Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2024-58237 (GCVE-0-2024-58237)
Vulnerability from cvelistv5 – Published: 2025-05-05 14:53 – Updated: 2026-08-05 11:47| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
51c39bb1d5d105a02e29aa7960f0a395086e6342 , < f1692ee23dcaaddc24ba407b269707ee5df1301f
(git)
Affected: 51c39bb1d5d105a02e29aa7960f0a395086e6342 , < 1c2244437f9ad3dd91215f920401a14f2542dbfc (git) Affected: 51c39bb1d5d105a02e29aa7960f0a395086e6342 , < 1a4607ffba35bf2a630aab299e34dd3f6e658d70 (git) |
guessed | |
| Linux | Linux |
Affected:
5.6
Unaffected: 0 , < 5.6 (semver) Unaffected: 6.6.90 , ≤ 6.6.* (semver) Unaffected: 6.12.9 , ≤ 6.12.* (semver) Unaffected: 6.13 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/core/filter.c",
"tools/testing/selftests/bpf/progs/tc_bpf2bpf.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "f1692ee23dcaaddc24ba407b269707ee5df1301f",
"status": "affected",
"version": "51c39bb1d5d105a02e29aa7960f0a395086e6342",
"versionType": "git"
},
{
"lessThan": "1c2244437f9ad3dd91215f920401a14f2542dbfc",
"status": "affected",
"version": "51c39bb1d5d105a02e29aa7960f0a395086e6342",
"versionType": "git"
},
{
"lessThan": "1a4607ffba35bf2a630aab299e34dd3f6e658d70",
"status": "affected",
"version": "51c39bb1d5d105a02e29aa7960f0a395086e6342",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/core/filter.c",
"tools/testing/selftests/bpf/progs/tc_bpf2bpf.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.6"
},
{
"lessThan": "5.6",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.90",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.9",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.13",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.90",
"versionStartIncluding": "5.6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.12.9",
"versionStartIncluding": "5.6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.13",
"versionStartIncluding": "5.6",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nbpf: consider that tail calls invalidate packet pointers\n\nTail-called programs could execute any of the helpers that invalidate\npacket pointers. Hence, conservatively assume that each tail call\ninvalidates packet pointers.\n\nMaking the change in bpf_helper_changes_pkt_data() automatically makes\nuse of check_cfg() logic that computes \u0027changes_pkt_data\u0027 effect for\nglobal sub-programs, such that the following program could be\nrejected:\n\n int tail_call(struct __sk_buff *sk)\n {\n \tbpf_tail_call_static(sk, \u0026jmp_table, 0);\n \treturn 0;\n }\n\n SEC(\"tc\")\n int not_safe(struct __sk_buff *sk)\n {\n \tint *p = (void *)(long)sk-\u003edata;\n \t... make p valid ...\n \ttail_call(sk);\n \t*p = 42; /* this is unsafe */\n \t...\n }\n\nThe tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that\ncan invalidate packet pointers. Otherwise, it can\u0027t be freplaced with\ntailcall_freplace.c:entry_freplace() that does a tail call."
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 7.8,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The vulnerability is a BPF verifier flaw triggered by loading a crafted eBPF program through the bpf() syscall; the resulting memory corruption occurs during local packet processing controlled by the attacker, requiring local access.\nAC:L - The attacker fully controls the malicious program, its subprogram/tail-call structure, and the heap grooming, so acceptance by the buggy verifier and the subsequent stale-pointer dereference are fully reliable with no attacker-uncontrolled conditions.\nPR:L - Reaching the flaw requires loading a packet-processing eBPF program (e.g., SCHED_CLS/tc) which needs the CAP_BPF/CAP_NET_ADMIN privilege over the BPF subsystem \u2014 a limited, delegatable privilege over the component rather than full root.\nUI:N - The attacker loads, attaches, and triggers the malicious program entirely on their own; no action by any other user is required.\nS:U - The verifier bypass corrupts kernel heap memory within the kernel\u0027s own security authority; there is no crossing into a different security scope such as a VM or IOMMU boundary.\nC:H - The stale packet pointer permits out-of-bounds reads of reallocated/adjacent kernel heap memory, allowing disclosure of sensitive kernel data.\nI:H - The verifier accepts a program that writes through a stale packet pointer (`*p = 42`), giving a controlled out-of-bounds write to kernel heap memory that can be leveraged into an arbitrary-write/control-flow-hijack primitive.\nA:H - Out-of-bounds reads/writes on reallocated kernel heap memory readily cause kernel memory corruption and panic/oops."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T11:47:47.022Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/f1692ee23dcaaddc24ba407b269707ee5df1301f"
},
{
"url": "https://git.kernel.org/stable/c/1c2244437f9ad3dd91215f920401a14f2542dbfc"
},
{
"url": "https://git.kernel.org/stable/c/1a4607ffba35bf2a630aab299e34dd3f6e658d70"
}
],
"title": "bpf: consider that tail calls invalidate packet pointers",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-58237",
"datePublished": "2025-05-05T14:53:34.153Z",
"dateReserved": "2025-04-16T07:19:43.804Z",
"dateUpdated": "2026-08-05T11:47:47.022Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2024-58237",
"date": "2026-09-28",
"epss": "0.00188",
"percentile": "0.07537"
},
"microsoft_vex": {
"current_release_date": "2026-09-09T01:46:34.000Z",
"cve": "CVE-2024-58237",
"id": "msrc_CVE-2024-58237",
"initial_release_date": "2025-07-11T00:00:00.000Z",
"product_status:fixed": "2",
"product_status:known_affected": "7",
"source": "Microsoft CSAF VEX",
"status": "final",
"title": "bpf: consider that tail calls invalidate packet pointers",
"url": "https://msrc.microsoft.com/csaf/vex/2025/msrc_cve-2024-58237.json",
"version": "5"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/core/filter.c",
"tools/testing/selftests/bpf/progs/tc_bpf2bpf.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "f1692ee23dcaaddc24ba407b269707ee5df1301f",
"status": "affected",
"version": "51c39bb1d5d105a02e29aa7960f0a395086e6342",
"versionType": "git"
},
{
"lessThan": "1c2244437f9ad3dd91215f920401a14f2542dbfc",
"status": "affected",
"version": "51c39bb1d5d105a02e29aa7960f0a395086e6342",
"versionType": "git"
},
{
"lessThan": "1a4607ffba35bf2a630aab299e34dd3f6e658d70",
"status": "affected",
"version": "51c39bb1d5d105a02e29aa7960f0a395086e6342",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/core/filter.c",
"tools/testing/selftests/bpf/progs/tc_bpf2bpf.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.6"
},
{
"lessThan": "5.6",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.90",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.9",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.13",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "639CB8B7-A013-410F-ACC9-35ADBDE2AC4C",
"versionEndExcluding": "6.6.90",
"versionStartIncluding": "5.6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "1D13AF97-FFED-4B68-906D-CFE38D0B88DD",
"versionEndExcluding": "6.12.9",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.13:rc1:*:*:*:*:*:*",
"matchCriteriaId": "62567B3C-6CEE-46D0-BC2E-B3717FBF7D13",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.13:rc2:*:*:*:*:*:*",
"matchCriteriaId": "5A073481-106D-4B15-B4C7-FB0213B8E1D4",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nbpf: consider that tail calls invalidate packet pointers\n\nTail-called programs could execute any of the helpers that invalidate\npacket pointers. Hence, conservatively assume that each tail call\ninvalidates packet pointers.\n\nMaking the change in bpf_helper_changes_pkt_data() automatically makes\nuse of check_cfg() logic that computes \u0027changes_pkt_data\u0027 effect for\nglobal sub-programs, such that the following program could be\nrejected:\n\n int tail_call(struct __sk_buff *sk)\n {\n \tbpf_tail_call_static(sk, \u0026jmp_table, 0);\n \treturn 0;\n }\n\n SEC(\"tc\")\n int not_safe(struct __sk_buff *sk)\n {\n \tint *p = (void *)(long)sk-\u003edata;\n \t... make p valid ...\n \ttail_call(sk);\n \t*p = 42; /* this is unsafe */\n \t...\n }\n\nThe tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that\ncan invalidate packet pointers. Otherwise, it can\u0027t be freplaced with\ntailcall_freplace.c:entry_freplace() that does a tail call."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: bpf: considerar que las llamadas de cola invalidan los punteros de paquete. Los programas con llamadas de cola podr\u00edan ejecutar cualquiera de los ayudantes que invalidan los punteros de paquete. Por lo tanto, se asume, de forma conservadora, que cada llamada de cola invalida los punteros de paquete. Al realizar el cambio en bpf_helper_changes_pkt_data(), se utiliza autom\u00e1ticamente la l\u00f3gica check_cfg(), que calcula el efecto de \u0027changes_pkt_data\u0027 para los subprogramas globales, de modo que el siguiente programa podr\u00eda ser rechazado: int tail_call(struct __sk_buff *sk) { bpf_tail_call_static(sk, \u0026amp;jmp_table, 0); return 0; } SEC(\"tc\") int not_safe(struct __sk_buff *sk) { int *p = (void *)(long)sk-\u0026gt;data; ... make p valid ... tail_call(sk); *p = 42; /* esto no es seguro */ ... } La funci\u00f3n tc_bpf2bpf.c:subprog_tc() debe modificarse: m\u00e1rquela como una funci\u00f3n que puede invalidar punteros de paquetes. De lo contrario, no se puede reemplazar con tailcall_freplace.c:entry_freplace(), que realiza una llamada de cola."
}
],
"id": "CVE-2024-58237",
"lastModified": "2026-08-04T11:22:40.363",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2025-05-05T15:15:54.010",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/1a4607ffba35bf2a630aab299e34dd3f6e658d70"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/1c2244437f9ad3dd91215f920401a14f2542dbfc"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f1692ee23dcaaddc24ba407b269707ee5df1301f"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2026-08-04T14:12:05+00:00",
"cve": "CVE-2024-58237",
"id": "CVE-2024-58237",
"initial_release_date": "2024-01-01T00:00:00+00:00",
"product_status:known_affected": "274",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: bpf: consider that tail calls invalidate packet pointers",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2024/cve-2024-58237.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-09-23T17:13:57Z",
"cve": "CVE-2024-58237",
"id": "CVE-2024-58237",
"initial_release_date": "2025-05-07T02:12:59Z",
"product_status:known_affected": "498",
"product_status:known_not_affected": "323",
"product_status:recommended": "396",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2024-58237",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2024-58237.json",
"version": "41"
}
}
}
CERTFR-2026-AVI-0316
Vulnerability from certfr_avis - Published: 2026-03-19 - Updated: 2026-03-19
De multiples vulnérabilités ont été découvertes dans les produits VMware. Elles permettent à un attaquant de provoquer un problème de sécurité non spécifié par l'éditeur.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| VMware | N/A | NodeJS Buildpack versions antérieures à 1.8.82 | ||
| VMware | Tanzu Platform | Tanzu for MySQL sur Tanzu Platform versions antérieures à 10.1.1 | ||
| VMware | N/A | Java Buildpack versions antérieures à 4.90.0 | ||
| VMware | N/A | NGINX Buildpack versions antérieures à 1.2.71 | ||
| VMware | N/A | HWC Buildpack versions antérieures à 3.1.91 | ||
| VMware | Tanzu Platform | Foundation Core for VMware Tanzu Platform versions antérieures à 3.1.9 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "NodeJS Buildpack versions ant\u00e9rieures \u00e0 1.8.82",
"product": {
"name": "N/A",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu for MySQL sur Tanzu Platform versions ant\u00e9rieures \u00e0 10.1.1",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Java Buildpack versions ant\u00e9rieures \u00e0 4.90.0",
"product": {
"name": "N/A",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "NGINX Buildpack versions ant\u00e9rieures \u00e0 1.2.71",
"product": {
"name": "N/A",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "HWC Buildpack versions ant\u00e9rieures \u00e0 3.1.91",
"product": {
"name": "N/A",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Foundation Core for VMware Tanzu Platform versions ant\u00e9rieures \u00e0 3.1.9",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-28422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28422"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2022-50759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50759"
},
{
"name": "CVE-2026-26007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26007"
},
{
"name": "CVE-2025-71075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71075"
},
{
"name": "CVE-2024-49912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49912"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2026-23198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23198"
},
{
"name": "CVE-2023-3640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3640"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2025-40273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40273"
},
{
"name": "CVE-2023-53714",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53714"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2025-68230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68230"
},
{
"name": "CVE-2026-28420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28420"
},
{
"name": "CVE-2022-49069",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49069"
},
{
"name": "CVE-2024-57875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57875"
},
{
"name": "CVE-2022-27943",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27943"
},
{
"name": "CVE-2025-40064",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40064"
},
{
"name": "CVE-2023-54129",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54129"
},
{
"name": "CVE-2025-66865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66865"
},
{
"name": "CVE-2024-41031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41031"
},
{
"name": "CVE-2025-39992",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39992"
},
{
"name": "CVE-2025-69534",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69534"
},
{
"name": "CVE-2025-61730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61730"
},
{
"name": "CVE-2022-49543",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49543"
},
{
"name": "CVE-2026-23202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23202"
},
{
"name": "CVE-2025-38485",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38485"
},
{
"name": "CVE-2023-53562",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53562"
},
{
"name": "CVE-2025-68324",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68324"
},
{
"name": "CVE-2025-22026",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22026"
},
{
"name": "CVE-2023-54149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54149"
},
{
"name": "CVE-2025-71086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71086"
},
{
"name": "CVE-2024-50063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50063"
},
{
"name": "CVE-2023-33875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-33875"
},
{
"name": "CVE-2024-41001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41001"
},
{
"name": "CVE-2024-42155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42155"
},
{
"name": "CVE-2026-23167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23167"
},
{
"name": "CVE-2025-36353",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36353"
},
{
"name": "CVE-2025-68196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68196"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2025-38042",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38042"
},
{
"name": "CVE-2025-22083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22083"
},
{
"name": "CVE-2023-53829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53829"
},
{
"name": "CVE-2025-58183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58183"
},
{
"name": "CVE-2023-54002",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54002"
},
{
"name": "CVE-2022-50550",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50550"
},
{
"name": "CVE-2022-0400",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0400"
},
{
"name": "CVE-2022-49138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49138"
},
{
"name": "CVE-2025-66199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66199"
},
{
"name": "CVE-2024-42239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42239"
},
{
"name": "CVE-2022-49359",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49359"
},
{
"name": "CVE-2025-68342",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68342"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2022-50425",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50425"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2024-39293",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39293"
},
{
"name": "CVE-2023-53008",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53008"
},
{
"name": "CVE-2025-38669",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38669"
},
{
"name": "CVE-2025-40137",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40137"
},
{
"name": "CVE-2023-54052",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54052"
},
{
"name": "CVE-2025-22107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22107"
},
{
"name": "CVE-2024-38306",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38306"
},
{
"name": "CVE-2023-53733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53733"
},
{
"name": "CVE-2025-37775",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37775"
},
{
"name": "CVE-2025-21682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21682"
},
{
"name": "CVE-2023-1386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1386"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-39298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39298"
},
{
"name": "CVE-2024-56703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56703"
},
{
"name": "CVE-2026-23098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23098"
},
{
"name": "CVE-2023-53347",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53347"
},
{
"name": "CVE-2023-28374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28374"
},
{
"name": "CVE-2023-52926",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52926"
},
{
"name": "CVE-2026-32597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-32597"
},
{
"name": "CVE-2025-68286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68286"
},
{
"name": "CVE-2025-9231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9231"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2025-40057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40057"
},
{
"name": "CVE-2024-41050",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41050"
},
{
"name": "CVE-2026-25500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25500"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2025-27558",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27558"
},
{
"name": "CVE-2025-71094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71094"
},
{
"name": "CVE-2026-21637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21637"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-37891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37891"
},
{
"name": "CVE-2021-0076",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0076"
},
{
"name": "CVE-2025-68788",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68788"
},
{
"name": "CVE-2024-58237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58237"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-42147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42147"
},
{
"name": "CVE-2023-53529",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53529"
},
{
"name": "CVE-2024-50028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50028"
},
{
"name": "CVE-2023-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53042"
},
{
"name": "CVE-2022-50527",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50527"
},
{
"name": "CVE-2023-54280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54280"
},
{
"name": "CVE-2025-21786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21786"
},
{
"name": "CVE-2024-58094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58094"
},
{
"name": "CVE-2024-11187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11187"
},
{
"name": "CVE-2025-52534",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52534"
},
{
"name": "CVE-2025-40314",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40314"
},
{
"name": "CVE-2024-46705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46705"
},
{
"name": "CVE-2022-50407",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50407"
},
{
"name": "CVE-2026-23196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23196"
},
{
"name": "CVE-2024-26595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26595"
},
{
"name": "CVE-2022-23825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23825"
},
{
"name": "CVE-2024-45775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45775"
},
{
"name": "CVE-2025-40306",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40306"
},
{
"name": "CVE-2025-21881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21881"
},
{
"name": "CVE-2022-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49901"
},
{
"name": "CVE-2026-23126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23126"
},
{
"name": "CVE-2025-38329",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38329"
},
{
"name": "CVE-2021-33096",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33096"
},
{
"name": "CVE-2022-50230",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50230"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2025-39947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39947"
},
{
"name": "CVE-2025-68778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68778"
},
{
"name": "CVE-2023-53588",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53588"
},
{
"name": "CVE-2024-41082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41082"
},
{
"name": "CVE-2023-53685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53685"
},
{
"name": "CVE-2025-5222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5222"
},
{
"name": "CVE-2025-23155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23155"
},
{
"name": "CVE-2026-23054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23054"
},
{
"name": "CVE-2025-37870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37870"
},
{
"name": "CVE-2025-40254",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40254"
},
{
"name": "CVE-2022-49533",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49533"
},
{
"name": "CVE-2024-42253",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42253"
},
{
"name": "CVE-2020-26557",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26557"
},
{
"name": "CVE-2025-71064",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71064"
},
{
"name": "CVE-2023-54201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54201"
},
{
"name": "CVE-2021-33114",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33114"
},
{
"name": "CVE-2025-69645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69645"
},
{
"name": "CVE-2025-68200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68200"
},
{
"name": "CVE-2022-49518",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49518"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2022-49125",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49125"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2025-38501",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38501"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2024-27010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27010"
},
{
"name": "CVE-2025-27516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27516"
},
{
"name": "CVE-2025-68736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68736"
},
{
"name": "CVE-2023-52561",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52561"
},
{
"name": "CVE-2025-68725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68725"
},
{
"name": "CVE-2024-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53221"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2025-68176",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68176"
},
{
"name": "CVE-2025-37777",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37777"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2025-68204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68204"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2025-68795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68795"
},
{
"name": "CVE-2025-68349",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68349"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2022-50815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50815"
},
{
"name": "CVE-2025-21931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21931"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-38036",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38036"
},
{
"name": "CVE-2025-2668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2668"
},
{
"name": "CVE-2025-71221",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71221"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2025-39716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39716"
},
{
"name": "CVE-2024-46860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46860"
},
{
"name": "CVE-2025-22040",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22040"
},
{
"name": "CVE-2024-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53095"
},
{
"name": "CVE-2025-22872",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22872"
},
{
"name": "CVE-2025-8277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8277"
},
{
"name": "CVE-2025-8941",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8941"
},
{
"name": "CVE-2022-38457",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-38457"
},
{
"name": "CVE-2024-56665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56665"
},
{
"name": "CVE-2025-38340",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38340"
},
{
"name": "CVE-2025-38109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38109"
},
{
"name": "CVE-2023-53629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53629"
},
{
"name": "CVE-2022-50178",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50178"
},
{
"name": "CVE-2025-39779",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39779"
},
{
"name": "CVE-2025-66866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66866"
},
{
"name": "CVE-2025-68283",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68283"
},
{
"name": "CVE-2023-7216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7216"
},
{
"name": "CVE-2025-37880",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37880"
},
{
"name": "CVE-2025-36427",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36427"
},
{
"name": "CVE-2026-23217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23217"
},
{
"name": "CVE-2025-15469",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15469"
},
{
"name": "CVE-2025-37833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37833"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2025-68246",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68246"
},
{
"name": "CVE-2025-68339",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68339"
},
{
"name": "CVE-2025-40287",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40287"
},
{
"name": "CVE-2023-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53320"
},
{
"name": "CVE-2024-44961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44961"
},
{
"name": "CVE-2026-23069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23069"
},
{
"name": "CVE-2025-21656",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21656"
},
{
"name": "CVE-2024-46835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46835"
},
{
"name": "CVE-2025-69650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69650"
},
{
"name": "CVE-2022-50554",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50554"
},
{
"name": "CVE-2023-53509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53509"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2025-11731",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11731"
},
{
"name": "CVE-2026-22992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22992"
},
{
"name": "CVE-2024-52005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52005"
},
{
"name": "CVE-2024-46775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46775"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2025-38207",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38207"
},
{
"name": "CVE-2022-49465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49465"
},
{
"name": "CVE-2026-23004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23004"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2025-39720",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39720"
},
{
"name": "CVE-2023-54271",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54271"
},
{
"name": "CVE-2022-49742",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49742"
},
{
"name": "CVE-2025-71191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71191"
},
{
"name": "CVE-2025-68295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68295"
},
{
"name": "CVE-2025-68728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68728"
},
{
"name": "CVE-2025-40780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40780"
},
{
"name": "CVE-2025-68364",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68364"
},
{
"name": "CVE-2024-42118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42118"
},
{
"name": "CVE-2025-40100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40100"
},
{
"name": "CVE-2026-1965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1965"
},
{
"name": "CVE-2024-52560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52560"
},
{
"name": "CVE-2024-56604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56604"
},
{
"name": "CVE-2026-23227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23227"
},
{
"name": "CVE-2025-71087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71087"
},
{
"name": "CVE-2023-37920",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37920"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2025-40285",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40285"
},
{
"name": "CVE-2023-52508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52508"
},
{
"name": "CVE-2025-69647",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69647"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2024-50014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50014"
},
{
"name": "CVE-2022-49108",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49108"
},
{
"name": "CVE-2024-56677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56677"
},
{
"name": "CVE-2025-38717",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38717"
},
{
"name": "CVE-2026-3497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3497"
},
{
"name": "CVE-2025-22019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22019"
},
{
"name": "CVE-2025-0913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0913"
},
{
"name": "CVE-2025-40208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40208"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2025-21872",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21872"
},
{
"name": "CVE-2026-2219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2219"
},
{
"name": "CVE-2025-68287",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68287"
},
{
"name": "CVE-2025-40039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40039"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2022-50627",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50627"
},
{
"name": "CVE-2024-50285",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50285"
},
{
"name": "CVE-2025-38099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38099"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38029",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38029"
},
{
"name": "CVE-2022-49123",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49123"
},
{
"name": "CVE-2024-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50289"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2024-46813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46813"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2025-47907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47907"
},
{
"name": "CVE-2024-47658",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47658"
},
{
"name": "CVE-2022-41409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-41409"
},
{
"name": "CVE-2025-38096",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38096"
},
{
"name": "CVE-2024-48873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48873"
},
{
"name": "CVE-2025-68746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68746"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2024-46765",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46765"
},
{
"name": "CVE-2022-50380",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50380"
},
{
"name": "CVE-2025-38039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38039"
},
{
"name": "CVE-2022-48990",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48990"
},
{
"name": "CVE-2024-24864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24864"
},
{
"name": "CVE-2024-35832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35832"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2025-71133",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71133"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2024-45782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45782"
},
{
"name": "CVE-2022-50785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50785"
},
{
"name": "CVE-2025-39745",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39745"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2025-40103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40103"
},
{
"name": "CVE-2026-23020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23020"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2025-71223",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71223"
},
{
"name": "CVE-2025-36098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36098"
},
{
"name": "CVE-2025-68796",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68796"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2023-53765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53765"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2025-40356",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40356"
},
{
"name": "CVE-2026-1642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1642"
},
{
"name": "CVE-2025-45582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-45582"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2025-21752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21752"
},
{
"name": "CVE-2026-27138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27138"
},
{
"name": "CVE-2025-40312",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40312"
},
{
"name": "CVE-2025-37852",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37852"
},
{
"name": "CVE-2025-68220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68220"
},
{
"name": "CVE-2025-22125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22125"
},
{
"name": "CVE-2019-6293",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-6293"
},
{
"name": "CVE-2024-26953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26953"
},
{
"name": "CVE-2024-39282",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39282"
},
{
"name": "CVE-2025-21738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21738"
},
{
"name": "CVE-2023-50868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50868"
},
{
"name": "CVE-2025-68302",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68302"
},
{
"name": "CVE-2024-50146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50146"
},
{
"name": "CVE-2025-68238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68238"
},
{
"name": "CVE-2024-56709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56709"
},
{
"name": "CVE-2025-38063",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38063"
},
{
"name": "CVE-2025-68297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68297"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2025-68175",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68175"
},
{
"name": "CVE-2023-3817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3817"
},
{
"name": "CVE-2023-54227",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54227"
},
{
"name": "CVE-2023-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46316"
},
{
"name": "CVE-2024-47866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47866"
},
{
"name": "CVE-2024-44970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44970"
},
{
"name": "CVE-2022-49476",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49476"
},
{
"name": "CVE-2023-53855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53855"
},
{
"name": "CVE-2026-23208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23208"
},
{
"name": "CVE-2025-68804",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68804"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2025-68769",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68769"
},
{
"name": "CVE-2024-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50286"
},
{
"name": "CVE-2025-40139",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40139"
},
{
"name": "CVE-2025-68794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68794"
},
{
"name": "CVE-2025-21768",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21768"
},
{
"name": "CVE-2022-48667",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48667"
},
{
"name": "CVE-2025-69419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69419"
},
{
"name": "CVE-2024-56744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56744"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2026-3783",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3783"
},
{
"name": "CVE-2022-49161",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49161"
},
{
"name": "CVE-2021-21240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21240"
},
{
"name": "CVE-2022-48771",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48771"
},
{
"name": "CVE-2025-37961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37961"
},
{
"name": "CVE-2025-23131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23131"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2023-52485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52485"
},
{
"name": "CVE-2025-40309",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40309"
},
{
"name": "CVE-2022-49997",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49997"
},
{
"name": "CVE-2022-49469",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49469"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2026-23179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23179"
},
{
"name": "CVE-2025-68334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68334"
},
{
"name": "CVE-2025-40343",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40343"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2022-0480",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0480"
},
{
"name": "CVE-2025-68173",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68173"
},
{
"name": "CVE-2024-49932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49932"
},
{
"name": "CVE-2026-23090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23090"
},
{
"name": "CVE-2026-23035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23035"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2023-54253",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54253"
},
{
"name": "CVE-2025-38127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38127"
},
{
"name": "CVE-2025-22103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22103"
},
{
"name": "CVE-2025-1272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1272"
},
{
"name": "CVE-2025-21658",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21658"
},
{
"name": "CVE-2022-49651",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49651"
},
{
"name": "CVE-2025-68307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68307"
},
{
"name": "CVE-2025-40308",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40308"
},
{
"name": "CVE-2024-26770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26770"
},
{
"name": "CVE-2023-54324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54324"
},
{
"name": "CVE-2024-27041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27041"
},
{
"name": "CVE-2025-36184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36184"
},
{
"name": "CVE-2026-3195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3195"
},
{
"name": "CVE-2025-37743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37743"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2025-37920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37920"
},
{
"name": "CVE-2024-56326",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56326"
},
{
"name": "CVE-2023-26242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26242"
},
{
"name": "CVE-2025-58185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58185"
},
{
"name": "CVE-2025-40315",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40315"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2024-56722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56722"
},
{
"name": "CVE-2021-33113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33113"
},
{
"name": "CVE-2022-48668",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48668"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2025-68231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68231"
},
{
"name": "CVE-2021-22930",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22930"
},
{
"name": "CVE-2026-23064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23064"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2025-68806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68806"
},
{
"name": "CVE-2022-50322",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50322"
},
{
"name": "CVE-2023-50782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50782"
},
{
"name": "CVE-2022-27635",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27635"
},
{
"name": "CVE-2025-71098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71098"
},
{
"name": "CVE-2024-49922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49922"
},
{
"name": "CVE-2020-12317",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-12317"
},
{
"name": "CVE-2025-61731",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61731"
},
{
"name": "CVE-2025-40251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40251"
},
{
"name": "CVE-2024-42128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42128"
},
{
"name": "CVE-2025-71078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71078"
},
{
"name": "CVE-2024-49909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49909"
},
{
"name": "CVE-2025-40355",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40355"
},
{
"name": "CVE-2021-42771",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42771"
},
{
"name": "CVE-2021-4095",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4095"
},
{
"name": "CVE-2022-50240",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50240"
},
{
"name": "CVE-2025-40054",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40054"
},
{
"name": "CVE-2024-45015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45015"
},
{
"name": "CVE-2025-68184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68184"
},
{
"name": "CVE-2024-36357",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36357"
},
{
"name": "CVE-2025-71074",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71074"
},
{
"name": "CVE-2025-38673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38673"
},
{
"name": "CVE-2025-40107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40107"
},
{
"name": "CVE-2025-11234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11234"
},
{
"name": "CVE-2025-71083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71083"
},
{
"name": "CVE-2026-23061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23061"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2024-46754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46754"
},
{
"name": "CVE-2021-0161",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0161"
},
{
"name": "CVE-2018-1121",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1121"
},
{
"name": "CVE-2022-49547",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49547"
},
{
"name": "CVE-2025-66863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66863"
},
{
"name": "CVE-2025-0622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0622"
},
{
"name": "CVE-2023-0286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0286"
},
{
"name": "CVE-2024-26757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26757"
},
{
"name": "CVE-2024-49899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49899"
},
{
"name": "CVE-2022-49484",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49484"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-46748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46748"
},
{
"name": "CVE-2025-68813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68813"
},
{
"name": "CVE-2024-50164",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50164"
},
{
"name": "CVE-2026-27137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27137"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2024-56788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56788"
},
{
"name": "CVE-2016-8660",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-8660"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2026-23047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23047"
},
{
"name": "CVE-2025-22121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22121"
},
{
"name": "CVE-2024-1975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1975"
},
{
"name": "CVE-2025-38215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38215"
},
{
"name": "CVE-2025-7519",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7519"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2025-68365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68365"
},
{
"name": "CVE-2024-57804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57804"
},
{
"name": "CVE-2024-49908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49908"
},
{
"name": "CVE-2025-68265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68265"
},
{
"name": "CVE-2024-50048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50048"
},
{
"name": "CVE-2026-28421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28421"
},
{
"name": "CVE-2026-23119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23119"
},
{
"name": "CVE-2025-37943",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37943"
},
{
"name": "CVE-2025-21918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21918"
},
{
"name": "CVE-2025-37745",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37745"
},
{
"name": "CVE-2025-71085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71085"
},
{
"name": "CVE-2026-27171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27171"
},
{
"name": "CVE-2022-50811",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50811"
},
{
"name": "CVE-2023-4133",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4133"
},
{
"name": "CVE-2024-50183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50183"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2023-53366",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53366"
},
{
"name": "CVE-2022-49910",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49910"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2022-49203",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49203"
},
{
"name": "CVE-2024-40918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40918"
},
{
"name": "CVE-2024-27032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27032"
},
{
"name": "CVE-2022-50236",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50236"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35839"
},
{
"name": "CVE-2025-68344",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68344"
},
{
"name": "CVE-2026-23137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23137"
},
{
"name": "CVE-2025-40347",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40347"
},
{
"name": "CVE-2025-71154",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71154"
},
{
"name": "CVE-2025-37882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37882"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-46762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46762"
},
{
"name": "CVE-2023-34983",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34983"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2026-3731",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3731"
},
{
"name": "CVE-2025-40198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40198"
},
{
"name": "CVE-2024-0760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0760"
},
{
"name": "CVE-2025-39942",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39942"
},
{
"name": "CVE-2025-68310",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68310"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2025-68229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68229"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2024-42107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42107"
},
{
"name": "CVE-2025-68257",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68257"
},
{
"name": "CVE-2025-39929",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39929"
},
{
"name": "CVE-2022-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50304"
},
{
"name": "CVE-2026-23226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23226"
},
{
"name": "CVE-2020-26146",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26146"
},
{
"name": "CVE-2024-43844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43844"
},
{
"name": "CVE-2023-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52920"
},
{
"name": "CVE-2023-52590",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52590"
},
{
"name": "CVE-2025-71084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71084"
},
{
"name": "CVE-2024-22025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22025"
},
{
"name": "CVE-2026-23049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23049"
},
{
"name": "CVE-2025-68321",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68321"
},
{
"name": "CVE-2021-0072",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0072"
},
{
"name": "CVE-2025-40190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40190"
},
{
"name": "CVE-2025-69652",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69652"
},
{
"name": "CVE-2025-21635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21635"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2022-40133",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40133"
},
{
"name": "CVE-2020-26143",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26143"
},
{
"name": "CVE-2025-21712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21712"
},
{
"name": "CVE-2025-38353",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38353"
},
{
"name": "CVE-2025-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36009"
},
{
"name": "CVE-2019-0154",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-0154"
},
{
"name": "CVE-2024-57982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57982"
},
{
"name": "CVE-2023-52761",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52761"
},
{
"name": "CVE-2022-49773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49773"
},
{
"name": "CVE-2023-53609",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53609"
},
{
"name": "CVE-2023-53478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53478"
},
{
"name": "CVE-2024-42117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42117"
},
{
"name": "CVE-2025-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23160"
},
{
"name": "CVE-2023-53682",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53682"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2025-40311",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40311"
},
{
"name": "CVE-2025-54770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54770"
},
{
"name": "CVE-2026-3442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3442"
},
{
"name": "CVE-2024-58238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58238"
},
{
"name": "CVE-2024-13176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-13176"
},
{
"name": "CVE-2025-68814",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68814"
},
{
"name": "CVE-2025-22039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22039"
},
{
"name": "CVE-2025-37842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37842"
},
{
"name": "CVE-2025-39933",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39933"
},
{
"name": "CVE-2025-40237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40237"
},
{
"name": "CVE-2025-47908",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47908"
},
{
"name": "CVE-2022-49722",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49722"
},
{
"name": "CVE-2026-23745",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23745"
},
{
"name": "CVE-2025-68780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68780"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2025-39990",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39990"
},
{
"name": "CVE-2025-15467",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15467"
},
{
"name": "CVE-2025-71081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71081"
},
{
"name": "CVE-2023-53780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53780"
},
{
"name": "CVE-2020-35501",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-35501"
},
{
"name": "CVE-2024-58251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58251"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-9820",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9820"
},
{
"name": "CVE-2023-52624",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52624"
},
{
"name": "CVE-2024-56557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56557"
},
{
"name": "CVE-2022-49699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49699"
},
{
"name": "CVE-2022-50700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50700"
},
{
"name": "CVE-2023-52632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52632"
},
{
"name": "CVE-2024-46836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46836"
},
{
"name": "CVE-2026-23101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23101"
},
{
"name": "CVE-2026-23099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23099"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2025-1180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1180"
},
{
"name": "CVE-2025-38060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38060"
},
{
"name": "CVE-2022-48929",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48929"
},
{
"name": "CVE-2025-55130",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55130"
},
{
"name": "CVE-2025-36070",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36070"
},
{
"name": "CVE-2024-46820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46820"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2025-38105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38105"
},
{
"name": "CVE-2025-37744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37744"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2023-53198",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53198"
},
{
"name": "CVE-2023-53846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53846"
},
{
"name": "CVE-2025-71121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71121"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2022-1247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1247"
},
{
"name": "CVE-2025-40333",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40333"
},
{
"name": "CVE-2022-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50234"
},
{
"name": "CVE-2025-38082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38082"
},
{
"name": "CVE-2025-37884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37884"
},
{
"name": "CVE-2024-58054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58054"
},
{
"name": "CVE-2024-49934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49934"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-38022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38022"
},
{
"name": "CVE-2026-23066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23066"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2023-4969",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4969"
},
{
"name": "CVE-2024-50098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50098"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2023-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44487"
},
{
"name": "CVE-2023-53789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53789"
},
{
"name": "CVE-2022-49858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49858"
},
{
"name": "CVE-2025-39692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39692"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2023-5363",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5363"
},
{
"name": "CVE-2025-36428",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36428"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2026-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23085"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2025-40360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40360"
},
{
"name": "CVE-2026-23209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23209"
},
{
"name": "CVE-2025-71136",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71136"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2025-22105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22105"
},
{
"name": "CVE-2024-8612",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8612"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2025-40332",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40332"
},
{
"name": "CVE-2021-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46195"
},
{
"name": "CVE-2025-68354",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68354"
},
{
"name": "CVE-2025-68801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68801"
},
{
"name": "CVE-2021-33110",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33110"
},
{
"name": "CVE-2025-37834",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37834"
},
{
"name": "CVE-2025-21833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21833"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2019-19378",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-19378"
},
{
"name": "CVE-2026-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23150"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2025-61985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61985"
},
{
"name": "CVE-2025-71073",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71073"
},
{
"name": "CVE-2025-38426",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38426"
},
{
"name": "CVE-2025-38436",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38436"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2025-55131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55131"
},
{
"name": "CVE-2025-40104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40104"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2025-38097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38097"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2023-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53068"
},
{
"name": "CVE-2025-22090",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22090"
},
{
"name": "CVE-2021-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-31615"
},
{
"name": "CVE-2024-1737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1737"
},
{
"name": "CVE-2025-40097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40097"
},
{
"name": "CVE-2022-49932",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49932"
},
{
"name": "CVE-2022-25837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25837"
},
{
"name": "CVE-2025-68258",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68258"
},
{
"name": "CVE-2024-49939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49939"
},
{
"name": "CVE-2025-38239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38239"
},
{
"name": "CVE-2024-49905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49905"
},
{
"name": "CVE-2023-52831",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52831"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2024-26719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26719"
},
{
"name": "CVE-2022-44034",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-44034"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2023-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53072"
},
{
"name": "CVE-2023-2007",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2007"
},
{
"name": "CVE-2022-37341",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-37341"
},
{
"name": "CVE-2025-69648",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69648"
},
{
"name": "CVE-2023-0466",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0466"
},
{
"name": "CVE-2024-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50298"
},
{
"name": "CVE-2025-36424",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36424"
},
{
"name": "CVE-2025-21915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21915"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2024-46843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46843"
},
{
"name": "CVE-2025-21792",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21792"
},
{
"name": "CVE-2023-54016",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54016"
},
{
"name": "CVE-2025-36387",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36387"
},
{
"name": "CVE-2025-38709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38709"
},
{
"name": "CVE-2024-58018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58018"
},
{
"name": "CVE-2023-4408",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4408"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2023-53602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53602"
},
{
"name": "CVE-2023-2828",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2828"
},
{
"name": "CVE-2023-54035",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54035"
},
{
"name": "CVE-2025-40322",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40322"
},
{
"name": "CVE-2023-53867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53867"
},
{
"name": "CVE-2023-0465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0465"
},
{
"name": "CVE-2025-37926",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37926"
},
{
"name": "CVE-2024-46715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46715"
},
{
"name": "CVE-2025-38038",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38038"
},
{
"name": "CVE-2024-46802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46802"
},
{
"name": "CVE-2025-39859",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39859"
},
{
"name": "CVE-2025-40313",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40313"
},
{
"name": "CVE-2023-52582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52582"
},
{
"name": "CVE-2023-33053",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-33053"
},
{
"name": "CVE-2025-1152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1152"
},
{
"name": "CVE-2026-24051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-24051"
},
{
"name": "CVE-2025-38015",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38015"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2025-38449",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38449"
},
{
"name": "CVE-2025-21714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21714"
},
{
"name": "CVE-2025-38261",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38261"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2025-37853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37853"
},
{
"name": "CVE-2025-69644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69644"
},
{
"name": "CVE-2022-49303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49303"
},
{
"name": "CVE-2025-38126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38126"
},
{
"name": "CVE-2023-46809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46809"
},
{
"name": "CVE-2025-59465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59465"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-21972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21972"
},
{
"name": "CVE-2023-54088",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54088"
},
{
"name": "CVE-2024-42320",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42320"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-40271",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40271"
},
{
"name": "CVE-2024-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53234"
},
{
"name": "CVE-2025-11961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11961"
},
{
"name": "CVE-2025-39877",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39877"
},
{
"name": "CVE-2022-3114",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3114"
},
{
"name": "CVE-2023-52916",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52916"
},
{
"name": "CVE-2025-38064",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38064"
},
{
"name": "CVE-2026-22991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22991"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2022-50628",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50628"
},
{
"name": "CVE-2024-56718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56718"
},
{
"name": "CVE-2024-43824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43824"
},
{
"name": "CVE-2025-39886",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39886"
},
{
"name": "CVE-2022-50350",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50350"
},
{
"name": "CVE-2025-21831",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21831"
},
{
"name": "CVE-2022-50721",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50721"
},
{
"name": "CVE-2022-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50095"
},
{
"name": "CVE-2025-40073",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40073"
},
{
"name": "CVE-2024-26662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26662"
},
{
"name": "CVE-2026-3196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3196"
},
{
"name": "CVE-2025-61662",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61662"
},
{
"name": "CVE-2025-68308",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68308"
},
{
"name": "CVE-2024-50217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50217"
},
{
"name": "CVE-2021-0168",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0168"
},
{
"name": "CVE-2026-22795",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22795"
},
{
"name": "CVE-2022-50479",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50479"
},
{
"name": "CVE-2022-50583",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50583"
},
{
"name": "CVE-2025-37806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37806"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2025-68822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68822"
},
{
"name": "CVE-2025-40242",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40242"
},
{
"name": "CVE-2023-0030",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0030"
},
{
"name": "CVE-2024-42110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42110"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2025-61727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61727"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-37820",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37820"
},
{
"name": "CVE-2024-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53179"
},
{
"name": "CVE-2024-57945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57945"
},
{
"name": "CVE-2023-54233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54233"
},
{
"name": "CVE-2024-43899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43899"
},
{
"name": "CVE-2025-21986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21986"
},
{
"name": "CVE-2019-15213",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-15213"
},
{
"name": "CVE-2025-38234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38234"
},
{
"name": "CVE-2022-49935",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49935"
},
{
"name": "CVE-2021-44532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44532"
},
{
"name": "CVE-2025-38011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38011"
},
{
"name": "CVE-2022-49534",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49534"
},
{
"name": "CVE-2024-57974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57974"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2025-68190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68190"
},
{
"name": "CVE-2023-53010",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53010"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-57888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57888"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2023-54237",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54237"
},
{
"name": "CVE-2025-37878",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37878"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2026-23207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23207"
},
{
"name": "CVE-2025-40252",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40252"
},
{
"name": "CVE-2022-49134",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49134"
},
{
"name": "CVE-2025-21946",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21946"
},
{
"name": "CVE-2025-21838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21838"
},
{
"name": "CVE-2022-49333",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49333"
},
{
"name": "CVE-2023-53791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53791"
},
{
"name": "CVE-2024-49994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49994"
},
{
"name": "CVE-2025-53859",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53859"
},
{
"name": "CVE-2019-19814",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-19814"
},
{
"name": "CVE-2022-49136",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49136"
},
{
"name": "CVE-2025-68255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68255"
},
{
"name": "CVE-2025-47910",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47910"
},
{
"name": "CVE-2023-54081",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54081"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-44962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44962"
},
{
"name": "CVE-2025-68322",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68322"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2026-22980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22980"
},
{
"name": "CVE-2026-23138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23138"
},
{
"name": "CVE-2025-39927",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39927"
},
{
"name": "CVE-2023-26551",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26551"
},
{
"name": "CVE-2024-46857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46857"
},
{
"name": "CVE-2024-58013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58013"
},
{
"name": "CVE-2024-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53210"
},
{
"name": "CVE-2023-54185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54185"
},
{
"name": "CVE-2022-49342",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49342"
},
{
"name": "CVE-2015-8553",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-8553"
},
{
"name": "CVE-2025-40277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40277"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2024-36966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36966"
},
{
"name": "CVE-2023-53332",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53332"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-58095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58095"
},
{
"name": "CVE-2024-45010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45010"
},
{
"name": "CVE-2022-49471",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49471"
},
{
"name": "CVE-2025-68174",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68174"
},
{
"name": "CVE-2022-48976",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48976"
},
{
"name": "CVE-2025-21751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21751"
},
{
"name": "CVE-2023-53753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53753"
},
{
"name": "CVE-2024-41074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41074"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2025-40272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40272"
},
{
"name": "CVE-2024-50106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50106"
},
{
"name": "CVE-2025-23162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23162"
},
{
"name": "CVE-2026-23133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23133"
},
{
"name": "CVE-2025-71093",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71093"
},
{
"name": "CVE-2017-13694",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-13694"
},
{
"name": "CVE-2025-71102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71102"
},
{
"name": "CVE-2026-23212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23212"
},
{
"name": "CVE-2013-7445",
"url": "https://www.cve.org/CVERecord?id=CVE-2013-7445"
},
{
"name": "CVE-2026-23170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23170"
},
{
"name": "CVE-2023-52701",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52701"
},
{
"name": "CVE-2024-49906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49906"
},
{
"name": "CVE-2024-26647",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26647"
},
{
"name": "CVE-2025-68759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68759"
},
{
"name": "CVE-2024-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47809"
},
{
"name": "CVE-2026-23204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23204"
},
{
"name": "CVE-2022-49317",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49317"
},
{
"name": "CVE-2026-23019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23019"
},
{
"name": "CVE-2018-12928",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-12928"
},
{
"name": "CVE-2025-71188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71188"
},
{
"name": "CVE-2023-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38552"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-56607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56607"
},
{
"name": "CVE-2025-40345",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40345"
},
{
"name": "CVE-2026-27142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27142"
},
{
"name": "CVE-2024-49904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49904"
},
{
"name": "CVE-2023-53671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53671"
},
{
"name": "CVE-2025-40354",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40354"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2026-28417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28417"
},
{
"name": "CVE-2025-37931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37931"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2023-29942",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29942"
},
{
"name": "CVE-2026-23125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23125"
},
{
"name": "CVE-2026-0966",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0966"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-3238",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3238"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2026-22185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22185"
},
{
"name": "CVE-2023-53781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53781"
},
{
"name": "CVE-2023-53584",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53584"
},
{
"name": "CVE-2024-57809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57809"
},
{
"name": "CVE-2025-38057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38057"
},
{
"name": "CVE-2025-68733",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68733"
},
{
"name": "CVE-2024-56719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56719"
},
{
"name": "CVE-2022-50418",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50418"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2025-47906",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47906"
},
{
"name": "CVE-2023-53460",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53460"
},
{
"name": "CVE-2026-23214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23214"
},
{
"name": "CVE-2024-52559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52559"
},
{
"name": "CVE-2025-68188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68188"
},
{
"name": "CVE-2025-40269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40269"
},
{
"name": "CVE-2024-56671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56671"
},
{
"name": "CVE-2025-68335",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68335"
},
{
"name": "CVE-2025-71079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71079"
},
{
"name": "CVE-2025-62626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62626"
},
{
"name": "CVE-2025-39940",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39940"
},
{
"name": "CVE-2023-52751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52751"
},
{
"name": "CVE-2022-49562",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49562"
},
{
"name": "CVE-2025-37861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37861"
},
{
"name": "CVE-2023-53483",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53483"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2025-37938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37938"
},
{
"name": "CVE-2025-37746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37746"
},
{
"name": "CVE-2022-38076",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-38076"
},
{
"name": "CVE-2025-38368",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38368"
},
{
"name": "CVE-2026-23178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23178"
},
{
"name": "CVE-2025-59375",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59375"
},
{
"name": "CVE-2025-31133",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-31133"
},
{
"name": "CVE-2026-22997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22997"
},
{
"name": "CVE-2024-56368",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56368"
},
{
"name": "CVE-2025-40075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40075"
},
{
"name": "CVE-2022-49172",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49172"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2025-39977",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39977"
},
{
"name": "CVE-2025-38331",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38331"
},
{
"name": "CVE-2026-23240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23240"
},
{
"name": "CVE-2025-68330",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68330"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2024-49945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49945"
},
{
"name": "CVE-2022-44033",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-44033"
},
{
"name": "CVE-2024-56757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56757"
},
{
"name": "CVE-2023-53662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53662"
},
{
"name": "CVE-2025-38069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38069"
},
{
"name": "CVE-2022-49750",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49750"
},
{
"name": "CVE-2023-53707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53707"
},
{
"name": "CVE-2023-53115",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53115"
},
{
"name": "CVE-2025-71196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71196"
},
{
"name": "CVE-2025-21645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21645"
},
{
"name": "CVE-2023-54107",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54107"
},
{
"name": "CVE-2022-48646",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48646"
},
{
"name": "CVE-2024-43912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43912"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-58012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58012"
},
{
"name": "CVE-2025-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50181"
},
{
"name": "CVE-2025-61663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61663"
},
{
"name": "CVE-2025-68772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68772"
},
{
"name": "CVE-2024-49891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49891"
},
{
"name": "CVE-2024-36948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36948"
},
{
"name": "CVE-2022-48887",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48887"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2024-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53187"
},
{
"name": "CVE-2023-45929",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45929"
},
{
"name": "CVE-2025-68343",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68343"
},
{
"name": "CVE-2025-66382",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66382"
},
{
"name": "CVE-2024-57795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57795"
},
{
"name": "CVE-2025-37855",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37855"
},
{
"name": "CVE-2025-21816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21816"
},
{
"name": "CVE-2021-33115",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33115"
},
{
"name": "CVE-2025-21780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21780"
},
{
"name": "CVE-2020-26559",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26559"
},
{
"name": "CVE-2024-12705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12705"
},
{
"name": "CVE-2025-69421",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69421"
},
{
"name": "CVE-2020-26140",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26140"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2026-23191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23191"
},
{
"name": "CVE-2026-32249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-32249"
},
{
"name": "CVE-2025-37899",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37899"
},
{
"name": "CVE-2026-23078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23078"
},
{
"name": "CVE-2025-40362",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40362"
},
{
"name": "CVE-2025-68201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68201"
},
{
"name": "CVE-2024-43831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43831"
},
{
"name": "CVE-2023-30630",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-30630"
},
{
"name": "CVE-2025-40289",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40289"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2025-38330",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38330"
},
{
"name": "CVE-2025-58188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58188"
},
{
"name": "CVE-2017-13693",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-13693"
},
{
"name": "CVE-2025-68768",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68768"
},
{
"name": "CVE-2024-50284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50284"
},
{
"name": "CVE-2022-49306",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49306"
},
{
"name": "CVE-2024-49898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49898"
},
{
"name": "CVE-2025-36423",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36423"
},
{
"name": "CVE-2022-49622",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49622"
},
{
"name": "CVE-2025-68785",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68785"
},
{
"name": "CVE-2024-50211",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50211"
},
{
"name": "CVE-2025-38507",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38507"
},
{
"name": "CVE-2022-50284",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50284"
},
{
"name": "CVE-2025-39989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39989"
},
{
"name": "CVE-2023-6240",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6240"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-22028",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22028"
},
{
"name": "CVE-2024-41008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41008"
},
{
"name": "CVE-2024-27035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27035"
},
{
"name": "CVE-2023-53218",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53218"
},
{
"name": "CVE-2022-25836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25836"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2025-68808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68808"
},
{
"name": "CVE-2025-4674",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4674"
},
{
"name": "CVE-2025-29934",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29934"
},
{
"name": "CVE-2024-27005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27005"
},
{
"name": "CVE-2025-68223",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68223"
},
{
"name": "CVE-2022-49133",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49133"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2025-68783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68783"
},
{
"name": "CVE-2025-71147",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71147"
},
{
"name": "CVE-2025-38438",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38438"
},
{
"name": "CVE-2025-40032",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40032"
},
{
"name": "CVE-2023-26555",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26555"
},
{
"name": "CVE-2023-1193",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1193"
},
{
"name": "CVE-2025-71220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71220"
},
{
"name": "CVE-2024-46806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46806"
},
{
"name": "CVE-2022-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50073"
},
{
"name": "CVE-2025-68724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68724"
},
{
"name": "CVE-2025-5278",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5278"
},
{
"name": "CVE-2026-23103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23103"
},
{
"name": "CVE-2026-23074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23074"
},
{
"name": "CVE-2025-68786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68786"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2022-50393",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50393"
},
{
"name": "CVE-2025-68779",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68779"
},
{
"name": "CVE-2024-56433",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56433"
},
{
"name": "CVE-2025-21819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21819"
},
{
"name": "CVE-2025-48514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48514"
},
{
"name": "CVE-2024-41030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41030"
},
{
"name": "CVE-2025-71199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71199"
},
{
"name": "CVE-2024-47664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47664"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2026-25749",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25749"
},
{
"name": "CVE-2024-49504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49504"
},
{
"name": "CVE-2025-38118",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38118"
},
{
"name": "CVE-2023-0464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0464"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2022-50500",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50500"
},
{
"name": "CVE-2019-14899",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-14899"
},
{
"name": "CVE-2022-29526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29526"
},
{
"name": "CVE-2024-53098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53098"
},
{
"name": "CVE-2025-68797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68797"
},
{
"name": "CVE-2024-49968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49968"
},
{
"name": "CVE-2025-68358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68358"
},
{
"name": "CVE-2025-40206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40206"
},
{
"name": "CVE-2026-23180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23180"
},
{
"name": "CVE-2021-0164",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0164"
},
{
"name": "CVE-2024-46870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46870"
},
{
"name": "CVE-2022-49178",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49178"
},
{
"name": "CVE-2024-22195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22195"
},
{
"name": "CVE-2023-23931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23931"
},
{
"name": "CVE-2024-49929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49929"
},
{
"name": "CVE-2025-40257",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40257"
},
{
"name": "CVE-2023-53748",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53748"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2022-49173",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49173"
},
{
"name": "CVE-2024-45781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45781"
},
{
"name": "CVE-2025-71125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71125"
},
{
"name": "CVE-2025-21947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21947"
},
{
"name": "CVE-2024-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53056"
},
{
"name": "CVE-2022-50551",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50551"
},
{
"name": "CVE-2026-26269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26269"
},
{
"name": "CVE-2024-43872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43872"
},
{
"name": "CVE-2025-71108",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71108"
},
{
"name": "CVE-2022-49401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49401"
},
{
"name": "CVE-2025-71069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71069"
},
{
"name": "CVE-2025-68312",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68312"
},
{
"name": "CVE-2025-68284",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68284"
},
{
"name": "CVE-2025-68194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68194"
},
{
"name": "CVE-2023-52939",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52939"
},
{
"name": "CVE-2024-14027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-14027"
},
{
"name": "CVE-2025-38269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38269"
},
{
"name": "CVE-2025-69649",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69649"
},
{
"name": "CVE-2024-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53175"
},
{
"name": "CVE-2025-21734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21734"
},
{
"name": "CVE-2024-49859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49859"
},
{
"name": "CVE-2025-40336",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40336"
},
{
"name": "CVE-2025-37945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37945"
},
{
"name": "CVE-2025-71195",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71195"
},
{
"name": "CVE-2022-49766",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49766"
},
{
"name": "CVE-2025-6141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6141"
},
{
"name": "CVE-2025-22043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22043"
},
{
"name": "CVE-2024-49569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49569"
},
{
"name": "CVE-2025-61984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61984"
},
{
"name": "CVE-2023-52569",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52569"
},
{
"name": "CVE-2024-56609",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56609"
},
{
"name": "CVE-2022-49940",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49940"
},
{
"name": "CVE-2026-23083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23083"
},
{
"name": "CVE-2025-38422",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38422"
},
{
"name": "CVE-2024-56611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56611"
},
{
"name": "CVE-2025-21927",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21927"
},
{
"name": "CVE-2026-23088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23088"
},
{
"name": "CVE-2020-25743",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-25743"
},
{
"name": "CVE-2022-50167",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50167"
},
{
"name": "CVE-2025-68183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68183"
},
{
"name": "CVE-2026-27704",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27704"
},
{
"name": "CVE-2022-48064",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48064"
},
{
"name": "CVE-2023-45896",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45896"
},
{
"name": "CVE-2025-37903",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37903"
},
{
"name": "CVE-2025-68774",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68774"
},
{
"name": "CVE-2024-49940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49940"
},
{
"name": "CVE-2025-40263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40263"
},
{
"name": "CVE-2021-3735",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3735"
},
{
"name": "CVE-2025-40353",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40353"
},
{
"name": "CVE-2024-46861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46861"
},
{
"name": "CVE-2025-40222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40222"
},
{
"name": "CVE-2022-50634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50634"
},
{
"name": "CVE-2025-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52881"
},
{
"name": "CVE-2025-54514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54514"
},
{
"name": "CVE-2025-71202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71202"
},
{
"name": "CVE-2015-7837",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-7837"
},
{
"name": "CVE-2025-0677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0677"
},
{
"name": "CVE-2024-45780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45780"
},
{
"name": "CVE-2024-46749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46749"
},
{
"name": "CVE-2022-50492",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50492"
},
{
"name": "CVE-2024-49888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49888"
},
{
"name": "CVE-2022-50406",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50406"
},
{
"name": "CVE-2023-26552",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26552"
},
{
"name": "CVE-2024-49921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49921"
},
{
"name": "CVE-2024-5535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5535"
},
{
"name": "CVE-2026-23108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23108"
},
{
"name": "CVE-2025-71180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71180"
},
{
"name": "CVE-2025-38232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38232"
},
{
"name": "CVE-2025-68244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68244"
},
{
"name": "CVE-2025-59691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59691"
},
{
"name": "CVE-2024-46830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46830"
},
{
"name": "CVE-2023-52481",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52481"
},
{
"name": "CVE-2023-52888",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52888"
},
{
"name": "CVE-2025-22057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22057"
},
{
"name": "CVE-2024-47666",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47666"
},
{
"name": "CVE-2025-22868",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22868"
},
{
"name": "CVE-2025-40278",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40278"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2024-50056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50056"
},
{
"name": "CVE-2025-71194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71194"
},
{
"name": "CVE-2026-1788",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1788"
},
{
"name": "CVE-2023-53721",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53721"
},
{
"name": "CVE-2025-22113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22113"
},
{
"name": "CVE-2025-40342",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40342"
},
{
"name": "CVE-2022-50256",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50256"
},
{
"name": "CVE-2024-42091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42091"
},
{
"name": "CVE-2024-27983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27983"
},
{
"name": "CVE-2025-37907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37907"
},
{
"name": "CVE-2024-38625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38625"
},
{
"name": "CVE-2025-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23085"
},
{
"name": "CVE-2026-22796",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22796"
},
{
"name": "CVE-2023-4010",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4010"
},
{
"name": "CVE-2025-38425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38425"
},
{
"name": "CVE-2024-46727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46727"
},
{
"name": "CVE-2023-54028",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54028"
},
{
"name": "CVE-2024-42129",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42129"
},
{
"name": "CVE-2023-54105",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54105"
},
{
"name": "CVE-2018-17977",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-17977"
},
{
"name": "CVE-2019-1010204",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-1010204"
},
{
"name": "CVE-2023-53992",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53992"
},
{
"name": "CVE-2026-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26960"
},
{
"name": "CVE-2025-40210",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40210"
},
{
"name": "CVE-2022-50354",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50354"
},
{
"name": "CVE-2025-61724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61724"
},
{
"name": "CVE-2026-22999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22999"
},
{
"name": "CVE-2025-21812",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21812"
},
{
"name": "CVE-2025-71082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71082"
},
{
"name": "CVE-2025-12801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12801"
},
{
"name": "CVE-2024-58015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58015"
},
{
"name": "CVE-2026-23068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23068"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2025-68765",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68765"
},
{
"name": "CVE-2026-23089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23089"
},
{
"name": "CVE-2024-43823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43823"
},
{
"name": "CVE-2023-52589",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52589"
},
{
"name": "CVE-2022-41848",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-41848"
},
{
"name": "CVE-2026-23216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23216"
},
{
"name": "CVE-2023-53434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53434"
},
{
"name": "CVE-2023-29935",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29935"
},
{
"name": "CVE-2023-35061",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-35061"
},
{
"name": "CVE-2025-71132",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71132"
},
{
"name": "CVE-2025-71225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71225"
},
{
"name": "CVE-2026-21636",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21636"
},
{
"name": "CVE-2026-23239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23239"
},
{
"name": "CVE-2021-0172",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0172"
},
{
"name": "CVE-2024-47662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47662"
},
{
"name": "CVE-2018-12930",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-12930"
},
{
"name": "CVE-2026-23071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23071"
},
{
"name": "CVE-2024-49970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49970"
},
{
"name": "CVE-2024-41067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41067"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2026-23056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23056"
},
{
"name": "CVE-2025-40193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40193"
},
{
"name": "CVE-2023-32644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32644"
},
{
"name": "CVE-2025-71077",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71077"
},
{
"name": "CVE-2025-21908",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21908"
},
{
"name": "CVE-2024-46681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46681"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2025-61732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61732"
},
{
"name": "CVE-2025-61723",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61723"
},
{
"name": "CVE-2025-9232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9232"
},
{
"name": "CVE-2025-40012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40012"
},
{
"name": "CVE-2025-40279",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40279"
},
{
"name": "CVE-2026-0964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0964"
},
{
"name": "CVE-2025-68328",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68328"
},
{
"name": "CVE-2023-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53178"
},
{
"name": "CVE-2024-47141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47141"
},
{
"name": "CVE-2024-8354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8354"
},
{
"name": "CVE-2023-54323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54323"
},
{
"name": "CVE-2025-37952",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37952"
},
{
"name": "CVE-2023-45803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45803"
},
{
"name": "CVE-2025-0689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0689"
},
{
"name": "CVE-2022-50316",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50316"
},
{
"name": "CVE-2023-31347",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31347"
},
{
"name": "CVE-2025-40084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40084"
},
{
"name": "CVE-2025-22111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22111"
},
{
"name": "CVE-2023-53657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53657"
},
{
"name": "CVE-2024-49915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49915"
},
{
"name": "CVE-2026-23063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23063"
},
{
"name": "CVE-2025-55132",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55132"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2022-49759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49759"
},
{
"name": "CVE-2026-23073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23073"
},
{
"name": "CVE-2022-49167",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49167"
},
{
"name": "CVE-2025-68311",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68311"
},
{
"name": "CVE-2026-27903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27903"
},
{
"name": "CVE-2023-54023",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54023"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2023-31082",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31082"
},
{
"name": "CVE-2024-41088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41088"
},
{
"name": "CVE-2025-0690",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0690"
},
{
"name": "CVE-2025-71114",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71114"
},
{
"name": "CVE-2023-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53052"
},
{
"name": "CVE-2026-23058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23058"
},
{
"name": "CVE-2022-49234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49234"
},
{
"name": "CVE-2022-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50163"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2025-71067",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71067"
},
{
"name": "CVE-2024-49919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49919"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2025-71182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71182"
},
{
"name": "CVE-2020-26556",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26556"
},
{
"name": "CVE-2025-46394",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-46394"
},
{
"name": "CVE-2025-66471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66471"
},
{
"name": "CVE-2026-23038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23038"
},
{
"name": "CVE-2025-40341",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40341"
},
{
"name": "CVE-2025-38409",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38409"
},
{
"name": "CVE-2021-3826",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3826"
},
{
"name": "CVE-2024-26699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26699"
},
{
"name": "CVE-2024-57876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57876"
},
{
"name": "CVE-2024-58019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58019"
},
{
"name": "CVE-2026-25679",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25679"
},
{
"name": "CVE-2026-22990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22990"
},
{
"name": "CVE-2025-14017",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14017"
},
{
"name": "CVE-2022-50390",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50390"
},
{
"name": "CVE-2026-23000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23000"
},
{
"name": "CVE-2026-21441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21441"
},
{
"name": "CVE-2024-45337",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45337"
},
{
"name": "CVE-2025-71186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71186"
},
{
"name": "CVE-2024-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53220"
},
{
"name": "CVE-2026-23176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23176"
},
{
"name": "CVE-2023-53539",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53539"
},
{
"name": "CVE-2025-40338",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40338"
},
{
"name": "CVE-2025-68821",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68821"
},
{
"name": "CVE-2025-31648",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-31648"
},
{
"name": "CVE-2026-1229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1229"
},
{
"name": "CVE-2025-0678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0678"
},
{
"name": "CVE-2024-41075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41075"
},
{
"name": "CVE-2026-23026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23026"
},
{
"name": "CVE-2024-56674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56674"
},
{
"name": "CVE-2024-27982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27982"
},
{
"name": "CVE-2025-40195",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40195"
},
{
"name": "CVE-2024-31884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31884"
},
{
"name": "CVE-2025-21976",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21976"
},
{
"name": "CVE-2019-1563",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-1563"
},
{
"name": "CVE-2026-23128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23128"
},
{
"name": "CVE-2024-57975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57975"
},
{
"name": "CVE-2023-53574",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53574"
},
{
"name": "CVE-2022-50166",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50166"
},
{
"name": "CVE-2025-61725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61725"
},
{
"name": "CVE-2025-68325",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68325"
},
{
"name": "CVE-2025-71190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71190"
},
{
"name": "CVE-2024-56738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56738"
},
{
"name": "CVE-2022-50778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50778"
},
{
"name": "CVE-2024-42067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42067"
},
{
"name": "CVE-2022-49971",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49971"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2025-21693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21693"
},
{
"name": "CVE-2025-71203",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71203"
},
{
"name": "CVE-2024-56657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56657"
},
{
"name": "CVE-2025-39789",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39789"
},
{
"name": "CVE-2022-49124",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49124"
},
{
"name": "CVE-2024-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49901"
},
{
"name": "CVE-2023-52700",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52700"
},
{
"name": "CVE-2024-56583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56583"
},
{
"name": "CVE-2022-50195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50195"
},
{
"name": "CVE-2025-40358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40358"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-56712",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56712"
},
{
"name": "CVE-2025-68318",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68318"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2023-52634",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52634"
},
{
"name": "CVE-2025-22104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22104"
},
{
"name": "CVE-2022-2795",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2795"
},
{
"name": "CVE-2025-62526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62526"
},
{
"name": "CVE-2024-49918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49918"
},
{
"name": "CVE-2025-68296",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68296"
},
{
"name": "CVE-2023-53785",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53785"
},
{
"name": "CVE-2025-55163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55163"
},
{
"name": "CVE-2024-45776",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45776"
},
{
"name": "CVE-2022-50090",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50090"
},
{
"name": "CVE-2025-40340",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40340"
},
{
"name": "CVE-2025-68332",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68332"
},
{
"name": "CVE-2020-14356",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14356"
},
{
"name": "CVE-2025-68745",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68745"
},
{
"name": "CVE-2023-54263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54263"
},
{
"name": "CVE-2025-71104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71104"
},
{
"name": "CVE-2026-22978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22978"
},
{
"name": "CVE-2023-53764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53764"
},
{
"name": "CVE-2024-53687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53687"
},
{
"name": "CVE-2025-39901",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39901"
},
{
"name": "CVE-2025-40283",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40283"
},
{
"name": "CVE-2025-5918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5918"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2025-40324",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40324"
},
{
"name": "CVE-2025-38672",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38672"
},
{
"name": "CVE-2023-54181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54181"
},
{
"name": "CVE-2025-0684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0684"
},
{
"name": "CVE-2025-10158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10158"
},
{
"name": "CVE-2025-68378",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68378"
},
{
"name": "CVE-2024-47794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47794"
},
{
"name": "CVE-2026-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23146"
},
{
"name": "CVE-2025-38272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38272"
},
{
"name": "CVE-2024-10524",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-10524"
},
{
"name": "CVE-2025-40146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40146"
},
{
"name": "CVE-2025-38359",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38359"
},
{
"name": "CVE-2019-20794",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20794"
},
{
"name": "CVE-2023-53849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53849"
},
{
"name": "CVE-2022-4543",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4543"
},
{
"name": "CVE-2025-21899",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21899"
},
{
"name": "CVE-2024-35195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35195"
},
{
"name": "CVE-2025-38129",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38129"
},
{
"name": "CVE-2026-23037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23037"
},
{
"name": "CVE-2023-53627",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53627"
},
{
"name": "CVE-2025-40250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40250"
},
{
"name": "CVE-2025-38091",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38091"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2025-40264",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40264"
},
{
"name": "CVE-2025-38334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38334"
},
{
"name": "CVE-2023-53575",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53575"
},
{
"name": "CVE-2022-49516",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49516"
},
{
"name": "CVE-2025-40778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40778"
},
{
"name": "CVE-2025-38728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38728"
},
{
"name": "CVE-2022-3523",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3523"
},
{
"name": "CVE-2026-26157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26157"
},
{
"name": "CVE-2026-23001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23001"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2025-68367",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68367"
},
{
"name": "CVE-2025-71224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71224"
},
{
"name": "CVE-2025-22072",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22072"
},
{
"name": "CVE-2025-68820",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68820"
},
{
"name": "CVE-2021-45261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-45261"
},
{
"name": "CVE-2025-40074",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40074"
},
{
"name": "CVE-2026-23193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23193"
},
{
"name": "CVE-2025-40321",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40321"
},
{
"name": "CVE-2024-47736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47736"
},
{
"name": "CVE-2023-53037",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53037"
},
{
"name": "CVE-2024-46842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46842"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2025-13462",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13462"
},
{
"name": "CVE-2024-50112",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50112"
},
{
"name": "CVE-2025-69646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69646"
},
{
"name": "CVE-2023-54207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54207"
},
{
"name": "CVE-2026-23215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23215"
},
{
"name": "CVE-2024-28956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28956"
},
{
"name": "CVE-2025-68740",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68740"
},
{
"name": "CVE-2020-26142",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26142"
},
{
"name": "CVE-2022-49955",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49955"
},
{
"name": "CVE-2023-53628",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53628"
},
{
"name": "CVE-2025-29943",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29943"
},
{
"name": "CVE-2025-39978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39978"
},
{
"name": "CVE-2023-31346",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31346"
},
{
"name": "CVE-2024-9143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9143"
},
{
"name": "CVE-2025-40158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40158"
},
{
"name": "CVE-2024-56201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56201"
},
{
"name": "CVE-2025-38071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38071"
},
{
"name": "CVE-2025-38140",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38140"
},
{
"name": "CVE-2022-50002",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50002"
},
{
"name": "CVE-2025-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38621"
},
{
"name": "CVE-2025-68742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68742"
},
{
"name": "CVE-2025-39908",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39908"
},
{
"name": "CVE-2026-24842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-24842"
},
{
"name": "CVE-2024-49920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49920"
},
{
"name": "CVE-2025-40282",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40282"
},
{
"name": "CVE-2026-23118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23118"
},
{
"name": "CVE-2025-34034",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-34034"
},
{
"name": "CVE-2025-37984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37984"
},
{
"name": "CVE-2025-59692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59692"
},
{
"name": "CVE-2022-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50116"
},
{
"name": "CVE-2018-12931",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-12931"
},
{
"name": "CVE-2025-40168",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40168"
},
{
"name": "CVE-2025-37856",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37856"
},
{
"name": "CVE-2022-50224",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50224"
},
{
"name": "CVE-2025-22874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22874"
},
{
"name": "CVE-2020-13791",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-13791"
},
{
"name": "CVE-2026-23950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23950"
},
{
"name": "CVE-2024-49990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49990"
},
{
"name": "CVE-2020-15802",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-15802"
},
{
"name": "CVE-2020-24240",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-24240"
},
{
"name": "CVE-2024-46718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46718"
},
{
"name": "CVE-2025-68816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68816"
},
{
"name": "CVE-2024-41045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41045"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2022-50552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50552"
},
{
"name": "CVE-2021-0066",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0066"
},
{
"name": "CVE-2025-38333",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38333"
},
{
"name": "CVE-2023-53376",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53376"
},
{
"name": "CVE-2023-53538",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53538"
},
{
"name": "CVE-2025-68192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68192"
},
{
"name": "CVE-2024-5569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5569"
},
{
"name": "CVE-2025-68379",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68379"
},
{
"name": "CVE-2022-50357",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50357"
},
{
"name": "CVE-2024-57952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57952"
},
{
"name": "CVE-2025-68256",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68256"
},
{
"name": "CVE-2025-68777",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68777"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2022-50303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50303"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2025-68254",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68254"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2025-38059",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38059"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53176"
},
{
"name": "CVE-2025-37956",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37956"
},
{
"name": "CVE-2025-40196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40196"
},
{
"name": "CVE-2024-49880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49880"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2025-38117",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38117"
},
{
"name": "CVE-2017-13165",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-13165"
},
{
"name": "CVE-2025-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38556"
},
{
"name": "CVE-2025-68171",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68171"
},
{
"name": "CVE-2025-39932",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39932"
},
{
"name": "CVE-2024-47683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47683"
},
{
"name": "CVE-2023-6237",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6237"
},
{
"name": "CVE-2024-46811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46811"
},
{
"name": "CVE-2025-21985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21985"
},
{
"name": "CVE-2025-22109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22109"
},
{
"name": "CVE-2025-38300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38300"
},
{
"name": "CVE-2025-40040",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40040"
},
{
"name": "CVE-2023-53635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53635"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2026-22982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22982"
},
{
"name": "CVE-2025-23132",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23132"
},
{
"name": "CVE-2024-47678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47678"
},
{
"name": "CVE-2022-49531",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49531"
},
{
"name": "CVE-2022-49504",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49504"
},
{
"name": "CVE-2025-1376",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1376"
},
{
"name": "CVE-2022-49810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49810"
},
{
"name": "CVE-2025-47912",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47912"
},
{
"name": "CVE-2025-71109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71109"
},
{
"name": "CVE-2023-26586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26586"
},
{
"name": "CVE-2025-38373",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38373"
},
{
"name": "CVE-2025-66861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66861"
},
{
"name": "CVE-2025-40095",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40095"
},
{
"name": "CVE-2025-37957",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37957"
},
{
"name": "CVE-2025-38369",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38369"
},
{
"name": "CVE-2023-43804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-43804"
},
{
"name": "CVE-2024-44950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44950"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2022-50332",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50332"
},
{
"name": "CVE-2023-53822",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53822"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2025-71222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71222"
},
{
"name": "CVE-2022-50461",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50461"
},
{
"name": "CVE-2025-21801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21801"
},
{
"name": "CVE-2023-26554",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26554"
},
{
"name": "CVE-2025-38486",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38486"
},
{
"name": "CVE-2021-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-26934"
},
{
"name": "CVE-2023-53466",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53466"
},
{
"name": "CVE-2025-21629",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21629"
},
{
"name": "CVE-2025-71118",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71118"
},
{
"name": "CVE-2023-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53168"
},
{
"name": "CVE-2022-49528",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49528"
},
{
"name": "CVE-2025-68160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68160"
},
{
"name": "CVE-2022-45888",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45888"
},
{
"name": "CVE-2022-49218",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49218"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2025-39754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39754"
},
{
"name": "CVE-2025-40286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40286"
},
{
"name": "CVE-2022-49967",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49967"
},
{
"name": "CVE-2025-68327",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68327"
},
{
"name": "CVE-2024-2236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2236"
},
{
"name": "CVE-2022-49245",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49245"
},
{
"name": "CVE-2025-38098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38098"
},
{
"name": "CVE-2023-52682",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52682"
},
{
"name": "CVE-2022-50871",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50871"
},
{
"name": "CVE-2025-71150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71150"
},
{
"name": "CVE-2025-71229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71229"
},
{
"name": "CVE-2026-23213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23213"
},
{
"name": "CVE-2025-39958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39958"
},
{
"name": "CVE-2018-8956",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8956"
},
{
"name": "CVE-2025-40266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40266"
},
{
"name": "CVE-2026-23091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23091"
},
{
"name": "CVE-2025-68241",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68241"
},
{
"name": "CVE-2022-49420",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49420"
},
{
"name": "CVE-2022-40964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40964"
},
{
"name": "CVE-2026-3441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3441"
},
{
"name": "CVE-2024-36244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36244"
},
{
"name": "CVE-2023-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53149"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2024-49987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49987"
},
{
"name": "CVE-2025-60753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-60753"
},
{
"name": "CVE-2022-50746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50746"
},
{
"name": "CVE-2025-52565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52565"
},
{
"name": "CVE-2024-50034",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50034"
},
{
"name": "CVE-2025-38259",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38259"
},
{
"name": "CVE-2025-71192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71192"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2022-49943",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49943"
},
{
"name": "CVE-2022-50260",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50260"
},
{
"name": "CVE-2025-40135",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40135"
},
{
"name": "CVE-2026-23121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23121"
},
{
"name": "CVE-2020-12319",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-12319"
},
{
"name": "CVE-2025-37951",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37951"
},
{
"name": "CVE-2023-50495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50495"
},
{
"name": "CVE-2024-49568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49568"
},
{
"name": "CVE-2025-21750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21750"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2017-11164",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-11164"
},
{
"name": "CVE-2023-3397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3397"
},
{
"name": "CVE-2025-68734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68734"
},
{
"name": "CVE-2024-26672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26672"
},
{
"name": "CVE-2024-57924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57924"
},
{
"name": "CVE-2025-37947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37947"
},
{
"name": "CVE-2025-68776",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68776"
},
{
"name": "CVE-2025-61728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61728"
},
{
"name": "CVE-2025-71066",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71066"
},
{
"name": "CVE-2026-0965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0965"
},
{
"name": "CVE-2023-53806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53806"
},
{
"name": "CVE-2025-21817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21817"
},
{
"name": "CVE-2025-68972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68972"
},
{
"name": "CVE-2025-68799",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68799"
},
{
"name": "CVE-2021-33139",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33139"
},
{
"name": "CVE-2025-58186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58186"
},
{
"name": "CVE-2025-21825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21825"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2025-68345",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68345"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2024-50057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50057"
},
{
"name": "CVE-2025-38343",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38343"
},
{
"name": "CVE-2025-71097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71097"
},
{
