
i2c_unregister_device+0x174/0x1d0
v4l2_device_unregister+0x224/0x380
em28xx_v4l2_init+0x1d90/0x3770
The buggy address belongs to the object at ffff8000d7ca2000
which belongs to the cache kmalloc-2k of size 2048
The buggy address is located 776 bytes inside of
2048-byte region [ffff8000d7ca2000, ffff8000d7ca2800)
The buggy address belongs to the page:
page:ffff7fe00035f280 count:1 mapcount:0 mapping:ffff8000c001f000 index:0x0
flags: 0x7ff800000000100(slab)
raw: 07ff800000000100 ffff7fe00049d880 0000000300000003 ffff8000c001f000
raw: 0000000000000000 0000000080100010 00000001ffffffff 0000000000000000
page dumped because: kasan: bad access detected
Memory state around the buggy address:
ffff8000d7ca2200: fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb
ffff8000d7ca2280: fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb
>ffff8000d7ca2300: fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb
^
ffff8000d7ca2380: fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb
ffff8000d7ca2400: fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb
==================================================================
[2] Actually, it is allocated for struct tuner, and dvb_frontend is inside.(CVE-2024-43900)
In the Linux kernel, the following vulnerability has been resolved:
sched/smt: Fix unbalance sched_smt_present dec/inc
I got the following warn report while doing stress test:
jump label: negative count! WARNING: CPU: 3 PID: 38 at kernel/jump_label.c:263 static_key_slow_try_dec+0x9d/0xb0 Call Trace: <TASK> __static_key_slow_dec_cpuslocked+0x16/0x70 sched_cpu_deactivate+0x26e/0x2a0 cpuhp_invoke_callback+0x3ad/0x10d0 cpuhp_thread_fun+0x3f5/0x680 smpboot_thread_fn+0x56d/0x8d0 kthread+0x309/0x400 ret_from_fork+0x41/0x70 ret_from_fork_asm+0x1b/0x30 </TASK>
Because when cpuset_cpu_inactive() fails in sched_cpu_deactivate(), the cpu offline failed, but sched_smt_present is decremented before calling sched_cpu_deactivate(), it leads to unbalanced dec/inc, so fix it by incrementing sched_smt_present in the error path.(CVE-2024-44958)
In the Linux kernel, the following vulnerability has been resolved:
drm/msm/dpu: cleanup FB if dpu_format_populate_layout fails
If the dpu_format_populate_layout() fails, then FB is prepared, but not cleaned up. This ends up leaking the pin_count on the GEM object and causes a splat during DRM file closure:
msm_obj->pin_count WARNING: CPU: 2 PID: 569 at drivers/gpu/drm/msm/msm_gem.c:121 update_lru_locked+0xc4/0xcc [...] Call trace: update_lru_locked+0xc4/0xcc put_pages+0xac/0x100 msm_gem_free_object+0x138/0x180 drm_gem_object_free+0x1c/0x30 drm_gem_object_handle_put_unlocked+0x108/0x10c drm_gem_object_release_handle+0x58/0x70 idr_for_each+0x68/0xec drm_gem_release+0x28/0x40 drm_file_free+0x174/0x234 drm_release+0xb0/0x160 __fput+0xc0/0x2c8 __fput_sync+0x50/0x5c __arm64_sys_close+0x38/0x7c invoke_syscall+0x48/0x118 el0_svc_common.constprop.0+0x40/0xe0 do_el0_svc+0x1c/0x28 el0_svc+0x4c/0x120 el0t_64_sync_handler+0x100/0x12c el0t_64_sync+0x190/0x194 irq event stamp: 129818 hardirqs last enabled at (129817): [<ffffa5f6d953fcc0>] console_unlock+0x118/0x124 hardirqs last disabled at (129818): [<ffffa5f6da7dcf04>] el1_dbg+0x24/0x8c softirqs last enabled at (129808): [<ffffa5f6d94afc18>] handle_softirqs+0x4c8/0x4e8 softirqs last disabled at (129785): [<ffffa5f6d94105e4>] __do_softirq+0x14/0x20
Patchwork: https://patchwork.freedesktop.org/patch/600714/(CVE-2024-44982)
In the Linux kernel, the following vulnerability has been resolved:
Input: MT - limit max slots
syzbot is reporting too large allocation at input_mt_init_slots(), for num_slots is supplied from userspace using ioctl(UI_DEV_CREATE).
Since nobody knows possible max slots, this patch chose 1024.(CVE-2024-45008)
In the Linux kernel, the following vulnerability has been resolved:
netem: fix return value if duplicate enqueue fails
There is a bug in netem_enqueue() introduced by commit 5845f706388a ("net: netem: fix skb length BUG_ON in __skb_to_sgvec") that can lead to a use-after-free.
This commit made netem_enqueue() always return NET_XMIT_SUCCESS when a packet is duplicated, which can cause the parent qdisc's q.qlen to be mistakenly incremented. When this happens qlen_notify() may be skipped on the parent during destruction, leaving a dangling pointer for some classful qdiscs like DRR.
There are two ways for the bug happen:
- If the duplicated packet is dropped by rootq->enqueue() and then the original packet is also dropped.
- If rootq->enqueue() sends the duplicated packet to a different qdisc and the original packet is dropped.
In both cases NET_XMIT_SUCCESS is returned even though no packets are enqueued at the netem qdisc.
The fix is to defer the enqueue of the duplicate packet until after the original packet has been guaranteed to return NET_XMIT_SUCCESS.(CVE-2024-45016)
In the Linux kernel, the following vulnerability has been resolved:
scsi: aacraid: Fix double-free on probe failure
aac_probe_one() calls hardware-specific init functions through the aac_driver_ident::init pointer, all of which eventually call down to aac_init_adapter().
If aac_init_adapter() fails after allocating memory for aac_dev::queues, it frees the memory but does not clear that member.
After the hardware-specific init function returns an error, aac_probe_one() goes down an error path that frees the memory pointed to by aac_dev::queues, resulting.in a double-free.(CVE-2024-46673)
In the Linux kernel, the following vulnerability has been resolved:
usb: dwc3: st: fix probed platform device ref count on probe error path
The probe function never performs any paltform device allocation, thus error path "undo_platform_dev_alloc" is entirely bogus. It drops the reference count from the platform device being probed. If error path is triggered, this will lead to unbalanced device reference counts and premature release of device resources, thus possible use-after-free when releasing remaining devm-managed resources.(CVE-2024-46674)
In the Linux kernel, the following vulnerability has been resolved:
ethtool: check device is present when getting link settings
A sysfs reader can race with a device reset or removal, attempting to read device state when the device is not actually present. eg:
[exception RIP: qed_get_current_link+17]
#8 [ffffb9e4f2907c48] qede_get_link_ksettings at ffffffffc07a994a [qede] #9 [ffffb9e4f2907cd8] __rh_call_get_link_ksettings at ffffffff992b01a3 #10 [ffffb9e4f2907d38] __ethtool_get_link_ksettings at ffffffff992b04e4 #11 [ffffb9e4f2907d90] duplex_show at ffffffff99260300 #12 [ffffb9e4f2907e38] dev_attr_show at ffffffff9905a01c #13 [ffffb9e4f2907e50] sysfs_kf_seq_show at ffffffff98e0145b #14 [ffffb9e4f2907e68] seq_read at ffffffff98d902e3 #15 [ffffb9e4f2907ec8] vfs_read at ffffffff98d657d1 #16 [ffffb9e4f2907f00] ksys_read at ffffffff98d65c3f #17 [ffffb9e4f2907f38] do_syscall_64 at ffffffff98a052fb
crash> struct net_device.state ffff9a9d21336000 state = 5,
state 5 is __LINK_STATE_START (0b1) and __LINK_STATE_NOCARRIER (0b100). The device is not present, note lack of __LINK_STATE_PRESENT (0b10).
This is the same sort of panic as observed in commit 4224cfd7fb65 ("net-sysfs: add check for netdevice being present to speed_show").
There are many other callers of __ethtool_get_link_ksettings() which don't have a device presence check.
Move this check into ethtool to protect all callers.(CVE-2024-46679)
In the Linux kernel, the following vulnerability has been resolved:
pktgen: use cpus_read_lock() in pg_net_init()
I have seen the WARN_ON(smp_processor_id() != cpu) firing in pktgen_thread_worker() during tests.
We must use cpus_read_lock()/cpus_read_unlock() around the for_each_online_cpu(cpu) loop.
While we are at it use WARN_ON_ONCE() to avoid a possible syslog flood.(CVE-2024-46681)
In the Linux kernel, the following vulnerability has been resolved:
selinux,smack: don't bypass permissions check in inode_setsecctx hook
Marek Gresko reports that the root user on an NFS client is able to change the security labels on files on an NFS filesystem that is exported with root squashing enabled.
The end of the kerneldoc comment for __vfs_setxattr_noperm() states:
- This function requires the caller to lock the inode's i_mutex before it
- is executed. It also assumes that the caller will make the appropriate
- permission checks.
nfsd_setattr() does do permissions checking via fh_verify() and nfsd_permission(), but those don't do all the same permissions checks that are done by security_inode_setxattr() and its related LSM hooks do.
Since nfsd_setattr() is the only consumer of security_inode_setsecctx(), simplest solution appears to be to replace the call to __vfs_setxattr_noperm() with a call to __vfs_setxattr_locked(). This fixes the above issue and has the added benefit of causing nfsd to recall conflicting delegations on a file when a client tries to change its security label.(CVE-2024-46695)
In the Linux kernel, the following vulnerability has been resolved:
KVM: arm64: Make ICC_SGI_EL1 undef in the absence of a vGICv3
On a system with a GICv3, if a guest hasn't been configured with GICv3 and that the host is not capable of GICv2 emulation, a write to any of the ICC_SGI_EL1 registers is trapped to EL2.
We therefore try to emulate the SGI access, only to hit a NULL pointer as no private interrupt is allocated (no GIC, remember?).
The obvious fix is to give the guest what it deserves, in the shape of a UNDEF exception.(CVE-2024-46707)
In the Linux kernel, the following vulnerability has been resolved:
apparmor: fix possible NULL pointer dereference
profile->parent->dents[AAFS_PROF_DIR] could be NULL only if its parent is made from __create_missing_ancestors(..) and 'ent->old' is NULL in aa_replace_profiles(..). In that case, it must return an error code and the code, -ENOENT represents its state that the path of its parent is not existed yet.
BUG: kernel NULL pointer dereference, address: 0000000000000030 PGD 0 P4D 0 PREEMPT SMP PTI CPU: 4 PID: 3362 Comm: apparmor_parser Not tainted 6.8.0-24-generic #24 Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.15.0-1 04/01/2014 RIP: 0010:aafs_create.constprop.0+0x7f/0x130 Code: 4c 63 e0 48 83 c4 18 4c 89 e0 5b 41 5c 41 5d 41 5e 41 5f 5d 31 d2 31 c9 31 f6 31 ff 45 31 c0 45 31 c9 45 31 d2 c3 cc cc cc cc <4d> 8b 55 30 4d 8d ba a0 00 00 00 4c 89 55 c0 4c 89 ff e8 7a 6a ae RSP: 0018:ffffc9000b2c7c98 EFLAGS: 00010246 RAX: 0000000000000000 RBX: 00000000000041ed RCX: 0000000000000000 RDX: 0000000000000000 RSI: 0000000000000000 RDI: 0000000000000000 RBP: ffffc9000b2c7cd8 R08: 0000000000000000 R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000000 R12: ffffffff82baac10 R13: 0000000000000000 R14: 0000000000000000 R15: 0000000000000000 FS: 00007be9f22cf740(0000) GS:ffff88817bc00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000000000000030 CR3: 0000000134b08000 CR4: 00000000000006f0 Call Trace: <TASK> ? show_regs+0x6d/0x80 ? __die+0x24/0x80 ? page_fault_oops+0x99/0x1b0 ? kernelmode_fixup_or_oops+0xb2/0x140 ? __bad_area_nosemaphore+0x1a5/0x2c0 ? find_vma+0x34/0x60 ? bad_area_nosemaphore+0x16/0x30 ? do_user_addr_fault+0x2a2/0x6b0 ? exc_page_fault+0x83/0x1b0 ? asm_exc_page_fault+0x27/0x30 ? aafs_create.constprop.0+0x7f/0x130 ? aafs_create.constprop.0+0x51/0x130 __aafs_profile_mkdir+0x3d6/0x480 aa_replace_profiles+0x83f/0x1270 policy_update+0xe3/0x180 profile_load+0xbc/0x150 ? rw_verify_area+0x47/0x140 vfs_write+0x100/0x480 ? __x64_sys_openat+0x55/0xa0 ? syscall_exit_to_user_mode+0x86/0x260 ksys_write+0x73/0x100 __x64_sys_write+0x19/0x30 x64_sys_call+0x7e/0x25c0 do_syscall_64+0x7f/0x180 entry_SYSCALL_64_after_hwframe+0x78/0x80 RIP: 0033:0x7be9f211c574 Code: c7 00 16 00 00 00 b8 ff ff ff ff c3 66 2e 0f 1f 84 00 00 00 00 00 f3 0f 1e fa 80 3d d5 ea 0e 00 00 74 13 b8 01 00 00 00 0f 05 <48> 3d 00 f0 ff ff 77 54 c3 0f 1f 00 55 48 89 e5 48 83 ec 20 48 89 RSP: 002b:00007ffd26f2b8c8 EFLAGS: 00000202 ORIG_RAX: 0000000000000001 RAX: ffffffffffffffda RBX: 00005d504415e200 RCX: 00007be9f211c574 RDX: 0000000000001fc1 RSI: 00005d504418bc80 RDI: 0000000000000004 RBP: 0000000000001fc1 R08: 0000000000001fc1 R09: 0000000080000000 R10: 0000000000000000 R11: 0000000000000202 R12: 00005d504418bc80 R13: 0000000000000004 R14: 00007ffd26f2b9b0 R15: 00007ffd26f2ba30 </TASK> Modules linked in: snd_seq_dummy snd_hrtimer qrtr snd_hda_codec_generic snd_hda_intel snd_intel_dspcfg snd_intel_sdw_acpi snd_hda_codec snd_hda_core snd_hwdep snd_pcm snd_seq_midi snd_seq_midi_event snd_rawmidi snd_seq snd_seq_device i2c_i801 snd_timer i2c_smbus qxl snd soundcore drm_ttm_helper lpc_ich ttm joydev input_leds serio_raw mac_hid binfmt_misc msr parport_pc ppdev lp parport efi_pstore nfnetlink dmi_sysfs qemu_fw_cfg ip_tables x_tables autofs4 hid_generic usbhid hid ahci libahci psmouse virtio_rng xhci_pci xhci_pci_renesas CR2: 0000000000000030 ---[ end trace 0000000000000000 ]--- RIP: 0010:aafs_create.constprop.0+0x7f/0x130 Code: 4c 63 e0 48 83 c4 18 4c 89 e0 5b 41 5c 41 5d 41 5e 41 5f 5d 31 d2 31 c9 31 f6 31 ff 45 31 c0 45 31 c9 45 31 d2 c3 cc cc cc cc <4d> 8b 55 30 4d 8d ba a0 00 00 00 4c 89 55 c0 4c 89 ff e8 7a 6a ae RSP: 0018:ffffc9000b2c7c98 EFLAGS: 00010246 RAX: 0000000000000000 RBX: 00000000000041ed RCX: 0000000000000000 RDX: 0000000000000000 RSI: 0000000000000000 RDI: 0000000000000000 RBP: ffffc9000b2c7cd8 R08: 0000000000000000 R09: 0000000000000000 R10: 0000 ---truncated---(CVE-2024-46721)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu: Fix out-of-bounds write warning
Check the ring type value to fix the out-of-bounds write warning(CVE-2024-46725)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Ensure index calculation will not overflow
[WHY & HOW] Make sure vmid0p72_idx, vnom0p8_idx and vmax0p9_idx calculation will never overflow and exceess array size.