"name": "CVE-2024-46808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46808"
},
{
"name": "CVE-2026-26158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26158"
},
{
"name": "CVE-2025-38202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38202"
},
{
"name": "CVE-2025-68288",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68288"
},
{
"name": "CVE-2025-38168",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38168"
},
{
"name": "CVE-2023-53547",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53547"
},
{
"name": "CVE-2019-20426",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20426"
},
{
"name": "CVE-2025-71107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71107"
},
{
"name": "CVE-2024-0727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0727"
},
{
"name": "CVE-2025-40310",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40310"
},
{
"name": "CVE-2026-29786",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-29786"
},
{
"name": "CVE-2025-58187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58187"
},
{
"name": "CVE-2025-40083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40083"
},
{
"name": "CVE-2023-6129",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6129"
},
{
"name": "CVE-2024-56584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56584"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2025-71111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71111"
},
{
"name": "CVE-2022-4899",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4899"
},
{
"name": "CVE-2025-71152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71152"
},
{
"name": "CVE-2024-42139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42139"
},
{
"name": "CVE-2024-56692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56692"
},
{
"name": "CVE-2024-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53196"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2022-50212",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50212"
},
{
"name": "CVE-2026-23087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23087"
},
{
"name": "CVE-2023-54259",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54259"
},
{
"name": "CVE-2025-68802",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68802"
},
{
"name": "CVE-2023-54067",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54067"
},
{
"name": "CVE-2025-1369",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1369"
},
{
"name": "CVE-2022-3219",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3219"
},
{
"name": "CVE-2025-68317",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68317"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2025-71185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71185"
},
{
"name": "CVE-2022-2961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2961"
},
{
"name": "CVE-2025-40331",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40331"
},
{
"name": "CVE-2025-4673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4673"
},
{
"name": "CVE-2022-49635",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49635"
},
{
"name": "CVE-2024-50017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50017"
},
{
"name": "CVE-2026-23096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23096"
},
{
"name": "CVE-2024-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53241"
},
{
"name": "CVE-2025-38704",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38704"
},
{
"name": "CVE-2023-34969",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34969"
},
{
"name": "CVE-2021-33155",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33155"
},
{
"name": "CVE-2025-68337",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68337"
},
{
"name": "CVE-2024-57899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57899"
},
{
"name": "CVE-2024-49928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49928"
},
{
"name": "CVE-2025-21885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21885"
},
{
"name": "CVE-2024-50187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50187"
},
{
"name": "CVE-2022-50851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50851"
},
{
"name": "CVE-2025-36001",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36001"
},
{
"name": "CVE-2022-50464",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50464"
},
{
"name": "CVE-2025-38674",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38674"
},
{
"name": "CVE-2025-40093",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40093"
},
{
"name": "CVE-2020-26560",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26560"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-45777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45777"
},
{
"name": "CVE-2025-38040",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38040"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2022-49965",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49965"
},
{
"name": "CVE-2025-54771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54771"
},
{
"name": "CVE-2024-0564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0564"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2025-71131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71131"
},
{
"name": "CVE-2022-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49961"
},
{
"name": "CVE-2025-69651",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69651"
},
{
"name": "CVE-2025-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38552"
},
{
"name": "CVE-2025-40335",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40335"
},
{
"name": "CVE-2025-40149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40149"
},
{
"name": "CVE-2024-58098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58098"
},
{
"name": "CVE-2025-22871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22871"
},
{
"name": "CVE-2022-28667",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28667"
},
{
"name": "CVE-2023-53383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53383"
},
{
"name": "CVE-2024-46717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46717"
},
{
"name": "CVE-2024-25743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25743"
},
{
"name": "CVE-2022-50704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50704"
},
{
"name": "CVE-2025-40164",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40164"
},
{
"name": "CVE-2023-54125",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54125"
},
{
"name": "CVE-2025-10911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10911"
},
{
"name": "CVE-2026-23164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23164"
},
{
"name": "CVE-2024-41036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41036"
},
{
"name": "CVE-2023-53751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53751"
},
{
"name": "CVE-2025-0033",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0033"
},
{
"name": "CVE-2023-53743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53743"
},
{
"name": "CVE-2024-42319",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42319"
},
{
"name": "CVE-2025-37928",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37928"
},
{
"name": "CVE-2017-13716",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-13716"
},
{
"name": "CVE-2024-22018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22018"
},
{
"name": "CVE-2025-71116",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71116"
},
{
"name": "CVE-2022-40735",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40735"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2025-21723",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21723"
},
{
"name": "CVE-2023-54190",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54190"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2025-68281",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68281"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2025-38440",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38440"
},
{
"name": "CVE-2026-23124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23124"
},
{
"name": "CVE-2023-52981",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52981"
},
{
"name": "CVE-2024-53224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53224"
},
{
"name": "CVE-2024-49910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49910"
},
{
"name": "CVE-2025-68362",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68362"
},
{
"name": "CVE-2023-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53105"
},
{
"name": "CVE-2025-68236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68236"
},
{
"name": "CVE-2024-39286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39286"
},
{
"name": "CVE-2025-14524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14524"
},
{
"name": "CVE-2024-49855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49855"
},
{
"name": "CVE-2024-47081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47081"
},
{
"name": "CVE-2025-68333",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68333"
},
{
"name": "CVE-2024-47689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47689"
},
{
"name": "CVE-2025-71160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71160"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2023-52625",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52625"
},
{
"name": "CVE-2023-53353",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53353"
},
{
"name": "CVE-2024-58096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58096"
},
{
"name": "CVE-2025-38225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38225"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2025-22037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22037"
},
{
"name": "CVE-2023-53702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53702"
},
{
"name": "CVE-2025-68290",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68290"
},
{
"name": "CVE-2025-40280",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40280"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2025-40099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40099"
},
{
"name": "CVE-2023-54059",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54059"
},
{
"name": "CVE-2025-71162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71162"
},
{
"name": "CVE-2021-0170",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0170"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-53133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53133"
},
{
"name": "CVE-2026-23075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23075"
},
{
"name": "CVE-2022-50571",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50571"
},
{
"name": "CVE-2021-31879",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-31879"
},
{
"name": "CVE-2026-23120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23120"
},
{
"name": "CVE-2025-40180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40180"
},
{
"name": "CVE-2022-49393",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49393"
},
{
"name": "CVE-2024-6119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6119"
},
{
"name": "CVE-2025-68803",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68803"
},
{
"name": "CVE-2026-22996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22996"
},
{
"name": "CVE-2024-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53091"
},
{
"name": "CVE-2025-39851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39851"
},
{
"name": "CVE-2025-71204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71204"
},
{
"name": "CVE-2025-68331",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68331"
},
{
"name": "CVE-2025-38244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38244"
},
{
"name": "CVE-2022-29217",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29217"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2025-38080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38080"
},
{
"name": "CVE-2023-32651",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32651"
},
{
"name": "CVE-2025-37747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37747"
},
{
"name": "CVE-2026-2297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2297"
},
{
"name": "CVE-2026-23105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23105"
},
{
"name": "CVE-2023-53036",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53036"
},
{
"name": "CVE-2025-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38615"
},
{
"name": "CVE-2025-58181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58181"
},
{
"name": "CVE-2025-71115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71115"
},
{
"name": "CVE-2026-22976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22976"
},
{
"name": "CVE-2022-50862",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50862"
},
{
"name": "CVE-2025-1118",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1118"
},
{
"name": "CVE-2024-50166",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50166"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2023-53355",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53355"
},
{
"name": "CVE-2022-25265",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25265"
},
{
"name": "CVE-2026-0967",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0967"
},
{
"name": "CVE-2026-23181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23181"
},
{
"name": "CVE-2025-37944",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37944"
},
{
"name": "CVE-2023-53558",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53558"
},
{
"name": "CVE-2025-47914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47914"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2026-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23141"
},
{
"name": "CVE-2026-22860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22860"
},
{
"name": "CVE-2025-36365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36365"
},
{
"name": "CVE-2025-9403",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9403"
},
{
"name": "CVE-2025-40247",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40247"
},
{
"name": "CVE-2023-1255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1255"
},
{
"name": "CVE-2024-56641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56641"
},
{
"name": "CVE-2024-43842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43842"
},
{
"name": "CVE-2025-0686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0686"
},
{
"name": "CVE-2025-21739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21739"
},
{
"name": "CVE-2024-49992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49992"
},
{
"name": "CVE-2025-68781",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68781"
},
{
"name": "CVE-2025-39753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39753"
},
{
"name": "CVE-2025-69418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69418"
},
{
"name": "CVE-2026-23182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23182"
},
{
"name": "CVE-2021-0173",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0173"
},
{
"name": "CVE-2025-71112",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71112"
},
{
"name": "CVE-2023-54285",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54285"
},
{
"name": "CVE-2024-45778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45778"
},
{
"name": "CVE-2026-23086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23086"
},
{
"name": "CVE-2024-47661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47661"
},
{
"name": "CVE-2026-28418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28418"
},
{
"name": "CVE-2023-54151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54151"
},
{
"name": "CVE-2025-22022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22022"
},
{
"name": "CVE-2025-66864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66864"
},
{
"name": "CVE-2024-46803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46803"
},
{
"name": "CVE-2025-22869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22869"
},
{
"name": "CVE-2025-59466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59466"
},
{
"name": "CVE-2025-40192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40192"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-68818",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68818"
},
{
"name": "CVE-2022-36351",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36351"
},
{
"name": "CVE-2023-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52921"
},
{
"name": "CVE-2025-15468",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15468"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-43832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43832"
},
{
"name": "CVE-2026-1299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1299"
},
{
"name": "CVE-2024-54683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54683"
},
{
"name": "CVE-2025-1150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1150"
},
{
"name": "CVE-2024-46720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46720"
},
{
"name": "CVE-2024-26658",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26658"
},
{
"name": "CVE-2026-2243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2243"
},
{
"name": "CVE-2025-38198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38198"
},
{
"name": "CVE-2025-58189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58189"
},
{
"name": "CVE-2022-36087",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36087"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2021-0174",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0174"
},
{
"name": "CVE-2025-8746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8746"
},
{
"name": "CVE-2025-36442",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36442"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2025-40102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40102"
},
{
"name": "CVE-2026-0968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0968"
},
{
"name": "CVE-2025-40170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40170"
},
{
"name": "CVE-2025-38437",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38437"
},
{
"name": "CVE-2025-40160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40160"
},
{
"name": "CVE-2023-7008",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7008"
},
{
"name": "CVE-2024-45779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45779"
},
{
"name": "CVE-2025-40284",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40284"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2025-40077",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40077"
},
{
"name": "CVE-2024-57857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57857"
},
{
"name": "CVE-2024-4603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4603"
},
{
"name": "CVE-2022-50213",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50213"
},
{
"name": "CVE-2024-46823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46823"
},
{
"name": "CVE-2023-32642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32642"
},
{
"name": "CVE-2025-71227",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71227"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2022-50015",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50015"
},
{
"name": "CVE-2025-40071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40071"
},
{
"name": "CVE-2024-7883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7883"
},
{
"name": "CVE-2024-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50271"
},
{
"name": "CVE-2022-50772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50772"
},
{
"name": "CVE-2024-56717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56717"
},
{
"name": "CVE-2025-68366",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68366"
},
{
"name": "CVE-2024-56707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56707"
},
{
"name": "CVE-2023-54234",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54234"
},
{
"name": "CVE-2022-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45885"
},
{
"name": "CVE-2022-49783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49783"
},
{
"name": "CVE-2025-40305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40305"
},
{
"name": "CVE-2016-2781",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-2781"
},
{
"name": "CVE-2023-29383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29383"
},
{
"name": "CVE-2025-47153",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47153"
},
{
"name": "CVE-2025-40080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40080"
},
{
"name": "CVE-2024-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53216"
},
{
"name": "CVE-2022-49539",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49539"
},
{
"name": "CVE-2024-36347",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36347"
},
{
"name": "CVE-2024-26869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26869"
},
{
"name": "CVE-2025-22870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22870"
},
{
"name": "CVE-2025-68815",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68815"
},
{
"name": "CVE-2021-20255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20255"
},
{
"name": "CVE-2022-48979",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48979"
},
{
"name": "CVE-2025-40307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40307"
},
{
"name": "CVE-2025-71193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71193"
},
{
"name": "CVE-2023-54180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54180"
},
{
"name": "CVE-2026-23095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23095"
},
{
"name": "CVE-2024-46848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46848"
},
{
"name": "CVE-2025-68346",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68346"
},
{
"name": "CVE-2025-38081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38081"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2025-71163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71163"
},
{
"name": "CVE-2024-36350",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36350"
},
{
"name": "CVE-2023-25951",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25951"
},
{
"name": "CVE-2025-40211",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40211"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2021-0308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0308"
},
{
"name": "CVE-2025-68315",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68315"
},
{
"name": "CVE-2024-50009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50009"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2022-1205",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1205"
},
{
"name": "CVE-2023-45927",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45927"
},
{
"name": "CVE-2020-25742",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-25742"
},
{
"name": "CVE-2022-0987",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0987"
},
{
"name": "CVE-2025-71096",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71096"
},
{
"name": "CVE-2025-71095",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71095"
},
{
"name": "CVE-2025-40217",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40217"
},
{
"name": "CVE-2025-38199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38199"
},
{
"name": "CVE-2025-39905",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39905"
},
{
"name": "CVE-2025-21944",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21944"
},
{
"name": "CVE-2022-50720",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50720"
},
{
"name": "CVE-2025-71105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71105"
},
{
"name": "CVE-2023-50387",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50387"
},
{
"name": "CVE-2022-49529",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49529"
},
{
"name": "CVE-2025-68266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68266"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2025-68771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68771"
},
{
"name": "CVE-2025-39961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39961"
},
{
"name": "CVE-2025-68363",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68363"
},
{
"name": "CVE-2024-54456",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54456"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2025-40248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40248"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2025-37876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37876"
},
{
"name": "CVE-2024-58089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58089"
},
{
"name": "CVE-2024-36331",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36331"
},
{
"name": "CVE-2026-27571",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27571"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2026-22984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22984"
},
{
"name": "CVE-2026-27139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27139"
},
{
"name": "CVE-2022-49127",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49127"
},
{
"name": "CVE-2020-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-25741"
},
{
"name": "CVE-2022-50748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50748"
},
{
"name": "CVE-2023-53767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53767"
},
{
"name": "CVE-2025-21667",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21667"
},
{
"name": "CVE-2025-9230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9230"
},
{
"name": "CVE-2023-49083",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-49083"
},
{
"name": "CVE-2025-21696",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21696"
},
{
"name": "CVE-2025-68303",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68303"
},
{
"name": "CVE-2025-21955",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21955"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2025-40259",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40259"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2026-28419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28419"
},
{
"name": "CVE-2025-8677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8677"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2026-23206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23206"
},
{
"name": "CVE-2025-68757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68757"
},
{
"name": "CVE-2024-46678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46678"
},
{
"name": "CVE-2024-58097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58097"
},
{
"name": "CVE-2023-53620",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53620"
},
{
"name": "CVE-2022-50539",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50539"
},
{
"name": "CVE-2025-71068",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71068"
},
{
"name": "CVE-2025-23130",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23130"
},
{
"name": "CVE-2022-49496",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49496"
},
{
"name": "CVE-2025-38349",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38349"
},
{
"name": "CVE-2024-56782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56782"
},
{
"name": "CVE-2025-39957",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39957"
},
{
"name": "CVE-2025-1352",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1352"
},
{
"name": "CVE-2023-53540",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53540"
},
{
"name": "CVE-2022-49552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49552"
},
{
"name": "CVE-2024-4741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4741"
},
{
"name": "CVE-2023-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53261"
},
{
"name": "CVE-2026-23033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23033"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2024-26759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26759"
},
{
"name": "CVE-2025-39931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39931"
},
{
"name": "CVE-2023-54187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54187"
},
{
"name": "CVE-2026-22977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22977"
},
{
"name": "CVE-2026-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23145"
},
{
"name": "CVE-2022-44032",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-44032"
},
{
"name": "CVE-2024-57895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57895"
},
{
"name": "CVE-2023-53240",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53240"
},
{
"name": "CVE-2025-13735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13735"
},
{
"name": "CVE-2023-53694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53694"
},
{
"name": "CVE-2024-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53195"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2026-23003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23003"
},
{
"name": "CVE-2025-21891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21891"
},
{
"name": "CVE-2025-38716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38716"
},
{
"name": "CVE-2025-11187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11187"
},
{
"name": "CVE-2024-56660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56660"
},
{
"name": "CVE-2026-23076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23076"
},
{
"name": "CVE-2023-54145",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54145"
},
{
"name": "CVE-2025-38033",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38033"
},
{
"name": "CVE-2024-41023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41023"
},
{
"name": "CVE-2024-47704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47704"
},
{
"name": "CVE-2025-21672",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21672"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-49978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49978"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2025-15079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15079"
},
{
"name": "CVE-2024-49870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49870"
},
{
"name": "CVE-2025-36366",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36366"
},
{
"name": "CVE-2024-42125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42125"
},
{
"name": "CVE-2025-36123",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36123"
},
{
"name": "CVE-2024-56737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56737"
},
{
"name": "CVE-2025-68168",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68168"
},
{
"name": "CVE-2025-21821",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21821"
},
{
"name": "CVE-2025-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68206"
},
{
"name": "CVE-2020-11935",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11935"
},
{
"name": "CVE-2023-54247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54247"
},
{
"name": "CVE-2025-68309",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68309"
},
{
"name": "CVE-2023-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52905"
},
{
"name": "CVE-2024-57852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57852"
},
{
"name": "CVE-2025-40003",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40003"
},
{
"name": "CVE-2025-22042",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22042"
},
{
"name": "CVE-2025-71158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71158"
},
{
"name": "CVE-2022-49803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49803"
},
{
"name": "CVE-2024-57898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57898"
},
{
"name": "CVE-2020-35503",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-35503"
},
{
"name": "CVE-2024-49923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49923"
},
{
"name": "CVE-2024-56639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56639"
},
{
"name": "CVE-2025-68372",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68372"
},
{
"name": "CVE-2026-23171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23171"
},
{
"name": "CVE-2024-3651",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3651"
},
{
"name": "CVE-2023-53002",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53002"
},
{
"name": "CVE-2021-0183",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0183"
},
{
"name": "CVE-2025-39884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39884"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2026-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26996"
},
{
"name": "CVE-2024-35826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35826"
},
{
"name": "CVE-2026-23112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23112"
},
{
"name": "CVE-2022-49764",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49764"
},
{
"name": "CVE-2025-68121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68121"
},
{
"name": "CVE-2025-21651",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21651"
},
{
"name": "CVE-2025-38092",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38092"
},
{
"name": "CVE-2025-22124",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22124"
},
{
"name": "CVE-2025-68313",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68313"
},
{
"name": "CVE-2024-58053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58053"
},
{
"name": "CVE-2023-26553",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26553"
},
{
"name": "CVE-2025-60876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-60876"
},
{
"name": "CVE-2025-37776",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37776"
},
{
"name": "CVE-2021-23840",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-23840"
},
{
"name": "CVE-2024-58077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58077"
},
{
"name": "CVE-2024-6519",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6519"
},
{
"name": "CVE-2024-46729",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46729"
},
{
"name": "CVE-2023-53850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53850"
},
{
"name": "CVE-2023-2975",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2975"
},
{
"name": "CVE-2022-50266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50266"
},
{
"name": "CVE-2024-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53178"
},
{
"name": "CVE-2025-71137",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71137"
},
{
"name": "CVE-2026-23084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23084"
},
{
"name": "CVE-2023-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53093"
},
{
"name": "CVE-2025-11065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11065"
},
{
"name": "CVE-2026-23190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23190"
},
{
"name": "CVE-2025-40123",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40123"
},
{
"name": "CVE-2026-22979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22979"
},
{
"name": "CVE-2025-68301",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68301"
},
{
"name": "CVE-2024-49991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49991"
},
{
"name": "CVE-2022-50009",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50009"
},
{
"name": "CVE-2022-26047",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26047"
},
{
"name": "CVE-2024-53240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53240"
},
{
"name": "CVE-2026-23011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23011"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2023-53816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53816"
},
{
"name": "CVE-2025-37877",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37877"
},
{
"name": "CVE-2024-2193",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2193"
},
{
"name": "CVE-2025-4382",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4382"
},
{
"name": "CVE-2022-28693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28693"
},
{
"name": "CVE-2025-71161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71161"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-22038",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22038"
},
{
"name": "CVE-2025-68217",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68217"
},
{
"name": "CVE-2023-54242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54242"
},
{
"name": "CVE-2025-68289",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68289"
},
{
"name": "CVE-2025-40363",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40363"
},
{
"name": "CVE-2024-41062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41062"
},
{
"name": "CVE-2025-40253",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40253"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2025-37800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37800"
},
{
"name": "CVE-2025-61726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61726"
},
{
"name": "CVE-2022-50518",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50518"
},
{
"name": "CVE-2022-49829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49829"
},
{
"name": "CVE-2025-64756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-64756"
},
{
"name": "CVE-2025-21967",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21967"
},
{
"name": "CVE-2016-2568",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-2568"
},
{
"name": "CVE-2020-13817",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-13817"
},
{
"name": "CVE-2025-68245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68245"
},
{
"name": "CVE-2018-12929",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-12929"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2024-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53147"
},
{
"name": "CVE-2025-39952",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39952"
},
{
"name": "CVE-2025-40317",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40317"
},
{
"name": "CVE-2024-45783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45783"
},
{
"name": "CVE-2026-23110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23110"
},
{
"name": "CVE-2023-53410",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53410"
},
{
"name": "CVE-2023-53254",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53254"
},
{
"name": "CVE-2024-34064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34064"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2025-68809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68809"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2021-0165",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0165"
},
{
"name": "CVE-2025-0624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0624"
},
{
"name": "CVE-2022-49177",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49177"
},
{
"name": "CVE-2025-38205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38205"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2025-59464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59464"
},
{
"name": "CVE-2024-58241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58241"
},
{
"name": "CVE-2025-21863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21863"
},
{
"name": "CVE-2025-71120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71120"
},
{
"name": "CVE-2025-38166",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38166"
},
{
"name": "CVE-2022-49833",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49833"
},
{
"name": "CVE-2026-23060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23060"
},
{
"name": "CVE-2025-38321",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38321"
},
{
"name": "CVE-2025-68282",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68282"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2025-68817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68817"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2025-38045",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38045"
},
{
"name": "CVE-2024-46726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46726"
},
{
"name": "CVE-2025-40025",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40025"
},
{
"name": "CVE-2024-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53079"
},
{
"name": "CVE-2025-68787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68787"
},
{
"name": "CVE-2025-1125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1125"
},
{
"name": "CVE-2023-53647",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53647"
},
{
"name": "CVE-2025-37954",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37954"
},
{
"name": "CVE-2025-23133",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23133"
},
{
"name": "CVE-2025-0012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0012"
},
{
"name": "CVE-2020-12313",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-12313"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2025-68782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68782"
},
{
"name": "CVE-2021-0166",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0166"
},
{
"name": "CVE-2025-21945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21945"
},
{
"name": "CVE-2022-3872",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3872"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2025-71197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71197"
},
{
"name": "CVE-2025-68177",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68177"
},
{
"name": "CVE-2025-68758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68758"
},
{
"name": "CVE-2024-49931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49931"
},
{
"name": "CVE-2024-43866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43866"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-47728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47728"
},
{
"name": "CVE-2025-68191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68191"
},
{
"name": "CVE-2026-23031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23031"
},
{
"name": "CVE-2024-46730",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46730"
},
{
"name": "CVE-2025-71113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71113"
},
{
"name": "CVE-2025-71127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71127"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2024-46728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46728"
},
{
"name": "CVE-2023-53561",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53561"
},
{
"name": "CVE-2026-22998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22998"
},
{
"name": "CVE-2023-54172",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54172"
},
{
"name": "CVE-2026-23050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23050"
},
{
"name": "CVE-2024-58100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58100"
},
{
"name": "CVE-2020-0256",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-0256"
},
{
"name": "CVE-2025-21673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21673"
},
{
"name": "CVE-2024-26954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26954"
},
{
"name": "CVE-2025-21634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21634"
},
{
"name": "CVE-2024-57999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57999"
},
{
"name": "CVE-2025-38047",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38047"
},
{
"name": "CVE-2024-47738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47738"
},
{
"name": "CVE-2025-68340",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68340"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2023-54320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54320"
},
{
"name": "CVE-2024-43911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43911"
},
{
"name": "CVE-2025-37959",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37959"
},
{
"name": "CVE-2017-0537",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-0537"
},
{
"name": "CVE-2025-38191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38191"
},
{
"name": "CVE-2023-32681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32681"
},
{
"name": "CVE-2025-68219",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68219"
},
{
"name": "CVE-2022-50232",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50232"
},
{
"name": "CVE-2025-38062",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38062"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2023-26112",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26112"
},
{
"name": "CVE-2018-6952",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-6952"
},
{
"name": "CVE-2020-14304",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14304"
},
{
"name": "CVE-2024-46834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46834"
},
{
"name": "CVE-2025-40288",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40288"
},
{
"name": "CVE-2025-68239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68239"
},
{
"name": "CVE-2025-40258",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40258"
},
{
"name": "CVE-2025-21894",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21894"
},
{
"name": "CVE-2025-40281",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40281"
},
{
"name": "CVE-2025-68185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68185"
},
{
"name": "CVE-2025-40304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40304"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-40110",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40110"
},
{
"name": "CVE-2026-24001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-24001"
},
{
"name": "CVE-2025-37807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37807"
},
{
"name": "CVE-2025-38131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38131"
},
{
"name": "CVE-2022-50016",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50016"
},
{
"name": "CVE-2025-29481",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29481"
},
{
"name": "CVE-2024-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53219"
},
{
"name": "CVE-2023-53009",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53009"
},
{
"name": "CVE-2025-40268",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40268"
},
{
"name": "CVE-2025-61661",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61661"
},
{
"name": "CVE-2026-23111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23111"
},
{
"name": "CVE-2024-25740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25740"
},
{
"name": "CVE-2024-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50246"
},
{
"name": "CVE-2023-3446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3446"
},
{
"name": "CVE-2024-57950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57950"
},
{
"name": "CVE-2025-21759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21759"
},
{
"name": "CVE-2025-40325",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40325"
},
{
"name": "CVE-2024-2511",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2511"
},
{
"name": "CVE-2024-42321",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42321"
},
{
"name": "CVE-2026-23113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23113"
},
{
"name": "CVE-2021-0176",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0176"
},
{
"name": "CVE-2025-1151",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1151"
},
{
"name": "CVE-2022-48998",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48998"
},
{
"name": "CVE-2025-68798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68798"
},
{
"name": "CVE-2024-42273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42273"
},
{
"name": "CVE-2025-68336",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68336"
},
{
"name": "CVE-2023-53794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53794"
},
{
"name": "CVE-2026-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23157"
},
{
"name": "CVE-2025-40303",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40303"
},
{
"name": "CVE-2025-68178",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68178"
},
{
"name": "CVE-2022-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49974"
},
{
"name": "CVE-2025-40337",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40337"
},
{
"name": "CVE-2019-20633",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20633"
},
{
"name": "CVE-2025-38264",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38264"
},
{
"name": "CVE-2021-3714",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3714"
},
{
"name": "CVE-2023-54071",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54071"
},
{
"name": "CVE-2024-56566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56566"
},
{
"name": "CVE-2025-40036",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40036"
},
{
"name": "CVE-2024-57993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57993"
},
{
"name": "CVE-2024-47745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47745"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2026-23097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23097"
},
{
"name": "CVE-2025-37980",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37980"
},
{
"name": "CVE-2024-53190",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53190"
},
{
"name": "CVE-2025-40262",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40262"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-56591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56591"
},
{
"name": "CVE-2024-56544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56544"
},
{
"name": "CVE-2024-56647",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56647"
},
{
"name": "CVE-2025-71198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71198"
},
{
"name": "CVE-2025-21649",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21649"
},
{
"name": "CVE-2024-57976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57976"
},
{
"name": "CVE-2025-68819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68819"
},
{
"name": "CVE-2025-0685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0685"
},
{
"name": "CVE-2024-57893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57893"
},
{
"name": "CVE-2026-23231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23231"
},
{
"name": "CVE-2025-37879",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37879"
},
{
"name": "CVE-2022-50071",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50071"
},
{
"name": "CVE-2025-40261",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40261"
},
{
"name": "CVE-2024-56180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56180"
},
{
"name": "CVE-2023-39333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39333"
},
{
"name": "CVE-2025-38643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38643"
},
{
"name": "CVE-2021-3864",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3864"
},
{
"name": "CVE-2025-39771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39771"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26648",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26648"
},
{
"name": "CVE-2025-66862",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66862"
},
{
"name": "CVE-2020-11868",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11868"
},
{
"name": "CVE-2020-24352",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-24352"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2026-23021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23021"
},
{
"name": "CVE-2025-39819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39819"
},
{
"name": "CVE-2022-49296",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49296"
},
{
"name": "CVE-2024-49914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49914"
},
{
"name": "CVE-2025-38360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38360"
},
{
"name": "CVE-2025-68732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68732"
},
{
"name": "CVE-2025-39715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39715"
},
{
"name": "CVE-2025-36407",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36407"
},
{
"name": "CVE-2024-0217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0217"
},
{
"name": "CVE-2025-40323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40323"
},
{
"name": "CVE-2025-21732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21732"
},
{
"name": "CVE-2021-47658",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47658"
},
{
"name": "CVE-2025-68285",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68285"
},
{
"name": "CVE-2019-12067",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-12067"
},
{
"name": "CVE-2024-57843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57843"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2024-50135",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50135"
},
{
"name": "CVE-2024-49916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49916"
},
{
"name": "CVE-2025-68119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68119"
},
{
"name": "CVE-2024-49988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49988"
},
{
"name": "CVE-2023-52648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52648"
},
{
"name": "CVE-2024-49861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49861"
},
{
"name": "CVE-2026-23093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23093"
},
{
"name": "CVE-2024-49893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49893"
},
{
"name": "CVE-2024-44963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44963"
},
{
"name": "CVE-2023-53348",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53348"
},
{
"name": "CVE-2022-48766",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48766"
},
{
"name": "CVE-2019-15794",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-15794"
},
{
"name": "CVE-2024-49917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49917"
},
{
"name": "CVE-2022-50467",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50467"
},
{
"name": "CVE-2025-37849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37849"
},
{
"name": "CVE-2024-48875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48875"
},
{
"name": "CVE-2024-41935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41935"
},
{
"name": "CVE-2025-38162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38162"
},
{
"name": "CVE-2022-23491",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23491"
},
{
"name": "CVE-2025-22873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22873"
},
{
"name": "CVE-2023-5678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5678"
},
{
"name": "CVE-2025-71183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71183"
},
{
"name": "CVE-2023-54047",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54047"
},
{
"name": "CVE-2023-53382",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53382"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2023-53651",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53651"
},
{
"name": "CVE-2025-21832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21832"
},
{
"name": "CVE-2025-68371",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68371"
},
{
"name": "CVE-2022-50383",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50383"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2025-40275",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40275"
},
{
"name": "CVE-2023-53387",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53387"
},
{
"name": "CVE-2026-31802",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31802"
},
{
"name": "CVE-2024-45774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45774"
},
{
"name": "CVE-2023-54019",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54019"
},
{
"name": "CVE-2025-22053",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22053"
},
{
"name": "CVE-2025-61664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61664"
},
{
"name": "CVE-2025-68211",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68211"
},
{
"name": "CVE-2026-25702",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25702"
},
{
"name": "CVE-2023-52452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52452"
},
{
"name": "CVE-2023-42366",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42366"
},
{
"name": "CVE-2022-50863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50863"
},
{
"name": "CVE-2025-39829",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39829"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2025-71091",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71091"
},
{
"name": "CVE-2025-39781",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39781"
},
{
"name": "CVE-2025-39762",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39762"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2023-52576",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52576"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2025-0167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0167"
},
{
"name": "CVE-2024-57887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57887"
},
{
"name": "CVE-2025-21730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21730"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2025-71184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71184"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2025-69420",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69420"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-68227",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68227"
},
{
"name": "CVE-2025-22041",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22041"
},
{
"name": "CVE-2025-40339",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40339"
},
{
"name": "CVE-2025-22127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22127"
},
{
"name": "CVE-2025-47273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47273"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2025-38020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38020"
},
{
"name": "CVE-2024-27011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27011"
},
{
"name": "CVE-2025-15224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15224"
},
{
"name": "CVE-2024-26605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26605"
},
{
"name": "CVE-2026-27904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27904"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2025-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68263"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2025-38689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38689"
},
{
"name": "CVE-2025-68800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68800"
},
{
"name": "CVE-2025-38275",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38275"
},
{
"name": "CVE-2025-68261",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68261"
},
{
"name": "CVE-2022-48744",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48744"
},
{
"name": "CVE-2025-38070",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38070"
},
{
"name": "CVE-2025-68755",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68755"
},
{
"name": "CVE-2025-62525",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62525"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2021-0175",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0175"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2022-48706",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48706"
},
{
"name": "CVE-2025-40334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40334"
},
{
"name": "CVE-2025-68767",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68767"
},
{
"name": "CVE-2024-46716",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46716"
},
{
"name": "CVE-2012-4542",
"url": "https://www.cve.org/CVERecord?id=CVE-2012-4542"
},
{
"name": "CVE-2021-3773",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3773"
},
{
"name": "CVE-2025-61729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61729"
},
{
"name": "CVE-2022-49267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49267"
},
{
"name": "CVE-2024-56592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56592"
},
{
"name": "CVE-2025-37854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37854"
},
{
"name": "CVE-2025-38189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38189"
},
{
"name": "CVE-2022-48628",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48628"
},
{
"name": "CVE-2024-6345",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6345"
},
{
"name": "CVE-2024-50138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50138"
},
{
"name": "CVE-2025-40319",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40319"
},
{
"name": "CVE-2021-44534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44534"
},
{
"name": "CVE-2025-14831",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14831"
},
{
"name": "CVE-2024-56565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56565"
},
{
"name": "CVE-2025-68193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68193"
},
{
"name": "CVE-2025-68727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68727"
},
{
"name": "CVE-2024-57872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57872"
},
{
"name": "CVE-2023-28720",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28720"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2026-23080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23080"
},
{
"name": "CVE-2024-46833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46833"
},
{
"name": "CVE-2024-47703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47703"
},
{
"name": "CVE-2023-53742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53742"
},
{
"name": "CVE-2025-38361",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38361"
},
{
"name": "CVE-2025-38041",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38041"
},
{
"name": "CVE-2024-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53177"
},
{
"name": "CVE-2024-56588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56588"
},
{
"name": "CVE-2023-53452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53452"
},
{
"name": "CVE-2023-54121",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54121"
},
{
"name": "CVE-2023-6610",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6610"
},
{
"name": "CVE-2023-54261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54261"
},
{
"name": "CVE-2022-50616",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50616"
},
{
"name": "CVE-2025-66418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66418"
},
{
"name": "CVE-2023-53544",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53544"
},
{
"name": "CVE-2025-68264",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68264"
},
{
"name": "CVE-2024-49911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49911"
},
{
"name": "CVE-2026-23154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23154"
},
{
"name": "CVE-2022-50708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50708"
},
{
"name": "CVE-2026-3784",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3784"
},
{
"name": "CVE-2025-68764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68764"
},
{
"name": "CVE-2025-9301",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9301"
}
],
"initial_release_date": "2026-03-19T00:00:00",
"last_revision_date": "2026-03-19T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0316",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-03-19T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits VMware. Elles permettent \u00e0 un attaquant de provoquer un probl\u00e8me de s\u00e9curit\u00e9 non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits VMware",
"vendor_advisories": [
{
"published_at": "2026-03-18",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37219",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37219"
},
{
"published_at": "2026-03-18",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37211",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37211"
},
{
"published_at": "2026-03-18",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37215",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37215"
},
{
"published_at": "2026-03-18",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37218",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37218"
},
{
"published_at": "2026-03-18",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37220",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37220"
},
{
"published_at": "2026-03-18",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37216",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37216"
},
{
"published_at": "2026-03-18",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37221",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37221"
},
{
"published_at": "2026-03-18",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37213",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37213"
},
{
"published_at": "2026-03-18",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37217",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37217"
},
{
"published_at": "2026-03-18",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37212",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37212"
},
{
"published_at": "2026-03-18",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37214",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37214"
},
{
"published_at": "2026-03-18",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37222",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37222"
}
]
}
CERTFR-2026-AVI-0326
Vulnerability from certfr_avis - Published: 2026-03-20 - Updated: 2026-03-20
De multiples vulnérabilités ont été découvertes dans les produits VMware. Elles permettent à un attaquant de provoquer un problème de sécurité non spécifié par l'éditeur.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| VMware | Tanzu Platform | Isolation Segmentation pour VMware Tanzu Platform versions antérieures à 6.0.26+LTS-T | ||
| VMware | Tanzu Platform | Isolation Segmentation pour VMware Tanzu Platform versions antérieures à 10.3.6 | ||
| VMware | Tanzu Platform | App Autoscaler CLI Plugin pour VMware Tanzu Platform versions antérieures à 250.6.9 | ||
| VMware | N/A | Python Buildpack versions antérieures à 1.8.83 | ||
| VMware | Tanzu Platform | Tanzu Platform versions antérieures à 3.1.9 | ||
| VMware | Tanzu Platform | Tanzu RabbitMQ sur Tanzu Platform versions antérieures à 2.4.4 | ||
| VMware | N/A | PHP Buildpack versions antérieures à 4.6.69 | ||
| VMware | Tanzu Platform | Tanzu Platform versions antérieures à 3.2.5 | ||
| VMware | Tanzu Platform | Elastic Application Runtime Windows add-on pour VMware Tanzu Platform versions antérieures à 10.2.9+LTS-T | ||
| VMware | Tanzu Platform | App Autoscaler CLI Plugin pour VMware Tanzu Platform versions antérieures à 250.5.17 | ||
| VMware | Tanzu Platform | Tanzu RabbitMQ pour Tanzu Platform versions antérieures à 10.1.2 | ||
| VMware | Tanzu Platform | Tanzu Platform versions antérieures à 2.4.6 | ||
| VMware | Tanzu Platform | Tanzu Platform versions antérieures à 1.16.18 | ||
| VMware | Tanzu Platform | Tanzu for Valkey sur Tanzu Platform versions antérieures à 10.2.2 | ||
| VMware | Tanzu Platform | Elastic Application Runtime Windows add-on pour VMware Tanzu Platform versions antérieures à 6.0.26+LTS-T | ||
| VMware | Tanzu Platform | Isolation Segmentation pour VMware Tanzu Platform versions antérieures à 10.2.9+LTS-T | ||
| VMware | Tanzu Platform | Elastic Application Runtime Windows add-on pour VMware Tanzu Platform versions antérieures à 10.3.6 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Isolation Segmentation pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 6.0.26+LTS-T",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Isolation Segmentation pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 10.3.6",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "App Autoscaler CLI Plugin pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 250.6.9",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Python Buildpack versions ant\u00e9rieures \u00e0 1.8.83",
"product": {
"name": "N/A",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu Platform versions ant\u00e9rieures \u00e0 3.1.9",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu RabbitMQ sur Tanzu Platform versions ant\u00e9rieures \u00e0 2.4.4",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "PHP Buildpack versions ant\u00e9rieures \u00e0 4.6.69",
"product": {
"name": "N/A",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu Platform versions ant\u00e9rieures \u00e0 3.2.5",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Elastic Application Runtime Windows add-on pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 10.2.9+LTS-T",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "App Autoscaler CLI Plugin pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 250.5.17",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu RabbitMQ pour Tanzu Platform versions ant\u00e9rieures \u00e0 10.1.2",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu Platform versions ant\u00e9rieures \u00e0 2.4.6",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu Platform versions ant\u00e9rieures \u00e0 1.16.18",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu for Valkey sur Tanzu Platform versions ant\u00e9rieures \u00e0 10.2.2",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Elastic Application Runtime Windows add-on pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 6.0.26+LTS-T",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Isolation Segmentation pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 10.2.9+LTS-T",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Elastic Application Runtime Windows add-on pour VMware Tanzu Platform versions ant\u00e9rieures \u00e0 10.3.6",
"product": {
"name": "Tanzu Platform",
"vendor": {
"name": "VMware",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-28422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28422"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2022-50759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50759"
},
{
"name": "CVE-2026-26007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26007"
},
{
"name": "CVE-2025-71075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71075"
},
{
"name": "CVE-2024-49912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49912"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2026-23198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23198"
},
{
"name": "CVE-2023-3640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3640"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2025-40273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40273"
},
{
"name": "CVE-2023-53714",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53714"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2025-68230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68230"
},
{
"name": "CVE-2026-28420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28420"
},
{
"name": "CVE-2022-49069",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49069"
},
{
"name": "CVE-2024-57875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57875"
},
{
"name": "CVE-2022-27943",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27943"
},
{
"name": "CVE-2025-40064",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40064"
},
{
"name": "CVE-2023-54129",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54129"
},
{
"name": "CVE-2025-66865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66865"
},
{
"name": "CVE-2024-41031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41031"
},
{
"name": "CVE-2025-39992",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39992"
},
{
"name": "CVE-2025-69534",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69534"
},
{
"name": "CVE-2025-61730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61730"
},
{
"name": "CVE-2022-49543",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49543"
},
{
"name": "CVE-2026-23202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23202"
},
{
"name": "CVE-2025-38485",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38485"
},
{
"name": "CVE-2023-53562",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53562"
},
{
"name": "CVE-2025-68324",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68324"
},
{
"name": "CVE-2025-22026",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22026"
},
{
"name": "CVE-2023-54149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54149"
},
{
"name": "CVE-2025-71086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71086"
},
{
"name": "CVE-2024-50063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50063"
},
{
"name": "CVE-2023-33875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-33875"
},
{
"name": "CVE-2024-41001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41001"
},
{
"name": "CVE-2024-42155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42155"
},
{
"name": "CVE-2026-23167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23167"
},
{
"name": "CVE-2025-36353",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36353"
},
{
"name": "CVE-2025-68196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68196"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2025-38042",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38042"
},
{
"name": "CVE-2025-22083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22083"
},
{
"name": "CVE-2023-53829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53829"
},
{
"name": "CVE-2025-58183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58183"
},
{
"name": "CVE-2025-59830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59830"
},
{
"name": "CVE-2023-54002",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54002"
},
{
"name": "CVE-2022-50550",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50550"
},
{
"name": "CVE-2022-0400",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0400"
},
{
"name": "CVE-2022-49138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49138"
},
{
"name": "CVE-2025-66199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66199"
},
{
"name": "CVE-2024-42239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42239"
},
{
"name": "CVE-2022-49359",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49359"
},
{
"name": "CVE-2025-68342",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68342"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2022-50425",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50425"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2024-39293",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39293"
},
{
"name": "CVE-2023-53008",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53008"
},
{
"name": "CVE-2025-38669",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38669"
},
{
"name": "CVE-2025-40137",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40137"
},
{
"name": "CVE-2023-54052",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54052"
},
{
"name": "CVE-2025-22107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22107"
},
{
"name": "CVE-2024-38306",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38306"
},
{
"name": "CVE-2023-53733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53733"
},
{
"name": "CVE-2025-37775",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37775"
},
{
"name": "CVE-2025-21682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21682"
},
{
"name": "CVE-2023-1386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1386"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-39298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39298"
},
{
"name": "CVE-2024-56703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56703"
},
{
"name": "CVE-2026-23098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23098"
},
{
"name": "CVE-2023-53347",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53347"
},
{
"name": "CVE-2023-28374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28374"
},
{
"name": "CVE-2023-52926",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52926"
},
{
"name": "CVE-2026-32597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-32597"
},
{
"name": "CVE-2025-68286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68286"
},
{
"name": "CVE-2025-9231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9231"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2025-40057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40057"
},
{
"name": "CVE-2024-41050",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41050"
},
{
"name": "CVE-2026-25500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25500"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2025-27558",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27558"
},
{
"name": "CVE-2025-71094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71094"
},
{
"name": "CVE-2026-21637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21637"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-37891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37891"
},
{
"name": "CVE-2021-0076",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0076"
},
{
"name": "CVE-2025-68788",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68788"
},
{
"name": "CVE-2024-58237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58237"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-42147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42147"
},
{
"name": "CVE-2023-53529",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53529"
},
{
"name": "CVE-2024-50028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50028"
},
{
"name": "CVE-2023-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53042"
},
{
"name": "CVE-2022-50527",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50527"
},
{
"name": "CVE-2023-54280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54280"
},
{
"name": "CVE-2025-21786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21786"
},
{
"name": "CVE-2024-58094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58094"
},
{
"name": "CVE-2024-11187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11187"
},
{
"name": "CVE-2025-52534",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52534"
},
{
"name": "CVE-2025-40314",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40314"
},
{
"name": "CVE-2024-46705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46705"
},
{
"name": "CVE-2022-50407",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50407"
},
{
"name": "CVE-2026-23196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23196"
},
{
"name": "CVE-2024-26595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26595"
},
{
"name": "CVE-2022-23825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23825"
},
{
"name": "CVE-2024-45775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45775"
},
{
"name": "CVE-2025-40306",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40306"
},
{
"name": "CVE-2025-21881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21881"
},
{
"name": "CVE-2022-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49901"
},
{
"name": "CVE-2026-23126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23126"
},
{
"name": "CVE-2025-38329",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38329"
},
{
"name": "CVE-2021-33096",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33096"
},
{
"name": "CVE-2022-50230",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50230"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2025-39947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39947"
},
{
"name": "CVE-2025-68778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68778"
},
{
"name": "CVE-2023-53588",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53588"
},
{
"name": "CVE-2024-41082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41082"
},
{
"name": "CVE-2023-53685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53685"
},
{
"name": "CVE-2025-5222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5222"
},
{
"name": "CVE-2025-23155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23155"
},
{
"name": "CVE-2026-23054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23054"
},
{
"name": "CVE-2025-37870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37870"
},
{
"name": "CVE-2025-40254",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40254"
},
{
"name": "CVE-2022-49533",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49533"
},
{
"name": "CVE-2024-42253",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42253"
},
{
"name": "CVE-2020-26557",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26557"
},
{
"name": "CVE-2025-71064",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71064"
},
{
"name": "CVE-2023-54201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54201"
},
{
"name": "CVE-2021-33114",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33114"
},
{
"name": "CVE-2025-69645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69645"
},
{
"name": "CVE-2025-68200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68200"
},
{
"name": "CVE-2022-49518",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49518"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2022-49125",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49125"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2025-38501",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38501"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2024-27010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27010"
},
{
"name": "CVE-2025-27516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27516"
},
{
"name": "CVE-2025-68736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68736"
},
{
"name": "CVE-2023-52561",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52561"
},
{
"name": "CVE-2025-68725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68725"
},
{
"name": "CVE-2024-3220",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3220"
},
{
"name": "CVE-2024-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53221"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2025-68176",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68176"
},
{
"name": "CVE-2025-37777",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37777"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2026-24734",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-24734"
},
{
"name": "CVE-2025-68204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68204"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2025-68795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68795"
},
{
"name": "CVE-2025-68349",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68349"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2022-50815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50815"
},
{
"name": "CVE-2025-21931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21931"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-38036",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38036"
},
{
"name": "CVE-2025-2668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2668"
},
{
"name": "CVE-2025-71221",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71221"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2025-39716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39716"
},
{
"name": "CVE-2024-46860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46860"
},
{
"name": "CVE-2025-22040",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22040"
},
{
"name": "CVE-2024-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53095"
},
{
"name": "CVE-2025-22872",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22872"
},
{
"name": "CVE-2025-8277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8277"
},
{
"name": "CVE-2025-8941",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8941"
},
{
"name": "CVE-2022-38457",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-38457"
},
{
"name": "CVE-2024-56665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56665"
},
{
"name": "CVE-2025-38340",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38340"
},
{
"name": "CVE-2025-38109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38109"
},
{
"name": "CVE-2023-53629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53629"
},
{
"name": "CVE-2022-50178",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50178"
},
{
"name": "CVE-2025-39779",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39779"
},
{
"name": "CVE-2025-66866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66866"
},
{
"name": "CVE-2025-68283",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68283"
},
{
"name": "CVE-2023-7216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7216"
},
{
"name": "CVE-2025-66614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66614"
},
{
"name": "CVE-2025-37880",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37880"
},
{
"name": "CVE-2025-36427",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36427"
},
{
"name": "CVE-2026-23217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23217"
},
{
"name": "CVE-2025-15469",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15469"
},
{
"name": "CVE-2025-37833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37833"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2025-68246",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68246"
},
{
"name": "CVE-2025-68339",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68339"
},
{
"name": "CVE-2025-40287",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40287"
},
{
"name": "CVE-2023-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53320"
},
{
"name": "CVE-2024-44961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44961"
},
{
"name": "CVE-2026-23069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23069"
},
{
"name": "CVE-2025-21656",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21656"
},
{
"name": "CVE-2024-46835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46835"
},
{
"name": "CVE-2025-69650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69650"
},
{
"name": "CVE-2022-50554",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50554"
},
{
"name": "CVE-2023-53509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53509"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2025-11731",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11731"
},
{
"name": "CVE-2026-22992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22992"
},
{
"name": "CVE-2024-52005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52005"
},
{
"name": "CVE-2024-46775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46775"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2025-38207",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38207"
},
{
"name": "CVE-2022-49465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49465"
},
{
"name": "CVE-2026-23004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23004"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2025-39720",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39720"
},
{
"name": "CVE-2023-54271",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54271"
},
{
"name": "CVE-2022-49742",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49742"
},
{
"name": "CVE-2025-71191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71191"
},
{
"name": "CVE-2025-68295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68295"
},
{
"name": "CVE-2025-68728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68728"
},
{
"name": "CVE-2025-40780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40780"
},
{
"name": "CVE-2025-68364",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68364"
},
{
"name": "CVE-2024-42118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42118"
},
{
"name": "CVE-2025-40100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40100"
},
{
"name": "CVE-2026-1965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1965"
},
{
"name": "CVE-2024-52560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52560"
},
{
"name": "CVE-2024-56604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56604"
},
{
"name": "CVE-2026-23227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23227"
},
{
"name": "CVE-2025-71087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71087"
},
{
"name": "CVE-2023-37920",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37920"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2025-40285",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40285"
},
{
"name": "CVE-2023-52508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52508"
},
{
"name": "CVE-2025-69647",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69647"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2024-50014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50014"
},
{
"name": "CVE-2022-49108",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49108"
},
{
"name": "CVE-2024-56677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56677"
},
{
"name": "CVE-2025-38717",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38717"
},
{
"name": "CVE-2026-3497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3497"
},
{
"name": "CVE-2025-22019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22019"
},
{
"name": "CVE-2025-0913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0913"
},
{
"name": "CVE-2025-40208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40208"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2025-21872",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21872"
},
{
"name": "CVE-2026-2219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2219"
},
{
"name": "CVE-2025-68287",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68287"
},
{
"name": "CVE-2025-40039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40039"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2022-50627",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50627"
},
{
"name": "CVE-2024-50285",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50285"
},
{
"name": "CVE-2025-38099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38099"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38029",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38029"
},
{
"name": "CVE-2022-49123",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49123"
},
{
"name": "CVE-2024-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50289"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2024-46813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46813"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2025-47907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47907"
},
{
"name": "CVE-2024-47658",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47658"
},
{
"name": "CVE-2022-41409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-41409"
},
{
"name": "CVE-2025-38096",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38096"
},
{
"name": "CVE-2024-48873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48873"
},
{
"name": "CVE-2025-68746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68746"
},
{
"name": "CVE-2024-12797",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12797"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2024-46765",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46765"
},
{
"name": "CVE-2022-50380",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50380"
},
{
"name": "CVE-2025-12084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12084"
},
{
"name": "CVE-2025-38039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38039"
},
{
"name": "CVE-2022-48990",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48990"
},
{
"name": "CVE-2024-24864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24864"
},
{
"name": "CVE-2024-35832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35832"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2025-71133",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71133"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2024-45782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45782"
},
{
"name": "CVE-2022-50785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50785"
},
{
"name": "CVE-2025-39745",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39745"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2025-40103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40103"
},
{
"name": "CVE-2026-23020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23020"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2025-71223",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71223"
},
{
"name": "CVE-2025-36098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36098"
},
{
"name": "CVE-2025-68796",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68796"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2023-53765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53765"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2025-40356",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40356"
},
{
"name": "CVE-2026-1642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1642"
},
{
"name": "CVE-2025-45582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-45582"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2025-21752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21752"
},
{
"name": "CVE-2026-27138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27138"
},
{
"name": "CVE-2025-40312",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40312"
},
{
"name": "CVE-2025-37852",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37852"
},
{
"name": "CVE-2025-68220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68220"
},
{
"name": "CVE-2025-22125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22125"
},
{
"name": "CVE-2019-6293",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-6293"
},
{
"name": "CVE-2024-26953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26953"
},
{
"name": "CVE-2024-39282",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39282"
},
{
"name": "CVE-2025-21738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21738"
},
{
"name": "CVE-2023-50868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50868"
},
{
"name": "CVE-2025-68302",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68302"
},
{
"name": "CVE-2024-50146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50146"
},
{
"name": "CVE-2025-68238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68238"
},
{
"name": "CVE-2024-56709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56709"
},
{
"name": "CVE-2025-38063",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38063"
},
{
"name": "CVE-2025-68297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68297"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2025-68175",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68175"
},
{
"name": "CVE-2025-6069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6069"
},
{
"name": "CVE-2023-3817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3817"
},
{
"name": "CVE-2023-54227",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54227"
},
{
"name": "CVE-2023-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46316"
},
{
"name": "CVE-2024-47866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47866"
},
{
"name": "CVE-2024-44970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44970"
},
{
"name": "CVE-2022-49476",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49476"
},
{
"name": "CVE-2023-53855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53855"
},
{
"name": "CVE-2026-23208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23208"
},
{
"name": "CVE-2025-68804",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68804"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2025-68769",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68769"
},
{
"name": "CVE-2024-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50286"
},
{
"name": "CVE-2025-40139",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40139"
},
{
"name": "CVE-2025-68794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68794"
},
{
"name": "CVE-2025-21768",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21768"
},
{
"name": "CVE-2022-48667",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48667"
},
{
"name": "CVE-2025-69419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69419"
},
{
"name": "CVE-2024-56744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56744"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2026-3783",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3783"
},
{
"name": "CVE-2022-49161",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49161"
},
{
"name": "CVE-2021-21240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21240"
},
{
"name": "CVE-2022-48771",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48771"
},
{
"name": "CVE-2025-37961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37961"
},
{
"name": "CVE-2025-23131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23131"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2023-52485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52485"
},
{
"name": "CVE-2025-40309",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40309"
},
{
"name": "CVE-2022-49997",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49997"
},
{
"name": "CVE-2022-49469",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49469"
},
{
"name": "CVE-2025-6075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6075"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2026-23179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23179"
},
{
"name": "CVE-2025-68334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68334"
},
{
"name": "CVE-2025-40343",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40343"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2022-0480",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0480"
},
{
"name": "CVE-2025-68173",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68173"
},
{
"name": "CVE-2024-49932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49932"
},
{
"name": "CVE-2026-23090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23090"
},
{
"name": "CVE-2026-23035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23035"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2023-54253",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54253"
},
{
"name": "CVE-2025-38127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38127"
},
{
"name": "CVE-2025-22103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22103"
},
{
"name": "CVE-2025-1272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1272"
},
{
"name": "CVE-2025-21658",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21658"
},
{
"name": "CVE-2022-49651",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49651"
},
{
"name": "CVE-2025-68307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68307"
},
{
"name": "CVE-2025-40308",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40308"
},
{
"name": "CVE-2024-26770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26770"
},
{
"name": "CVE-2023-54324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54324"
},
{
"name": "CVE-2024-27041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27041"
},
{
"name": "CVE-2025-36184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36184"
},
{
"name": "CVE-2026-3195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3195"
},
{
"name": "CVE-2025-37743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37743"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2025-37920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37920"
},
{
"name": "CVE-2024-56326",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56326"
},
{
"name": "CVE-2023-26242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26242"
},
{
"name": "CVE-2025-58185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58185"
},
{
"name": "CVE-2025-40315",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40315"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2024-56722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56722"
},
{
"name": "CVE-2021-33113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33113"
},
{
"name": "CVE-2022-48668",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48668"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2025-68231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68231"
},
{
"name": "CVE-2021-22930",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22930"
},
{
"name": "CVE-2025-14177",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14177"
},
{
"name": "CVE-2026-23064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23064"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2025-68806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68806"
},
{
"name": "CVE-2022-50322",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50322"
},
{
"name": "CVE-2023-50782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50782"
},
{
"name": "CVE-2022-27635",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27635"
},
{
"name": "CVE-2025-71098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71098"
},
{
"name": "CVE-2024-49922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49922"
},
{
"name": "CVE-2020-12317",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-12317"
},
{
"name": "CVE-2025-61731",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61731"
},
{
"name": "CVE-2025-40251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40251"
},
{
"name": "CVE-2024-42128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42128"
},
{
"name": "CVE-2025-71078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71078"
},
{
"name": "CVE-2024-49909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49909"
},
{
"name": "CVE-2025-40355",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40355"
},
{
"name": "CVE-2021-42771",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42771"
},
{
"name": "CVE-2026-2391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2391"
},
{
"name": "CVE-2021-4095",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4095"
},
{
"name": "CVE-2022-50240",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50240"
},
{
"name": "CVE-2025-40054",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40054"
},
{
"name": "CVE-2024-45015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45015"
},
{
"name": "CVE-2025-68184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68184"
},
{
"name": "CVE-2024-36357",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36357"
},
{
"name": "CVE-2025-71074",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71074"
},
{
"name": "CVE-2025-38673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38673"
},
{
"name": "CVE-2025-40107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40107"
},
{
"name": "CVE-2025-11234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11234"
},
{
"name": "CVE-2025-71083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71083"
},
{
"name": "CVE-2026-23061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23061"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2024-46754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46754"
},
{
"name": "CVE-2021-0161",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0161"
},
{
"name": "CVE-2018-1121",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1121"
},
{
"name": "CVE-2022-49547",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49547"
},
{
"name": "CVE-2025-66863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66863"
},
{
"name": "CVE-2025-0622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0622"
},
{
"name": "CVE-2023-0286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0286"
},
{
"name": "CVE-2024-26757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26757"
},
{
"name": "CVE-2024-49899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49899"
},
{
"name": "CVE-2022-49484",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49484"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-46748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46748"
},
{
"name": "CVE-2025-68813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68813"
},
{
"name": "CVE-2024-50164",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50164"
},
{
"name": "CVE-2026-27137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27137"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2024-56788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56788"
},
{
"name": "CVE-2016-8660",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-8660"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2026-23047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23047"
},
{
"name": "CVE-2025-22121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22121"
},
{
"name": "CVE-2024-1975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1975"
},
{
"name": "CVE-2025-38215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38215"
},
{
"name": "CVE-2025-7519",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7519"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2025-68365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68365"
},
{
"name": "CVE-2024-57804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57804"
},
{
"name": "CVE-2024-49908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49908"
},
{
"name": "CVE-2025-68265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68265"
},
{
"name": "CVE-2024-50048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50048"
},
{
"name": "CVE-2026-28421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28421"
},
{
"name": "CVE-2026-23119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23119"
},
{
"name": "CVE-2025-37943",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37943"
},
{
"name": "CVE-2025-21918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21918"
},
{
"name": "CVE-2025-37745",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37745"
},
{
"name": "CVE-2025-71085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71085"
},
{
"name": "CVE-2026-27171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27171"
},
{
"name": "CVE-2022-50811",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50811"
},
{
"name": "CVE-2025-13837",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13837"
},
{
"name": "CVE-2023-4133",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4133"
},
{
"name": "CVE-2024-50183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50183"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2023-53366",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53366"
},
{
"name": "CVE-2022-49910",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49910"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2022-49203",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49203"
},
{
"name": "CVE-2024-40918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40918"
},
{
"name": "CVE-2024-27032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27032"
},
{
"name": "CVE-2022-50236",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50236"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35839"
},
{
"name": "CVE-2025-68344",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68344"
},
{
"name": "CVE-2026-23137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23137"
},
{
"name": "CVE-2025-40347",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40347"
},
{
"name": "CVE-2025-71154",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71154"
},
{
"name": "CVE-2025-37882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37882"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-46762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46762"
},
{
"name": "CVE-2023-34983",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34983"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2026-3731",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3731"
},
{
"name": "CVE-2025-40198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40198"
},
{
"name": "CVE-2024-0760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0760"
},
{
"name": "CVE-2025-39942",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39942"
},
{
"name": "CVE-2025-68310",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68310"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2025-68229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68229"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2024-42107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42107"
},
{
"name": "CVE-2025-68257",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68257"
},
{
"name": "CVE-2025-39929",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39929"
},
{
"name": "CVE-2022-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50304"
},
{
"name": "CVE-2026-23226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23226"
},
{
"name": "CVE-2020-26146",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26146"
},
{
"name": "CVE-2024-43844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43844"
},
{
"name": "CVE-2023-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52920"
},
{
"name": "CVE-2023-52590",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52590"
},
{
"name": "CVE-2025-71084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71084"
},
{
"name": "CVE-2024-22025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22025"
},
{
"name": "CVE-2026-23049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23049"
},
{
"name": "CVE-2025-68321",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68321"
},
{
"name": "CVE-2021-0072",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0072"
},
{
"name": "CVE-2025-40190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40190"
},
{
"name": "CVE-2025-69652",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69652"
},
{
"name": "CVE-2025-21635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21635"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2022-40133",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40133"
},
{
"name": "CVE-2020-26143",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26143"
},
{
"name": "CVE-2025-21712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21712"
},
{
"name": "CVE-2025-38353",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38353"
},
{
"name": "CVE-2025-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36009"
},
{
"name": "CVE-2019-0154",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-0154"
},
{
"name": "CVE-2024-57982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57982"
},
{
"name": "CVE-2023-52761",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52761"
},
{
"name": "CVE-2022-49773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49773"
},
{
"name": "CVE-2023-53609",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53609"
},
{
"name": "CVE-2023-53478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53478"
},
{
"name": "CVE-2024-42117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42117"
},
{
"name": "CVE-2025-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23160"
},
{
"name": "CVE-2023-53682",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53682"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2025-40311",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40311"
},
{
"name": "CVE-2025-54770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54770"
},
{
"name": "CVE-2026-3442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3442"
},
{
"name": "CVE-2024-58238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58238"
},
{
"name": "CVE-2024-13176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-13176"
},
{
"name": "CVE-2025-68814",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68814"
},
{
"name": "CVE-2025-22039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22039"
},
{
"name": "CVE-2025-37842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37842"
},
{
"name": "CVE-2025-39933",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39933"
},
{
"name": "CVE-2025-40237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40237"
},
{
"name": "CVE-2022-49722",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49722"
},
{
"name": "CVE-2026-23745",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23745"
},
{
"name": "CVE-2025-68780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68780"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2025-39990",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39990"
},
{
"name": "CVE-2025-15467",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15467"
},
{
"name": "CVE-2025-71081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71081"
},
{
"name": "CVE-2023-53780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53780"
},
{
"name": "CVE-2020-35501",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-35501"
},
{
"name": "CVE-2024-58251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58251"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-9820",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9820"
},
{
"name": "CVE-2023-52624",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52624"
},
{
"name": "CVE-2024-56557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56557"
},
{
"name": "CVE-2022-49699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49699"
},
{
"name": "CVE-2022-50700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50700"
},
{
"name": "CVE-2023-52632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52632"
},
{
"name": "CVE-2024-46836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46836"
},
{
"name": "CVE-2026-23101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23101"
},
{
"name": "CVE-2026-23099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23099"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2025-1180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1180"
},
{
"name": "CVE-2025-38060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38060"
},
{
"name": "CVE-2022-48929",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48929"
},
{
"name": "CVE-2025-55130",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55130"
},
{
"name": "CVE-2025-36070",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36070"
},
{
"name": "CVE-2024-46820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46820"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2025-38105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38105"
},
{
"name": "CVE-2025-37744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37744"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2023-53198",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53198"
},
{
"name": "CVE-2023-53846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53846"
},
{
"name": "CVE-2025-71121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71121"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2022-1247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1247"
},
{
"name": "CVE-2025-40333",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40333"
},
{
"name": "CVE-2022-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50234"
},
{
"name": "CVE-2025-38082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38082"
},
{
"name": "CVE-2025-37884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37884"
},
{
"name": "CVE-2024-58054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58054"
},
{
"name": "CVE-2024-49934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49934"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-38022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38022"
},
{
"name": "CVE-2026-23066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23066"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2023-4969",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4969"
},
{
"name": "CVE-2024-50098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50098"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2023-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44487"
},
{
"name": "CVE-2023-53789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53789"
},
{
"name": "CVE-2022-49858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49858"
},
{
"name": "CVE-2025-39692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39692"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2023-5363",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5363"
},
{
"name": "CVE-2025-36428",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36428"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2026-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23085"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2025-40360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40360"
},
{
"name": "CVE-2026-23209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23209"
},
{
"name": "CVE-2025-71136",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71136"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2025-22105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22105"
},
{
"name": "CVE-2024-8612",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8612"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2025-40332",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40332"
},
{
"name": "CVE-2021-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46195"
},
{
"name": "CVE-2025-68354",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68354"
},
{
"name": "CVE-2025-68801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68801"
},
{
"name": "CVE-2021-33110",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33110"
},
{
"name": "CVE-2025-37834",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37834"
},
{
"name": "CVE-2025-21833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21833"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2019-19378",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-19378"
},
{
"name": "CVE-2026-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23150"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2025-61985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61985"
},
{
"name": "CVE-2025-71073",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71073"
},
{
"name": "CVE-2025-38426",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38426"
},
{
"name": "CVE-2025-38436",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38436"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2025-55131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55131"
},
{
"name": "CVE-2025-40104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40104"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2025-38097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38097"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2023-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53068"
},
{
"name": "CVE-2025-22090",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22090"
},
{
"name": "CVE-2025-61919",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61919"
},
{
"name": "CVE-2021-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-31615"
},
{
"name": "CVE-2024-1737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1737"
},
{
"name": "CVE-2025-40097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40097"
},
{
"name": "CVE-2022-49932",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49932"
},
{
"name": "CVE-2022-25837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25837"
},
{
"name": "CVE-2025-68258",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68258"
},
{
"name": "CVE-2024-49939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49939"
},
{
"name": "CVE-2025-38239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38239"
},
{
"name": "CVE-2024-49905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49905"
},
{
"name": "CVE-2023-52831",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52831"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2024-26719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26719"
},
{
"name": "CVE-2022-44034",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-44034"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2023-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53072"
},
{
"name": "CVE-2023-2007",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2007"
},
{
"name": "CVE-2022-37341",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-37341"
},
{
"name": "CVE-2025-69648",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69648"
},
{
"name": "CVE-2023-0466",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0466"
},
{
"name": "CVE-2024-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50298"
},
{
"name": "CVE-2025-36424",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36424"
},
{
"name": "CVE-2025-21915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21915"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2024-46843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46843"
},
{
"name": "CVE-2025-21792",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21792"
},
{
"name": "CVE-2023-54016",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54016"
},
{
"name": "CVE-2025-36387",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36387"
},
{
"name": "CVE-2025-38709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38709"
},
{
"name": "CVE-2024-58018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58018"
},
{
"name": "CVE-2023-4408",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4408"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2025-61771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61771"
},
{
"name": "CVE-2023-53602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53602"
},
{
"name": "CVE-2023-2828",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2828"
},
{
"name": "CVE-2023-54035",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54035"
},
{
"name": "CVE-2025-40322",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40322"
},
{
"name": "CVE-2023-53867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53867"
},
{
"name": "CVE-2023-0465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0465"
},
{
"name": "CVE-2025-61770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61770"
},
{
"name": "CVE-2025-37926",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37926"
},
{
"name": "CVE-2024-46715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46715"
},
{
"name": "CVE-2025-38038",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38038"
},
{
"name": "CVE-2024-46802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46802"
},
{
"name": "CVE-2025-39859",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39859"
},
{
"name": "CVE-2025-40313",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40313"
},
{
"name": "CVE-2023-52582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52582"
},
{
"name": "CVE-2023-33053",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-33053"
},
{
"name": "CVE-2025-1152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1152"
},
{
"name": "CVE-2026-24051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-24051"
},
{
"name": "CVE-2025-38015",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38015"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2025-38449",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38449"
},
{
"name": "CVE-2025-21714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21714"
},
{
"name": "CVE-2025-38261",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38261"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2025-37853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37853"
},
{
"name": "CVE-2025-69644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69644"
},
{
"name": "CVE-2022-49303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49303"
},
{
"name": "CVE-2025-38126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38126"
},
{
"name": "CVE-2023-46809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46809"
},
{
"name": "CVE-2025-59465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59465"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-21972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21972"
},
{
"name": "CVE-2023-54088",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54088"
},
{
"name": "CVE-2024-42320",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42320"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-40271",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40271"
},
{
"name": "CVE-2024-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53234"
},
{
"name": "CVE-2025-11961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11961"
},
{
"name": "CVE-2025-39877",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39877"
},
{
"name": "CVE-2022-3114",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3114"
},
{
"name": "CVE-2023-52916",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52916"
},
{
"name": "CVE-2025-38064",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38064"
},
{
"name": "CVE-2026-22991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22991"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2022-50628",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50628"
},
{
"name": "CVE-2024-56718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56718"
},
{
"name": "CVE-2024-43824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43824"
},
{
"name": "CVE-2025-39886",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39886"
},
{
"name": "CVE-2022-50350",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50350"
},
{
"name": "CVE-2025-21831",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21831"
},
{
"name": "CVE-2022-50721",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50721"
},
{
"name": "CVE-2022-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50095"
},
{
"name": "CVE-2025-40073",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40073"
},
{
"name": "CVE-2024-26662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26662"
},
{
"name": "CVE-2026-3196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3196"
},
{
"name": "CVE-2025-61662",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61662"
},
{
"name": "CVE-2025-8291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8291"
},
{
"name": "CVE-2025-68308",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68308"
},
{
"name": "CVE-2024-50217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50217"
},
{
"name": "CVE-2021-0168",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0168"
},
{
"name": "CVE-2026-22795",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22795"
},
{
"name": "CVE-2022-50479",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50479"
},
{
"name": "CVE-2022-50583",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50583"
},
{
"name": "CVE-2025-37806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37806"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2025-68822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68822"
},
{
"name": "CVE-2025-40242",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40242"
},
{
"name": "CVE-2023-0030",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0030"
},
{
"name": "CVE-2024-42110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42110"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2025-61727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61727"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-37820",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37820"
},
{
"name": "CVE-2024-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53179"
},
{
"name": "CVE-2024-57945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57945"
},
{
"name": "CVE-2023-54233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54233"
},
{
"name": "CVE-2024-43899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43899"
},
{
"name": "CVE-2025-21986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21986"
},
{
"name": "CVE-2019-15213",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-15213"
},
{
"name": "CVE-2025-38234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38234"
},
{
"name": "CVE-2022-49935",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49935"
},
{
"name": "CVE-2021-44532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44532"
},
{
"name": "CVE-2025-38011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38011"
},
{
"name": "CVE-2022-49534",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49534"
},
{
"name": "CVE-2024-57974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57974"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2025-68190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68190"
},
{
"name": "CVE-2023-53010",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53010"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-57888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57888"
},
{
"name": "CVE-2025-65637",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-65637"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2023-54237",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54237"
},
{
"name": "CVE-2025-37878",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37878"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2026-23207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23207"
},
{
"name": "CVE-2025-40252",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40252"
},
{
"name": "CVE-2022-49134",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49134"
},
{
"name": "CVE-2025-21946",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21946"
},
{
"name": "CVE-2025-21838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21838"
},
{
"name": "CVE-2022-49333",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49333"
},
{
"name": "CVE-2023-53791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53791"
},
{
"name": "CVE-2025-27111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27111"
},
{
"name": "CVE-2024-49994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49994"
},
{
"name": "CVE-2025-53859",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53859"
},
{
"name": "CVE-2019-19814",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-19814"
},
{
"name": "CVE-2022-49136",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49136"
},
{
"name": "CVE-2025-68255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68255"
},
{
"name": "CVE-2025-47910",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47910"
},
{
"name": "CVE-2023-54081",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54081"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-44962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44962"
},
{
"name": "CVE-2025-68322",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68322"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2026-22980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22980"
},
{
"name": "CVE-2026-23138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23138"
},
{
"name": "CVE-2025-39927",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39927"
},
{
"name": "CVE-2026-1703",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1703"
},
{
"name": "CVE-2023-26551",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26551"
},
{
"name": "CVE-2024-46857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46857"
},
{
"name": "CVE-2024-58013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58013"
},
{
"name": "CVE-2024-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53210"
},
{
"name": "CVE-2023-54185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54185"
},
{
"name": "CVE-2022-49342",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49342"
},
{
"name": "CVE-2015-8553",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-8553"
},
{
"name": "CVE-2025-40277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40277"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2024-36966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36966"
},
{
"name": "CVE-2023-53332",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53332"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-58095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58095"
},
{
"name": "CVE-2024-45010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45010"
},
{
"name": "CVE-2022-49471",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49471"
},
{
"name": "CVE-2025-68174",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68174"
},
{
"name": "CVE-2022-48976",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48976"
},
{
"name": "CVE-2025-21751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21751"
},
{
"name": "CVE-2023-53753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53753"
},
{
"name": "CVE-2024-41074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41074"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2025-40272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40272"
},
{
"name": "CVE-2024-50106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50106"
},
{
"name": "CVE-2025-23162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23162"
},
{
"name": "CVE-2026-23133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23133"
},
{
"name": "CVE-2025-71093",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71093"
},
{
"name": "CVE-2025-46727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-46727"
},
{
"name": "CVE-2017-13694",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-13694"
},
{
"name": "CVE-2025-71102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71102"
},
{
"name": "CVE-2026-23212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23212"
},
{
"name": "CVE-2013-7445",
"url": "https://www.cve.org/CVERecord?id=CVE-2013-7445"
},
{
"name": "CVE-2026-23170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23170"
},
{
"name": "CVE-2023-52701",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52701"
},
{
"name": "CVE-2024-49906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49906"
},
{
"name": "CVE-2024-26647",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26647"
},
{
"name": "CVE-2025-68759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68759"
},
{
"name": "CVE-2024-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47809"
},
{
"name": "CVE-2026-23204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23204"
},
{
"name": "CVE-2022-49317",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49317"
},
{
"name": "CVE-2026-23019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23019"
},
{
"name": "CVE-2018-12928",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-12928"
},
{
"name": "CVE-2025-71188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71188"
},
{
"name": "CVE-2023-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38552"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-56607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56607"
},
{
"name": "CVE-2025-40345",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40345"
},
{
"name": "CVE-2026-27142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27142"
},
{
"name": "CVE-2024-49904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49904"
},
{
"name": "CVE-2023-53671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53671"
},
{
"name": "CVE-2025-40354",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40354"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2026-28417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28417"
},
{
"name": "CVE-2025-37931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37931"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2023-29942",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29942"
},
{
"name": "CVE-2026-23125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23125"
},
{
"name": "CVE-2026-0966",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0966"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-3238",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3238"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2026-22185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22185"
},
{
"name": "CVE-2023-53781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53781"
},
{
"name": "CVE-2023-53584",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53584"
},
{
"name": "CVE-2024-57809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57809"
},
{
"name": "CVE-2025-38057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38057"
},
{
"name": "CVE-2025-68733",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68733"
},
{
"name": "CVE-2024-56719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56719"
},
{
"name": "CVE-2022-50418",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50418"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2025-47906",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47906"
},
{
"name": "CVE-2023-53460",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53460"
},
{
"name": "CVE-2026-23214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23214"
},
{
"name": "CVE-2024-52559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52559"
},
{
"name": "CVE-2025-68188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68188"
},
{
"name": "CVE-2025-40269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40269"
},
{
"name": "CVE-2024-56671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56671"
},
{
"name": "CVE-2025-68335",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68335"
},
{
"name": "CVE-2025-71079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71079"
},
{
"name": "CVE-2025-62626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62626"
},
{
"name": "CVE-2025-39940",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39940"
},
{
"name": "CVE-2023-52751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52751"
},
{
"name": "CVE-2022-49562",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49562"
},
{
"name": "CVE-2025-37861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37861"
},
{
"name": "CVE-2023-53483",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53483"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2025-37938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37938"
},
{
"name": "CVE-2025-37746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37746"
},
{
"name": "CVE-2022-38076",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-38076"
},
{
"name": "CVE-2025-38368",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38368"
},
{
"name": "CVE-2026-23178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23178"
},
{
"name": "CVE-2025-59375",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59375"
},
{
"name": "CVE-2025-31133",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-31133"
},
{
"name": "CVE-2026-22997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22997"
},
{
"name": "CVE-2024-56368",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56368"
},
{
"name": "CVE-2025-40075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40075"
},
{
"name": "CVE-2022-49172",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49172"
},
{
"name": "CVE-2025-8194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8194"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2025-39977",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39977"
},
{
"name": "CVE-2025-38331",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38331"
},
{
"name": "CVE-2026-23240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23240"
},
{
"name": "CVE-2025-68330",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68330"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2024-49945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49945"
},
{
"name": "CVE-2022-44033",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-44033"
},
{
"name": "CVE-2024-56757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56757"
},
{
"name": "CVE-2023-53662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53662"
},
{
"name": "CVE-2025-38069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38069"
},
{
"name": "CVE-2022-49750",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49750"
},
{
"name": "CVE-2023-53707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53707"
},
{
"name": "CVE-2023-53115",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53115"
},
{
"name": "CVE-2025-71196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71196"
},
{
"name": "CVE-2025-21645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21645"
},
{
"name": "CVE-2023-54107",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54107"
},
{
"name": "CVE-2022-48646",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48646"
},
{
"name": "CVE-2024-43912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43912"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-58012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58012"
},
{
"name": "CVE-2025-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50181"
},
{
"name": "CVE-2025-61663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61663"
},
{
"name": "CVE-2025-68772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68772"
},
{
"name": "CVE-2024-49891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49891"
},
{
"name": "CVE-2024-36948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36948"
},
{
"name": "CVE-2022-48887",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48887"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2024-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53187"
},
{
"name": "CVE-2023-45929",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45929"
},
{
"name": "CVE-2025-68343",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68343"
},
{
"name": "CVE-2025-66382",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66382"
},
{
"name": "CVE-2024-57795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57795"
},
{
"name": "CVE-2025-37855",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37855"
},
{
"name": "CVE-2025-21816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21816"
},
{
"name": "CVE-2021-33115",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33115"
},
{
"name": "CVE-2025-21780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21780"
},
{
"name": "CVE-2020-26559",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26559"
},
{
"name": "CVE-2024-12705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12705"
},
{
"name": "CVE-2025-69421",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69421"
},
{
"name": "CVE-2020-26140",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26140"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2026-23191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23191"
},
{
"name": "CVE-2026-32249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-32249"
},
{
"name": "CVE-2025-37899",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37899"
},
{
"name": "CVE-2026-23078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23078"
},
{
"name": "CVE-2025-40362",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40362"
},
{
"name": "CVE-2025-68201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68201"
},
{
"name": "CVE-2024-43831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43831"
},
{
"name": "CVE-2023-30630",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-30630"
},
{
"name": "CVE-2025-40289",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40289"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2025-38330",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38330"
},
{
"name": "CVE-2025-58188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58188"
},
{
"name": "CVE-2017-13693",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-13693"
},
{
"name": "CVE-2025-68768",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68768"
},
{
"name": "CVE-2024-50284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50284"
},
{
"name": "CVE-2022-49306",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49306"
},
{
"name": "CVE-2024-49898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49898"
},
{
"name": "CVE-2025-36423",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36423"
},
{
"name": "CVE-2022-49622",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49622"
},
{
"name": "CVE-2025-68785",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68785"
},
{
"name": "CVE-2024-50211",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50211"
},
{
"name": "CVE-2025-38507",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38507"
},
{
"name": "CVE-2022-50284",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50284"
},
{
"name": "CVE-2025-39989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39989"
},
{
"name": "CVE-2023-6240",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6240"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-22028",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22028"
},
{
"name": "CVE-2024-41008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41008"
},
{
"name": "CVE-2024-27035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27035"
},
{
"name": "CVE-2023-53218",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53218"
},
{
"name": "CVE-2022-25836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25836"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2025-68808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68808"
},
{
"name": "CVE-2025-4674",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4674"
},
{
"name": "CVE-2025-29934",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29934"
},
{
"name": "CVE-2024-27005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27005"
},
{
"name": "CVE-2025-68223",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68223"
},
{
"name": "CVE-2022-49133",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49133"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2025-68783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68783"
},
{
"name": "CVE-2025-71147",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71147"
},
{
"name": "CVE-2025-38438",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38438"
},
{
"name": "CVE-2025-40032",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40032"
},
{
"name": "CVE-2023-26555",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26555"
},
{
"name": "CVE-2023-1193",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1193"
},
{
"name": "CVE-2025-71220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71220"
},
{
"name": "CVE-2024-46806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46806"
},
{
"name": "CVE-2022-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50073"
},
{
"name": "CVE-2025-68724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68724"
},
{
"name": "CVE-2025-5278",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5278"
},
{
"name": "CVE-2026-23103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23103"
},
{
"name": "CVE-2026-23074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23074"
},
{
"name": "CVE-2025-68786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68786"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2022-50393",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50393"
},
{
"name": "CVE-2025-68779",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68779"
},
{
"name": "CVE-2024-56433",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56433"
},
{
"name": "CVE-2025-21819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21819"
},
{
"name": "CVE-2025-48514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48514"
},
{
"name": "CVE-2024-41030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41030"
},
{
"name": "CVE-2025-71199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71199"
},
{
"name": "CVE-2024-47664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47664"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2026-25749",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25749"
},
{
"name": "CVE-2024-49504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49504"
},
{
"name": "CVE-2025-38118",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38118"
},
{
"name": "CVE-2023-0464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0464"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2022-50500",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50500"
},
{
"name": "CVE-2019-14899",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-14899"
},
{
"name": "CVE-2022-29526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29526"
},
{
"name": "CVE-2024-53098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53098"
},
{
"name": "CVE-2025-68797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68797"
},
{
"name": "CVE-2024-49968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49968"
},
{
"name": "CVE-2025-68358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68358"
},
{
"name": "CVE-2025-40206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40206"
},
{
"name": "CVE-2026-23180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23180"
},
{
"name": "CVE-2021-0164",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0164"
},
{
"name": "CVE-2026-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26958"
},
{
"name": "CVE-2024-46870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46870"
},
{
"name": "CVE-2022-49178",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49178"
},
{
"name": "CVE-2024-22195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22195"
},
{
"name": "CVE-2023-23931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23931"
},
{
"name": "CVE-2024-49929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49929"
},
{
"name": "CVE-2025-40257",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40257"
},
{
"name": "CVE-2023-53748",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53748"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2022-49173",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49173"
},
{
"name": "CVE-2024-45781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45781"
},
{
"name": "CVE-2025-71125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71125"
},
{
"name": "CVE-2025-21947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21947"
},
{
"name": "CVE-2024-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53056"
},
{
"name": "CVE-2022-50551",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50551"
},
{
"name": "CVE-2026-26269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26269"
},
{
"name": "CVE-2024-43872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43872"
},
{
"name": "CVE-2025-71108",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71108"
},
{
"name": "CVE-2022-49401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49401"
},
{
"name": "CVE-2025-71069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71069"
},
{
"name": "CVE-2025-68312",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68312"
},
{
"name": "CVE-2025-68284",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68284"
},
{
"name": "CVE-2025-68194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68194"
},
{
"name": "CVE-2023-52939",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52939"
},
{
"name": "CVE-2024-14027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-14027"
},
{
"name": "CVE-2025-38269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38269"
},
{
"name": "CVE-2025-69649",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69649"
},
{
"name": "CVE-2024-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53175"
},
{
"name": "CVE-2025-21734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21734"
},
{
"name": "CVE-2024-49859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49859"
},
{
"name": "CVE-2025-40336",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40336"
},
{
"name": "CVE-2025-37945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37945"
},
{
"name": "CVE-2025-71195",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71195"
},
{
"name": "CVE-2022-49766",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49766"
},
{
"name": "CVE-2025-6141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6141"
},
{
"name": "CVE-2025-22043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22043"
},
{
"name": "CVE-2024-49569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49569"
},
{
"name": "CVE-2025-61984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61984"
},
{
"name": "CVE-2023-52569",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52569"
},
{
"name": "CVE-2024-56609",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56609"
},
{
"name": "CVE-2022-49940",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49940"
},
{
"name": "CVE-2026-23083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23083"
},
{
"name": "CVE-2025-38422",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38422"
},
{
"name": "CVE-2024-56611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56611"
},
{
"name": "CVE-2025-21927",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21927"
},
{
"name": "CVE-2026-23088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23088"
},
{
"name": "CVE-2020-25743",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-25743"
},
{
"name": "CVE-2022-50167",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50167"
},
{
"name": "CVE-2025-68183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68183"
},
{
"name": "CVE-2026-27704",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27704"
},
{
"name": "CVE-2022-48064",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48064"
},
{
"name": "CVE-2023-45896",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45896"
},
{
"name": "CVE-2025-37903",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37903"
},
{
"name": "CVE-2025-68161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68161"
},
{
"name": "CVE-2025-68774",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68774"
},
{
"name": "CVE-2024-49940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49940"
},
{
"name": "CVE-2025-40263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40263"
},
{
"name": "CVE-2021-3735",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3735"
},
{
"name": "CVE-2025-40353",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40353"
},
{
"name": "CVE-2024-46861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46861"
},
{
"name": "CVE-2025-40222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40222"
},
{
"name": "CVE-2022-50634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50634"
},
{
"name": "CVE-2025-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52881"
},
{
"name": "CVE-2025-54514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54514"
},
{
"name": "CVE-2025-71202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71202"
},
{
"name": "CVE-2015-7837",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-7837"
},
{
"name": "CVE-2025-0677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0677"
},
{
"name": "CVE-2024-45780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45780"
},
{
"name": "CVE-2024-46749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46749"
},
{
"name": "CVE-2022-50492",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50492"
},
{
"name": "CVE-2024-49888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49888"
},
{
"name": "CVE-2022-50406",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50406"
},
{
"name": "CVE-2023-26552",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26552"
},
{
"name": "CVE-2024-49921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49921"
},
{
"name": "CVE-2024-5535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5535"
},
{
"name": "CVE-2026-23108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23108"
},
{
"name": "CVE-2025-71180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71180"
},
{
"name": "CVE-2025-38232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38232"
},
{
"name": "CVE-2025-68244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68244"
},
{
"name": "CVE-2025-59691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59691"
},
{
"name": "CVE-2024-46830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46830"
},
{
"name": "CVE-2023-52481",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52481"
},
{
"name": "CVE-2023-52888",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52888"
},
{
"name": "CVE-2025-22057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22057"
},
{
"name": "CVE-2024-47666",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47666"
},
{
"name": "CVE-2025-22868",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22868"
},
{
"name": "CVE-2025-40278",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40278"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2024-50056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50056"
},
{
"name": "CVE-2025-71194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71194"
},
{
"name": "CVE-2026-1788",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1788"
},
{
"name": "CVE-2023-53721",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53721"
},
{
"name": "CVE-2025-22113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22113"
},
{
"name": "CVE-2025-40342",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40342"
},
{
"name": "CVE-2022-50256",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50256"
},
{
"name": "CVE-2024-42091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42091"
},
{
"name": "CVE-2024-27983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27983"
},
{
"name": "CVE-2025-37907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37907"
},
{
"name": "CVE-2024-38625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38625"
},
{
"name": "CVE-2025-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23085"
},
{
"name": "CVE-2026-22796",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22796"
},
{
"name": "CVE-2023-4010",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4010"
},
{
"name": "CVE-2025-38425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38425"
},
{
"name": "CVE-2024-46727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46727"
},
{
"name": "CVE-2023-54028",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54028"
},
{
"name": "CVE-2024-42129",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42129"
},
{
"name": "CVE-2023-54105",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54105"
},
{
"name": "CVE-2018-17977",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-17977"
},
{
"name": "CVE-2019-1010204",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-1010204"
},
{
"name": "CVE-2023-53992",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53992"
},
{
"name": "CVE-2026-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26960"
},
{
"name": "CVE-2025-40210",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40210"
},
{
"name": "CVE-2022-50354",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50354"
},
{
"name": "CVE-2025-61724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61724"
},
{
"name": "CVE-2026-22999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22999"
},
{
"name": "CVE-2025-21812",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21812"
},
{
"name": "CVE-2025-71082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71082"
},
{
"name": "CVE-2025-12801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12801"
},
{
"name": "CVE-2024-58015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58015"
},
{
"name": "CVE-2026-23068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23068"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2025-68765",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68765"
},
{
"name": "CVE-2026-23089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23089"
},
{
"name": "CVE-2024-43823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43823"
},
{
"name": "CVE-2023-52589",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52589"
},
{
"name": "CVE-2022-41848",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-41848"
},
{
"name": "CVE-2026-23216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23216"
},
{
"name": "CVE-2023-53434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53434"
},
{
"name": "CVE-2023-29935",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29935"
},
{
"name": "CVE-2023-35061",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-35061"
},
{
"name": "CVE-2025-71132",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71132"
},
{
"name": "CVE-2025-71225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71225"
},
{
"name": "CVE-2026-21636",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21636"
},
{
"name": "CVE-2026-23239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23239"
},
{
"name": "CVE-2021-0172",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0172"
},
{
"name": "CVE-2024-47662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47662"
},
{
"name": "CVE-2018-12930",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-12930"
},
{
"name": "CVE-2026-23071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23071"
},
{
"name": "CVE-2024-49970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49970"
},
{
"name": "CVE-2024-41067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41067"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2026-23056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23056"
},
{
"name": "CVE-2025-40193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40193"
},
{
"name": "CVE-2023-32644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32644"
},
{
"name": "CVE-2025-71077",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71077"
},
{
"name": "CVE-2025-21908",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21908"
},
{
"name": "CVE-2024-46681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46681"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2025-61732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61732"
},
{
"name": "CVE-2025-61723",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61723"
},
{
"name": "CVE-2025-9232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9232"
},
{
"name": "CVE-2025-40012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40012"
},
{
"name": "CVE-2025-40279",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40279"
},
{
"name": "CVE-2026-0964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0964"
},
{
"name": "CVE-2025-68328",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68328"
},
{
"name": "CVE-2023-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53178"
},
{
"name": "CVE-2024-47141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47141"
},
{
"name": "CVE-2024-8354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8354"
},
{
"name": "CVE-2023-54323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54323"
},
{
"name": "CVE-2025-37952",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37952"
},
{
"name": "CVE-2023-45803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45803"
},
{
"name": "CVE-2025-0689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0689"
},
{
"name": "CVE-2022-50316",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50316"
},
{
"name": "CVE-2023-31347",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31347"
},
{
"name": "CVE-2025-40084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40084"
},
{
"name": "CVE-2025-22111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22111"
},
{
"name": "CVE-2023-53657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53657"
},
{
"name": "CVE-2024-49915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49915"
},
{
"name": "CVE-2026-23063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23063"
},
{
"name": "CVE-2025-55132",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55132"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2022-49759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49759"
},
{
"name": "CVE-2025-61795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61795"
},
{
"name": "CVE-2026-23073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23073"
},
{
"name": "CVE-2022-49167",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49167"
},
{
"name": "CVE-2025-68311",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68311"
},
{
"name": "CVE-2026-27903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27903"
},
{
"name": "CVE-2023-54023",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54023"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2023-31082",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31082"
},
{
"name": "CVE-2024-41088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41088"
},
{
"name": "CVE-2025-0690",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0690"
},
{
"name": "CVE-2025-71114",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71114"
},
{
"name": "CVE-2023-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53052"
},
{
"name": "CVE-2026-23058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23058"
},
{
"name": "CVE-2022-49234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49234"
},
{
"name": "CVE-2022-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50163"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2025-71067",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71067"
},
{
"name": "CVE-2024-49919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49919"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2025-71182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71182"
},
{
"name": "CVE-2020-26556",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26556"
},
{
"name": "CVE-2025-46394",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-46394"
},
{
"name": "CVE-2025-66471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66471"
},
{
"name": "CVE-2026-23038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23038"
},
{
"name": "CVE-2025-40341",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40341"
},
{
"name": "CVE-2025-38409",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38409"
},
{
"name": "CVE-2021-3826",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3826"
},
{
"name": "CVE-2024-26699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26699"
},
{
"name": "CVE-2024-57876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57876"
},
{
"name": "CVE-2024-58019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58019"
},
{
"name": "CVE-2026-25679",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25679"
},
{
"name": "CVE-2026-22990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22990"
},
{
"name": "CVE-2025-14017",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14017"
},
{
"name": "CVE-2022-50390",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50390"
},
{
"name": "CVE-2026-23000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23000"
},
{
"name": "CVE-2026-21441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21441"
},
{
"name": "CVE-2024-45337",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45337"
},
{
"name": "CVE-2025-71186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71186"
},
{
"name": "CVE-2024-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53220"
},
{
"name": "CVE-2026-23176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23176"
},
{
"name": "CVE-2023-53539",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53539"
},
{
"name": "CVE-2025-13836",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13836"
},
{
"name": "CVE-2025-40338",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40338"
},
{
"name": "CVE-2025-68821",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68821"
},
{
"name": "CVE-2025-31648",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-31648"
},
{
"name": "CVE-2025-0678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0678"
},
{
"name": "CVE-2024-41075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41075"
},
{
"name": "CVE-2026-23026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23026"
},
{
"name": "CVE-2024-56674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56674"
},
{
"name": "CVE-2024-27982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27982"
},
{
"name": "CVE-2025-40195",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40195"
},
{
"name": "CVE-2024-31884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31884"
},
{
"name": "CVE-2025-21976",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21976"
},
{
"name": "CVE-2019-1563",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-1563"
},
{
"name": "CVE-2026-1002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1002"
},
{
"name": "CVE-2026-23128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23128"
},
{
"name": "CVE-2024-57975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57975"
},
{
"name": "CVE-2023-53574",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53574"
},
{
"name": "CVE-2022-50166",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50166"
},
{
"name": "CVE-2025-61725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61725"
},
{
"name": "CVE-2025-68325",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68325"
},
{
"name": "CVE-2025-71190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71190"
},
{
"name": "CVE-2024-56738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56738"
},
{
"name": "CVE-2022-50778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50778"
},
{
"name": "CVE-2024-42067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42067"
},
{
"name": "CVE-2022-49971",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49971"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2025-21693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21693"
},
{
"name": "CVE-2025-71203",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71203"
},
{
"name": "CVE-2024-56657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56657"
},
{
"name": "CVE-2025-39789",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39789"
},
{
"name": "CVE-2022-49124",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49124"
},
{
"name": "CVE-2024-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49901"
},
{
"name": "CVE-2023-52700",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52700"
},
{
"name": "CVE-2024-56583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56583"
},
{
"name": "CVE-2022-50195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50195"
},
{
"name": "CVE-2025-40358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40358"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-56712",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56712"
},
{
"name": "CVE-2025-68318",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68318"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2023-52634",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52634"
},
{
"name": "CVE-2025-22104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22104"
},
{
"name": "CVE-2022-2795",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2795"
},
{
"name": "CVE-2025-62526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62526"
},
{
"name": "CVE-2024-49918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49918"
},
{
"name": "CVE-2025-68296",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68296"
},
{
"name": "CVE-2023-53785",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53785"
},
{
"name": "CVE-2024-45776",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45776"
},
{
"name": "CVE-2022-50090",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50090"
},
{
"name": "CVE-2025-40340",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40340"
},
{
"name": "CVE-2025-68332",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68332"
},
{
"name": "CVE-2020-14356",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14356"
},
{
"name": "CVE-2025-68745",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68745"
},
{
"name": "CVE-2023-54263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54263"
},
{
"name": "CVE-2025-71104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71104"
},
{
"name": "CVE-2026-22978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22978"
},
{
"name": "CVE-2023-53764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53764"
},
{
"name": "CVE-2024-53687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53687"
},
{
"name": "CVE-2025-39901",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39901"
},
{
"name": "CVE-2025-40283",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40283"
},
{
"name": "CVE-2025-5918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5918"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2025-40324",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40324"
},
{
"name": "CVE-2025-38672",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38672"
},
{
"name": "CVE-2023-54181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54181"
},
{
"name": "CVE-2025-0684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0684"
},
{
"name": "CVE-2025-10158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10158"
},
{
"name": "CVE-2025-68378",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68378"
},
{
"name": "CVE-2024-47794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47794"
},
{
"name": "CVE-2026-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23146"
},
{
"name": "CVE-2025-38272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38272"
},
{
"name": "CVE-2024-10524",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-10524"
},
{
"name": "CVE-2025-40146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40146"
},
{
"name": "CVE-2025-38359",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38359"
},
{
"name": "CVE-2019-20794",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20794"
},
{
"name": "CVE-2023-53849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53849"
},
{
"name": "CVE-2022-4543",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4543"
},
{
"name": "CVE-2025-21899",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21899"
},
{
"name": "CVE-2024-35195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35195"
},
{
"name": "CVE-2025-38129",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38129"
},
{
"name": "CVE-2026-23037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23037"
},
{
"name": "CVE-2023-53627",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53627"
},
{
"name": "CVE-2025-40250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40250"
},
{
"name": "CVE-2025-38091",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38091"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2025-40264",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40264"
},
{
"name": "CVE-2025-38334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38334"
},
{
"name": "CVE-2023-53575",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53575"
},
{
"name": "CVE-2022-49516",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49516"
},
{
"name": "CVE-2025-40778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40778"
},
{
"name": "CVE-2025-38728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38728"
},
{
"name": "CVE-2022-3523",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3523"
},
{
"name": "CVE-2026-26157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26157"
},
{
"name": "CVE-2026-23001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23001"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2025-68367",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68367"
},
{
"name": "CVE-2025-71224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71224"
},
{
"name": "CVE-2025-22072",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22072"
},
{
"name": "CVE-2025-68820",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68820"
},
{
"name": "CVE-2021-45261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-45261"
},
{
"name": "CVE-2025-40074",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40074"
},
{
"name": "CVE-2026-23193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23193"
},
{
"name": "CVE-2025-40321",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40321"
},
{
"name": "CVE-2024-47736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47736"
},
{
"name": "CVE-2023-53037",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53037"
},
{
"name": "CVE-2024-46842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46842"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2025-13462",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13462"
},
{
"name": "CVE-2024-50112",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50112"
},
{
"name": "CVE-2025-69646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69646"
},
{
"name": "CVE-2023-54207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54207"
},
{
"name": "CVE-2026-23215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23215"
},
{
"name": "CVE-2024-28956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28956"
},
{
"name": "CVE-2025-68740",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68740"
},
{
"name": "CVE-2020-26142",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26142"
},
{
"name": "CVE-2022-49955",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49955"
},
{
"name": "CVE-2023-53628",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53628"
},
{
"name": "CVE-2025-29943",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29943"
},
{
"name": "CVE-2025-39978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39978"
},
{
"name": "CVE-2023-31346",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31346"
},
{
"name": "CVE-2024-9143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9143"
},
{
"name": "CVE-2025-40158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40158"
},
{
"name": "CVE-2024-56201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56201"
},
{
"name": "CVE-2025-38071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38071"
},
{
"name": "CVE-2025-38140",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38140"
},
{
"name": "CVE-2022-50002",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50002"
},
{
"name": "CVE-2025-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38621"
},
{
"name": "CVE-2025-68742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68742"
},
{
"name": "CVE-2025-39908",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39908"
},
{
"name": "CVE-2026-24842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-24842"
},
{
"name": "CVE-2024-49920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49920"
},
{
"name": "CVE-2025-40282",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40282"
},
{
"name": "CVE-2026-23118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23118"
},
{
"name": "CVE-2025-34034",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-34034"
},
{
"name": "CVE-2025-37984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37984"
},
{
"name": "CVE-2025-59692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59692"
},
{
"name": "CVE-2022-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50116"
},
{
"name": "CVE-2018-12931",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-12931"
},
{
"name": "CVE-2025-40168",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40168"
},
{
"name": "CVE-2025-37856",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37856"
},
{
"name": "CVE-2022-50224",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50224"
},
{
"name": "CVE-2025-22874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22874"
},
{
"name": "CVE-2020-13791",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-13791"
},
{
"name": "CVE-2026-23950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23950"
},
{
"name": "CVE-2024-49990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49990"
},
{
"name": "CVE-2020-15802",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-15802"
},
{
"name": "CVE-2020-24240",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-24240"
},
{
"name": "CVE-2024-46718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46718"
},
{
"name": "CVE-2025-68816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68816"
},
{
"name": "CVE-2024-41045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41045"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2022-50552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50552"
},
{
"name": "CVE-2021-0066",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0066"
},
{
"name": "CVE-2025-38333",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38333"
},
{
"name": "CVE-2023-53376",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53376"
},
{
"name": "CVE-2023-53538",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53538"
},
{
"name": "CVE-2025-68192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68192"
},
{
"name": "CVE-2024-5569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5569"
},
{
"name": "CVE-2025-68379",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68379"
},
{
"name": "CVE-2022-50357",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50357"
},
{
"name": "CVE-2024-57952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57952"
},
{
"name": "CVE-2025-68256",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68256"
},
{
"name": "CVE-2025-68777",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68777"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2022-50303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50303"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2025-68254",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68254"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2025-38059",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38059"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53176"
},
{
"name": "CVE-2025-37956",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37956"
},
{
"name": "CVE-2025-40196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40196"
},
{
"name": "CVE-2024-49880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49880"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2025-38117",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38117"
},
{
"name": "CVE-2017-13165",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-13165"
},
{
"name": "CVE-2025-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38556"
},
{
"name": "CVE-2025-68171",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68171"
},
{
"name": "CVE-2025-39932",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39932"
},
{
"name": "CVE-2024-47683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47683"
},
{
"name": "CVE-2023-6237",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6237"
},
{
"name": "CVE-2024-46811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46811"
},
{
"name": "CVE-2025-21985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21985"
},
{
"name": "CVE-2025-22109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22109"
},
{
"name": "CVE-2025-38300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38300"
},
{
"name": "CVE-2025-40040",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40040"
},
{
"name": "CVE-2023-53635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53635"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2026-22982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22982"
},
{
"name": "CVE-2025-23132",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23132"
},
{
"name": "CVE-2024-47678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47678"
},
{
"name": "CVE-2022-49531",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49531"
},
{
"name": "CVE-2022-49504",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49504"
},
{
"name": "CVE-2025-1376",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1376"
},
{
"name": "CVE-2022-49810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49810"
},
{
"name": "CVE-2025-47912",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47912"
},
{
"name": "CVE-2025-71109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71109"
},
{
"name": "CVE-2023-26586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26586"
},
{
"name": "CVE-2025-38373",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38373"
},
{
"name": "CVE-2025-66861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66861"
},
{
"name": "CVE-2025-40095",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40095"
},
{
"name": "CVE-2025-37957",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37957"
},
{
"name": "CVE-2025-38369",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38369"
},
{
"name": "CVE-2023-43804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-43804"
},
{
"name": "CVE-2024-44950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44950"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2022-50332",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50332"
},
{
"name": "CVE-2023-53822",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53822"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2025-71222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71222"
},
{
"name": "CVE-2022-50461",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50461"
},
{
"name": "CVE-2025-21801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21801"
},
{
"name": "CVE-2023-26554",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26554"
},
{
"name": "CVE-2025-38486",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38486"
},
{
"name": "CVE-2021-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-26934"
},
{
"name": "CVE-2023-53466",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53466"
},
{
"name": "CVE-2025-21629",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21629"
},
{
"name": "CVE-2025-71118",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71118"
},
{
"name": "CVE-2023-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53168"
},
{
"name": "CVE-2022-49528",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49528"
},
{
"name": "CVE-2025-68160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68160"
},
{
"name": "CVE-2022-45888",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45888"
},
{
"name": "CVE-2022-49218",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49218"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2025-39754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39754"
},
{
"name": "CVE-2025-40286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40286"
},
{
"name": "CVE-2022-49967",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49967"
},
{
"name": "CVE-2025-68327",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68327"
},
{
"name": "CVE-2024-2236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2236"
},
{
"name": "CVE-2022-49245",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49245"
},
{
"name": "CVE-2025-38098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38098"
},
{
"name": "CVE-2023-52682",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52682"
},
{
"name": "CVE-2022-50871",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50871"
},
{
"name": "CVE-2025-71150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71150"
},
{
"name": "CVE-2025-71229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71229"
},
{
"name": "CVE-2026-23213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23213"
},
{
"name": "CVE-2025-39958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39958"
},
{
"name": "CVE-2018-8956",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8956"
},
{
"name": "CVE-2025-40266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40266"
},
{
"name": "CVE-2026-23091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23091"
},
{
"name": "CVE-2025-68241",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68241"
},
{
"name": "CVE-2022-49420",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49420"
},
{
"name": "CVE-2022-40964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40964"
},
{
"name": "CVE-2025-69873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69873"
},
{
"name": "CVE-2026-3441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3441"
},
{
"name": "CVE-2024-36244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36244"
},
{
"name": "CVE-2023-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53149"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2024-49987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49987"
},
{
"name": "CVE-2025-60753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-60753"
},
{
"name": "CVE-2022-50746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50746"
},
{
"name": "CVE-2025-52565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52565"
},
{
"name": "CVE-2024-50034",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50034"
},
{
"name": "CVE-2025-38259",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38259"
},
{
"name": "CVE-2025-71192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71192"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2022-49943",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49943"
},
{
"name": "CVE-2022-50260",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50260"
},
{
"name": "CVE-2025-40135",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40135"
},
{
"name": "CVE-2025-67735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-67735"
},
{
"name": "CVE-2026-23121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23121"
},
{
"name": "CVE-2020-12319",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-12319"
},
{
"name": "CVE-2025-37951",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37951"
},
{
"name": "CVE-2023-50495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50495"
},
{
"name": "CVE-2024-49568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49568"
},
{
"name": "CVE-2025-21750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21750"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2017-11164",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-11164"
},
{
"name": "CVE-2023-3397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3397"
},
{
"name": "CVE-2025-68734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68734"
},
{
"name": "CVE-2024-26672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26672"
},
{
"name": "CVE-2024-57924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57924"
},
{
"name": "CVE-2025-37947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37947"
},
{
"name": "CVE-2025-68776",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68776"
},
{
"name": "CVE-2025-61728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61728"
},
{
"name": "CVE-2025-71066",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71066"
},
{
"name": "CVE-2026-0965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0965"
},
{
"name": "CVE-2023-53806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53806"
},
{
"name": "CVE-2025-21817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21817"
},
{
"name": "CVE-2025-68972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68972"
},
{
"name": "CVE-2025-68799",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68799"
},
{
"name": "CVE-2021-33139",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33139"
},
{
"name": "CVE-2025-58186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58186"
},
{
"name": "CVE-2025-21825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21825"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2025-68345",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68345"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2024-50057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50057"
},
{
"name": "CVE-2025-38343",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38343"
},
{
"name": "CVE-2025-71097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71097"
},
{
"name": "CVE-2024-46808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46808"
},
{
"name": "CVE-2026-26158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26158"
},
{
"name": "CVE-2025-38202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38202"
},
{
"name": "CVE-2025-68288",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68288"
},
{
"name": "CVE-2025-38168",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38168"
},
{
"name": "CVE-2023-53547",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53547"
},
{
"name": "CVE-2019-20426",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20426"
},
{
"name": "CVE-2025-71107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71107"
},
{
"name": "CVE-2024-0727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0727"
},
{
"name": "CVE-2025-40310",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40310"
},
{
"name": "CVE-2026-29786",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-29786"
},
{
"name": "CVE-2025-58187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58187"
},
{
"name": "CVE-2025-40083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40083"
},
{
"name": "CVE-2023-6129",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6129"
},
{
"name": "CVE-2024-56584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56584"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2025-71111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71111"
},
{
"name": "CVE-2022-4899",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4899"
},
{
"name": "CVE-2025-71152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71152"
},
{
"name": "CVE-2024-42139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42139"
},
{
"name": "CVE-2024-56692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56692"
},
{
"name": "CVE-2024-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53196"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2022-50212",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50212"
},
{
"name": "CVE-2026-23087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23087"
},
{
"name": "CVE-2023-54259",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54259"
},
{
"name": "CVE-2025-68802",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68802"
},
{
"name": "CVE-2023-54067",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54067"
},
{
"name": "CVE-2025-1369",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1369"
},
{
"name": "CVE-2022-3219",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3219"
},
{
"name": "CVE-2025-68317",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68317"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2025-71185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71185"
},
{
"name": "CVE-2022-2961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2961"
},
{
"name": "CVE-2025-40331",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40331"
},
{
"name": "CVE-2025-4673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4673"
},
{
"name": "CVE-2022-49635",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49635"
},
{
"name": "CVE-2024-50017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50017"
},
{
"name": "CVE-2026-23096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23096"
},
{
"name": "CVE-2024-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53241"
},
{
"name": "CVE-2025-14180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14180"
},
{
"name": "CVE-2026-23949",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23949"
},
{
"name": "CVE-2025-38704",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38704"
},
{
"name": "CVE-2023-34969",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34969"
},
{
"name": "CVE-2021-33155",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33155"
},
{
"name": "CVE-2025-68337",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68337"
},
{
"name": "CVE-2024-57899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57899"
},
{
"name": "CVE-2024-49928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49928"
},
{
"name": "CVE-2025-21885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21885"
},
{
"name": "CVE-2024-50187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50187"
},
{
"name": "CVE-2022-50851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50851"
},
{
"name": "CVE-2025-36001",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36001"
},
{
"name": "CVE-2022-50464",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50464"
},
{
"name": "CVE-2025-38674",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38674"
},
{
"name": "CVE-2025-40093",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40093"
},
{
"name": "CVE-2020-26560",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26560"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-45777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45777"
},
{
"name": "CVE-2025-38040",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38040"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2022-49965",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49965"
},
{
"name": "CVE-2025-54771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54771"
},
{
"name": "CVE-2024-0564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0564"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2025-71131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71131"
},
{
"name": "CVE-2022-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49961"
},
{
"name": "CVE-2025-69651",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69651"
},
{
"name": "CVE-2025-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38552"
},
{
"name": "CVE-2025-40335",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40335"
},
{
"name": "CVE-2025-40149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40149"
},
{
"name": "CVE-2024-58098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58098"
},
{
"name": "CVE-2025-22871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22871"
},
{
"name": "CVE-2022-28667",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28667"
},
{
"name": "CVE-2023-53383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53383"
},
{
"name": "CVE-2024-46717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46717"
},
{
"name": "CVE-2024-25743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25743"
},
{
"name": "CVE-2022-50704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50704"
},
{
"name": "CVE-2025-40164",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40164"
},
{
"name": "CVE-2023-54125",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54125"
},
{
"name": "CVE-2025-10911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10911"
},
{
"name": "CVE-2026-23164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23164"
},
{
"name": "CVE-2024-41036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41036"
},
{
"name": "CVE-2023-53751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53751"
},
{
"name": "CVE-2025-0033",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0033"
},
{
"name": "CVE-2023-53743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53743"
},
{
"name": "CVE-2024-42319",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42319"
},
{
"name": "CVE-2025-37928",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37928"
},
{
"name": "CVE-2017-13716",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-13716"
},
{
"name": "CVE-2024-22018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22018"
},
{
"name": "CVE-2025-71116",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71116"
},
{
"name": "CVE-2022-40735",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40735"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2025-21723",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21723"
},
{
"name": "CVE-2023-54190",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54190"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2025-68281",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68281"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2025-38440",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38440"
},
{
"name": "CVE-2026-23124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23124"
},
{
"name": "CVE-2023-52981",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52981"
},
{
"name": "CVE-2024-53224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53224"
},
{
"name": "CVE-2024-49910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49910"
},
{
"name": "CVE-2025-68362",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68362"
},
{
"name": "CVE-2023-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53105"
},
{
"name": "CVE-2025-68236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68236"
},
{
"name": "CVE-2024-39286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39286"
},
{
"name": "CVE-2025-25184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25184"
},
{
"name": "CVE-2025-14524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14524"
},
{
"name": "CVE-2024-49855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49855"
},
{
"name": "CVE-2024-47081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47081"
},
{
"name": "CVE-2025-68333",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68333"
},
{
"name": "CVE-2024-47689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47689"
},
{
"name": "CVE-2025-71160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71160"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2023-52625",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52625"
},
{
"name": "CVE-2023-53353",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53353"
},
{
"name": "CVE-2024-58096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58096"
},
{
"name": "CVE-2025-38225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38225"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2025-22037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22037"
},
{
"name": "CVE-2023-53702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53702"
},
{
"name": "CVE-2025-68290",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68290"
},
{
"name": "CVE-2025-40280",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40280"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2025-40099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40099"
},
{
"name": "CVE-2023-54059",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54059"
},
{
"name": "CVE-2025-71162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71162"
},
{
"name": "CVE-2021-0170",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0170"
},
{
"name": "CVE-2019-10782",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-10782"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-53133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53133"
},
{
"name": "CVE-2026-23075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23075"
},
{
"name": "CVE-2022-50571",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50571"
},
{
"name": "CVE-2021-31879",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-31879"
},
{
"name": "CVE-2026-23120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23120"
},
{
"name": "CVE-2025-40180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40180"
},
{
"name": "CVE-2022-49393",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49393"
},
{
"name": "CVE-2024-6119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6119"
},
{
"name": "CVE-2025-68803",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68803"
},
{
"name": "CVE-2026-22996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22996"
},
{
"name": "CVE-2024-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53091"
},
{
"name": "CVE-2025-39851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39851"
},
{
"name": "CVE-2025-71204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71204"
},
{
"name": "CVE-2025-68331",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68331"
},
{
"name": "CVE-2025-38244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38244"
},
{
"name": "CVE-2022-29217",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29217"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2025-38080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38080"
},
{
"name": "CVE-2023-32651",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32651"
},
{
"name": "CVE-2025-37747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37747"
},
{
"name": "CVE-2026-2297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2297"
},
{
"name": "CVE-2026-23105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23105"
},
{
"name": "CVE-2023-53036",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53036"
},
{
"name": "CVE-2025-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38615"
},
{
"name": "CVE-2025-58181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58181"
},
{
"name": "CVE-2025-71115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71115"
},
{
"name": "CVE-2026-22976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22976"
},
{
"name": "CVE-2022-50862",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50862"
},
{
"name": "CVE-2025-1118",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1118"
},
{
"name": "CVE-2024-50166",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50166"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2023-53355",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53355"
},
{
"name": "CVE-2022-25265",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25265"
},
{
"name": "CVE-2026-0967",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0967"
},
{
"name": "CVE-2026-23181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23181"
},
{
"name": "CVE-2025-37944",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37944"
},
{
"name": "CVE-2023-53558",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53558"
},
{
"name": "CVE-2025-47914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47914"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2026-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23141"
},
{
"name": "CVE-2026-22860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22860"
},
{
"name": "CVE-2025-36365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36365"
},
{
"name": "CVE-2025-9403",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9403"
},
{
"name": "CVE-2025-40247",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40247"
},
{
"name": "CVE-2023-1255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1255"
},
{
"name": "CVE-2024-56641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56641"
},
{
"name": "CVE-2024-43842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43842"
},
{
"name": "CVE-2025-0686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0686"
},
{
"name": "CVE-2025-21739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21739"
},
{
"name": "CVE-2024-49992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49992"
},
{
"name": "CVE-2025-68781",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68781"
},
{
"name": "CVE-2025-39753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39753"
},
{
"name": "CVE-2025-69418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69418"
},
{
"name": "CVE-2026-23182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23182"
},
{
"name": "CVE-2021-0173",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0173"
},
{
"name": "CVE-2025-71112",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71112"
},
{
"name": "CVE-2023-54285",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54285"
},
{
"name": "CVE-2024-45778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45778"
},
{
"name": "CVE-2026-23086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23086"
},
{
"name": "CVE-2024-47661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47661"
},
{
"name": "CVE-2026-28418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28418"
},
{
"name": "CVE-2023-54151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54151"
},
{
"name": "CVE-2025-22022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22022"
},
{
"name": "CVE-2025-66864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66864"
},
{
"name": "CVE-2024-46803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46803"
},
{
"name": "CVE-2025-22869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22869"
},
{
"name": "CVE-2025-59466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59466"
},
{
"name": "CVE-2025-40192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40192"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-68818",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68818"
},
{
"name": "CVE-2022-36351",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36351"
},
{
"name": "CVE-2023-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52921"
},
{
"name": "CVE-2025-15468",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15468"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-43832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43832"
},
{
"name": "CVE-2026-25639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25639"
},
{
"name": "CVE-2026-1299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1299"
},
{
"name": "CVE-2024-54683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54683"
},
{
"name": "CVE-2025-1150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1150"
},
{
"name": "CVE-2024-46720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46720"
},
{
"name": "CVE-2024-26658",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26658"
},
{
"name": "CVE-2026-2243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2243"
},
{
"name": "CVE-2025-38198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38198"
},
{
"name": "CVE-2025-58189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58189"
},
{
"name": "CVE-2022-36087",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36087"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2021-0174",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0174"
},
{
"name": "CVE-2025-8746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8746"
},
{
"name": "CVE-2025-36442",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36442"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2025-40102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40102"
},
{
"name": "CVE-2026-0968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0968"
},
{
"name": "CVE-2025-40170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40170"
},
{
"name": "CVE-2025-38437",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38437"
},
{
"name": "CVE-2025-40160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40160"
},
{
"name": "CVE-2023-7008",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7008"
},
{
"name": "CVE-2024-45779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45779"
},
{
"name": "CVE-2025-40284",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40284"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2025-40077",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40077"
},
{
"name": "CVE-2024-57857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57857"
},
{
"name": "CVE-2024-4603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4603"
},
{
"name": "CVE-2022-50213",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50213"
},
{
"name": "CVE-2024-46823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46823"
},
{
"name": "CVE-2023-32642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32642"
},
{
"name": "CVE-2025-71227",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71227"
},
{
"name": "CVE-2025-61772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61772"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2022-50015",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50015"
},
{
"name": "CVE-2025-40071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40071"
},
{
"name": "CVE-2024-7883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7883"
},
{
"name": "CVE-2024-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50271"
},
{
"name": "CVE-2022-50772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50772"
},
{
"name": "CVE-2024-56717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56717"
},
{
"name": "CVE-2025-68366",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68366"
},
{
"name": "CVE-2024-56707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56707"
},
{
"name": "CVE-2023-54234",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54234"
},
{
"name": "CVE-2022-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45885"
},
{
"name": "CVE-2022-49783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49783"
},
{
"name": "CVE-2025-40305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40305"
},
{
"name": "CVE-2016-2781",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-2781"
},
{
"name": "CVE-2023-29383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29383"
},
{
"name": "CVE-2025-47153",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47153"
},
{
"name": "CVE-2025-40080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40080"
},
{
"name": "CVE-2024-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53216"
},
{
"name": "CVE-2022-49539",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49539"
},
{
"name": "CVE-2024-36347",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36347"
},
{
"name": "CVE-2024-26869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26869"
},
{
"name": "CVE-2025-22870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22870"
},
{
"name": "CVE-2025-68815",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68815"
},
{
"name": "CVE-2021-20255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20255"
},
{
"name": "CVE-2022-48979",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48979"
},
{
"name": "CVE-2025-40307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40307"
},
{
"name": "CVE-2025-71193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71193"
},
{
"name": "CVE-2023-54180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54180"
},
{
"name": "CVE-2026-23095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23095"
},
{
"name": "CVE-2024-46848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46848"
},
{
"name": "CVE-2025-68346",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68346"
},
{
"name": "CVE-2025-38081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38081"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2025-71163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71163"
},
{
"name": "CVE-2024-36350",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36350"
},
{
"name": "CVE-2023-25951",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25951"
},
{
"name": "CVE-2025-40211",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40211"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2021-0308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0308"
},
{
"name": "CVE-2025-68315",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68315"
},
{
"name": "CVE-2024-50009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50009"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2022-1205",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1205"
},
{
"name": "CVE-2023-45927",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45927"
},
{
"name": "CVE-2020-25742",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-25742"
},
{
"name": "CVE-2022-0987",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0987"
},
{
"name": "CVE-2025-71096",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71096"
},
{
"name": "CVE-2025-71095",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71095"
},
{
"name": "CVE-2025-40217",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40217"
},
{
"name": "CVE-2025-38199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38199"
},
{
"name": "CVE-2025-39905",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39905"
},
{
"name": "CVE-2025-21944",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21944"
},
{
"name": "CVE-2022-50720",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50720"
},
{
"name": "CVE-2025-71105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71105"
},
{
"name": "CVE-2023-50387",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50387"
},
{
"name": "CVE-2022-49529",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49529"
},
{
"name": "CVE-2025-68266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68266"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2025-68771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68771"
},
{
"name": "CVE-2025-39961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39961"
},
{
"name": "CVE-2025-68363",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68363"
},
{
"name": "CVE-2024-54456",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54456"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2025-40248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40248"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2025-37876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37876"
},
{
"name": "CVE-2024-58089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58089"
},
{
"name": "CVE-2024-36331",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36331"
},
{
"name": "CVE-2026-27571",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27571"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2026-22984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22984"
},
{
"name": "CVE-2026-27139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27139"
},
{
"name": "CVE-2022-49127",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49127"
},
{
"name": "CVE-2026-24733",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-24733"
},
{
"name": "CVE-2020-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-25741"
},
{
"name": "CVE-2022-50748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50748"
},
{
"name": "CVE-2023-53767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53767"
},
{
"name": "CVE-2025-21667",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21667"
},
{
"name": "CVE-2025-9230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9230"
},
{
"name": "CVE-2023-49083",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-49083"
},
{
"name": "CVE-2025-21696",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21696"
},
{
"name": "CVE-2025-68303",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68303"
},
{
"name": "CVE-2025-21955",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21955"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2025-40259",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40259"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2026-28419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28419"
},
{
"name": "CVE-2025-8677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8677"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2026-23206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23206"
},
{
"name": "CVE-2025-68757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68757"
},
{
"name": "CVE-2024-46678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46678"
},
{
"name": "CVE-2024-58097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58097"
},
{
"name": "CVE-2023-53620",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53620"
},
{
"name": "CVE-2022-50539",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50539"
},
{
"name": "CVE-2025-71068",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71068"
},
{
"name": "CVE-2025-23130",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23130"
},
{
"name": "CVE-2022-49496",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49496"
},
{
"name": "CVE-2025-38349",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38349"
},
{
"name": "CVE-2024-56782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56782"
},
{
"name": "CVE-2025-39957",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39957"
},
{
"name": "CVE-2025-1352",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1352"
},
{
"name": "CVE-2023-53540",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53540"
},
{
"name": "CVE-2022-49552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49552"
},
{
"name": "CVE-2024-4741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4741"
},
{
"name": "CVE-2023-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53261"
},
{
"name": "CVE-2026-24049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-24049"
},
{
"name": "CVE-2026-23033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23033"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2024-26759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26759"
},
{
"name": "CVE-2025-48924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48924"
},
{
"name": "CVE-2025-39931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39931"
},
{
"name": "CVE-2023-54187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54187"
},
{
"name": "CVE-2026-22977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22977"
},
{
"name": "CVE-2026-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23145"
},
{
"name": "CVE-2022-44032",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-44032"
},
{
"name": "CVE-2024-57895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57895"
},
{
"name": "CVE-2023-53240",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53240"
},
{
"name": "CVE-2025-13735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13735"
},
{
"name": "CVE-2023-53694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53694"
},
{
"name": "CVE-2024-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53195"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2026-23003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23003"
},
{
"name": "CVE-2025-21891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21891"
},
{
"name": "CVE-2025-38716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38716"
},
{
"name": "CVE-2025-11187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11187"
},
{
"name": "CVE-2024-56660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56660"
},
{
"name": "CVE-2026-23076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23076"
},
{
"name": "CVE-2023-54145",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54145"
},
{
"name": "CVE-2025-38033",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38033"
},
{
"name": "CVE-2024-41023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41023"
},
{
"name": "CVE-2024-47704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47704"
},
{
"name": "CVE-2025-21672",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21672"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-49978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49978"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2025-15079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15079"
},
{
"name": "CVE-2024-49870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49870"
},
{
"name": "CVE-2025-36366",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36366"
},
{
"name": "CVE-2024-42125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42125"
},
{
"name": "CVE-2025-36123",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36123"
},
{
"name": "CVE-2024-56737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56737"
},
{
"name": "CVE-2025-68168",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68168"
},
{
"name": "CVE-2025-21821",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21821"
},
{
"name": "CVE-2025-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68206"
},
{
"name": "CVE-2020-11935",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11935"
},
{
"name": "CVE-2023-54247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54247"
},
{
"name": "CVE-2025-68309",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68309"
},
{
"name": "CVE-2023-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52905"
},
{
"name": "CVE-2024-57852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57852"
},
{
"name": "CVE-2025-40003",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40003"
},
{
"name": "CVE-2025-22042",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22042"
},
{
"name": "CVE-2025-71158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71158"
},
{
"name": "CVE-2022-49803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49803"
},
{
"name": "CVE-2024-57898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57898"
},
{
"name": "CVE-2020-35503",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-35503"
},
{
"name": "CVE-2024-49923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49923"
},
{
"name": "CVE-2024-56639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56639"
},
{
"name": "CVE-2025-68372",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68372"
},
{
"name": "CVE-2026-23171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23171"
},
{
"name": "CVE-2024-3651",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3651"
},
{
"name": "CVE-2023-53002",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53002"
},
{
"name": "CVE-2021-0183",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0183"
},
{
"name": "CVE-2025-39884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39884"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2026-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-26996"
},
{
"name": "CVE-2024-35826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35826"
},
{
"name": "CVE-2026-23112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23112"
},
{
"name": "CVE-2022-49764",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49764"
},
{
"name": "CVE-2025-68121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68121"
},
{
"name": "CVE-2025-21651",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21651"
},
{
"name": "CVE-2025-38092",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38092"
},
{
"name": "CVE-2025-22124",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22124"
},
{
"name": "CVE-2025-68313",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68313"
},
{
"name": "CVE-2024-58053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58053"
},
{
"name": "CVE-2023-26553",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26553"
},
{
"name": "CVE-2025-60876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-60876"
},
{
"name": "CVE-2025-37776",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37776"
},
{
"name": "CVE-2021-23840",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-23840"
},
{
"name": "CVE-2024-58077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58077"
},
{
"name": "CVE-2024-6519",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6519"
},
{
"name": "CVE-2024-46729",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46729"
},
{
"name": "CVE-2023-53850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53850"
},
{
"name": "CVE-2023-2975",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2975"
},
{
"name": "CVE-2022-50266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50266"
},
{
"name": "CVE-2024-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53178"
},
{
"name": "CVE-2025-71137",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71137"
},
{
"name": "CVE-2026-23084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23084"
},
{
"name": "CVE-2023-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53093"
},
{
"name": "CVE-2025-11065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11065"
},
{
"name": "CVE-2026-23190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23190"
},
{
"name": "CVE-2025-40123",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40123"
},
{
"name": "CVE-2026-22979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22979"
},
{
"name": "CVE-2025-68301",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68301"
},
{
"name": "CVE-2024-49991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49991"
},
{
"name": "CVE-2022-50009",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50009"
},
{
"name": "CVE-2022-26047",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26047"
},
{
"name": "CVE-2024-53240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53240"
},
{
"name": "CVE-2026-23011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23011"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2023-53816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53816"
},
{
"name": "CVE-2025-37877",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37877"
},
{
"name": "CVE-2024-2193",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2193"
},
{
"name": "CVE-2025-4382",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4382"
},
{
"name": "CVE-2022-28693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28693"
},
{
"name": "CVE-2025-71161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71161"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-22038",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22038"
},
{
"name": "CVE-2025-68217",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68217"
},
{
"name": "CVE-2023-54242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54242"
},
{
"name": "CVE-2025-68289",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68289"
},
{
"name": "CVE-2025-40363",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40363"
},
{
"name": "CVE-2024-41062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41062"
},
{
"name": "CVE-2025-40253",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40253"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2026-27141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27141"
},
{
"name": "CVE-2025-37800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37800"
},
{
"name": "CVE-2025-61726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61726"
},
{
"name": "CVE-2022-50518",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50518"
},
{
"name": "CVE-2022-49829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49829"
},
{
"name": "CVE-2025-64756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-64756"
},
{
"name": "CVE-2025-21967",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21967"
},
{
"name": "CVE-2016-2568",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-2568"
},
{
"name": "CVE-2020-13817",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-13817"
},
{
"name": "CVE-2025-68245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68245"
},
{
"name": "CVE-2025-41254",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41254"
},
{
"name": "CVE-2018-12929",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-12929"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2024-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53147"
},
{
"name": "CVE-2025-39952",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39952"
},
{
"name": "CVE-2025-40317",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40317"
},
{
"name": "CVE-2024-45783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45783"
},
{
"name": "CVE-2026-23110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23110"
},
{
"name": "CVE-2023-53410",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53410"
},
{
"name": "CVE-2023-53254",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53254"
},
{
"name": "CVE-2024-34064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34064"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2025-68809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68809"
},
{
"name": "CVE-2025-53864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53864"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2021-0165",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0165"
},
{
"name": "CVE-2025-0624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0624"
},
{
"name": "CVE-2022-49177",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49177"
},
{
"name": "CVE-2025-38205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38205"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2025-59464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59464"
},
{
"name": "CVE-2024-58241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58241"
},
{
"name": "CVE-2025-21863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21863"
},
{
"name": "CVE-2025-71120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71120"
},
{
"name": "CVE-2025-38166",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38166"
},
{
"name": "CVE-2022-49833",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49833"
},
{
"name": "CVE-2026-23060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23060"
},
{
"name": "CVE-2025-38321",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38321"
},
{
"name": "CVE-2025-68282",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68282"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2025-68817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68817"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2025-38045",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38045"
},
{
"name": "CVE-2024-46726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46726"
},
{
"name": "CVE-2025-40025",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40025"
},
{
"name": "CVE-2024-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53079"
},
{
"name": "CVE-2025-68787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68787"
},
{
"name": "CVE-2025-1125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1125"
},
{
"name": "CVE-2023-53647",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53647"
},
{
"name": "CVE-2025-37954",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37954"
},
{
"name": "CVE-2025-23133",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23133"
},
{
"name": "CVE-2025-0012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0012"
},
{
"name": "CVE-2020-12313",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-12313"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2025-68782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68782"
},
{
"name": "CVE-2021-0166",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0166"
},
{
"name": "CVE-2025-21945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21945"
},
{
"name": "CVE-2022-3872",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3872"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2025-71197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71197"
},
{
"name": "CVE-2025-68177",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68177"
},
{
"name": "CVE-2025-68758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68758"
},
{
"name": "CVE-2024-49931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49931"
},
{
"name": "CVE-2024-43866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43866"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-47728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47728"
},
{
"name": "CVE-2025-27610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27610"
},
{
"name": "CVE-2025-68191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68191"
},
{
"name": "CVE-2026-23031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23031"
},
{
"name": "CVE-2024-46730",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46730"
},
{
"name": "CVE-2025-71113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71113"
},
{
"name": "CVE-2025-71127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71127"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2024-46728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46728"
},
{
"name": "CVE-2023-53561",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53561"
},
{
"name": "CVE-2026-22998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22998"
},
{
"name": "CVE-2023-54172",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54172"
},
{
"name": "CVE-2026-23050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23050"
},
{
"name": "CVE-2024-58100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58100"
},
{
"name": "CVE-2020-0256",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-0256"
},
{
"name": "CVE-2025-21673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21673"
},
{
"name": "CVE-2024-26954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26954"
},
{
"name": "CVE-2025-21634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21634"
},
{
"name": "CVE-2024-57999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57999"
},
{
"name": "CVE-2025-38047",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38047"
},
{
"name": "CVE-2024-47738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47738"
},
{
"name": "CVE-2025-68340",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68340"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2023-54320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54320"
},
{
"name": "CVE-2024-43911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43911"
},
{
"name": "CVE-2025-30204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30204"
},
{
"name": "CVE-2025-37959",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37959"
},
{
"name": "CVE-2017-0537",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-0537"
},
{
"name": "CVE-2025-38191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38191"
},
{
"name": "CVE-2023-32681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32681"
},
{
"name": "CVE-2025-68219",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68219"
},
{
"name": "CVE-2022-50232",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50232"
},
{
"name": "CVE-2025-38062",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38062"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2023-26112",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26112"
},
{
"name": "CVE-2018-6952",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-6952"
},
{
"name": "CVE-2020-14304",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-14304"
},
{
"name": "CVE-2024-46834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46834"
},
{
"name": "CVE-2025-40288",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40288"
},
{
"name": "CVE-2025-68239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68239"
},
{
"name": "CVE-2025-40258",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40258"
},
{
"name": "CVE-2025-21894",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21894"
},
{
"name": "CVE-2025-40281",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40281"
},
{
"name": "CVE-2025-68185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68185"
},
{
"name": "CVE-2025-40304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40304"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-40110",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40110"
},
{
"name": "CVE-2026-24001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-24001"
},
{
"name": "CVE-2025-37807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37807"
},
{
"name": "CVE-2025-38131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38131"
},
{
"name": "CVE-2022-50016",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50016"
},
{
"name": "CVE-2025-29481",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29481"
},
{
"name": "CVE-2024-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53219"
},
{
"name": "CVE-2023-53009",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53009"
},
{
"name": "CVE-2025-40268",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40268"
},
{
"name": "CVE-2025-61661",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61661"
},
{
"name": "CVE-2026-23111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23111"
},
{
"name": "CVE-2024-25740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25740"
},
{
"name": "CVE-2024-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50246"
},
{
"name": "CVE-2023-3446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3446"
},
{
"name": "CVE-2025-14178",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14178"
},
{
"name": "CVE-2024-57950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57950"
},
{
"name": "CVE-2025-21759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21759"
},
{
"name": "CVE-2025-40325",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40325"
},
{
"name": "CVE-2024-2511",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2511"
},
{
"name": "CVE-2024-42321",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42321"
},
{
"name": "CVE-2026-23113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23113"
},
{
"name": "CVE-2021-0176",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0176"
},
{
"name": "CVE-2025-1151",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1151"
},
{
"name": "CVE-2022-48998",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48998"
},
{
"name": "CVE-2025-68798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68798"
},
{
"name": "CVE-2024-42273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42273"
},
{
"name": "CVE-2025-68336",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68336"
},
{
"name": "CVE-2023-53794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53794"
},
{
"name": "CVE-2026-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23157"
},
{
"name": "CVE-2025-40303",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40303"
},
{
"name": "CVE-2025-68178",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68178"
},
{
"name": "CVE-2022-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49974"
},
{
"name": "CVE-2025-40337",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40337"
},
{
"name": "CVE-2019-20633",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20633"
},
{
"name": "CVE-2025-38264",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38264"
},
{
"name": "CVE-2021-3714",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3714"
},
{
"name": "CVE-2023-54071",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54071"
},
{
"name": "CVE-2024-56566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56566"
},
{
"name": "CVE-2025-46392",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-46392"
},
{
"name": "CVE-2025-40036",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40036"
},
{
"name": "CVE-2024-57993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57993"
},
{
"name": "CVE-2024-47745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47745"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2026-23097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23097"
},
{
"name": "CVE-2025-37980",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37980"
},
{
"name": "CVE-2024-53190",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53190"
},
{
"name": "CVE-2025-40262",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40262"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-56591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56591"
},
{
"name": "CVE-2024-56544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56544"
},
{
"name": "CVE-2024-56647",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56647"
},
{
"name": "CVE-2025-71198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71198"
},
{
"name": "CVE-2025-21649",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21649"
},
{
"name": "CVE-2024-57976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57976"
},
{
"name": "CVE-2025-68819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68819"
},
{
"name": "CVE-2025-0685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0685"
},
{
"name": "CVE-2024-57893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57893"
},
{
"name": "CVE-2026-23231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23231"
},
{
"name": "CVE-2025-37879",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37879"
},
{
"name": "CVE-2022-50071",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50071"
},
{
"name": "CVE-2025-40261",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40261"
},
{
"name": "CVE-2024-56180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56180"
},
{
"name": "CVE-2023-39333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39333"
},
{
"name": "CVE-2025-38643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38643"
},
{
"name": "CVE-2021-3864",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3864"
},
{
"name": "CVE-2025-39771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39771"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26648",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26648"
},
{
"name": "CVE-2025-66862",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66862"
},
{
"name": "CVE-2020-11868",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11868"
},
{
"name": "CVE-2020-24352",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-24352"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2026-23021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23021"
},
{
"name": "CVE-2025-39819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39819"
},
{
"name": "CVE-2022-49296",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49296"
},
{
"name": "CVE-2025-61780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61780"
},
{
"name": "CVE-2024-49914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49914"
},
{
"name": "CVE-2025-38360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38360"
},
{
"name": "CVE-2025-68732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68732"
},
{
"name": "CVE-2025-39715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39715"
},
{
"name": "CVE-2025-36407",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36407"
},
{
"name": "CVE-2024-0217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0217"
},
{
"name": "CVE-2025-40323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40323"
},
{
"name": "CVE-2025-21732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21732"
},
{
"name": "CVE-2021-47658",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47658"
},
{
"name": "CVE-2025-68285",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68285"
},
{
"name": "CVE-2025-4575",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4575"
},
{
"name": "CVE-2019-12067",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-12067"
},
{
"name": "CVE-2024-57843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57843"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2024-50135",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50135"
},
{
"name": "CVE-2024-49916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49916"
},
{
"name": "CVE-2025-68119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68119"
},
{
"name": "CVE-2024-49988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49988"
},
{
"name": "CVE-2023-52648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52648"
},
{
"name": "CVE-2024-49861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49861"
},
{
"name": "CVE-2026-23093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23093"
},
{
"name": "CVE-2024-49893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49893"
},
{
"name": "CVE-2024-44963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44963"
},
{
"name": "CVE-2023-53348",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53348"
},
{
"name": "CVE-2022-48766",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48766"
},
{
"name": "CVE-2019-15794",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-15794"
},
{
"name": "CVE-2024-49917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49917"
},
{
"name": "CVE-2022-50467",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50467"
},
{
"name": "CVE-2025-37849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37849"
},
{
"name": "CVE-2025-32441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32441"
},
{
"name": "CVE-2024-48875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48875"
},
{
"name": "CVE-2024-41935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41935"
},
{
"name": "CVE-2025-38162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38162"
},
{
"name": "CVE-2022-23491",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23491"
},
{
"name": "CVE-2025-22873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22873"
},
{
"name": "CVE-2023-5678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5678"
},
{
"name": "CVE-2025-71183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71183"
},
{
"name": "CVE-2023-54047",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54047"
},
{
"name": "CVE-2023-53382",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53382"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2023-53651",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53651"
},
{
"name": "CVE-2025-21832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21832"
},
{
"name": "CVE-2025-68371",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68371"
},
{
"name": "CVE-2022-50383",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50383"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2025-40275",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40275"
},
{
"name": "CVE-2023-53387",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53387"
},
{
"name": "CVE-2026-31802",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31802"
},
{
"name": "CVE-2024-45774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45774"
},
{
"name": "CVE-2023-54019",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54019"
},
{
"name": "CVE-2025-22053",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22053"
},
{
"name": "CVE-2025-13465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13465"
},
{
"name": "CVE-2025-61664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61664"
},
{
"name": "CVE-2025-68211",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68211"
},
{
"name": "CVE-2026-25702",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25702"
},
{
"name": "CVE-2023-52452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52452"
},
{
"name": "CVE-2023-42366",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42366"
},
{
"name": "CVE-2022-50863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50863"
},
{
"name": "CVE-2025-39829",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39829"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2025-71091",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71091"
},
{
"name": "CVE-2025-39781",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39781"
},
{
"name": "CVE-2025-39762",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39762"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2023-52576",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52576"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2025-0167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0167"
},
{
"name": "CVE-2024-57887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57887"
},
{
"name": "CVE-2025-21730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21730"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2025-71184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71184"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2025-69420",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69420"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-68227",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68227"
},
{
"name": "CVE-2025-22041",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22041"
},
{
"name": "CVE-2025-40339",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40339"
},
{
"name": "CVE-2025-22127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22127"
},
{
"name": "CVE-2025-47273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47273"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2025-38020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38020"
},
{
"name": "CVE-2024-27011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27011"
},
{
"name": "CVE-2025-15224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15224"
},
{
"name": "CVE-2024-26605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26605"
},
{
"name": "CVE-2026-27904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27904"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2025-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68263"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2025-38689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38689"
},
{
"name": "CVE-2025-68800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68800"
},
{
"name": "CVE-2026-1225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1225"
},
{
"name": "CVE-2025-38275",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38275"
},
{
"name": "CVE-2025-68261",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68261"
},
{
"name": "CVE-2022-48744",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48744"
},
{
"name": "CVE-2025-38070",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38070"
},
{
"name": "CVE-2025-68755",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68755"
},
{
"name": "CVE-2025-62525",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62525"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2021-0175",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0175"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2022-48706",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48706"
},
{
"name": "CVE-2025-40334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40334"
},
{
"name": "CVE-2025-68767",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68767"
},
{
"name": "CVE-2024-46716",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46716"
},
{
"name": "CVE-2012-4542",
"url": "https://www.cve.org/CVERecord?id=CVE-2012-4542"
},
{
"name": "CVE-2021-3773",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3773"
},
{
"name": "CVE-2025-61729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61729"
},
{
"name": "CVE-2022-49267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49267"
},
{
"name": "CVE-2024-56592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56592"
},
{
"name": "CVE-2025-37854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37854"
},
{
"name": "CVE-2025-38189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38189"
},
{
"name": "CVE-2022-48628",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48628"
},
{
"name": "CVE-2024-6345",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6345"
},
{
"name": "CVE-2024-50138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50138"
},
{
"name": "CVE-2025-40319",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40319"
},
{
"name": "CVE-2021-44534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44534"
},
{
"name": "CVE-2025-14831",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14831"
},
{
"name": "CVE-2024-56565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56565"
},
{
"name": "CVE-2025-68193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68193"
},
{
"name": "CVE-2025-68727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68727"
},
{
"name": "CVE-2024-57872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57872"
},
{
"name": "CVE-2023-28720",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28720"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2026-23080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23080"
},
{
"name": "CVE-2024-46833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46833"
},
{
"name": "CVE-2024-47703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47703"
},
{
"name": "CVE-2023-53742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53742"
},
{
"name": "CVE-2025-38361",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38361"
},
{
"name": "CVE-2025-38041",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38041"
},
{
"name": "CVE-2024-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53177"
},
{
"name": "CVE-2024-56588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56588"
},
{
"name": "CVE-2023-53452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53452"
},
{
"name": "CVE-2023-54121",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54121"
},
{
"name": "CVE-2023-6610",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6610"
},
{
"name": "CVE-2023-54261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-54261"
},
{
"name": "CVE-2022-50616",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50616"
},
{
"name": "CVE-2025-66418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66418"
},
{
"name": "CVE-2023-53544",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53544"
},
{
"name": "CVE-2025-68264",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68264"
},
{
"name": "CVE-2024-49911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49911"
},
{
"name": "CVE-2026-23154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23154"
},
{
"name": "CVE-2022-50708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50708"
},
{
"name": "CVE-2026-3784",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3784"
},
{
"name": "CVE-2025-68764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68764"
},
{
"name": "CVE-2025-9301",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9301"
},
{
"name": "CVE-2025-11226",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11226"
}
],
"initial_release_date": "2026-03-20T00:00:00",
"last_revision_date": "2026-03-20T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0326",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-03-20T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits VMware. Elles permettent \u00e0 un attaquant de provoquer un probl\u00e8me de s\u00e9curit\u00e9 non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits VMware",
"vendor_advisories": [
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37233",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37233"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37237",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37237"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37236",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37236"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37246",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37246"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37235",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37235"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37229",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37229"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37226",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37226"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37230",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37230"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37242",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37242"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37228",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37228"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37240",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37240"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37243",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37243"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37234",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37234"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37231",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37231"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37239",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37239"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37227",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37227"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37232",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37232"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37247",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37247"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37241",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37241"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37238",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37238"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37244",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37244"
},
{
"published_at": "2026-03-19",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37245",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37245"
}
]
}
FKIE_CVE-2024-58237
Vulnerability from fkie_nvd - Published: 2025-05-05 15:15 - Updated: 2026-08-04 11:225.5 (Medium) - CVSS:3.1/
| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/1a4607ffba35bf2a630aab299e34dd3f6e658d70 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/1c2244437f9ad3dd91215f920401a14f2542dbfc | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/f1692ee23dcaaddc24ba407b269707ee5df1301f | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | 6.13 | |
| linux | linux_kernel | 6.13 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/core/filter.c",
"tools/testing/selftests/bpf/progs/tc_bpf2bpf.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "f1692ee23dcaaddc24ba407b269707ee5df1301f",
"status": "affected",
"version": "51c39bb1d5d105a02e29aa7960f0a395086e6342",
"versionType": "git"
},
{
"lessThan": "1c2244437f9ad3dd91215f920401a14f2542dbfc",
"status": "affected",
"version": "51c39bb1d5d105a02e29aa7960f0a395086e6342",
"versionType": "git"
},
{
"lessThan": "1a4607ffba35bf2a630aab299e34dd3f6e658d70",
"status": "affected",
"version": "51c39bb1d5d105a02e29aa7960f0a395086e6342",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/core/filter.c",
"tools/testing/selftests/bpf/progs/tc_bpf2bpf.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.6"
},
{
"lessThan": "5.6",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.90",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.9",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.13",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "639CB8B7-A013-410F-ACC9-35ADBDE2AC4C",
"versionEndExcluding": "6.6.90",
"versionStartIncluding": "5.6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "1D13AF97-FFED-4B68-906D-CFE38D0B88DD",
"versionEndExcluding": "6.12.9",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.13:rc1:*:*:*:*:*:*",
"matchCriteriaId": "62567B3C-6CEE-46D0-BC2E-B3717FBF7D13",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.13:rc2:*:*:*:*:*:*",
"matchCriteriaId": "5A073481-106D-4B15-B4C7-FB0213B8E1D4",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nbpf: consider that tail calls invalidate packet pointers\n\nTail-called programs could execute any of the helpers that invalidate\npacket pointers. Hence, conservatively assume that each tail call\ninvalidates packet pointers.\n\nMaking the change in bpf_helper_changes_pkt_data() automatically makes\nuse of check_cfg() logic that computes \u0027changes_pkt_data\u0027 effect for\nglobal sub-programs, such that the following program could be\nrejected:\n\n int tail_call(struct __sk_buff *sk)\n {\n \tbpf_tail_call_static(sk, \u0026jmp_table, 0);\n \treturn 0;\n }\n\n SEC(\"tc\")\n int not_safe(struct __sk_buff *sk)\n {\n \tint *p = (void *)(long)sk-\u003edata;\n \t... make p valid ...\n \ttail_call(sk);\n \t*p = 42; /* this is unsafe */\n \t...\n }\n\nThe tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that\ncan invalidate packet pointers. Otherwise, it can\u0027t be freplaced with\ntailcall_freplace.c:entry_freplace() that does a tail call."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: bpf: considerar que las llamadas de cola invalidan los punteros de paquete. Los programas con llamadas de cola podr\u00edan ejecutar cualquiera de los ayudantes que invalidan los punteros de paquete. Por lo tanto, se asume, de forma conservadora, que cada llamada de cola invalida los punteros de paquete. Al realizar el cambio en bpf_helper_changes_pkt_data(), se utiliza autom\u00e1ticamente la l\u00f3gica check_cfg(), que calcula el efecto de \u0027changes_pkt_data\u0027 para los subprogramas globales, de modo que el siguiente programa podr\u00eda ser rechazado: int tail_call(struct __sk_buff *sk) { bpf_tail_call_static(sk, \u0026amp;jmp_table, 0); return 0; } SEC(\"tc\") int not_safe(struct __sk_buff *sk) { int *p = (void *)(long)sk-\u0026gt;data; ... make p valid ... tail_call(sk); *p = 42; /* esto no es seguro */ ... } La funci\u00f3n tc_bpf2bpf.c:subprog_tc() debe modificarse: m\u00e1rquela como una funci\u00f3n que puede invalidar punteros de paquetes. De lo contrario, no se puede reemplazar con tailcall_freplace.c:entry_freplace(), que realiza una llamada de cola."