This fixes 3 OVERRUN and 1 INTEGER_OVERFLOW issues reported by Coverity.(CVE-2024-46726)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Assign linear_pitch_alignment even for VM
[Description] Assign linear_pitch_alignment so we don't cause a divide by 0 error in VM environments(CVE-2024-46732)
In the Linux kernel, the following vulnerability has been resolved:
nvmet-tcp: fix kernel crash if commands allocation fails
If the commands allocation fails in nvmet_tcp_alloc_cmds() the kernel crashes in nvmet_tcp_release_queue_work() because of a NULL pointer dereference.
nvmet: failed to install queue 0 cntlid 1 ret 6 Unable to handle kernel NULL pointer dereference at virtual address 0000000000000008
Fix the bug by setting queue->nr_cmds to zero in case nvmet_tcp_alloc_cmd() fails.(CVE-2024-46737)
In the Linux kernel, the following vulnerability has been resolved:
VMCI: Fix use-after-free when removing resource in vmci_resource_remove()
When removing a resource from vmci_resource_table in vmci_resource_remove(), the search is performed using the resource handle by comparing context and resource fields.
It is possible though to create two resources with different types but same handle (same context and resource fields).
When trying to remove one of the resources, vmci_resource_remove() may not remove the intended one, but the object will still be freed as in the case of the datagram type in vmci_datagram_destroy_handle(). vmci_resource_table will still hold a pointer to this freed resource leading to a use-after-free vulnerability.
BUG: KASAN: use-after-free in vmci_handle_is_equal include/linux/vmw_vmci_defs.h:142 [inline] BUG: KASAN: use-after-free in vmci_resource_remove+0x3a1/0x410 drivers/misc/vmw_vmci/vmci_resource.c:147 Read of size 4 at addr ffff88801c16d800 by task syz-executor197/1592 Call Trace: <TASK> __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0x82/0xa9 lib/dump_stack.c:106 print_address_description.constprop.0+0x21/0x366 mm/kasan/report.c:239 __kasan_report.cold+0x7f/0x132 mm/kasan/report.c:425 kasan_report+0x38/0x51 mm/kasan/report.c:442 vmci_handle_is_equal include/linux/vmw_vmci_defs.h:142 [inline] vmci_resource_remove+0x3a1/0x410 drivers/misc/vmw_vmci/vmci_resource.c:147 vmci_qp_broker_detach+0x89a/0x11b9 drivers/misc/vmw_vmci/vmci_queue_pair.c:2182 ctx_free_ctx+0x473/0xbe1 drivers/misc/vmw_vmci/vmci_context.c:444 kref_put include/linux/kref.h:65 [inline] vmci_ctx_put drivers/misc/vmw_vmci/vmci_context.c:497 [inline] vmci_ctx_destroy+0x170/0x1d6 drivers/misc/vmw_vmci/vmci_context.c:195 vmci_host_close+0x125/0x1ac drivers/misc/vmw_vmci/vmci_host.c:143 __fput+0x261/0xa34 fs/file_table.c:282 task_work_run+0xf0/0x194 kernel/task_work.c:164 tracehook_notify_resume include/linux/tracehook.h:189 [inline] exit_to_user_mode_loop+0x184/0x189 kernel/entry/common.c:187 exit_to_user_mode_prepare+0x11b/0x123 kernel/entry/common.c:220 __syscall_exit_to_user_mode_work kernel/entry/common.c:302 [inline] syscall_exit_to_user_mode+0x18/0x42 kernel/entry/common.c:313 do_syscall_64+0x41/0x85 arch/x86/entry/common.c:86 entry_SYSCALL_64_after_hwframe+0x6e/0x0
This change ensures the type is also checked when removing the resource from vmci_resource_table in vmci_resource_remove().(CVE-2024-46738)
In the Linux kernel, the following vulnerability has been resolved:
uio_hv_generic: Fix kernel NULL pointer dereference in hv_uio_rescind
For primary VM Bus channels, primary_channel pointer is always NULL. This pointer is valid only for the secondary channels. Also, rescind callback is meant for primary channels only.
Fix NULL pointer dereference by retrieving the device_obj from the parent for the primary channel.(CVE-2024-46739)
In the Linux kernel, the following vulnerability has been resolved:
binder: fix UAF caused by offsets overwrite
Binder objects are processed and copied individually into the target buffer during transactions. Any raw data in-between these objects is copied as well. However, this raw data copy lacks an out-of-bounds check. If the raw data exceeds the data section size then the copy overwrites the offsets section. This eventually triggers an error that attempts to unwind the processed objects. However, at this point the offsets used to index these objects are now corrupted.
Unwinding with corrupted offsets can result in decrements of arbitrary nodes and lead to their premature release. Other users of such nodes are left with a dangling pointer triggering a use-after-free. This issue is made evident by the following KASAN report (trimmed):
================================================================== BUG: KASAN: slab-use-after-free in _raw_spin_lock+0xe4/0x19c Write of size 4 at addr ffff47fc91598f04 by task binder-util/743
CPU: 9 UID: 0 PID: 743 Comm: binder-util Not tainted 6.11.0-rc4 #1 Hardware name: linux,dummy-virt (DT) Call trace: _raw_spin_lock+0xe4/0x19c binder_free_buf+0x128/0x434 binder_thread_write+0x8a4/0x3260 binder_ioctl+0x18f0/0x258c [...]
Allocated by task 743: __kmalloc_cache_noprof+0x110/0x270 binder_new_node+0x50/0x700 binder_transaction+0x413c/0x6da8 binder_thread_write+0x978/0x3260 binder_ioctl+0x18f0/0x258c [...]
Freed by task 745: kfree+0xbc/0x208 binder_thread_read+0x1c5c/0x37d4 binder_ioctl+0x16d8/0x258c [...] ==================================================================
To avoid this issue, let's check that the raw data copy is within the boundaries of the data section.(CVE-2024-46740)
In the Linux kernel, the following vulnerability has been resolved:
of/irq: Prevent device address out-of-bounds read in interrupt map walk
When of_irq_parse_raw() is invoked with a device address smaller than the interrupt parent node (from #address-cells property), KASAN detects the following out-of-bounds read when populating the initial match table (dyndbg="func of_irq_parse_* +p"):
OF: of_irq_parse_one: dev=/soc@0/picasso/watchdog, index=0 OF: parent=/soc@0/pci@878000000000/gpio0@17,0, intsize=2 OF: intspec=4 OF: of_irq_parse_raw: ipar=/soc@0/pci@878000000000/gpio0@17,0, size=2 OF: -> addrsize=3 ================================================================== BUG: KASAN: slab-out-of-bounds in of_irq_parse_raw+0x2b8/0x8d0 Read of size 4 at addr ffffff81beca5608 by task bash/764
CPU: 1 PID: 764 Comm: bash Tainted: G O 6.1.67-484c613561-nokia_sm_arm64 #1 Hardware name: Unknown Unknown Product/Unknown Product, BIOS 2023.01-12.24.03-dirty 01/01/2023 Call trace: dump_backtrace+0xdc/0x130 show_stack+0x1c/0x30 dump_stack_lvl+0x6c/0x84 print_report+0x150/0x448 kasan_report+0x98/0x140 __asan_load4+0x78/0xa0 of_irq_parse_raw+0x2b8/0x8d0 of_irq_parse_one+0x24c/0x270 parse_interrupts+0xc0/0x120 of_fwnode_add_links+0x100/0x2d0 fw_devlink_parse_fwtree+0x64/0xc0 device_add+0xb38/0xc30 of_device_add+0x64/0x90 of_platform_device_create_pdata+0xd0/0x170 of_platform_bus_create+0x244/0x600 of_platform_notify+0x1b0/0x254 blocking_notifier_call_chain+0x9c/0xd0 __of_changeset_entry_notify+0x1b8/0x230 __of_changeset_apply_notify+0x54/0xe4 of_overlay_fdt_apply+0xc04/0xd94 ...
The buggy address belongs to the object at ffffff81beca5600 which belongs to the cache kmalloc-128 of size 128 The buggy address is located 8 bytes inside of 128-byte region [ffffff81beca5600, ffffff81beca5680)
The buggy address belongs to the physical page: page:00000000230d3d03 refcount:1 mapcount:0 mapping:0000000000000000 index:0x0 pfn:0x1beca4 head:00000000230d3d03 order:1 compound_mapcount:0 compound_pincount:0 flags: 0x8000000000010200(slab|head|zone=2) raw: 8000000000010200 0000000000000000 dead000000000122 ffffff810000c300 raw: 0000000000000000 0000000000200020 00000001ffffffff 0000000000000000 page dumped because: kasan: bad access detected
Memory state around the buggy address: ffffff81beca5500: 04 fc fc fc fc fc fc fc fc fc fc fc fc fc fc fc ffffff81beca5580: fc fc fc fc fc fc fc fc fc fc fc fc fc fc fc fc >ffffff81beca5600: 00 fc fc fc fc fc fc fc fc fc fc fc fc fc fc fc ^ ffffff81beca5680: fc fc fc fc fc fc fc fc fc fc fc fc fc fc fc fc ffffff81beca5700: 00 00 00 00 00 00 fc fc fc fc fc fc fc fc fc fc ================================================================== OF: -> got it !
Prevent the out-of-bounds read by copying the device address into a buffer of sufficient size.(CVE-2024-46743)
In the Linux kernel, the following vulnerability has been resolved:
PCI: Add missing bridge lock to pci_bus_lock()
One of the true positives that the cfg_access_lock lockdep effort identified is this sequence:
WARNING: CPU: 14 PID: 1 at drivers/pci/pci.c:4886 pci_bridge_secondary_bus_reset+0x5d/0x70 RIP: 0010:pci_bridge_secondary_bus_reset+0x5d/0x70 Call Trace: <TASK> ? __warn+0x8c/0x190 ? pci_bridge_secondary_bus_reset+0x5d/0x70 ? report_bug+0x1f8/0x200 ? handle_bug+0x3c/0x70 ? exc_invalid_op+0x18/0x70 ? asm_exc_invalid_op+0x1a/0x20 ? pci_bridge_secondary_bus_reset+0x5d/0x70 pci_reset_bus+0x1d8/0x270 vmd_probe+0x778/0xa10 pci_device_probe+0x95/0x120
Where pci_reset_bus() users are triggering unlocked secondary bus resets. Ironically pci_bus_reset(), several calls down from pci_reset_bus(), uses pci_bus_lock() before issuing the reset which locks everything but the bridge itself.
For the same motivation as adding:
bridge = pci_upstream_bridge(dev); if (bridge) pci_dev_lock(bridge);
to pci_reset_function() for the "bus" and "cxl_bus" reset cases, add pci_dev_lock() for @bus->self to pci_bus_lock().
In the Linux kernel, the following vulnerability has been resolved:
btrfs: handle errors from btrfs_dec_ref() properly
In walk_up_proc() we BUG_ON(ret) from btrfs_dec_ref(). This is incorrect, we have proper error handling here, return the error.(CVE-2024-46753)
In the Linux kernel, the following vulnerability has been resolved:
wifi: mwifiex: Do not return unused priv in mwifiex_get_priv_by_id()
mwifiex_get_priv_by_id() returns the priv pointer corresponding to the bss_num and bss_type, but without checking if the priv is actually currently in use. Unused priv pointers do not have a wiphy attached to them which can lead to NULL pointer dereferences further down the callstack. Fix this by returning only used priv pointers which have priv->bss_mode set to something else than NL80211_IFTYPE_UNSPECIFIED.