}
],
"id": "CVE-2024-58237",
"lastModified": "2026-08-04T11:22:40.363",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2025-05-05T15:15:54.010",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/1a4607ffba35bf2a630aab299e34dd3f6e658d70"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/1c2244437f9ad3dd91215f920401a14f2542dbfc"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f1692ee23dcaaddc24ba407b269707ee5df1301f"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-HV6F-P3FQ-464P
Vulnerability from github – Published: 2025-05-05 15:30 – Updated: 2025-11-10 18:30In the Linux kernel, the following vulnerability has been resolved:
bpf: consider that tail calls invalidate packet pointers
Tail-called programs could execute any of the helpers that invalidate packet pointers. Hence, conservatively assume that each tail call invalidates packet pointers.
Making the change in bpf_helper_changes_pkt_data() automatically makes use of check_cfg() logic that computes 'changes_pkt_data' effect for global sub-programs, such that the following program could be rejected:
int tail_call(struct __sk_buff *sk)
{
bpf_tail_call_static(sk, &jmp_table, 0);
return 0;
}
SEC("tc")
int not_safe(struct __sk_buff *sk)
{
int *p = (void *)(long)sk->data;
... make p valid ...
tail_call(sk);
*p = 42; /* this is unsafe */
...
}
The tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that can invalidate packet pointers. Otherwise, it can't be freplaced with tailcall_freplace.c:entry_freplace() that does a tail call.
{
"affected": [],
"aliases": [
"CVE-2024-58237"
],
"database_specific": {
"cwe_ids": [
"CWE-476"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2025-05-05T15:15:54Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nbpf: consider that tail calls invalidate packet pointers\n\nTail-called programs could execute any of the helpers that invalidate\npacket pointers. Hence, conservatively assume that each tail call\ninvalidates packet pointers.\n\nMaking the change in bpf_helper_changes_pkt_data() automatically makes\nuse of check_cfg() logic that computes \u0027changes_pkt_data\u0027 effect for\nglobal sub-programs, such that the following program could be\nrejected:\n\n int tail_call(struct __sk_buff *sk)\n {\n \tbpf_tail_call_static(sk, \u0026jmp_table, 0);\n \treturn 0;\n }\n\n SEC(\"tc\")\n int not_safe(struct __sk_buff *sk)\n {\n \tint *p = (void *)(long)sk-\u003edata;\n \t... make p valid ...\n \ttail_call(sk);\n \t*p = 42; /* this is unsafe */\n \t...\n }\n\nThe tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that\ncan invalidate packet pointers. Otherwise, it can\u0027t be freplaced with\ntailcall_freplace.c:entry_freplace() that does a tail call.",
"id": "GHSA-hv6f-p3fq-464p",
"modified": "2025-11-10T18:30:30Z",
"published": "2025-05-05T15:30:53Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-58237"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/1a4607ffba35bf2a630aab299e34dd3f6e658d70"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/1c2244437f9ad3dd91215f920401a14f2542dbfc"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/f1692ee23dcaaddc24ba407b269707ee5df1301f"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
MSRC_CVE-2024-58237
Vulnerability from csaf_microsoft - Published: 2025-07-11 00:00 - Updated: 2026-09-09 01:46OESA-2025-1878 (CVE-2024-58237)
Vulnerability from osv_openeuler – Published: 2025-07-25 11:08 – Updated: 2026-08-06 11:08 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
bpf: consider that tail calls invalidate packet pointers
Tail-called programs could execute any of the helpers that invalidate packet pointers. Hence, conservatively assume that each tail call invalidates packet pointers.
Making the change in bpf_helper_changes_pkt_data() automatically makes use of check_cfg() logic that computes 'changes_pkt_data' effect for global sub-programs, such that the following program could be rejected:
int tail_call(struct __sk_buff *sk)
{
bpf_tail_call_static(sk, &jmp_table, 0);
return 0;
}
SEC("tc")
int not_safe(struct __sk_buff *sk)
{
int *p = (void *)(long)sk->data;
... make p valid ...
tail_call(sk);
*p = 42; /* this is unsafe */
...
}
The tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that can invalidate packet pointers. Otherwise, it can't be freplaced with tailcall_freplace.c:entry_freplace() that does a tail call.(CVE-2024-58237)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/rxe: Fix the warning "__rxe_cleanup+0x12c/0x170 [rdma_rxe]"
The Call Trace is as below: " <TASK> ? show_regs.cold+0x1a/0x1f ? __rxe_cleanup+0x12c/0x170 [rdma_rxe] ? __warn+0x84/0xd0 ? __rxe_cleanup+0x12c/0x170 [rdma_rxe] ? report_bug+0x105/0x180 ? handle_bug+0x46/0x80 ? exc_invalid_op+0x19/0x70 ? asm_exc_invalid_op+0x1b/0x20 ? __rxe_cleanup+0x12c/0x170 [rdma_rxe] ? __rxe_cleanup+0x124/0x170 [rdma_rxe] rxe_destroy_qp.cold+0x24/0x29 [rdma_rxe] ib_destroy_qp_user+0x118/0x190 [ib_core] rdma_destroy_qp.cold+0x43/0x5e [rdma_cm] rtrs_cq_qp_destroy.cold+0x1d/0x2b [rtrs_core] rtrs_srv_close_work.cold+0x1b/0x31 [rtrs_server] process_one_work+0x21d/0x3f0 worker_thread+0x4a/0x3c0 ? process_one_work+0x3f0/0x3f0 kthread+0xf0/0x120 ? kthread_complete_and_exit+0x20/0x20 ret_from_fork+0x22/0x30 </TASK> " When too many rdma resources are allocated, rxe needs more time to handle these rdma resources. Sometimes with the current timeout, rxe can not release the rdma resources correctly.
Compared with other rdma drivers, a bigger timeout is used.(CVE-2025-21829)
In the Linux kernel, the following vulnerability has been resolved:
net: enetc: VFs do not support HWTSTAMP_TX_ONESTEP_SYNC
Actually ENETC VFs do not support HWTSTAMP_TX_ONESTEP_SYNC because only ENETC PF can access PMa_SINGLE_STEP registers. And there will be a crash if VFs are used to test one-step timestamp, the crash log as follows.
[ 129.110909] Unable to handle kernel paging request at virtual address 00000000000080c0 [ 129.287769] Call trace: [ 129.290219] enetc_port_mac_wr+0x30/0xec (P) [ 129.294504] enetc_start_xmit+0xda4/0xe74 [ 129.298525] enetc_xmit+0x70/0xec [ 129.301848] dev_hard_start_xmit+0x98/0x118(CVE-2025-21894)
In the Linux kernel, the following vulnerability has been resolved:
caif_virtio: fix wrong pointer check in cfv_probe()
del_vqs() frees virtqueues, therefore cfv->vq_tx pointer should be checked for NULL before calling it, not cfv->vdev. Also the current implementation is redundant because the pointer cfv->vdev is dereferenced before it is checked for NULL.
Fix this by checking cfv->vq_tx for NULL instead of cfv->vdev before calling del_vqs().(CVE-2025-21904)
In the Linux kernel, the following vulnerability has been resolved:
eth: bnxt: do not update checksum in bnxt_xdp_build_skb()
The bnxt_rx_pkt() updates ip_summed value at the end if checksum offload is enabled. When the XDP-MB program is attached and it returns XDP_PASS, the bnxt_xdp_build_skb() is called to update skb_shared_info. The main purpose of bnxt_xdp_build_skb() is to update skb_shared_info, but it updates ip_summed value too if checksum offload is enabled. This is actually duplicate work.
When the bnxt_rx_pkt() updates ip_summed value, it checks if ip_summed is CHECKSUM_NONE or not. It means that ip_summed should be CHECKSUM_NONE at this moment. But ip_summed may already be updated to CHECKSUM_UNNECESSARY in the XDP-MB-PASS path. So the by skb_checksum_none_assert() WARNS about it.
This is duplicate work and updating ip_summed in the bnxt_xdp_build_skb() is not needed.
Splat looks like: WARNING: CPU: 3 PID: 5782 at ./include/linux/skbuff.h:5155 bnxt_rx_pkt+0x479b/0x7610 [bnxt_en] Modules linked in: bnxt_re bnxt_en rdma_ucm rdma_cm iw_cm ib_cm ib_uverbs veth xt_nat xt_tcpudp xt_conntrack nft_chain_nat xt_MASQUERADE nf_] CPU: 3 UID: 0 PID: 5782 Comm: socat Tainted: G W 6.14.0-rc4+ #27 Tainted: [W]=WARN Hardware name: ASUS System Product Name/PRIME Z690-P D4, BIOS 0603 11/01/2021 RIP: 0010:bnxt_rx_pkt+0x479b/0x7610 [bnxt_en] Code: 54 24 0c 4c 89 f1 4c 89 ff c1 ea 1f ff d3 0f 1f 00 49 89 c6 48 85 c0 0f 84 4c e5 ff ff 48 89 c7 e8 ca 3d a0 c8 e9 8f f4 ff ff <0f> 0b f RSP: 0018:ffff88881ba09928 EFLAGS: 00010202 RAX: 0000000000000000 RBX: 00000000c7590303 RCX: 0000000000000000 RDX: 1ffff1104e7d1610 RSI: 0000000000000001 RDI: ffff8881c91300b8 RBP: ffff88881ba09b28 R08: ffff888273e8b0d0 R09: ffff888273e8b070 R10: ffff888273e8b010 R11: ffff888278b0f000 R12: ffff888273e8b080 R13: ffff8881c9130e00 R14: ffff8881505d3800 R15: ffff888273e8b000 FS: 00007f5a2e7be080(0000) GS:ffff88881ba00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007fff2e708ff8 CR3: 000000013e3b0000 CR4: 00000000007506f0 PKRU: 55555554 Call Trace: <IRQ> ? __warn+0xcd/0x2f0 ? bnxt_rx_pkt+0x479b/0x7610 ? report_bug+0x326/0x3c0 ? handle_bug+0x53/0xa0 ? exc_invalid_op+0x14/0x50 ? asm_exc_invalid_op+0x16/0x20 ? bnxt_rx_pkt+0x479b/0x7610 ? bnxt_rx_pkt+0x3e41/0x7610 ? __pfx_bnxt_rx_pkt+0x10/0x10 ? napi_complete_done+0x2cf/0x7d0 __bnxt_poll_work+0x4e8/0x1220 ? __pfxbnxtpoll_work+0x10/0x10 ? pfx_mark_lock.part.0+0x10/0x10 bnxt_poll_p5+0x36a/0xfa0 ? __pfx_bnxt_poll_p5+0x10/0x10 __napi_poll.constprop.0+0xa0/0x440 net_rx_action+0x899/0xd00 ...
Following ping.py patch adds xdp-mb-pass case. so ping.py is going to be able to reproduce this issue.(CVE-2025-21960)
In the Linux kernel, the following vulnerability has been resolved:
eth: bnxt: fix truesize for mb-xdp-pass case
When mb-xdp is set and return is XDP_PASS, packet is converted from xdp_buff to sk_buff with xdp_update_skb_shared_info() in bnxt_xdp_build_skb(). bnxt_xdp_build_skb() passes incorrect truesize argument to xdp_update_skb_shared_info(). The truesize is calculated as BNXT_RX_PAGE_SIZE * sinfo->nr_frags but the skb_shared_info was wiped by napi_build_skb() before. So it stores sinfo->nr_frags before bnxt_xdp_build_skb() and use it instead of getting skb_shared_info from xdp_get_shared_info_from_buff().
Splat looks like: ------------[ cut here ]------------ WARNING: CPU: 2 PID: 0 at net/core/skbuff.c:6072 skb_try_coalesce+0x504/0x590 Modules linked in: xt_nat xt_tcpudp veth af_packet xt_conntrack nft_chain_nat xt_MASQUERADE nf_conntrack_netlink xfrm_user xt_addrtype nft_coms CPU: 2 UID: 0 PID: 0 Comm: swapper/2 Not tainted 6.14.0-rc2+ #3 RIP: 0010:skb_try_coalesce+0x504/0x590 Code: 4b fd ff ff 49 8b 34 24 40 80 e6 40 0f 84 3d fd ff ff 49 8b 74 24 48 40 f6 c6 01 0f 84 2e fd ff ff 48 8d 4e ff e9 25 fd ff ff <0f> 0b e99 RSP: 0018:ffffb62c4120caa8 EFLAGS: 00010287 RAX: 0000000000000003 RBX: ffffb62c4120cb14 RCX: 0000000000000ec0 RDX: 0000000000001000 RSI: ffffa06e5d7dc000 RDI: 0000000000000003 RBP: ffffa06e5d7ddec0 R08: ffffa06e6120a800 R09: ffffa06e7a119900 R10: 0000000000002310 R11: ffffa06e5d7dcec0 R12: ffffe4360575f740 R13: ffffe43600000000 R14: 0000000000000002 R15: 0000000000000002 FS: 0000000000000000(0000) GS:ffffa0755f700000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007f147b76b0f8 CR3: 00000001615d4000 CR4: 00000000007506f0 PKRU: 55555554 Call Trace: <IRQ> ? __warn+0x84/0x130 ? skb_try_coalesce+0x504/0x590 ? report_bug+0x18a/0x1a0 ? handle_bug+0x53/0x90 ? exc_invalid_op+0x14/0x70 ? asm_exc_invalid_op+0x16/0x20 ? skb_try_coalesce+0x504/0x590 inet_frag_reasm_finish+0x11f/0x2e0 ip_defrag+0x37a/0x900 ip_local_deliver+0x51/0x120 ip_sublist_rcv_finish+0x64/0x70 ip_sublist_rcv+0x179/0x210 ip_list_rcv+0xf9/0x130
How to reproduce: <Node A> ip link set $interface1 xdp obj xdp_pass.o ip link set $interface1 mtu 9000 up ip a a 10.0.0.1/24 dev $interface1 <Node B> ip link set $interfac2 mtu 9000 up ip a a 10.0.0.2/24 dev $interface2 ping 10.0.0.1 -s 65000
Following ping.py patch adds xdp-mb-pass case. so ping.py is going to be able to reproduce this issue.(CVE-2025-21961)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5: handle errors in mlx5_chains_create_table()
In mlx5_chains_create_table(), the return value of mlx5_get_fdb_sub_ns() and mlx5_get_flow_namespace() must be checked to prevent NULL pointer dereferences. If either function fails, the function should log error message with mlx5_core_warn() and return error pointer.(CVE-2025-21975)
In the Linux kernel, the following vulnerability has been resolved:
xsk: fix an integer overflow in xp_create_and_assign_umem()
Since the i and pool->chunk_size variables are of type 'u32', their product can wrap around and then be cast to 'u64'. This can lead to two different XDP buffers pointing to the same memory area.
Found by InfoTeCS on behalf of Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2025-21997)
In the Linux kernel, the following vulnerability has been resolved:
net: atm: fix use after free in lec_send()
The ->send() operation frees skb so save the length before calling ->send() to avoid a use after free.(CVE-2025-22004)
In the Linux kernel, the following vulnerability has been resolved:
usbnet:fix NPE during rx_complete
Missing usbnet_going_away Check in Critical Path. The usb_submit_urb function lacks a usbnet_going_away validation, whereas __usbnet_queue_skb includes this check.
This inconsistency creates a race condition where: A URB request may succeed, but the corresponding SKB data fails to be queued.
Subsequent processes: (e.g., rx_complete → defer_bh → __skb_unlink(skb, list)) attempt to access skb->next, triggering a NULL pointer dereference (Kernel Panic).(CVE-2025-22050)
In the Linux kernel, the following vulnerability has been resolved:
net: ibmveth: make veth_pool_store stop hanging
v2: - Created a single error handling unlock and exit in veth_pool_store - Greatly expanded commit message with previous explanatory-only text
Summary: Use rtnl_mutex to synchronize veth_pool_store with itself, ibmveth_close and ibmveth_open, preventing multiple calls in a row to napi_disable.
Background: Two (or more) threads could call veth_pool_store through writing to /sys/devices/vio/30000002/pool/. You can do this easily with a little shell script. This causes a hang.
I configured LOCKDEP, compiled ibmveth.c with DEBUG, and built a new kernel. I ran this test again and saw:
Setting pool0/active to 0
Setting pool1/active to 1
[ 73.911067][ T4365] ibmveth 30000002 eth0: close starting
Setting pool1/active to 1
Setting pool1/active to 0
[ 73.911367][ T4366] ibmveth 30000002 eth0: close starting
[ 73.916056][ T4365] ibmveth 30000002 eth0: close complete
[ 73.916064][ T4365] ibmveth 30000002 eth0: open starting
[ 110.808564][ T712] systemd-journald[712]: Sent WATCHDOG=1 notification.
[ 230.808495][ T712] systemd-journald[712]: Sent WATCHDOG=1 notification.
[ 243.683786][ T123] INFO: task stress.sh:4365 blocked for more than 122 seconds.
[ 243.683827][ T123] Not tainted 6.14.0-01103-g2df0c02dab82-dirty #8
[ 243.683833][ T123] "echo 0 > /proc/sys/kernel/hung_task_timeout_secs" disables this message.
[ 243.683838][ T123] task:stress.sh state:D stack:28096 pid:4365 tgid:4365 ppid:4364 task_flags:0x400040 flags:0x00042000
[ 243.683852][ T123] Call Trace:
[ 243.683857][ T123] [c00000000c38f690] [0000000000000001] 0x1 (unreliable)
[ 243.683868][ T123] [c00000000c38f840] [c00000000001f908] __switch_to+0x318/0x4e0
[ 243.683878][ T123] [c00000000c38f8a0] [c000000001549a70] __schedule+0x500/0x12a0
[ 243.683888][ T123] [c00000000c38f9a0] [c00000000154a878] schedule+0x68/0x210
[ 243.683896][ T123] [c00000000c38f9d0] [c00000000154ac80] schedule_preempt_disabled+0x30/0x50
[ 243.683904][ T123] [c00000000c38fa00] [c00000000154dbb0] __mutex_lock+0x730/0x10f0
[ 243.683913][ T123] [c00000000c38fb10] [c000000001154d40] napi_enable+0x30/0x60
[ 243.683921][ T123] [c00000000c38fb40] [c000000000f4ae94] ibmveth_open+0x68/0x5dc
[ 243.683928][ T123] [c00000000c38fbe0] [c000000000f4aa20] veth_pool_store+0x220/0x270
[ 243.683936][ T123] [c00000000c38fc70] [c000000000826278] sysfs_kf_write+0x68/0xb0
[ 243.683944][ T123] [c00000000c38fcb0] [c0000000008240b8] kernfs_fop_write_iter+0x198/0x2d0
[ 243.683951][ T123] [c00000000c38fd00] [c00000000071b9ac] vfs_write+0x34c/0x650
[ 243.683958][ T123] [c00000000c38fdc0] [c00000000071bea8] ksys_write+0x88/0x150
[ 243.683966][ T123] [c00000000c38fe10] [c0000000000317f4] system_call_exception+0x124/0x340
[ 243.683973][ T123] [c00000000c38fe50] [c00000000000d05c] system_call_vectored_common+0x15c/0x2ec
...
[ 243.684087][ T123] Showing all locks held in the system:
[ 243.684095][ T123] 1 lock held by khungtaskd/123:
[ 243.684099][ T123] #0: c00000000278e370 (rcu_read_lock){....}-{1:2}, at: debug_show_all_locks+0x50/0x248
[ 243.684114][ T123] 4 locks held by stress.sh/4365:
[ 243.684119][ T123] #0: c00000003a4cd3f8 (sb_writers#3){.+.+}-{0:0}, at: ksys_write+0x88/0x150
[ 243.684132][ T123] #1: c000000041aea888 (&of->mutex#2){+.+.}-{3:3}, at: kernfs_fop_write_iter+0x154/0x2d0
[ 243.684143][ T123] #2: c0000000366fb9a8 (kn->active#64){.+.+}-{0:0}, at: kernfs_fop_write_iter+0x160/0x2d0
[ 243.684155][ T123] #3: c000000035ff4cb8 (&dev->lock){+.+.}-{3:3}, at: napi_enable+0x30/0x60
[ 243.684166][ T123] 5 locks held by stress.sh/4366:
[ 243.684170][ T123] #0: c00000003a4cd3f8 (sb_writers#3){.+.+}-{0:0}, at: ksys_write+0x88/0x150
[ 243.
---truncated---(CVE-2025-22053)
In the Linux kernel, the following vulnerability has been resolved:
arcnet: Add NULL check in com20020pci_probe()
devm_kasprintf() returns NULL when memory allocation fails. Currently, com20020pci_probe() does not check for this case, which results in a NULL pointer dereference.
Add NULL check after devm_kasprintf() to prevent this issue and ensure no resources are left allocated.(CVE-2025-22054)
In the Linux kernel, the following vulnerability has been resolved:
net: fix geneve_opt length integer overflow
struct geneve_opt uses 5 bit length for each single option, which means every vary size option should be smaller than 128 bytes.
However, all current related Netlink policies cannot promise this length condition and the attacker can exploit a exact 128-byte size option to fake a zero length option and confuse the parsing logic, further achieve heap out-of-bounds read.
One example crash log is like below:
[ 3.905425] ================================================================== [ 3.905925] BUG: KASAN: slab-out-of-bounds in nla_put+0xa9/0xe0 [ 3.906255] Read of size 124 at addr ffff888005f291cc by task poc/177 [ 3.906646] [ 3.906775] CPU: 0 PID: 177 Comm: poc-oob-read Not tainted 6.1.132 #1 [ 3.907131] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.16.0-0-gd239552ce722-prebuilt.qemu.org 04/01/2014 [ 3.907784] Call Trace: [ 3.907925] <TASK> [ 3.908048] dump_stack_lvl+0x44/0x5c [ 3.908258] print_report+0x184/0x4be [ 3.909151] kasan_report+0xc5/0x100 [ 3.909539] kasan_check_range+0xf3/0x1a0 [ 3.909794] memcpy+0x1f/0x60 [ 3.909968] nla_put+0xa9/0xe0 [ 3.910147] tunnel_key_dump+0x945/0xba0 [ 3.911536] tcf_action_dump_1+0x1c1/0x340 [ 3.912436] tcf_action_dump+0x101/0x180 [ 3.912689] tcf_exts_dump+0x164/0x1e0 [ 3.912905] fw_dump+0x18b/0x2d0 [ 3.913483] tcf_fill_node+0x2ee/0x460 [ 3.914778] tfilter_notify+0xf4/0x180 [ 3.915208] tc_new_tfilter+0xd51/0x10d0 [ 3.918615] rtnetlink_rcv_msg+0x4a2/0x560 [ 3.919118] netlink_rcv_skb+0xcd/0x200 [ 3.919787] netlink_unicast+0x395/0x530 [ 3.921032] netlink_sendmsg+0x3d0/0x6d0 [ 3.921987] __sock_sendmsg+0x99/0xa0 [ 3.922220] __sys_sendto+0x1b7/0x240 [ 3.922682] __x64_sys_sendto+0x72/0x90 [ 3.922906] do_syscall_64+0x5e/0x90 [ 3.923814] entry_SYSCALL_64_after_hwframe+0x6e/0xd8 [ 3.924122] RIP: 0033:0x7e83eab84407 [ 3.924331] Code: 48 89 fa 4c 89 df e8 38 aa 00 00 8b 93 08 03 00 00 59 5e 48 83 f8 fc 74 1a 5b c3 0f 1f 84 00 00 00 00 00 48 8b 44 24 10 0f 05 <5b> c3 0f 1f 80 00 00 00 00 83 e2 39 83 faf [ 3.925330] RSP: 002b:00007ffff505e370 EFLAGS: 00000202 ORIG_RAX: 000000000000002c [ 3.925752] RAX: ffffffffffffffda RBX: 00007e83eaafa740 RCX: 00007e83eab84407 [ 3.926173] RDX: 00000000000001a8 RSI: 00007ffff505e3c0 RDI: 0000000000000003 [ 3.926587] RBP: 00007ffff505f460 R08: 00007e83eace1000 R09: 000000000000000c [ 3.926977] R10: 0000000000000000 R11: 0000000000000202 R12: 00007ffff505f3c0 [ 3.927367] R13: 00007ffff505f5c8 R14: 00007e83ead1b000 R15: 00005d4fbbe6dcb8
Fix these issues by enforing correct length condition in related policies.(CVE-2025-22055)
In the Linux kernel, the following vulnerability has been resolved:
udp: Fix memory accounting leak.
Matt Dowling reported a weird UDP memory usage issue.
Under normal operation, the UDP memory usage reported in /proc/net/sockstat remains close to zero. However, it occasionally spiked to 524,288 pages and never dropped. Moreover, the value doubled when the application was terminated. Finally, it caused intermittent packet drops.
We can reproduce the issue with the script below [0]:
-
/proc/net/sockstat reports 0 pages
cat /proc/net/sockstat | grep UDP:
UDP: inuse 1 mem 0
-
Run the script till the report reaches 524,288
python3 test.py & sleep 5
cat /proc/net/sockstat | grep UDP:
UDP: inuse 3 mem 524288 <-- (INT_MAX + 1) >> PAGE_SHIFT
-
Kill the socket and confirm the number never drops
pkill python3 && sleep 5
cat /proc/net/sockstat | grep UDP:
UDP: inuse 1 mem 524288
-
(necessary since v6.0) Trigger proto_memory_pcpu_drain()
python3 test.py & sleep 1 && pkill python3
-
The number doubles
cat /proc/net/sockstat | grep UDP:
UDP: inuse 1 mem 1048577
The application set INT_MAX to SO_RCVBUF, which triggered an integer overflow in udp_rmem_release().
When a socket is close()d, udp_destruct_common() purges its receive queue and sums up skb->truesize in the queue. This total is calculated and stored in a local unsigned integer variable.
The total size is then passed to udp_rmem_release() to adjust memory accounting. However, because the function takes a signed integer argument, the total size can wrap around, causing an overflow.
Then, the released amount is calculated as follows:
1) Add size to sk->sk_forward_alloc. 2) Round down sk->sk_forward_alloc to the nearest lower multiple of PAGE_SIZE and assign it to amount. 3) Subtract amount from sk->sk_forward_alloc. 4) Pass amount >> PAGE_SHIFT to __sk_mem_reduce_allocated().
When the issue occurred, the total in udp_destruct_common() was 2147484480 (INT_MAX + 833), which was cast to -2147482816 in udp_rmem_release().
At 1) sk->sk_forward_alloc is changed from 3264 to -2147479552, and 2) sets -2147479552 to amount. 3) reverts the wraparound, so we don't see a warning in inet_sock_destruct(). However, udp_memory_allocated ends up doubling at 4).
Since commit 3cd3399dd7a8 ("net: implement per-cpu reserves for memory_allocated"), memory usage no longer doubles immediately after a socket is close()d because __sk_mem_reduce_allocated() caches the amount in udp_memory_per_cpu_fw_alloc. However, the next time a UDP socket receives a packet, the subtraction takes effect, causing UDP memory usage to double.
This issue makes further memory allocation fail once the socket's sk->sk_rmem_alloc exceeds net.ipv4.udp_rmem_min, resulting in packet drops.
To prevent this issue, let's use unsigned int for the calculation and call sk_forward_alloc_add() only once for the small delta.
Note that first_packet_length() also potentially has the same problem.
[0]: from socket import *
SO_RCVBUFFORCE = 33 INT_MAX = (2 ** 31) - 1
s = socket(AF_INET, SOCK_DGRAM) s.bind(('', 0)) s.setsockopt(SOL_SOCKET, SO_RCVBUFFORCE, INT_MAX)
c = socket(AF_INET, SOCK_DGRAM) c.connect(s.getsockname())
data = b'a' * 100
while True: c.send(data)(CVE-2025-22058)
In the Linux kernel, the following vulnerability has been resolved:
sctp: add mutual exclusion in proc_sctp_do_udp_port()
We must serialize calls to sctp_udp_sock_stop() and sctp_udp_sock_start() or risk a crash as syzbot reported:
Oops: general protection fault, probably for non-canonical address 0xdffffc000000000d: 0000 [#1] SMP KASAN PTI KASAN: null-ptr-deref in range [0x0000000000000068-0x000000000000006f] CPU: 1 UID: 0 PID: 6551 Comm: syz.1.44 Not tainted 6.14.0-syzkaller-g7f2ff7b62617 #0 PREEMPT(full) Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/12/2025 RIP: 0010:kernel_sock_shutdown+0x47/0x70 net/socket.c:3653 Call Trace: <TASK> udp_tunnel_sock_release+0x68/0x80 net/ipv4/udp_tunnel_core.c:181 sctp_udp_sock_stop+0x71/0x160 net/sctp/protocol.c:930 proc_sctp_do_udp_port+0x264/0x450 net/sctp/sysctl.c:553 proc_sys_call_handler+0x3d0/0x5b0 fs/proc/proc_sysctl.c:601 iter_file_splice_write+0x91c/0x1150 fs/splice.c:738 do_splice_from fs/splice.c:935 [inline] direct_splice_actor+0x18f/0x6c0 fs/splice.c:1158 splice_direct_to_actor+0x342/0xa30 fs/splice.c:1102 do_splice_direct_actor fs/splice.c:1201 [inline] do_splice_direct+0x174/0x240 fs/splice.c:1227 do_sendfile+0xafd/0xe50 fs/read_write.c:1368 __do_sys_sendfile64 fs/read_write.c:1429 [inline] __se_sys_sendfile64 fs/read_write.c:1415 [inline] __x64_sys_sendfile64+0x1d8/0x220 fs/read_write.c:1415 do_syscall_x64 arch/x86/entry/syscall_64.c:63 inline
In the Linux kernel, the following vulnerability has been resolved:
net: fix NULL pointer dereference in l3mdev_l3_rcv
When delete l3s ipvlan:
ip link del link eth0 ipvlan1 type ipvlan mode l3s
This may cause a null pointer dereference:
Call trace:
ip_rcv_finish+0x48/0xd0
ip_rcv+0x5c/0x100
__netif_receive_skb_one_core+0x64/0xb0
__netif_receive_skb+0x20/0x80
process_backlog+0xb4/0x204
napi_poll+0xe8/0x294
net_rx_action+0xd8/0x22c
__do_softirq+0x12c/0x354
This is because l3mdev_l3_rcv() visit dev->l3mdev_ops after ipvlan_l3s_unregister() assign the dev->l3mdev_ops to NULL. The process like this:
(CPU1) | (CPU2)
l3mdev_l3_rcv() |
check dev->priv_flags: |
master = skb->dev; |
|
| ipvlan_l3s_unregister()
| set dev->priv_flags
| dev->l3mdev_ops = NULL;
|
visit master->l3mdev_ops |
To avoid this by do not set dev->l3mdev_ops when unregister l3s ipvlan.(CVE-2025-22103)
In the Linux kernel, the following vulnerability has been resolved:
net: Remove RTNL dance for SIOCBRADDIF and SIOCBRDELIF.
SIOCBRDELIF is passed to dev_ioctl() first and later forwarded to br_ioctl_call(), which causes unnecessary RTNL dance and the splat below [0] under RTNL pressure.
Let's say Thread A is trying to detach a device from a bridge and Thread B is trying to remove the bridge.
In dev_ioctl(), Thread A bumps the bridge device's refcnt by netdev_hold() and releases RTNL because the following br_ioctl_call() also re-acquires RTNL.
In the race window, Thread B could acquire RTNL and try to remove the bridge device. Then, rtnl_unlock() by Thread B will release RTNL and wait for netdev_put() by Thread A.
Thread A, however, must hold RTNL after the unlock in dev_ifsioc(), which may take long under RTNL pressure, resulting in the splat by Thread B.
Thread A (SIOCBRDELIF) Thread B (SIOCBRDELBR)
---------------------- ----------------------
sock_ioctl sock_ioctl
- sock_do_ioctl- br_ioctl_call
- dev_ioctl- br_ioctl_stub
|- rtnl_lock |
|- dev_ifsioc '
' |- dev = __dev_get_by_name(...)
|- netdev_hold(dev, ...) .
/ |- rtnl_unlock ------. |
| |- br_ioctl_call ---> |- rtnl_lock
Race | |- br_ioctl_stub |- br_del_bridge
Window | | | |- dev = __dev_get_by_name(...)
| | | May take long | - br_dev_delete(dev, ...)
| | | under RTNL pressure |- unregister_netdevice_queue(dev, ...)
| | | | - rtnl_unlock
\ | |- rtnl_lock <-'- netdev_run_todo
| |- ... - netdev_run_todo
|- rtnl_unlock |- __rtnl_unlock
| |- netdev_wait_allrefs_any
|- netdev_put(dev, ...) <----------------'
Wait refcnt decrement
and log splat below
To avoid blocking SIOCBRDELBR unnecessarily, let's not call dev_ioctl() for SIOCBRADDIF and SIOCBRDELIF.
In the dev_ioctl() path, we do the following:
- Copy struct ifreq by get_user_ifreq in sock_do_ioctl()
- Check CAP_NET_ADMIN in dev_ioctl()
- Call dev_load() in dev_ioctl()
-
Fetch the master dev from ifr.ifr_name in dev_ifsioc()
-
can be done by request_module() in br_ioctl_call(), so we move 1., 2., and 4. to br_ioctl_stub().
Note that 2. is also checked later in add_del_if(), but it's better performed before RTNL.
SIOCBRADDIF and SIOCBRDELIF have been processed in dev_ioctl() since the pre-git era, and there seems to be no specific reason to process them there.
[0]: unregister_netdevice: waiting for wpan3 to become free. Usage count = 2 ref_tracker: wpan3@ffff8880662d8608 has 1/1 users at __netdev_tracker_alloc include/linux/netdevice.h:4282 [inline] netdev_hold include/linux/netdevice.h:4311 [inline] dev_ifsioc+0xc6a/0x1160 net/core/dev_ioctl.c:624 dev_ioctl+0x255/0x10c0 net/core/dev_ioctl.c:826 sock_do_ioctl+0x1ca/0x260 net/socket.c:1213 sock_ioctl+0x23a/0x6c0 net/socket.c:1318 vfs_ioctl fs/ioctl.c:51 [inline] __do_sys_ioctl fs/ioctl.c:906 [inline] __se_sys_ioctl fs/ioctl.c:892 [inline] __x64_sys_ioctl+0x1a4/0x210 fs/ioctl.c:892 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcb/0x250 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2025-22111)
In the Linux kernel, the following vulnerability has been resolved:
sctp: detect and prevent references to a freed transport in sendmsg
sctp_sendmsg() re-uses associations and transports when possible by doing a lookup based on the socket endpoint and the message destination address, and then sctp_sendmsg_to_asoc() sets the selected transport in all the message chunks to be sent.
There's a possible race condition if another thread triggers the removal of that selected transport, for instance, by explicitly unbinding an address with setsockopt(SCTP_SOCKOPT_BINDX_REM), after the chunks have been set up and before the message is sent. This can happen if the send buffer is full, during the period when the sender thread temporarily releases the socket lock in sctp_wait_for_sndbuf().
This causes the access to the transport data in sctp_outq_select_transport(), when the association outqueue is flushed, to result in a use-after-free read.
This change avoids this scenario by having sctp_transport_free() signal the freeing of the transport, tagging it as "dead". In order to do this, the patch restores the "dead" bit in struct sctp_transport, which was removed in commit 47faa1e4c50e ("sctp: remove the dead field of sctp_transport").
Then, in the scenario where the sender thread has released the socket lock in sctp_wait_for_sndbuf(), the bit is checked again after re-acquiring the socket lock to detect the deletion. This is done while holding a reference to the transport to prevent it from being freed in the process.
If the transport was deleted while the socket lock was relinquished, sctp_sendmsg_to_asoc() will return -EAGAIN to let userspace retry the send.
The bug was found by a private syzbot instance (see the error report [1] and the C reproducer that triggers it [2]).(CVE-2025-23142)
In the Linux kernel, the following vulnerability has been resolved:
net: stmmac: Fix accessing freed irq affinity_hint
The cpumask should not be a local variable, since its pointer is saved to irq_desc and may be accessed from procfs. To fix it, use the persistent mask cpumask_of(cpu#).(CVE-2025-23155)
In the Linux kernel, the following vulnerability has been resolved:
tipc: fix memory leak in tipc_link_xmit
In case the backlog transmit queue for system-importance messages is overloaded, tipc_link_xmit() returns -ENOBUFS but the skb list is not purged. This leads to memory leak and failure when a skb is allocated.
This commit fixes this issue by purging the skb list before tipc_link_xmit() returns.(CVE-2025-37757)
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: free routing table on probe failure
If complete = true in dsa_tree_setup(), it means that we are the last switch of the tree which is successfully probing, and we should be setting up all switches from our probe path.
After "complete" becomes true, dsa_tree_setup_cpu_ports() or any subsequent function may fail. If that happens, the entire tree setup is in limbo: the first N-1 switches have successfully finished probing (doing nothing but having allocated persistent memory in the tree's dst->ports, and maybe dst->rtable), and switch N failed to probe, ending the tree setup process before anything is tangible from the user's PoV.
If switch N fails to probe, its memory (ports) will be freed and removed from dst->ports. However, the dst->rtable elements pointing to its ports, as created by dsa_link_touch(), will remain there, and will lead to use-after-free if dereferenced.
If dsa_tree_setup_switches() returns -EPROBE_DEFER, which is entirely possible because that is where ds->ops->setup() is, we get a kasan report like this:
================================================================== BUG: KASAN: slab-use-after-free in mv88e6xxx_setup_upstream_port+0x240/0x568 Read of size 8 at addr ffff000004f56020 by task kworker/u8:3/42
Call trace: __asan_report_load8_noabort+0x20/0x30 mv88e6xxx_setup_upstream_port+0x240/0x568 mv88e6xxx_setup+0xebc/0x1eb0 dsa_register_switch+0x1af4/0x2ae0 mv88e6xxx_register_switch+0x1b8/0x2a8 mv88e6xxx_probe+0xc4c/0xf60 mdio_probe+0x78/0xb8 really_probe+0x2b8/0x5a8 __driver_probe_device+0x164/0x298 driver_probe_device+0x78/0x258 __device_attach_driver+0x274/0x350
Allocated by task 42: __kasan_kmalloc+0x84/0xa0 __kmalloc_cache_noprof+0x298/0x490 dsa_switch_touch_ports+0x174/0x3d8 dsa_register_switch+0x800/0x2ae0 mv88e6xxx_register_switch+0x1b8/0x2a8 mv88e6xxx_probe+0xc4c/0xf60 mdio_probe+0x78/0xb8 really_probe+0x2b8/0x5a8 __driver_probe_device+0x164/0x298 driver_probe_device+0x78/0x258 __device_attach_driver+0x274/0x350
Freed by task 42: __kasan_slab_free+0x48/0x68 kfree+0x138/0x418 dsa_register_switch+0x2694/0x2ae0 mv88e6xxx_register_switch+0x1b8/0x2a8 mv88e6xxx_probe+0xc4c/0xf60 mdio_probe+0x78/0xb8 really_probe+0x2b8/0x5a8 __driver_probe_device+0x164/0x298 driver_probe_device+0x78/0x258 __device_attach_driver+0x274/0x350
The simplest way to fix the bug is to delete the routing table in its entirety. dsa_tree_setup_routing_table() has no problem in regenerating it even if we deleted links between ports other than those of switch N, because dsa_link_touch() first checks whether the port pair already exists in dst->rtable, allocating if not.
The deletion of the routing table in its entirety already exists in dsa_tree_teardown(), so refactor that into a function that can also be called from the tree setup error path.
In my analysis of the commit to blame, it is the one which added dsa_link elements to dst->rtable. Prior to that, each switch had its own ds->rtable which is freed when the switch fails to probe. But the tree is potentially persistent memory.(CVE-2025-37786)
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: mv88e6xxx: avoid unregistering devlink regions which were never registered
Russell King reports that a system with mv88e6xxx dereferences a NULL pointer when unbinding this driver: https://lore.kernel.org/netdev/(CVE-2025-37787)
In the Linux kernel, the following vulnerability has been resolved:
cxgb4: fix memory leak in cxgb4_init_ethtool_filters() error path
In the for loop used to allocate the loc_array and bmap for each port, a memory leak is possible when the allocation for loc_array succeeds, but the allocation for bmap fails. This is because when the control flow goes to the label free_eth_finfo, only the allocations starting from (i-1)th iteration are freed.
Fix that by freeing the loc_array in the bmap allocation error path.(CVE-2025-37788)
In the Linux kernel, the following vulnerability has been resolved:
net: mctp: Set SOCK_RCU_FREE
Bind lookup runs under RCU, so ensure that a socket doesn't go away in the middle of a lookup.(CVE-2025-37790)
In the Linux kernel, the following vulnerability has been resolved:
net_sched: hfsc: Fix a UAF vulnerability in class handling
This patch fixes a Use-After-Free vulnerability in the HFSC qdisc class handling. The issue occurs due to a time-of-check/time-of-use condition in hfsc_change_class() when working with certain child qdiscs like netem or codel.
The vulnerability works as follows: 1. hfsc_change_class() checks if a class has packets (q.qlen != 0) 2. It then calls qdisc_peek_len(), which for certain qdiscs (e.g., codel, netem) might drop packets and empty the queue 3. The code continues assuming the queue is still non-empty, adding the class to vttree 4. This breaks HFSC scheduler assumptions that only non-empty classes are in vttree 5. Later, when the class is destroyed, this can lead to a Use-After-Free
The fix adds a second queue length check after qdisc_peek_len() to verify the queue wasn't emptied.(CVE-2025-37797)
In the Linux kernel, the following vulnerability has been resolved:
mcb: fix a double free bug in chameleon_parse_gdd()
In chameleon_parse_gdd(), if mcb_device_register() fails, 'mdev' would be released in mcb_device_register() via put_device(). Thus, goto 'err' label and free 'mdev' again causes a double free. Just return if mcb_device_register() fails.(CVE-2025-37817)
In the Linux kernel, the following vulnerability has been resolved:
xen-netfront: handle NULL returned by xdp_convert_buff_to_frame()
The function xdp_convert_buff_to_frame() may return NULL if it fails to correctly convert the XDP buffer into an XDP frame due to memory constraints, internal errors, or invalid data. Failing to check for NULL may lead to a NULL pointer dereference if the result is used later in processing, potentially causing crashes, data corruption, or undefined behavior.
On XDP redirect failure, the associated page must be released explicitly if it was previously retained via get_page(). Failing to do so may result in a memory leak, as the pages reference count is not decremented.(CVE-2025-37820)
In the Linux kernel, the following vulnerability has been resolved:
net_sched: hfsc: Fix a potential UAF in hfsc_dequeue() too
Similarly to the previous patch, we need to safe guard hfsc_dequeue() too. But for this one, we don't have a reliable reproducer.(CVE-2025-37823)
In the Linux kernel, the following vulnerability has been resolved:
tipc: fix NULL pointer dereference in tipc_mon_reinit_self()
syzbot reported:
tipc: Node number set to 1055423674 Oops: general protection fault, probably for non-canonical address 0xdffffc0000000000: 0000 [#1] SMP KASAN NOPTI KASAN: null-ptr-deref in range [0x0000000000000000-0x0000000000000007] CPU: 3 UID: 0 PID: 6017 Comm: kworker/3:5 Not tainted 6.15.0-rc1-syzkaller-00246-g900241a5cc15 #0 PREEMPT(full) Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-debian-1.16.3-2~bpo12+1 04/01/2014 Workqueue: events tipc_net_finalize_work RIP: 0010:tipc_mon_reinit_self+0x11c/0x210 net/tipc/monitor.c:719 ... RSP: 0018:ffffc9000356fb68 EFLAGS: 00010246 RAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000003ee87cba RDX: 0000000000000000 RSI: ffffffff8dbc56a7 RDI: ffff88804c2cc010 RBP: dffffc0000000000 R08: 0000000000000001 R09: 0000000000000000 R10: 0000000000000001 R11: 0000000000000000 R12: 0000000000000007 R13: fffffbfff2111097 R14: ffff88804ead8000 R15: ffff88804ead9010 FS: 0000000000000000(0000) GS:ffff888097ab9000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00000000f720eb00 CR3: 000000000e182000 CR4: 0000000000352ef0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> tipc_net_finalize+0x10b/0x180 net/tipc/net.c:140 process_one_work+0x9cc/0x1b70 kernel/workqueue.c:3238 process_scheduled_works kernel/workqueue.c:3319 [inline] worker_thread+0x6c8/0xf10 kernel/workqueue.c:3400 kthread+0x3c2/0x780 kernel/kthread.c:464 ret_from_fork+0x45/0x80 arch/x86/kernel/process.c:153 ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:245 </TASK> ... RIP: 0010:tipc_mon_reinit_self+0x11c/0x210 net/tipc/monitor.c:719 ... RSP: 0018:ffffc9000356fb68 EFLAGS: 00010246 RAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000003ee87cba RDX: 0000000000000000 RSI: ffffffff8dbc56a7 RDI: ffff88804c2cc010 RBP: dffffc0000000000 R08: 0000000000000001 R09: 0000000000000000 R10: 0000000000000001 R11: 0000000000000000 R12: 0000000000000007 R13: fffffbfff2111097 R14: ffff88804ead8000 R15: ffff88804ead9010 FS: 0000000000000000(0000) GS:ffff888097ab9000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00000000f720eb00 CR3: 000000000e182000 CR4: 0000000000352ef0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400
There is a racing condition between workqueue created when enabling bearer and another thread created when disabling bearer right after that as follow:
| enabling_bearer | disabling_bearer |
|---|---|
| tipc_disc_timeout() | |
| { | bearer_disable() |
| ... | { |
| schedule_work(&tn->work); | tipc_mon_delete() |
| ... | { |
| } | ... |
| write_lock_bh(&mon->lock); | |
| mon->self = NULL; | |
| write_unlock_bh(&mon->lock); | |
| ... | |
| } | |
| tipc_net_finalize_work() | } |
| { | |
| ... | |
| tipc_net_finalize() | |
| { | |
| ... | |
| tipc_mon_reinit_self() | |
| { | |
| ... | |
| write_lock_bh(&mon->lock); | |
| mon->self->addr = tipc_own_addr(net); | |
| write_unlock_bh(&mon->lock); | |
| ... | |
| ---truncated---(CVE-2025-37824) |
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: clean up FDB, MDB, VLAN entries on unbind
As explained in many places such as commit b117e1e8a86d ("net: dsa: delete dsa_legacy_fdb_add and dsa_legacy_fdb_del"), DSA is written given the assumption that higher layers have balanced additions/deletions. As such, it only makes sense to be extremely vocal when those assumptions are violated and the driver unbinds with entries still present.
But Ido Schimmel points out a very simple situation where that is wrong: https://lore.kernel.org/netdev/ZDazSM5UsPPjQuKr@shredder/ (also briefly discussed by me in the aforementioned commit).
Basically, while the bridge bypass operations are not something that DSA explicitly documents, and for the majority of DSA drivers this API simply causes them to go to promiscuous mode, that isn't the case for all drivers. Some have the necessary requirements for bridge bypass operations to do something useful - see dsa_switch_supports_uc_filtering().
Although in tools/testing/selftests/net/forwarding/local_termination.sh, we made an effort to popularize better mechanisms to manage address filters on DSA interfaces from user space - namely macvlan for unicast, and setsockopt(IP_ADD_MEMBERSHIP) - through mtools - for multicast, the fact is that 'bridge fdb add ... self static local' also exists as kernel UAPI, and might be useful to someone, even if only for a quick hack.
It seems counter-productive to block that path by implementing shim .ndo_fdb_add and .ndo_fdb_del operations which just return -EOPNOTSUPP in order to prevent the ndo_dflt_fdb_add() and ndo_dflt_fdb_del() from running, although we could do that.
Accepting that cleanup is necessary seems to be the only option. Especially since we appear to be coming back at this from a different angle as well. Russell King is noticing that the WARN_ON() triggers even for VLANs: https://lore.kernel.org/netdev/(CVE-2025-37864)
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: mv88e6xxx: fix -ENOENT when deleting VLANs and MST is unsupported
Russell King reports that on the ZII dev rev B, deleting a bridge VLAN from a user port fails with -ENOENT: https://lore.kernel.org/netdev/(CVE-2025-37865)
In the Linux kernel, the following vulnerability has been resolved:
net: pktgen: fix access outside of user given buffer in pktgen_thread_write()
Honour the user given buffer size for the strn_len() calls (otherwise strn_len() will access memory outside of the user given buffer).(CVE-2025-38061)
In the Linux kernel, the following vulnerability has been resolved:
scsi: target: iscsi: Fix timeout on deleted connection
NOPIN response timer may expire on a deleted connection and crash with such logs:
Did not receive response to NOPIN on CID: 0, failing connection for I_T Nexus (null),i,0x00023d000125,iqn.2017-01.com.iscsi.target,t,0x3d
BUG: Kernel NULL pointer dereference on read at 0x00000000 NIP strlcpy+0x8/0xb0 LR iscsit_fill_cxn_timeout_err_stats+0x5c/0xc0 [iscsi_target_mod] Call Trace: iscsit_handle_nopin_response_timeout+0xfc/0x120 [iscsi_target_mod] call_timer_fn+0x58/0x1f0 run_timer_softirq+0x740/0x860 __do_softirq+0x16c/0x420 irq_exit+0x188/0x1c0 timer_interrupt+0x184/0x410
That is because nopin response timer may be re-started on nopin timer expiration.
Stop nopin timer before stopping the nopin response timer to be sure that no one of them will be re-started.(CVE-2025-38075)
In the Linux kernel, the following vulnerability has been resolved:
crypto: algif_hash - fix double free in hash_accept
If accept(2) is called on socket type algif_hash with MSG_MORE flag set and crypto_ahash_import fails, sk2 is freed. However, it is also freed in af_alg_release, leading to slab-use-after-free error.(CVE-2025-38079)
A vulnerability was found in Linux Kernel (Operating System) and classified as problematic.The manipulation of the argument bNumDescriptors with an unknown input leads to a unknown weakness. Using CWE to declare the problem leads to CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.Impacted is confidentiality.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 7a6d6b68db128da2078ccd9a751dfa3f75c9cf5b/41827a2dbdd7880df9881506dee13bc88d4230bb/1df80d748f984290c895e843401824215dcfbfb0/a8f842534807985d3a676006d140541b87044345/4fa7831cf0ac71a0a345369d1a6084f2b096e55e/74388368927e9c52a69524af5bbd6c55eb4690de/485e1b741eb838cbe1d6b0e81e5ab62ae6c095cf/fe7f7ac8e0c708446ff017453add769ffc15deed is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38103)
A vulnerability was found in Linux Kernel up to 6.16-rc1 (Operating System). It has been classified as critical.CWE is classifying the issue as CWE-404. The product does not release or incorrectly releases a resource before it is made available for re-use.This is going to have an impact on availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc2 eliminates this vulnerability. Applying the patch c337efb20d6d9f9bbb4746f6b119917af5c886dc/b44f791f27b14c9eb6b907fbe51f2ba8bec32085/5814a7fc3abb41f63f2d44c9d3ff9d4e62965b72/9c19498bdd7cb9d854bd3c54260f71cf7408495e/b4e9bab6011b9559b7c157b16b91ae46d4d8c533/d1bc80da75c789f2f6830df89d91fb2f7a509943/82448d4dcd8406dec688632a405fdcf7f170ec69/82ffbe7776d0ac084031f114167712269bf3d832 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38115)
A vulnerability, which was classified as critical, has been found in Linux Kernel up to 6.6.93/6.12.33/6.15.2/6.16-rc1 (Operating System).Using CWE to declare the problem leads to CWE-416. Referencing memory after it has been freed can cause a program to crash, use unexpected values, or execute code.Impacted is confidentiality, integrity, and availability.Upgrading to version 6.6.94, 6.12.34, 6.15.3 or 6.16-rc2 eliminates this vulnerability. Applying the patch bdd56875c6926d8009914f427df71797693e90d4/4e83f2dbb2bf677e614109df24426c4dded472d4/d7882db79135c829a922daf3571f33ea1e056ae3/6fe26f694c824b8a4dbf50c635bee1302e3f099c is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38117)
A vulnerability, which was classified as problematic, was found in Linux Kernel up to 8058c88ac0df21239daee54b5934d5c80ca9685f (Operating System).CWE is classifying the issue as CWE-401. The product does not sufficiently track and release allocated memory after it has been used, which slowly consumes remaining memory.This is going to have an impact on confidentiality.Upgrading to version 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch b5ad58285f9217d68cd5ea2ad86ce254a3fe7c4d/90bc7f5a244aadee4292b28098b7c98aadd4b3aa/39bab2d3517b5b50c609b4f8c66129bf619fffa0/251496ce1728c9fd47bd2b20a7b21b20b9a020ca/8068e1e42b46518ce680dc6470bcd710efc3fa0a/ea77c397bff8b6d59f6d83dae1425b08f465e8b5 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38120)
A vulnerability classified as problematic has been found in Linux Kernel (Operating System).This is going to have an impact on confidentiality, integrity, and availability.Upgrading to version 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 0e65f38bd1aa14ea86e221b7bb814d38278d86c3/85eef1748c024da1a191aed56b30a3a65958c50c/4399f59a9467a324ed46657555f0e1f209a14acb/a04302867094bdc6efac1b598370fc47cf3f2388/3382a1ed7f778db841063f5d7e317ac55f9e7f72 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38124)
A vulnerability, which was classified as problematic, has been found in Linux Kernel up to 6.6.93/6.12.33/6.15.2 (Operating System).Using CWE to declare the problem leads to CWE-371.Impacted is confidentiality, integrity, and availability.Upgrading to version 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 1d3c5d0dec6797eca3a861dab0816fa9505d9c3e/276849954d7cbe6eec827b21fe2df43f9bf07011/0e061abaad1498c5b76c10c594d4359ceb6b9145/0153f36041b8e52019ebfa8629c13bf8f9b0a951 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38127)
A vulnerability has been found in Linux Kernel up to 6.15.2 (Operating System) and classified as problematic.The CWE definition for the vulnerability is CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.As an impact it is known to affect confidentiality, integrity, and availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch e5ce9df1d68094d37360dbd9b09289d42fa21e54/7ee3fb6258da8c890a51b514f60d7570dc703605/40471b23147c86ea3ed97faee79937c618250bd0/5482ef9875eaa43f0435e14570e1193823de857e/ee5ee646385f5846dcbc881389f3c44a197c402a/5a85c21f812e02cb00ca07007d88acdd42d08c46/ac4e317a95a1092b5da5b9918b7118759342641c is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-19787).(CVE-2025-38157)
A vulnerability classified as problematic was found in Linux Kernel up to 6.15.3 (Operating System).As an impact it is known to affect confidentiality, integrity, and availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch d9a55869d8237e677ddaa18b0f58586364cfbc1c/1f6332872374b7f482fc4ad865f9422fedb587fc/fbfe8446cd3274b9e367f5708d94574230a44409/5018d035530b6fbfad33eeb1dd1bc87da419a276/a87cbcc909ccfd394d4936a94663f586453d0961/aaa644e7ffff02e12c89cbce4753bc0b6f23ff87/d14cbed4baccd712447fb3f9c011f008b56b2097/42cb74a92adaf88061039601ddf7c874f58b554e is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-20037).(CVE-2025-38219)
A vulnerability, which was classified as critical, has been found in Linux Kernel up to 6.6.94/6.12.34/6.15.3 (Operating System).Using CWE to declare the problem leads to CWE-476. A NULL pointer dereference occurs when the application dereferences a pointer that it expects to be valid, but is NULL, typically causing a crash or exit.Impacted is availability.Upgrading to version 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch cf6a4c4ac7b6e3214f25df594c9689a62f1bb456/be5f3061a6f904e3674257879e71881ceee5b673/d7af6eee8cd60f55aa8c5fe2b91f11ec0c9a0f27/e26268ff1dcae5662c1b96c35f18cfa6ab73d9de is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-20036).(CVE-2025-38220)
Linux kernel is the kernel used by Linux, the open source operating system of the Linux Foundation in the United States. There is a security vulnerability in Linux kernel. This vulnerability originates from improper processing of composing size in vivid drivers, which may lead to over-bounds writing.(CVE-2025-38226)
A vulnerability, which was classified as problematic, was found in Linux Kernel up to 32700ecf8007e071d1ce4c78f65b85f46d05f32a (Operating System).The manipulation of the argument adxl_component_count with an unknown input leads to a unknown weakness. CWE is classifying the issue as CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.This is going to have an impact on confidentiality.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 80bf28fd623d97dd4f4825fbbe9d736cec2afba3/a6ed3a6edff09c1187cc6ade7f5967bca2376a13/bf6a8502a5f4ff6e4d135d795945cdade49ec8b0/e8530ed3c0769a4d8f79c212715ec1cf277787f8/3f5d0659000923735350da60ad710f8c804544fe/a13e8343ffcff27af1ff79597ff7ba241e6d9471/31ef6f7c9aee3be78d63789653e92350f2537f93/20d2d476b3ae18041be423671a8637ed5ffd6958 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38298)
A vulnerability classified as critical was found in Linux Kernel up to 6.15.3 (Operating System).The CWE definition for the vulnerability is CWE-476. A NULL pointer dereference occurs when the application dereferences a pointer that it expects to be valid, but is NULL, typically causing a crash or exit.As an impact it is known to affect availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch 5c1a34ff5b0bfdfd2f9343aa9b08d25df618bac5/ec669e5bf409f16e464bfad75f0ba039a45de29a/43d5e3bb5f1dcd91e30238ea0b59a5f77063f84e/23361b479f2700c00960d3ae9cdc8ededa762d47/2e7c64d7a92c031d016f11c8e8cb05131ab7b75a/f78b38af3540b4875147b7b884ee11a27b3dbf4c/a377996d714afb8d4d5f4906336f78510039da29/af98b0157adf6504fade79b3e6cb260c4ff68e37 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38337)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"bpftool-debuginfo-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"kernel-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"kernel-debuginfo-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"kernel-debugsource-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"kernel-devel-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"kernel-headers-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"kernel-source-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"kernel-tools-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"kernel-tools-debuginfo-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"kernel-tools-devel-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"perf-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"perf-debuginfo-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"python3-perf-6.6.0-102.0.0.94.oe2403.aarch64.rpm",
"python3-perf-debuginfo-6.6.0-102.0.0.94.oe2403.aarch64.rpm"
],
"src": [
"kernel-6.6.0-102.0.0.94.oe2403.src.rpm"
],
"x86_64": [
"bpftool-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"bpftool-debuginfo-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"kernel-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"kernel-debuginfo-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"kernel-debugsource-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"kernel-devel-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"kernel-headers-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"kernel-source-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"kernel-tools-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"kernel-tools-debuginfo-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"kernel-tools-devel-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"perf-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"perf-debuginfo-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"python3-perf-6.6.0-102.0.0.94.oe2403.x86_64.rpm",
"python3-perf-debuginfo-6.6.0-102.0.0.94.oe2403.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:24.03-LTS",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-24.03-LTS"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "6.6.0-102.0.0.94.oe2403"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbpf: consider that tail calls invalidate packet pointers\n\nTail-called programs could execute any of the helpers that invalidate\npacket pointers. Hence, conservatively assume that each tail call\ninvalidates packet pointers.\n\nMaking the change in bpf_helper_changes_pkt_data() automatically makes\nuse of check_cfg() logic that computes \u0026apos;changes_pkt_data\u0026apos; effect for\nglobal sub-programs, such that the following program could be\nrejected:\n\n int tail_call(struct __sk_buff *sk)\n {\n \tbpf_tail_call_static(sk, \u0026amp;jmp_table, 0);\n \treturn 0;\n }\n\n SEC(\u0026quot;tc\u0026quot;)\n int not_safe(struct __sk_buff *sk)\n {\n \tint *p = (void *)(long)sk-\u0026gt;data;\n \t... make p valid ...\n \ttail_call(sk);\n \t*p = 42; /* this is unsafe */\n \t...\n }\n\nThe tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that\ncan invalidate packet pointers. Otherwise, it can\u0026apos;t be freplaced with\ntailcall_freplace.c:entry_freplace() that does a tail call.(CVE-2024-58237)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/rxe: Fix the warning \u0026quot;__rxe_cleanup+0x12c/0x170 [rdma_rxe]\u0026quot;\n\nThe Call Trace is as below:\n\u0026quot;\n \u0026lt;TASK\u0026gt;\n ? show_regs.cold+0x1a/0x1f\n ? __rxe_cleanup+0x12c/0x170 [rdma_rxe]\n ? __warn+0x84/0xd0\n ? __rxe_cleanup+0x12c/0x170 [rdma_rxe]\n ? report_bug+0x105/0x180\n ? handle_bug+0x46/0x80\n ? exc_invalid_op+0x19/0x70\n ? asm_exc_invalid_op+0x1b/0x20\n ? __rxe_cleanup+0x12c/0x170 [rdma_rxe]\n ? __rxe_cleanup+0x124/0x170 [rdma_rxe]\n rxe_destroy_qp.cold+0x24/0x29 [rdma_rxe]\n ib_destroy_qp_user+0x118/0x190 [ib_core]\n rdma_destroy_qp.cold+0x43/0x5e [rdma_cm]\n rtrs_cq_qp_destroy.cold+0x1d/0x2b [rtrs_core]\n rtrs_srv_close_work.cold+0x1b/0x31 [rtrs_server]\n process_one_work+0x21d/0x3f0\n worker_thread+0x4a/0x3c0\n ? process_one_work+0x3f0/0x3f0\n kthread+0xf0/0x120\n ? kthread_complete_and_exit+0x20/0x20\n ret_from_fork+0x22/0x30\n \u0026lt;/TASK\u0026gt;\n\u0026quot;\nWhen too many rdma resources are allocated, rxe needs more time to\nhandle these rdma resources. Sometimes with the current timeout, rxe\ncan not release the rdma resources correctly.\n\nCompared with other rdma drivers, a bigger timeout is used.(CVE-2025-21829)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: enetc: VFs do not support HWTSTAMP_TX_ONESTEP_SYNC\n\nActually ENETC VFs do not support HWTSTAMP_TX_ONESTEP_SYNC because only\nENETC PF can access PMa_SINGLE_STEP registers. And there will be a crash\nif VFs are used to test one-step timestamp, the crash log as follows.\n\n[ 129.110909] Unable to handle kernel paging request at virtual address 00000000000080c0\n[ 129.287769] Call trace:\n[ 129.290219] enetc_port_mac_wr+0x30/0xec (P)\n[ 129.294504] enetc_start_xmit+0xda4/0xe74\n[ 129.298525] enetc_xmit+0x70/0xec\n[ 129.301848] dev_hard_start_xmit+0x98/0x118(CVE-2025-21894)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncaif_virtio: fix wrong pointer check in cfv_probe()\n\ndel_vqs() frees virtqueues, therefore cfv-\u0026gt;vq_tx pointer should be checked\nfor NULL before calling it, not cfv-\u0026gt;vdev. Also the current implementation\nis redundant because the pointer cfv-\u0026gt;vdev is dereferenced before it is\nchecked for NULL.\n\nFix this by checking cfv-\u0026gt;vq_tx for NULL instead of cfv-\u0026gt;vdev before\ncalling del_vqs().(CVE-2025-21904)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\neth: bnxt: do not update checksum in bnxt_xdp_build_skb()\n\nThe bnxt_rx_pkt() updates ip_summed value at the end if checksum offload\nis enabled.\nWhen the XDP-MB program is attached and it returns XDP_PASS, the\nbnxt_xdp_build_skb() is called to update skb_shared_info.\nThe main purpose of bnxt_xdp_build_skb() is to update skb_shared_info,\nbut it updates ip_summed value too if checksum offload is enabled.\nThis is actually duplicate work.\n\nWhen the bnxt_rx_pkt() updates ip_summed value, it checks if ip_summed\nis CHECKSUM_NONE or not.\nIt means that ip_summed should be CHECKSUM_NONE at this moment.\nBut ip_summed may already be updated to CHECKSUM_UNNECESSARY in the\nXDP-MB-PASS path.\nSo the by skb_checksum_none_assert() WARNS about it.\n\nThis is duplicate work and updating ip_summed in the\nbnxt_xdp_build_skb() is not needed.\n\nSplat looks like:\nWARNING: CPU: 3 PID: 5782 at ./include/linux/skbuff.h:5155 bnxt_rx_pkt+0x479b/0x7610 [bnxt_en]\nModules linked in: bnxt_re bnxt_en rdma_ucm rdma_cm iw_cm ib_cm ib_uverbs veth xt_nat xt_tcpudp xt_conntrack nft_chain_nat xt_MASQUERADE nf_]\nCPU: 3 UID: 0 PID: 5782 Comm: socat Tainted: G W 6.14.0-rc4+ #27\nTainted: [W]=WARN\nHardware name: ASUS System Product Name/PRIME Z690-P D4, BIOS 0603 11/01/2021\nRIP: 0010:bnxt_rx_pkt+0x479b/0x7610 [bnxt_en]\nCode: 54 24 0c 4c 89 f1 4c 89 ff c1 ea 1f ff d3 0f 1f 00 49 89 c6 48 85 c0 0f 84 4c e5 ff ff 48 89 c7 e8 ca 3d a0 c8 e9 8f f4 ff ff \u0026lt;0f\u0026gt; 0b f\nRSP: 0018:ffff88881ba09928 EFLAGS: 00010202\nRAX: 0000000000000000 RBX: 00000000c7590303 RCX: 0000000000000000\nRDX: 1ffff1104e7d1610 RSI: 0000000000000001 RDI: ffff8881c91300b8\nRBP: ffff88881ba09b28 R08: ffff888273e8b0d0 R09: ffff888273e8b070\nR10: ffff888273e8b010 R11: ffff888278b0f000 R12: ffff888273e8b080\nR13: ffff8881c9130e00 R14: ffff8881505d3800 R15: ffff888273e8b000\nFS: 00007f5a2e7be080(0000) GS:ffff88881ba00000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00007fff2e708ff8 CR3: 000000013e3b0000 CR4: 00000000007506f0\nPKRU: 55555554\nCall Trace:\n \u0026lt;IRQ\u0026gt;\n ? __warn+0xcd/0x2f0\n ? bnxt_rx_pkt+0x479b/0x7610\n ? report_bug+0x326/0x3c0\n ? handle_bug+0x53/0xa0\n ? exc_invalid_op+0x14/0x50\n ? asm_exc_invalid_op+0x16/0x20\n ? bnxt_rx_pkt+0x479b/0x7610\n ? bnxt_rx_pkt+0x3e41/0x7610\n ? __pfx_bnxt_rx_pkt+0x10/0x10\n ? napi_complete_done+0x2cf/0x7d0\n __bnxt_poll_work+0x4e8/0x1220\n ? __pfx___bnxt_poll_work+0x10/0x10\n ? __pfx_mark_lock.part.0+0x10/0x10\n bnxt_poll_p5+0x36a/0xfa0\n ? __pfx_bnxt_poll_p5+0x10/0x10\n __napi_poll.constprop.0+0xa0/0x440\n net_rx_action+0x899/0xd00\n...\n\nFollowing ping.py patch adds xdp-mb-pass case. so ping.py is going\nto be able to reproduce this issue.(CVE-2025-21960)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\neth: bnxt: fix truesize for mb-xdp-pass case\n\nWhen mb-xdp is set and return is XDP_PASS, packet is converted from\nxdp_buff to sk_buff with xdp_update_skb_shared_info() in\nbnxt_xdp_build_skb().\nbnxt_xdp_build_skb() passes incorrect truesize argument to\nxdp_update_skb_shared_info().\nThe truesize is calculated as BNXT_RX_PAGE_SIZE * sinfo-\u0026gt;nr_frags but\nthe skb_shared_info was wiped by napi_build_skb() before.\nSo it stores sinfo-\u0026gt;nr_frags before bnxt_xdp_build_skb() and use it\ninstead of getting skb_shared_info from xdp_get_shared_info_from_buff().\n\nSplat looks like:\n ------------[ cut here ]------------\n WARNING: CPU: 2 PID: 0 at net/core/skbuff.c:6072 skb_try_coalesce+0x504/0x590\n Modules linked in: xt_nat xt_tcpudp veth af_packet xt_conntrack nft_chain_nat xt_MASQUERADE nf_conntrack_netlink xfrm_user xt_addrtype nft_coms\n CPU: 2 UID: 0 PID: 0 Comm: swapper/2 Not tainted 6.14.0-rc2+ #3\n RIP: 0010:skb_try_coalesce+0x504/0x590\n Code: 4b fd ff ff 49 8b 34 24 40 80 e6 40 0f 84 3d fd ff ff 49 8b 74 24 48 40 f6 c6 01 0f 84 2e fd ff ff 48 8d 4e ff e9 25 fd ff ff \u0026lt;0f\u0026gt; 0b e99\n RSP: 0018:ffffb62c4120caa8 EFLAGS: 00010287\n RAX: 0000000000000003 RBX: ffffb62c4120cb14 RCX: 0000000000000ec0\n RDX: 0000000000001000 RSI: ffffa06e5d7dc000 RDI: 0000000000000003\n RBP: ffffa06e5d7ddec0 R08: ffffa06e6120a800 R09: ffffa06e7a119900\n R10: 0000000000002310 R11: ffffa06e5d7dcec0 R12: ffffe4360575f740\n R13: ffffe43600000000 R14: 0000000000000002 R15: 0000000000000002\n FS: 0000000000000000(0000) GS:ffffa0755f700000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 00007f147b76b0f8 CR3: 00000001615d4000 CR4: 00000000007506f0\n PKRU: 55555554\n Call Trace:\n \u0026lt;IRQ\u0026gt;\n ? __warn+0x84/0x130\n ? skb_try_coalesce+0x504/0x590\n ? report_bug+0x18a/0x1a0\n ? handle_bug+0x53/0x90\n ? exc_invalid_op+0x14/0x70\n ? asm_exc_invalid_op+0x16/0x20\n ? skb_try_coalesce+0x504/0x590\n inet_frag_reasm_finish+0x11f/0x2e0\n ip_defrag+0x37a/0x900\n ip_local_deliver+0x51/0x120\n ip_sublist_rcv_finish+0x64/0x70\n ip_sublist_rcv+0x179/0x210\n ip_list_rcv+0xf9/0x130\n\nHow to reproduce:\n\u0026lt;Node A\u0026gt;\nip link set $interface1 xdp obj xdp_pass.o\nip link set $interface1 mtu 9000 up\nip a a 10.0.0.1/24 dev $interface1\n\u0026lt;Node B\u0026gt;\nip link set $interfac2 mtu 9000 up\nip a a 10.0.0.2/24 dev $interface2\nping 10.0.0.1 -s 65000\n\nFollowing ping.py patch adds xdp-mb-pass case. so ping.py is going to be\nable to reproduce this issue.(CVE-2025-21961)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/mlx5: handle errors in mlx5_chains_create_table()\n\nIn mlx5_chains_create_table(), the return value of\u00a0mlx5_get_fdb_sub_ns()\nand mlx5_get_flow_namespace() must be checked to prevent NULL pointer\ndereferences. If either function fails, the function should log error\nmessage with mlx5_core_warn() and return error pointer.(CVE-2025-21975)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxsk: fix an integer overflow in xp_create_and_assign_umem()\n\nSince the i and pool-\u0026gt;chunk_size variables are of type \u0026apos;u32\u0026apos;,\ntheir product can wrap around and then be cast to \u0026apos;u64\u0026apos;.\nThis can lead to two different XDP buffers pointing to the same\nmemory area.\n\nFound by InfoTeCS on behalf of Linux Verification Center\n(linuxtesting.org) with SVACE.(CVE-2025-21997)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: atm: fix use after free in lec_send()\n\nThe -\u0026gt;send() operation frees skb so save the length before calling\n-\u0026gt;send() to avoid a use after free.(CVE-2025-22004)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusbnet:fix NPE during rx_complete\n\nMissing usbnet_going_away Check in Critical Path.\nThe usb_submit_urb function lacks a usbnet_going_away\nvalidation, whereas __usbnet_queue_skb includes this check.\n\nThis inconsistency creates a race condition where:\nA URB request may succeed, but the corresponding SKB data\nfails to be queued.\n\nSubsequent processes:\n(e.g., rx_complete \u2192 defer_bh \u2192 __skb_unlink(skb, list))\nattempt to access skb-\u0026gt;next, triggering a NULL pointer\ndereference (Kernel Panic).(CVE-2025-22050)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: ibmveth: make veth_pool_store stop hanging\n\nv2:\n- Created a single error handling unlock and exit in veth_pool_store\n- Greatly expanded commit message with previous explanatory-only text\n\nSummary: Use rtnl_mutex to synchronize veth_pool_store with itself,\nibmveth_close and ibmveth_open, preventing multiple calls in a row to\nnapi_disable.\n\nBackground: Two (or more) threads could call veth_pool_store through\nwriting to /sys/devices/vio/30000002/pool*/*. You can do this easily\nwith a little shell script. This causes a hang.\n\nI configured LOCKDEP, compiled ibmveth.c with DEBUG, and built a new\nkernel. I ran this test again and saw:\n\n Setting pool0/active to 0\n Setting pool1/active to 1\n [ 73.911067][ T4365] ibmveth 30000002 eth0: close starting\n Setting pool1/active to 1\n Setting pool1/active to 0\n [ 73.911367][ T4366] ibmveth 30000002 eth0: close starting\n [ 73.916056][ T4365] ibmveth 30000002 eth0: close complete\n [ 73.916064][ T4365] ibmveth 30000002 eth0: open starting\n [ 110.808564][ T712] systemd-journald[712]: Sent WATCHDOG=1 notification.\n [ 230.808495][ T712] systemd-journald[712]: Sent WATCHDOG=1 notification.\n [ 243.683786][ T123] INFO: task stress.sh:4365 blocked for more than 122 seconds.\n [ 243.683827][ T123] Not tainted 6.14.0-01103-g2df0c02dab82-dirty #8\n [ 243.683833][ T123] \u0026quot;echo 0 \u0026gt; /proc/sys/kernel/hung_task_timeout_secs\u0026quot; disables this message.