Said NULL pointer dereference happened when an Accesspoint was started with wpa_supplicant -i mlan0 with this config:
network={ ssid="somessid" mode=2 frequency=2412 key_mgmt=WPA-PSK WPA-PSK-SHA256 proto=RSN group=CCMP pairwise=CCMP psk="12345678" }
When waiting for the AP to be established, interrupting wpa_supplicant with <ctrl-c> and starting it again this happens:
| Unable to handle kernel NULL pointer dereference at virtual address 0000000000000140 | Mem abort info: | ESR = 0x0000000096000004 | EC = 0x25: DABT (current EL), IL = 32 bits | SET = 0, FnV = 0 | EA = 0, S1PTW = 0 | FSC = 0x04: level 0 translation fault | Data abort info: | ISV = 0, ISS = 0x00000004, ISS2 = 0x00000000 | CM = 0, WnR = 0, TnD = 0, TagAccess = 0 | GCS = 0, Overlay = 0, DirtyBit = 0, Xs = 0 | user pgtable: 4k pages, 48-bit VAs, pgdp=0000000046d96000 | [0000000000000140] pgd=0000000000000000, p4d=0000000000000000 | Internal error: Oops: 0000000096000004 [#1] PREEMPT SMP | Modules linked in: caam_jr caamhash_desc spidev caamalg_desc crypto_engine authenc libdes mwifiex_sdio +mwifiex crct10dif_ce cdc_acm onboard_usb_hub fsl_imx8_ddr_perf imx8m_ddrc rtc_ds1307 lm75 rtc_snvs +imx_sdma caam imx8mm_thermal spi_imx error imx_cpufreq_dt fuse ip_tables x_tables ipv6 | CPU: 0 PID: 8 Comm: kworker/0:1 Not tainted 6.9.0-00007-g937242013fce-dirty #18 | Hardware name: somemachine (DT) | Workqueue: events sdio_irq_work | pstate: 00000005 (nzcv daif -PAN -UAO -TCO -DIT -SSBS BTYPE=--) | pc : mwifiex_get_cfp+0xd8/0x15c [mwifiex] | lr : mwifiex_get_cfp+0x34/0x15c [mwifiex] | sp : ffff8000818b3a70 | x29: ffff8000818b3a70 x28: ffff000006bfd8a5 x27: 0000000000000004 | x26: 000000000000002c x25: 0000000000001511 x24: 0000000002e86bc9 | x23: ffff000006bfd996 x22: 0000000000000004 x21: ffff000007bec000 | x20: 000000000000002c x19: 0000000000000000 x18: 0000000000000000 | x17: 000000040044ffff x16: 00500072b5503510 x15: ccc283740681e517 | x14: 0201000101006d15 x13: 0000000002e8ff43 x12: 002c01000000ffb1 | x11: 0100000000000000 x10: 02e8ff43002c0100 x9 : 0000ffb100100157 | x8 : ffff000003d20000 x7 : 00000000000002f1 x6 : 00000000ffffe124 | x5 : 0000000000000001 x4 : 0000000000000003 x3 : 0000000000000000 | x2 : 0000000000000000 x1 : 0001000000011001 x0 : 0000000000000000 | Call trace: | mwifiex_get_cfp+0xd8/0x15c [mwifiex] | mwifiex_parse_single_response_buf+0x1d0/0x504 [mwifiex] | mwifiex_handle_event_ext_scan_report+0x19c/0x2f8 [mwifiex] | mwifiex_process_sta_event+0x298/0xf0c [mwifiex] | mwifiex_process_event+0x110/0x238 [mwifiex] | mwifiex_main_process+0x428/0xa44 [mwifiex] | mwifiex_sdio_interrupt+0x64/0x12c [mwifiex_sdio] | process_sdio_pending_irqs+0x64/0x1b8 | sdio_irq_work+0x4c/0x7c | process_one_work+0x148/0x2a0 | worker_thread+0x2fc/0x40c | kthread+0x110/0x114 | ret_from_fork+0x10/0x20 | Code: a94153f3 a8c37bfd d50323bf d65f03c0 (f940a000) | ---[ end trace 0000000000000000 ]---(CVE-2024-46755)
In the Linux kernel, the following vulnerability has been resolved:
hwmon: (w83627ehf) Fix underflows seen when writing limit attributes
DIV_ROUND_CLOSEST() after kstrtol() results in an underflow if a large negative number such as -9223372036854775808 is provided by the user. Fix it by reordering clamp_val() and DIV_ROUND_CLOSEST() operations.(CVE-2024-46756)
In the Linux kernel, the following vulnerability has been resolved:
hwmon: (lm95234) Fix underflows seen when writing limit attributes
DIV_ROUND_CLOSEST() after kstrtol() results in an underflow if a large negative number such as -9223372036854775808 is provided by the user. Fix it by reordering clamp_val() and DIV_ROUND_CLOSEST() operations.(CVE-2024-46758)
In the Linux kernel, the following vulnerability has been resolved:
hwmon: (adc128d818) Fix underflows seen when writing limit attributes
DIV_ROUND_CLOSEST() after kstrtol() results in an underflow if a large negative number such as -9223372036854775808 is provided by the user. Fix it by reordering clamp_val() and DIV_ROUND_CLOSEST() operations.(CVE-2024-46759)
In the Linux kernel, the following vulnerability has been resolved:
pci/hotplug/pnv_php: Fix hotplug driver crash on Powernv
The hotplug driver for powerpc (pci/hotplug/pnv_php.c) causes a kernel crash when we try to hot-unplug/disable the PCIe switch/bridge from the PHB.
The crash occurs because although the MSI data structure has been released during disable/hot-unplug path and it has been assigned with NULL, still during unregistration the code was again trying to explicitly disable the MSI which causes the NULL pointer dereference and kernel crash.
The patch fixes the check during unregistration path to prevent invoking pci_disable_msi/msix() since its data structure is already freed.(CVE-2024-46761)
In the Linux kernel, the following vulnerability has been resolved:
can: bcm: Remove proc entry when dev is unregistered.
syzkaller reported a warning in bcm_connect() below. [0]
The repro calls connect() to vxcan1, removes vxcan1, and calls connect() with ifindex == 0.
Calling connect() for a BCM socket allocates a proc entry. Then, bcm_sk(sk)->bound is set to 1 to prevent further connect().
However, removing the bound device resets bcm_sk(sk)->bound to 0 in bcm_notify().
The 2nd connect() tries to allocate a proc entry with the same name and sets NULL to bcm_sk(sk)->bcm_proc_read, leaking the original proc entry.
Since the proc entry is available only for connect()ed sockets, let's clean up the entry when the bound netdev is unregistered.
[0]: proc_dir_entry 'can-bcm/2456' already registered WARNING: CPU: 1 PID: 394 at fs/proc/generic.c:376 proc_register+0x645/0x8f0 fs/proc/generic.c:375 Modules linked in: CPU: 1 PID: 394 Comm: syz-executor403 Not tainted 6.10.0-rc7-g852e42cc2dd4 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.16.3-0-ga6ed6b701f0a-prebuilt.qemu.org 04/01/2014 RIP: 0010:proc_register+0x645/0x8f0 fs/proc/generic.c:375 Code: 00 00 00 00 00 48 85 ed 0f 85 97 02 00 00 4d 85 f6 0f 85 9f 02 00 00 48 c7 c7 9b cb cf 87 48 89 de 4c 89 fa e8 1c 6f eb fe 90 <0f> 0b 90 90 48 c7 c7 98 37 99 89 e8 cb 7e 22 05 bb 00 00 00 10 48 RSP: 0018:ffa0000000cd7c30 EFLAGS: 00010246 RAX: 9e129be1950f0200 RBX: ff1100011b51582c RCX: ff1100011857cd80 RDX: 0000000000000000 RSI: 0000000000000000 RDI: 0000000000000002 RBP: 0000000000000000 R08: ffd400000000000f R09: ff1100013e78cac0 R10: ffac800000cd7980 R11: ff1100013e12b1f0 R12: 0000000000000000 R13: 0000000000000000 R14: 0000000000000000 R15: ff1100011a99a2ec FS: 00007fbd7086f740(0000) GS:ff1100013fd00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00000000200071c0 CR3: 0000000118556004 CR4: 0000000000771ef0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe07f0 DR7: 0000000000000400 PKRU: 55555554 Call Trace: <TASK> proc_create_net_single+0x144/0x210 fs/proc/proc_net.c:220 bcm_connect+0x472/0x840 net/can/bcm.c:1673 __sys_connect_file net/socket.c:2049 [inline] __sys_connect+0x5d2/0x690 net/socket.c:2066 __do_sys_connect net/socket.c:2076 [inline] __se_sys_connect net/socket.c:2073 [inline] __x64_sys_connect+0x8f/0x100 net/socket.c:2073 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xd9/0x1c0 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x4b/0x53 RIP: 0033:0x7fbd708b0e5d Code: ff c3 66 2e 0f 1f 84 00 00 00 00 00 90 f3 0f 1e fa 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 8b 0d 73 9f 1b 00 f7 d8 64 89 01 48 RSP: 002b:00007fff8cd33f08 EFLAGS: 00000246 ORIG_RAX: 000000000000002a RAX: ffffffffffffffda RBX: 0000000000000003 RCX: 00007fbd708b0e5d RDX: 0000000000000010 RSI: 0000000020000040 RDI: 0000000000000003 RBP: 0000000000000000 R08: 0000000000000040 R09: 0000000000000040 R10: 0000000000000040 R11: 0000000000000246 R12: 00007fff8cd34098 R13: 0000000000401280 R14: 0000000000406de8 R15: 00007fbd70ab9000 </TASK> remove_proc_entry: removing non-empty directory 'net/can-bcm', leaking at least '2456'(CVE-2024-46771)
In the Linux kernel, the following vulnerability has been resolved:
udf: Avoid excessive partition lengths
Avoid mounting filesystems where the partition would overflow the 32-bits used for block number. Also refuse to mount filesystems where the partition length is so large we cannot safely index bits in a block bitmap.(CVE-2024-46777)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: protect references to superblock parameters exposed in sysfs
The superblock buffers of nilfs2 can not only be overwritten at runtime for modifications/repairs, but they are also regularly swapped, replaced during resizing, and even abandoned when degrading to one side due to backing device issues. So, accessing them requires mutual exclusion using the reader/writer semaphore "nilfs->ns_sem".
Some sysfs attribute show methods read this superblock buffer without the necessary mutual exclusion, which can cause problems with pointer dereferencing and memory access, so fix it.(CVE-2024-46780)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: fix missing cleanup on rollforward recovery error
In an error injection test of a routine for mount-time recovery, KASAN found a use-after-free bug.
It turned out that if data recovery was performed using partial logs created by dsync writes, but an error occurred before starting the log writer to create a recovered checkpoint, the inodes whose data had been recovered were left in the ns_dirty_files list of the nilfs object and were not freed.
Fix this issue by cleaning up inodes that have read the recovery data if the recovery routine fails midway before the log writer starts.(CVE-2024-46781)
In the Linux kernel, the following vulnerability has been resolved:
can: mcp251x: fix deadlock if an interrupt occurs during mcp251x_open
The mcp251x_hw_wake() function is called with the mpc_lock mutex held and disables the interrupt handler so that no interrupts can be processed while waking the device. If an interrupt has already occurred then waiting for the interrupt handler to complete will deadlock because it will be trying to acquire the same mutex.
CPU0 CPU1 ---- ---- mcp251x_open() mutex_lock(&priv->mcp_lock) request_threaded_irq() <interrupt> mcp251x_can_ist() mutex_lock(&priv->mcp_lock) mcp251x_hw_wake() disable_irq() <-- deadlock
Use disable_irq_nosync() instead because the interrupt handler does everything while holding the mutex so it doesn't matter if it's still running.(CVE-2024-46791)
In the Linux kernel, the following vulnerability has been resolved:
ASoC: dapm: Fix UAF for snd_soc_pcm_runtime object
When using kernel with the following extra config,
- CONFIG_KASAN=y
- CONFIG_KASAN_GENERIC=y
- CONFIG_KASAN_INLINE=y
- CONFIG_KASAN_VMALLOC=y
- CONFIG_FRAME_WARN=4096
kernel detects that snd_pcm_suspend_all() access a freed 'snd_soc_pcm_runtime' object when the system is suspended, which leads to a use-after-free bug:
[ 52.047746] BUG: KASAN: use-after-free in snd_pcm_suspend_all+0x1a8/0x270 [ 52.047765] Read of size 1 at addr ffff0000b9434d50 by task systemd-sleep/2330
[ 52.047785] Call trace: [ 52.047787] dump_backtrace+0x0/0x3c0 [ 52.047794] show_stack+0x34/0x50 [ 52.047797] dump_stack_lvl+0x68/0x8c [ 52.047802] print_address_description.constprop.0+0x74/0x2c0 [ 52.047809] kasan_report+0x210/0x230 [ 52.047815] __asan_report_load1_noabort+0x3c/0x50 [ 52.047820] snd_pcm_suspend_all+0x1a8/0x270 [ 52.047824] snd_soc_suspend+0x19c/0x4e0
The snd_pcm_sync_stop() has a NULL check on 'substream->runtime' before making any access. So we need to always set 'substream->runtime' to NULL everytime we kfree() it.(CVE-2024-46798)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Add array index check for hdcp ddc access
[Why] Coverity reports OVERRUN warning. Do not check if array index valid.
[How] Check msg_id valid and valid array index.(CVE-2024-46804)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Check msg_id before processing transcation
[WHY & HOW] HDCP_MESSAGE_ID_INVALID (-1) is not a valid msg_id nor is it a valid array index, and it needs checking before used.
This fixes 4 OVERRUN issues reported by Coverity.(CVE-2024-46814)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Stop amdgpu_dm initialize when link nums greater than max_links
[Why] Coverity report OVERRUN warning. There are only max_links elements within dc->links. link count could up to AMDGPU_DM_MAX_DISPLAY_INDEX 31.
[How] Make sure link count less than max_links.(CVE-2024-46816)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Check gpio_id before used as array index
[WHY & HOW] GPIO_ID_UNKNOWN (-1) is not a valid value for array index and therefore should be checked in advance.
This fixes 5 OVERRUN issues reported by Coverity.(CVE-2024-46818)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/pm: Fix negative array index read
Avoid using the negative values for clk_idex as an index into an array pptable->DpmDescriptor.
V2: fix clk_index return check (Tim Huang)(CVE-2024-46821)
In the Linux kernel, the following vulnerability has been resolved:
rtmutex: Drop rt_mutex::wait_lock before scheduling
rt_mutex_handle_deadlock() is called with rt_mutex::wait_lock held. In the good case it returns with the lock held and in the deadlock case it emits a warning and goes into an endless scheduling loop with the lock held, which triggers the 'scheduling in atomic' warning.
Unlock rt_mutex::wait_lock in the dead lock case before issuing the warning and dropping into the schedule for ever loop.
In the Linux kernel, the following vulnerability has been resolved:
net: hns3: void array out of bound when loop tnl_num
When query reg inf of SSU, it loops tnl_num times. However, tnl_num comes from hardware and the length of array is a fixed value. To void array out of bound, make sure the loop time is not greater than the length of array(CVE-2024-46833)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: don't BUG_ON on ENOMEM from btrfs_lookup_extent_info() in walk_down_proc()
We handle errors here properly, ENOMEM isn't fatal, return the error.(CVE-2024-46841)
In the Linux kernel, the following vulnerability has been resolved:
um: line: always fill *error_out in setup_one_line()
The pointer isn't initialized by callers, but I have encountered cases where it's still printed; initialize it in all possible cases in setup_one_line().(CVE-2024-46844)
In the Linux kernel, the following vulnerability has been resolved:
ASoC: meson: axg-card: fix 'use-after-free'
Buffer 'card->dai_link' is reallocated in 'meson_card_reallocate_links()', so move 'pad' pointer initialization after this function when memory is already reallocated.
Kasan bug report:
================================================================== BUG: KASAN: slab-use-after-free in axg_card_add_link+0x76c/0x9bc Read of size 8 at addr ffff000000e8b260 by task modprobe/356
CPU: 0 PID: 356 Comm: modprobe Tainted: G O 6.9.12-sdkernel #1 Call trace: dump_backtrace+0x94/0xec show_stack+0x18/0x24 dump_stack_lvl+0x78/0x90 print_report+0xfc/0x5c0 kasan_report+0xb8/0xfc __asan_load8+0x9c/0xb8 axg_card_add_link+0x76c/0x9bc [snd_soc_meson_axg_sound_card] meson_card_probe+0x344/0x3b8 [snd_soc_meson_card_utils] platform_probe+0x8c/0xf4 really_probe+0x110/0x39c __driver_probe_device+0xb8/0x18c driver_probe_device+0x108/0x1d8 __driver_attach+0xd0/0x25c bus_for_each_dev+0xe0/0x154 driver_attach+0x34/0x44 bus_add_driver+0x134/0x294 driver_register+0xa8/0x1e8 __platform_driver_register+0x44/0x54 axg_card_pdrv_init+0x20/0x1000 [snd_soc_meson_axg_sound_card] do_one_initcall+0xdc/0x25c do_init_module+0x10c/0x334 load_module+0x24c4/0x26cc init_module_from_file+0xd4/0x128 __arm64_sys_finit_module+0x1f4/0x41c invoke_syscall+0x60/0x188 el0_svc_common.constprop.0+0x78/0x13c do_el0_svc+0x30/0x40 el0_svc+0x38/0x78 el0t_64_sync_handler+0x100/0x12c el0t_64_sync+0x190/0x194(CVE-2024-46849)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5: Fix bridge mode operations when there are no VFs
Currently, trying to set the bridge mode attribute when numvfs=0 leads to a crash:
bridge link set dev eth2 hwmode vepa
[ 168.967392] BUG: kernel NULL pointer dereference, address: 0000000000000030 [...] [ 168.969989] RIP: 0010:mlx5_add_flow_rules+0x1f/0x300 [mlx5_core] [...] [ 168.976037] Call Trace: [ 168.976188] <TASK> [ 168.978620] _mlx5_eswitch_set_vepa_locked+0x113/0x230 [mlx5_core] [ 168.979074] mlx5_eswitch_set_vepa+0x7f/0xa0 [mlx5_core] [ 168.979471] rtnl_bridge_setlink+0xe9/0x1f0 [ 168.979714] rtnetlink_rcv_msg+0x159/0x400 [ 168.980451] netlink_rcv_skb+0x54/0x100 [ 168.980675] netlink_unicast+0x241/0x360 [ 168.980918] netlink_sendmsg+0x1f6/0x430 [ 168.981162] _syssendmsg+0x3bb/0x3f0 [ 168.982155] _sys_sendmsg+0x88/0xd0 [ 168.985036] __sys_sendmsg+0x59/0xa0 [ 168.985477] do_syscall_64+0x79/0x150 [ 168.987273] entry_SYSCALL_64_after_hwframe+0x76/0x7e [ 168.987773] RIP: 0033:0x7f8f7950f917
(esw->fdb_table.legacy.vepa_fdb is null)
The bridge mode is only relevant when there are multiple functions per port. Therefore, prevent setting and getting this setting when there are no VFs.
Note that after this change, there are no settings to change on the PF
interface using bridge link when there are no VFs, so the interface no
longer appears in the bridge link output.(CVE-2024-46857)
| URL | Type | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm",
"kernel-debuginfo-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm",
"kernel-debugsource-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm",
"kernel-devel-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm",
"kernel-headers-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm",
"kernel-source-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm",
"kernel-tools-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm",
"kernel-tools-devel-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm",
"perf-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm",
"perf-debuginfo-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm",
"python3-perf-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-231.0.0.133.oe2203sp3.aarch64.rpm"
],
"src": [
"kernel-5.10.0-231.0.0.133.oe2203sp3.src.rpm"
],
"x86_64": [
"kernel-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm",
"kernel-debuginfo-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm",
"kernel-debugsource-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm",
"kernel-devel-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm",
"kernel-headers-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm",
"kernel-source-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm",
"kernel-tools-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm",
"kernel-tools-devel-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm",
"perf-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm",
"perf-debuginfo-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm",
"python3-perf-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-231.0.0.133.oe2203sp3.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP3",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP3"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-231.0.0.133.oe2203sp3"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nALSA: usb-audio: Stop parsing channels bits when all channels are found.\r\n\r\nIf a usb audio device sets more bits than the amount of channels\nit could write outside of the map array.(CVE-2024-27436)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nusb: gadget: f_fs: Fix race between aio_cancel() and AIO request complete\r\n\r\nFFS based applications can utilize the aio_cancel() callback to dequeue\npending USB requests submitted to the UDC. There is a scenario where the\nFFS application issues an AIO cancel call, while the UDC is handling a\nsoft disconnect. For a DWC3 based implementation, the callstack looks\nlike the following:\r\n\r\n DWC3 Gadget FFS Application\ndwc3_gadget_soft_disconnect() ...\n --\u0026gt; dwc3_stop_active_transfers()\n --\u0026gt; dwc3_gadget_giveback(-ESHUTDOWN)\n --\u0026gt; ffs_epfile_async_io_complete() ffs_aio_cancel()\n --\u0026gt; usb_ep_free_request() --\u0026gt; usb_ep_dequeue()\r\n\r\nThere is currently no locking implemented between the AIO completion\nhandler and AIO cancel, so the issue occurs if the completion routine is\nrunning in parallel to an AIO cancel call coming from the FFS application.\nAs the completion call frees the USB request (io_data-\u0026gt;req) the FFS\napplication is also referencing it for the usb_ep_dequeue() call. This can\nlead to accessing a stale/hanging pointer.\r\n\r\ncommit b566d38857fc (\u0026quot;usb: gadget: f_fs: use io_data-\u0026gt;status consistently\u0026quot;)\nrelocated the usb_ep_free_request() into ffs_epfile_async_io_complete().\nHowever, in order to properly implement locking to mitigate this issue, the\nspinlock can\u0026apos;t be added to ffs_epfile_async_io_complete(), as\nusb_ep_dequeue() (if successfully dequeuing a USB request) will call the\nfunction driver\u0026apos;s completion handler in the same context. Hence, leading\ninto a deadlock.\r\n\r\nFix this issue by moving the usb_ep_free_request() back to\nffs_user_copy_worker(), and ensuring that it explicitly sets io_data-\u0026gt;req\nto NULL after freeing it within the ffs-\u0026gt;eps_lock. This resolves the race\ncondition above, as the ffs_aio_cancel() routine will not continue\nattempting to dequeue a request that has already been freed, or the\nffs_user_copy_work() not freeing the USB request until the AIO cancel is\ndone referencing it.\r\n\r\nThis fix depends on\n commit b566d38857fc (\u0026quot;usb: gadget: f_fs: use io_data-\u0026gt;status\n consistently\u0026quot;)(CVE-2024-36894)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: bfa: Ensure the copied buf is NUL terminated\r\n\r\nCurrently, we allocate a nbytes-sized kernel buffer and copy nbytes from\nuserspace to that buffer. Later, we use sscanf on this buffer but we don\u0026apos;t\nensure that the string is terminated inside the buffer, this can lead to\nOOB read when using sscanf. Fix this issue by using memdup_user_nul instead\nof memdup_user.(CVE-2024-38560)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nenic: Validate length of nl attributes in enic_set_vf_port\r\n\r\nenic_set_vf_port assumes that the nl attribute IFLA_PORT_PROFILE\nis of length PORT_PROFILE_MAX and that the nl attributes\nIFLA_PORT_INSTANCE_UUID, IFLA_PORT_HOST_UUID are of length PORT_UUID_MAX.\nThese attributes are validated (in the function do_setlink in rtnetlink.c)\nusing the nla_policy ifla_port_policy. The policy defines IFLA_PORT_PROFILE\nas NLA_STRING, IFLA_PORT_INSTANCE_UUID as NLA_BINARY and\nIFLA_PORT_HOST_UUID as NLA_STRING. That means that the length validation\nusing the policy is for the max size of the attributes and not on exact\nsize so the length of these attributes might be less than the sizes that\nenic_set_vf_port expects. This might cause an out of bands\nread access in the memcpys of the data of these\nattributes in enic_set_vf_port.(CVE-2024-38659)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbcache: fix variable length array abuse in btree_iter\r\n\r\nbtree_iter is used in two ways: either allocated on the stack with a\nfixed size MAX_BSETS, or from a mempool with a dynamic size based on the\nspecific cache set. Previously, the struct had a fixed-length array of\nsize MAX_BSETS which was indexed out-of-bounds for the dynamically-sized\niterators, which causes UBSAN to complain.\r\n\r\nThis patch uses the same approach as in bcachefs\u0026apos;s sort_iter and splits\nthe iterator into a btree_iter with a flexible array member and a\nbtree_iter_stack which embeds a btree_iter as well as a fixed-length\ndata array.(CVE-2024-39482)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nksmbd: discard write access to the directory open\r\n\r\nmay_open() does not allow a directory to be opened with the write access.\nHowever, some writing flags set by client result in adding write access\non server, making ksmbd incompatible with FUSE file system. Simply, let\u0026apos;s\ndiscard the write access when opening a directory.\r\n\r\nlist_add corruption. next is NULL.\n------------[ cut here ]------------\nkernel BUG at lib/list_debug.c:26!\npc : __list_add_valid+0x88/0xbc\nlr : __list_add_valid+0x88/0xbc\nCall trace:\n__list_add_valid+0x88/0xbc\nfuse_finish_open+0x11c/0x170\nfuse_open_common+0x284/0x5e8\nfuse_dir_open+0x14/0x24\ndo_dentry_open+0x2a4/0x4e0\ndentry_open+0x50/0x80\nsmb2_open+0xbe4/0x15a4\nhandle_ksmbd_work+0x478/0x5ec\nprocess_one_work+0x1b4/0x448\nworker_thread+0x25c/0x430\nkthread+0x104/0x1d4\nret_from_fork+0x10/0x20(CVE-2024-41030)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/nouveau/dispnv04: fix null pointer dereference in nv17_tv_get_ld_modes\r\n\r\nIn nv17_tv_get_ld_modes(), the return value of drm_mode_duplicate() is\nassigned to mode, which will lead to a possible NULL pointer dereference\non failure of drm_mode_duplicate(). Add a check to avoid npd.(CVE-2024-41095)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: xc2028: avoid use-after-free in load_firmware_cb()\r\n\r\nsyzkaller reported use-after-free in load_firmware_cb() [1].