\n [ 243.683838][ T123] task:stress.sh state:D stack:28096 pid:4365 tgid:4365 ppid:4364 task_flags:0x400040 flags:0x00042000\n [ 243.683852][ T123] Call Trace:\n [ 243.683857][ T123] [c00000000c38f690] [0000000000000001] 0x1 (unreliable)\n [ 243.683868][ T123] [c00000000c38f840] [c00000000001f908] __switch_to+0x318/0x4e0\n [ 243.683878][ T123] [c00000000c38f8a0] [c000000001549a70] __schedule+0x500/0x12a0\n [ 243.683888][ T123] [c00000000c38f9a0] [c00000000154a878] schedule+0x68/0x210\n [ 243.683896][ T123] [c00000000c38f9d0] [c00000000154ac80] schedule_preempt_disabled+0x30/0x50\n [ 243.683904][ T123] [c00000000c38fa00] [c00000000154dbb0] __mutex_lock+0x730/0x10f0\n [ 243.683913][ T123] [c00000000c38fb10] [c000000001154d40] napi_enable+0x30/0x60\n [ 243.683921][ T123] [c00000000c38fb40] [c000000000f4ae94] ibmveth_open+0x68/0x5dc\n [ 243.683928][ T123] [c00000000c38fbe0] [c000000000f4aa20] veth_pool_store+0x220/0x270\n [ 243.683936][ T123] [c00000000c38fc70] [c000000000826278] sysfs_kf_write+0x68/0xb0\n [ 243.683944][ T123] [c00000000c38fcb0] [c0000000008240b8] kernfs_fop_write_iter+0x198/0x2d0\n [ 243.683951][ T123] [c00000000c38fd00] [c00000000071b9ac] vfs_write+0x34c/0x650\n [ 243.683958][ T123] [c00000000c38fdc0] [c00000000071bea8] ksys_write+0x88/0x150\n [ 243.683966][ T123] [c00000000c38fe10] [c0000000000317f4] system_call_exception+0x124/0x340\n [ 243.683973][ T123] [c00000000c38fe50] [c00000000000d05c] system_call_vectored_common+0x15c/0x2ec\n ...\n [ 243.684087][ T123] Showing all locks held in the system:\n [ 243.684095][ T123] 1 lock held by khungtaskd/123:\n [ 243.684099][ T123] #0: c00000000278e370 (rcu_read_lock){....}-{1:2}, at: debug_show_all_locks+0x50/0x248\n [ 243.684114][ T123] 4 locks held by stress.sh/4365:\n [ 243.684119][ T123] #0: c00000003a4cd3f8 (sb_writers#3){.+.+}-{0:0}, at: ksys_write+0x88/0x150\n [ 243.684132][ T123] #1: c000000041aea888 (\u0026amp;of-\u0026gt;mutex#2){+.+.}-{3:3}, at: kernfs_fop_write_iter+0x154/0x2d0\n [ 243.684143][ T123] #2: c0000000366fb9a8 (kn-\u0026gt;active#64){.+.+}-{0:0}, at: kernfs_fop_write_iter+0x160/0x2d0\n [ 243.684155][ T123] #3: c000000035ff4cb8 (\u0026amp;dev-\u0026gt;lock){+.+.}-{3:3}, at: napi_enable+0x30/0x60\n [ 243.684166][ T123] 5 locks held by stress.sh/4366:\n [ 243.684170][ T123] #0: c00000003a4cd3f8 (sb_writers#3){.+.+}-{0:0}, at: ksys_write+0x88/0x150\n [ 243.\n---truncated---(CVE-2025-22053)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\narcnet: Add NULL check in com20020pci_probe()\n\ndevm_kasprintf() returns NULL when memory allocation fails. Currently,\ncom20020pci_probe() does not check for this case, which results in a\nNULL pointer dereference.\n\nAdd NULL check after devm_kasprintf() to prevent this issue and ensure\nno resources are left allocated.(CVE-2025-22054)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: fix geneve_opt length integer overflow\n\nstruct geneve_opt uses 5 bit length for each single option, which\nmeans every vary size option should be smaller than 128 bytes.\n\nHowever, all current related Netlink policies cannot promise this\nlength condition and the attacker can exploit a exact 128-byte size\noption to *fake* a zero length option and confuse the parsing logic,\nfurther achieve heap out-of-bounds read.\n\nOne example crash log is like below:\n\n[ 3.905425] ==================================================================\n[ 3.905925] BUG: KASAN: slab-out-of-bounds in nla_put+0xa9/0xe0\n[ 3.906255] Read of size 124 at addr ffff888005f291cc by task poc/177\n[ 3.906646]\n[ 3.906775] CPU: 0 PID: 177 Comm: poc-oob-read Not tainted 6.1.132 #1\n[ 3.907131] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.16.0-0-gd239552ce722-prebuilt.qemu.org 04/01/2014\n[ 3.907784] Call Trace:\n[ 3.907925] \u0026lt;TASK\u0026gt;\n[ 3.908048] dump_stack_lvl+0x44/0x5c\n[ 3.908258] print_report+0x184/0x4be\n[ 3.909151] kasan_report+0xc5/0x100\n[ 3.909539] kasan_check_range+0xf3/0x1a0\n[ 3.909794] memcpy+0x1f/0x60\n[ 3.909968] nla_put+0xa9/0xe0\n[ 3.910147] tunnel_key_dump+0x945/0xba0\n[ 3.911536] tcf_action_dump_1+0x1c1/0x340\n[ 3.912436] tcf_action_dump+0x101/0x180\n[ 3.912689] tcf_exts_dump+0x164/0x1e0\n[ 3.912905] fw_dump+0x18b/0x2d0\n[ 3.913483] tcf_fill_node+0x2ee/0x460\n[ 3.914778] tfilter_notify+0xf4/0x180\n[ 3.915208] tc_new_tfilter+0xd51/0x10d0\n[ 3.918615] rtnetlink_rcv_msg+0x4a2/0x560\n[ 3.919118] netlink_rcv_skb+0xcd/0x200\n[ 3.919787] netlink_unicast+0x395/0x530\n[ 3.921032] netlink_sendmsg+0x3d0/0x6d0\n[ 3.921987] __sock_sendmsg+0x99/0xa0\n[ 3.922220] __sys_sendto+0x1b7/0x240\n[ 3.922682] __x64_sys_sendto+0x72/0x90\n[ 3.922906] do_syscall_64+0x5e/0x90\n[ 3.923814] entry_SYSCALL_64_after_hwframe+0x6e/0xd8\n[ 3.924122] RIP: 0033:0x7e83eab84407\n[ 3.924331] Code: 48 89 fa 4c 89 df e8 38 aa 00 00 8b 93 08 03 00 00 59 5e 48 83 f8 fc 74 1a 5b c3 0f 1f 84 00 00 00 00 00 48 8b 44 24 10 0f 05 \u0026lt;5b\u0026gt; c3 0f 1f 80 00 00 00 00 83 e2 39 83 faf\n[ 3.925330] RSP: 002b:00007ffff505e370 EFLAGS: 00000202 ORIG_RAX: 000000000000002c\n[ 3.925752] RAX: ffffffffffffffda RBX: 00007e83eaafa740 RCX: 00007e83eab84407\n[ 3.926173] RDX: 00000000000001a8 RSI: 00007ffff505e3c0 RDI: 0000000000000003\n[ 3.926587] RBP: 00007ffff505f460 R08: 00007e83eace1000 R09: 000000000000000c\n[ 3.926977] R10: 0000000000000000 R11: 0000000000000202 R12: 00007ffff505f3c0\n[ 3.927367] R13: 00007ffff505f5c8 R14: 00007e83ead1b000 R15: 00005d4fbbe6dcb8\n\nFix these issues by enforing correct length condition in related\npolicies.(CVE-2025-22055)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nudp: Fix memory accounting leak.\n\nMatt Dowling reported a weird UDP memory usage issue.\n\nUnder normal operation, the UDP memory usage reported in /proc/net/sockstat\nremains close to zero. However, it occasionally spiked to 524,288 pages\nand never dropped. Moreover, the value doubled when the application was\nterminated. Finally, it caused intermittent packet drops.\n\nWe can reproduce the issue with the script below [0]:\n\n 1. /proc/net/sockstat reports 0 pages\n\n # cat /proc/net/sockstat | grep UDP:\n UDP: inuse 1 mem 0\n\n 2. Run the script till the report reaches 524,288\n\n # python3 test.py \u0026amp; sleep 5\n # cat /proc/net/sockstat | grep UDP:\n UDP: inuse 3 mem 524288 \u0026lt;-- (INT_MAX + 1) \u0026gt;\u0026gt; PAGE_SHIFT\n\n 3. Kill the socket and confirm the number never drops\n\n # pkill python3 \u0026amp;\u0026amp; sleep 5\n # cat /proc/net/sockstat | grep UDP:\n UDP: inuse 1 mem 524288\n\n 4. (necessary since v6.0) Trigger proto_memory_pcpu_drain()\n\n # python3 test.py \u0026amp; sleep 1 \u0026amp;\u0026amp; pkill python3\n\n 5. The number doubles\n\n # cat /proc/net/sockstat | grep UDP:\n UDP: inuse 1 mem 1048577\n\nThe application set INT_MAX to SO_RCVBUF, which triggered an integer\noverflow in udp_rmem_release().\n\nWhen a socket is close()d, udp_destruct_common() purges its receive\nqueue and sums up skb-\u0026gt;truesize in the queue. This total is calculated\nand stored in a local unsigned integer variable.\n\nThe total size is then passed to udp_rmem_release() to adjust memory\naccounting. However, because the function takes a signed integer\nargument, the total size can wrap around, causing an overflow.\n\nThen, the released amount is calculated as follows:\n\n 1) Add size to sk-\u0026gt;sk_forward_alloc.\n 2) Round down sk-\u0026gt;sk_forward_alloc to the nearest lower multiple of\n PAGE_SIZE and assign it to amount.\n 3) Subtract amount from sk-\u0026gt;sk_forward_alloc.\n 4) Pass amount \u0026gt;\u0026gt; PAGE_SHIFT to __sk_mem_reduce_allocated().\n\nWhen the issue occurred, the total in udp_destruct_common() was 2147484480\n(INT_MAX + 833), which was cast to -2147482816 in udp_rmem_release().\n\nAt 1) sk-\u0026gt;sk_forward_alloc is changed from 3264 to -2147479552, and\n2) sets -2147479552 to amount. 3) reverts the wraparound, so we don\u0026apos;t\nsee a warning in inet_sock_destruct(). However, udp_memory_allocated\nends up doubling at 4).\n\nSince commit 3cd3399dd7a8 (\u0026quot;net: implement per-cpu reserves for\nmemory_allocated\u0026quot;), memory usage no longer doubles immediately after\na socket is close()d because __sk_mem_reduce_allocated() caches the\namount in udp_memory_per_cpu_fw_alloc. However, the next time a UDP\nsocket receives a packet, the subtraction takes effect, causing UDP\nmemory usage to double.\n\nThis issue makes further memory allocation fail once the socket\u0026apos;s\nsk-\u0026gt;sk_rmem_alloc exceeds net.ipv4.udp_rmem_min, resulting in packet\ndrops.\n\nTo prevent this issue, let\u0026apos;s use unsigned int for the calculation and\ncall sk_forward_alloc_add() only once for the small delta.\n\nNote that first_packet_length() also potentially has the same problem.\n\n[0]:\nfrom socket import *\n\nSO_RCVBUFFORCE = 33\nINT_MAX = (2 ** 31) - 1\n\ns = socket(AF_INET, SOCK_DGRAM)\ns.bind((\u0026apos;\u0026apos;, 0))\ns.setsockopt(SOL_SOCKET, SO_RCVBUFFORCE, INT_MAX)\n\nc = socket(AF_INET, SOCK_DGRAM)\nc.connect(s.getsockname())\n\ndata = b\u0026apos;a\u0026apos; * 100\n\nwhile True:\n c.send(data)(CVE-2025-22058)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: add mutual exclusion in proc_sctp_do_udp_port()\n\nWe must serialize calls to sctp_udp_sock_stop() and sctp_udp_sock_start()\nor risk a crash as syzbot reported:\n\nOops: general protection fault, probably for non-canonical address 0xdffffc000000000d: 0000 [#1] SMP KASAN PTI\nKASAN: null-ptr-deref in range [0x0000000000000068-0x000000000000006f]\nCPU: 1 UID: 0 PID: 6551 Comm: syz.1.44 Not tainted 6.14.0-syzkaller-g7f2ff7b62617 #0 PREEMPT(full)\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/12/2025\n RIP: 0010:kernel_sock_shutdown+0x47/0x70 net/socket.c:3653\nCall Trace:\n \u0026lt;TASK\u0026gt;\n udp_tunnel_sock_release+0x68/0x80 net/ipv4/udp_tunnel_core.c:181\n sctp_udp_sock_stop+0x71/0x160 net/sctp/protocol.c:930\n proc_sctp_do_udp_port+0x264/0x450 net/sctp/sysctl.c:553\n proc_sys_call_handler+0x3d0/0x5b0 fs/proc/proc_sysctl.c:601\n iter_file_splice_write+0x91c/0x1150 fs/splice.c:738\n do_splice_from fs/splice.c:935 [inline]\n direct_splice_actor+0x18f/0x6c0 fs/splice.c:1158\n splice_direct_to_actor+0x342/0xa30 fs/splice.c:1102\n do_splice_direct_actor fs/splice.c:1201 [inline]\n do_splice_direct+0x174/0x240 fs/splice.c:1227\n do_sendfile+0xafd/0xe50 fs/read_write.c:1368\n __do_sys_sendfile64 fs/read_write.c:1429 [inline]\n __se_sys_sendfile64 fs/read_write.c:1415 [inline]\n __x64_sys_sendfile64+0x1d8/0x220 fs/read_write.c:1415\n do_syscall_x64 arch/x86/entry/syscall_64.c:63 [inline](CVE-2025-22062)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: fix NULL pointer dereference in l3mdev_l3_rcv\n\nWhen delete l3s ipvlan:\n\n ip link del link eth0 ipvlan1 type ipvlan mode l3s\n\nThis may cause a null pointer dereference:\n\n Call trace:\n ip_rcv_finish+0x48/0xd0\n ip_rcv+0x5c/0x100\n __netif_receive_skb_one_core+0x64/0xb0\n __netif_receive_skb+0x20/0x80\n process_backlog+0xb4/0x204\n napi_poll+0xe8/0x294\n net_rx_action+0xd8/0x22c\n __do_softirq+0x12c/0x354\n\nThis is because l3mdev_l3_rcv() visit dev-\u0026gt;l3mdev_ops after\nipvlan_l3s_unregister() assign the dev-\u0026gt;l3mdev_ops to NULL. The process\nlike this:\n\n (CPU1) | (CPU2)\n l3mdev_l3_rcv() |\n check dev-\u0026gt;priv_flags: |\n master = skb-\u0026gt;dev; |\n |\n | ipvlan_l3s_unregister()\n | set dev-\u0026gt;priv_flags\n | dev-\u0026gt;l3mdev_ops = NULL;\n |\n visit master-\u0026gt;l3mdev_ops |\n\nTo avoid this by do not set dev-\u0026gt;l3mdev_ops when unregister l3s ipvlan.(CVE-2025-22103)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: Remove RTNL dance for SIOCBRADDIF and SIOCBRDELIF.\n\nSIOCBRDELIF is passed to dev_ioctl() first and later forwarded to\nbr_ioctl_call(), which causes unnecessary RTNL dance and the splat\nbelow [0] under RTNL pressure.\n\nLet\u0026apos;s say Thread A is trying to detach a device from a bridge and\nThread B is trying to remove the bridge.\n\nIn dev_ioctl(), Thread A bumps the bridge device\u0026apos;s refcnt by\nnetdev_hold() and releases RTNL because the following br_ioctl_call()\nalso re-acquires RTNL.\n\nIn the race window, Thread B could acquire RTNL and try to remove\nthe bridge device. Then, rtnl_unlock() by Thread B will release RTNL\nand wait for netdev_put() by Thread A.\n\nThread A, however, must hold RTNL after the unlock in dev_ifsioc(),\nwhich may take long under RTNL pressure, resulting in the splat by\nThread B.\n\n Thread A (SIOCBRDELIF) Thread B (SIOCBRDELBR)\n ---------------------- ----------------------\n sock_ioctl sock_ioctl\n `- sock_do_ioctl `- br_ioctl_call\n `- dev_ioctl `- br_ioctl_stub\n |- rtnl_lock |\n |- dev_ifsioc \u0026apos;\n \u0026apos; |- dev = __dev_get_by_name(...)\n |- netdev_hold(dev, ...) .\n / |- rtnl_unlock ------. |\n | |- br_ioctl_call `---\u0026gt; |- rtnl_lock\n Race | | `- br_ioctl_stub |- br_del_bridge\n Window | | | |- dev = __dev_get_by_name(...)\n | | | May take long | `- br_dev_delete(dev, ...)\n | | | under RTNL pressure | `- unregister_netdevice_queue(dev, ...)\n | | | | `- rtnl_unlock\n \\ | |- rtnl_lock \u0026lt;-\u0026apos; `- netdev_run_todo\n | |- ... `- netdev_run_todo\n | `- rtnl_unlock |- __rtnl_unlock\n | |- netdev_wait_allrefs_any\n |- netdev_put(dev, ...) \u0026lt;----------------\u0026apos;\n Wait refcnt decrement\n and log splat below\n\nTo avoid blocking SIOCBRDELBR unnecessarily, let\u0026apos;s not call\ndev_ioctl() for SIOCBRADDIF and SIOCBRDELIF.\n\nIn the dev_ioctl() path, we do the following:\n\n 1. Copy struct ifreq by get_user_ifreq in sock_do_ioctl()\n 2. Check CAP_NET_ADMIN in dev_ioctl()\n 3. Call dev_load() in dev_ioctl()\n 4. Fetch the master dev from ifr.ifr_name in dev_ifsioc()\n\n3. can be done by request_module() in br_ioctl_call(), so we move\n1., 2., and 4. to br_ioctl_stub().\n\nNote that 2. is also checked later in add_del_if(), but it\u0026apos;s better\nperformed before RTNL.\n\nSIOCBRADDIF and SIOCBRDELIF have been processed in dev_ioctl() since\nthe pre-git era, and there seems to be no specific reason to process\nthem there.\n\n[0]:\nunregister_netdevice: waiting for wpan3 to become free. Usage count = 2\nref_tracker: wpan3@ffff8880662d8608 has 1/1 users at\n __netdev_tracker_alloc include/linux/netdevice.h:4282 [inline]\n netdev_hold include/linux/netdevice.h:4311 [inline]\n dev_ifsioc+0xc6a/0x1160 net/core/dev_ioctl.c:624\n dev_ioctl+0x255/0x10c0 net/core/dev_ioctl.c:826\n sock_do_ioctl+0x1ca/0x260 net/socket.c:1213\n sock_ioctl+0x23a/0x6c0 net/socket.c:1318\n vfs_ioctl fs/ioctl.c:51 [inline]\n __do_sys_ioctl fs/ioctl.c:906 [inline]\n __se_sys_ioctl fs/ioctl.c:892 [inline]\n __x64_sys_ioctl+0x1a4/0x210 fs/ioctl.c:892\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcb/0x250 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2025-22111)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: detect and prevent references to a freed transport in sendmsg\n\nsctp_sendmsg() re-uses associations and transports when possible by\ndoing a lookup based on the socket endpoint and the message destination\naddress, and then sctp_sendmsg_to_asoc() sets the selected transport in\nall the message chunks to be sent.\n\nThere\u0026apos;s a possible race condition if another thread triggers the removal\nof that selected transport, for instance, by explicitly unbinding an\naddress with setsockopt(SCTP_SOCKOPT_BINDX_REM), after the chunks have\nbeen set up and before the message is sent. This can happen if the send\nbuffer is full, during the period when the sender thread temporarily\nreleases the socket lock in sctp_wait_for_sndbuf().\n\nThis causes the access to the transport data in\nsctp_outq_select_transport(), when the association outqueue is flushed,\nto result in a use-after-free read.\n\nThis change avoids this scenario by having sctp_transport_free() signal\nthe freeing of the transport, tagging it as \u0026quot;dead\u0026quot;. In order to do this,\nthe patch restores the \u0026quot;dead\u0026quot; bit in struct sctp_transport, which was\nremoved in\ncommit 47faa1e4c50e (\u0026quot;sctp: remove the dead field of sctp_transport\u0026quot;).\n\nThen, in the scenario where the sender thread has released the socket\nlock in sctp_wait_for_sndbuf(), the bit is checked again after\nre-acquiring the socket lock to detect the deletion. This is done while\nholding a reference to the transport to prevent it from being freed in\nthe process.\n\nIf the transport was deleted while the socket lock was relinquished,\nsctp_sendmsg_to_asoc() will return -EAGAIN to let userspace retry the\nsend.\n\nThe bug was found by a private syzbot instance (see the error report [1]\nand the C reproducer that triggers it [2]).(CVE-2025-23142)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: stmmac: Fix accessing freed irq affinity_hint\n\nThe cpumask should not be a local variable, since its pointer is saved\nto irq_desc and may be accessed from procfs.\nTo fix it, use the persistent mask cpumask_of(cpu#).(CVE-2025-23155)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntipc: fix memory leak in tipc_link_xmit\n\nIn case the backlog transmit queue for system-importance messages is overloaded,\ntipc_link_xmit() returns -ENOBUFS but the skb list is not purged. This leads to\nmemory leak and failure when a skb is allocated.\n\nThis commit fixes this issue by purging the skb list before tipc_link_xmit()\nreturns.(CVE-2025-37757)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: dsa: free routing table on probe failure\n\nIf complete = true in dsa_tree_setup(), it means that we are the last\nswitch of the tree which is successfully probing, and we should be\nsetting up all switches from our probe path.\n\nAfter \u0026quot;complete\u0026quot; becomes true, dsa_tree_setup_cpu_ports() or any\nsubsequent function may fail. If that happens, the entire tree setup is\nin limbo: the first N-1 switches have successfully finished probing\n(doing nothing but having allocated persistent memory in the tree\u0026apos;s\ndst-\u0026gt;ports, and maybe dst-\u0026gt;rtable), and switch N failed to probe, ending\nthe tree setup process before anything is tangible from the user\u0026apos;s PoV.\n\nIf switch N fails to probe, its memory (ports) will be freed and removed\nfrom dst-\u0026gt;ports. However, the dst-\u0026gt;rtable elements pointing to its ports,\nas created by dsa_link_touch(), will remain there, and will lead to\nuse-after-free if dereferenced.\n\nIf dsa_tree_setup_switches() returns -EPROBE_DEFER, which is entirely\npossible because that is where ds-\u0026gt;ops-\u0026gt;setup() is, we get a kasan\nreport like this:\n\n==================================================================\nBUG: KASAN: slab-use-after-free in mv88e6xxx_setup_upstream_port+0x240/0x568\nRead of size 8 at addr ffff000004f56020 by task kworker/u8:3/42\n\nCall trace:\n __asan_report_load8_noabort+0x20/0x30\n mv88e6xxx_setup_upstream_port+0x240/0x568\n mv88e6xxx_setup+0xebc/0x1eb0\n dsa_register_switch+0x1af4/0x2ae0\n mv88e6xxx_register_switch+0x1b8/0x2a8\n mv88e6xxx_probe+0xc4c/0xf60\n mdio_probe+0x78/0xb8\n really_probe+0x2b8/0x5a8\n __driver_probe_device+0x164/0x298\n driver_probe_device+0x78/0x258\n __device_attach_driver+0x274/0x350\n\nAllocated by task 42:\n __kasan_kmalloc+0x84/0xa0\n __kmalloc_cache_noprof+0x298/0x490\n dsa_switch_touch_ports+0x174/0x3d8\n dsa_register_switch+0x800/0x2ae0\n mv88e6xxx_register_switch+0x1b8/0x2a8\n mv88e6xxx_probe+0xc4c/0xf60\n mdio_probe+0x78/0xb8\n really_probe+0x2b8/0x5a8\n __driver_probe_device+0x164/0x298\n driver_probe_device+0x78/0x258\n __device_attach_driver+0x274/0x350\n\nFreed by task 42:\n __kasan_slab_free+0x48/0x68\n kfree+0x138/0x418\n dsa_register_switch+0x2694/0x2ae0\n mv88e6xxx_register_switch+0x1b8/0x2a8\n mv88e6xxx_probe+0xc4c/0xf60\n mdio_probe+0x78/0xb8\n really_probe+0x2b8/0x5a8\n __driver_probe_device+0x164/0x298\n driver_probe_device+0x78/0x258\n __device_attach_driver+0x274/0x350\n\nThe simplest way to fix the bug is to delete the routing table in its\nentirety. dsa_tree_setup_routing_table() has no problem in regenerating\nit even if we deleted links between ports other than those of switch N,\nbecause dsa_link_touch() first checks whether the port pair already\nexists in dst-\u0026gt;rtable, allocating if not.\n\nThe deletion of the routing table in its entirety already exists in\ndsa_tree_teardown(), so refactor that into a function that can also be\ncalled from the tree setup error path.\n\nIn my analysis of the commit to blame, it is the one which added\ndsa_link elements to dst-\u0026gt;rtable. Prior to that, each switch had its own\nds-\u0026gt;rtable which is freed when the switch fails to probe. But the tree\nis potentially persistent memory.(CVE-2025-37786)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: dsa: mv88e6xxx: avoid unregistering devlink regions which were never registered\n\nRussell King reports that a system with mv88e6xxx dereferences a NULL\npointer when unbinding this driver:\nhttps://lore.kernel.org/netdev/(CVE-2025-37787)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncxgb4: fix memory leak in cxgb4_init_ethtool_filters() error path\n\nIn the for loop used to allocate the loc_array and bmap for each port, a\nmemory leak is possible when the allocation for loc_array succeeds,\nbut the allocation for bmap fails. This is because when the control flow\ngoes to the label free_eth_finfo, only the allocations starting from\n(i-1)th iteration are freed.\n\nFix that by freeing the loc_array in the bmap allocation error path.(CVE-2025-37788)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: mctp: Set SOCK_RCU_FREE\n\nBind lookup runs under RCU, so ensure that a socket doesn\u0026apos;t go away in\nthe middle of a lookup.(CVE-2025-37790)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet_sched: hfsc: Fix a UAF vulnerability in class handling\n\nThis patch fixes a Use-After-Free vulnerability in the HFSC qdisc class\nhandling. The issue occurs due to a time-of-check/time-of-use condition\nin hfsc_change_class() when working with certain child qdiscs like netem\nor codel.\n\nThe vulnerability works as follows:\n1. hfsc_change_class() checks if a class has packets (q.qlen != 0)\n2. It then calls qdisc_peek_len(), which for certain qdiscs (e.g.,\n codel, netem) might drop packets and empty the queue\n3. The code continues assuming the queue is still non-empty, adding\n the class to vttree\n4. This breaks HFSC scheduler assumptions that only non-empty classes\n are in vttree\n5. Later, when the class is destroyed, this can lead to a Use-After-Free\n\nThe fix adds a second queue length check after qdisc_peek_len() to verify\nthe queue wasn\u0026apos;t emptied.(CVE-2025-37797)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmcb: fix a double free bug in chameleon_parse_gdd()\n\nIn chameleon_parse_gdd(), if mcb_device_register() fails, \u0026apos;mdev\u0026apos;\nwould be released in mcb_device_register() via put_device().\nThus, goto \u0026apos;err\u0026apos; label and free \u0026apos;mdev\u0026apos; again causes a double free.\nJust return if mcb_device_register() fails.(CVE-2025-37817)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxen-netfront: handle NULL returned by xdp_convert_buff_to_frame()\n\nThe function xdp_convert_buff_to_frame() may return NULL if it fails\nto correctly convert the XDP buffer into an XDP frame due to memory\nconstraints, internal errors, or invalid data. Failing to check for NULL\nmay lead to a NULL pointer dereference if the result is used later in\nprocessing, potentially causing crashes, data corruption, or undefined\nbehavior.\n\nOn XDP redirect failure, the associated page must be released explicitly\nif it was previously retained via get_page(). Failing to do so may result\nin a memory leak, as the pages reference count is not decremented.(CVE-2025-37820)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet_sched: hfsc: Fix a potential UAF in hfsc_dequeue() too\n\nSimilarly to the previous patch, we need to safe guard hfsc_dequeue()\ntoo. But for this one, we don\u0026apos;t have a reliable reproducer.(CVE-2025-37823)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntipc: fix NULL pointer dereference in tipc_mon_reinit_self()\n\nsyzbot reported:\n\ntipc: Node number set to 1055423674\nOops: general protection fault, probably for non-canonical address 0xdffffc0000000000: 0000 [#1] SMP KASAN NOPTI\nKASAN: null-ptr-deref in range [0x0000000000000000-0x0000000000000007]\nCPU: 3 UID: 0 PID: 6017 Comm: kworker/3:5 Not tainted 6.15.0-rc1-syzkaller-00246-g900241a5cc15 #0 PREEMPT(full)\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-debian-1.16.3-2~bpo12+1 04/01/2014\nWorkqueue: events tipc_net_finalize_work\nRIP: 0010:tipc_mon_reinit_self+0x11c/0x210 net/tipc/monitor.c:719\n...\nRSP: 0018:ffffc9000356fb68 EFLAGS: 00010246\nRAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000003ee87cba\nRDX: 0000000000000000 RSI: ffffffff8dbc56a7 RDI: ffff88804c2cc010\nRBP: dffffc0000000000 R08: 0000000000000001 R09: 0000000000000000\nR10: 0000000000000001 R11: 0000000000000000 R12: 0000000000000007\nR13: fffffbfff2111097 R14: ffff88804ead8000 R15: ffff88804ead9010\nFS: 0000000000000000(0000) GS:ffff888097ab9000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00000000f720eb00 CR3: 000000000e182000 CR4: 0000000000352ef0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n \u0026lt;TASK\u0026gt;\n tipc_net_finalize+0x10b/0x180 net/tipc/net.c:140\n process_one_work+0x9cc/0x1b70 kernel/workqueue.c:3238\n process_scheduled_works kernel/workqueue.c:3319 [inline]\n worker_thread+0x6c8/0xf10 kernel/workqueue.c:3400\n kthread+0x3c2/0x780 kernel/kthread.c:464\n ret_from_fork+0x45/0x80 arch/x86/kernel/process.c:153\n ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:245\n \u0026lt;/TASK\u0026gt;\n...\nRIP: 0010:tipc_mon_reinit_self+0x11c/0x210 net/tipc/monitor.c:719\n...\nRSP: 0018:ffffc9000356fb68 EFLAGS: 00010246\nRAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000003ee87cba\nRDX: 0000000000000000 RSI: ffffffff8dbc56a7 RDI: ffff88804c2cc010\nRBP: dffffc0000000000 R08: 0000000000000001 R09: 0000000000000000\nR10: 0000000000000001 R11: 0000000000000000 R12: 0000000000000007\nR13: fffffbfff2111097 R14: ffff88804ead8000 R15: ffff88804ead9010\nFS: 0000000000000000(0000) GS:ffff888097ab9000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00000000f720eb00 CR3: 000000000e182000 CR4: 0000000000352ef0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n\nThere is a racing condition between workqueue created when enabling\nbearer and another thread created when disabling bearer right after\nthat as follow:\n\nenabling_bearer | disabling_bearer\n--------------- | ----------------\ntipc_disc_timeout() |\n{ | bearer_disable()\n ... | {\n schedule_work(\u0026amp;tn-\u0026gt;work); | tipc_mon_delete()\n ... | {\n} | ...\n | write_lock_bh(\u0026amp;mon-\u0026gt;lock);\n | mon-\u0026gt;self = NULL;\n | write_unlock_bh(\u0026amp;mon-\u0026gt;lock);\n | ...\n | }\ntipc_net_finalize_work() | }\n{ |\n ... |\n tipc_net_finalize() |\n { |\n ... |\n tipc_mon_reinit_self() |\n { |\n ... |\n write_lock_bh(\u0026amp;mon-\u0026gt;lock); |\n mon-\u0026gt;self-\u0026gt;addr = tipc_own_addr(net); |\n write_unlock_bh(\u0026amp;mon-\u0026gt;lock); |\n ... \n---truncated---(CVE-2025-37824)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: dsa: clean up FDB, MDB, VLAN entries on unbind\n\nAs explained in many places such as commit b117e1e8a86d (\u0026quot;net: dsa:\ndelete dsa_legacy_fdb_add and dsa_legacy_fdb_del\u0026quot;), DSA is written given\nthe assumption that higher layers have balanced additions/deletions.\nAs such, it only makes sense to be extremely vocal when those\nassumptions are violated and the driver unbinds with entries still\npresent.\n\nBut Ido Schimmel points out a very simple situation where that is wrong:\nhttps://lore.kernel.org/netdev/ZDazSM5UsPPjQuKr@shredder/\n(also briefly discussed by me in the aforementioned commit).\n\nBasically, while the bridge bypass operations are not something that DSA\nexplicitly documents, and for the majority of DSA drivers this API\nsimply causes them to go to promiscuous mode, that isn\u0026apos;t the case for\nall drivers. Some have the necessary requirements for bridge bypass\noperations to do something useful - see dsa_switch_supports_uc_filtering().\n\nAlthough in tools/testing/selftests/net/forwarding/local_termination.sh,\nwe made an effort to popularize better mechanisms to manage address\nfilters on DSA interfaces from user space - namely macvlan for unicast,\nand setsockopt(IP_ADD_MEMBERSHIP) - through mtools - for multicast, the\nfact is that \u0026apos;bridge fdb add ... self static local\u0026apos; also exists as\nkernel UAPI, and might be useful to someone, even if only for a quick\nhack.\n\nIt seems counter-productive to block that path by implementing shim\n.ndo_fdb_add and .ndo_fdb_del operations which just return -EOPNOTSUPP\nin order to prevent the ndo_dflt_fdb_add() and ndo_dflt_fdb_del() from\nrunning, although we could do that.\n\nAccepting that cleanup is necessary seems to be the only option.\nEspecially since we appear to be coming back at this from a different\nangle as well. Russell King is noticing that the WARN_ON() triggers even\nfor VLANs:\nhttps://lore.kernel.org/netdev/(CVE-2025-37864)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: dsa: mv88e6xxx: fix -ENOENT when deleting VLANs and MST is unsupported\n\nRussell King reports that on the ZII dev rev B, deleting a bridge VLAN\nfrom a user port fails with -ENOENT:\nhttps://lore.kernel.org/netdev/(CVE-2025-37865)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: pktgen: fix access outside of user given buffer in pktgen_thread_write()\n\nHonour the user given buffer size for the strn_len() calls (otherwise\nstrn_len() will access memory outside of the user given buffer).(CVE-2025-38061)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: target: iscsi: Fix timeout on deleted connection\n\nNOPIN response timer may expire on a deleted connection and crash with\nsuch logs:\n\nDid not receive response to NOPIN on CID: 0, failing connection for I_T Nexus (null),i,0x00023d000125,iqn.2017-01.com.iscsi.target,t,0x3d\n\nBUG: Kernel NULL pointer dereference on read at 0x00000000\nNIP strlcpy+0x8/0xb0\nLR iscsit_fill_cxn_timeout_err_stats+0x5c/0xc0 [iscsi_target_mod]\nCall Trace:\n iscsit_handle_nopin_response_timeout+0xfc/0x120 [iscsi_target_mod]\n call_timer_fn+0x58/0x1f0\n run_timer_softirq+0x740/0x860\n __do_softirq+0x16c/0x420\n irq_exit+0x188/0x1c0\n timer_interrupt+0x184/0x410\n\nThat is because nopin response timer may be re-started on nopin timer\nexpiration.\n\nStop nopin timer before stopping the nopin response timer to be sure\nthat no one of them will be re-started.(CVE-2025-38075)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: algif_hash - fix double free in hash_accept\n\nIf accept(2) is called on socket type algif_hash with\nMSG_MORE flag set and crypto_ahash_import fails,\nsk2 is freed. However, it is also freed in af_alg_release,\nleading to slab-use-after-free error.(CVE-2025-38079)\n\nA vulnerability was found in Linux Kernel (Operating System) and classified as problematic.The manipulation of the argument bNumDescriptors with an unknown input leads to a unknown weakness. Using CWE to declare the problem leads to CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.Impacted is confidentiality.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 7a6d6b68db128da2078ccd9a751dfa3f75c9cf5b/41827a2dbdd7880df9881506dee13bc88d4230bb/1df80d748f984290c895e843401824215dcfbfb0/a8f842534807985d3a676006d140541b87044345/4fa7831cf0ac71a0a345369d1a6084f2b096e55e/74388368927e9c52a69524af5bbd6c55eb4690de/485e1b741eb838cbe1d6b0e81e5ab62ae6c095cf/fe7f7ac8e0c708446ff017453add769ffc15deed is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38103)\n\nA vulnerability was found in Linux Kernel up to 6.16-rc1 (Operating System). It has been classified as critical.CWE is classifying the issue as CWE-404. The product does not release or incorrectly releases a resource before it is made available for re-use.This is going to have an impact on availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc2 eliminates this vulnerability. Applying the patch c337efb20d6d9f9bbb4746f6b119917af5c886dc/b44f791f27b14c9eb6b907fbe51f2ba8bec32085/5814a7fc3abb41f63f2d44c9d3ff9d4e62965b72/9c19498bdd7cb9d854bd3c54260f71cf7408495e/b4e9bab6011b9559b7c157b16b91ae46d4d8c533/d1bc80da75c789f2f6830df89d91fb2f7a509943/82448d4dcd8406dec688632a405fdcf7f170ec69/82ffbe7776d0ac084031f114167712269bf3d832 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38115)\n\nA vulnerability, which was classified as critical, has been found in Linux Kernel up to 6.6.93/6.12.33/6.15.2/6.16-rc1 (Operating System).Using CWE to declare the problem leads to CWE-416. Referencing memory after it has been freed can cause a program to crash, use unexpected values, or execute code.Impacted is confidentiality, integrity, and availability.Upgrading to version 6.6.94, 6.12.34, 6.15.3 or 6.16-rc2 eliminates this vulnerability. Applying the patch bdd56875c6926d8009914f427df71797693e90d4/4e83f2dbb2bf677e614109df24426c4dded472d4/d7882db79135c829a922daf3571f33ea1e056ae3/6fe26f694c824b8a4dbf50c635bee1302e3f099c is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38117)\n\nA vulnerability, which was classified as problematic, was found in Linux Kernel up to 8058c88ac0df21239daee54b5934d5c80ca9685f (Operating System).CWE is classifying the issue as CWE-401. The product does not sufficiently track and release allocated memory after it has been used, which slowly consumes remaining memory.This is going to have an impact on confidentiality.Upgrading to version 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch b5ad58285f9217d68cd5ea2ad86ce254a3fe7c4d/90bc7f5a244aadee4292b28098b7c98aadd4b3aa/39bab2d3517b5b50c609b4f8c66129bf619fffa0/251496ce1728c9fd47bd2b20a7b21b20b9a020ca/8068e1e42b46518ce680dc6470bcd710efc3fa0a/ea77c397bff8b6d59f6d83dae1425b08f465e8b5 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38120)\n\nA vulnerability classified as problematic has been found in Linux Kernel (Operating System).This is going to have an impact on confidentiality, integrity, and availability.Upgrading to version 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 0e65f38bd1aa14ea86e221b7bb814d38278d86c3/85eef1748c024da1a191aed56b30a3a65958c50c/4399f59a9467a324ed46657555f0e1f209a14acb/a04302867094bdc6efac1b598370fc47cf3f2388/3382a1ed7f778db841063f5d7e317ac55f9e7f72 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38124)\n\nA vulnerability, which was classified as problematic, has been found in Linux Kernel up to 6.6.93/6.12.33/6.15.2 (Operating System).Using CWE to declare the problem leads to CWE-371.Impacted is confidentiality, integrity, and availability.Upgrading to version 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 1d3c5d0dec6797eca3a861dab0816fa9505d9c3e/276849954d7cbe6eec827b21fe2df43f9bf07011/0e061abaad1498c5b76c10c594d4359ceb6b9145/0153f36041b8e52019ebfa8629c13bf8f9b0a951 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38127)\n\nA vulnerability has been found in Linux Kernel up to 6.15.2 (Operating System) and classified as problematic.The CWE definition for the vulnerability is CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.As an impact it is known to affect confidentiality, integrity, and availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch e5ce9df1d68094d37360dbd9b09289d42fa21e54/7ee3fb6258da8c890a51b514f60d7570dc703605/40471b23147c86ea3ed97faee79937c618250bd0/5482ef9875eaa43f0435e14570e1193823de857e/ee5ee646385f5846dcbc881389f3c44a197c402a/5a85c21f812e02cb00ca07007d88acdd42d08c46/ac4e317a95a1092b5da5b9918b7118759342641c is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-19787).(CVE-2025-38157)\n\nA vulnerability classified as problematic was found in Linux Kernel up to 6.15.3 (Operating System).As an impact it is known to affect confidentiality, integrity, and availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch d9a55869d8237e677ddaa18b0f58586364cfbc1c/1f6332872374b7f482fc4ad865f9422fedb587fc/fbfe8446cd3274b9e367f5708d94574230a44409/5018d035530b6fbfad33eeb1dd1bc87da419a276/a87cbcc909ccfd394d4936a94663f586453d0961/aaa644e7ffff02e12c89cbce4753bc0b6f23ff87/d14cbed4baccd712447fb3f9c011f008b56b2097/42cb74a92adaf88061039601ddf7c874f58b554e is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-20037).(CVE-2025-38219)\n\nA vulnerability, which was classified as critical, has been found in Linux Kernel up to 6.6.94/6.12.34/6.15.3 (Operating System).Using CWE to declare the problem leads to CWE-476. A NULL pointer dereference occurs when the application dereferences a pointer that it expects to be valid, but is NULL, typically causing a crash or exit.Impacted is availability.Upgrading to version 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch cf6a4c4ac7b6e3214f25df594c9689a62f1bb456/be5f3061a6f904e3674257879e71881ceee5b673/d7af6eee8cd60f55aa8c5fe2b91f11ec0c9a0f27/e26268ff1dcae5662c1b96c35f18cfa6ab73d9de is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-20036).(CVE-2025-38220)\n\nLinux kernel is the kernel used by Linux, the open source operating system of the Linux Foundation in the United States.\n There is a security vulnerability in Linux kernel. This vulnerability originates from improper processing of composing size in vivid drivers, which may lead to over-bounds writing.(CVE-2025-38226)\n\nA vulnerability, which was classified as problematic, was found in Linux Kernel up to 32700ecf8007e071d1ce4c78f65b85f46d05f32a (Operating System).The manipulation of the argument adxl_component_count with an unknown input leads to a unknown weakness. CWE is classifying the issue as CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.This is going to have an impact on confidentiality.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 80bf28fd623d97dd4f4825fbbe9d736cec2afba3/a6ed3a6edff09c1187cc6ade7f5967bca2376a13/bf6a8502a5f4ff6e4d135d795945cdade49ec8b0/e8530ed3c0769a4d8f79c212715ec1cf277787f8/3f5d0659000923735350da60ad710f8c804544fe/a13e8343ffcff27af1ff79597ff7ba241e6d9471/31ef6f7c9aee3be78d63789653e92350f2537f93/20d2d476b3ae18041be423671a8637ed5ffd6958 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38298)\n\nA vulnerability classified as critical was found in Linux Kernel up to 6.15.3 (Operating System).The CWE definition for the vulnerability is CWE-476. A NULL pointer dereference occurs when the application dereferences a pointer that it expects to be valid, but is NULL, typically causing a crash or exit.As an impact it is known to affect availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch 5c1a34ff5b0bfdfd2f9343aa9b08d25df618bac5/ec669e5bf409f16e464bfad75f0ba039a45de29a/43d5e3bb5f1dcd91e30238ea0b59a5f77063f84e/23361b479f2700c00960d3ae9cdc8ededa762d47/2e7c64d7a92c031d016f11c8e8cb05131ab7b75a/f78b38af3540b4875147b7b884ee11a27b3dbf4c/a377996d714afb8d4d5f4906336f78510039da29/af98b0157adf6504fade79b3e6cb260c4ff68e37 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38337)",
"id": "OESA-2025-1878",
"modified": "2026-08-06T11:08:57Z",
"published": "2025-07-25T11:08:57Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2025-1878"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-58237"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21829"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21894"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21904"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21960"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21961"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21975"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21997"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22004"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22050"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22053"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22054"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22055"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22058"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22062"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22103"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22111"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-23142"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-23155"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37757"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37786"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37787"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37788"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37790"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37797"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37817"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37820"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37823"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37824"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37864"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37865"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38061"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38075"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38079"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38103"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38115"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38117"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38120"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38124"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38127"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38157"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38219"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38220"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38226"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38298"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38337"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:A/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2024-58237",
"CVE-2025-21829",
"CVE-2025-21894",
"CVE-2025-21904",
"CVE-2025-21960",
"CVE-2025-21961",
"CVE-2025-21975",
"CVE-2025-21997",
"CVE-2025-22004",
"CVE-2025-22050",
"CVE-2025-22053",
"CVE-2025-22054",
"CVE-2025-22055",
"CVE-2025-22058",
"CVE-2025-22062",
"CVE-2025-22103",
"CVE-2025-22111",
"CVE-2025-23142",
"CVE-2025-23155",
"CVE-2025-37757",
"CVE-2025-37786",
"CVE-2025-37787",
"CVE-2025-37788",
"CVE-2025-37790",
"CVE-2025-37797",
"CVE-2025-37817",
"CVE-2025-37820",
"CVE-2025-37823",
"CVE-2025-37824",
"CVE-2025-37864",
"CVE-2025-37865",
"CVE-2025-38061",
"CVE-2025-38075",
"CVE-2025-38079",
"CVE-2025-38103",
"CVE-2025-38115",
"CVE-2025-38117",
"CVE-2025-38120",
"CVE-2025-38124",
"CVE-2025-38127",
"CVE-2025-38157",
"CVE-2025-38219",
"CVE-2025-38220",
"CVE-2025-38226",
"CVE-2025-38298",
"CVE-2025-38337"
]
}
OESA-2025-1879 (CVE-2024-58237)
Vulnerability from osv_openeuler – Published: 2025-07-25 11:08 – Updated: 2026-08-06 11:08 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
bpf: consider that tail calls invalidate packet pointers
Tail-called programs could execute any of the helpers that invalidate packet pointers. Hence, conservatively assume that each tail call invalidates packet pointers.
Making the change in bpf_helper_changes_pkt_data() automatically makes use of check_cfg() logic that computes 'changes_pkt_data' effect for global sub-programs, such that the following program could be rejected:
int tail_call(struct __sk_buff *sk)
{
bpf_tail_call_static(sk, &jmp_table, 0);
return 0;
}
SEC("tc")
int not_safe(struct __sk_buff *sk)
{
int *p = (void *)(long)sk->data;
... make p valid ...
tail_call(sk);
*p = 42; /* this is unsafe */
...
}
The tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that can invalidate packet pointers. Otherwise, it can't be freplaced with tailcall_freplace.c:entry_freplace() that does a tail call.(CVE-2024-58237)
In the Linux kernel, the following vulnerability has been resolved:
netem: Update sch->q.qlen before qdisc_tree_reduce_backlog()
qdisc_tree_reduce_backlog() notifies parent qdisc only if child qdisc becomes empty, therefore we need to reduce the backlog of the child qdisc before calling it. Otherwise it would miss the opportunity to call cops->qlen_notify(), in the case of DRR, it resulted in UAF since DRR uses ->qlen_notify() to maintain its active list.(CVE-2025-21703)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/rxe: Fix the warning "__rxe_cleanup+0x12c/0x170 [rdma_rxe]"
The Call Trace is as below: " <TASK> ? show_regs.cold+0x1a/0x1f ? __rxe_cleanup+0x12c/0x170 [rdma_rxe] ? __warn+0x84/0xd0 ? __rxe_cleanup+0x12c/0x170 [rdma_rxe] ? report_bug+0x105/0x180 ? handle_bug+0x46/0x80 ? exc_invalid_op+0x19/0x70 ? asm_exc_invalid_op+0x1b/0x20 ? __rxe_cleanup+0x12c/0x170 [rdma_rxe] ? __rxe_cleanup+0x124/0x170 [rdma_rxe] rxe_destroy_qp.cold+0x24/0x29 [rdma_rxe] ib_destroy_qp_user+0x118/0x190 [ib_core] rdma_destroy_qp.cold+0x43/0x5e [rdma_cm] rtrs_cq_qp_destroy.cold+0x1d/0x2b [rtrs_core] rtrs_srv_close_work.cold+0x1b/0x31 [rtrs_server] process_one_work+0x21d/0x3f0 worker_thread+0x4a/0x3c0 ? process_one_work+0x3f0/0x3f0 kthread+0xf0/0x120 ? kthread_complete_and_exit+0x20/0x20 ret_from_fork+0x22/0x30 </TASK> " When too many rdma resources are allocated, rxe needs more time to handle these rdma resources. Sometimes with the current timeout, rxe can not release the rdma resources correctly.
Compared with other rdma drivers, a bigger timeout is used.(CVE-2025-21829)
In the Linux kernel, the following vulnerability has been resolved:
net: enetc: VFs do not support HWTSTAMP_TX_ONESTEP_SYNC
Actually ENETC VFs do not support HWTSTAMP_TX_ONESTEP_SYNC because only ENETC PF can access PMa_SINGLE_STEP registers. And there will be a crash if VFs are used to test one-step timestamp, the crash log as follows.
[ 129.110909] Unable to handle kernel paging request at virtual address 00000000000080c0 [ 129.287769] Call trace: [ 129.290219] enetc_port_mac_wr+0x30/0xec (P) [ 129.294504] enetc_start_xmit+0xda4/0xe74 [ 129.298525] enetc_xmit+0x70/0xec [ 129.301848] dev_hard_start_xmit+0x98/0x118(CVE-2025-21894)
In the Linux kernel, the following vulnerability has been resolved:
caif_virtio: fix wrong pointer check in cfv_probe()
del_vqs() frees virtqueues, therefore cfv->vq_tx pointer should be checked for NULL before calling it, not cfv->vdev. Also the current implementation is redundant because the pointer cfv->vdev is dereferenced before it is checked for NULL.
Fix this by checking cfv->vq_tx for NULL instead of cfv->vdev before calling del_vqs().(CVE-2025-21904)
In the Linux kernel, the following vulnerability has been resolved:
vlan: enforce underlying device type
Currently, VLAN devices can be created on top of non-ethernet devices.
Besides the fact that it doesn't make much sense, this also causes a bug which leaks the address of a kernel function to usermode.
When creating a VLAN device, we initialize GARP (garp_init_applicant) and MRP (mrp_init_applicant) for the underlying device.
As part of the initialization process, we add the multicast address of each applicant to the underlying device, by calling dev_mc_add.
__dev_mc_add uses dev->addr_len to determine the length of the new multicast address.
This causes an out-of-bounds read if dev->addr_len is greater than 6, since the multicast addresses provided by GARP and MRP are only 6 bytes long.
This behaviour can be reproduced using the following commands:
ip tunnel add gretest mode ip6gre local ::1 remote ::2 dev lo ip l set up dev gretest ip link add link gretest name vlantest type vlan id 100
Then, the following command will display the address of garp_pdu_rcv:
ip maddr show | grep 01:80:c2:00:00:21
Fix the bug by enforcing the type of the underlying device during VLAN device initialization.(CVE-2025-21920)
In the Linux kernel, the following vulnerability has been resolved:
net: gso: fix ownership in __udp_gso_segment
In __udp_gso_segment the skb destructor is removed before segmenting the skb but the socket reference is kept as-is. This is an issue if the original skb is later orphaned as we can hit the following bug:
kernel BUG at ./include/linux/skbuff.h:3312! (skb_orphan) RIP: 0010:ip_rcv_core+0x8b2/0xca0 Call Trace: ip_rcv+0xab/0x6e0 __netif_receive_skb_one_core+0x168/0x1b0 process_backlog+0x384/0x1100 __napi_poll.constprop.0+0xa1/0x370 net_rx_action+0x925/0xe50
The above can happen following a sequence of events when using OpenVSwitch, when an OVS_ACTION_ATTR_USERSPACE action precedes an OVS_ACTION_ATTR_OUTPUT action:
- OVS_ACTION_ATTR_USERSPACE is handled (in do_execute_actions): the skb goes through queue_gso_packets and then __udp_gso_segment, where its destructor is removed.
- The segments' data are copied and sent to userspace.
- OVS_ACTION_ATTR_OUTPUT is handled (in do_execute_actions) and the same original skb is sent to its path.
- If it later hits skb_orphan, we hit the bug.
Fix this by also removing the reference to the socket in __udp_gso_segment.(CVE-2025-21926)
In the Linux kernel, the following vulnerability has been resolved:
mptcp: fix 'scheduling while atomic' in mptcp_pm_nl_append_new_local_addr
If multiple connection requests attempt to create an implicit mptcp endpoint in parallel, more than one caller may end up in mptcp_pm_nl_append_new_local_addr because none found the address in local_addr_list during their call to mptcp_pm_nl_get_local_id. In this case, the concurrent new_local_addr calls may delete the address entry created by the previous caller. These deletes use synchronize_rcu, but this is not permitted in some of the contexts where this function may be called. During packet recv, the caller may be in a rcu read critical section and have preemption disabled.
An example stack:
BUG: scheduling while atomic: swapper/2/0/0x00000302
Call Trace: <IRQ> dump_stack_lvl (lib/dump_stack.c:117 (discriminator 1)) dump_stack (lib/dump_stack.c:124) __schedule_bug (kernel/sched/core.c:5943) schedule_debug.constprop.0 (arch/x86/include/asm/preempt.h:33 kernel/sched/core.c:5970) __schedule (arch/x86/include/asm/jump_label.h:27 include/linux/jump_label.h:207 kernel/sched/features.h:29 kernel/sched/core.c:6621) schedule (arch/x86/include/asm/preempt.h:84 kernel/sched/core.c:6804 kernel/sched/core.c:6818) schedule_timeout (kernel/time/timer.c:2160) wait_for_completion (kernel/sched/completion.c:96 kernel/sched/completion.c:116 kernel/sched/completion.c:127 kernel/sched/completion.c:148) __wait_rcu_gp (include/linux/rcupdate.h:311 kernel/rcu/update.c:444) synchronize_rcu (kernel/rcu/tree.c:3609) mptcp_pm_nl_append_new_local_addr (net/mptcp/pm_netlink.c:966 net/mptcp/pm_netlink.c:1061) mptcp_pm_nl_get_local_id (net/mptcp/pm_netlink.c:1164) mptcp_pm_get_local_id (net/mptcp/pm.c:420) subflow_check_req (net/mptcp/subflow.c:98 net/mptcp/subflow.c:213) subflow_v4_route_req (net/mptcp/subflow.c:305) tcp_conn_request (net/ipv4/tcp_input.c:7216) subflow_v4_conn_request (net/mptcp/subflow.c:651) tcp_rcv_state_process (net/ipv4/tcp_input.c:6709) tcp_v4_do_rcv (net/ipv4/tcp_ipv4.c:1934) tcp_v4_rcv (net/ipv4/tcp_ipv4.c:2334) ip_protocol_deliver_rcu (net/ipv4/ip_input.c:205 (discriminator 1)) ip_local_deliver_finish (include/linux/rcupdate.h:813 net/ipv4/ip_input.c:234) ip_local_deliver (include/linux/netfilter.h:314 include/linux/netfilter.h:308 net/ipv4/ip_input.c:254) ip_sublist_rcv_finish (include/net/dst.h:461 net/ipv4/ip_input.c:580) ip_sublist_rcv (net/ipv4/ip_input.c:640) ip_list_rcv (net/ipv4/ip_input.c:675) __netif_receive_skb_list_core (net/core/dev.c:5583 net/core/dev.c:5631) netif_receive_skb_list_internal (net/core/dev.c:5685 net/core/dev.c:5774) napi_complete_done (include/linux/list.h:37 include/net/gro.h:449 include/net/gro.h:444 net/core/dev.c:6114) igb_poll (drivers/net/ethernet/intel/igb/igb_main.c:8244) igb __napi_poll (net/core/dev.c:6582) net_rx_action (net/core/dev.c:6653 net/core/dev.c:6787) handle_softirqs (kernel/softirq.c:553) __irq_exit_rcu (kernel/softirq.c:588 kernel/softirq.c:427 kernel/softirq.c:636) irq_exit_rcu (kernel/softirq.c:651) common_interrupt (arch/x86/kernel/irq.c:247 (discriminator 14)) </IRQ>
This problem seems particularly prevalent if the user advertises an endpoint that has a different external vs internal address. In the case where the external address is advertised and multiple connections already exist, multiple subflow SYNs arrive in parallel which tends to trigger the race during creation of the first local_addr_list entries which have the internal address instead.
Fix by skipping the replacement of an existing implicit local address if called via mptcp_pm_nl_get_local_id.(CVE-2025-21938)
In the Linux kernel, the following vulnerability has been resolved:
eth: bnxt: do not update checksum in bnxt_xdp_build_skb()
The bnxt_rx_pkt() updates ip_summed value at the end if checksum offload is enabled. When the XDP-MB program is attached and it returns XDP_PASS, the bnxt_xdp_build_skb() is called to update skb_shared_info. The main purpose of bnxt_xdp_build_skb() is to update skb_shared_info, but it updates ip_summed value too if checksum offload is enabled. This is actually duplicate work.
When the bnxt_rx_pkt() updates ip_summed value, it checks if ip_summed is CHECKSUM_NONE or not. It means that ip_summed should be CHECKSUM_NONE at this moment. But ip_summed may already be updated to CHECKSUM_UNNECESSARY in the XDP-MB-PASS path. So the by skb_checksum_none_assert() WARNS about it.
This is duplicate work and updating ip_summed in the bnxt_xdp_build_skb() is not needed.
Splat looks like: WARNING: CPU: 3 PID: 5782 at ./include/linux/skbuff.h:5155 bnxt_rx_pkt+0x479b/0x7610 [bnxt_en] Modules linked in: bnxt_re bnxt_en rdma_ucm rdma_cm iw_cm ib_cm ib_uverbs veth xt_nat xt_tcpudp xt_conntrack nft_chain_nat xt_MASQUERADE nf_] CPU: 3 UID: 0 PID: 5782 Comm: socat Tainted: G W 6.14.0-rc4+ #27 Tainted: [W]=WARN Hardware name: ASUS System Product Name/PRIME Z690-P D4, BIOS 0603 11/01/2021 RIP: 0010:bnxt_rx_pkt+0x479b/0x7610 [bnxt_en] Code: 54 24 0c 4c 89 f1 4c 89 ff c1 ea 1f ff d3 0f 1f 00 49 89 c6 48 85 c0 0f 84 4c e5 ff ff 48 89 c7 e8 ca 3d a0 c8 e9 8f f4 ff ff <0f> 0b f RSP: 0018:ffff88881ba09928 EFLAGS: 00010202 RAX: 0000000000000000 RBX: 00000000c7590303 RCX: 0000000000000000 RDX: 1ffff1104e7d1610 RSI: 0000000000000001 RDI: ffff8881c91300b8 RBP: ffff88881ba09b28 R08: ffff888273e8b0d0 R09: ffff888273e8b070 R10: ffff888273e8b010 R11: ffff888278b0f000 R12: ffff888273e8b080 R13: ffff8881c9130e00 R14: ffff8881505d3800 R15: ffff888273e8b000 FS: 00007f5a2e7be080(0000) GS:ffff88881ba00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007fff2e708ff8 CR3: 000000013e3b0000 CR4: 00000000007506f0 PKRU: 55555554 Call Trace: <IRQ> ? __warn+0xcd/0x2f0 ? bnxt_rx_pkt+0x479b/0x7610 ? report_bug+0x326/0x3c0 ? handle_bug+0x53/0xa0 ? exc_invalid_op+0x14/0x50 ? asm_exc_invalid_op+0x16/0x20 ? bnxt_rx_pkt+0x479b/0x7610 ? bnxt_rx_pkt+0x3e41/0x7610 ? __pfx_bnxt_rx_pkt+0x10/0x10 ? napi_complete_done+0x2cf/0x7d0 __bnxt_poll_work+0x4e8/0x1220 ? __pfxbnxtpoll_work+0x10/0x10 ? pfx_mark_lock.part.0+0x10/0x10 bnxt_poll_p5+0x36a/0xfa0 ? __pfx_bnxt_poll_p5+0x10/0x10 __napi_poll.constprop.0+0xa0/0x440 net_rx_action+0x899/0xd00 ...
Following ping.py patch adds xdp-mb-pass case. so ping.py is going to be able to reproduce this issue.(CVE-2025-21960)
In the Linux kernel, the following vulnerability has been resolved:
eth: bnxt: fix truesize for mb-xdp-pass case
When mb-xdp is set and return is XDP_PASS, packet is converted from xdp_buff to sk_buff with xdp_update_skb_shared_info() in bnxt_xdp_build_skb(). bnxt_xdp_build_skb() passes incorrect truesize argument to xdp_update_skb_shared_info(). The truesize is calculated as BNXT_RX_PAGE_SIZE * sinfo->nr_frags but the skb_shared_info was wiped by napi_build_skb() before. So it stores sinfo->nr_frags before bnxt_xdp_build_skb() and use it instead of getting skb_shared_info from xdp_get_shared_info_from_buff().
Splat looks like: ------------[ cut here ]------------ WARNING: CPU: 2 PID: 0 at net/core/skbuff.c:6072 skb_try_coalesce+0x504/0x590 Modules linked in: xt_nat xt_tcpudp veth af_packet xt_conntrack nft_chain_nat xt_MASQUERADE nf_conntrack_netlink xfrm_user xt_addrtype nft_coms CPU: 2 UID: 0 PID: 0 Comm: swapper/2 Not tainted 6.14.0-rc2+ #3 RIP: 0010:skb_try_coalesce+0x504/0x590 Code: 4b fd ff ff 49 8b 34 24 40 80 e6 40 0f 84 3d fd ff ff 49 8b 74 24 48 40 f6 c6 01 0f 84 2e fd ff ff 48 8d 4e ff e9 25 fd ff ff <0f> 0b e99 RSP: 0018:ffffb62c4120caa8 EFLAGS: 00010287 RAX: 0000000000000003 RBX: ffffb62c4120cb14 RCX: 0000000000000ec0 RDX: 0000000000001000 RSI: ffffa06e5d7dc000 RDI: 0000000000000003 RBP: ffffa06e5d7ddec0 R08: ffffa06e6120a800 R09: ffffa06e7a119900 R10: 0000000000002310 R11: ffffa06e5d7dcec0 R12: ffffe4360575f740 R13: ffffe43600000000 R14: 0000000000000002 R15: 0000000000000002 FS: 0000000000000000(0000) GS:ffffa0755f700000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007f147b76b0f8 CR3: 00000001615d4000 CR4: 00000000007506f0 PKRU: 55555554 Call Trace: <IRQ> ? __warn+0x84/0x130 ? skb_try_coalesce+0x504/0x590 ? report_bug+0x18a/0x1a0 ? handle_bug+0x53/0x90 ? exc_invalid_op+0x14/0x70 ? asm_exc_invalid_op+0x16/0x20 ? skb_try_coalesce+0x504/0x590 inet_frag_reasm_finish+0x11f/0x2e0 ip_defrag+0x37a/0x900 ip_local_deliver+0x51/0x120 ip_sublist_rcv_finish+0x64/0x70 ip_sublist_rcv+0x179/0x210 ip_list_rcv+0xf9/0x130
How to reproduce: <Node A> ip link set $interface1 xdp obj xdp_pass.o ip link set $interface1 mtu 9000 up ip a a 10.0.0.1/24 dev $interface1 <Node B> ip link set $interfac2 mtu 9000 up ip a a 10.0.0.2/24 dev $interface2 ping 10.0.0.1 -s 65000
Following ping.py patch adds xdp-mb-pass case. so ping.py is going to be able to reproduce this issue.(CVE-2025-21961)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5: handle errors in mlx5_chains_create_table()
In mlx5_chains_create_table(), the return value of mlx5_get_fdb_sub_ns() and mlx5_get_flow_namespace() must be checked to prevent NULL pointer dereferences. If either function fails, the function should log error message with mlx5_core_warn() and return error pointer.(CVE-2025-21975)
In the Linux kernel, the following vulnerability has been resolved:
xsk: fix an integer overflow in xp_create_and_assign_umem()
Since the i and pool->chunk_size variables are of type 'u32', their product can wrap around and then be cast to 'u64'. This can lead to two different XDP buffers pointing to the same memory area.
Found by InfoTeCS on behalf of Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2025-21997)
In the Linux kernel, the following vulnerability has been resolved:
net: atm: fix use after free in lec_send()
The ->send() operation frees skb so save the length before calling ->send() to avoid a use after free.(CVE-2025-22004)
In the Linux kernel, the following vulnerability has been resolved:
usbnet:fix NPE during rx_complete
Missing usbnet_going_away Check in Critical Path. The usb_submit_urb function lacks a usbnet_going_away validation, whereas __usbnet_queue_skb includes this check.
This inconsistency creates a race condition where: A URB request may succeed, but the corresponding SKB data fails to be queued.
Subsequent processes: (e.g., rx_complete → defer_bh → __skb_unlink(skb, list)) attempt to access skb->next, triggering a NULL pointer dereference (Kernel Panic).(CVE-2025-22050)
In the Linux kernel, the following vulnerability has been resolved:
net: ibmveth: make veth_pool_store stop hanging
v2: - Created a single error handling unlock and exit in veth_pool_store - Greatly expanded commit message with previous explanatory-only text
Summary: Use rtnl_mutex to synchronize veth_pool_store with itself, ibmveth_close and ibmveth_open, preventing multiple calls in a row to napi_disable.
Background: Two (or more) threads could call veth_pool_store through writing to /sys/devices/vio/30000002/pool/. You can do this easily with a little shell script. This causes a hang.
I configured LOCKDEP, compiled ibmveth.c with DEBUG, and built a new kernel. I ran this test again and saw:
Setting pool0/active to 0
Setting pool1/active to 1
[ 73.911067][ T4365] ibmveth 30000002 eth0: close starting
Setting pool1/active to 1
Setting pool1/active to 0
[ 73.911367][ T4366] ibmveth 30000002 eth0: close starting
[ 73.916056][ T4365] ibmveth 30000002 eth0: close complete
[ 73.916064][ T4365] ibmveth 30000002 eth0: open starting
[ 110.808564][ T712] systemd-journald[712]: Sent WATCHDOG=1 notification.
[ 230.808495][ T712] systemd-journald[712]: Sent WATCHDOG=1 notification.
[ 243.683786][ T123] INFO: task stress.sh:4365 blocked for more than 122 seconds.
[ 243.683827][ T123] Not tainted 6.14.0-01103-g2df0c02dab82-dirty #8
[ 243.683833][ T123] "echo 0 > /proc/sys/kernel/hung_task_timeout_secs" disables this message.
[ 243.683838][ T123] task:stress.sh state:D stack:28096 pid:4365 tgid:4365 ppid:4364 task_flags:0x400040 flags:0x00042000
[ 243.683852][ T123] Call Trace:
[ 243.683857][ T123] [c00000000c38f690] [0000000000000001] 0x1 (unreliable)
[ 243.683868][ T123] [c00000000c38f840] [c00000000001f908] __switch_to+0x318/0x4e0
[ 243.683878][ T123] [c00000000c38f8a0] [c000000001549a70] __schedule+0x500/0x12a0
[ 243.683888][ T123] [c00000000c38f9a0] [c00000000154a878] schedule+0x68/0x210
[ 243.683896][ T123] [c00000000c38f9d0] [c00000000154ac80] schedule_preempt_disabled+0x30/0x50
[ 243.683904][ T123] [c00000000c38fa00] [c00000000154dbb0] __mutex_lock+0x730/0x10f0
[ 243.683913][ T123] [c00000000c38fb10] [c000000001154d40] napi_enable+0x30/0x60
[ 243.683921][ T123] [c00000000c38fb40] [c000000000f4ae94] ibmveth_open+0x68/0x5dc
[ 243.683928][ T123] [c00000000c38fbe0] [c000000000f4aa20] veth_pool_store+0x220/0x270
[ 243.683936][ T123] [c00000000c38fc70] [c000000000826278] sysfs_kf_write+0x68/0xb0
[ 243.683944][ T123] [c00000000c38fcb0] [c0000000008240b8] kernfs_fop_write_iter+0x198/0x2d0
[ 243.683951][ T123] [c00000000c38fd00] [c00000000071b9ac] vfs_write+0x34c/0x650
[ 243.683958][ T123] [c00000000c38fdc0] [c00000000071bea8] ksys_write+0x88/0x150
[ 243.683966][ T123] [c00000000c38fe10] [c0000000000317f4] system_call_exception+0x124/0x340
[ 243.683973][ T123] [c00000000c38fe50] [c00000000000d05c] system_call_vectored_common+0x15c/0x2ec
...
[ 243.684087][ T123] Showing all locks held in the system:
[ 243.684095][ T123] 1 lock held by khungtaskd/123:
[ 243.684099][ T123] #0: c00000000278e370 (rcu_read_lock){....}-{1:2}, at: debug_show_all_locks+0x50/0x248
[ 243.684114][ T123] 4 locks held by stress.sh/4365:
[ 243.684119][ T123] #0: c00000003a4cd3f8 (sb_writers#3){.+.+}-{0:0}, at: ksys_write+0x88/0x150
[ 243.684132][ T123] #1: c000000041aea888 (&of->mutex#2){+.+.}-{3:3}, at: kernfs_fop_write_iter+0x154/0x2d0
[ 243.684143][ T123] #2: c0000000366fb9a8 (kn->active#64){.+.+}-{0:0}, at: kernfs_fop_write_iter+0x160/0x2d0
[ 243.684155][ T123] #3: c000000035ff4cb8 (&dev->lock){+.+.}-{3:3}, at: napi_enable+0x30/0x60
[ 243.684166][ T123] 5 locks held by stress.sh/4366:
[ 243.684170][ T123] #0: c00000003a4cd3f8 (sb_writers#3){.+.+}-{0:0}, at: ksys_write+0x88/0x150
[ 243.
---truncated---(CVE-2025-22053)
In the Linux kernel, the following vulnerability has been resolved:
arcnet: Add NULL check in com20020pci_probe()
devm_kasprintf() returns NULL when memory allocation fails. Currently, com20020pci_probe() does not check for this case, which results in a NULL pointer dereference.
Add NULL check after devm_kasprintf() to prevent this issue and ensure no resources are left allocated.(CVE-2025-22054)
In the Linux kernel, the following vulnerability has been resolved:
net: fix geneve_opt length integer overflow
struct geneve_opt uses 5 bit length for each single option, which means every vary size option should be smaller than 128 bytes.
However, all current related Netlink policies cannot promise this length condition and the attacker can exploit a exact 128-byte size option to fake a zero length option and confuse the parsing logic, further achieve heap out-of-bounds read.
One example crash log is like below:
[ 3.905425] ================================================================== [ 3.905925] BUG: KASAN: slab-out-of-bounds in nla_put+0xa9/0xe0 [ 3.906255] Read of size 124 at addr ffff888005f291cc by task poc/177 [ 3.906646] [ 3.906775] CPU: 0 PID: 177 Comm: poc-oob-read Not tainted 6.1.132 #1 [ 3.907131] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.16.0-0-gd239552ce722-prebuilt.qemu.org 04/01/2014 [ 3.907784] Call Trace: [ 3.907925] <TASK> [ 3.908048] dump_stack_lvl+0x44/0x5c [ 3.908258] print_report+0x184/0x4be [ 3.909151] kasan_report+0xc5/0x100 [ 3.909539] kasan_check_range+0xf3/0x1a0 [ 3.909794] memcpy+0x1f/0x60 [ 3.909968] nla_put+0xa9/0xe0 [ 3.910147] tunnel_key_dump+0x945/0xba0 [ 3.911536] tcf_action_dump_1+0x1c1/0x340 [ 3.912436] tcf_action_dump+0x101/0x180 [ 3.912689] tcf_exts_dump+0x164/0x1e0 [ 3.912905] fw_dump+0x18b/0x2d0 [ 3.913483] tcf_fill_node+0x2ee/0x460 [ 3.914778] tfilter_notify+0xf4/0x180 [ 3.915208] tc_new_tfilter+0xd51/0x10d0 [ 3.918615] rtnetlink_rcv_msg+0x4a2/0x560 [ 3.919118] netlink_rcv_skb+0xcd/0x200 [ 3.919787] netlink_unicast+0x395/0x530 [ 3.921032] netlink_sendmsg+0x3d0/0x6d0 [ 3.921987] __sock_sendmsg+0x99/0xa0 [ 3.922220] __sys_sendto+0x1b7/0x240 [ 3.922682] __x64_sys_sendto+0x72/0x90 [ 3.922906] do_syscall_64+0x5e/0x90 [ 3.923814] entry_SYSCALL_64_after_hwframe+0x6e/0xd8 [ 3.924122] RIP: 0033:0x7e83eab84407 [ 3.924331] Code: 48 89 fa 4c 89 df e8 38 aa 00 00 8b 93 08 03 00 00 59 5e 48 83 f8 fc 74 1a 5b c3 0f 1f 84 00 00 00 00 00 48 8b 44 24 10 0f 05 <5b> c3 0f 1f 80 00 00 00 00 83 e2 39 83 faf [ 3.925330] RSP: 002b:00007ffff505e370 EFLAGS: 00000202 ORIG_RAX: 000000000000002c [ 3.925752] RAX: ffffffffffffffda RBX: 00007e83eaafa740 RCX: 00007e83eab84407 [ 3.926173] RDX: 00000000000001a8 RSI: 00007ffff505e3c0 RDI: 0000000000000003 [ 3.926587] RBP: 00007ffff505f460 R08: 00007e83eace1000 R09: 000000000000000c [ 3.926977] R10: 0000000000000000 R11: 0000000000000202 R12: 00007ffff505f3c0 [ 3.927367] R13: 00007ffff505f5c8 R14: 00007e83ead1b000 R15: 00005d4fbbe6dcb8
Fix these issues by enforing correct length condition in related policies.(CVE-2025-22055)
In the Linux kernel, the following vulnerability has been resolved:
udp: Fix memory accounting leak.