\nThe reason is because the module allocated a struct tuner in tuner_probe(),\nand then the module initialization failed, the struct tuner was released.\nA worker which created during module initialization accesses this struct\ntuner later, it caused use-after-free.\r\n\r\nThe process is as follows:\r\n\r\ntask-6504 worker_thread\ntuner_probe \u0026lt;= alloc dvb_frontend [2]\n...\nrequest_firmware_nowait \u0026lt;= create a worker\n...\ntuner_remove \u0026lt;= free dvb_frontend\n...\n request_firmware_work_func \u0026lt;= the firmware is ready\n load_firmware_cb \u0026lt;= but now the dvb_frontend has been freed\r\n\r\nTo fix the issue, check the dvd_frontend in load_firmware_cb(), if it is\nnull, report a warning and just return.\r\n\r\n[1]:\n ==================================================================\n BUG: KASAN: use-after-free in load_firmware_cb+0x1310/0x17a0\n Read of size 8 at addr ffff8000d7ca2308 by task kworker/2:3/6504\r\n\r\n Call trace:\n load_firmware_cb+0x1310/0x17a0\n request_firmware_work_func+0x128/0x220\n process_one_work+0x770/0x1824\n worker_thread+0x488/0xea0\n kthread+0x300/0x430\n ret_from_fork+0x10/0x20\r\n\r\n Allocated by task 6504:\n kzalloc\n tuner_probe+0xb0/0x1430\n i2c_device_probe+0x92c/0xaf0\n really_probe+0x678/0xcd0\n driver_probe_device+0x280/0x370\n __device_attach_driver+0x220/0x330\n bus_for_each_drv+0x134/0x1c0\n __device_attach+0x1f4/0x410\n device_initial_probe+0x20/0x30\n bus_probe_device+0x184/0x200\n device_add+0x924/0x12c0\n device_register+0x24/0x30\n i2c_new_device+0x4e0/0xc44\n v4l2_i2c_new_subdev_board+0xbc/0x290\n v4l2_i2c_new_subdev+0xc8/0x104\n em28xx_v4l2_init+0x1dd0/0x3770\r\n\r\n Freed by task 6504:\n kfree+0x238/0x4e4\n tuner_remove+0x144/0x1c0\n i2c_device_remove+0xc8/0x290\n __device_release_driver+0x314/0x5fc\n device_release_driver+0x30/0x44\n bus_remove_device+0x244/0x490\n device_del+0x350/0x900\n device_unregister+0x28/0xd0\n i2c_unregister_device+0x174/0x1d0\n v4l2_device_unregister+0x224/0x380\n em28xx_v4l2_init+0x1d90/0x3770\r\n\r\n The buggy address belongs to the object at ffff8000d7ca2000\n which belongs to the cache kmalloc-2k of size 2048\n The buggy address is located 776 bytes inside of\n 2048-byte region [ffff8000d7ca2000, ffff8000d7ca2800)\n The buggy address belongs to the page:\n page:ffff7fe00035f280 count:1 mapcount:0 mapping:ffff8000c001f000 index:0x0\n flags: 0x7ff800000000100(slab)\n raw: 07ff800000000100 ffff7fe00049d880 0000000300000003 ffff8000c001f000\n raw: 0000000000000000 0000000080100010 00000001ffffffff 0000000000000000\n page dumped because: kasan: bad access detected\r\n\r\n Memory state around the buggy address:\n ffff8000d7ca2200: fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb\n ffff8000d7ca2280: fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb\n \u0026gt;ffff8000d7ca2300: fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb\n ^\n ffff8000d7ca2380: fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb\n ffff8000d7ca2400: fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb fb\n ==================================================================\r\n\r\n[2]\n Actually, it is allocated for struct tuner, and dvb_frontend is inside.(CVE-2024-43900)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nsched/smt: Fix unbalance sched_smt_present dec/inc\r\n\r\nI got the following warn report while doing stress test:\r\n\r\njump label: negative count!\nWARNING: CPU: 3 PID: 38 at kernel/jump_label.c:263 static_key_slow_try_dec+0x9d/0xb0\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __static_key_slow_dec_cpuslocked+0x16/0x70\n sched_cpu_deactivate+0x26e/0x2a0\n cpuhp_invoke_callback+0x3ad/0x10d0\n cpuhp_thread_fun+0x3f5/0x680\n smpboot_thread_fn+0x56d/0x8d0\n kthread+0x309/0x400\n ret_from_fork+0x41/0x70\n ret_from_fork_asm+0x1b/0x30\n \u0026lt;/TASK\u0026gt;\r\n\r\nBecause when cpuset_cpu_inactive() fails in sched_cpu_deactivate(),\nthe cpu offline failed, but sched_smt_present is decremented before\ncalling sched_cpu_deactivate(), it leads to unbalanced dec/inc, so\nfix it by incrementing sched_smt_present in the error path.(CVE-2024-44958)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/msm/dpu: cleanup FB if dpu_format_populate_layout fails\r\n\r\nIf the dpu_format_populate_layout() fails, then FB is prepared, but not\ncleaned up. This ends up leaking the pin_count on the GEM object and\ncauses a splat during DRM file closure:\r\n\r\nmsm_obj-\u0026gt;pin_count\nWARNING: CPU: 2 PID: 569 at drivers/gpu/drm/msm/msm_gem.c:121 update_lru_locked+0xc4/0xcc\n[...]\nCall trace:\n update_lru_locked+0xc4/0xcc\n put_pages+0xac/0x100\n msm_gem_free_object+0x138/0x180\n drm_gem_object_free+0x1c/0x30\n drm_gem_object_handle_put_unlocked+0x108/0x10c\n drm_gem_object_release_handle+0x58/0x70\n idr_for_each+0x68/0xec\n drm_gem_release+0x28/0x40\n drm_file_free+0x174/0x234\n drm_release+0xb0/0x160\n __fput+0xc0/0x2c8\n __fput_sync+0x50/0x5c\n __arm64_sys_close+0x38/0x7c\n invoke_syscall+0x48/0x118\n el0_svc_common.constprop.0+0x40/0xe0\n do_el0_svc+0x1c/0x28\n el0_svc+0x4c/0x120\n el0t_64_sync_handler+0x100/0x12c\n el0t_64_sync+0x190/0x194\nirq event stamp: 129818\nhardirqs last enabled at (129817): [\u0026lt;ffffa5f6d953fcc0\u0026gt;] console_unlock+0x118/0x124\nhardirqs last disabled at (129818): [\u0026lt;ffffa5f6da7dcf04\u0026gt;] el1_dbg+0x24/0x8c\nsoftirqs last enabled at (129808): [\u0026lt;ffffa5f6d94afc18\u0026gt;] handle_softirqs+0x4c8/0x4e8\nsoftirqs last disabled at (129785): [\u0026lt;ffffa5f6d94105e4\u0026gt;] __do_softirq+0x14/0x20\r\n\r\nPatchwork: https://patchwork.freedesktop.org/patch/600714/(CVE-2024-44982)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nInput: MT - limit max slots\r\n\r\nsyzbot is reporting too large allocation at input_mt_init_slots(), for\nnum_slots is supplied from userspace using ioctl(UI_DEV_CREATE).\r\n\r\nSince nobody knows possible max slots, this patch chose 1024.(CVE-2024-45008)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetem: fix return value if duplicate enqueue fails\r\n\r\nThere is a bug in netem_enqueue() introduced by\ncommit 5845f706388a (\u0026quot;net: netem: fix skb length BUG_ON in __skb_to_sgvec\u0026quot;)\nthat can lead to a use-after-free.\r\n\r\nThis commit made netem_enqueue() always return NET_XMIT_SUCCESS\nwhen a packet is duplicated, which can cause the parent qdisc\u0026apos;s q.qlen\nto be mistakenly incremented. When this happens qlen_notify() may be\nskipped on the parent during destruction, leaving a dangling pointer\nfor some classful qdiscs like DRR.\r\n\r\nThere are two ways for the bug happen:\r\n\r\n- If the duplicated packet is dropped by rootq-\u0026gt;enqueue() and then\n the original packet is also dropped.\n- If rootq-\u0026gt;enqueue() sends the duplicated packet to a different qdisc\n and the original packet is dropped.\r\n\r\nIn both cases NET_XMIT_SUCCESS is returned even though no packets\nare enqueued at the netem qdisc.\r\n\r\nThe fix is to defer the enqueue of the duplicate packet until after\nthe original packet has been guaranteed to return NET_XMIT_SUCCESS.(CVE-2024-45016)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: aacraid: Fix double-free on probe failure\r\n\r\naac_probe_one() calls hardware-specific init functions through the\naac_driver_ident::init pointer, all of which eventually call down to\naac_init_adapter().\r\n\r\nIf aac_init_adapter() fails after allocating memory for aac_dev::queues,\nit frees the memory but does not clear that member.\r\n\r\nAfter the hardware-specific init function returns an error,\naac_probe_one() goes down an error path that frees the memory pointed to\nby aac_dev::queues, resulting.in a double-free.(CVE-2024-46673)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nusb: dwc3: st: fix probed platform device ref count on probe error path\r\n\r\nThe probe function never performs any paltform device allocation, thus\nerror path \u0026quot;undo_platform_dev_alloc\u0026quot; is entirely bogus. It drops the\nreference count from the platform device being probed. If error path is\ntriggered, this will lead to unbalanced device reference counts and\npremature release of device resources, thus possible use-after-free when\nreleasing remaining devm-managed resources.(CVE-2024-46674)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nethtool: check device is present when getting link settings\r\n\r\nA sysfs reader can race with a device reset or removal, attempting to\nread device state when the device is not actually present. eg:\r\n\r\n [exception RIP: qed_get_current_link+17]\n #8 [ffffb9e4f2907c48] qede_get_link_ksettings at ffffffffc07a994a [qede]\n #9 [ffffb9e4f2907cd8] __rh_call_get_link_ksettings at ffffffff992b01a3\n #10 [ffffb9e4f2907d38] __ethtool_get_link_ksettings at ffffffff992b04e4\n #11 [ffffb9e4f2907d90] duplex_show at ffffffff99260300\n #12 [ffffb9e4f2907e38] dev_attr_show at ffffffff9905a01c\n #13 [ffffb9e4f2907e50] sysfs_kf_seq_show at ffffffff98e0145b\n #14 [ffffb9e4f2907e68] seq_read at ffffffff98d902e3\n #15 [ffffb9e4f2907ec8] vfs_read at ffffffff98d657d1\n #16 [ffffb9e4f2907f00] ksys_read at ffffffff98d65c3f\n #17 [ffffb9e4f2907f38] do_syscall_64 at ffffffff98a052fb\r\n\r\n crash\u0026gt; struct net_device.state ffff9a9d21336000\n state = 5,\r\n\r\nstate 5 is __LINK_STATE_START (0b1) and __LINK_STATE_NOCARRIER (0b100).\nThe device is not present, note lack of __LINK_STATE_PRESENT (0b10).\r\n\r\nThis is the same sort of panic as observed in commit 4224cfd7fb65\n(\u0026quot;net-sysfs: add check for netdevice being present to speed_show\u0026quot;).\r\n\r\nThere are many other callers of __ethtool_get_link_ksettings() which\ndon\u0026apos;t have a device presence check.\r\n\r\nMove this check into ethtool to protect all callers.(CVE-2024-46679)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npktgen: use cpus_read_lock() in pg_net_init()\r\n\r\nI have seen the WARN_ON(smp_processor_id() != cpu) firing\nin pktgen_thread_worker() during tests.\r\n\r\nWe must use cpus_read_lock()/cpus_read_unlock()\naround the for_each_online_cpu(cpu) loop.\r\n\r\nWhile we are at it use WARN_ON_ONCE() to avoid a possible syslog flood.(CVE-2024-46681)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nselinux,smack: don\u0026apos;t bypass permissions check in inode_setsecctx hook\r\n\r\nMarek Gresko reports that the root user on an NFS client is able to\nchange the security labels on files on an NFS filesystem that is\nexported with root squashing enabled.\r\n\r\nThe end of the kerneldoc comment for __vfs_setxattr_noperm() states:\r\n\r\n * This function requires the caller to lock the inode\u0026apos;s i_mutex before it\n * is executed. It also assumes that the caller will make the appropriate\n * permission checks.\r\n\r\nnfsd_setattr() does do permissions checking via fh_verify() and\nnfsd_permission(), but those don\u0026apos;t do all the same permissions checks\nthat are done by security_inode_setxattr() and its related LSM hooks do.\r\n\r\nSince nfsd_setattr() is the only consumer of security_inode_setsecctx(),\nsimplest solution appears to be to replace the call to\n__vfs_setxattr_noperm() with a call to __vfs_setxattr_locked(). This\nfixes the above issue and has the added benefit of causing nfsd to\nrecall conflicting delegations on a file when a client tries to change\nits security label.(CVE-2024-46695)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nKVM: arm64: Make ICC_*SGI*_EL1 undef in the absence of a vGICv3\r\n\r\nOn a system with a GICv3, if a guest hasn\u0026apos;t been configured with\nGICv3 and that the host is not capable of GICv2 emulation,\na write to any of the ICC_*SGI*_EL1 registers is trapped to EL2.\r\n\r\nWe therefore try to emulate the SGI access, only to hit a NULL\npointer as no private interrupt is allocated (no GIC, remember?).\r\n\r\nThe obvious fix is to give the guest what it deserves, in the\nshape of a UNDEF exception.(CVE-2024-46707)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\napparmor: fix possible NULL pointer dereference\r\n\r\nprofile-\u0026gt;parent-\u0026gt;dents[AAFS_PROF_DIR] could be NULL only if its parent is made\nfrom __create_missing_ancestors(..) and \u0026apos;ent-\u0026gt;old\u0026apos; is NULL in\naa_replace_profiles(..).\nIn that case, it must return an error code and the code, -ENOENT represents\nits state that the path of its parent is not existed yet.\r\n\r\nBUG: kernel NULL pointer dereference, address: 0000000000000030\nPGD 0 P4D 0\nPREEMPT SMP PTI\nCPU: 4 PID: 3362 Comm: apparmor_parser Not tainted 6.8.0-24-generic #24\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.15.0-1 04/01/2014\nRIP: 0010:aafs_create.constprop.0+0x7f/0x130\nCode: 4c 63 e0 48 83 c4 18 4c 89 e0 5b 41 5c 41 5d 41 5e 41 5f 5d 31 d2 31 c9 31 f6 31 ff 45 31 c0 45 31 c9 45 31 d2 c3 cc cc cc cc \u0026lt;4d\u0026gt; 8b 55 30 4d 8d ba a0 00 00 00 4c 89 55 c0 4c 89 ff e8 7a 6a ae\nRSP: 0018:ffffc9000b2c7c98 EFLAGS: 00010246\nRAX: 0000000000000000 RBX: 00000000000041ed RCX: 0000000000000000\nRDX: 0000000000000000 RSI: 0000000000000000 RDI: 0000000000000000\nRBP: ffffc9000b2c7cd8 R08: 0000000000000000 R09: 0000000000000000\nR10: 0000000000000000 R11: 0000000000000000 R12: ffffffff82baac10\nR13: 0000000000000000 R14: 0000000000000000 R15: 0000000000000000\nFS: 00007be9f22cf740(0000) GS:ffff88817bc00000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000000000000030 CR3: 0000000134b08000 CR4: 00000000000006f0\nCall Trace:\n \u0026lt;TASK\u0026gt;\n ? show_regs+0x6d/0x80\n ? __die+0x24/0x80\n ? page_fault_oops+0x99/0x1b0\n ? kernelmode_fixup_or_oops+0xb2/0x140\n ? __bad_area_nosemaphore+0x1a5/0x2c0\n ? find_vma+0x34/0x60\n ? bad_area_nosemaphore+0x16/0x30\n ? do_user_addr_fault+0x2a2/0x6b0\n ? exc_page_fault+0x83/0x1b0\n ? asm_exc_page_fault+0x27/0x30\n ? aafs_create.constprop.0+0x7f/0x130\n ? aafs_create.constprop.0+0x51/0x130\n __aafs_profile_mkdir+0x3d6/0x480\n aa_replace_profiles+0x83f/0x1270\n policy_update+0xe3/0x180\n profile_load+0xbc/0x150\n ? rw_verify_area+0x47/0x140\n vfs_write+0x100/0x480\n ? __x64_sys_openat+0x55/0xa0\n ? syscall_exit_to_user_mode+0x86/0x260\n ksys_write+0x73/0x100\n __x64_sys_write+0x19/0x30\n x64_sys_call+0x7e/0x25c0\n do_syscall_64+0x7f/0x180\n entry_SYSCALL_64_after_hwframe+0x78/0x80\nRIP: 0033:0x7be9f211c574\nCode: c7 00 16 00 00 00 b8 ff ff ff ff c3 66 2e 0f 1f 84 00 00 00 00 00 f3 0f 1e fa 80 3d d5 ea 0e 00 00 74 13 b8 01 00 00 00 0f 05 \u0026lt;48\u0026gt; 3d 00 f0 ff ff 77 54 c3 0f 1f 00 55 48 89 e5 48 83 ec 20 48 89\nRSP: 002b:00007ffd26f2b8c8 EFLAGS: 00000202 ORIG_RAX: 0000000000000001\nRAX: ffffffffffffffda RBX: 00005d504415e200 RCX: 00007be9f211c574\nRDX: 0000000000001fc1 RSI: 00005d504418bc80 RDI: 0000000000000004\nRBP: 0000000000001fc1 R08: 0000000000001fc1 R09: 0000000080000000\nR10: 0000000000000000 R11: 0000000000000202 R12: 00005d504418bc80\nR13: 0000000000000004 R14: 00007ffd26f2b9b0 R15: 00007ffd26f2ba30\n \u0026lt;/TASK\u0026gt;\nModules linked in: snd_seq_dummy snd_hrtimer qrtr snd_hda_codec_generic snd_hda_intel snd_intel_dspcfg snd_intel_sdw_acpi snd_hda_codec snd_hda_core snd_hwdep snd_pcm snd_seq_midi snd_seq_midi_event snd_rawmidi snd_seq snd_seq_device i2c_i801 snd_timer i2c_smbus qxl snd soundcore drm_ttm_helper lpc_ich ttm joydev input_leds serio_raw mac_hid binfmt_misc msr parport_pc ppdev lp parport efi_pstore nfnetlink dmi_sysfs qemu_fw_cfg ip_tables x_tables autofs4 hid_generic usbhid hid ahci libahci psmouse virtio_rng xhci_pci xhci_pci_renesas\nCR2: 0000000000000030\n---[ end trace 0000000000000000 ]---\nRIP: 0010:aafs_create.constprop.0+0x7f/0x130\nCode: 4c 63 e0 48 83 c4 18 4c 89 e0 5b 41 5c 41 5d 41 5e 41 5f 5d 31 d2 31 c9 31 f6 31 ff 45 31 c0 45 31 c9 45 31 d2 c3 cc cc cc cc \u0026lt;4d\u0026gt; 8b 55 30 4d 8d ba a0 00 00 00 4c 89 55 c0 4c 89 ff e8 7a 6a ae\nRSP: 0018:ffffc9000b2c7c98 EFLAGS: 00010246\nRAX: 0000000000000000 RBX: 00000000000041ed RCX: 0000000000000000\nRDX: 0000000000000000 RSI: 0000000000000000 RDI: 0000000000000000\nRBP: ffffc9000b2c7cd8 R08: 0000000000000000 R09: 0000000000000000\nR10: 0000\n---truncated---(CVE-2024-46721)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu: Fix out-of-bounds write warning\r\n\r\nCheck the ring type value to fix the out-of-bounds\nwrite warning(CVE-2024-46725)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Ensure index calculation will not overflow\r\n\r\n[WHY \u0026amp; HOW]\nMake sure vmid0p72_idx, vnom0p8_idx and vmax0p9_idx calculation will\nnever overflow and exceess array size.\r\n\r\nThis fixes 3 OVERRUN and 1 INTEGER_OVERFLOW issues reported by Coverity.(CVE-2024-46726)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Assign linear_pitch_alignment even for VM\r\n\r\n[Description]\nAssign linear_pitch_alignment so we don\u0026apos;t cause a divide by 0\nerror in VM environments(CVE-2024-46732)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnvmet-tcp: fix kernel crash if commands allocation fails\r\n\r\nIf the commands allocation fails in nvmet_tcp_alloc_cmds()\nthe kernel crashes in nvmet_tcp_release_queue_work() because of\na NULL pointer dereference.\r\n\r\n nvmet: failed to install queue 0 cntlid 1 ret 6\n Unable to handle kernel NULL pointer dereference at\n virtual address 0000000000000008\r\n\r\nFix the bug by setting queue-\u0026gt;nr_cmds to zero in case\nnvmet_tcp_alloc_cmd() fails.(CVE-2024-46737)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nVMCI: Fix use-after-free when removing resource in vmci_resource_remove()\r\n\r\nWhen removing a resource from vmci_resource_table in\nvmci_resource_remove(), the search is performed using the resource\nhandle by comparing context and resource fields.\r\n\r\nIt is possible though to create two resources with different types\nbut same handle (same context and resource fields).\r\n\r\nWhen trying to remove one of the resources, vmci_resource_remove()\nmay not remove the intended one, but the object will still be freed\nas in the case of the datagram type in vmci_datagram_destroy_handle().\nvmci_resource_table will still hold a pointer to this freed resource\nleading to a use-after-free vulnerability.\r\n\r\nBUG: KASAN: use-after-free in vmci_handle_is_equal include/linux/vmw_vmci_defs.h:142 [inline]\nBUG: KASAN: use-after-free in vmci_resource_remove+0x3a1/0x410 drivers/misc/vmw_vmci/vmci_resource.c:147\nRead of size 4 at addr ffff88801c16d800 by task syz-executor197/1592\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0x82/0xa9 lib/dump_stack.c:106\n print_address_description.constprop.0+0x21/0x366 mm/kasan/report.c:239\n __kasan_report.cold+0x7f/0x132 mm/kasan/report.c:425\n kasan_report+0x38/0x51 mm/kasan/report.c:442\n vmci_handle_is_equal include/linux/vmw_vmci_defs.h:142 [inline]\n vmci_resource_remove+0x3a1/0x410 drivers/misc/vmw_vmci/vmci_resource.c:147\n vmci_qp_broker_detach+0x89a/0x11b9 drivers/misc/vmw_vmci/vmci_queue_pair.c:2182\n ctx_free_ctx+0x473/0xbe1 drivers/misc/vmw_vmci/vmci_context.c:444\n kref_put include/linux/kref.h:65 [inline]\n vmci_ctx_put drivers/misc/vmw_vmci/vmci_context.c:497 [inline]\n vmci_ctx_destroy+0x170/0x1d6 drivers/misc/vmw_vmci/vmci_context.c:195\n vmci_host_close+0x125/0x1ac drivers/misc/vmw_vmci/vmci_host.c:143\n __fput+0x261/0xa34 fs/file_table.c:282\n task_work_run+0xf0/0x194 kernel/task_work.c:164\n tracehook_notify_resume include/linux/tracehook.h:189 [inline]\n exit_to_user_mode_loop+0x184/0x189 kernel/entry/common.c:187\n exit_to_user_mode_prepare+0x11b/0x123 kernel/entry/common.c:220\n __syscall_exit_to_user_mode_work kernel/entry/common.c:302 [inline]\n syscall_exit_to_user_mode+0x18/0x42 kernel/entry/common.c:313\n do_syscall_64+0x41/0x85 arch/x86/entry/common.c:86\n entry_SYSCALL_64_after_hwframe+0x6e/0x0\r\n\r\nThis change ensures the type is also checked when removing\nthe resource from vmci_resource_table in vmci_resource_remove().(CVE-2024-46738)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nuio_hv_generic: Fix kernel NULL pointer dereference in hv_uio_rescind\r\n\r\nFor primary VM Bus channels, primary_channel pointer is always NULL. This\npointer is valid only for the secondary channels. Also, rescind callback\nis meant for primary channels only.\r\n\r\nFix NULL pointer dereference by retrieving the device_obj from the parent\nfor the primary channel.(CVE-2024-46739)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbinder: fix UAF caused by offsets overwrite\r\n\r\nBinder objects are processed and copied individually into the target\nbuffer during transactions. Any raw data in-between these objects is\ncopied as well. However, this raw data copy lacks an out-of-bounds\ncheck. If the raw data exceeds the data section size then the copy\noverwrites the offsets section. This eventually triggers an error that\nattempts to unwind the processed objects. However, at this point the\noffsets used to index these objects are now corrupted.\r\n\r\nUnwinding with corrupted offsets can result in decrements of arbitrary\nnodes and lead to their premature release. Other users of such nodes are\nleft with a dangling pointer triggering a use-after-free. This issue is\nmade evident by the following KASAN report (trimmed):\r\n\r\n ==================================================================\n BUG: KASAN: slab-use-after-free in _raw_spin_lock+0xe4/0x19c\n Write of size 4 at addr ffff47fc91598f04 by task binder-util/743\r\n\r\n CPU: 9 UID: 0 PID: 743 Comm: binder-util Not tainted 6.11.0-rc4 #1\n Hardware name: linux,dummy-virt (DT)\n Call trace:\n _raw_spin_lock+0xe4/0x19c\n binder_free_buf+0x128/0x434\n binder_thread_write+0x8a4/0x3260\n binder_ioctl+0x18f0/0x258c\n [...]\r\n\r\n Allocated by task 743:\n __kmalloc_cache_noprof+0x110/0x270\n binder_new_node+0x50/0x700\n binder_transaction+0x413c/0x6da8\n binder_thread_write+0x978/0x3260\n binder_ioctl+0x18f0/0x258c\n [...]\r\n\r\n Freed by task 745:\n kfree+0xbc/0x208\n binder_thread_read+0x1c5c/0x37d4\n binder_ioctl+0x16d8/0x258c\n [...]\n ==================================================================\r\n\r\nTo avoid this issue, let\u0026apos;s check that the raw data copy is within the\nboundaries of the data section.(CVE-2024-46740)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nof/irq: Prevent device address out-of-bounds read in interrupt map walk\r\n\r\nWhen of_irq_parse_raw() is invoked with a device address smaller than\nthe interrupt parent node (from #address-cells property), KASAN detects\nthe following out-of-bounds read when populating the initial match table\n(dyndbg=\u0026quot;func of_irq_parse_* +p\u0026quot;):\r\n\r\n OF: of_irq_parse_one: dev=/soc@0/picasso/watchdog, index=0\n OF: parent=/soc@0/pci@878000000000/gpio0@17,0, intsize=2\n OF: intspec=4\n OF: of_irq_parse_raw: ipar=/soc@0/pci@878000000000/gpio0@17,0, size=2\n OF: -\u0026gt; addrsize=3\n ==================================================================\n BUG: KASAN: slab-out-of-bounds in of_irq_parse_raw+0x2b8/0x8d0\n Read of size 4 at addr ffffff81beca5608 by task bash/764\r\n\r\n CPU: 1 PID: 764 Comm: bash Tainted: G O 6.1.67-484c613561-nokia_sm_arm64 #1\n Hardware name: Unknown Unknown Product/Unknown Product, BIOS 2023.01-12.24.03-dirty 01/01/2023\n Call trace:\n dump_backtrace+0xdc/0x130\n show_stack+0x1c/0x30\n dump_stack_lvl+0x6c/0x84\n print_report+0x150/0x448\n kasan_report+0x98/0x140\n __asan_load4+0x78/0xa0\n of_irq_parse_raw+0x2b8/0x8d0\n of_irq_parse_one+0x24c/0x270\n parse_interrupts+0xc0/0x120\n of_fwnode_add_links+0x100/0x2d0\n fw_devlink_parse_fwtree+0x64/0xc0\n device_add+0xb38/0xc30\n of_device_add+0x64/0x90\n of_platform_device_create_pdata+0xd0/0x170\n of_platform_bus_create+0x244/0x600\n of_platform_notify+0x1b0/0x254\n blocking_notifier_call_chain+0x9c/0xd0\n __of_changeset_entry_notify+0x1b8/0x230\n __of_changeset_apply_notify+0x54/0xe4\n of_overlay_fdt_apply+0xc04/0xd94\n ...\r\n\r\n The buggy address belongs to the object at ffffff81beca5600\n which belongs to the cache kmalloc-128 of size 128\n The buggy address is located 8 bytes inside of\n 128-byte region [ffffff81beca5600, ffffff81beca5680)\r\n\r\n The buggy address belongs to the physical page:\n page:00000000230d3d03 refcount:1 mapcount:0 mapping:0000000000000000 index:0x0 pfn:0x1beca4\n head:00000000230d3d03 order:1 compound_mapcount:0 compound_pincount:0\n flags: 0x8000000000010200(slab|head|zone=2)\n raw: 8000000000010200 0000000000000000 dead000000000122 ffffff810000c300\n raw: 0000000000000000 0000000000200020 00000001ffffffff 0000000000000000\n page dumped because: kasan: bad access detected\r\n\r\n Memory state around the buggy address:\n ffffff81beca5500: 04 fc fc fc fc fc fc fc fc fc fc fc fc fc fc fc\n ffffff81beca5580: fc fc fc fc fc fc fc fc fc fc fc fc fc fc fc fc\n \u0026gt;ffffff81beca5600: 00 fc fc fc fc fc fc fc fc fc fc fc fc fc fc fc\n ^\n ffffff81beca5680: fc fc fc fc fc fc fc fc fc fc fc fc fc fc fc fc\n ffffff81beca5700: 00 00 00 00 00 00 fc fc fc fc fc fc fc fc fc fc\n ==================================================================\n OF: -\u0026gt; got it !