Matt Dowling reported a weird UDP memory usage issue.
Under normal operation, the UDP memory usage reported in /proc/net/sockstat remains close to zero. However, it occasionally spiked to 524,288 pages and never dropped. Moreover, the value doubled when the application was terminated. Finally, it caused intermittent packet drops.
We can reproduce the issue with the script below [0]:
-
/proc/net/sockstat reports 0 pages
cat /proc/net/sockstat | grep UDP:
UDP: inuse 1 mem 0
-
Run the script till the report reaches 524,288
python3 test.py & sleep 5
cat /proc/net/sockstat | grep UDP:
UDP: inuse 3 mem 524288 <-- (INT_MAX + 1) >> PAGE_SHIFT
-
Kill the socket and confirm the number never drops
pkill python3 && sleep 5
cat /proc/net/sockstat | grep UDP:
UDP: inuse 1 mem 524288
-
(necessary since v6.0) Trigger proto_memory_pcpu_drain()
python3 test.py & sleep 1 && pkill python3
-
The number doubles
cat /proc/net/sockstat | grep UDP:
UDP: inuse 1 mem 1048577
The application set INT_MAX to SO_RCVBUF, which triggered an integer overflow in udp_rmem_release().
When a socket is close()d, udp_destruct_common() purges its receive queue and sums up skb->truesize in the queue. This total is calculated and stored in a local unsigned integer variable.
The total size is then passed to udp_rmem_release() to adjust memory accounting. However, because the function takes a signed integer argument, the total size can wrap around, causing an overflow.
Then, the released amount is calculated as follows:
1) Add size to sk->sk_forward_alloc. 2) Round down sk->sk_forward_alloc to the nearest lower multiple of PAGE_SIZE and assign it to amount. 3) Subtract amount from sk->sk_forward_alloc. 4) Pass amount >> PAGE_SHIFT to __sk_mem_reduce_allocated().
When the issue occurred, the total in udp_destruct_common() was 2147484480 (INT_MAX + 833), which was cast to -2147482816 in udp_rmem_release().
At 1) sk->sk_forward_alloc is changed from 3264 to -2147479552, and 2) sets -2147479552 to amount. 3) reverts the wraparound, so we don't see a warning in inet_sock_destruct(). However, udp_memory_allocated ends up doubling at 4).
Since commit 3cd3399dd7a8 ("net: implement per-cpu reserves for memory_allocated"), memory usage no longer doubles immediately after a socket is close()d because __sk_mem_reduce_allocated() caches the amount in udp_memory_per_cpu_fw_alloc. However, the next time a UDP socket receives a packet, the subtraction takes effect, causing UDP memory usage to double.
This issue makes further memory allocation fail once the socket's sk->sk_rmem_alloc exceeds net.ipv4.udp_rmem_min, resulting in packet drops.
To prevent this issue, let's use unsigned int for the calculation and call sk_forward_alloc_add() only once for the small delta.
Note that first_packet_length() also potentially has the same problem.
[0]: from socket import *
SO_RCVBUFFORCE = 33 INT_MAX = (2 ** 31) - 1
s = socket(AF_INET, SOCK_DGRAM) s.bind(('', 0)) s.setsockopt(SOL_SOCKET, SO_RCVBUFFORCE, INT_MAX)
c = socket(AF_INET, SOCK_DGRAM) c.connect(s.getsockname())
data = b'a' * 100
while True: c.send(data)(CVE-2025-22058)
In the Linux kernel, the following vulnerability has been resolved:
sctp: add mutual exclusion in proc_sctp_do_udp_port()
We must serialize calls to sctp_udp_sock_stop() and sctp_udp_sock_start() or risk a crash as syzbot reported:
Oops: general protection fault, probably for non-canonical address 0xdffffc000000000d: 0000 [#1] SMP KASAN PTI KASAN: null-ptr-deref in range [0x0000000000000068-0x000000000000006f] CPU: 1 UID: 0 PID: 6551 Comm: syz.1.44 Not tainted 6.14.0-syzkaller-g7f2ff7b62617 #0 PREEMPT(full) Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/12/2025 RIP: 0010:kernel_sock_shutdown+0x47/0x70 net/socket.c:3653 Call Trace: <TASK> udp_tunnel_sock_release+0x68/0x80 net/ipv4/udp_tunnel_core.c:181 sctp_udp_sock_stop+0x71/0x160 net/sctp/protocol.c:930 proc_sctp_do_udp_port+0x264/0x450 net/sctp/sysctl.c:553 proc_sys_call_handler+0x3d0/0x5b0 fs/proc/proc_sysctl.c:601 iter_file_splice_write+0x91c/0x1150 fs/splice.c:738 do_splice_from fs/splice.c:935 [inline] direct_splice_actor+0x18f/0x6c0 fs/splice.c:1158 splice_direct_to_actor+0x342/0xa30 fs/splice.c:1102 do_splice_direct_actor fs/splice.c:1201 [inline] do_splice_direct+0x174/0x240 fs/splice.c:1227 do_sendfile+0xafd/0xe50 fs/read_write.c:1368 __do_sys_sendfile64 fs/read_write.c:1429 [inline] __se_sys_sendfile64 fs/read_write.c:1415 [inline] __x64_sys_sendfile64+0x1d8/0x220 fs/read_write.c:1415 do_syscall_x64 arch/x86/entry/syscall_64.c:63 inline
In the Linux kernel, the following vulnerability has been resolved:
net: fix NULL pointer dereference in l3mdev_l3_rcv
When delete l3s ipvlan:
ip link del link eth0 ipvlan1 type ipvlan mode l3s
This may cause a null pointer dereference:
Call trace:
ip_rcv_finish+0x48/0xd0
ip_rcv+0x5c/0x100
__netif_receive_skb_one_core+0x64/0xb0
__netif_receive_skb+0x20/0x80
process_backlog+0xb4/0x204
napi_poll+0xe8/0x294
net_rx_action+0xd8/0x22c
__do_softirq+0x12c/0x354
This is because l3mdev_l3_rcv() visit dev->l3mdev_ops after ipvlan_l3s_unregister() assign the dev->l3mdev_ops to NULL. The process like this:
(CPU1) | (CPU2)
l3mdev_l3_rcv() |
check dev->priv_flags: |
master = skb->dev; |
|
| ipvlan_l3s_unregister()
| set dev->priv_flags
| dev->l3mdev_ops = NULL;
|
visit master->l3mdev_ops |
To avoid this by do not set dev->l3mdev_ops when unregister l3s ipvlan.(CVE-2025-22103)
In the Linux kernel, the following vulnerability has been resolved:
net: Remove RTNL dance for SIOCBRADDIF and SIOCBRDELIF.
SIOCBRDELIF is passed to dev_ioctl() first and later forwarded to br_ioctl_call(), which causes unnecessary RTNL dance and the splat below [0] under RTNL pressure.
Let's say Thread A is trying to detach a device from a bridge and Thread B is trying to remove the bridge.
In dev_ioctl(), Thread A bumps the bridge device's refcnt by netdev_hold() and releases RTNL because the following br_ioctl_call() also re-acquires RTNL.
In the race window, Thread B could acquire RTNL and try to remove the bridge device. Then, rtnl_unlock() by Thread B will release RTNL and wait for netdev_put() by Thread A.
Thread A, however, must hold RTNL after the unlock in dev_ifsioc(), which may take long under RTNL pressure, resulting in the splat by Thread B.
Thread A (SIOCBRDELIF) Thread B (SIOCBRDELBR)
---------------------- ----------------------
sock_ioctl sock_ioctl
- sock_do_ioctl- br_ioctl_call
- dev_ioctl- br_ioctl_stub
|- rtnl_lock |
|- dev_ifsioc '
' |- dev = __dev_get_by_name(...)
|- netdev_hold(dev, ...) .
/ |- rtnl_unlock ------. |
| |- br_ioctl_call ---> |- rtnl_lock
Race | |- br_ioctl_stub |- br_del_bridge
Window | | | |- dev = __dev_get_by_name(...)
| | | May take long | - br_dev_delete(dev, ...)
| | | under RTNL pressure |- unregister_netdevice_queue(dev, ...)
| | | | - rtnl_unlock
\ | |- rtnl_lock <-'- netdev_run_todo
| |- ... - netdev_run_todo
|- rtnl_unlock |- __rtnl_unlock
| |- netdev_wait_allrefs_any
|- netdev_put(dev, ...) <----------------'
Wait refcnt decrement
and log splat below
To avoid blocking SIOCBRDELBR unnecessarily, let's not call dev_ioctl() for SIOCBRADDIF and SIOCBRDELIF.
In the dev_ioctl() path, we do the following:
- Copy struct ifreq by get_user_ifreq in sock_do_ioctl()
- Check CAP_NET_ADMIN in dev_ioctl()
- Call dev_load() in dev_ioctl()
-
Fetch the master dev from ifr.ifr_name in dev_ifsioc()
-
can be done by request_module() in br_ioctl_call(), so we move 1., 2., and 4. to br_ioctl_stub().
Note that 2. is also checked later in add_del_if(), but it's better performed before RTNL.
SIOCBRADDIF and SIOCBRDELIF have been processed in dev_ioctl() since the pre-git era, and there seems to be no specific reason to process them there.
[0]: unregister_netdevice: waiting for wpan3 to become free. Usage count = 2 ref_tracker: wpan3@ffff8880662d8608 has 1/1 users at __netdev_tracker_alloc include/linux/netdevice.h:4282 [inline] netdev_hold include/linux/netdevice.h:4311 [inline] dev_ifsioc+0xc6a/0x1160 net/core/dev_ioctl.c:624 dev_ioctl+0x255/0x10c0 net/core/dev_ioctl.c:826 sock_do_ioctl+0x1ca/0x260 net/socket.c:1213 sock_ioctl+0x23a/0x6c0 net/socket.c:1318 vfs_ioctl fs/ioctl.c:51 [inline] __do_sys_ioctl fs/ioctl.c:906 [inline] __se_sys_ioctl fs/ioctl.c:892 [inline] __x64_sys_ioctl+0x1a4/0x210 fs/ioctl.c:892 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcb/0x250 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2025-22111)
In the Linux kernel, the following vulnerability has been resolved:
sctp: detect and prevent references to a freed transport in sendmsg
sctp_sendmsg() re-uses associations and transports when possible by doing a lookup based on the socket endpoint and the message destination address, and then sctp_sendmsg_to_asoc() sets the selected transport in all the message chunks to be sent.
There's a possible race condition if another thread triggers the removal of that selected transport, for instance, by explicitly unbinding an address with setsockopt(SCTP_SOCKOPT_BINDX_REM), after the chunks have been set up and before the message is sent. This can happen if the send buffer is full, during the period when the sender thread temporarily releases the socket lock in sctp_wait_for_sndbuf().
This causes the access to the transport data in sctp_outq_select_transport(), when the association outqueue is flushed, to result in a use-after-free read.
This change avoids this scenario by having sctp_transport_free() signal the freeing of the transport, tagging it as "dead". In order to do this, the patch restores the "dead" bit in struct sctp_transport, which was removed in commit 47faa1e4c50e ("sctp: remove the dead field of sctp_transport").
Then, in the scenario where the sender thread has released the socket lock in sctp_wait_for_sndbuf(), the bit is checked again after re-acquiring the socket lock to detect the deletion. This is done while holding a reference to the transport to prevent it from being freed in the process.
If the transport was deleted while the socket lock was relinquished, sctp_sendmsg_to_asoc() will return -EAGAIN to let userspace retry the send.
The bug was found by a private syzbot instance (see the error report [1] and the C reproducer that triggers it [2]).(CVE-2025-23142)
In the Linux kernel, the following vulnerability has been resolved:
net: stmmac: Fix accessing freed irq affinity_hint
The cpumask should not be a local variable, since its pointer is saved to irq_desc and may be accessed from procfs. To fix it, use the persistent mask cpumask_of(cpu#).(CVE-2025-23155)
In the Linux kernel, the following vulnerability has been resolved:
tipc: fix memory leak in tipc_link_xmit
In case the backlog transmit queue for system-importance messages is overloaded, tipc_link_xmit() returns -ENOBUFS but the skb list is not purged. This leads to memory leak and failure when a skb is allocated.
This commit fixes this issue by purging the skb list before tipc_link_xmit() returns.(CVE-2025-37757)
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: free routing table on probe failure
If complete = true in dsa_tree_setup(), it means that we are the last switch of the tree which is successfully probing, and we should be setting up all switches from our probe path.
After "complete" becomes true, dsa_tree_setup_cpu_ports() or any subsequent function may fail. If that happens, the entire tree setup is in limbo: the first N-1 switches have successfully finished probing (doing nothing but having allocated persistent memory in the tree's dst->ports, and maybe dst->rtable), and switch N failed to probe, ending the tree setup process before anything is tangible from the user's PoV.
If switch N fails to probe, its memory (ports) will be freed and removed from dst->ports. However, the dst->rtable elements pointing to its ports, as created by dsa_link_touch(), will remain there, and will lead to use-after-free if dereferenced.
If dsa_tree_setup_switches() returns -EPROBE_DEFER, which is entirely possible because that is where ds->ops->setup() is, we get a kasan report like this:
================================================================== BUG: KASAN: slab-use-after-free in mv88e6xxx_setup_upstream_port+0x240/0x568 Read of size 8 at addr ffff000004f56020 by task kworker/u8:3/42
Call trace: __asan_report_load8_noabort+0x20/0x30 mv88e6xxx_setup_upstream_port+0x240/0x568 mv88e6xxx_setup+0xebc/0x1eb0 dsa_register_switch+0x1af4/0x2ae0 mv88e6xxx_register_switch+0x1b8/0x2a8 mv88e6xxx_probe+0xc4c/0xf60 mdio_probe+0x78/0xb8 really_probe+0x2b8/0x5a8 __driver_probe_device+0x164/0x298 driver_probe_device+0x78/0x258 __device_attach_driver+0x274/0x350
Allocated by task 42: __kasan_kmalloc+0x84/0xa0 __kmalloc_cache_noprof+0x298/0x490 dsa_switch_touch_ports+0x174/0x3d8 dsa_register_switch+0x800/0x2ae0 mv88e6xxx_register_switch+0x1b8/0x2a8 mv88e6xxx_probe+0xc4c/0xf60 mdio_probe+0x78/0xb8 really_probe+0x2b8/0x5a8 __driver_probe_device+0x164/0x298 driver_probe_device+0x78/0x258 __device_attach_driver+0x274/0x350
Freed by task 42: __kasan_slab_free+0x48/0x68 kfree+0x138/0x418 dsa_register_switch+0x2694/0x2ae0 mv88e6xxx_register_switch+0x1b8/0x2a8 mv88e6xxx_probe+0xc4c/0xf60 mdio_probe+0x78/0xb8 really_probe+0x2b8/0x5a8 __driver_probe_device+0x164/0x298 driver_probe_device+0x78/0x258 __device_attach_driver+0x274/0x350
The simplest way to fix the bug is to delete the routing table in its entirety. dsa_tree_setup_routing_table() has no problem in regenerating it even if we deleted links between ports other than those of switch N, because dsa_link_touch() first checks whether the port pair already exists in dst->rtable, allocating if not.
The deletion of the routing table in its entirety already exists in dsa_tree_teardown(), so refactor that into a function that can also be called from the tree setup error path.
In my analysis of the commit to blame, it is the one which added dsa_link elements to dst->rtable. Prior to that, each switch had its own ds->rtable which is freed when the switch fails to probe. But the tree is potentially persistent memory.(CVE-2025-37786)
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: mv88e6xxx: avoid unregistering devlink regions which were never registered
Russell King reports that a system with mv88e6xxx dereferences a NULL pointer when unbinding this driver: https://lore.kernel.org/netdev/(CVE-2025-37787)
In the Linux kernel, the following vulnerability has been resolved:
cxgb4: fix memory leak in cxgb4_init_ethtool_filters() error path
In the for loop used to allocate the loc_array and bmap for each port, a memory leak is possible when the allocation for loc_array succeeds, but the allocation for bmap fails. This is because when the control flow goes to the label free_eth_finfo, only the allocations starting from (i-1)th iteration are freed.
Fix that by freeing the loc_array in the bmap allocation error path.(CVE-2025-37788)
In the Linux kernel, the following vulnerability has been resolved:
net: mctp: Set SOCK_RCU_FREE
Bind lookup runs under RCU, so ensure that a socket doesn't go away in the middle of a lookup.(CVE-2025-37790)
In the Linux kernel, the following vulnerability has been resolved:
net_sched: hfsc: Fix a UAF vulnerability in class handling
This patch fixes a Use-After-Free vulnerability in the HFSC qdisc class handling. The issue occurs due to a time-of-check/time-of-use condition in hfsc_change_class() when working with certain child qdiscs like netem or codel.
The vulnerability works as follows: 1. hfsc_change_class() checks if a class has packets (q.qlen != 0) 2. It then calls qdisc_peek_len(), which for certain qdiscs (e.g., codel, netem) might drop packets and empty the queue 3. The code continues assuming the queue is still non-empty, adding the class to vttree 4. This breaks HFSC scheduler assumptions that only non-empty classes are in vttree 5. Later, when the class is destroyed, this can lead to a Use-After-Free
The fix adds a second queue length check after qdisc_peek_len() to verify the queue wasn't emptied.(CVE-2025-37797)
In the Linux kernel, the following vulnerability has been resolved:
mcb: fix a double free bug in chameleon_parse_gdd()
In chameleon_parse_gdd(), if mcb_device_register() fails, 'mdev' would be released in mcb_device_register() via put_device(). Thus, goto 'err' label and free 'mdev' again causes a double free. Just return if mcb_device_register() fails.(CVE-2025-37817)
In the Linux kernel, the following vulnerability has been resolved:
xen-netfront: handle NULL returned by xdp_convert_buff_to_frame()
The function xdp_convert_buff_to_frame() may return NULL if it fails to correctly convert the XDP buffer into an XDP frame due to memory constraints, internal errors, or invalid data. Failing to check for NULL may lead to a NULL pointer dereference if the result is used later in processing, potentially causing crashes, data corruption, or undefined behavior.
On XDP redirect failure, the associated page must be released explicitly if it was previously retained via get_page(). Failing to do so may result in a memory leak, as the pages reference count is not decremented.(CVE-2025-37820)
In the Linux kernel, the following vulnerability has been resolved:
net_sched: hfsc: Fix a potential UAF in hfsc_dequeue() too
Similarly to the previous patch, we need to safe guard hfsc_dequeue() too. But for this one, we don't have a reliable reproducer.(CVE-2025-37823)
In the Linux kernel, the following vulnerability has been resolved:
tipc: fix NULL pointer dereference in tipc_mon_reinit_self()
syzbot reported:
tipc: Node number set to 1055423674 Oops: general protection fault, probably for non-canonical address 0xdffffc0000000000: 0000 [#1] SMP KASAN NOPTI KASAN: null-ptr-deref in range [0x0000000000000000-0x0000000000000007] CPU: 3 UID: 0 PID: 6017 Comm: kworker/3:5 Not tainted 6.15.0-rc1-syzkaller-00246-g900241a5cc15 #0 PREEMPT(full) Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-debian-1.16.3-2~bpo12+1 04/01/2014 Workqueue: events tipc_net_finalize_work RIP: 0010:tipc_mon_reinit_self+0x11c/0x210 net/tipc/monitor.c:719 ... RSP: 0018:ffffc9000356fb68 EFLAGS: 00010246 RAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000003ee87cba RDX: 0000000000000000 RSI: ffffffff8dbc56a7 RDI: ffff88804c2cc010 RBP: dffffc0000000000 R08: 0000000000000001 R09: 0000000000000000 R10: 0000000000000001 R11: 0000000000000000 R12: 0000000000000007 R13: fffffbfff2111097 R14: ffff88804ead8000 R15: ffff88804ead9010 FS: 0000000000000000(0000) GS:ffff888097ab9000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00000000f720eb00 CR3: 000000000e182000 CR4: 0000000000352ef0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> tipc_net_finalize+0x10b/0x180 net/tipc/net.c:140 process_one_work+0x9cc/0x1b70 kernel/workqueue.c:3238 process_scheduled_works kernel/workqueue.c:3319 [inline] worker_thread+0x6c8/0xf10 kernel/workqueue.c:3400 kthread+0x3c2/0x780 kernel/kthread.c:464 ret_from_fork+0x45/0x80 arch/x86/kernel/process.c:153 ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:245 </TASK> ... RIP: 0010:tipc_mon_reinit_self+0x11c/0x210 net/tipc/monitor.c:719 ... RSP: 0018:ffffc9000356fb68 EFLAGS: 00010246 RAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000003ee87cba RDX: 0000000000000000 RSI: ffffffff8dbc56a7 RDI: ffff88804c2cc010 RBP: dffffc0000000000 R08: 0000000000000001 R09: 0000000000000000 R10: 0000000000000001 R11: 0000000000000000 R12: 0000000000000007 R13: fffffbfff2111097 R14: ffff88804ead8000 R15: ffff88804ead9010 FS: 0000000000000000(0000) GS:ffff888097ab9000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00000000f720eb00 CR3: 000000000e182000 CR4: 0000000000352ef0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400
There is a racing condition between workqueue created when enabling bearer and another thread created when disabling bearer right after that as follow:
| enabling_bearer | disabling_bearer |
|---|---|
| tipc_disc_timeout() | |
| { | bearer_disable() |
| ... | { |
| schedule_work(&tn->work); | tipc_mon_delete() |
| ... | { |
| } | ... |
| write_lock_bh(&mon->lock); | |
| mon->self = NULL; | |
| write_unlock_bh(&mon->lock); | |
| ... | |
| } | |
| tipc_net_finalize_work() | } |
| { | |
| ... | |
| tipc_net_finalize() | |
| { | |
| ... | |
| tipc_mon_reinit_self() | |
| { | |
| ... | |
| write_lock_bh(&mon->lock); | |
| mon->self->addr = tipc_own_addr(net); | |
| write_unlock_bh(&mon->lock); | |
| ... | |
| ---truncated---(CVE-2025-37824) |
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: clean up FDB, MDB, VLAN entries on unbind
As explained in many places such as commit b117e1e8a86d ("net: dsa: delete dsa_legacy_fdb_add and dsa_legacy_fdb_del"), DSA is written given the assumption that higher layers have balanced additions/deletions. As such, it only makes sense to be extremely vocal when those assumptions are violated and the driver unbinds with entries still present.
But Ido Schimmel points out a very simple situation where that is wrong: https://lore.kernel.org/netdev/ZDazSM5UsPPjQuKr@shredder/ (also briefly discussed by me in the aforementioned commit).
Basically, while the bridge bypass operations are not something that DSA explicitly documents, and for the majority of DSA drivers this API simply causes them to go to promiscuous mode, that isn't the case for all drivers. Some have the necessary requirements for bridge bypass operations to do something useful - see dsa_switch_supports_uc_filtering().
Although in tools/testing/selftests/net/forwarding/local_termination.sh, we made an effort to popularize better mechanisms to manage address filters on DSA interfaces from user space - namely macvlan for unicast, and setsockopt(IP_ADD_MEMBERSHIP) - through mtools - for multicast, the fact is that 'bridge fdb add ... self static local' also exists as kernel UAPI, and might be useful to someone, even if only for a quick hack.
It seems counter-productive to block that path by implementing shim .ndo_fdb_add and .ndo_fdb_del operations which just return -EOPNOTSUPP in order to prevent the ndo_dflt_fdb_add() and ndo_dflt_fdb_del() from running, although we could do that.
Accepting that cleanup is necessary seems to be the only option. Especially since we appear to be coming back at this from a different angle as well. Russell King is noticing that the WARN_ON() triggers even for VLANs: https://lore.kernel.org/netdev/(CVE-2025-37864)
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: mv88e6xxx: fix -ENOENT when deleting VLANs and MST is unsupported
Russell King reports that on the ZII dev rev B, deleting a bridge VLAN from a user port fails with -ENOENT: https://lore.kernel.org/netdev/(CVE-2025-37865)
In the Linux kernel, the following vulnerability has been resolved:
net: pktgen: fix access outside of user given buffer in pktgen_thread_write()
Honour the user given buffer size for the strn_len() calls (otherwise strn_len() will access memory outside of the user given buffer).(CVE-2025-38061)
In the Linux kernel, the following vulnerability has been resolved:
scsi: target: iscsi: Fix timeout on deleted connection
NOPIN response timer may expire on a deleted connection and crash with such logs:
Did not receive response to NOPIN on CID: 0, failing connection for I_T Nexus (null),i,0x00023d000125,iqn.2017-01.com.iscsi.target,t,0x3d
BUG: Kernel NULL pointer dereference on read at 0x00000000 NIP strlcpy+0x8/0xb0 LR iscsit_fill_cxn_timeout_err_stats+0x5c/0xc0 [iscsi_target_mod] Call Trace: iscsit_handle_nopin_response_timeout+0xfc/0x120 [iscsi_target_mod] call_timer_fn+0x58/0x1f0 run_timer_softirq+0x740/0x860 __do_softirq+0x16c/0x420 irq_exit+0x188/0x1c0 timer_interrupt+0x184/0x410
That is because nopin response timer may be re-started on nopin timer expiration.
Stop nopin timer before stopping the nopin response timer to be sure that no one of them will be re-started.(CVE-2025-38075)
In the Linux kernel, the following vulnerability has been resolved:
crypto: algif_hash - fix double free in hash_accept
If accept(2) is called on socket type algif_hash with MSG_MORE flag set and crypto_ahash_import fails, sk2 is freed. However, it is also freed in af_alg_release, leading to slab-use-after-free error.(CVE-2025-38079)
A vulnerability was found in Linux Kernel (Operating System) and classified as problematic.The manipulation of the argument bNumDescriptors with an unknown input leads to a unknown weakness. Using CWE to declare the problem leads to CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.Impacted is confidentiality.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 7a6d6b68db128da2078ccd9a751dfa3f75c9cf5b/41827a2dbdd7880df9881506dee13bc88d4230bb/1df80d748f984290c895e843401824215dcfbfb0/a8f842534807985d3a676006d140541b87044345/4fa7831cf0ac71a0a345369d1a6084f2b096e55e/74388368927e9c52a69524af5bbd6c55eb4690de/485e1b741eb838cbe1d6b0e81e5ab62ae6c095cf/fe7f7ac8e0c708446ff017453add769ffc15deed is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38103)
A vulnerability was found in Linux Kernel up to 6.16-rc1 (Operating System). It has been classified as critical.CWE is classifying the issue as CWE-404. The product does not release or incorrectly releases a resource before it is made available for re-use.This is going to have an impact on availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc2 eliminates this vulnerability. Applying the patch c337efb20d6d9f9bbb4746f6b119917af5c886dc/b44f791f27b14c9eb6b907fbe51f2ba8bec32085/5814a7fc3abb41f63f2d44c9d3ff9d4e62965b72/9c19498bdd7cb9d854bd3c54260f71cf7408495e/b4e9bab6011b9559b7c157b16b91ae46d4d8c533/d1bc80da75c789f2f6830df89d91fb2f7a509943/82448d4dcd8406dec688632a405fdcf7f170ec69/82ffbe7776d0ac084031f114167712269bf3d832 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38115)
A vulnerability, which was classified as critical, has been found in Linux Kernel up to 6.6.93/6.12.33/6.15.2/6.16-rc1 (Operating System).Using CWE to declare the problem leads to CWE-416. Referencing memory after it has been freed can cause a program to crash, use unexpected values, or execute code.Impacted is confidentiality, integrity, and availability.Upgrading to version 6.6.94, 6.12.34, 6.15.3 or 6.16-rc2 eliminates this vulnerability. Applying the patch bdd56875c6926d8009914f427df71797693e90d4/4e83f2dbb2bf677e614109df24426c4dded472d4/d7882db79135c829a922daf3571f33ea1e056ae3/6fe26f694c824b8a4dbf50c635bee1302e3f099c is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38117)
A vulnerability, which was classified as problematic, was found in Linux Kernel up to 8058c88ac0df21239daee54b5934d5c80ca9685f (Operating System).CWE is classifying the issue as CWE-401. The product does not sufficiently track and release allocated memory after it has been used, which slowly consumes remaining memory.This is going to have an impact on confidentiality.Upgrading to version 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch b5ad58285f9217d68cd5ea2ad86ce254a3fe7c4d/90bc7f5a244aadee4292b28098b7c98aadd4b3aa/39bab2d3517b5b50c609b4f8c66129bf619fffa0/251496ce1728c9fd47bd2b20a7b21b20b9a020ca/8068e1e42b46518ce680dc6470bcd710efc3fa0a/ea77c397bff8b6d59f6d83dae1425b08f465e8b5 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38120)
A vulnerability classified as problematic has been found in Linux Kernel (Operating System).This is going to have an impact on confidentiality, integrity, and availability.Upgrading to version 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 0e65f38bd1aa14ea86e221b7bb814d38278d86c3/85eef1748c024da1a191aed56b30a3a65958c50c/4399f59a9467a324ed46657555f0e1f209a14acb/a04302867094bdc6efac1b598370fc47cf3f2388/3382a1ed7f778db841063f5d7e317ac55f9e7f72 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38124)
A vulnerability, which was classified as problematic, has been found in Linux Kernel up to 6.6.93/6.12.33/6.15.2 (Operating System).Using CWE to declare the problem leads to CWE-371.Impacted is confidentiality, integrity, and availability.Upgrading to version 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 1d3c5d0dec6797eca3a861dab0816fa9505d9c3e/276849954d7cbe6eec827b21fe2df43f9bf07011/0e061abaad1498c5b76c10c594d4359ceb6b9145/0153f36041b8e52019ebfa8629c13bf8f9b0a951 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38127)
A vulnerability has been found in Linux Kernel up to 6.15.2 (Operating System) and classified as problematic.The CWE definition for the vulnerability is CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.As an impact it is known to affect confidentiality, integrity, and availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch e5ce9df1d68094d37360dbd9b09289d42fa21e54/7ee3fb6258da8c890a51b514f60d7570dc703605/40471b23147c86ea3ed97faee79937c618250bd0/5482ef9875eaa43f0435e14570e1193823de857e/ee5ee646385f5846dcbc881389f3c44a197c402a/5a85c21f812e02cb00ca07007d88acdd42d08c46/ac4e317a95a1092b5da5b9918b7118759342641c is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-19787).(CVE-2025-38157)
A vulnerability classified as problematic was found in Linux Kernel up to 6.15.3 (Operating System).As an impact it is known to affect confidentiality, integrity, and availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch d9a55869d8237e677ddaa18b0f58586364cfbc1c/1f6332872374b7f482fc4ad865f9422fedb587fc/fbfe8446cd3274b9e367f5708d94574230a44409/5018d035530b6fbfad33eeb1dd1bc87da419a276/a87cbcc909ccfd394d4936a94663f586453d0961/aaa644e7ffff02e12c89cbce4753bc0b6f23ff87/d14cbed4baccd712447fb3f9c011f008b56b2097/42cb74a92adaf88061039601ddf7c874f58b554e is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-20037).(CVE-2025-38219)
A vulnerability, which was classified as critical, has been found in Linux Kernel up to 6.6.94/6.12.34/6.15.3 (Operating System).Using CWE to declare the problem leads to CWE-476. A NULL pointer dereference occurs when the application dereferences a pointer that it expects to be valid, but is NULL, typically causing a crash or exit.Impacted is availability.Upgrading to version 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch cf6a4c4ac7b6e3214f25df594c9689a62f1bb456/be5f3061a6f904e3674257879e71881ceee5b673/d7af6eee8cd60f55aa8c5fe2b91f11ec0c9a0f27/e26268ff1dcae5662c1b96c35f18cfa6ab73d9de is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-20036).(CVE-2025-38220)
Linux kernel is the kernel used by Linux, the open source operating system of the Linux Foundation in the United States. There is a security vulnerability in Linux kernel. This vulnerability originates from improper processing of composing size in vivid drivers, which may lead to over-bounds writing.(CVE-2025-38226)
A vulnerability, which was classified as problematic, was found in Linux Kernel up to 32700ecf8007e071d1ce4c78f65b85f46d05f32a (Operating System).The manipulation of the argument adxl_component_count with an unknown input leads to a unknown weakness. CWE is classifying the issue as CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.This is going to have an impact on confidentiality.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 80bf28fd623d97dd4f4825fbbe9d736cec2afba3/a6ed3a6edff09c1187cc6ade7f5967bca2376a13/bf6a8502a5f4ff6e4d135d795945cdade49ec8b0/e8530ed3c0769a4d8f79c212715ec1cf277787f8/3f5d0659000923735350da60ad710f8c804544fe/a13e8343ffcff27af1ff79597ff7ba241e6d9471/31ef6f7c9aee3be78d63789653e92350f2537f93/20d2d476b3ae18041be423671a8637ed5ffd6958 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38298)
A vulnerability classified as critical was found in Linux Kernel up to 6.15.3 (Operating System).The CWE definition for the vulnerability is CWE-476. A NULL pointer dereference occurs when the application dereferences a pointer that it expects to be valid, but is NULL, typically causing a crash or exit.As an impact it is known to affect availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch 5c1a34ff5b0bfdfd2f9343aa9b08d25df618bac5/ec669e5bf409f16e464bfad75f0ba039a45de29a/43d5e3bb5f1dcd91e30238ea0b59a5f77063f84e/23361b479f2700c00960d3ae9cdc8ededa762d47/2e7c64d7a92c031d016f11c8e8cb05131ab7b75a/f78b38af3540b4875147b7b884ee11a27b3dbf4c/a377996d714afb8d4d5f4906336f78510039da29/af98b0157adf6504fade79b3e6cb260c4ff68e37 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38337)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"bpftool-debuginfo-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"kernel-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"kernel-debuginfo-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"kernel-debugsource-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"kernel-devel-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"kernel-headers-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"kernel-source-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"kernel-tools-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"kernel-tools-debuginfo-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"kernel-tools-devel-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"perf-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"perf-debuginfo-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"python3-perf-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm",
"python3-perf-debuginfo-6.6.0-102.0.0.105.oe2403sp1.aarch64.rpm"
],
"src": [
"kernel-6.6.0-102.0.0.105.oe2403sp1.src.rpm"
],
"x86_64": [
"bpftool-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"bpftool-debuginfo-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"kernel-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"kernel-debuginfo-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"kernel-debugsource-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"kernel-devel-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"kernel-headers-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"kernel-source-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"kernel-tools-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"kernel-tools-debuginfo-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"kernel-tools-devel-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"perf-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"perf-debuginfo-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"python3-perf-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm",
"python3-perf-debuginfo-6.6.0-102.0.0.105.oe2403sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:24.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-24.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "6.6.0-102.0.0.105.oe2403sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbpf: consider that tail calls invalidate packet pointers\n\nTail-called programs could execute any of the helpers that invalidate\npacket pointers. Hence, conservatively assume that each tail call\ninvalidates packet pointers.\n\nMaking the change in bpf_helper_changes_pkt_data() automatically makes\nuse of check_cfg() logic that computes \u0026apos;changes_pkt_data\u0026apos; effect for\nglobal sub-programs, such that the following program could be\nrejected:\n\n int tail_call(struct __sk_buff *sk)\n {\n \tbpf_tail_call_static(sk, \u0026amp;jmp_table, 0);\n \treturn 0;\n }\n\n SEC(\u0026quot;tc\u0026quot;)\n int not_safe(struct __sk_buff *sk)\n {\n \tint *p = (void *)(long)sk-\u0026gt;data;\n \t... make p valid ...\n \ttail_call(sk);\n \t*p = 42; /* this is unsafe */\n \t...\n }\n\nThe tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that\ncan invalidate packet pointers. Otherwise, it can\u0026apos;t be freplaced with\ntailcall_freplace.c:entry_freplace() that does a tail call.(CVE-2024-58237)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetem: Update sch-\u0026gt;q.qlen before qdisc_tree_reduce_backlog()\n\nqdisc_tree_reduce_backlog() notifies parent qdisc only if child\nqdisc becomes empty, therefore we need to reduce the backlog of the\nchild qdisc before calling it. Otherwise it would miss the opportunity\nto call cops-\u0026gt;qlen_notify(), in the case of DRR, it resulted in UAF\nsince DRR uses -\u0026gt;qlen_notify() to maintain its active list.(CVE-2025-21703)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/rxe: Fix the warning \u0026quot;__rxe_cleanup+0x12c/0x170 [rdma_rxe]\u0026quot;\n\nThe Call Trace is as below:\n\u0026quot;\n \u0026lt;TASK\u0026gt;\n ? show_regs.cold+0x1a/0x1f\n ? __rxe_cleanup+0x12c/0x170 [rdma_rxe]\n ? __warn+0x84/0xd0\n ? __rxe_cleanup+0x12c/0x170 [rdma_rxe]\n ? report_bug+0x105/0x180\n ? handle_bug+0x46/0x80\n ? exc_invalid_op+0x19/0x70\n ? asm_exc_invalid_op+0x1b/0x20\n ? __rxe_cleanup+0x12c/0x170 [rdma_rxe]\n ? __rxe_cleanup+0x124/0x170 [rdma_rxe]\n rxe_destroy_qp.cold+0x24/0x29 [rdma_rxe]\n ib_destroy_qp_user+0x118/0x190 [ib_core]\n rdma_destroy_qp.cold+0x43/0x5e [rdma_cm]\n rtrs_cq_qp_destroy.cold+0x1d/0x2b [rtrs_core]\n rtrs_srv_close_work.cold+0x1b/0x31 [rtrs_server]\n process_one_work+0x21d/0x3f0\n worker_thread+0x4a/0x3c0\n ? process_one_work+0x3f0/0x3f0\n kthread+0xf0/0x120\n ? kthread_complete_and_exit+0x20/0x20\n ret_from_fork+0x22/0x30\n \u0026lt;/TASK\u0026gt;\n\u0026quot;\nWhen too many rdma resources are allocated, rxe needs more time to\nhandle these rdma resources. Sometimes with the current timeout, rxe\ncan not release the rdma resources correctly.\n\nCompared with other rdma drivers, a bigger timeout is used.(CVE-2025-21829)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: enetc: VFs do not support HWTSTAMP_TX_ONESTEP_SYNC\n\nActually ENETC VFs do not support HWTSTAMP_TX_ONESTEP_SYNC because only\nENETC PF can access PMa_SINGLE_STEP registers. And there will be a crash\nif VFs are used to test one-step timestamp, the crash log as follows.\n\n[ 129.110909] Unable to handle kernel paging request at virtual address 00000000000080c0\n[ 129.287769] Call trace:\n[ 129.290219] enetc_port_mac_wr+0x30/0xec (P)\n[ 129.294504] enetc_start_xmit+0xda4/0xe74\n[ 129.298525] enetc_xmit+0x70/0xec\n[ 129.301848] dev_hard_start_xmit+0x98/0x118(CVE-2025-21894)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncaif_virtio: fix wrong pointer check in cfv_probe()\n\ndel_vqs() frees virtqueues, therefore cfv-\u0026gt;vq_tx pointer should be checked\nfor NULL before calling it, not cfv-\u0026gt;vdev. Also the current implementation\nis redundant because the pointer cfv-\u0026gt;vdev is dereferenced before it is\nchecked for NULL.\n\nFix this by checking cfv-\u0026gt;vq_tx for NULL instead of cfv-\u0026gt;vdev before\ncalling del_vqs().(CVE-2025-21904)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nvlan: enforce underlying device type\n\nCurrently, VLAN devices can be created on top of non-ethernet devices.\n\nBesides the fact that it doesn\u0026apos;t make much sense, this also causes a\nbug which leaks the address of a kernel function to usermode.\n\nWhen creating a VLAN device, we initialize GARP (garp_init_applicant)\nand MRP (mrp_init_applicant) for the underlying device.\n\nAs part of the initialization process, we add the multicast address of\neach applicant to the underlying device, by calling dev_mc_add.\n\n__dev_mc_add uses dev-\u0026gt;addr_len to determine the length of the new\nmulticast address.\n\nThis causes an out-of-bounds read if dev-\u0026gt;addr_len is greater than 6,\nsince the multicast addresses provided by GARP and MRP are only 6\nbytes long.\n\nThis behaviour can be reproduced using the following commands:\n\nip tunnel add gretest mode ip6gre local ::1 remote ::2 dev lo\nip l set up dev gretest\nip link add link gretest name vlantest type vlan id 100\n\nThen, the following command will display the address of garp_pdu_rcv:\n\nip maddr show | grep 01:80:c2:00:00:21\n\nFix the bug by enforcing the type of the underlying device during VLAN\ndevice initialization.(CVE-2025-21920)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: gso: fix ownership in __udp_gso_segment\n\nIn __udp_gso_segment the skb destructor is removed before segmenting the\nskb but the socket reference is kept as-is. This is an issue if the\noriginal skb is later orphaned as we can hit the following bug:\n\n kernel BUG at ./include/linux/skbuff.h:3312! (skb_orphan)\n RIP: 0010:ip_rcv_core+0x8b2/0xca0\n Call Trace:\n ip_rcv+0xab/0x6e0\n __netif_receive_skb_one_core+0x168/0x1b0\n process_backlog+0x384/0x1100\n __napi_poll.constprop.0+0xa1/0x370\n net_rx_action+0x925/0xe50\n\nThe above can happen following a sequence of events when using\nOpenVSwitch, when an OVS_ACTION_ATTR_USERSPACE action precedes an\nOVS_ACTION_ATTR_OUTPUT action:\n\n1. OVS_ACTION_ATTR_USERSPACE is handled (in do_execute_actions): the skb\n goes through queue_gso_packets and then __udp_gso_segment, where its\n destructor is removed.\n2. The segments\u0026apos; data are copied and sent to userspace.\n3. OVS_ACTION_ATTR_OUTPUT is handled (in do_execute_actions) and the\n same original skb is sent to its path.\n4. If it later hits skb_orphan, we hit the bug.\n\nFix this by also removing the reference to the socket in\n__udp_gso_segment.(CVE-2025-21926)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmptcp: fix \u0026apos;scheduling while atomic\u0026apos; in mptcp_pm_nl_append_new_local_addr\n\nIf multiple connection requests attempt to create an implicit mptcp\nendpoint in parallel, more than one caller may end up in\nmptcp_pm_nl_append_new_local_addr because none found the address in\nlocal_addr_list during their call to mptcp_pm_nl_get_local_id. In this\ncase, the concurrent new_local_addr calls may delete the address entry\ncreated by the previous caller. These deletes use synchronize_rcu, but\nthis is not permitted in some of the contexts where this function may be\ncalled. During packet recv, the caller may be in a rcu read critical\nsection and have preemption disabled.\n\nAn example stack:\n\n BUG: scheduling while atomic: swapper/2/0/0x00000302\n\n Call Trace:\n \u0026lt;IRQ\u0026gt;\n dump_stack_lvl (lib/dump_stack.c:117 (discriminator 1))\n dump_stack (lib/dump_stack.c:124)\n __schedule_bug (kernel/sched/core.c:5943)\n schedule_debug.constprop.0 (arch/x86/include/asm/preempt.h:33 kernel/sched/core.c:5970)\n __schedule (arch/x86/include/asm/jump_label.h:27 include/linux/jump_label.h:207 kernel/sched/features.h:29 kernel/sched/core.c:6621)\n schedule (arch/x86/include/asm/preempt.h:84 kernel/sched/core.c:6804 kernel/sched/core.c:6818)\n schedule_timeout (kernel/time/timer.c:2160)\n wait_for_completion (kernel/sched/completion.c:96 kernel/sched/completion.c:116 kernel/sched/completion.c:127 kernel/sched/completion.c:148)\n __wait_rcu_gp (include/linux/rcupdate.h:311 kernel/rcu/update.c:444)\n synchronize_rcu (kernel/rcu/tree.c:3609)\n mptcp_pm_nl_append_new_local_addr (net/mptcp/pm_netlink.c:966 net/mptcp/pm_netlink.c:1061)\n mptcp_pm_nl_get_local_id (net/mptcp/pm_netlink.c:1164)\n mptcp_pm_get_local_id (net/mptcp/pm.c:420)\n subflow_check_req (net/mptcp/subflow.c:98 net/mptcp/subflow.c:213)\n subflow_v4_route_req (net/mptcp/subflow.c:305)\n tcp_conn_request (net/ipv4/tcp_input.c:7216)\n subflow_v4_conn_request (net/mptcp/subflow.c:651)\n tcp_rcv_state_process (net/ipv4/tcp_input.c:6709)\n tcp_v4_do_rcv (net/ipv4/tcp_ipv4.c:1934)\n tcp_v4_rcv (net/ipv4/tcp_ipv4.c:2334)\n ip_protocol_deliver_rcu (net/ipv4/ip_input.c:205 (discriminator 1))\n ip_local_deliver_finish (include/linux/rcupdate.h:813 net/ipv4/ip_input.c:234)\n ip_local_deliver (include/linux/netfilter.h:314 include/linux/netfilter.h:308 net/ipv4/ip_input.c:254)\n ip_sublist_rcv_finish (include/net/dst.h:461 net/ipv4/ip_input.c:580)\n ip_sublist_rcv (net/ipv4/ip_input.c:640)\n ip_list_rcv (net/ipv4/ip_input.c:675)\n __netif_receive_skb_list_core (net/core/dev.c:5583 net/core/dev.c:5631)\n netif_receive_skb_list_internal (net/core/dev.c:5685 net/core/dev.c:5774)\n napi_complete_done (include/linux/list.h:37 include/net/gro.h:449 include/net/gro.h:444 net/core/dev.c:6114)\n igb_poll (drivers/net/ethernet/intel/igb/igb_main.c:8244) igb\n __napi_poll (net/core/dev.c:6582)\n net_rx_action (net/core/dev.c:6653 net/core/dev.c:6787)\n handle_softirqs (kernel/softirq.c:553)\n __irq_exit_rcu (kernel/softirq.c:588 kernel/softirq.c:427 kernel/softirq.c:636)\n irq_exit_rcu (kernel/softirq.c:651)\n common_interrupt (arch/x86/kernel/irq.c:247 (discriminator 14))\n \u0026lt;/IRQ\u0026gt;\n\nThis problem seems particularly prevalent if the user advertises an\nendpoint that has a different external vs internal address. In the case\nwhere the external address is advertised and multiple connections\nalready exist, multiple subflow SYNs arrive in parallel which tends to\ntrigger the race during creation of the first local_addr_list entries\nwhich have the internal address instead.\n\nFix by skipping the replacement of an existing implicit local address if\ncalled via mptcp_pm_nl_get_local_id.(CVE-2025-21938)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\neth: bnxt: do not update checksum in bnxt_xdp_build_skb()\n\nThe bnxt_rx_pkt() updates ip_summed value at the end if checksum offload\nis enabled.\nWhen the XDP-MB program is attached and it returns XDP_PASS, the\nbnxt_xdp_build_skb() is called to update skb_shared_info.\nThe main purpose of bnxt_xdp_build_skb() is to update skb_shared_info,\nbut it updates ip_summed value too if checksum offload is enabled.\nThis is actually duplicate work.\n\nWhen the bnxt_rx_pkt() updates ip_summed value, it checks if ip_summed\nis CHECKSUM_NONE or not.\nIt means that ip_summed should be CHECKSUM_NONE at this moment.\nBut ip_summed may already be updated to CHECKSUM_UNNECESSARY in the\nXDP-MB-PASS path.\nSo the by skb_checksum_none_assert() WARNS about it.\n\nThis is duplicate work and updating ip_summed in the\nbnxt_xdp_build_skb() is not needed.\n\nSplat looks like:\nWARNING: CPU: 3 PID: 5782 at ./include/linux/skbuff.h:5155 bnxt_rx_pkt+0x479b/0x7610 [bnxt_en]\nModules linked in: bnxt_re bnxt_en rdma_ucm rdma_cm iw_cm ib_cm ib_uverbs veth xt_nat xt_tcpudp xt_conntrack nft_chain_nat xt_MASQUERADE nf_]\nCPU: 3 UID: 0 PID: 5782 Comm: socat Tainted: G W 6.14.0-rc4+ #27\nTainted: [W]=WARN\nHardware name: ASUS System Product Name/PRIME Z690-P D4, BIOS 0603 11/01/2021\nRIP: 0010:bnxt_rx_pkt+0x479b/0x7610 [bnxt_en]\nCode: 54 24 0c 4c 89 f1 4c 89 ff c1 ea 1f ff d3 0f 1f 00 49 89 c6 48 85 c0 0f 84 4c e5 ff ff 48 89 c7 e8 ca 3d a0 c8 e9 8f f4 ff ff \u0026lt;0f\u0026gt; 0b f\nRSP: 0018:ffff88881ba09928 EFLAGS: 00010202\nRAX: 0000000000000000 RBX: 00000000c7590303 RCX: 0000000000000000\nRDX: 1ffff1104e7d1610 RSI: 0000000000000001 RDI: ffff8881c91300b8\nRBP: ffff88881ba09b28 R08: ffff888273e8b0d0 R09: ffff888273e8b070\nR10: ffff888273e8b010 R11: ffff888278b0f000 R12: ffff888273e8b080\nR13: ffff8881c9130e00 R14: ffff8881505d3800 R15: ffff888273e8b000\nFS: 00007f5a2e7be080(0000) GS:ffff88881ba00000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00007fff2e708ff8 CR3: 000000013e3b0000 CR4: 00000000007506f0\nPKRU: 55555554\nCall Trace:\n \u0026lt;IRQ\u0026gt;\n ? __warn+0xcd/0x2f0\n ? bnxt_rx_pkt+0x479b/0x7610\n ? report_bug+0x326/0x3c0\n ? handle_bug+0x53/0xa0\n ? exc_invalid_op+0x14/0x50\n ? asm_exc_invalid_op+0x16/0x20\n ? bnxt_rx_pkt+0x479b/0x7610\n ? bnxt_rx_pkt+0x3e41/0x7610\n ? __pfx_bnxt_rx_pkt+0x10/0x10\n ? napi_complete_done+0x2cf/0x7d0\n __bnxt_poll_work+0x4e8/0x1220\n ? __pfx___bnxt_poll_work+0x10/0x10\n ? __pfx_mark_lock.part.0+0x10/0x10\n bnxt_poll_p5+0x36a/0xfa0\n ? __pfx_bnxt_poll_p5+0x10/0x10\n __napi_poll.constprop.0+0xa0/0x440\n net_rx_action+0x899/0xd00\n...\n\nFollowing ping.py patch adds xdp-mb-pass case. so ping.py is going\nto be able to reproduce this issue.(CVE-2025-21960)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\neth: bnxt: fix truesize for mb-xdp-pass case\n\nWhen mb-xdp is set and return is XDP_PASS, packet is converted from\nxdp_buff to sk_buff with xdp_update_skb_shared_info() in\nbnxt_xdp_build_skb().\nbnxt_xdp_build_skb() passes incorrect truesize argument to\nxdp_update_skb_shared_info().\nThe truesize is calculated as BNXT_RX_PAGE_SIZE * sinfo-\u0026gt;nr_frags but\nthe skb_shared_info was wiped by napi_build_skb() before.\nSo it stores sinfo-\u0026gt;nr_frags before bnxt_xdp_build_skb() and use it\ninstead of getting skb_shared_info from xdp_get_shared_info_from_buff().\n\nSplat looks like:\n ------------[ cut here ]------------\n WARNING: CPU: 2 PID: 0 at net/core/skbuff.c:6072 skb_try_coalesce+0x504/0x590\n Modules linked in: xt_nat xt_tcpudp veth af_packet xt_conntrack nft_chain_nat xt_MASQUERADE nf_conntrack_netlink xfrm_user xt_addrtype nft_coms\n CPU: 2 UID: 0 PID: 0 Comm: swapper/2 Not tainted 6.14.0-rc2+ #3\n RIP: 0010:skb_try_coalesce+0x504/0x590\n Code: 4b fd ff ff 49 8b 34 24 40 80 e6 40 0f 84 3d fd ff ff 49 8b 74 24 48 40 f6 c6 01 0f 84 2e fd ff ff 48 8d 4e ff e9 25 fd ff ff \u0026lt;0f\u0026gt; 0b e99\n RSP: 0018:ffffb62c4120caa8 EFLAGS: 00010287\n RAX: 0000000000000003 RBX: ffffb62c4120cb14 RCX: 0000000000000ec0\n RDX: 0000000000001000 RSI: ffffa06e5d7dc000 RDI: 0000000000000003\n RBP: ffffa06e5d7ddec0 R08: ffffa06e6120a800 R09: ffffa06e7a119900\n R10: 0000000000002310 R11: ffffa06e5d7dcec0 R12: ffffe4360575f740\n R13: ffffe43600000000 R14: 0000000000000002 R15: 0000000000000002\n FS: 0000000000000000(0000) GS:ffffa0755f700000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 00007f147b76b0f8 CR3: 00000001615d4000 CR4: 00000000007506f0\n PKRU: 55555554\n Call Trace:\n \u0026lt;IRQ\u0026gt;\n ? __warn+0x84/0x130\n ? skb_try_coalesce+0x504/0x590\n ? report_bug+0x18a/0x1a0\n ? handle_bug+0x53/0x90\n ? exc_invalid_op+0x14/0x70\n ? asm_exc_invalid_op+0x16/0x20\n ? skb_try_coalesce+0x504/0x590\n inet_frag_reasm_finish+0x11f/0x2e0\n ip_defrag+0x37a/0x900\n ip_local_deliver+0x51/0x120\n ip_sublist_rcv_finish+0x64/0x70\n ip_sublist_rcv+0x179/0x210\n ip_list_rcv+0xf9/0x130\n\nHow to reproduce:\n\u0026lt;Node A\u0026gt;\nip link set $interface1 xdp obj xdp_pass.o\nip link set $interface1 mtu 9000 up\nip a a 10.0.0.1/24 dev $interface1\n\u0026lt;Node B\u0026gt;\nip link set $interfac2 mtu 9000 up\nip a a 10.0.0.2/24 dev $interface2\nping 10.0.0.1 -s 65000\n\nFollowing ping.py patch adds xdp-mb-pass case. so ping.py is going to be\nable to reproduce this issue.(CVE-2025-21961)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/mlx5: handle errors in mlx5_chains_create_table()\n\nIn mlx5_chains_create_table(), the return value of\u00a0mlx5_get_fdb_sub_ns()\nand mlx5_get_flow_namespace() must be checked to prevent NULL pointer\ndereferences. If either function fails, the function should log error\nmessage with mlx5_core_warn() and return error pointer.(CVE-2025-21975)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxsk: fix an integer overflow in xp_create_and_assign_umem()\n\nSince the i and pool-\u0026gt;chunk_size variables are of type \u0026apos;u32\u0026apos;,\ntheir product can wrap around and then be cast to \u0026apos;u64\u0026apos;.\nThis can lead to two different XDP buffers pointing to the same\nmemory area.\n\nFound by InfoTeCS on behalf of Linux Verification Center\n(linuxtesting.org) with SVACE.(CVE-2025-21997)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: atm: fix use after free in lec_send()\n\nThe -\u0026gt;send() operation frees skb so save the length before calling\n-\u0026gt;send() to avoid a use after free.(CVE-2025-22004)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusbnet:fix NPE during rx_complete\n\nMissing usbnet_going_away Check in Critical Path.\nThe usb_submit_urb function lacks a usbnet_going_away\nvalidation, whereas __usbnet_queue_skb includes this check.\n\nThis inconsistency creates a race condition where:\nA URB request may succeed, but the corresponding SKB data\nfails to be queued.\n\nSubsequent processes:\n(e.g., rx_complete \u2192 defer_bh \u2192 __skb_unlink(skb, list))\nattempt to access skb-\u0026gt;next, triggering a NULL pointer\ndereference (Kernel Panic).(CVE-2025-22050)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: ibmveth: make veth_pool_store stop hanging\n\nv2:\n- Created a single error handling unlock and exit in veth_pool_store\n- Greatly expanded commit message with previous explanatory-only text\n\nSummary: Use rtnl_mutex to synchronize veth_pool_store with itself,\nibmveth_close and ibmveth_open, preventing multiple calls in a row to\nnapi_disable.\n\nBackground: Two (or more) threads could call veth_pool_store through\nwriting to /sys/devices/vio/30000002/pool*/*. You can do this easily\nwith a little shell script. This causes a hang.\n\nI configured LOCKDEP, compiled ibmveth.c with DEBUG, and built a new\nkernel. I ran this test again and saw:\n\n Setting pool0/active to 0\n Setting pool1/active to 1\n [ 73.911067][ T4365] ibmveth 30000002 eth0: close starting\n Setting pool1/active to 1\n Setting pool1/active to 0\n [ 73.911367][ T4366] ibmveth 30000002 eth0: close starting\n [ 73.916056][ T4365] ibmveth 30000002 eth0: close complete\n [ 73.916064][ T4365] ibmveth 30000002 eth0: open starting\n [ 110.808564][ T712] systemd-journald[712]: Sent WATCHDOG=1 notification.\n [ 230.808495][ T712] systemd-journald[712]: Sent WATCHDOG=1 notification.\n [ 243.683786][ T123] INFO: task stress.sh:4365 blocked for more than 122 seconds.\n [ 243.683827][ T123] Not tainted 6.14.0-01103-g2df0c02dab82-dirty #8\n [ 243.683833][ T123] \u0026quot;echo 0 \u0026gt; /proc/sys/kernel/hung_task_timeout_secs\u0026quot; disables this message.\n [ 243.683838][ T123] task:stress.sh state:D stack:28096 pid:4365 tgid:4365 ppid:4364 task_flags:0x400040 flags:0x00042000\n [ 243.683852][ T123] Call Trace:\n [ 243.683857][ T123] [c00000000c38f690] [0000000000000001] 0x1 (unreliable)\n [ 243.683868][ T123] [c00000000c38f840] [c00000000001f908] __switch_to+0x318/0x4e0\n [ 243.683878][ T123] [c00000000c38f8a0] [c000000001549a70] __schedule+0x500/0x12a0\n [ 243.683888][ T123] [c00000000c38f9a0] [c00000000154a878] schedule+0x68/0x210\n [ 243.683896][ T123] [c00000000c38f9d0] [c00000000154ac80] schedule_preempt_disabled+0x30/0x50\n [ 243.683904][ T123] [c00000000c38fa00] [c00000000154dbb0] __mutex_lock+0x730/0x10f0\n [ 243.683913][ T123] [c00000000c38fb10] [c000000001154d40] napi_enable+0x30/0x60\n [ 243.683921][ T123] [c00000000c38fb40] [c000000000f4ae94] ibmveth_open+0x68/0x5dc\n [ 243.683928][ T123] [c00000000c38fbe0] [c000000000f4aa20] veth_pool_store+0x220/0x270\n [ 243.683936][ T123] [c00000000c38fc70] [c000000000826278] sysfs_kf_write+0x68/0xb0\n [ 243.683944][ T123] [c00000000c38fcb0] [c0000000008240b8] kernfs_fop_write_iter+0x198/0x2d0\n [ 243.683951][ T123] [c00000000c38fd00] [c00000000071b9ac] vfs_write+0x34c/0x650\n [ 243.683958][ T123] [c00000000c38fdc0] [c00000000071bea8] ksys_write+0x88/0x150\n [ 243.683966][ T123] [c00000000c38fe10] [c0000000000317f4] system_call_exception+0x124/0x340\n [ 243.683973][ T123] [c00000000c38fe50] [c00000000000d05c] system_call_vectored_common+0x15c/0x2ec\n ...\n [ 243.684087][ T123] Showing all locks held in the system:\n [ 243.684095][ T123] 1 lock held by khungtaskd/123:\n [ 243.684099][ T123] #0: c00000000278e370 (rcu_read_lock){....}-{1:2}, at: debug_show_all_locks+0x50/0x248\n [ 243.684114][ T123] 4 locks held by stress.sh/4365:\n [ 243.684119][ T123] #0: c00000003a4cd3f8 (sb_writers#3){.+.+}-{0:0}, at: ksys_write+0x88/0x150\n [ 243.684132][ T123] #1: c000000041aea888 (\u0026amp;of-\u0026gt;mutex#2){+.+.}-{3:3}, at: kernfs_fop_write_iter+0x154/0x2d0\n [ 243.684143][ T123] #2: c0000000366fb9a8 (kn-\u0026gt;active#64){.+.+}-{0:0}, at: kernfs_fop_write_iter+0x160/0x2d0\n [ 243.684155][ T123] #3: c000000035ff4cb8 (\u0026amp;dev-\u0026gt;lock){+.+.}-{3:3}, at: napi_enable+0x30/0x60\n [ 243.684166][ T123] 5 locks held by stress.sh/4366:\n [ 243.684170][ T123] #0: c00000003a4cd3f8 (sb_writers#3){.+.+}-{0:0}, at: ksys_write+0x88/0x150\n [ 243.\n---truncated---(CVE-2025-22053)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\narcnet: Add NULL check in com20020pci_probe()\n\ndevm_kasprintf() returns NULL when memory allocation fails. Currently,\ncom20020pci_probe() does not check for this case, which results in a\nNULL pointer dereference.\n\nAdd NULL check after devm_kasprintf() to prevent this issue and ensure\nno resources are left allocated.(CVE-2025-22054)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: fix geneve_opt length integer overflow\n\nstruct geneve_opt uses 5 bit length for each single option, which\nmeans every vary size option should be smaller than 128 bytes.\n\nHowever, all current related Netlink policies cannot promise this\nlength condition and the attacker can exploit a exact 128-byte size\noption to *fake* a zero length option and confuse the parsing logic,\nfurther achieve heap out-of-bounds read.\n\nOne example crash log is like below:\n\n[ 3.905425] ==================================================================\n[ 3.905925] BUG: KASAN: slab-out-of-bounds in nla_put+0xa9/0xe0\n[ 3.906255] Read of size 124 at addr ffff888005f291cc by task poc/177\n[ 3.906646]\n[ 3.906775] CPU: 0 PID: 177 Comm: poc-oob-read Not tainted 6.1.132 #1\n[ 3.907131] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.16.0-0-gd239552ce722-prebuilt.qemu.org 04/01/2014\n[ 3.907784] Call Trace:\n[ 3.907925] \u0026lt;TASK\u0026gt;\n[ 3.908048] dump_stack_lvl+0x44/0x5c\n[ 3.908258] print_report+0x184/0x4be\n[ 3.909151] kasan_report+0xc5/0x100\n[ 3.909539] kasan_check_range+0xf3/0x1a0\n[ 3.909794] memcpy+0x1f/0x60\n[ 3.909968] nla_put+0xa9/0xe0\n[ 3.910147] tunnel_key_dump+0x945/0xba0\n[ 3.911536] tcf_action_dump_1+0x1c1/0x340\n[ 3.912436] tcf_action_dump+0x101/0x180\n[ 3.912689] tcf_exts_dump+0x164/0x1e0\n[ 3.912905] fw_dump+0x18b/0x2d0\n[ 3.913483] tcf_fill_node+0x2ee/0x460\n[ 3.914778] tfilter_notify+0xf4/0x180\n[ 3.915208] tc_new_tfilter+0xd51/0x10d0\n[ 3.918615] rtnetlink_rcv_msg+0x4a2/0x560\n[ 3.919118] netlink_rcv_skb+0xcd/0x200\n[ 3.919787] netlink_unicast+0x395/0x530\n[ 3.921032] netlink_sendmsg+0x3d0/0x6d0\n[ 3.921987] __sock_sendmsg+0x99/0xa0\n[ 3.922220] __sys_sendto+0x1b7/0x240\n[ 3.922682] __x64_sys_sendto+0x72/0x90\n[ 3.922906] do_syscall_64+0x5e/0x90\n[ 3.923814] entry_SYSCALL_64_after_hwframe+0x6e/0xd8\n[ 3.924122] RIP: 0033:0x7e83eab84407\n[ 3.924331] Code: 48 89 fa 4c 89 df e8 38 aa 00 00 8b 93 08 03 00 00 59 5e 48 83 f8 fc 74 1a 5b c3 0f 1f 84 00 00 00 00 00 48 8b 44 24 10 0f 05 \u0026lt;5b\u0026gt; c3 0f 1f 80 00 00 00 00 83 e2 39 83 faf\n[ 3.925330] RSP: 002b:00007ffff505e370 EFLAGS: 00000202 ORIG_RAX: 000000000000002c\n[ 3.925752] RAX: ffffffffffffffda RBX: 00007e83eaafa740 RCX: 00007e83eab84407\n[ 3.926173] RDX: 00000000000001a8 RSI: 00007ffff505e3c0 RDI: 0000000000000003\n[ 3.926587] RBP: 00007ffff505f460 R08: 00007e83eace1000 R09: 000000000000000c\n[ 3.926977] R10: 0000000000000000 R11: 0000000000000202 R12: 00007ffff505f3c0\n[ 3.927367] R13: 00007ffff505f5c8 R14: 00007e83ead1b000 R15: 00005d4fbbe6dcb8\n\nFix these issues by enforing correct length condition in related\npolicies.(CVE-2025-22055)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nudp: Fix memory accounting leak.\n\nMatt Dowling reported a weird UDP memory usage issue.\n\nUnder normal operation, the UDP memory usage reported in /proc/net/sockstat\nremains close to zero. However, it occasionally spiked to 524,288 pages\nand never dropped. Moreover, the value doubled when the application was\nterminated. Finally, it caused intermittent packet drops.\n\nWe can reproduce the issue with the script below [0]:\n\n 1. /proc/net/sockstat reports 0 pages\n\n # cat /proc/net/sockstat | grep UDP:\n UDP: inuse 1 mem 0\n\n 2. Run the script till the report reaches 524,288\n\n # python3 test.py \u0026amp; sleep 5\n # cat /proc/net/sockstat | grep UDP:\n UDP: inuse 3 mem 524288 \u0026lt;-- (INT_MAX + 1) \u0026gt;\u0026gt; PAGE_SHIFT\n\n 3. Kill the socket and confirm the number never drops\n\n # pkill python3 \u0026amp;\u0026amp; sleep 5\n # cat /proc/net/sockstat | grep UDP:\n UDP: inuse 1 mem 524288\n\n 4. (necessary since v6.0) Trigger proto_memory_pcpu_drain()\n\n # python3 test.py \u0026amp; sleep 1 \u0026amp;\u0026amp; pkill python3\n\n 5. The number doubles\n\n # cat /proc/net/sockstat | grep UDP:\n UDP: inuse 1 mem 1048577\n\nThe application set INT_MAX to SO_RCVBUF, which triggered an integer\noverflow in udp_rmem_release().\n\nWhen a socket is close()d, udp_destruct_common() purges its receive\nqueue and sums up skb-\u0026gt;truesize in the queue. This total is calculated\nand stored in a local unsigned integer variable.\n\nThe total size is then passed to udp_rmem_release() to adjust memory\naccounting. However, because the function takes a signed integer\nargument, the total size can wrap around, causing an overflow.\n\nThen, the released amount is calculated as follows:\n\n 1) Add size to sk-\u0026gt;sk_forward_alloc.\n 2) Round down sk-\u0026gt;sk_forward_alloc to the nearest lower multiple of\n PAGE_SIZE and assign it to amount.\n 3) Subtract amount from sk-\u0026gt;sk_forward_alloc.\n 4) Pass amount \u0026gt;\u0026gt; PAGE_SHIFT to __sk_mem_reduce_allocated().\n\nWhen the issue occurred, the total in udp_destruct_common() was 2147484480\n(INT_MAX + 833), which was cast to -2147482816 in udp_rmem_release().\n\nAt 1) sk-\u0026gt;sk_forward_alloc is changed from 3264 to -2147479552, and\n2) sets -2147479552 to amount. 3) reverts the wraparound, so we don\u0026apos;t\nsee a warning in inet_sock_destruct(). However, udp_memory_allocated\nends up doubling at 4).\n\nSince commit 3cd3399dd7a8 (\u0026quot;net: implement per-cpu reserves for\nmemory_allocated\u0026quot;), memory usage no longer doubles immediately after\na socket is close()d because __sk_mem_reduce_allocated() caches the\namount in udp_memory_per_cpu_fw_alloc. However, the next time a UDP\nsocket receives a packet, the subtraction takes effect, causing UDP\nmemory usage to double.\n\nThis issue makes further memory allocation fail once the socket\u0026apos;s\nsk-\u0026gt;sk_rmem_alloc exceeds net.ipv4.udp_rmem_min, resulting in packet\ndrops.\n\nTo prevent this issue, let\u0026apos;s use unsigned int for the calculation and\ncall sk_forward_alloc_add() only once for the small delta.\n\nNote that first_packet_length() also potentially has the same problem.\n\n[0]:\nfrom socket import *\n\nSO_RCVBUFFORCE = 33\nINT_MAX = (2 ** 31) - 1\n\ns = socket(AF_INET, SOCK_DGRAM)\ns.bind((\u0026apos;\u0026apos;, 0))\ns.setsockopt(SOL_SOCKET, SO_RCVBUFFORCE, INT_MAX)\n\nc = socket(AF_INET, SOCK_DGRAM)\nc.connect(s.getsockname())\n\ndata = b\u0026apos;a\u0026apos; * 100\n\nwhile True:\n c.send(data)(CVE-2025-22058)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: add mutual exclusion in proc_sctp_do_udp_port()\n\nWe must serialize calls to sctp_udp_sock_stop() and sctp_udp_sock_start()\nor risk a crash as syzbot reported:\n\nOops: general protection fault, probably for non-canonical address 0xdffffc000000000d: 0000 [#1] SMP KASAN PTI\nKASAN: null-ptr-deref in range [0x0000000000000068-0x000000000000006f]\nCPU: 1 UID: 0 PID: 6551 Comm: syz.1.44 Not tainted 6.14.0-syzkaller-g7f2ff7b62617 #0 PREEMPT(full)\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/12/2025\n RIP: 0010:kernel_sock_shutdown+0x47/0x70 net/socket.c:3653\nCall Trace:\n \u0026lt;TASK\u0026gt;\n udp_tunnel_sock_release+0x68/0x80 net/ipv4/udp_tunnel_core.c:181\n sctp_udp_sock_stop+0x71/0x160 net/sctp/protocol.c:930\n proc_sctp_do_udp_port+0x264/0x450 net/sctp/sysctl.c:553\n proc_sys_call_handler+0x3d0/0x5b0 fs/proc/proc_sysctl.c:601\n iter_file_splice_write+0x91c/0x1150 fs/splice.c:738\n do_splice_from fs/splice.c:935 [inline]\n direct_splice_actor+0x18f/0x6c0 fs/splice.c:1158\n splice_direct_to_actor+0x342/0xa30 fs/splice.c:1102\n do_splice_direct_actor fs/splice.c:1201 [inline]\n do_splice_direct+0x174/0x240 fs/splice.c:1227\n do_sendfile+0xafd/0xe50 fs/read_write.c:1368\n __do_sys_sendfile64 fs/read_write.c:1429 [inline]\n __se_sys_sendfile64 fs/read_write.c:1415 [inline]\n __x64_sys_sendfile64+0x1d8/0x220 fs/read_write.c:1415\n do_syscall_x64 arch/x86/entry/syscall_64.c:63 [inline](CVE-2025-22062)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: fix NULL pointer dereference in l3mdev_l3_rcv\n\nWhen delete l3s ipvlan:\n\n ip link del link eth0 ipvlan1 type ipvlan mode l3s\n\nThis may cause a null pointer dereference:\n\n Call trace:\n ip_rcv_finish+0x48/0xd0\n ip_rcv+0x5c/0x100\n __netif_receive_skb_one_core+0x64/0xb0\n __netif_receive_skb+0x20/0x80\n process_backlog+0xb4/0x204\n napi_poll+0xe8/0x294\n net_rx_action+0xd8/0x22c\n __do_softirq+0x12c/0x354\n\nThis is because l3mdev_l3_rcv() visit dev-\u0026gt;l3mdev_ops after\nipvlan_l3s_unregister() assign the dev-\u0026gt;l3mdev_ops to NULL. The process\nlike this:\n\n (CPU1) | (CPU2)\n l3mdev_l3_rcv() |\n check dev-\u0026gt;priv_flags: |\n master = skb-\u0026gt;dev; |\n |\n | ipvlan_l3s_unregister()\n | set dev-\u0026gt;priv_flags\n | dev-\u0026gt;l3mdev_ops = NULL;\n |\n visit master-\u0026gt;l3mdev_ops |\n\nTo avoid this by do not set dev-\u0026gt;l3mdev_ops when unregister l3s ipvlan.(CVE-2025-22103)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: Remove RTNL dance for SIOCBRADDIF and SIOCBRDELIF.\n\nSIOCBRDELIF is passed to dev_ioctl() first and later forwarded to\nbr_ioctl_call(), which causes unnecessary RTNL dance and the splat\nbelow [0] under RTNL pressure.\n\nLet\u0026apos;s say Thread A is trying to detach a device from a bridge and\nThread B is trying to remove the bridge.\n\nIn dev_ioctl(), Thread A bumps the bridge device\u0026apos;s refcnt by\nnetdev_hold() and releases RTNL because the following br_ioctl_call()\nalso re-acquires RTNL.\n\nIn the race window, Thread B could acquire RTNL and try to remove\nthe bridge device. Then, rtnl_unlock() by Thread B will release RTNL\nand wait for netdev_put() by Thread A.\n\nThread A, however, must hold RTNL after the unlock in dev_ifsioc(),\nwhich may take long under RTNL pressure, resulting in the splat by\nThread B.\n\n Thread A (SIOCBRDELIF) Thread B (SIOCBRDELBR)\n ---------------------- ----------------------\n sock_ioctl sock_ioctl\n `- sock_do_ioctl `- br_ioctl_call\n `- dev_ioctl `- br_ioctl_stub\n |- rtnl_lock |\n |- dev_ifsioc \u0026apos;\n \u0026apos; |- dev = __dev_get_by_name(...)\n |- netdev_hold(dev, ...) .\n / |- rtnl_unlock ------. |\n | |- br_ioctl_call `---\u0026gt; |- rtnl_lock\n Race | | `- br_ioctl_stub |- br_del_bridge\n Window | | | |- dev = __dev_get_by_name(...)\n | | | May take long | `- br_dev_delete(dev, ...)\n | | | under RTNL pressure | `- unregister_netdevice_queue(dev, ...)\n | | | | `- rtnl_unlock\n \\ | |- rtnl_lock \u0026lt;-\u0026apos; `- netdev_run_todo\n | |- ... `- netdev_run_todo\n | `- rtnl_unlock |- __rtnl_unlock\n | |- netdev_wait_allrefs_any\n |- netdev_put(dev, ...) \u0026lt;----------------\u0026apos;\n Wait refcnt decrement\n and log splat below\n\nTo avoid blocking SIOCBRDELBR unnecessarily, let\u0026apos;s not call\ndev_ioctl() for SIOCBRADDIF and SIOCBRDELIF.\n\nIn the dev_ioctl() path, we do the following:\n\n 1. Copy struct ifreq by get_user_ifreq in sock_do_ioctl()\n 2. Check CAP_NET_ADMIN in dev_ioctl()\n 3. Call dev_load() in dev_ioctl()\n 4. Fetch the master dev from ifr.ifr_name in dev_ifsioc()\n\n3. can be done by request_module() in br_ioctl_call(), so we move\n1., 2., and 4. to br_ioctl_stub().\n\nNote that 2. is also checked later in add_del_if(), but it\u0026apos;s better\nperformed before RTNL.\n\nSIOCBRADDIF and SIOCBRDELIF have been processed in dev_ioctl() since\nthe pre-git era, and there seems to be no specific reason to process\nthem there.\n\n[0]:\nunregister_netdevice: waiting for wpan3 to become free. Usage count = 2\nref_tracker: wpan3@ffff8880662d8608 has 1/1 users at\n __netdev_tracker_alloc include/linux/netdevice.h:4282 [inline]\n netdev_hold include/linux/netdevice.h:4311 [inline]\n dev_ifsioc+0xc6a/0x1160 net/core/dev_ioctl.c:624\n dev_ioctl+0x255/0x10c0 net/core/dev_ioctl.c:826\n sock_do_ioctl+0x1ca/0x260 net/socket.c:1213\n sock_ioctl+0x23a/0x6c0 net/socket.c:1318\n vfs_ioctl fs/ioctl.c:51 [inline]\n __do_sys_ioctl fs/ioctl.c:906 [inline]\n __se_sys_ioctl fs/ioctl.c:892 [inline]\n __x64_sys_ioctl+0x1a4/0x210 fs/ioctl.c:892\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcb/0x250 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2025-22111)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: detect and prevent references to a freed transport in sendmsg\n\nsctp_sendmsg() re-uses associations and transports when possible by\ndoing a lookup based on the socket endpoint and the message destination\naddress, and then sctp_sendmsg_to_asoc() sets the selected transport in\nall the message chunks to be sent.\n\nThere\u0026apos;s a possible race condition if another thread triggers the removal\nof that selected transport, for instance, by explicitly unbinding an\naddress with setsockopt(SCTP_SOCKOPT_BINDX_REM), after the chunks have\nbeen set up and before the message is sent. This can happen if the send\nbuffer is full, during the period when the sender thread temporarily\nreleases the socket lock in sctp_wait_for_sndbuf().\n\nThis causes the access to the transport data in\nsctp_outq_select_transport(), when the association outqueue is flushed,\nto result in a use-after-free read.\n\nThis change avoids this scenario by having sctp_transport_free() signal\nthe freeing of the transport, tagging it as \u0026quot;dead\u0026quot;. In order to do this,\nthe patch restores the \u0026quot;dead\u0026quot; bit in struct sctp_transport, which was\nremoved in\ncommit 47faa1e4c50e (\u0026quot;sctp: remove the dead field of sctp_transport\u0026quot;).\n\nThen, in the scenario where the sender thread has released the socket\nlock in sctp_wait_for_sndbuf(), the bit is checked again after\nre-acquiring the socket lock to detect the deletion. This is done while\nholding a reference to the transport to prevent it from being freed in\nthe process.\n\nIf the transport was deleted while the socket lock was relinquished,\nsctp_sendmsg_to_asoc() will return -EAGAIN to let userspace retry the\nsend.\n\nThe bug was found by a private syzbot instance (see the error report [1]\nand the C reproducer that triggers it [2]).(CVE-2025-23142)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: stmmac: Fix accessing freed irq affinity_hint\n\nThe cpumask should not be a local variable, since its pointer is saved\nto irq_desc and may be accessed from procfs.\nTo fix it, use the persistent mask cpumask_of(cpu#).(CVE-2025-23155)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntipc: fix memory leak in tipc_link_xmit\n\nIn case the backlog transmit queue for system-importance messages is overloaded,\ntipc_link_xmit() returns -ENOBUFS but the skb list is not purged. This leads to\nmemory leak and failure when a skb is allocated.\n\nThis commit fixes this issue by purging the skb list before tipc_link_xmit()\nreturns.(CVE-2025-37757)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: dsa: free routing table on probe failure\n\nIf complete = true in dsa_tree_setup(), it means that we are the last\nswitch of the tree which is successfully probing, and we should be\nsetting up all switches from our probe path.\n\nAfter \u0026quot;complete\u0026quot; becomes true, dsa_tree_setup_cpu_ports() or any\nsubsequent function may fail. If that happens, the entire tree setup is\nin limbo: the first N-1 switches have successfully finished probing\n(doing nothing but having allocated persistent memory in the tree\u0026apos;s\ndst-\u0026gt;ports, and maybe dst-\u0026gt;rtable), and switch N failed to probe, ending\nthe tree setup process before anything is tangible from the user\u0026apos;s PoV.\n\nIf switch N fails to probe, its memory (ports) will be freed and removed\nfrom dst-\u0026gt;ports. However, the dst-\u0026gt;rtable elements pointing to its ports,\nas created by dsa_link_touch(), will remain there, and will lead to\nuse-after-free if dereferenced.\n\nIf dsa_tree_setup_switches() returns -EPROBE_DEFER, which is entirely\npossible because that is where ds-\u0026gt;ops-\u0026gt;setup() is, we get a kasan\nreport like this:\n\n==================================================================\nBUG: KASAN: slab-use-after-free in mv88e6xxx_setup_upstream_port+0x240/0x568\nRead of size 8 at addr ffff000004f56020 by task kworker/u8:3/42\n\nCall trace:\n __asan_report_load8_noabort+0x20/0x30\n mv88e6xxx_setup_upstream_port+0x240/0x568\n mv88e6xxx_setup+0xebc/0x1eb0\n dsa_register_switch+0x1af4/0x2ae0\n mv88e6xxx_register_switch+0x1b8/0x2a8\n mv88e6xxx_probe+0xc4c/0xf60\n mdio_probe+0x78/0xb8\n really_probe+0x2b8/0x5a8\n __driver_probe_device+0x164/0x298\n driver_probe_device+0x78/0x258\n __device_attach_driver+0x274/0x350\n\nAllocated by task 42:\n __kasan_kmalloc+0x84/0xa0\n __kmalloc_cache_noprof+0x298/0x490\n dsa_switch_touch_ports+0x174/0x3d8\n dsa_register_switch+0x800/0x2ae0\n mv88e6xxx_register_switch+0x1b8/0x2a8\n mv88e6xxx_probe+0xc4c/0xf60\n mdio_probe+0x78/0xb8\n really_probe+0x2b8/0x5a8\n __driver_probe_device+0x164/0x298\n driver_probe_device+0x78/0x258\n __device_attach_driver+0x274/0x350\n\nFreed by task 42:\n __kasan_slab_free+0x48/0x68\n kfree+0x138/0x418\n dsa_register_switch+0x2694/0x2ae0\n mv88e6xxx_register_switch+0x1b8/0x2a8\n mv88e6xxx_probe+0xc4c/0xf60\n mdio_probe+0x78/0xb8\n really_probe+0x2b8/0x5a8\n __driver_probe_device+0x164/0x298\n driver_probe_device+0x78/0x258\n __device_attach_driver+0x274/0x350\n\nThe simplest way to fix the bug is to delete the routing table in its\nentirety. dsa_tree_setup_routing_table() has no problem in regenerating\nit even if we deleted links between ports other than those of switch N,\nbecause dsa_link_touch() first checks whether the port pair already\nexists in dst-\u0026gt;rtable, allocating if not.\n\nThe deletion of the routing table in its entirety already exists in\ndsa_tree_teardown(), so refactor that into a function that can also be\ncalled from the tree setup error path.\n\nIn my analysis of the commit to blame, it is the one which added\ndsa_link elements to dst-\u0026gt;rtable. Prior to that, each switch had its own\nds-\u0026gt;rtable which is freed when the switch fails to probe. But the tree\nis potentially persistent memory.(CVE-2025-37786)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: dsa: mv88e6xxx: avoid unregistering devlink regions which were never registered\n\nRussell King reports that a system with mv88e6xxx dereferences a NULL\npointer when unbinding this driver:\nhttps://lore.kernel.org/netdev/(CVE-2025-37787)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncxgb4: fix memory leak in cxgb4_init_ethtool_filters() error path\n\nIn the for loop used to allocate the loc_array and bmap for each port, a\nmemory leak is possible when the allocation for loc_array succeeds,\nbut the allocation for bmap fails. This is because when the control flow\ngoes to the label free_eth_finfo, only the allocations starting from\n(i-1)th iteration are freed.\n\nFix that by freeing the loc_array in the bmap allocation error path.(CVE-2025-37788)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: mctp: Set SOCK_RCU_FREE\n\nBind lookup runs under RCU, so ensure that a socket doesn\u0026apos;t go away in\nthe middle of a lookup.(CVE-2025-37790)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet_sched: hfsc: Fix a UAF vulnerability in class handling\n\nThis patch fixes a Use-After-Free vulnerability in the HFSC qdisc class\nhandling. The issue occurs due to a time-of-check/time-of-use condition\nin hfsc_change_class() when working with certain child qdiscs like netem\nor codel.\n\nThe vulnerability works as follows:\n1. hfsc_change_class() checks if a class has packets (q.qlen != 0)\n2. It then calls qdisc_peek_len(), which for certain qdiscs (e.g.,\n codel, netem) might drop packets and empty the queue\n3. The code continues assuming the queue is still non-empty, adding\n the class to vttree\n4. This breaks HFSC scheduler assumptions that only non-empty classes\n are in vttree\n5. Later, when the class is destroyed, this can lead to a Use-After-Free\n\nThe fix adds a second queue length check after qdisc_peek_len() to verify\nthe queue wasn\u0026apos;t emptied.(CVE-2025-37797)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmcb: fix a double free bug in chameleon_parse_gdd()\n\nIn chameleon_parse_gdd(), if mcb_device_register() fails, \u0026apos;mdev\u0026apos;\nwould be released in mcb_device_register() via put_device().\nThus, goto \u0026apos;err\u0026apos; label and free \u0026apos;mdev\u0026apos; again causes a double free.\nJust return if mcb_device_register() fails.(CVE-2025-37817)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxen-netfront: handle NULL returned by xdp_convert_buff_to_frame()\n\nThe function xdp_convert_buff_to_frame() may return NULL if it fails\nto correctly convert the XDP buffer into an XDP frame due to memory\nconstraints, internal errors, or invalid data. Failing to check for NULL\nmay lead to a NULL pointer dereference if the result is used later in\nprocessing, potentially causing crashes, data corruption, or undefined\nbehavior.\n\nOn XDP redirect failure, the associated page must be released explicitly\nif it was previously retained via get_page(). Failing to do so may result\nin a memory leak, as the pages reference count is not decremented.(CVE-2025-37820)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet_sched: hfsc: Fix a potential UAF in hfsc_dequeue() too\n\nSimilarly to the previous patch, we need to safe guard hfsc_dequeue()\ntoo. But for this one, we don\u0026apos;t have a reliable reproducer.(CVE-2025-37823)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntipc: fix NULL pointer dereference in tipc_mon_reinit_self()\n\nsyzbot reported:\n\ntipc: Node number set to 1055423674\nOops: general protection fault, probably for non-canonical address 0xdffffc0000000000: 0000 [#1] SMP KASAN NOPTI\nKASAN: null-ptr-deref in range [0x0000000000000000-0x0000000000000007]\nCPU: 3 UID: 0 PID: 6017 Comm: kworker/3:5 Not tainted 6.15.0-rc1-syzkaller-00246-g900241a5cc15 #0 PREEMPT(full)\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-debian-1.16.3-2~bpo12+1 04/01/2014\nWorkqueue: events tipc_net_finalize_work\nRIP: 0010:tipc_mon_reinit_self+0x11c/0x210 net/tipc/monitor.c:719\n...\nRSP: 0018:ffffc9000356fb68 EFLAGS: 00010246\nRAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000003ee87cba\nRDX: 0000000000000000 RSI: ffffffff8dbc56a7 RDI: ffff88804c2cc010\nRBP: dffffc0000000000 R08: 0000000000000001 R09: 0000000000000000\nR10: 0000000000000001 R11: 0000000000000000 R12: 0000000000000007\nR13: fffffbfff2111097 R14: ffff88804ead8000 R15: ffff88804ead9010\nFS: 0000000000000000(0000) GS:ffff888097ab9000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00000000f720eb00 CR3: 000000000e182000 CR4: 0000000000352ef0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n \u0026lt;TASK\u0026gt;\n tipc_net_finalize+0x10b/0x180 net/tipc/net.c:140\n process_one_work+0x9cc/0x1b70 kernel/workqueue.c:3238\n process_scheduled_works kernel/workqueue.c:3319 [inline]\n worker_thread+0x6c8/0xf10 kernel/workqueue.c:3400\n kthread+0x3c2/0x780 kernel/kthread.c:464\n ret_from_fork+0x45/0x80 arch/x86/kernel/process.c:153\n ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:245\n \u0026lt;/TASK\u0026gt;\n...\nRIP: 0010:tipc_mon_reinit_self+0x11c/0x210 net/tipc/monitor.c:719\n...\nRSP: 0018:ffffc9000356fb68 EFLAGS: 00010246\nRAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000003ee87cba\nRDX: 0000000000000000 RSI: ffffffff8dbc56a7 RDI: ffff88804c2cc010\nRBP: dffffc0000000000 R08: 0000000000000001 R09: 0000000000000000\nR10: 0000000000000001 R11: 0000000000000000 R12: 0000000000000007\nR13: fffffbfff2111097 R14: ffff88804ead8000 R15: ffff88804ead9010\nFS: 0000000000000000(0000) GS:ffff888097ab9000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00000000f720eb00 CR3: 000000000e182000 CR4: 0000000000352ef0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n\nThere is a racing condition between workqueue created when enabling\nbearer and another thread created when disabling bearer right after\nthat as follow:\n\nenabling_bearer | disabling_bearer\n--------------- | ----------------\ntipc_disc_timeout() |\n{ | bearer_disable()\n ... | {\n schedule_work(\u0026amp;tn-\u0026gt;work); | tipc_mon_delete()\n ... | {\n} | ...\n | write_lock_bh(\u0026amp;mon-\u0026gt;lock);\n | mon-\u0026gt;self = NULL;\n | write_unlock_bh(\u0026amp;mon-\u0026gt;lock);\n | ...\n | }\ntipc_net_finalize_work() | }\n{ |\n ... |\n tipc_net_finalize() |\n { |\n ... |\n tipc_mon_reinit_self() |\n { |\n ... |\n write_lock_bh(\u0026amp;mon-\u0026gt;lock); |\n mon-\u0026gt;self-\u0026gt;addr = tipc_own_addr(net); |\n write_unlock_bh(\u0026amp;mon-\u0026gt;lock); |\n ... \n---truncated---(CVE-2025-37824)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: dsa: clean up FDB, MDB, VLAN entries on unbind\n\nAs explained in many places such as commit b117e1e8a86d (\u0026quot;net: dsa:\ndelete dsa_legacy_fdb_add and dsa_legacy_fdb_del\u0026quot;), DSA is written given\nthe assumption that higher layers have balanced additions/deletions.\nAs such, it only makes sense to be extremely vocal when those\nassumptions are violated and the driver unbinds with entries still\npresent.\n\nBut Ido Schimmel points out a very simple situation where that is wrong:\nhttps://lore.kernel.org/netdev/ZDazSM5UsPPjQuKr@shredder/\n(also briefly discussed by me in the aforementioned commit).\n\nBasically, while the bridge bypass operations are not something that DSA\nexplicitly documents, and for the majority of DSA drivers this API\nsimply causes them to go to promiscuous mode, that isn\u0026apos;t the case for\nall drivers. Some have the necessary requirements for bridge bypass\noperations to do something useful - see dsa_switch_supports_uc_filtering().\n\nAlthough in tools/testing/selftests/net/forwarding/local_termination.sh,\nwe made an effort to popularize better mechanisms to manage address\nfilters on DSA interfaces from user space - namely macvlan for unicast,\nand setsockopt(IP_ADD_MEMBERSHIP) - through mtools - for multicast, the\nfact is that \u0026apos;bridge fdb add ... self static local\u0026apos; also exists as\nkernel UAPI, and might be useful to someone, even if only for a quick\nhack.\n\nIt seems counter-productive to block that path by implementing shim\n.ndo_fdb_add and .ndo_fdb_del operations which just return -EOPNOTSUPP\nin order to prevent the ndo_dflt_fdb_add() and ndo_dflt_fdb_del() from\nrunning, although we could do that.\n\nAccepting that cleanup is necessary seems to be the only option.\nEspecially since we appear to be coming back at this from a different\nangle as well. Russell King is noticing that the WARN_ON() triggers even\nfor VLANs:\nhttps://lore.kernel.org/netdev/(CVE-2025-37864)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: dsa: mv88e6xxx: fix -ENOENT when deleting VLANs and MST is unsupported\n\nRussell King reports that on the ZII dev rev B, deleting a bridge VLAN\nfrom a user port fails with -ENOENT:\nhttps://lore.kernel.org/netdev/(CVE-2025-37865)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: pktgen: fix access outside of user given buffer in pktgen_thread_write()\n\nHonour the user given buffer size for the strn_len() calls (otherwise\nstrn_len() will access memory outside of the user given buffer).(CVE-2025-38061)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: target: iscsi: Fix timeout on deleted connection\n\nNOPIN response timer may expire on a deleted connection and crash with\nsuch logs:\n\nDid not receive response to NOPIN on CID: 0, failing connection for I_T Nexus (null),i,0x00023d000125,iqn.2017-01.com.iscsi.target,t,0x3d\n\nBUG: Kernel NULL pointer dereference on read at 0x00000000\nNIP strlcpy+0x8/0xb0\nLR iscsit_fill_cxn_timeout_err_stats+0x5c/0xc0 [iscsi_target_mod]\nCall Trace:\n iscsit_handle_nopin_response_timeout+0xfc/0x120 [iscsi_target_mod]\n call_timer_fn+0x58/0x1f0\n run_timer_softirq+0x740/0x860\n __do_softirq+0x16c/0x420\n irq_exit+0x188/0x1c0\n timer_interrupt+0x184/0x410\n\nThat is because nopin response timer may be re-started on nopin timer\nexpiration.\n\nStop nopin timer before stopping the nopin response timer to be sure\nthat no one of them will be re-started.(CVE-2025-38075)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: algif_hash - fix double free in hash_accept\n\nIf accept(2) is called on socket type algif_hash with\nMSG_MORE flag set and crypto_ahash_import fails,\nsk2 is freed. However, it is also freed in af_alg_release,\nleading to slab-use-after-free error.(CVE-2025-38079)\n\nA vulnerability was found in Linux Kernel (Operating System) and classified as problematic.The manipulation of the argument bNumDescriptors with an unknown input leads to a unknown weakness. Using CWE to declare the problem leads to CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.Impacted is confidentiality.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 7a6d6b68db128da2078ccd9a751dfa3f75c9cf5b/41827a2dbdd7880df9881506dee13bc88d4230bb/1df80d748f984290c895e843401824215dcfbfb0/a8f842534807985d3a676006d140541b87044345/4fa7831cf0ac71a0a345369d1a6084f2b096e55e/74388368927e9c52a69524af5bbd6c55eb4690de/485e1b741eb838cbe1d6b0e81e5ab62ae6c095cf/fe7f7ac8e0c708446ff017453add769ffc15deed is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38103)\n\nA vulnerability was found in Linux Kernel up to 6.16-rc1 (Operating System). It has been classified as critical.CWE is classifying the issue as CWE-404. The product does not release or incorrectly releases a resource before it is made available for re-use.This is going to have an impact on availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc2 eliminates this vulnerability. Applying the patch c337efb20d6d9f9bbb4746f6b119917af5c886dc/b44f791f27b14c9eb6b907fbe51f2ba8bec32085/5814a7fc3abb41f63f2d44c9d3ff9d4e62965b72/9c19498bdd7cb9d854bd3c54260f71cf7408495e/b4e9bab6011b9559b7c157b16b91ae46d4d8c533/d1bc80da75c789f2f6830df89d91fb2f7a509943/82448d4dcd8406dec688632a405fdcf7f170ec69/82ffbe7776d0ac084031f114167712269bf3d832 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38115)\n\nA vulnerability, which was classified as critical, has been found in Linux Kernel up to 6.6.93/6.12.33/6.15.2/6.16-rc1 (Operating System).Using CWE to declare the problem leads to CWE-416. Referencing memory after it has been freed can cause a program to crash, use unexpected values, or execute code.Impacted is confidentiality, integrity, and availability.Upgrading to version 6.6.94, 6.12.34, 6.15.3 or 6.16-rc2 eliminates this vulnerability. Applying the patch bdd56875c6926d8009914f427df71797693e90d4/4e83f2dbb2bf677e614109df24426c4dded472d4/d7882db79135c829a922daf3571f33ea1e056ae3/6fe26f694c824b8a4dbf50c635bee1302e3f099c is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38117)\n\nA vulnerability, which was classified as problematic, was found in Linux Kernel up to 8058c88ac0df21239daee54b5934d5c80ca9685f (Operating System).CWE is classifying the issue as CWE-401. The product does not sufficiently track and release allocated memory after it has been used, which slowly consumes remaining memory.This is going to have an impact on confidentiality.Upgrading to version 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch b5ad58285f9217d68cd5ea2ad86ce254a3fe7c4d/90bc7f5a244aadee4292b28098b7c98aadd4b3aa/39bab2d3517b5b50c609b4f8c66129bf619fffa0/251496ce1728c9fd47bd2b20a7b21b20b9a020ca/8068e1e42b46518ce680dc6470bcd710efc3fa0a/ea77c397bff8b6d59f6d83dae1425b08f465e8b5 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38120)\n\nA vulnerability classified as problematic has been found in Linux Kernel (Operating System).This is going to have an impact on confidentiality, integrity, and availability.Upgrading to version 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 0e65f38bd1aa14ea86e221b7bb814d38278d86c3/85eef1748c024da1a191aed56b30a3a65958c50c/4399f59a9467a324ed46657555f0e1f209a14acb/a04302867094bdc6efac1b598370fc47cf3f2388/3382a1ed7f778db841063f5d7e317ac55f9e7f72 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38124)\n\nA vulnerability, which was classified as problematic, has been found in Linux Kernel up to 6.6.93/6.12.33/6.15.2 (Operating System).Using CWE to declare the problem leads to CWE-371.Impacted is confidentiality, integrity, and availability.Upgrading to version 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 1d3c5d0dec6797eca3a861dab0816fa9505d9c3e/276849954d7cbe6eec827b21fe2df43f9bf07011/0e061abaad1498c5b76c10c594d4359ceb6b9145/0153f36041b8e52019ebfa8629c13bf8f9b0a951 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38127)\n\nA vulnerability has been found in Linux Kernel up to 6.15.2 (Operating System) and classified as problematic.The CWE definition for the vulnerability is CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.As an impact it is known to affect confidentiality, integrity, and availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch e5ce9df1d68094d37360dbd9b09289d42fa21e54/7ee3fb6258da8c890a51b514f60d7570dc703605/40471b23147c86ea3ed97faee79937c618250bd0/5482ef9875eaa43f0435e14570e1193823de857e/ee5ee646385f5846dcbc881389f3c44a197c402a/5a85c21f812e02cb00ca07007d88acdd42d08c46/ac4e317a95a1092b5da5b9918b7118759342641c is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-19787).(CVE-2025-38157)\n\nA vulnerability classified as problematic was found in Linux Kernel up to 6.15.3 (Operating System).As an impact it is known to affect confidentiality, integrity, and availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch d9a55869d8237e677ddaa18b0f58586364cfbc1c/1f6332872374b7f482fc4ad865f9422fedb587fc/fbfe8446cd3274b9e367f5708d94574230a44409/5018d035530b6fbfad33eeb1dd1bc87da419a276/a87cbcc909ccfd394d4936a94663f586453d0961/aaa644e7ffff02e12c89cbce4753bc0b6f23ff87/d14cbed4baccd712447fb3f9c011f008b56b2097/42cb74a92adaf88061039601ddf7c874f58b554e is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-20037).(CVE-2025-38219)\n\nA vulnerability, which was classified as critical, has been found in Linux Kernel up to 6.6.94/6.12.34/6.15.3 (Operating System).Using CWE to declare the problem leads to CWE-476. A NULL pointer dereference occurs when the application dereferences a pointer that it expects to be valid, but is NULL, typically causing a crash or exit.Impacted is availability.Upgrading to version 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch cf6a4c4ac7b6e3214f25df594c9689a62f1bb456/be5f3061a6f904e3674257879e71881ceee5b673/d7af6eee8cd60f55aa8c5fe2b91f11ec0c9a0f27/e26268ff1dcae5662c1b96c35f18cfa6ab73d9de is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-20036).(CVE-2025-38220)\n\nLinux kernel is the kernel used by Linux, the open source operating system of the Linux Foundation in the United States.\n There is a security vulnerability in Linux kernel. This vulnerability originates from improper processing of composing size in vivid drivers, which may lead to over-bounds writing.(CVE-2025-38226)\n\nA vulnerability, which was classified as problematic, was found in Linux Kernel up to 32700ecf8007e071d1ce4c78f65b85f46d05f32a (Operating System).The manipulation of the argument adxl_component_count with an unknown input leads to a unknown weakness. CWE is classifying the issue as CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.This is going to have an impact on confidentiality.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 80bf28fd623d97dd4f4825fbbe9d736cec2afba3/a6ed3a6edff09c1187cc6ade7f5967bca2376a13/bf6a8502a5f4ff6e4d135d795945cdade49ec8b0/e8530ed3c0769a4d8f79c212715ec1cf277787f8/3f5d0659000923735350da60ad710f8c804544fe/a13e8343ffcff27af1ff79597ff7ba241e6d9471/31ef6f7c9aee3be78d63789653e92350f2537f93/20d2d476b3ae18041be423671a8637ed5ffd6958 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38298)\n\nA vulnerability classified as critical was found in Linux Kernel up to 6.15.3 (Operating System).The CWE definition for the vulnerability is CWE-476. A NULL pointer dereference occurs when the application dereferences a pointer that it expects to be valid, but is NULL, typically causing a crash or exit.As an impact it is known to affect availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch 5c1a34ff5b0bfdfd2f9343aa9b08d25df618bac5/ec669e5bf409f16e464bfad75f0ba039a45de29a/43d5e3bb5f1dcd91e30238ea0b59a5f77063f84e/23361b479f2700c00960d3ae9cdc8ededa762d47/2e7c64d7a92c031d016f11c8e8cb05131ab7b75a/f78b38af3540b4875147b7b884ee11a27b3dbf4c/a377996d714afb8d4d5f4906336f78510039da29/af98b0157adf6504fade79b3e6cb260c4ff68e37 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38337)",
"id": "OESA-2025-1879",
"modified": "2026-08-06T11:08:57Z",
"published": "2025-07-25T11:08:57Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2025-1879"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-58237"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21703"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21829"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21894"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21904"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21920"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21926"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21938"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21960"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21961"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21975"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21997"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22004"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22050"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22053"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22054"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22055"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22058"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22062"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22103"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22111"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-23142"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-23155"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37757"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37786"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37787"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37788"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37790"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37797"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37817"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37820"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37823"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37824"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37864"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37865"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38061"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38075"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38079"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38103"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38115"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38117"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38120"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38124"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38127"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38157"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38219"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38220"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38226"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38298"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38337"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:A/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2024-58237",
"CVE-2025-21703",
"CVE-2025-21829",
"CVE-2025-21894",
"CVE-2025-21904",
"CVE-2025-21920",
"CVE-2025-21926",
"CVE-2025-21938",
"CVE-2025-21960",
"CVE-2025-21961",
"CVE-2025-21975",
"CVE-2025-21997",
"CVE-2025-22004",
"CVE-2025-22050",
"CVE-2025-22053",
"CVE-2025-22054",
"CVE-2025-22055",
"CVE-2025-22058",
"CVE-2025-22062",
"CVE-2025-22103",
"CVE-2025-22111",
"CVE-2025-23142",
"CVE-2025-23155",
"CVE-2025-37757",
"CVE-2025-37786",
"CVE-2025-37787",
"CVE-2025-37788",
"CVE-2025-37790",
"CVE-2025-37797",
"CVE-2025-37817",
"CVE-2025-37820",
"CVE-2025-37823",
"CVE-2025-37824",
"CVE-2025-37864",
"CVE-2025-37865",
"CVE-2025-38061",
"CVE-2025-38075",
"CVE-2025-38079",
"CVE-2025-38103",
"CVE-2025-38115",
"CVE-2025-38117",
"CVE-2025-38120",
"CVE-2025-38124",
"CVE-2025-38127",
"CVE-2025-38157",
"CVE-2025-38219",
"CVE-2025-38220",
"CVE-2025-38226",
"CVE-2025-38298",
"CVE-2025-38337"
]
}
OESA-2025-1880 (CVE-2024-58237)
Vulnerability from osv_openeuler – Published: 2025-07-25 11:08 – Updated: 2026-08-06 11:08 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
bpf: consider that tail calls invalidate packet pointers
Tail-called programs could execute any of the helpers that invalidate packet pointers. Hence, conservatively assume that each tail call invalidates packet pointers.
Making the change in bpf_helper_changes_pkt_data() automatically makes use of check_cfg() logic that computes 'changes_pkt_data' effect for global sub-programs, such that the following program could be rejected:
int tail_call(struct __sk_buff *sk)
{
bpf_tail_call_static(sk, &jmp_table, 0);
return 0;
}
SEC("tc")
int not_safe(struct __sk_buff *sk)
{
int *p = (void *)(long)sk->data;
... make p valid ...
tail_call(sk);
*p = 42; /* this is unsafe */
...
}
The tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that can invalidate packet pointers. Otherwise, it can't be freplaced with tailcall_freplace.c:entry_freplace() that does a tail call.(CVE-2024-58237)
In the Linux kernel, the following vulnerability has been resolved:
eth: bnxt: do not update checksum in bnxt_xdp_build_skb()
The bnxt_rx_pkt() updates ip_summed value at the end if checksum offload is enabled. When the XDP-MB program is attached and it returns XDP_PASS, the bnxt_xdp_build_skb() is called to update skb_shared_info. The main purpose of bnxt_xdp_build_skb() is to update skb_shared_info, but it updates ip_summed value too if checksum offload is enabled. This is actually duplicate work.
When the bnxt_rx_pkt() updates ip_summed value, it checks if ip_summed is CHECKSUM_NONE or not. It means that ip_summed should be CHECKSUM_NONE at this moment. But ip_summed may already be updated to CHECKSUM_UNNECESSARY in the XDP-MB-PASS path. So the by skb_checksum_none_assert() WARNS about it.
This is duplicate work and updating ip_summed in the bnxt_xdp_build_skb() is not needed.
Splat looks like: WARNING: CPU: 3 PID: 5782 at ./include/linux/skbuff.h:5155 bnxt_rx_pkt+0x479b/0x7610 [bnxt_en] Modules linked in: bnxt_re bnxt_en rdma_ucm rdma_cm iw_cm ib_cm ib_uverbs veth xt_nat xt_tcpudp xt_conntrack nft_chain_nat xt_MASQUERADE nf_] CPU: 3 UID: 0 PID: 5782 Comm: socat Tainted: G W 6.14.0-rc4+ #27 Tainted: [W]=WARN Hardware name: ASUS System Product Name/PRIME Z690-P D4, BIOS 0603 11/01/2021 RIP: 0010:bnxt_rx_pkt+0x479b/0x7610 [bnxt_en] Code: 54 24 0c 4c 89 f1 4c 89 ff c1 ea 1f ff d3 0f 1f 00 49 89 c6 48 85 c0 0f 84 4c e5 ff ff 48 89 c7 e8 ca 3d a0 c8 e9 8f f4 ff ff <0f> 0b f RSP: 0018:ffff88881ba09928 EFLAGS: 00010202 RAX: 0000000000000000 RBX: 00000000c7590303 RCX: 0000000000000000 RDX: 1ffff1104e7d1610 RSI: 0000000000000001 RDI: ffff8881c91300b8 RBP: ffff88881ba09b28 R08: ffff888273e8b0d0 R09: ffff888273e8b070 R10: ffff888273e8b010 R11: ffff888278b0f000 R12: ffff888273e8b080 R13: ffff8881c9130e00 R14: ffff8881505d3800 R15: ffff888273e8b000 FS: 00007f5a2e7be080(0000) GS:ffff88881ba00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007fff2e708ff8 CR3: 000000013e3b0000 CR4: 00000000007506f0 PKRU: 55555554 Call Trace: <IRQ> ? __warn+0xcd/0x2f0 ? bnxt_rx_pkt+0x479b/0x7610 ? report_bug+0x326/0x3c0 ? handle_bug+0x53/0xa0 ? exc_invalid_op+0x14/0x50 ? asm_exc_invalid_op+0x16/0x20 ? bnxt_rx_pkt+0x479b/0x7610 ? bnxt_rx_pkt+0x3e41/0x7610 ? __pfx_bnxt_rx_pkt+0x10/0x10 ? napi_complete_done+0x2cf/0x7d0 __bnxt_poll_work+0x4e8/0x1220 ? __pfxbnxtpoll_work+0x10/0x10 ? pfx_mark_lock.part.0+0x10/0x10 bnxt_poll_p5+0x36a/0xfa0 ? __pfx_bnxt_poll_p5+0x10/0x10 __napi_poll.constprop.0+0xa0/0x440 net_rx_action+0x899/0xd00 ...
Following ping.py patch adds xdp-mb-pass case. so ping.py is going to be able to reproduce this issue.(CVE-2025-21960)
In the Linux kernel, the following vulnerability has been resolved:
eth: bnxt: fix truesize for mb-xdp-pass case
When mb-xdp is set and return is XDP_PASS, packet is converted from xdp_buff to sk_buff with xdp_update_skb_shared_info() in bnxt_xdp_build_skb(). bnxt_xdp_build_skb() passes incorrect truesize argument to xdp_update_skb_shared_info(). The truesize is calculated as BNXT_RX_PAGE_SIZE * sinfo->nr_frags but the skb_shared_info was wiped by napi_build_skb() before. So it stores sinfo->nr_frags before bnxt_xdp_build_skb() and use it instead of getting skb_shared_info from xdp_get_shared_info_from_buff().
Splat looks like: ------------[ cut here ]------------ WARNING: CPU: 2 PID: 0 at net/core/skbuff.c:6072 skb_try_coalesce+0x504/0x590 Modules linked in: xt_nat xt_tcpudp veth af_packet xt_conntrack nft_chain_nat xt_MASQUERADE nf_conntrack_netlink xfrm_user xt_addrtype nft_coms CPU: 2 UID: 0 PID: 0 Comm: swapper/2 Not tainted 6.14.0-rc2+ #3 RIP: 0010:skb_try_coalesce+0x504/0x590 Code: 4b fd ff ff 49 8b 34 24 40 80 e6 40 0f 84 3d fd ff ff 49 8b 74 24 48 40 f6 c6 01 0f 84 2e fd ff ff 48 8d 4e ff e9 25 fd ff ff <0f> 0b e99 RSP: 0018:ffffb62c4120caa8 EFLAGS: 00010287 RAX: 0000000000000003 RBX: ffffb62c4120cb14 RCX: 0000000000000ec0 RDX: 0000000000001000 RSI: ffffa06e5d7dc000 RDI: 0000000000000003 RBP: ffffa06e5d7ddec0 R08: ffffa06e6120a800 R09: ffffa06e7a119900 R10: 0000000000002310 R11: ffffa06e5d7dcec0 R12: ffffe4360575f740 R13: ffffe43600000000 R14: 0000000000000002 R15: 0000000000000002 FS: 0000000000000000(0000) GS:ffffa0755f700000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007f147b76b0f8 CR3: 00000001615d4000 CR4: 00000000007506f0 PKRU: 55555554 Call Trace: <IRQ> ? __warn+0x84/0x130 ? skb_try_coalesce+0x504/0x590 ? report_bug+0x18a/0x1a0 ? handle_bug+0x53/0x90 ? exc_invalid_op+0x14/0x70 ? asm_exc_invalid_op+0x16/0x20 ? skb_try_coalesce+0x504/0x590 inet_frag_reasm_finish+0x11f/0x2e0 ip_defrag+0x37a/0x900 ip_local_deliver+0x51/0x120 ip_sublist_rcv_finish+0x64/0x70 ip_sublist_rcv+0x179/0x210 ip_list_rcv+0xf9/0x130
How to reproduce: <Node A> ip link set $interface1 xdp obj xdp_pass.o ip link set $interface1 mtu 9000 up ip a a 10.0.0.1/24 dev $interface1 <Node B> ip link set $interfac2 mtu 9000 up ip a a 10.0.0.2/24 dev $interface2 ping 10.0.0.1 -s 65000
Following ping.py patch adds xdp-mb-pass case. so ping.py is going to be able to reproduce this issue.(CVE-2025-21961)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5: handle errors in mlx5_chains_create_table()
In mlx5_chains_create_table(), the return value of mlx5_get_fdb_sub_ns() and mlx5_get_flow_namespace() must be checked to prevent NULL pointer dereferences. If either function fails, the function should log error message with mlx5_core_warn() and return error pointer.(CVE-2025-21975)
In the Linux kernel, the following vulnerability has been resolved:
xsk: fix an integer overflow in xp_create_and_assign_umem()
Since the i and pool->chunk_size variables are of type 'u32', their product can wrap around and then be cast to 'u64'. This can lead to two different XDP buffers pointing to the same memory area.
Found by InfoTeCS on behalf of Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2025-21997)
In the Linux kernel, the following vulnerability has been resolved:
net: atm: fix use after free in lec_send()
The ->send() operation frees skb so save the length before calling ->send() to avoid a use after free.(CVE-2025-22004)
In the Linux kernel, the following vulnerability has been resolved:
usbnet:fix NPE during rx_complete
Missing usbnet_going_away Check in Critical Path. The usb_submit_urb function lacks a usbnet_going_away validation, whereas __usbnet_queue_skb includes this check.
This inconsistency creates a race condition where: A URB request may succeed, but the corresponding SKB data fails to be queued.
Subsequent processes: (e.g., rx_complete → defer_bh → __skb_unlink(skb, list)) attempt to access skb->next, triggering a NULL pointer dereference (Kernel Panic).(CVE-2025-22050)
In the Linux kernel, the following vulnerability has been resolved:
net: ibmveth: make veth_pool_store stop hanging
v2: - Created a single error handling unlock and exit in veth_pool_store - Greatly expanded commit message with previous explanatory-only text
Summary: Use rtnl_mutex to synchronize veth_pool_store with itself, ibmveth_close and ibmveth_open, preventing multiple calls in a row to napi_disable.
Background: Two (or more) threads could call veth_pool_store through writing to /sys/devices/vio/30000002/pool/. You can do this easily with a little shell script. This causes a hang.
I configured LOCKDEP, compiled ibmveth.c with DEBUG, and built a new kernel. I ran this test again and saw:
Setting pool0/active to 0
Setting pool1/active to 1
[ 73.911067][ T4365] ibmveth 30000002 eth0: close starting
Setting pool1/active to 1
Setting pool1/active to 0
[ 73.911367][ T4366] ibmveth 30000002 eth0: close starting
[ 73.916056][ T4365] ibmveth 30000002 eth0: close complete
[ 73.916064][ T4365] ibmveth 30000002 eth0: open starting
[ 110.808564][ T712] systemd-journald[712]: Sent WATCHDOG=1 notification.
[ 230.808495][ T712] systemd-journald[712]: Sent WATCHDOG=1 notification.
[ 243.683786][ T123] INFO: task stress.sh:4365 blocked for more than 122 seconds.
[ 243.683827][ T123] Not tainted 6.14.0-01103-g2df0c02dab82-dirty #8
[ 243.683833][ T123] "echo 0 > /proc/sys/kernel/hung_task_timeout_secs" disables this message.
[ 243.683838][ T123] task:stress.sh state:D stack:28096 pid:4365 tgid:4365 ppid:4364 task_flags:0x400040 flags:0x00042000
[ 243.683852][ T123] Call Trace:
[ 243.683857][ T123] [c00000000c38f690] [0000000000000001] 0x1 (unreliable)
[ 243.683868][ T123] [c00000000c38f840] [c00000000001f908] __switch_to+0x318/0x4e0
[ 243.683878][ T123] [c00000000c38f8a0] [c000000001549a70] __schedule+0x500/0x12a0
[ 243.683888][ T123] [c00000000c38f9a0] [c00000000154a878] schedule+0x68/0x210
[ 243.683896][ T123] [c00000000c38f9d0] [c00000000154ac80] schedule_preempt_disabled+0x30/0x50
[ 243.683904][ T123] [c00000000c38fa00] [c00000000154dbb0] __mutex_lock+0x730/0x10f0
[ 243.683913][ T123] [c00000000c38fb10] [c000000001154d40] napi_enable+0x30/0x60
[ 243.683921][ T123] [c00000000c38fb40] [c000000000f4ae94] ibmveth_open+0x68/0x5dc
[ 243.683928][ T123] [c00000000c38fbe0] [c000000000f4aa20] veth_pool_store+0x220/0x270
[ 243.683936][ T123] [c00000000c38fc70] [c000000000826278] sysfs_kf_write+0x68/0xb0
[ 243.683944][ T123] [c00000000c38fcb0] [c0000000008240b8] kernfs_fop_write_iter+0x198/0x2d0
[ 243.683951][ T123] [c00000000c38fd00] [c00000000071b9ac] vfs_write+0x34c/0x650
[ 243.683958][ T123] [c00000000c38fdc0] [c00000000071bea8] ksys_write+0x88/0x150
[ 243.683966][ T123] [c00000000c38fe10] [c0000000000317f4] system_call_exception+0x124/0x340
[ 243.683973][ T123] [c00000000c38fe50] [c00000000000d05c] system_call_vectored_common+0x15c/0x2ec
...
[ 243.684087][ T123] Showing all locks held in the system:
[ 243.684095][ T123] 1 lock held by khungtaskd/123:
[ 243.684099][ T123] #0: c00000000278e370 (rcu_read_lock){....}-{1:2}, at: debug_show_all_locks+0x50/0x248
[ 243.684114][ T123] 4 locks held by stress.sh/4365:
[ 243.684119][ T123] #0: c00000003a4cd3f8 (sb_writers#3){.+.+}-{0:0}, at: ksys_write+0x88/0x150
[ 243.684132][ T123] #1: c000000041aea888 (&of->mutex#2){+.+.}-{3:3}, at: kernfs_fop_write_iter+0x154/0x2d0
[ 243.684143][ T123] #2: c0000000366fb9a8 (kn->active#64){.+.+}-{0:0}, at: kernfs_fop_write_iter+0x160/0x2d0
[ 243.684155][ T123] #3: c000000035ff4cb8 (&dev->lock){+.+.}-{3:3}, at: napi_enable+0x30/0x60
[ 243.684166][ T123] 5 locks held by stress.sh/4366:
[ 243.684170][ T123] #0: c00000003a4cd3f8 (sb_writers#3){.+.+}-{0:0}, at: ksys_write+0x88/0x150
[ 243.
---truncated---(CVE-2025-22053)
In the Linux kernel, the following vulnerability has been resolved:
arcnet: Add NULL check in com20020pci_probe()
devm_kasprintf() returns NULL when memory allocation fails. Currently, com20020pci_probe() does not check for this case, which results in a NULL pointer dereference.
Add NULL check after devm_kasprintf() to prevent this issue and ensure no resources are left allocated.(CVE-2025-22054)
In the Linux kernel, the following vulnerability has been resolved:
net: fix geneve_opt length integer overflow
struct geneve_opt uses 5 bit length for each single option, which means every vary size option should be smaller than 128 bytes.
However, all current related Netlink policies cannot promise this length condition and the attacker can exploit a exact 128-byte size option to fake a zero length option and confuse the parsing logic, further achieve heap out-of-bounds read.
One example crash log is like below:
[ 3.905425] ================================================================== [ 3.905925] BUG: KASAN: slab-out-of-bounds in nla_put+0xa9/0xe0 [ 3.906255] Read of size 124 at addr ffff888005f291cc by task poc/177 [ 3.906646] [ 3.906775] CPU: 0 PID: 177 Comm: poc-oob-read Not tainted 6.1.132 #1 [ 3.907131] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.16.0-0-gd239552ce722-prebuilt.qemu.org 04/01/2014 [ 3.907784] Call Trace: [ 3.907925] <TASK> [ 3.908048] dump_stack_lvl+0x44/0x5c [ 3.908258] print_report+0x184/0x4be [ 3.909151] kasan_report+0xc5/0x100 [ 3.909539] kasan_check_range+0xf3/0x1a0 [ 3.909794] memcpy+0x1f/0x60 [ 3.909968] nla_put+0xa9/0xe0 [ 3.910147] tunnel_key_dump+0x945/0xba0 [ 3.911536] tcf_action_dump_1+0x1c1/0x340 [ 3.912436] tcf_action_dump+0x101/0x180 [ 3.912689] tcf_exts_dump+0x164/0x1e0 [ 3.912905] fw_dump+0x18b/0x2d0 [ 3.913483] tcf_fill_node+0x2ee/0x460 [ 3.914778] tfilter_notify+0xf4/0x180 [ 3.915208] tc_new_tfilter+0xd51/0x10d0 [ 3.918615] rtnetlink_rcv_msg+0x4a2/0x560 [ 3.919118] netlink_rcv_skb+0xcd/0x200 [ 3.919787] netlink_unicast+0x395/0x530 [ 3.921032] netlink_sendmsg+0x3d0/0x6d0 [ 3.921987] __sock_sendmsg+0x99/0xa0 [ 3.922220] __sys_sendto+0x1b7/0x240 [ 3.922682] __x64_sys_sendto+0x72/0x90 [ 3.922906] do_syscall_64+0x5e/0x90 [ 3.923814] entry_SYSCALL_64_after_hwframe+0x6e/0xd8 [ 3.924122] RIP: 0033:0x7e83eab84407 [ 3.924331] Code: 48 89 fa 4c 89 df e8 38 aa 00 00 8b 93 08 03 00 00 59 5e 48 83 f8 fc 74 1a 5b c3 0f 1f 84 00 00 00 00 00 48 8b 44 24 10 0f 05 <5b> c3 0f 1f 80 00 00 00 00 83 e2 39 83 faf [ 3.925330] RSP: 002b:00007ffff505e370 EFLAGS: 00000202 ORIG_RAX: 000000000000002c [ 3.925752] RAX: ffffffffffffffda RBX: 00007e83eaafa740 RCX: 00007e83eab84407 [ 3.926173] RDX: 00000000000001a8 RSI: 00007ffff505e3c0 RDI: 0000000000000003 [ 3.926587] RBP: 00007ffff505f460 R08: 00007e83eace1000 R09: 000000000000000c [ 3.926977] R10: 0000000000000000 R11: 0000000000000202 R12: 00007ffff505f3c0 [ 3.927367] R13: 00007ffff505f5c8 R14: 00007e83ead1b000 R15: 00005d4fbbe6dcb8
Fix these issues by enforing correct length condition in related policies.(CVE-2025-22055)
In the Linux kernel, the following vulnerability has been resolved:
udp: Fix memory accounting leak.
Matt Dowling reported a weird UDP memory usage issue.
Under normal operation, the UDP memory usage reported in /proc/net/sockstat remains close to zero. However, it occasionally spiked to 524,288 pages and never dropped. Moreover, the value doubled when the application was terminated. Finally, it caused intermittent packet drops.
We can reproduce the issue with the script below [0]:
-
/proc/net/sockstat reports 0 pages
cat /proc/net/sockstat | grep UDP:
UDP: inuse 1 mem 0
-
Run the script till the report reaches 524,288
python3 test.py & sleep 5
cat /proc/net/sockstat | grep UDP:
UDP: inuse 3 mem 524288 <-- (INT_MAX + 1) >> PAGE_SHIFT
-
Kill the socket and confirm the number never drops
pkill python3 && sleep 5
cat /proc/net/sockstat | grep UDP:
UDP: inuse 1 mem 524288
-
(necessary since v6.0) Trigger proto_memory_pcpu_drain()
python3 test.py & sleep 1 && pkill python3
-
The number doubles
cat /proc/net/sockstat | grep UDP:
UDP: inuse 1 mem 1048577
The application set INT_MAX to SO_RCVBUF, which triggered an integer overflow in udp_rmem_release().
When a socket is close()d, udp_destruct_common() purges its receive queue and sums up skb->truesize in the queue. This total is calculated and stored in a local unsigned integer variable.
The total size is then passed to udp_rmem_release() to adjust memory accounting. However, because the function takes a signed integer argument, the total size can wrap around, causing an overflow.
Then, the released amount is calculated as follows:
1) Add size to sk->sk_forward_alloc. 2) Round down sk->sk_forward_alloc to the nearest lower multiple of PAGE_SIZE and assign it to amount. 3) Subtract amount from sk->sk_forward_alloc. 4) Pass amount >> PAGE_SHIFT to __sk_mem_reduce_allocated().
When the issue occurred, the total in udp_destruct_common() was 2147484480 (INT_MAX + 833), which was cast to -2147482816 in udp_rmem_release().
At 1) sk->sk_forward_alloc is changed from 3264 to -2147479552, and 2) sets -2147479552 to amount. 3) reverts the wraparound, so we don't see a warning in inet_sock_destruct(). However, udp_memory_allocated ends up doubling at 4).
Since commit 3cd3399dd7a8 ("net: implement per-cpu reserves for memory_allocated"), memory usage no longer doubles immediately after a socket is close()d because __sk_mem_reduce_allocated() caches the amount in udp_memory_per_cpu_fw_alloc. However, the next time a UDP socket receives a packet, the subtraction takes effect, causing UDP memory usage to double.
This issue makes further memory allocation fail once the socket's sk->sk_rmem_alloc exceeds net.ipv4.udp_rmem_min, resulting in packet drops.
To prevent this issue, let's use unsigned int for the calculation and call sk_forward_alloc_add() only once for the small delta.
Note that first_packet_length() also potentially has the same problem.
[0]: from socket import *
SO_RCVBUFFORCE = 33 INT_MAX = (2 ** 31) - 1
s = socket(AF_INET, SOCK_DGRAM) s.bind(('', 0)) s.setsockopt(SOL_SOCKET, SO_RCVBUFFORCE, INT_MAX)
c = socket(AF_INET, SOCK_DGRAM) c.connect(s.getsockname())
data = b'a' * 100
while True: c.send(data)(CVE-2025-22058)
In the Linux kernel, the following vulnerability has been resolved:
sctp: add mutual exclusion in proc_sctp_do_udp_port()
We must serialize calls to sctp_udp_sock_stop() and sctp_udp_sock_start() or risk a crash as syzbot reported:
Oops: general protection fault, probably for non-canonical address 0xdffffc000000000d: 0000 [#1] SMP KASAN PTI KASAN: null-ptr-deref in range [0x0000000000000068-0x000000000000006f] CPU: 1 UID: 0 PID: 6551 Comm: syz.1.44 Not tainted 6.14.0-syzkaller-g7f2ff7b62617 #0 PREEMPT(full) Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/12/2025 RIP: 0010:kernel_sock_shutdown+0x47/0x70 net/socket.c:3653 Call Trace: <TASK> udp_tunnel_sock_release+0x68/0x80 net/ipv4/udp_tunnel_core.c:181 sctp_udp_sock_stop+0x71/0x160 net/sctp/protocol.c:930 proc_sctp_do_udp_port+0x264/0x450 net/sctp/sysctl.c:553 proc_sys_call_handler+0x3d0/0x5b0 fs/proc/proc_sysctl.c:601 iter_file_splice_write+0x91c/0x1150 fs/splice.c:738 do_splice_from fs/splice.c:935 [inline] direct_splice_actor+0x18f/0x6c0 fs/splice.c:1158 splice_direct_to_actor+0x342/0xa30 fs/splice.c:1102 do_splice_direct_actor fs/splice.c:1201 [inline] do_splice_direct+0x174/0x240 fs/splice.c:1227 do_sendfile+0xafd/0xe50 fs/read_write.c:1368 __do_sys_sendfile64 fs/read_write.c:1429 [inline] __se_sys_sendfile64 fs/read_write.c:1415 [inline] __x64_sys_sendfile64+0x1d8/0x220 fs/read_write.c:1415 do_syscall_x64 arch/x86/entry/syscall_64.c:63 inline
In the Linux kernel, the following vulnerability has been resolved:
net: fix NULL pointer dereference in l3mdev_l3_rcv
When delete l3s ipvlan:
ip link del link eth0 ipvlan1 type ipvlan mode l3s
This may cause a null pointer dereference:
Call trace:
ip_rcv_finish+0x48/0xd0
ip_rcv+0x5c/0x100
__netif_receive_skb_one_core+0x64/0xb0
__netif_receive_skb+0x20/0x80
process_backlog+0xb4/0x204
napi_poll+0xe8/0x294
net_rx_action+0xd8/0x22c
__do_softirq+0x12c/0x354
This is because l3mdev_l3_rcv() visit dev->l3mdev_ops after ipvlan_l3s_unregister() assign the dev->l3mdev_ops to NULL. The process like this:
(CPU1) | (CPU2)
l3mdev_l3_rcv() |
check dev->priv_flags: |
master = skb->dev; |
|
| ipvlan_l3s_unregister()
| set dev->priv_flags
| dev->l3mdev_ops = NULL;
|
visit master->l3mdev_ops |
To avoid this by do not set dev->l3mdev_ops when unregister l3s ipvlan.(CVE-2025-22103)
In the Linux kernel, the following vulnerability has been resolved:
net: Remove RTNL dance for SIOCBRADDIF and SIOCBRDELIF.
SIOCBRDELIF is passed to dev_ioctl() first and later forwarded to br_ioctl_call(), which causes unnecessary RTNL dance and the splat below [0] under RTNL pressure.
Let's say Thread A is trying to detach a device from a bridge and Thread B is trying to remove the bridge.
In dev_ioctl(), Thread A bumps the bridge device's refcnt by netdev_hold() and releases RTNL because the following br_ioctl_call() also re-acquires RTNL.
In the race window, Thread B could acquire RTNL and try to remove the bridge device. Then, rtnl_unlock() by Thread B will release RTNL and wait for netdev_put() by Thread A.
Thread A, however, must hold RTNL after the unlock in dev_ifsioc(), which may take long under RTNL pressure, resulting in the splat by Thread B.
Thread A (SIOCBRDELIF) Thread B (SIOCBRDELBR)
---------------------- ----------------------
sock_ioctl sock_ioctl
- sock_do_ioctl- br_ioctl_call
- dev_ioctl- br_ioctl_stub
|- rtnl_lock |
|- dev_ifsioc '
' |- dev = __dev_get_by_name(...)
|- netdev_hold(dev, ...) .
/ |- rtnl_unlock ------. |
| |- br_ioctl_call ---> |- rtnl_lock
Race | |- br_ioctl_stub |- br_del_bridge
Window | | | |- dev = __dev_get_by_name(...)
| | | May take long | - br_dev_delete(dev, ...)
| | | under RTNL pressure |- unregister_netdevice_queue(dev, ...)
| | | | - rtnl_unlock
\ | |- rtnl_lock <-'- netdev_run_todo
| |- ... - netdev_run_todo
|- rtnl_unlock |- __rtnl_unlock
| |- netdev_wait_allrefs_any
|- netdev_put(dev, ...) <----------------'
Wait refcnt decrement
and log splat below
To avoid blocking SIOCBRDELBR unnecessarily, let's not call dev_ioctl() for SIOCBRADDIF and SIOCBRDELIF.
In the dev_ioctl() path, we do the following:
- Copy struct ifreq by get_user_ifreq in sock_do_ioctl()
- Check CAP_NET_ADMIN in dev_ioctl()
- Call dev_load() in dev_ioctl()
-
Fetch the master dev from ifr.ifr_name in dev_ifsioc()
-
can be done by request_module() in br_ioctl_call(), so we move 1., 2., and 4. to br_ioctl_stub().
Note that 2. is also checked later in add_del_if(), but it's better performed before RTNL.
SIOCBRADDIF and SIOCBRDELIF have been processed in dev_ioctl() since the pre-git era, and there seems to be no specific reason to process them there.
[0]: unregister_netdevice: waiting for wpan3 to become free. Usage count = 2 ref_tracker: wpan3@ffff8880662d8608 has 1/1 users at __netdev_tracker_alloc include/linux/netdevice.h:4282 [inline] netdev_hold include/linux/netdevice.h:4311 [inline] dev_ifsioc+0xc6a/0x1160 net/core/dev_ioctl.c:624 dev_ioctl+0x255/0x10c0 net/core/dev_ioctl.c:826 sock_do_ioctl+0x1ca/0x260 net/socket.c:1213 sock_ioctl+0x23a/0x6c0 net/socket.c:1318 vfs_ioctl fs/ioctl.c:51 [inline] __do_sys_ioctl fs/ioctl.c:906 [inline] __se_sys_ioctl fs/ioctl.c:892 [inline] __x64_sys_ioctl+0x1a4/0x210 fs/ioctl.c:892 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcb/0x250 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2025-22111)
In the Linux kernel, the following vulnerability has been resolved:
sctp: detect and prevent references to a freed transport in sendmsg
sctp_sendmsg() re-uses associations and transports when possible by doing a lookup based on the socket endpoint and the message destination address, and then sctp_sendmsg_to_asoc() sets the selected transport in all the message chunks to be sent.
There's a possible race condition if another thread triggers the removal of that selected transport, for instance, by explicitly unbinding an address with setsockopt(SCTP_SOCKOPT_BINDX_REM), after the chunks have been set up and before the message is sent. This can happen if the send buffer is full, during the period when the sender thread temporarily releases the socket lock in sctp_wait_for_sndbuf().
This causes the access to the transport data in sctp_outq_select_transport(), when the association outqueue is flushed, to result in a use-after-free read.
This change avoids this scenario by having sctp_transport_free() signal the freeing of the transport, tagging it as "dead". In order to do this, the patch restores the "dead" bit in struct sctp_transport, which was removed in commit 47faa1e4c50e ("sctp: remove the dead field of sctp_transport").
Then, in the scenario where the sender thread has released the socket lock in sctp_wait_for_sndbuf(), the bit is checked again after re-acquiring the socket lock to detect the deletion. This is done while holding a reference to the transport to prevent it from being freed in the process.
If the transport was deleted while the socket lock was relinquished, sctp_sendmsg_to_asoc() will return -EAGAIN to let userspace retry the send.
The bug was found by a private syzbot instance (see the error report [1] and the C reproducer that triggers it [2]).(CVE-2025-23142)
In the Linux kernel, the following vulnerability has been resolved:
net: stmmac: Fix accessing freed irq affinity_hint
The cpumask should not be a local variable, since its pointer is saved to irq_desc and may be accessed from procfs. To fix it, use the persistent mask cpumask_of(cpu#).(CVE-2025-23155)
In the Linux kernel, the following vulnerability has been resolved:
tipc: fix memory leak in tipc_link_xmit
In case the backlog transmit queue for system-importance messages is overloaded, tipc_link_xmit() returns -ENOBUFS but the skb list is not purged. This leads to memory leak and failure when a skb is allocated.
This commit fixes this issue by purging the skb list before tipc_link_xmit() returns.(CVE-2025-37757)
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: free routing table on probe failure
If complete = true in dsa_tree_setup(), it means that we are the last switch of the tree which is successfully probing, and we should be setting up all switches from our probe path.
After "complete" becomes true, dsa_tree_setup_cpu_ports() or any subsequent function may fail. If that happens, the entire tree setup is in limbo: the first N-1 switches have successfully finished probing (doing nothing but having allocated persistent memory in the tree's dst->ports, and maybe dst->rtable), and switch N failed to probe, ending the tree setup process before anything is tangible from the user's PoV.
If switch N fails to probe, its memory (ports) will be freed and removed from dst->ports. However, the dst->rtable elements pointing to its ports, as created by dsa_link_touch(), will remain there, and will lead to use-after-free if dereferenced.
If dsa_tree_setup_switches() returns -EPROBE_DEFER, which is entirely possible because that is where ds->ops->setup() is, we get a kasan report like this:
================================================================== BUG: KASAN: slab-use-after-free in mv88e6xxx_setup_upstream_port+0x240/0x568 Read of size 8 at addr ffff000004f56020 by task kworker/u8:3/42
Call trace: __asan_report_load8_noabort+0x20/0x30 mv88e6xxx_setup_upstream_port+0x240/0x568 mv88e6xxx_setup+0xebc/0x1eb0 dsa_register_switch+0x1af4/0x2ae0 mv88e6xxx_register_switch+0x1b8/0x2a8 mv88e6xxx_probe+0xc4c/0xf60 mdio_probe+0x78/0xb8 really_probe+0x2b8/0x5a8 __driver_probe_device+0x164/0x298 driver_probe_device+0x78/0x258 __device_attach_driver+0x274/0x350
Allocated by task 42: __kasan_kmalloc+0x84/0xa0 __kmalloc_cache_noprof+0x298/0x490 dsa_switch_touch_ports+0x174/0x3d8 dsa_register_switch+0x800/0x2ae0 mv88e6xxx_register_switch+0x1b8/0x2a8 mv88e6xxx_probe+0xc4c/0xf60 mdio_probe+0x78/0xb8 really_probe+0x2b8/0x5a8 __driver_probe_device+0x164/0x298 driver_probe_device+0x78/0x258 __device_attach_driver+0x274/0x350
Freed by task 42: __kasan_slab_free+0x48/0x68 kfree+0x138/0x418 dsa_register_switch+0x2694/0x2ae0 mv88e6xxx_register_switch+0x1b8/0x2a8 mv88e6xxx_probe+0xc4c/0xf60 mdio_probe+0x78/0xb8 really_probe+0x2b8/0x5a8 __driver_probe_device+0x164/0x298 driver_probe_device+0x78/0x258 __device_attach_driver+0x274/0x350
The simplest way to fix the bug is to delete the routing table in its entirety. dsa_tree_setup_routing_table() has no problem in regenerating it even if we deleted links between ports other than those of switch N, because dsa_link_touch() first checks whether the port pair already exists in dst->rtable, allocating if not.
The deletion of the routing table in its entirety already exists in dsa_tree_teardown(), so refactor that into a function that can also be called from the tree setup error path.
In my analysis of the commit to blame, it is the one which added dsa_link elements to dst->rtable. Prior to that, each switch had its own ds->rtable which is freed when the switch fails to probe. But the tree is potentially persistent memory.(CVE-2025-37786)
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: mv88e6xxx: avoid unregistering devlink regions which were never registered
Russell King reports that a system with mv88e6xxx dereferences a NULL pointer when unbinding this driver: https://lore.kernel.org/netdev/(CVE-2025-37787)
In the Linux kernel, the following vulnerability has been resolved:
cxgb4: fix memory leak in cxgb4_init_ethtool_filters() error path
In the for loop used to allocate the loc_array and bmap for each port, a memory leak is possible when the allocation for loc_array succeeds, but the allocation for bmap fails. This is because when the control flow goes to the label free_eth_finfo, only the allocations starting from (i-1)th iteration are freed.
Fix that by freeing the loc_array in the bmap allocation error path.(CVE-2025-37788)
In the Linux kernel, the following vulnerability has been resolved:
net: mctp: Set SOCK_RCU_FREE
Bind lookup runs under RCU, so ensure that a socket doesn't go away in the middle of a lookup.(CVE-2025-37790)
In the Linux kernel, the following vulnerability has been resolved:
net_sched: hfsc: Fix a UAF vulnerability in class handling
This patch fixes a Use-After-Free vulnerability in the HFSC qdisc class handling. The issue occurs due to a time-of-check/time-of-use condition in hfsc_change_class() when working with certain child qdiscs like netem or codel.
The vulnerability works as follows: 1. hfsc_change_class() checks if a class has packets (q.qlen != 0) 2. It then calls qdisc_peek_len(), which for certain qdiscs (e.g., codel, netem) might drop packets and empty the queue 3. The code continues assuming the queue is still non-empty, adding the class to vttree 4. This breaks HFSC scheduler assumptions that only non-empty classes are in vttree 5. Later, when the class is destroyed, this can lead to a Use-After-Free
The fix adds a second queue length check after qdisc_peek_len() to verify the queue wasn't emptied.(CVE-2025-37797)
In the Linux kernel, the following vulnerability has been resolved:
mcb: fix a double free bug in chameleon_parse_gdd()
In chameleon_parse_gdd(), if mcb_device_register() fails, 'mdev' would be released in mcb_device_register() via put_device(). Thus, goto 'err' label and free 'mdev' again causes a double free. Just return if mcb_device_register() fails.(CVE-2025-37817)
In the Linux kernel, the following vulnerability has been resolved:
xen-netfront: handle NULL returned by xdp_convert_buff_to_frame()
The function xdp_convert_buff_to_frame() may return NULL if it fails to correctly convert the XDP buffer into an XDP frame due to memory constraints, internal errors, or invalid data. Failing to check for NULL may lead to a NULL pointer dereference if the result is used later in processing, potentially causing crashes, data corruption, or undefined behavior.
On XDP redirect failure, the associated page must be released explicitly if it was previously retained via get_page(). Failing to do so may result in a memory leak, as the pages reference count is not decremented.(CVE-2025-37820)
In the Linux kernel, the following vulnerability has been resolved:
net_sched: hfsc: Fix a potential UAF in hfsc_dequeue() too
Similarly to the previous patch, we need to safe guard hfsc_dequeue() too. But for this one, we don't have a reliable reproducer.(CVE-2025-37823)
In the Linux kernel, the following vulnerability has been resolved:
tipc: fix NULL pointer dereference in tipc_mon_reinit_self()
syzbot reported:
tipc: Node number set to 1055423674 Oops: general protection fault, probably for non-canonical address 0xdffffc0000000000: 0000 [#1] SMP KASAN NOPTI KASAN: null-ptr-deref in range [0x0000000000000000-0x0000000000000007] CPU: 3 UID: 0 PID: 6017 Comm: kworker/3:5 Not tainted 6.15.0-rc1-syzkaller-00246-g900241a5cc15 #0 PREEMPT(full) Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-debian-1.16.3-2~bpo12+1 04/01/2014 Workqueue: events tipc_net_finalize_work RIP: 0010:tipc_mon_reinit_self+0x11c/0x210 net/tipc/monitor.c:719 ... RSP: 0018:ffffc9000356fb68 EFLAGS: 00010246 RAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000003ee87cba RDX: 0000000000000000 RSI: ffffffff8dbc56a7 RDI: ffff88804c2cc010 RBP: dffffc0000000000 R08: 0000000000000001 R09: 0000000000000000 R10: 0000000000000001 R11: 0000000000000000 R12: 0000000000000007 R13: fffffbfff2111097 R14: ffff88804ead8000 R15: ffff88804ead9010 FS: 0000000000000000(0000) GS:ffff888097ab9000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00000000f720eb00 CR3: 000000000e182000 CR4: 0000000000352ef0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> tipc_net_finalize+0x10b/0x180 net/tipc/net.c:140 process_one_work+0x9cc/0x1b70 kernel/workqueue.c:3238 process_scheduled_works kernel/workqueue.c:3319 [inline] worker_thread+0x6c8/0xf10 kernel/workqueue.c:3400 kthread+0x3c2/0x780 kernel/kthread.c:464 ret_from_fork+0x45/0x80 arch/x86/kernel/process.c:153 ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:245 </TASK> ... RIP: 0010:tipc_mon_reinit_self+0x11c/0x210 net/tipc/monitor.c:719 ... RSP: 0018:ffffc9000356fb68 EFLAGS: 00010246 RAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000003ee87cba RDX: 0000000000000000 RSI: ffffffff8dbc56a7 RDI: ffff88804c2cc010 RBP: dffffc0000000000 R08: 0000000000000001 R09: 0000000000000000 R10: 0000000000000001 R11: 0000000000000000 R12: 0000000000000007 R13: fffffbfff2111097 R14: ffff88804ead8000 R15: ffff88804ead9010 FS: 0000000000000000(0000) GS:ffff888097ab9000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00000000f720eb00 CR3: 000000000e182000 CR4: 0000000000352ef0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400
There is a racing condition between workqueue created when enabling bearer and another thread created when disabling bearer right after that as follow:
| enabling_bearer | disabling_bearer |
|---|---|
| tipc_disc_timeout() | |
| { | bearer_disable() |
| ... | { |
| schedule_work(&tn->work); | tipc_mon_delete() |
| ... | { |
| } | ... |
| write_lock_bh(&mon->lock); | |
| mon->self = NULL; | |
| write_unlock_bh(&mon->lock); | |
| ... | |
| } | |
| tipc_net_finalize_work() | } |
| { | |
| ... | |
| tipc_net_finalize() | |
| { | |
| ... | |
| tipc_mon_reinit_self() | |
| { | |
| ... | |
| write_lock_bh(&mon->lock); | |
| mon->self->addr = tipc_own_addr(net); | |
| write_unlock_bh(&mon->lock); | |
| ... | |
| ---truncated---(CVE-2025-37824) |
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: clean up FDB, MDB, VLAN entries on unbind
As explained in many places such as commit b117e1e8a86d ("net: dsa: delete dsa_legacy_fdb_add and dsa_legacy_fdb_del"), DSA is written given the assumption that higher layers have balanced additions/deletions. As such, it only makes sense to be extremely vocal when those assumptions are violated and the driver unbinds with entries still present.
But Ido Schimmel points out a very simple situation where that is wrong: https://lore.kernel.org/netdev/ZDazSM5UsPPjQuKr@shredder/ (also briefly discussed by me in the aforementioned commit).
Basically, while the bridge bypass operations are not something that DSA explicitly documents, and for the majority of DSA drivers this API simply causes them to go to promiscuous mode, that isn't the case for all drivers. Some have the necessary requirements for bridge bypass operations to do something useful - see dsa_switch_supports_uc_filtering().
Although in tools/testing/selftests/net/forwarding/local_termination.sh, we made an effort to popularize better mechanisms to manage address filters on DSA interfaces from user space - namely macvlan for unicast, and setsockopt(IP_ADD_MEMBERSHIP) - through mtools - for multicast, the fact is that 'bridge fdb add ... self static local' also exists as kernel UAPI, and might be useful to someone, even if only for a quick hack.
It seems counter-productive to block that path by implementing shim .ndo_fdb_add and .ndo_fdb_del operations which just return -EOPNOTSUPP in order to prevent the ndo_dflt_fdb_add() and ndo_dflt_fdb_del() from running, although we could do that.
Accepting that cleanup is necessary seems to be the only option. Especially since we appear to be coming back at this from a different angle as well. Russell King is noticing that the WARN_ON() triggers even for VLANs: https://lore.kernel.org/netdev/(CVE-2025-37864)
In the Linux kernel, the following vulnerability has been resolved:
net: dsa: mv88e6xxx: fix -ENOENT when deleting VLANs and MST is unsupported
Russell King reports that on the ZII dev rev B, deleting a bridge VLAN from a user port fails with -ENOENT: https://lore.kernel.org/netdev/(CVE-2025-37865)
In the Linux kernel, the following vulnerability has been resolved:
net: pktgen: fix access outside of user given buffer in pktgen_thread_write()
Honour the user given buffer size for the strn_len() calls (otherwise strn_len() will access memory outside of the user given buffer).(CVE-2025-38061)
In the Linux kernel, the following vulnerability has been resolved:
scsi: target: iscsi: Fix timeout on deleted connection
NOPIN response timer may expire on a deleted connection and crash with such logs:
Did not receive response to NOPIN on CID: 0, failing connection for I_T Nexus (null),i,0x00023d000125,iqn.2017-01.com.iscsi.target,t,0x3d
BUG: Kernel NULL pointer dereference on read at 0x00000000 NIP strlcpy+0x8/0xb0 LR iscsit_fill_cxn_timeout_err_stats+0x5c/0xc0 [iscsi_target_mod] Call Trace: iscsit_handle_nopin_response_timeout+0xfc/0x120 [iscsi_target_mod] call_timer_fn+0x58/0x1f0 run_timer_softirq+0x740/0x860 __do_softirq+0x16c/0x420 irq_exit+0x188/0x1c0 timer_interrupt+0x184/0x410
That is because nopin response timer may be re-started on nopin timer expiration.