\r\n\r\nPrevent the out-of-bounds read by copying the device address into a\nbuffer of sufficient size.(CVE-2024-46743)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nPCI: Add missing bridge lock to pci_bus_lock()\r\n\r\nOne of the true positives that the cfg_access_lock lockdep effort\nidentified is this sequence:\r\n\r\n WARNING: CPU: 14 PID: 1 at drivers/pci/pci.c:4886 pci_bridge_secondary_bus_reset+0x5d/0x70\n RIP: 0010:pci_bridge_secondary_bus_reset+0x5d/0x70\n Call Trace:\n \u0026lt;TASK\u0026gt;\n ? __warn+0x8c/0x190\n ? pci_bridge_secondary_bus_reset+0x5d/0x70\n ? report_bug+0x1f8/0x200\n ? handle_bug+0x3c/0x70\n ? exc_invalid_op+0x18/0x70\n ? asm_exc_invalid_op+0x1a/0x20\n ? pci_bridge_secondary_bus_reset+0x5d/0x70\n pci_reset_bus+0x1d8/0x270\n vmd_probe+0x778/0xa10\n pci_device_probe+0x95/0x120\r\n\r\nWhere pci_reset_bus() users are triggering unlocked secondary bus resets.\nIronically pci_bus_reset(), several calls down from pci_reset_bus(), uses\npci_bus_lock() before issuing the reset which locks everything *but* the\nbridge itself.\r\n\r\nFor the same motivation as adding:\r\n\r\n bridge = pci_upstream_bridge(dev);\n if (bridge)\n pci_dev_lock(bridge);\r\n\r\nto pci_reset_function() for the \u0026quot;bus\u0026quot; and \u0026quot;cxl_bus\u0026quot; reset cases, add\npci_dev_lock() for @bus-\u0026gt;self to pci_bus_lock().\r\n\r\n[bhelgaas: squash in recursive locking deadlock fix from Keith Busch:\nhttps://lore.kernel.org/r/20240711193650.701834-1-kbusch@meta.com](CVE-2024-46750)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: handle errors from btrfs_dec_ref() properly\r\n\r\nIn walk_up_proc() we BUG_ON(ret) from btrfs_dec_ref(). This is\nincorrect, we have proper error handling here, return the error.(CVE-2024-46753)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: mwifiex: Do not return unused priv in mwifiex_get_priv_by_id()\r\n\r\nmwifiex_get_priv_by_id() returns the priv pointer corresponding to\nthe bss_num and bss_type, but without checking if the priv is actually\ncurrently in use.\nUnused priv pointers do not have a wiphy attached to them which can\nlead to NULL pointer dereferences further down the callstack. Fix\nthis by returning only used priv pointers which have priv-\u0026gt;bss_mode\nset to something else than NL80211_IFTYPE_UNSPECIFIED.\r\n\r\nSaid NULL pointer dereference happened when an Accesspoint was started\nwith wpa_supplicant -i mlan0 with this config:\r\n\r\nnetwork={\n ssid=\u0026quot;somessid\u0026quot;\n mode=2\n frequency=2412\n key_mgmt=WPA-PSK WPA-PSK-SHA256\n proto=RSN\n group=CCMP\n pairwise=CCMP\n psk=\u0026quot;12345678\u0026quot;\n}\r\n\r\nWhen waiting for the AP to be established, interrupting wpa_supplicant\nwith \u0026lt;ctrl-c\u0026gt; and starting it again this happens:\r\n\r\n| Unable to handle kernel NULL pointer dereference at virtual address 0000000000000140\n| Mem abort info:\n| ESR = 0x0000000096000004\n| EC = 0x25: DABT (current EL), IL = 32 bits\n| SET = 0, FnV = 0\n| EA = 0, S1PTW = 0\n| FSC = 0x04: level 0 translation fault\n| Data abort info:\n| ISV = 0, ISS = 0x00000004, ISS2 = 0x00000000\n| CM = 0, WnR = 0, TnD = 0, TagAccess = 0\n| GCS = 0, Overlay = 0, DirtyBit = 0, Xs = 0\n| user pgtable: 4k pages, 48-bit VAs, pgdp=0000000046d96000\n| [0000000000000140] pgd=0000000000000000, p4d=0000000000000000\n| Internal error: Oops: 0000000096000004 [#1] PREEMPT SMP\n| Modules linked in: caam_jr caamhash_desc spidev caamalg_desc crypto_engine authenc libdes mwifiex_sdio\n+mwifiex crct10dif_ce cdc_acm onboard_usb_hub fsl_imx8_ddr_perf imx8m_ddrc rtc_ds1307 lm75 rtc_snvs\n+imx_sdma caam imx8mm_thermal spi_imx error imx_cpufreq_dt fuse ip_tables x_tables ipv6\n| CPU: 0 PID: 8 Comm: kworker/0:1 Not tainted 6.9.0-00007-g937242013fce-dirty #18\n| Hardware name: somemachine (DT)\n| Workqueue: events sdio_irq_work\n| pstate: 00000005 (nzcv daif -PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n| pc : mwifiex_get_cfp+0xd8/0x15c [mwifiex]\n| lr : mwifiex_get_cfp+0x34/0x15c [mwifiex]\n| sp : ffff8000818b3a70\n| x29: ffff8000818b3a70 x28: ffff000006bfd8a5 x27: 0000000000000004\n| x26: 000000000000002c x25: 0000000000001511 x24: 0000000002e86bc9\n| x23: ffff000006bfd996 x22: 0000000000000004 x21: ffff000007bec000\n| x20: 000000000000002c x19: 0000000000000000 x18: 0000000000000000\n| x17: 000000040044ffff x16: 00500072b5503510 x15: ccc283740681e517\n| x14: 0201000101006d15 x13: 0000000002e8ff43 x12: 002c01000000ffb1\n| x11: 0100000000000000 x10: 02e8ff43002c0100 x9 : 0000ffb100100157\n| x8 : ffff000003d20000 x7 : 00000000000002f1 x6 : 00000000ffffe124\n| x5 : 0000000000000001 x4 : 0000000000000003 x3 : 0000000000000000\n| x2 : 0000000000000000 x1 : 0001000000011001 x0 : 0000000000000000\n| Call trace:\n| mwifiex_get_cfp+0xd8/0x15c [mwifiex]\n| mwifiex_parse_single_response_buf+0x1d0/0x504 [mwifiex]\n| mwifiex_handle_event_ext_scan_report+0x19c/0x2f8 [mwifiex]\n| mwifiex_process_sta_event+0x298/0xf0c [mwifiex]\n| mwifiex_process_event+0x110/0x238 [mwifiex]\n| mwifiex_main_process+0x428/0xa44 [mwifiex]\n| mwifiex_sdio_interrupt+0x64/0x12c [mwifiex_sdio]\n| process_sdio_pending_irqs+0x64/0x1b8\n| sdio_irq_work+0x4c/0x7c\n| process_one_work+0x148/0x2a0\n| worker_thread+0x2fc/0x40c\n| kthread+0x110/0x114\n| ret_from_fork+0x10/0x20\n| Code: a94153f3 a8c37bfd d50323bf d65f03c0 (f940a000)\n| ---[ end trace 0000000000000000 ]---(CVE-2024-46755)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhwmon: (w83627ehf) Fix underflows seen when writing limit attributes\r\n\r\nDIV_ROUND_CLOSEST() after kstrtol() results in an underflow if a large\nnegative number such as -9223372036854775808 is provided by the user.\nFix it by reordering clamp_val() and DIV_ROUND_CLOSEST() operations.(CVE-2024-46756)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhwmon: (lm95234) Fix underflows seen when writing limit attributes\r\n\r\nDIV_ROUND_CLOSEST() after kstrtol() results in an underflow if a large\nnegative number such as -9223372036854775808 is provided by the user.\nFix it by reordering clamp_val() and DIV_ROUND_CLOSEST() operations.(CVE-2024-46758)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhwmon: (adc128d818) Fix underflows seen when writing limit attributes\r\n\r\nDIV_ROUND_CLOSEST() after kstrtol() results in an underflow if a large\nnegative number such as -9223372036854775808 is provided by the user.\nFix it by reordering clamp_val() and DIV_ROUND_CLOSEST() operations.(CVE-2024-46759)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npci/hotplug/pnv_php: Fix hotplug driver crash on Powernv\r\n\r\nThe hotplug driver for powerpc (pci/hotplug/pnv_php.c) causes a kernel\ncrash when we try to hot-unplug/disable the PCIe switch/bridge from\nthe PHB.\r\n\r\nThe crash occurs because although the MSI data structure has been\nreleased during disable/hot-unplug path and it has been assigned\nwith NULL, still during unregistration the code was again trying to\nexplicitly disable the MSI which causes the NULL pointer dereference and\nkernel crash.\r\n\r\nThe patch fixes the check during unregistration path to prevent invoking\npci_disable_msi/msix() since its data structure is already freed.(CVE-2024-46761)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: bcm: Remove proc entry when dev is unregistered.\r\n\r\nsyzkaller reported a warning in bcm_connect() below. [0]\r\n\r\nThe repro calls connect() to vxcan1, removes vxcan1, and calls\nconnect() with ifindex == 0.\r\n\r\nCalling connect() for a BCM socket allocates a proc entry.\nThen, bcm_sk(sk)-\u0026gt;bound is set to 1 to prevent further connect().\r\n\r\nHowever, removing the bound device resets bcm_sk(sk)-\u0026gt;bound to 0\nin bcm_notify().\r\n\r\nThe 2nd connect() tries to allocate a proc entry with the same\nname and sets NULL to bcm_sk(sk)-\u0026gt;bcm_proc_read, leaking the\noriginal proc entry.\r\n\r\nSince the proc entry is available only for connect()ed sockets,\nlet\u0026apos;s clean up the entry when the bound netdev is unregistered.\r\n\r\n[0]:\nproc_dir_entry \u0026apos;can-bcm/2456\u0026apos; already registered\nWARNING: CPU: 1 PID: 394 at fs/proc/generic.c:376 proc_register+0x645/0x8f0 fs/proc/generic.c:375\nModules linked in:\nCPU: 1 PID: 394 Comm: syz-executor403 Not tainted 6.10.0-rc7-g852e42cc2dd4\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.16.3-0-ga6ed6b701f0a-prebuilt.qemu.org 04/01/2014\nRIP: 0010:proc_register+0x645/0x8f0 fs/proc/generic.c:375\nCode: 00 00 00 00 00 48 85 ed 0f 85 97 02 00 00 4d 85 f6 0f 85 9f 02 00 00 48 c7 c7 9b cb cf 87 48 89 de 4c 89 fa e8 1c 6f eb fe 90 \u0026lt;0f\u0026gt; 0b 90 90 48 c7 c7 98 37 99 89 e8 cb 7e 22 05 bb 00 00 00 10 48\nRSP: 0018:ffa0000000cd7c30 EFLAGS: 00010246\nRAX: 9e129be1950f0200 RBX: ff1100011b51582c RCX: ff1100011857cd80\nRDX: 0000000000000000 RSI: 0000000000000000 RDI: 0000000000000002\nRBP: 0000000000000000 R08: ffd400000000000f R09: ff1100013e78cac0\nR10: ffac800000cd7980 R11: ff1100013e12b1f0 R12: 0000000000000000\nR13: 0000000000000000 R14: 0000000000000000 R15: ff1100011a99a2ec\nFS: 00007fbd7086f740(0000) GS:ff1100013fd00000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00000000200071c0 CR3: 0000000118556004 CR4: 0000000000771ef0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe07f0 DR7: 0000000000000400\nPKRU: 55555554\nCall Trace:\n \u0026lt;TASK\u0026gt;\n proc_create_net_single+0x144/0x210 fs/proc/proc_net.c:220\n bcm_connect+0x472/0x840 net/can/bcm.c:1673\n __sys_connect_file net/socket.c:2049 [inline]\n __sys_connect+0x5d2/0x690 net/socket.c:2066\n __do_sys_connect net/socket.c:2076 [inline]\n __se_sys_connect net/socket.c:2073 [inline]\n __x64_sys_connect+0x8f/0x100 net/socket.c:2073\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xd9/0x1c0 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x4b/0x53\nRIP: 0033:0x7fbd708b0e5d\nCode: ff c3 66 2e 0f 1f 84 00 00 00 00 00 90 f3 0f 1e fa 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 8b 0d 73 9f 1b 00 f7 d8 64 89 01 48\nRSP: 002b:00007fff8cd33f08 EFLAGS: 00000246 ORIG_RAX: 000000000000002a\nRAX: ffffffffffffffda RBX: 0000000000000003 RCX: 00007fbd708b0e5d\nRDX: 0000000000000010 RSI: 0000000020000040 RDI: 0000000000000003\nRBP: 0000000000000000 R08: 0000000000000040 R09: 0000000000000040\nR10: 0000000000000040 R11: 0000000000000246 R12: 00007fff8cd34098\nR13: 0000000000401280 R14: 0000000000406de8 R15: 00007fbd70ab9000\n \u0026lt;/TASK\u0026gt;\nremove_proc_entry: removing non-empty directory \u0026apos;net/can-bcm\u0026apos;, leaking at least \u0026apos;2456\u0026apos;(CVE-2024-46771)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nudf: Avoid excessive partition lengths\r\n\r\nAvoid mounting filesystems where the partition would overflow the\n32-bits used for block number. Also refuse to mount filesystems where\nthe partition length is so large we cannot safely index bits in a\nblock bitmap.(CVE-2024-46777)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: protect references to superblock parameters exposed in sysfs\r\n\r\nThe superblock buffers of nilfs2 can not only be overwritten at runtime\nfor modifications/repairs, but they are also regularly swapped, replaced\nduring resizing, and even abandoned when degrading to one side due to\nbacking device issues. So, accessing them requires mutual exclusion using\nthe reader/writer semaphore \u0026quot;nilfs-\u0026gt;ns_sem\u0026quot;.\r\n\r\nSome sysfs attribute show methods read this superblock buffer without the\nnecessary mutual exclusion, which can cause problems with pointer\ndereferencing and memory access, so fix it.(CVE-2024-46780)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: fix missing cleanup on rollforward recovery error\r\n\r\nIn an error injection test of a routine for mount-time recovery, KASAN\nfound a use-after-free bug.\r\n\r\nIt turned out that if data recovery was performed using partial logs\ncreated by dsync writes, but an error occurred before starting the log\nwriter to create a recovered checkpoint, the inodes whose data had been\nrecovered were left in the ns_dirty_files list of the nilfs object and\nwere not freed.\r\n\r\nFix this issue by cleaning up inodes that have read the recovery data if\nthe recovery routine fails midway before the log writer starts.(CVE-2024-46781)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: mcp251x: fix deadlock if an interrupt occurs during mcp251x_open\r\n\r\nThe mcp251x_hw_wake() function is called with the mpc_lock mutex held and\ndisables the interrupt handler so that no interrupts can be processed while\nwaking the device. If an interrupt has already occurred then waiting for\nthe interrupt handler to complete will deadlock because it will be trying\nto acquire the same mutex.\r\n\r\nCPU0 CPU1\n---- ----\nmcp251x_open()\n mutex_lock(\u0026amp;priv-\u0026gt;mcp_lock)\n request_threaded_irq()\n \u0026lt;interrupt\u0026gt;\n mcp251x_can_ist()\n mutex_lock(\u0026amp;priv-\u0026gt;mcp_lock)\n mcp251x_hw_wake()\n disable_irq() \u0026lt;-- deadlock\r\n\r\nUse disable_irq_nosync() instead because the interrupt handler does\neverything while holding the mutex so it doesn\u0026apos;t matter if it\u0026apos;s still\nrunning.(CVE-2024-46791)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nASoC: dapm: Fix UAF for snd_soc_pcm_runtime object\r\n\r\nWhen using kernel with the following extra config,\r\n\r\n - CONFIG_KASAN=y\n - CONFIG_KASAN_GENERIC=y\n - CONFIG_KASAN_INLINE=y\n - CONFIG_KASAN_VMALLOC=y\n - CONFIG_FRAME_WARN=4096\r\n\r\nkernel detects that snd_pcm_suspend_all() access a freed\n\u0026apos;snd_soc_pcm_runtime\u0026apos; object when the system is suspended, which\nleads to a use-after-free bug:\r\n\r\n[ 52.047746] BUG: KASAN: use-after-free in snd_pcm_suspend_all+0x1a8/0x270\n[ 52.047765] Read of size 1 at addr ffff0000b9434d50 by task systemd-sleep/2330\r\n\r\n[ 52.047785] Call trace:\n[ 52.047787] dump_backtrace+0x0/0x3c0\n[ 52.047794] show_stack+0x34/0x50\n[ 52.047797] dump_stack_lvl+0x68/0x8c\n[ 52.047802] print_address_description.constprop.0+0x74/0x2c0\n[ 52.047809] kasan_report+0x210/0x230\n[ 52.047815] __asan_report_load1_noabort+0x3c/0x50\n[ 52.047820] snd_pcm_suspend_all+0x1a8/0x270\n[ 52.047824] snd_soc_suspend+0x19c/0x4e0\r\n\r\nThe snd_pcm_sync_stop() has a NULL check on \u0026apos;substream-\u0026gt;runtime\u0026apos; before\nmaking any access. So we need to always set \u0026apos;substream-\u0026gt;runtime\u0026apos; to NULL\neverytime we kfree() it.(CVE-2024-46798)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Add array index check for hdcp ddc access\r\n\r\n[Why]\nCoverity reports OVERRUN warning. Do not check if array\nindex valid.\r\n\r\n[How]\nCheck msg_id valid and valid array index.(CVE-2024-46804)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Check msg_id before processing transcation\r\n\r\n[WHY \u0026amp; HOW]\nHDCP_MESSAGE_ID_INVALID (-1) is not a valid msg_id nor is it a valid\narray index, and it needs checking before used.\r\n\r\nThis fixes 4 OVERRUN issues reported by Coverity.(CVE-2024-46814)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Stop amdgpu_dm initialize when link nums greater than max_links\r\n\r\n[Why]\nCoverity report OVERRUN warning. There are\nonly max_links elements within dc-\u0026gt;links. link\ncount could up to AMDGPU_DM_MAX_DISPLAY_INDEX 31.\r\n\r\n[How]\nMake sure link count less than max_links.(CVE-2024-46816)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Check gpio_id before used as array index\r\n\r\n[WHY \u0026amp; HOW]\nGPIO_ID_UNKNOWN (-1) is not a valid value for array index and therefore\nshould be checked in advance.\r\n\r\nThis fixes 5 OVERRUN issues reported by Coverity.(CVE-2024-46818)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/pm: Fix negative array index read\r\n\r\nAvoid using the negative values\nfor clk_idex as an index into an array pptable-\u0026gt;DpmDescriptor.\r\n\r\nV2: fix clk_index return check (Tim Huang)(CVE-2024-46821)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nrtmutex: Drop rt_mutex::wait_lock before scheduling\r\n\r\nrt_mutex_handle_deadlock() is called with rt_mutex::wait_lock held. In the\ngood case it returns with the lock held and in the deadlock case it emits a\nwarning and goes into an endless scheduling loop with the lock held, which\ntriggers the \u0026apos;scheduling in atomic\u0026apos; warning.\r\n\r\nUnlock rt_mutex::wait_lock in the dead lock case before issuing the warning\nand dropping into the schedule for ever loop.\r\n\r\n[ tglx: Moved unlock before the WARN(), removed the pointless comment,\n \tmassaged changelog, added Fixes tag ](CVE-2024-46829)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: hns3: void array out of bound when loop tnl_num\r\n\r\nWhen query reg inf of SSU, it loops tnl_num times. However, tnl_num comes\nfrom hardware and the length of array is a fixed value. To void array out\nof bound, make sure the loop time is not greater than the length of array(CVE-2024-46833)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: don\u0026apos;t BUG_ON on ENOMEM from btrfs_lookup_extent_info() in walk_down_proc()\r\n\r\nWe handle errors here properly, ENOMEM isn\u0026apos;t fatal, return the error.(CVE-2024-46841)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\num: line: always fill *error_out in setup_one_line()\r\n\r\nThe pointer isn\u0026apos;t initialized by callers, but I have\nencountered cases where it\u0026apos;s still printed; initialize\nit in all possible cases in setup_one_line().(CVE-2024-46844)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nASoC: meson: axg-card: fix \u0026apos;use-after-free\u0026apos;\r\n\r\nBuffer \u0026apos;card-\u0026gt;dai_link\u0026apos; is reallocated in \u0026apos;meson_card_reallocate_links()\u0026apos;,\nso move \u0026apos;pad\u0026apos; pointer initialization after this function when memory is\nalready reallocated.\r\n\r\nKasan bug report:\r\n\r\n==================================================================\nBUG: KASAN: slab-use-after-free in axg_card_add_link+0x76c/0x9bc\nRead of size 8 at addr ffff000000e8b260 by task modprobe/356\r\n\r\nCPU: 0 PID: 356 Comm: modprobe Tainted: G O 6.9.12-sdkernel #1\nCall trace:\n dump_backtrace+0x94/0xec\n show_stack+0x18/0x24\n dump_stack_lvl+0x78/0x90\n print_report+0xfc/0x5c0\n kasan_report+0xb8/0xfc\n __asan_load8+0x9c/0xb8\n axg_card_add_link+0x76c/0x9bc [snd_soc_meson_axg_sound_card]\n meson_card_probe+0x344/0x3b8 [snd_soc_meson_card_utils]\n platform_probe+0x8c/0xf4\n really_probe+0x110/0x39c\n __driver_probe_device+0xb8/0x18c\n driver_probe_device+0x108/0x1d8\n __driver_attach+0xd0/0x25c\n bus_for_each_dev+0xe0/0x154\n driver_attach+0x34/0x44\n bus_add_driver+0x134/0x294\n driver_register+0xa8/0x1e8\n __platform_driver_register+0x44/0x54\n axg_card_pdrv_init+0x20/0x1000 [snd_soc_meson_axg_sound_card]\n do_one_initcall+0xdc/0x25c\n do_init_module+0x10c/0x334\n load_module+0x24c4/0x26cc\n init_module_from_file+0xd4/0x128\n __arm64_sys_finit_module+0x1f4/0x41c\n invoke_syscall+0x60/0x188\n el0_svc_common.constprop.0+0x78/0x13c\n do_el0_svc+0x30/0x40\n el0_svc+0x38/0x78\n el0t_64_sync_handler+0x100/0x12c\n el0t_64_sync+0x190/0x194(CVE-2024-46849)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/mlx5: Fix bridge mode operations when there are no VFs\r\n\r\nCurrently, trying to set the bridge mode attribute when numvfs=0 leads to a\ncrash:\r\n\r\nbridge link set dev eth2 hwmode vepa\r\n\r\n[ 168.967392] BUG: kernel NULL pointer dereference, address: 0000000000000030\n[...]\n[ 168.969989] RIP: 0010:mlx5_add_flow_rules+0x1f/0x300 [mlx5_core]\n[...]\n[ 168.976037] Call Trace:\n[ 168.976188] \u0026lt;TASK\u0026gt;\n[ 168.978620] _mlx5_eswitch_set_vepa_locked+0x113/0x230 [mlx5_core]\n[ 168.979074] mlx5_eswitch_set_vepa+0x7f/0xa0 [mlx5_core]\n[ 168.979471] rtnl_bridge_setlink+0xe9/0x1f0\n[ 168.979714] rtnetlink_rcv_msg+0x159/0x400\n[ 168.980451] netlink_rcv_skb+0x54/0x100\n[ 168.980675] netlink_unicast+0x241/0x360\n[ 168.980918] netlink_sendmsg+0x1f6/0x430\n[ 168.981162] ____sys_sendmsg+0x3bb/0x3f0\n[ 168.982155] ___sys_sendmsg+0x88/0xd0\n[ 168.985036] __sys_sendmsg+0x59/0xa0\n[ 168.985477] do_syscall_64+0x79/0x150\n[ 168.987273] entry_SYSCALL_64_after_hwframe+0x76/0x7e\n[ 168.987773] RIP: 0033:0x7f8f7950f917\r\n\r\n(esw-\u0026gt;fdb_table.legacy.vepa_fdb is null)\r\n\r\nThe bridge mode is only relevant when there are multiple functions per\nport. Therefore, prevent setting and getting this setting when there are no\nVFs.\r\n\r\nNote that after this change, there are no settings to change on the PF\ninterface using `bridge link` when there are no VFs, so the interface no\nlonger appears in the `bridge link` output.(CVE-2024-46857)",
"id": "OESA-2024-2216",
"modified": "2026-08-06T11:07:41Z",
"published": "2024-10-12T11:07:41Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2024-2216"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27436"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36894"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38560"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38659"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39482"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41030"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41095"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43900"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-44958"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-44982"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-45008"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-45016"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46673"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46674"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46679"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46681"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46695"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46707"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46721"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46725"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46726"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46732"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46737"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46738"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46739"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46740"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46743"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46750"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46753"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46755"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46756"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46758"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46759"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46761"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46771"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46777"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46780"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46781"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46791"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46798"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46804"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46814"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46816"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46818"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46821"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46829"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46833"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46841"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46844"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46849"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-46857"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2024-27436",
"CVE-2024-36894",
"CVE-2024-38560",
"CVE-2024-38659",
"CVE-2024-39482",
"CVE-2024-41030",
"CVE-2024-41095",
"CVE-2024-43900",
"CVE-2024-44958",
"CVE-2024-44982",
"CVE-2024-45008",
"CVE-2024-45016",
"CVE-2024-46673",
"CVE-2024-46674",
"CVE-2024-46679",
"CVE-2024-46681",
"CVE-2024-46695",
"CVE-2024-46707",
"CVE-2024-46721",
"CVE-2024-46725",
"CVE-2024-46726",
"CVE-2024-46732",
"CVE-2024-46737",
"CVE-2024-46738",
"CVE-2024-46739",
"CVE-2024-46740",
"CVE-2024-46743",
"CVE-2024-46750",
"CVE-2024-46753",
"CVE-2024-46755",
"CVE-2024-46756",
"CVE-2024-46758",
"CVE-2024-46759",
"CVE-2024-46761",
"CVE-2024-46771",
"CVE-2024-46777",
"CVE-2024-46780",
"CVE-2024-46781",
"CVE-2024-46791",
"CVE-2024-46798",
"CVE-2024-46804",
"CVE-2024-46814",
"CVE-2024-46816",
"CVE-2024-46818",
"CVE-2024-46821",
"CVE-2024-46829",
"CVE-2024-46833",
"CVE-2024-46841",
"CVE-2024-46844",
"CVE-2024-46849",
"CVE-2024-46857"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.