Stop nopin timer before stopping the nopin response timer to be sure that no one of them will be re-started.(CVE-2025-38075)
In the Linux kernel, the following vulnerability has been resolved:
crypto: algif_hash - fix double free in hash_accept
If accept(2) is called on socket type algif_hash with MSG_MORE flag set and crypto_ahash_import fails, sk2 is freed. However, it is also freed in af_alg_release, leading to slab-use-after-free error.(CVE-2025-38079)
A vulnerability was found in Linux Kernel (Operating System) and classified as problematic.The manipulation of the argument bNumDescriptors with an unknown input leads to a unknown weakness. Using CWE to declare the problem leads to CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.Impacted is confidentiality.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 7a6d6b68db128da2078ccd9a751dfa3f75c9cf5b/41827a2dbdd7880df9881506dee13bc88d4230bb/1df80d748f984290c895e843401824215dcfbfb0/a8f842534807985d3a676006d140541b87044345/4fa7831cf0ac71a0a345369d1a6084f2b096e55e/74388368927e9c52a69524af5bbd6c55eb4690de/485e1b741eb838cbe1d6b0e81e5ab62ae6c095cf/fe7f7ac8e0c708446ff017453add769ffc15deed is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38103)
A vulnerability was found in Linux Kernel up to 6.16-rc1 (Operating System). It has been classified as critical.CWE is classifying the issue as CWE-404. The product does not release or incorrectly releases a resource before it is made available for re-use.This is going to have an impact on availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc2 eliminates this vulnerability. Applying the patch c337efb20d6d9f9bbb4746f6b119917af5c886dc/b44f791f27b14c9eb6b907fbe51f2ba8bec32085/5814a7fc3abb41f63f2d44c9d3ff9d4e62965b72/9c19498bdd7cb9d854bd3c54260f71cf7408495e/b4e9bab6011b9559b7c157b16b91ae46d4d8c533/d1bc80da75c789f2f6830df89d91fb2f7a509943/82448d4dcd8406dec688632a405fdcf7f170ec69/82ffbe7776d0ac084031f114167712269bf3d832 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38115)
A vulnerability, which was classified as critical, has been found in Linux Kernel up to 6.6.93/6.12.33/6.15.2/6.16-rc1 (Operating System).Using CWE to declare the problem leads to CWE-416. Referencing memory after it has been freed can cause a program to crash, use unexpected values, or execute code.Impacted is confidentiality, integrity, and availability.Upgrading to version 6.6.94, 6.12.34, 6.15.3 or 6.16-rc2 eliminates this vulnerability. Applying the patch bdd56875c6926d8009914f427df71797693e90d4/4e83f2dbb2bf677e614109df24426c4dded472d4/d7882db79135c829a922daf3571f33ea1e056ae3/6fe26f694c824b8a4dbf50c635bee1302e3f099c is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38117)
A vulnerability, which was classified as problematic, was found in Linux Kernel up to 8058c88ac0df21239daee54b5934d5c80ca9685f (Operating System).CWE is classifying the issue as CWE-401. The product does not sufficiently track and release allocated memory after it has been used, which slowly consumes remaining memory.This is going to have an impact on confidentiality.Upgrading to version 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch b5ad58285f9217d68cd5ea2ad86ce254a3fe7c4d/90bc7f5a244aadee4292b28098b7c98aadd4b3aa/39bab2d3517b5b50c609b4f8c66129bf619fffa0/251496ce1728c9fd47bd2b20a7b21b20b9a020ca/8068e1e42b46518ce680dc6470bcd710efc3fa0a/ea77c397bff8b6d59f6d83dae1425b08f465e8b5 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38120)
A vulnerability classified as problematic has been found in Linux Kernel (Operating System).This is going to have an impact on confidentiality, integrity, and availability.Upgrading to version 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 0e65f38bd1aa14ea86e221b7bb814d38278d86c3/85eef1748c024da1a191aed56b30a3a65958c50c/4399f59a9467a324ed46657555f0e1f209a14acb/a04302867094bdc6efac1b598370fc47cf3f2388/3382a1ed7f778db841063f5d7e317ac55f9e7f72 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38124)
A vulnerability, which was classified as problematic, has been found in Linux Kernel up to 6.6.93/6.12.33/6.15.2 (Operating System).Using CWE to declare the problem leads to CWE-371.Impacted is confidentiality, integrity, and availability.Upgrading to version 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 1d3c5d0dec6797eca3a861dab0816fa9505d9c3e/276849954d7cbe6eec827b21fe2df43f9bf07011/0e061abaad1498c5b76c10c594d4359ceb6b9145/0153f36041b8e52019ebfa8629c13bf8f9b0a951 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38127)
A vulnerability has been found in Linux Kernel up to 6.15.2 (Operating System) and classified as problematic.The CWE definition for the vulnerability is CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.As an impact it is known to affect confidentiality, integrity, and availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch e5ce9df1d68094d37360dbd9b09289d42fa21e54/7ee3fb6258da8c890a51b514f60d7570dc703605/40471b23147c86ea3ed97faee79937c618250bd0/5482ef9875eaa43f0435e14570e1193823de857e/ee5ee646385f5846dcbc881389f3c44a197c402a/5a85c21f812e02cb00ca07007d88acdd42d08c46/ac4e317a95a1092b5da5b9918b7118759342641c is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-19787).(CVE-2025-38157)
A vulnerability classified as problematic was found in Linux Kernel up to 6.15.3 (Operating System).As an impact it is known to affect confidentiality, integrity, and availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch d9a55869d8237e677ddaa18b0f58586364cfbc1c/1f6332872374b7f482fc4ad865f9422fedb587fc/fbfe8446cd3274b9e367f5708d94574230a44409/5018d035530b6fbfad33eeb1dd1bc87da419a276/a87cbcc909ccfd394d4936a94663f586453d0961/aaa644e7ffff02e12c89cbce4753bc0b6f23ff87/d14cbed4baccd712447fb3f9c011f008b56b2097/42cb74a92adaf88061039601ddf7c874f58b554e is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-20037).(CVE-2025-38219)
A vulnerability, which was classified as critical, has been found in Linux Kernel up to 6.6.94/6.12.34/6.15.3 (Operating System).Using CWE to declare the problem leads to CWE-476. A NULL pointer dereference occurs when the application dereferences a pointer that it expects to be valid, but is NULL, typically causing a crash or exit.Impacted is availability.Upgrading to version 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch cf6a4c4ac7b6e3214f25df594c9689a62f1bb456/be5f3061a6f904e3674257879e71881ceee5b673/d7af6eee8cd60f55aa8c5fe2b91f11ec0c9a0f27/e26268ff1dcae5662c1b96c35f18cfa6ab73d9de is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-20036).(CVE-2025-38220)
Linux kernel is the kernel used by Linux, the open source operating system of the Linux Foundation in the United States. There is a security vulnerability in Linux kernel. This vulnerability originates from improper processing of composing size in vivid drivers, which may lead to over-bounds writing.(CVE-2025-38226)
A vulnerability, which was classified as problematic, was found in Linux Kernel up to 32700ecf8007e071d1ce4c78f65b85f46d05f32a (Operating System).The manipulation of the argument adxl_component_count with an unknown input leads to a unknown weakness. CWE is classifying the issue as CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.This is going to have an impact on confidentiality.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 80bf28fd623d97dd4f4825fbbe9d736cec2afba3/a6ed3a6edff09c1187cc6ade7f5967bca2376a13/bf6a8502a5f4ff6e4d135d795945cdade49ec8b0/e8530ed3c0769a4d8f79c212715ec1cf277787f8/3f5d0659000923735350da60ad710f8c804544fe/a13e8343ffcff27af1ff79597ff7ba241e6d9471/31ef6f7c9aee3be78d63789653e92350f2537f93/20d2d476b3ae18041be423671a8637ed5ffd6958 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38298)
A vulnerability classified as critical was found in Linux Kernel up to 6.15.3 (Operating System).The CWE definition for the vulnerability is CWE-476. A NULL pointer dereference occurs when the application dereferences a pointer that it expects to be valid, but is NULL, typically causing a crash or exit.As an impact it is known to affect availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch 5c1a34ff5b0bfdfd2f9343aa9b08d25df618bac5/ec669e5bf409f16e464bfad75f0ba039a45de29a/43d5e3bb5f1dcd91e30238ea0b59a5f77063f84e/23361b479f2700c00960d3ae9cdc8ededa762d47/2e7c64d7a92c031d016f11c8e8cb05131ab7b75a/f78b38af3540b4875147b7b884ee11a27b3dbf4c/a377996d714afb8d4d5f4906336f78510039da29/af98b0157adf6504fade79b3e6cb260c4ff68e37 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38337)
| URL | Type | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"bpftool-debuginfo-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"kernel-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"kernel-debuginfo-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"kernel-debugsource-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"kernel-devel-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"kernel-extra-modules-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"kernel-headers-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"kernel-source-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"kernel-tools-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"kernel-tools-debuginfo-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"kernel-tools-devel-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"perf-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"perf-debuginfo-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"python3-perf-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm",
"python3-perf-debuginfo-6.6.0-102.0.0.108.oe2403sp2.aarch64.rpm"
],
"src": [
"kernel-6.6.0-102.0.0.108.oe2403sp2.src.rpm"
],
"x86_64": [
"bpftool-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"bpftool-debuginfo-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"kernel-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"kernel-debuginfo-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"kernel-debugsource-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"kernel-devel-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"kernel-extra-modules-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"kernel-headers-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"kernel-source-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"kernel-tools-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"kernel-tools-debuginfo-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"kernel-tools-devel-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"perf-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"perf-debuginfo-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"python3-perf-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm",
"python3-perf-debuginfo-6.6.0-102.0.0.108.oe2403sp2.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:24.03-LTS-SP2",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-24.03-LTS-SP2"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "6.6.0-102.0.0.108.oe2403sp2"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbpf: consider that tail calls invalidate packet pointers\n\nTail-called programs could execute any of the helpers that invalidate\npacket pointers. Hence, conservatively assume that each tail call\ninvalidates packet pointers.\n\nMaking the change in bpf_helper_changes_pkt_data() automatically makes\nuse of check_cfg() logic that computes \u0026apos;changes_pkt_data\u0026apos; effect for\nglobal sub-programs, such that the following program could be\nrejected:\n\n int tail_call(struct __sk_buff *sk)\n {\n \tbpf_tail_call_static(sk, \u0026amp;jmp_table, 0);\n \treturn 0;\n }\n\n SEC(\u0026quot;tc\u0026quot;)\n int not_safe(struct __sk_buff *sk)\n {\n \tint *p = (void *)(long)sk-\u0026gt;data;\n \t... make p valid ...\n \ttail_call(sk);\n \t*p = 42; /* this is unsafe */\n \t...\n }\n\nThe tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that\ncan invalidate packet pointers. Otherwise, it can\u0026apos;t be freplaced with\ntailcall_freplace.c:entry_freplace() that does a tail call.(CVE-2024-58237)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\neth: bnxt: do not update checksum in bnxt_xdp_build_skb()\n\nThe bnxt_rx_pkt() updates ip_summed value at the end if checksum offload\nis enabled.\nWhen the XDP-MB program is attached and it returns XDP_PASS, the\nbnxt_xdp_build_skb() is called to update skb_shared_info.\nThe main purpose of bnxt_xdp_build_skb() is to update skb_shared_info,\nbut it updates ip_summed value too if checksum offload is enabled.\nThis is actually duplicate work.\n\nWhen the bnxt_rx_pkt() updates ip_summed value, it checks if ip_summed\nis CHECKSUM_NONE or not.\nIt means that ip_summed should be CHECKSUM_NONE at this moment.\nBut ip_summed may already be updated to CHECKSUM_UNNECESSARY in the\nXDP-MB-PASS path.\nSo the by skb_checksum_none_assert() WARNS about it.\n\nThis is duplicate work and updating ip_summed in the\nbnxt_xdp_build_skb() is not needed.\n\nSplat looks like:\nWARNING: CPU: 3 PID: 5782 at ./include/linux/skbuff.h:5155 bnxt_rx_pkt+0x479b/0x7610 [bnxt_en]\nModules linked in: bnxt_re bnxt_en rdma_ucm rdma_cm iw_cm ib_cm ib_uverbs veth xt_nat xt_tcpudp xt_conntrack nft_chain_nat xt_MASQUERADE nf_]\nCPU: 3 UID: 0 PID: 5782 Comm: socat Tainted: G W 6.14.0-rc4+ #27\nTainted: [W]=WARN\nHardware name: ASUS System Product Name/PRIME Z690-P D4, BIOS 0603 11/01/2021\nRIP: 0010:bnxt_rx_pkt+0x479b/0x7610 [bnxt_en]\nCode: 54 24 0c 4c 89 f1 4c 89 ff c1 ea 1f ff d3 0f 1f 00 49 89 c6 48 85 c0 0f 84 4c e5 ff ff 48 89 c7 e8 ca 3d a0 c8 e9 8f f4 ff ff \u0026lt;0f\u0026gt; 0b f\nRSP: 0018:ffff88881ba09928 EFLAGS: 00010202\nRAX: 0000000000000000 RBX: 00000000c7590303 RCX: 0000000000000000\nRDX: 1ffff1104e7d1610 RSI: 0000000000000001 RDI: ffff8881c91300b8\nRBP: ffff88881ba09b28 R08: ffff888273e8b0d0 R09: ffff888273e8b070\nR10: ffff888273e8b010 R11: ffff888278b0f000 R12: ffff888273e8b080\nR13: ffff8881c9130e00 R14: ffff8881505d3800 R15: ffff888273e8b000\nFS: 00007f5a2e7be080(0000) GS:ffff88881ba00000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00007fff2e708ff8 CR3: 000000013e3b0000 CR4: 00000000007506f0\nPKRU: 55555554\nCall Trace:\n \u0026lt;IRQ\u0026gt;\n ? __warn+0xcd/0x2f0\n ? bnxt_rx_pkt+0x479b/0x7610\n ? report_bug+0x326/0x3c0\n ? handle_bug+0x53/0xa0\n ? exc_invalid_op+0x14/0x50\n ? asm_exc_invalid_op+0x16/0x20\n ? bnxt_rx_pkt+0x479b/0x7610\n ? bnxt_rx_pkt+0x3e41/0x7610\n ? __pfx_bnxt_rx_pkt+0x10/0x10\n ? napi_complete_done+0x2cf/0x7d0\n __bnxt_poll_work+0x4e8/0x1220\n ? __pfx___bnxt_poll_work+0x10/0x10\n ? __pfx_mark_lock.part.0+0x10/0x10\n bnxt_poll_p5+0x36a/0xfa0\n ? __pfx_bnxt_poll_p5+0x10/0x10\n __napi_poll.constprop.0+0xa0/0x440\n net_rx_action+0x899/0xd00\n...\n\nFollowing ping.py patch adds xdp-mb-pass case. so ping.py is going\nto be able to reproduce this issue.(CVE-2025-21960)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\neth: bnxt: fix truesize for mb-xdp-pass case\n\nWhen mb-xdp is set and return is XDP_PASS, packet is converted from\nxdp_buff to sk_buff with xdp_update_skb_shared_info() in\nbnxt_xdp_build_skb().\nbnxt_xdp_build_skb() passes incorrect truesize argument to\nxdp_update_skb_shared_info().\nThe truesize is calculated as BNXT_RX_PAGE_SIZE * sinfo-\u0026gt;nr_frags but\nthe skb_shared_info was wiped by napi_build_skb() before.\nSo it stores sinfo-\u0026gt;nr_frags before bnxt_xdp_build_skb() and use it\ninstead of getting skb_shared_info from xdp_get_shared_info_from_buff().\n\nSplat looks like:\n ------------[ cut here ]------------\n WARNING: CPU: 2 PID: 0 at net/core/skbuff.c:6072 skb_try_coalesce+0x504/0x590\n Modules linked in: xt_nat xt_tcpudp veth af_packet xt_conntrack nft_chain_nat xt_MASQUERADE nf_conntrack_netlink xfrm_user xt_addrtype nft_coms\n CPU: 2 UID: 0 PID: 0 Comm: swapper/2 Not tainted 6.14.0-rc2+ #3\n RIP: 0010:skb_try_coalesce+0x504/0x590\n Code: 4b fd ff ff 49 8b 34 24 40 80 e6 40 0f 84 3d fd ff ff 49 8b 74 24 48 40 f6 c6 01 0f 84 2e fd ff ff 48 8d 4e ff e9 25 fd ff ff \u0026lt;0f\u0026gt; 0b e99\n RSP: 0018:ffffb62c4120caa8 EFLAGS: 00010287\n RAX: 0000000000000003 RBX: ffffb62c4120cb14 RCX: 0000000000000ec0\n RDX: 0000000000001000 RSI: ffffa06e5d7dc000 RDI: 0000000000000003\n RBP: ffffa06e5d7ddec0 R08: ffffa06e6120a800 R09: ffffa06e7a119900\n R10: 0000000000002310 R11: ffffa06e5d7dcec0 R12: ffffe4360575f740\n R13: ffffe43600000000 R14: 0000000000000002 R15: 0000000000000002\n FS: 0000000000000000(0000) GS:ffffa0755f700000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 00007f147b76b0f8 CR3: 00000001615d4000 CR4: 00000000007506f0\n PKRU: 55555554\n Call Trace:\n \u0026lt;IRQ\u0026gt;\n ? __warn+0x84/0x130\n ? skb_try_coalesce+0x504/0x590\n ? report_bug+0x18a/0x1a0\n ? handle_bug+0x53/0x90\n ? exc_invalid_op+0x14/0x70\n ? asm_exc_invalid_op+0x16/0x20\n ? skb_try_coalesce+0x504/0x590\n inet_frag_reasm_finish+0x11f/0x2e0\n ip_defrag+0x37a/0x900\n ip_local_deliver+0x51/0x120\n ip_sublist_rcv_finish+0x64/0x70\n ip_sublist_rcv+0x179/0x210\n ip_list_rcv+0xf9/0x130\n\nHow to reproduce:\n\u0026lt;Node A\u0026gt;\nip link set $interface1 xdp obj xdp_pass.o\nip link set $interface1 mtu 9000 up\nip a a 10.0.0.1/24 dev $interface1\n\u0026lt;Node B\u0026gt;\nip link set $interfac2 mtu 9000 up\nip a a 10.0.0.2/24 dev $interface2\nping 10.0.0.1 -s 65000\n\nFollowing ping.py patch adds xdp-mb-pass case. so ping.py is going to be\nable to reproduce this issue.(CVE-2025-21961)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/mlx5: handle errors in mlx5_chains_create_table()\n\nIn mlx5_chains_create_table(), the return value of\u00a0mlx5_get_fdb_sub_ns()\nand mlx5_get_flow_namespace() must be checked to prevent NULL pointer\ndereferences. If either function fails, the function should log error\nmessage with mlx5_core_warn() and return error pointer.(CVE-2025-21975)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxsk: fix an integer overflow in xp_create_and_assign_umem()\n\nSince the i and pool-\u0026gt;chunk_size variables are of type \u0026apos;u32\u0026apos;,\ntheir product can wrap around and then be cast to \u0026apos;u64\u0026apos;.\nThis can lead to two different XDP buffers pointing to the same\nmemory area.\n\nFound by InfoTeCS on behalf of Linux Verification Center\n(linuxtesting.org) with SVACE.(CVE-2025-21997)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: atm: fix use after free in lec_send()\n\nThe -\u0026gt;send() operation frees skb so save the length before calling\n-\u0026gt;send() to avoid a use after free.(CVE-2025-22004)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusbnet:fix NPE during rx_complete\n\nMissing usbnet_going_away Check in Critical Path.\nThe usb_submit_urb function lacks a usbnet_going_away\nvalidation, whereas __usbnet_queue_skb includes this check.\n\nThis inconsistency creates a race condition where:\nA URB request may succeed, but the corresponding SKB data\nfails to be queued.\n\nSubsequent processes:\n(e.g., rx_complete \u2192 defer_bh \u2192 __skb_unlink(skb, list))\nattempt to access skb-\u0026gt;next, triggering a NULL pointer\ndereference (Kernel Panic).(CVE-2025-22050)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: ibmveth: make veth_pool_store stop hanging\n\nv2:\n- Created a single error handling unlock and exit in veth_pool_store\n- Greatly expanded commit message with previous explanatory-only text\n\nSummary: Use rtnl_mutex to synchronize veth_pool_store with itself,\nibmveth_close and ibmveth_open, preventing multiple calls in a row to\nnapi_disable.\n\nBackground: Two (or more) threads could call veth_pool_store through\nwriting to /sys/devices/vio/30000002/pool*/*. You can do this easily\nwith a little shell script. This causes a hang.\n\nI configured LOCKDEP, compiled ibmveth.c with DEBUG, and built a new\nkernel. I ran this test again and saw:\n\n Setting pool0/active to 0\n Setting pool1/active to 1\n [ 73.911067][ T4365] ibmveth 30000002 eth0: close starting\n Setting pool1/active to 1\n Setting pool1/active to 0\n [ 73.911367][ T4366] ibmveth 30000002 eth0: close starting\n [ 73.916056][ T4365] ibmveth 30000002 eth0: close complete\n [ 73.916064][ T4365] ibmveth 30000002 eth0: open starting\n [ 110.808564][ T712] systemd-journald[712]: Sent WATCHDOG=1 notification.\n [ 230.808495][ T712] systemd-journald[712]: Sent WATCHDOG=1 notification.\n [ 243.683786][ T123] INFO: task stress.sh:4365 blocked for more than 122 seconds.\n [ 243.683827][ T123] Not tainted 6.14.0-01103-g2df0c02dab82-dirty #8\n [ 243.683833][ T123] \u0026quot;echo 0 \u0026gt; /proc/sys/kernel/hung_task_timeout_secs\u0026quot; disables this message.\n [ 243.683838][ T123] task:stress.sh state:D stack:28096 pid:4365 tgid:4365 ppid:4364 task_flags:0x400040 flags:0x00042000\n [ 243.683852][ T123] Call Trace:\n [ 243.683857][ T123] [c00000000c38f690] [0000000000000001] 0x1 (unreliable)\n [ 243.683868][ T123] [c00000000c38f840] [c00000000001f908] __switch_to+0x318/0x4e0\n [ 243.683878][ T123] [c00000000c38f8a0] [c000000001549a70] __schedule+0x500/0x12a0\n [ 243.683888][ T123] [c00000000c38f9a0] [c00000000154a878] schedule+0x68/0x210\n [ 243.683896][ T123] [c00000000c38f9d0] [c00000000154ac80] schedule_preempt_disabled+0x30/0x50\n [ 243.683904][ T123] [c00000000c38fa00] [c00000000154dbb0] __mutex_lock+0x730/0x10f0\n [ 243.683913][ T123] [c00000000c38fb10] [c000000001154d40] napi_enable+0x30/0x60\n [ 243.683921][ T123] [c00000000c38fb40] [c000000000f4ae94] ibmveth_open+0x68/0x5dc\n [ 243.683928][ T123] [c00000000c38fbe0] [c000000000f4aa20] veth_pool_store+0x220/0x270\n [ 243.683936][ T123] [c00000000c38fc70] [c000000000826278] sysfs_kf_write+0x68/0xb0\n [ 243.683944][ T123] [c00000000c38fcb0] [c0000000008240b8] kernfs_fop_write_iter+0x198/0x2d0\n [ 243.683951][ T123] [c00000000c38fd00] [c00000000071b9ac] vfs_write+0x34c/0x650\n [ 243.683958][ T123] [c00000000c38fdc0] [c00000000071bea8] ksys_write+0x88/0x150\n [ 243.683966][ T123] [c00000000c38fe10] [c0000000000317f4] system_call_exception+0x124/0x340\n [ 243.683973][ T123] [c00000000c38fe50] [c00000000000d05c] system_call_vectored_common+0x15c/0x2ec\n ...\n [ 243.684087][ T123] Showing all locks held in the system:\n [ 243.684095][ T123] 1 lock held by khungtaskd/123:\n [ 243.684099][ T123] #0: c00000000278e370 (rcu_read_lock){....}-{1:2}, at: debug_show_all_locks+0x50/0x248\n [ 243.684114][ T123] 4 locks held by stress.sh/4365:\n [ 243.684119][ T123] #0: c00000003a4cd3f8 (sb_writers#3){.+.+}-{0:0}, at: ksys_write+0x88/0x150\n [ 243.684132][ T123] #1: c000000041aea888 (\u0026amp;of-\u0026gt;mutex#2){+.+.}-{3:3}, at: kernfs_fop_write_iter+0x154/0x2d0\n [ 243.684143][ T123] #2: c0000000366fb9a8 (kn-\u0026gt;active#64){.+.+}-{0:0}, at: kernfs_fop_write_iter+0x160/0x2d0\n [ 243.684155][ T123] #3: c000000035ff4cb8 (\u0026amp;dev-\u0026gt;lock){+.+.}-{3:3}, at: napi_enable+0x30/0x60\n [ 243.684166][ T123] 5 locks held by stress.sh/4366:\n [ 243.684170][ T123] #0: c00000003a4cd3f8 (sb_writers#3){.+.+}-{0:0}, at: ksys_write+0x88/0x150\n [ 243.\n---truncated---(CVE-2025-22053)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\narcnet: Add NULL check in com20020pci_probe()\n\ndevm_kasprintf() returns NULL when memory allocation fails. Currently,\ncom20020pci_probe() does not check for this case, which results in a\nNULL pointer dereference.\n\nAdd NULL check after devm_kasprintf() to prevent this issue and ensure\nno resources are left allocated.(CVE-2025-22054)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: fix geneve_opt length integer overflow\n\nstruct geneve_opt uses 5 bit length for each single option, which\nmeans every vary size option should be smaller than 128 bytes.\n\nHowever, all current related Netlink policies cannot promise this\nlength condition and the attacker can exploit a exact 128-byte size\noption to *fake* a zero length option and confuse the parsing logic,\nfurther achieve heap out-of-bounds read.\n\nOne example crash log is like below:\n\n[ 3.905425] ==================================================================\n[ 3.905925] BUG: KASAN: slab-out-of-bounds in nla_put+0xa9/0xe0\n[ 3.906255] Read of size 124 at addr ffff888005f291cc by task poc/177\n[ 3.906646]\n[ 3.906775] CPU: 0 PID: 177 Comm: poc-oob-read Not tainted 6.1.132 #1\n[ 3.907131] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.16.0-0-gd239552ce722-prebuilt.qemu.org 04/01/2014\n[ 3.907784] Call Trace:\n[ 3.907925] \u0026lt;TASK\u0026gt;\n[ 3.908048] dump_stack_lvl+0x44/0x5c\n[ 3.908258] print_report+0x184/0x4be\n[ 3.909151] kasan_report+0xc5/0x100\n[ 3.909539] kasan_check_range+0xf3/0x1a0\n[ 3.909794] memcpy+0x1f/0x60\n[ 3.909968] nla_put+0xa9/0xe0\n[ 3.910147] tunnel_key_dump+0x945/0xba0\n[ 3.911536] tcf_action_dump_1+0x1c1/0x340\n[ 3.912436] tcf_action_dump+0x101/0x180\n[ 3.912689] tcf_exts_dump+0x164/0x1e0\n[ 3.912905] fw_dump+0x18b/0x2d0\n[ 3.913483] tcf_fill_node+0x2ee/0x460\n[ 3.914778] tfilter_notify+0xf4/0x180\n[ 3.915208] tc_new_tfilter+0xd51/0x10d0\n[ 3.918615] rtnetlink_rcv_msg+0x4a2/0x560\n[ 3.919118] netlink_rcv_skb+0xcd/0x200\n[ 3.919787] netlink_unicast+0x395/0x530\n[ 3.921032] netlink_sendmsg+0x3d0/0x6d0\n[ 3.921987] __sock_sendmsg+0x99/0xa0\n[ 3.922220] __sys_sendto+0x1b7/0x240\n[ 3.922682] __x64_sys_sendto+0x72/0x90\n[ 3.922906] do_syscall_64+0x5e/0x90\n[ 3.923814] entry_SYSCALL_64_after_hwframe+0x6e/0xd8\n[ 3.924122] RIP: 0033:0x7e83eab84407\n[ 3.924331] Code: 48 89 fa 4c 89 df e8 38 aa 00 00 8b 93 08 03 00 00 59 5e 48 83 f8 fc 74 1a 5b c3 0f 1f 84 00 00 00 00 00 48 8b 44 24 10 0f 05 \u0026lt;5b\u0026gt; c3 0f 1f 80 00 00 00 00 83 e2 39 83 faf\n[ 3.925330] RSP: 002b:00007ffff505e370 EFLAGS: 00000202 ORIG_RAX: 000000000000002c\n[ 3.925752] RAX: ffffffffffffffda RBX: 00007e83eaafa740 RCX: 00007e83eab84407\n[ 3.926173] RDX: 00000000000001a8 RSI: 00007ffff505e3c0 RDI: 0000000000000003\n[ 3.926587] RBP: 00007ffff505f460 R08: 00007e83eace1000 R09: 000000000000000c\n[ 3.926977] R10: 0000000000000000 R11: 0000000000000202 R12: 00007ffff505f3c0\n[ 3.927367] R13: 00007ffff505f5c8 R14: 00007e83ead1b000 R15: 00005d4fbbe6dcb8\n\nFix these issues by enforing correct length condition in related\npolicies.(CVE-2025-22055)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nudp: Fix memory accounting leak.\n\nMatt Dowling reported a weird UDP memory usage issue.\n\nUnder normal operation, the UDP memory usage reported in /proc/net/sockstat\nremains close to zero. However, it occasionally spiked to 524,288 pages\nand never dropped. Moreover, the value doubled when the application was\nterminated. Finally, it caused intermittent packet drops.\n\nWe can reproduce the issue with the script below [0]:\n\n 1. /proc/net/sockstat reports 0 pages\n\n # cat /proc/net/sockstat | grep UDP:\n UDP: inuse 1 mem 0\n\n 2. Run the script till the report reaches 524,288\n\n # python3 test.py \u0026amp; sleep 5\n # cat /proc/net/sockstat | grep UDP:\n UDP: inuse 3 mem 524288 \u0026lt;-- (INT_MAX + 1) \u0026gt;\u0026gt; PAGE_SHIFT\n\n 3. Kill the socket and confirm the number never drops\n\n # pkill python3 \u0026amp;\u0026amp; sleep 5\n # cat /proc/net/sockstat | grep UDP:\n UDP: inuse 1 mem 524288\n\n 4. (necessary since v6.0) Trigger proto_memory_pcpu_drain()\n\n # python3 test.py \u0026amp; sleep 1 \u0026amp;\u0026amp; pkill python3\n\n 5. The number doubles\n\n # cat /proc/net/sockstat | grep UDP:\n UDP: inuse 1 mem 1048577\n\nThe application set INT_MAX to SO_RCVBUF, which triggered an integer\noverflow in udp_rmem_release().\n\nWhen a socket is close()d, udp_destruct_common() purges its receive\nqueue and sums up skb-\u0026gt;truesize in the queue. This total is calculated\nand stored in a local unsigned integer variable.\n\nThe total size is then passed to udp_rmem_release() to adjust memory\naccounting. However, because the function takes a signed integer\nargument, the total size can wrap around, causing an overflow.\n\nThen, the released amount is calculated as follows:\n\n 1) Add size to sk-\u0026gt;sk_forward_alloc.\n 2) Round down sk-\u0026gt;sk_forward_alloc to the nearest lower multiple of\n PAGE_SIZE and assign it to amount.\n 3) Subtract amount from sk-\u0026gt;sk_forward_alloc.\n 4) Pass amount \u0026gt;\u0026gt; PAGE_SHIFT to __sk_mem_reduce_allocated().\n\nWhen the issue occurred, the total in udp_destruct_common() was 2147484480\n(INT_MAX + 833), which was cast to -2147482816 in udp_rmem_release().\n\nAt 1) sk-\u0026gt;sk_forward_alloc is changed from 3264 to -2147479552, and\n2) sets -2147479552 to amount. 3) reverts the wraparound, so we don\u0026apos;t\nsee a warning in inet_sock_destruct(). However, udp_memory_allocated\nends up doubling at 4).\n\nSince commit 3cd3399dd7a8 (\u0026quot;net: implement per-cpu reserves for\nmemory_allocated\u0026quot;), memory usage no longer doubles immediately after\na socket is close()d because __sk_mem_reduce_allocated() caches the\namount in udp_memory_per_cpu_fw_alloc. However, the next time a UDP\nsocket receives a packet, the subtraction takes effect, causing UDP\nmemory usage to double.\n\nThis issue makes further memory allocation fail once the socket\u0026apos;s\nsk-\u0026gt;sk_rmem_alloc exceeds net.ipv4.udp_rmem_min, resulting in packet\ndrops.\n\nTo prevent this issue, let\u0026apos;s use unsigned int for the calculation and\ncall sk_forward_alloc_add() only once for the small delta.\n\nNote that first_packet_length() also potentially has the same problem.\n\n[0]:\nfrom socket import *\n\nSO_RCVBUFFORCE = 33\nINT_MAX = (2 ** 31) - 1\n\ns = socket(AF_INET, SOCK_DGRAM)\ns.bind((\u0026apos;\u0026apos;, 0))\ns.setsockopt(SOL_SOCKET, SO_RCVBUFFORCE, INT_MAX)\n\nc = socket(AF_INET, SOCK_DGRAM)\nc.connect(s.getsockname())\n\ndata = b\u0026apos;a\u0026apos; * 100\n\nwhile True:\n c.send(data)(CVE-2025-22058)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: add mutual exclusion in proc_sctp_do_udp_port()\n\nWe must serialize calls to sctp_udp_sock_stop() and sctp_udp_sock_start()\nor risk a crash as syzbot reported:\n\nOops: general protection fault, probably for non-canonical address 0xdffffc000000000d: 0000 [#1] SMP KASAN PTI\nKASAN: null-ptr-deref in range [0x0000000000000068-0x000000000000006f]\nCPU: 1 UID: 0 PID: 6551 Comm: syz.1.44 Not tainted 6.14.0-syzkaller-g7f2ff7b62617 #0 PREEMPT(full)\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/12/2025\n RIP: 0010:kernel_sock_shutdown+0x47/0x70 net/socket.c:3653\nCall Trace:\n \u0026lt;TASK\u0026gt;\n udp_tunnel_sock_release+0x68/0x80 net/ipv4/udp_tunnel_core.c:181\n sctp_udp_sock_stop+0x71/0x160 net/sctp/protocol.c:930\n proc_sctp_do_udp_port+0x264/0x450 net/sctp/sysctl.c:553\n proc_sys_call_handler+0x3d0/0x5b0 fs/proc/proc_sysctl.c:601\n iter_file_splice_write+0x91c/0x1150 fs/splice.c:738\n do_splice_from fs/splice.c:935 [inline]\n direct_splice_actor+0x18f/0x6c0 fs/splice.c:1158\n splice_direct_to_actor+0x342/0xa30 fs/splice.c:1102\n do_splice_direct_actor fs/splice.c:1201 [inline]\n do_splice_direct+0x174/0x240 fs/splice.c:1227\n do_sendfile+0xafd/0xe50 fs/read_write.c:1368\n __do_sys_sendfile64 fs/read_write.c:1429 [inline]\n __se_sys_sendfile64 fs/read_write.c:1415 [inline]\n __x64_sys_sendfile64+0x1d8/0x220 fs/read_write.c:1415\n do_syscall_x64 arch/x86/entry/syscall_64.c:63 [inline](CVE-2025-22062)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: fix NULL pointer dereference in l3mdev_l3_rcv\n\nWhen delete l3s ipvlan:\n\n ip link del link eth0 ipvlan1 type ipvlan mode l3s\n\nThis may cause a null pointer dereference:\n\n Call trace:\n ip_rcv_finish+0x48/0xd0\n ip_rcv+0x5c/0x100\n __netif_receive_skb_one_core+0x64/0xb0\n __netif_receive_skb+0x20/0x80\n process_backlog+0xb4/0x204\n napi_poll+0xe8/0x294\n net_rx_action+0xd8/0x22c\n __do_softirq+0x12c/0x354\n\nThis is because l3mdev_l3_rcv() visit dev-\u0026gt;l3mdev_ops after\nipvlan_l3s_unregister() assign the dev-\u0026gt;l3mdev_ops to NULL. The process\nlike this:\n\n (CPU1) | (CPU2)\n l3mdev_l3_rcv() |\n check dev-\u0026gt;priv_flags: |\n master = skb-\u0026gt;dev; |\n |\n | ipvlan_l3s_unregister()\n | set dev-\u0026gt;priv_flags\n | dev-\u0026gt;l3mdev_ops = NULL;\n |\n visit master-\u0026gt;l3mdev_ops |\n\nTo avoid this by do not set dev-\u0026gt;l3mdev_ops when unregister l3s ipvlan.(CVE-2025-22103)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: Remove RTNL dance for SIOCBRADDIF and SIOCBRDELIF.\n\nSIOCBRDELIF is passed to dev_ioctl() first and later forwarded to\nbr_ioctl_call(), which causes unnecessary RTNL dance and the splat\nbelow [0] under RTNL pressure.\n\nLet\u0026apos;s say Thread A is trying to detach a device from a bridge and\nThread B is trying to remove the bridge.\n\nIn dev_ioctl(), Thread A bumps the bridge device\u0026apos;s refcnt by\nnetdev_hold() and releases RTNL because the following br_ioctl_call()\nalso re-acquires RTNL.\n\nIn the race window, Thread B could acquire RTNL and try to remove\nthe bridge device. Then, rtnl_unlock() by Thread B will release RTNL\nand wait for netdev_put() by Thread A.\n\nThread A, however, must hold RTNL after the unlock in dev_ifsioc(),\nwhich may take long under RTNL pressure, resulting in the splat by\nThread B.\n\n Thread A (SIOCBRDELIF) Thread B (SIOCBRDELBR)\n ---------------------- ----------------------\n sock_ioctl sock_ioctl\n `- sock_do_ioctl `- br_ioctl_call\n `- dev_ioctl `- br_ioctl_stub\n |- rtnl_lock |\n |- dev_ifsioc \u0026apos;\n \u0026apos; |- dev = __dev_get_by_name(...)\n |- netdev_hold(dev, ...) .\n / |- rtnl_unlock ------. |\n | |- br_ioctl_call `---\u0026gt; |- rtnl_lock\n Race | | `- br_ioctl_stub |- br_del_bridge\n Window | | | |- dev = __dev_get_by_name(...)\n | | | May take long | `- br_dev_delete(dev, ...)\n | | | under RTNL pressure | `- unregister_netdevice_queue(dev, ...)\n | | | | `- rtnl_unlock\n \\ | |- rtnl_lock \u0026lt;-\u0026apos; `- netdev_run_todo\n | |- ... `- netdev_run_todo\n | `- rtnl_unlock |- __rtnl_unlock\n | |- netdev_wait_allrefs_any\n |- netdev_put(dev, ...) \u0026lt;----------------\u0026apos;\n Wait refcnt decrement\n and log splat below\n\nTo avoid blocking SIOCBRDELBR unnecessarily, let\u0026apos;s not call\ndev_ioctl() for SIOCBRADDIF and SIOCBRDELIF.\n\nIn the dev_ioctl() path, we do the following:\n\n 1. Copy struct ifreq by get_user_ifreq in sock_do_ioctl()\n 2. Check CAP_NET_ADMIN in dev_ioctl()\n 3. Call dev_load() in dev_ioctl()\n 4. Fetch the master dev from ifr.ifr_name in dev_ifsioc()\n\n3. can be done by request_module() in br_ioctl_call(), so we move\n1., 2., and 4. to br_ioctl_stub().\n\nNote that 2. is also checked later in add_del_if(), but it\u0026apos;s better\nperformed before RTNL.\n\nSIOCBRADDIF and SIOCBRDELIF have been processed in dev_ioctl() since\nthe pre-git era, and there seems to be no specific reason to process\nthem there.\n\n[0]:\nunregister_netdevice: waiting for wpan3 to become free. Usage count = 2\nref_tracker: wpan3@ffff8880662d8608 has 1/1 users at\n __netdev_tracker_alloc include/linux/netdevice.h:4282 [inline]\n netdev_hold include/linux/netdevice.h:4311 [inline]\n dev_ifsioc+0xc6a/0x1160 net/core/dev_ioctl.c:624\n dev_ioctl+0x255/0x10c0 net/core/dev_ioctl.c:826\n sock_do_ioctl+0x1ca/0x260 net/socket.c:1213\n sock_ioctl+0x23a/0x6c0 net/socket.c:1318\n vfs_ioctl fs/ioctl.c:51 [inline]\n __do_sys_ioctl fs/ioctl.c:906 [inline]\n __se_sys_ioctl fs/ioctl.c:892 [inline]\n __x64_sys_ioctl+0x1a4/0x210 fs/ioctl.c:892\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcb/0x250 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2025-22111)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: detect and prevent references to a freed transport in sendmsg\n\nsctp_sendmsg() re-uses associations and transports when possible by\ndoing a lookup based on the socket endpoint and the message destination\naddress, and then sctp_sendmsg_to_asoc() sets the selected transport in\nall the message chunks to be sent.\n\nThere\u0026apos;s a possible race condition if another thread triggers the removal\nof that selected transport, for instance, by explicitly unbinding an\naddress with setsockopt(SCTP_SOCKOPT_BINDX_REM), after the chunks have\nbeen set up and before the message is sent. This can happen if the send\nbuffer is full, during the period when the sender thread temporarily\nreleases the socket lock in sctp_wait_for_sndbuf().\n\nThis causes the access to the transport data in\nsctp_outq_select_transport(), when the association outqueue is flushed,\nto result in a use-after-free read.\n\nThis change avoids this scenario by having sctp_transport_free() signal\nthe freeing of the transport, tagging it as \u0026quot;dead\u0026quot;. In order to do this,\nthe patch restores the \u0026quot;dead\u0026quot; bit in struct sctp_transport, which was\nremoved in\ncommit 47faa1e4c50e (\u0026quot;sctp: remove the dead field of sctp_transport\u0026quot;).\n\nThen, in the scenario where the sender thread has released the socket\nlock in sctp_wait_for_sndbuf(), the bit is checked again after\nre-acquiring the socket lock to detect the deletion. This is done while\nholding a reference to the transport to prevent it from being freed in\nthe process.\n\nIf the transport was deleted while the socket lock was relinquished,\nsctp_sendmsg_to_asoc() will return -EAGAIN to let userspace retry the\nsend.\n\nThe bug was found by a private syzbot instance (see the error report [1]\nand the C reproducer that triggers it [2]).(CVE-2025-23142)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: stmmac: Fix accessing freed irq affinity_hint\n\nThe cpumask should not be a local variable, since its pointer is saved\nto irq_desc and may be accessed from procfs.\nTo fix it, use the persistent mask cpumask_of(cpu#).(CVE-2025-23155)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntipc: fix memory leak in tipc_link_xmit\n\nIn case the backlog transmit queue for system-importance messages is overloaded,\ntipc_link_xmit() returns -ENOBUFS but the skb list is not purged. This leads to\nmemory leak and failure when a skb is allocated.\n\nThis commit fixes this issue by purging the skb list before tipc_link_xmit()\nreturns.(CVE-2025-37757)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: dsa: free routing table on probe failure\n\nIf complete = true in dsa_tree_setup(), it means that we are the last\nswitch of the tree which is successfully probing, and we should be\nsetting up all switches from our probe path.\n\nAfter \u0026quot;complete\u0026quot; becomes true, dsa_tree_setup_cpu_ports() or any\nsubsequent function may fail. If that happens, the entire tree setup is\nin limbo: the first N-1 switches have successfully finished probing\n(doing nothing but having allocated persistent memory in the tree\u0026apos;s\ndst-\u0026gt;ports, and maybe dst-\u0026gt;rtable), and switch N failed to probe, ending\nthe tree setup process before anything is tangible from the user\u0026apos;s PoV.\n\nIf switch N fails to probe, its memory (ports) will be freed and removed\nfrom dst-\u0026gt;ports. However, the dst-\u0026gt;rtable elements pointing to its ports,\nas created by dsa_link_touch(), will remain there, and will lead to\nuse-after-free if dereferenced.\n\nIf dsa_tree_setup_switches() returns -EPROBE_DEFER, which is entirely\npossible because that is where ds-\u0026gt;ops-\u0026gt;setup() is, we get a kasan\nreport like this:\n\n==================================================================\nBUG: KASAN: slab-use-after-free in mv88e6xxx_setup_upstream_port+0x240/0x568\nRead of size 8 at addr ffff000004f56020 by task kworker/u8:3/42\n\nCall trace:\n __asan_report_load8_noabort+0x20/0x30\n mv88e6xxx_setup_upstream_port+0x240/0x568\n mv88e6xxx_setup+0xebc/0x1eb0\n dsa_register_switch+0x1af4/0x2ae0\n mv88e6xxx_register_switch+0x1b8/0x2a8\n mv88e6xxx_probe+0xc4c/0xf60\n mdio_probe+0x78/0xb8\n really_probe+0x2b8/0x5a8\n __driver_probe_device+0x164/0x298\n driver_probe_device+0x78/0x258\n __device_attach_driver+0x274/0x350\n\nAllocated by task 42:\n __kasan_kmalloc+0x84/0xa0\n __kmalloc_cache_noprof+0x298/0x490\n dsa_switch_touch_ports+0x174/0x3d8\n dsa_register_switch+0x800/0x2ae0\n mv88e6xxx_register_switch+0x1b8/0x2a8\n mv88e6xxx_probe+0xc4c/0xf60\n mdio_probe+0x78/0xb8\n really_probe+0x2b8/0x5a8\n __driver_probe_device+0x164/0x298\n driver_probe_device+0x78/0x258\n __device_attach_driver+0x274/0x350\n\nFreed by task 42:\n __kasan_slab_free+0x48/0x68\n kfree+0x138/0x418\n dsa_register_switch+0x2694/0x2ae0\n mv88e6xxx_register_switch+0x1b8/0x2a8\n mv88e6xxx_probe+0xc4c/0xf60\n mdio_probe+0x78/0xb8\n really_probe+0x2b8/0x5a8\n __driver_probe_device+0x164/0x298\n driver_probe_device+0x78/0x258\n __device_attach_driver+0x274/0x350\n\nThe simplest way to fix the bug is to delete the routing table in its\nentirety. dsa_tree_setup_routing_table() has no problem in regenerating\nit even if we deleted links between ports other than those of switch N,\nbecause dsa_link_touch() first checks whether the port pair already\nexists in dst-\u0026gt;rtable, allocating if not.\n\nThe deletion of the routing table in its entirety already exists in\ndsa_tree_teardown(), so refactor that into a function that can also be\ncalled from the tree setup error path.\n\nIn my analysis of the commit to blame, it is the one which added\ndsa_link elements to dst-\u0026gt;rtable. Prior to that, each switch had its own\nds-\u0026gt;rtable which is freed when the switch fails to probe. But the tree\nis potentially persistent memory.(CVE-2025-37786)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: dsa: mv88e6xxx: avoid unregistering devlink regions which were never registered\n\nRussell King reports that a system with mv88e6xxx dereferences a NULL\npointer when unbinding this driver:\nhttps://lore.kernel.org/netdev/(CVE-2025-37787)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncxgb4: fix memory leak in cxgb4_init_ethtool_filters() error path\n\nIn the for loop used to allocate the loc_array and bmap for each port, a\nmemory leak is possible when the allocation for loc_array succeeds,\nbut the allocation for bmap fails. This is because when the control flow\ngoes to the label free_eth_finfo, only the allocations starting from\n(i-1)th iteration are freed.\n\nFix that by freeing the loc_array in the bmap allocation error path.(CVE-2025-37788)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: mctp: Set SOCK_RCU_FREE\n\nBind lookup runs under RCU, so ensure that a socket doesn\u0026apos;t go away in\nthe middle of a lookup.(CVE-2025-37790)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet_sched: hfsc: Fix a UAF vulnerability in class handling\n\nThis patch fixes a Use-After-Free vulnerability in the HFSC qdisc class\nhandling. The issue occurs due to a time-of-check/time-of-use condition\nin hfsc_change_class() when working with certain child qdiscs like netem\nor codel.\n\nThe vulnerability works as follows:\n1. hfsc_change_class() checks if a class has packets (q.qlen != 0)\n2. It then calls qdisc_peek_len(), which for certain qdiscs (e.g.,\n codel, netem) might drop packets and empty the queue\n3. The code continues assuming the queue is still non-empty, adding\n the class to vttree\n4. This breaks HFSC scheduler assumptions that only non-empty classes\n are in vttree\n5. Later, when the class is destroyed, this can lead to a Use-After-Free\n\nThe fix adds a second queue length check after qdisc_peek_len() to verify\nthe queue wasn\u0026apos;t emptied.(CVE-2025-37797)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmcb: fix a double free bug in chameleon_parse_gdd()\n\nIn chameleon_parse_gdd(), if mcb_device_register() fails, \u0026apos;mdev\u0026apos;\nwould be released in mcb_device_register() via put_device().\nThus, goto \u0026apos;err\u0026apos; label and free \u0026apos;mdev\u0026apos; again causes a double free.\nJust return if mcb_device_register() fails.(CVE-2025-37817)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxen-netfront: handle NULL returned by xdp_convert_buff_to_frame()\n\nThe function xdp_convert_buff_to_frame() may return NULL if it fails\nto correctly convert the XDP buffer into an XDP frame due to memory\nconstraints, internal errors, or invalid data. Failing to check for NULL\nmay lead to a NULL pointer dereference if the result is used later in\nprocessing, potentially causing crashes, data corruption, or undefined\nbehavior.\n\nOn XDP redirect failure, the associated page must be released explicitly\nif it was previously retained via get_page(). Failing to do so may result\nin a memory leak, as the pages reference count is not decremented.(CVE-2025-37820)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet_sched: hfsc: Fix a potential UAF in hfsc_dequeue() too\n\nSimilarly to the previous patch, we need to safe guard hfsc_dequeue()\ntoo. But for this one, we don\u0026apos;t have a reliable reproducer.(CVE-2025-37823)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntipc: fix NULL pointer dereference in tipc_mon_reinit_self()\n\nsyzbot reported:\n\ntipc: Node number set to 1055423674\nOops: general protection fault, probably for non-canonical address 0xdffffc0000000000: 0000 [#1] SMP KASAN NOPTI\nKASAN: null-ptr-deref in range [0x0000000000000000-0x0000000000000007]\nCPU: 3 UID: 0 PID: 6017 Comm: kworker/3:5 Not tainted 6.15.0-rc1-syzkaller-00246-g900241a5cc15 #0 PREEMPT(full)\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-debian-1.16.3-2~bpo12+1 04/01/2014\nWorkqueue: events tipc_net_finalize_work\nRIP: 0010:tipc_mon_reinit_self+0x11c/0x210 net/tipc/monitor.c:719\n...\nRSP: 0018:ffffc9000356fb68 EFLAGS: 00010246\nRAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000003ee87cba\nRDX: 0000000000000000 RSI: ffffffff8dbc56a7 RDI: ffff88804c2cc010\nRBP: dffffc0000000000 R08: 0000000000000001 R09: 0000000000000000\nR10: 0000000000000001 R11: 0000000000000000 R12: 0000000000000007\nR13: fffffbfff2111097 R14: ffff88804ead8000 R15: ffff88804ead9010\nFS: 0000000000000000(0000) GS:ffff888097ab9000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00000000f720eb00 CR3: 000000000e182000 CR4: 0000000000352ef0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n \u0026lt;TASK\u0026gt;\n tipc_net_finalize+0x10b/0x180 net/tipc/net.c:140\n process_one_work+0x9cc/0x1b70 kernel/workqueue.c:3238\n process_scheduled_works kernel/workqueue.c:3319 [inline]\n worker_thread+0x6c8/0xf10 kernel/workqueue.c:3400\n kthread+0x3c2/0x780 kernel/kthread.c:464\n ret_from_fork+0x45/0x80 arch/x86/kernel/process.c:153\n ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:245\n \u0026lt;/TASK\u0026gt;\n...\nRIP: 0010:tipc_mon_reinit_self+0x11c/0x210 net/tipc/monitor.c:719\n...\nRSP: 0018:ffffc9000356fb68 EFLAGS: 00010246\nRAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000003ee87cba\nRDX: 0000000000000000 RSI: ffffffff8dbc56a7 RDI: ffff88804c2cc010\nRBP: dffffc0000000000 R08: 0000000000000001 R09: 0000000000000000\nR10: 0000000000000001 R11: 0000000000000000 R12: 0000000000000007\nR13: fffffbfff2111097 R14: ffff88804ead8000 R15: ffff88804ead9010\nFS: 0000000000000000(0000) GS:ffff888097ab9000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00000000f720eb00 CR3: 000000000e182000 CR4: 0000000000352ef0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n\nThere is a racing condition between workqueue created when enabling\nbearer and another thread created when disabling bearer right after\nthat as follow:\n\nenabling_bearer | disabling_bearer\n--------------- | ----------------\ntipc_disc_timeout() |\n{ | bearer_disable()\n ... | {\n schedule_work(\u0026amp;tn-\u0026gt;work); | tipc_mon_delete()\n ... | {\n} | ...\n | write_lock_bh(\u0026amp;mon-\u0026gt;lock);\n | mon-\u0026gt;self = NULL;\n | write_unlock_bh(\u0026amp;mon-\u0026gt;lock);\n | ...\n | }\ntipc_net_finalize_work() | }\n{ |\n ... |\n tipc_net_finalize() |\n { |\n ... |\n tipc_mon_reinit_self() |\n { |\n ... |\n write_lock_bh(\u0026amp;mon-\u0026gt;lock); |\n mon-\u0026gt;self-\u0026gt;addr = tipc_own_addr(net); |\n write_unlock_bh(\u0026amp;mon-\u0026gt;lock); |\n ... \n---truncated---(CVE-2025-37824)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: dsa: clean up FDB, MDB, VLAN entries on unbind\n\nAs explained in many places such as commit b117e1e8a86d (\u0026quot;net: dsa:\ndelete dsa_legacy_fdb_add and dsa_legacy_fdb_del\u0026quot;), DSA is written given\nthe assumption that higher layers have balanced additions/deletions.\nAs such, it only makes sense to be extremely vocal when those\nassumptions are violated and the driver unbinds with entries still\npresent.\n\nBut Ido Schimmel points out a very simple situation where that is wrong:\nhttps://lore.kernel.org/netdev/ZDazSM5UsPPjQuKr@shredder/\n(also briefly discussed by me in the aforementioned commit).\n\nBasically, while the bridge bypass operations are not something that DSA\nexplicitly documents, and for the majority of DSA drivers this API\nsimply causes them to go to promiscuous mode, that isn\u0026apos;t the case for\nall drivers. Some have the necessary requirements for bridge bypass\noperations to do something useful - see dsa_switch_supports_uc_filtering().\n\nAlthough in tools/testing/selftests/net/forwarding/local_termination.sh,\nwe made an effort to popularize better mechanisms to manage address\nfilters on DSA interfaces from user space - namely macvlan for unicast,\nand setsockopt(IP_ADD_MEMBERSHIP) - through mtools - for multicast, the\nfact is that \u0026apos;bridge fdb add ... self static local\u0026apos; also exists as\nkernel UAPI, and might be useful to someone, even if only for a quick\nhack.\n\nIt seems counter-productive to block that path by implementing shim\n.ndo_fdb_add and .ndo_fdb_del operations which just return -EOPNOTSUPP\nin order to prevent the ndo_dflt_fdb_add() and ndo_dflt_fdb_del() from\nrunning, although we could do that.\n\nAccepting that cleanup is necessary seems to be the only option.\nEspecially since we appear to be coming back at this from a different\nangle as well. Russell King is noticing that the WARN_ON() triggers even\nfor VLANs:\nhttps://lore.kernel.org/netdev/(CVE-2025-37864)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: dsa: mv88e6xxx: fix -ENOENT when deleting VLANs and MST is unsupported\n\nRussell King reports that on the ZII dev rev B, deleting a bridge VLAN\nfrom a user port fails with -ENOENT:\nhttps://lore.kernel.org/netdev/(CVE-2025-37865)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: pktgen: fix access outside of user given buffer in pktgen_thread_write()\n\nHonour the user given buffer size for the strn_len() calls (otherwise\nstrn_len() will access memory outside of the user given buffer).(CVE-2025-38061)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: target: iscsi: Fix timeout on deleted connection\n\nNOPIN response timer may expire on a deleted connection and crash with\nsuch logs:\n\nDid not receive response to NOPIN on CID: 0, failing connection for I_T Nexus (null),i,0x00023d000125,iqn.2017-01.com.iscsi.target,t,0x3d\n\nBUG: Kernel NULL pointer dereference on read at 0x00000000\nNIP strlcpy+0x8/0xb0\nLR iscsit_fill_cxn_timeout_err_stats+0x5c/0xc0 [iscsi_target_mod]\nCall Trace:\n iscsit_handle_nopin_response_timeout+0xfc/0x120 [iscsi_target_mod]\n call_timer_fn+0x58/0x1f0\n run_timer_softirq+0x740/0x860\n __do_softirq+0x16c/0x420\n irq_exit+0x188/0x1c0\n timer_interrupt+0x184/0x410\n\nThat is because nopin response timer may be re-started on nopin timer\nexpiration.\n\nStop nopin timer before stopping the nopin response timer to be sure\nthat no one of them will be re-started.(CVE-2025-38075)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: algif_hash - fix double free in hash_accept\n\nIf accept(2) is called on socket type algif_hash with\nMSG_MORE flag set and crypto_ahash_import fails,\nsk2 is freed. However, it is also freed in af_alg_release,\nleading to slab-use-after-free error.(CVE-2025-38079)\n\nA vulnerability was found in Linux Kernel (Operating System) and classified as problematic.The manipulation of the argument bNumDescriptors with an unknown input leads to a unknown weakness. Using CWE to declare the problem leads to CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.Impacted is confidentiality.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 7a6d6b68db128da2078ccd9a751dfa3f75c9cf5b/41827a2dbdd7880df9881506dee13bc88d4230bb/1df80d748f984290c895e843401824215dcfbfb0/a8f842534807985d3a676006d140541b87044345/4fa7831cf0ac71a0a345369d1a6084f2b096e55e/74388368927e9c52a69524af5bbd6c55eb4690de/485e1b741eb838cbe1d6b0e81e5ab62ae6c095cf/fe7f7ac8e0c708446ff017453add769ffc15deed is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38103)\n\nA vulnerability was found in Linux Kernel up to 6.16-rc1 (Operating System). It has been classified as critical.CWE is classifying the issue as CWE-404. The product does not release or incorrectly releases a resource before it is made available for re-use.This is going to have an impact on availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc2 eliminates this vulnerability. Applying the patch c337efb20d6d9f9bbb4746f6b119917af5c886dc/b44f791f27b14c9eb6b907fbe51f2ba8bec32085/5814a7fc3abb41f63f2d44c9d3ff9d4e62965b72/9c19498bdd7cb9d854bd3c54260f71cf7408495e/b4e9bab6011b9559b7c157b16b91ae46d4d8c533/d1bc80da75c789f2f6830df89d91fb2f7a509943/82448d4dcd8406dec688632a405fdcf7f170ec69/82ffbe7776d0ac084031f114167712269bf3d832 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38115)\n\nA vulnerability, which was classified as critical, has been found in Linux Kernel up to 6.6.93/6.12.33/6.15.2/6.16-rc1 (Operating System).Using CWE to declare the problem leads to CWE-416. Referencing memory after it has been freed can cause a program to crash, use unexpected values, or execute code.Impacted is confidentiality, integrity, and availability.Upgrading to version 6.6.94, 6.12.34, 6.15.3 or 6.16-rc2 eliminates this vulnerability. Applying the patch bdd56875c6926d8009914f427df71797693e90d4/4e83f2dbb2bf677e614109df24426c4dded472d4/d7882db79135c829a922daf3571f33ea1e056ae3/6fe26f694c824b8a4dbf50c635bee1302e3f099c is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38117)\n\nA vulnerability, which was classified as problematic, was found in Linux Kernel up to 8058c88ac0df21239daee54b5934d5c80ca9685f (Operating System).CWE is classifying the issue as CWE-401. The product does not sufficiently track and release allocated memory after it has been used, which slowly consumes remaining memory.This is going to have an impact on confidentiality.Upgrading to version 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch b5ad58285f9217d68cd5ea2ad86ce254a3fe7c4d/90bc7f5a244aadee4292b28098b7c98aadd4b3aa/39bab2d3517b5b50c609b4f8c66129bf619fffa0/251496ce1728c9fd47bd2b20a7b21b20b9a020ca/8068e1e42b46518ce680dc6470bcd710efc3fa0a/ea77c397bff8b6d59f6d83dae1425b08f465e8b5 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38120)\n\nA vulnerability classified as problematic has been found in Linux Kernel (Operating System).This is going to have an impact on confidentiality, integrity, and availability.Upgrading to version 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 0e65f38bd1aa14ea86e221b7bb814d38278d86c3/85eef1748c024da1a191aed56b30a3a65958c50c/4399f59a9467a324ed46657555f0e1f209a14acb/a04302867094bdc6efac1b598370fc47cf3f2388/3382a1ed7f778db841063f5d7e317ac55f9e7f72 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38124)\n\nA vulnerability, which was classified as problematic, has been found in Linux Kernel up to 6.6.93/6.12.33/6.15.2 (Operating System).Using CWE to declare the problem leads to CWE-371.Impacted is confidentiality, integrity, and availability.Upgrading to version 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 1d3c5d0dec6797eca3a861dab0816fa9505d9c3e/276849954d7cbe6eec827b21fe2df43f9bf07011/0e061abaad1498c5b76c10c594d4359ceb6b9145/0153f36041b8e52019ebfa8629c13bf8f9b0a951 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38127)\n\nA vulnerability has been found in Linux Kernel up to 6.15.2 (Operating System) and classified as problematic.The CWE definition for the vulnerability is CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.As an impact it is known to affect confidentiality, integrity, and availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch e5ce9df1d68094d37360dbd9b09289d42fa21e54/7ee3fb6258da8c890a51b514f60d7570dc703605/40471b23147c86ea3ed97faee79937c618250bd0/5482ef9875eaa43f0435e14570e1193823de857e/ee5ee646385f5846dcbc881389f3c44a197c402a/5a85c21f812e02cb00ca07007d88acdd42d08c46/ac4e317a95a1092b5da5b9918b7118759342641c is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-19787).(CVE-2025-38157)\n\nA vulnerability classified as problematic was found in Linux Kernel up to 6.15.3 (Operating System).As an impact it is known to affect confidentiality, integrity, and availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch d9a55869d8237e677ddaa18b0f58586364cfbc1c/1f6332872374b7f482fc4ad865f9422fedb587fc/fbfe8446cd3274b9e367f5708d94574230a44409/5018d035530b6fbfad33eeb1dd1bc87da419a276/a87cbcc909ccfd394d4936a94663f586453d0961/aaa644e7ffff02e12c89cbce4753bc0b6f23ff87/d14cbed4baccd712447fb3f9c011f008b56b2097/42cb74a92adaf88061039601ddf7c874f58b554e is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-20037).(CVE-2025-38219)\n\nA vulnerability, which was classified as critical, has been found in Linux Kernel up to 6.6.94/6.12.34/6.15.3 (Operating System).Using CWE to declare the problem leads to CWE-476. A NULL pointer dereference occurs when the application dereferences a pointer that it expects to be valid, but is NULL, typically causing a crash or exit.Impacted is availability.Upgrading to version 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch cf6a4c4ac7b6e3214f25df594c9689a62f1bb456/be5f3061a6f904e3674257879e71881ceee5b673/d7af6eee8cd60f55aa8c5fe2b91f11ec0c9a0f27/e26268ff1dcae5662c1b96c35f18cfa6ab73d9de is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.The vulnerability is also documented in the vulnerability database at EUVD (EUVD-2025-20036).(CVE-2025-38220)\n\nLinux kernel is the kernel used by Linux, the open source operating system of the Linux Foundation in the United States.\n There is a security vulnerability in Linux kernel. This vulnerability originates from improper processing of composing size in vivid drivers, which may lead to over-bounds writing.(CVE-2025-38226)\n\nA vulnerability, which was classified as problematic, was found in Linux Kernel up to 32700ecf8007e071d1ce4c78f65b85f46d05f32a (Operating System).The manipulation of the argument adxl_component_count with an unknown input leads to a unknown weakness. CWE is classifying the issue as CWE-125. The product reads data past the end, or before the beginning, of the intended buffer.This is going to have an impact on confidentiality.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.94, 6.12.34, 6.15.3 or 6.16-rc1 eliminates this vulnerability. Applying the patch 80bf28fd623d97dd4f4825fbbe9d736cec2afba3/a6ed3a6edff09c1187cc6ade7f5967bca2376a13/bf6a8502a5f4ff6e4d135d795945cdade49ec8b0/e8530ed3c0769a4d8f79c212715ec1cf277787f8/3f5d0659000923735350da60ad710f8c804544fe/a13e8343ffcff27af1ff79597ff7ba241e6d9471/31ef6f7c9aee3be78d63789653e92350f2537f93/20d2d476b3ae18041be423671a8637ed5ffd6958 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38298)\n\nA vulnerability classified as critical was found in Linux Kernel up to 6.15.3 (Operating System).The CWE definition for the vulnerability is CWE-476. A NULL pointer dereference occurs when the application dereferences a pointer that it expects to be valid, but is NULL, typically causing a crash or exit.As an impact it is known to affect availability.Upgrading to version 5.4.295, 5.10.239, 5.15.186, 6.1.142, 6.6.95, 6.12.35, 6.15.4 or 6.16-rc1 eliminates this vulnerability. Applying the patch 5c1a34ff5b0bfdfd2f9343aa9b08d25df618bac5/ec669e5bf409f16e464bfad75f0ba039a45de29a/43d5e3bb5f1dcd91e30238ea0b59a5f77063f84e/23361b479f2700c00960d3ae9cdc8ededa762d47/2e7c64d7a92c031d016f11c8e8cb05131ab7b75a/f78b38af3540b4875147b7b884ee11a27b3dbf4c/a377996d714afb8d4d5f4906336f78510039da29/af98b0157adf6504fade79b3e6cb260c4ff68e37 is able to eliminate this problem. The bugfix is ready for download at git.kernel.org. The best possible mitigation is suggested to be upgrading to the latest version.(CVE-2025-38337)",
"id": "OESA-2025-1880",
"modified": "2026-08-06T11:08:58Z",
"published": "2025-07-25T11:08:58Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2025-1880"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-58237"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21960"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21961"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21975"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21997"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22004"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22050"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22053"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22054"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22055"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22058"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22062"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22103"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-22111"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-23142"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-23155"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37757"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37786"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37787"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37788"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37790"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37797"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37817"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37820"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37823"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37824"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37864"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37865"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38061"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38075"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38079"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38103"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38115"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38117"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38120"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38124"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38127"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38157"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38219"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38220"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38226"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38298"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38337"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:A/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2024-58237",
"CVE-2025-21960",
"CVE-2025-21961",
"CVE-2025-21975",
"CVE-2025-21997",
"CVE-2025-22004",
"CVE-2025-22050",
"CVE-2025-22053",
"CVE-2025-22054",
"CVE-2025-22055",
"CVE-2025-22058",
"CVE-2025-22062",
"CVE-2025-22103",
"CVE-2025-22111",
"CVE-2025-23142",
"CVE-2025-23155",
"CVE-2025-37757",
"CVE-2025-37786",
"CVE-2025-37787",
"CVE-2025-37788",
"CVE-2025-37790",
"CVE-2025-37797",
"CVE-2025-37817",
"CVE-2025-37820",
"CVE-2025-37823",
"CVE-2025-37824",
"CVE-2025-37864",
"CVE-2025-37865",
"CVE-2025-38061",
"CVE-2025-38075",
"CVE-2025-38079",
"CVE-2025-38103",
"CVE-2025-38115",
"CVE-2025-38117",
"CVE-2025-38120",
"CVE-2025-38124",
"CVE-2025-38127",
"CVE-2025-38157",
"CVE-2025-38219",
"CVE-2025-38220",
"CVE-2025-38226",
"CVE-2025-38298",
"CVE-2025-38337"
]
}
OESA-2025-2554 (CVE-2022-50306)
Vulnerability from osv_openeuler – Published: 2025-10-31 11:09 – Updated: 2026-08-06 11:09 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
ext4: fix potential out of bound read in ext4_fc_replay_scan()
For scan loop must ensure that at least EXT4_FC_TAG_BASE_LEN space. If remain space less than EXT4_FC_TAG_BASE_LEN which will lead to out of bound read when mounting corrupt file system image. ADD_RANGE/HEAD/TAIL is needed to add extra check when do journal scan, as this three tags will read data during scan, tag length couldn't less than data length which will read.(CVE-2022-50306)
A use-after-free vulnerability in the Linux kernel s netfilter: nf_tables component can be exploited to achieve local privilege escalation.Due to a race condition between nf_tables netlink control plane transaction and nft_set element garbage collection, it is possible to underflow the reference counter causing a use-after-free vulnerability.We recommend upgrading past commit 3e91b0ebd994635df2346353322ac51ce84ce6d8.(CVE-2023-4244)
In the Linux kernel, the following vulnerability has been resolved:
HID: multitouch: Correct devm device reference for hidinput input_dev name
Reference the HID device rather than the input device for the devm allocation of the input_dev name. Referencing the input_dev would lead to a use-after-free when the input_dev was unregistered and subsequently fires a uevent that depends on the name. At the point of firing the uevent, the name would be freed by devres management.
Use devm_kasprintf to simplify the logic for allocating memory and formatting the input_dev name string.(CVE-2023-53454)
In the Linux kernel, the following vulnerability has been resolved:
scsi: qla2xxx: Fix deletion race condition
System crash when using debug kernel due to link list corruption. The cause of the link list corruption is due to session deletion was allowed to queue up twice. Here's the internal trace that show the same port was allowed to double queue for deletion on different cpu.
20808683956 015 qla2xxx [0000:13:00.1]-e801:4: Scheduling sess ffff93ebf9306800 for deletion 50:06:0e:80:12:48:ff:50 fc4_type 1 20808683957 027 qla2xxx [0000:13:00.1]-e801:4: Scheduling sess ffff93ebf9306800 for deletion 50:06:0e:80:12:48:ff:50 fc4_type 1
Move the clearing/setting of deleted flag lock.(CVE-2023-53615)
In the Linux kernel, the following vulnerability has been resolved:
scsi: ses: Fix possible desc_ptr out-of-bounds accesses
Sanitize possible desc_ptr out-of-bounds accesses in ses_enclosure_data_process().(CVE-2023-53675)
In the Linux kernel, the following vulnerability has been resolved:
NFS: Fix a potential data corruption
We must ensure that the subrequests are joined back into the head before we can retransmit a request. If the head was not on the commit lists, because the server wrote it synchronously, we still need to add it back to the retransmission list. Add a call that mirrors the effect of nfs_cancel_remove_inode() for O_DIRECT.(CVE-2023-53711)
In the Linux kernel, the following vulnerability has been resolved: md: raid1: fix potential OOB in raid1_remove_disk(). If rddev->raid_disk is greater than mddev->raid_disks, there will be an out-of-bounds in raid1_remove_disk(). We have already found similar reports as follows: 1) commit d17f744e883b ("md-raid10: fix KASAN warning") 2) commit 1ebc2cec0b7d ("dm raid: fix KASAN warning in raid5_remove_disk"). Fix this bug by checking whether the "number" variable is valid.(CVE-2023-53722)
In the Linux kernel, the following vulnerability has been resolved:posix-timers: Ensure timer ID search-loop limit is validposix_timer_add() tries to allocate a posix timer ID by starting from thecached ID which was stored by the last successful allocation.This is done in a loop searching the ID space for a free slot one byone. The loop has to terminate when the search wrapped around to thestarting point.But that s racy vs. establishing the starting point. That is read outlockless, which leads to the following problem:CPU0 CPU1posix_timer_add() start = sig->posix_timer_id; lock(hash_lock); ... posix_timer_add() if (++sig->posix_timer_id < 0) start = sig->posix_timer_id; sig->posix_timer_id = 0;So CPU1 can observe a negative start value, i.e. -1, and the loop breaknever happens because the condition can never be true: if (sig->posix_timer_id == start) break;While this is unlikely to ever turn into an endless loop as the ID space ishuge (INT_MAX), the racy read of the start value caught the attention ofKCSAN and Dmitry unearthed that incorrectness.Rewrite it so that all id operations are under the hash lock.(CVE-2023-53728)
In the Linux kernel, the following vulnerability has been resolved:posix-clock: posix-clock: Fix unbalanced locking in pc_clock_settime()If get_clock_desc() succeeds, it calls fget() for the clockid s fd,and get the clk->rwsem read lock, so the error path should releasethe lock to make the lock balance and fput the clockid s fd to makethe refcount balance and release the fd related resource.However the below commit left the error path locked behind resulting inunbalanced locking. Check timespec64_valid_strict() beforeget_clock_desc() to fix it, because the ts is not changedafter that.pabeni@redhat.com: fixed commit message typo
In the Linux kernel, the following vulnerability has been resolved:sunrpc: fix one UAF issue caused by sunrpc kernel tcp socketBUG: KASAN: slab-use-after-free in tcp_write_timer_handler+0x156/0x3e0Read of size 1 at addr ffff888111f322cd by task swapper/0/0CPU: 0 UID: 0 PID: 0 Comm: swapper/0 Not tainted 6.12.0-rc4-dirty #7Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1Call Trace: <IRQ> dump_stack_lvl+0x68/0xa0 print_address_description.constprop.0+0x2c/0x3d0 print_report+0xb4/0x270 kasan_report+0xbd/0xf0 tcp_write_timer_handler+0x156/0x3e0 tcp_write_timer+0x66/0x170 call_timer_fn+0xfb/0x1d0 __run_timers+0x3f8/0x480 run_timer_softirq+0x9b/0x100 handle_softirqs+0x153/0x390 __irq_exit_rcu+0x103/0x120 irq_exit_rcu+0xe/0x20 sysvec_apic_timer_interrupt+0x76/0x90 </IRQ> <TASK> asm_sysvec_apic_timer_interrupt+0x1a/0x20RIP: 0010:default_idle+0xf/0x20Code: 4c 01 c7 4c 29 c2 e9 72 ff ff ff 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 f3 0f 1e fa 66 90 0f 00 2d 33 f8 25 00 fb f4 <fa> c3 cc cc cc cc 66 66 2e 0f 1f 84 00 00 00 00 00 90 90 90 90 90RSP: 0018:ffffffffa2007e28 EFLAGS: 00000242RAX: 00000000000f3b31 RBX: 1ffffffff4400fc7 RCX: ffffffffa09c3196RDX: 0000000000000000 RSI: 0000000000000000 RDI: ffffffff9f00590fRBP: 0000000000000000 R08: 0000000000000001 R09: ffffed102360835dR10: ffff88811b041aeb R11: 0000000000000001 R12: 0000000000000000R13: ffffffffa202d7c0 R14: 0000000000000000 R15: 00000000000147d0 default_idle_call+0x6b/0xa0 cpuidle_idle_call+0x1af/0x1f0 do_idle+0xbc/0x130 cpu_startup_entry+0x33/0x40 rest_init+0x11f/0x210 start_kernel+0x39a/0x420 x86_64_start_reservations+0x18/0x30 x86_64_start_kernel+0x97/0xa0 common_startup_64+0x13e/0x141 </TASK>Allocated by task 595: kasan_save_stack+0x24/0x50 kasan_save_track+0x14/0x30 __kasan_slab_alloc+0x87/0x90 kmem_cache_alloc_noprof+0x12b/0x3f0 copy_net_ns+0x94/0x380 create_new_namespaces+0x24c/0x500 unshare_nsproxy_namespaces+0x75/0xf0 ksys_unshare+0x24e/0x4f0 __x64_sys_unshare+0x1f/0x30 do_syscall_64+0x70/0x180 entry_SYSCALL_64_after_hwframe+0x76/0x7eFreed by task 100: kasan_save_stack+0x24/0x50 kasan_save_track+0x14/0x30 kasan_save_free_info+0x3b/0x60 __kasan_slab_free+0x54/0x70 kmem_cache_free+0x156/0x5d0 cleanup_net+0x5d3/0x670 process_one_work+0x776/0xa90 worker_thread+0x2e2/0x560 kthread+0x1a8/0x1f0 ret_from_fork+0x34/0x60 ret_from_fork_asm+0x1a/0x30Reproduction script:mkdir -p /mnt/nfssharemkdir -p /mnt/nfs/netns_1mkfs.ext4 /dev/sdbmount /dev/sdb /mnt/nfssharesystemctl restart nfs-serverchmod 777 /mnt/nfsshareexportfs -i -o rw,no_root_squash *:/mnt/nfsshareip netns add netns_1ip link add name veth_1_peer type veth peer veth_1ifconfig veth_1_peer 11.11.0.254 upip link set veth_1 netns netns_1ip netns exec netns_1 ifconfig veth_1 11.11.0.1ip netns exec netns_1 /root/iptables -A OUTPUT -d 11.11.0.254 -p tcp --tcp-flags FIN FIN -j DROP(note: In my environment, a DESTROY_CLIENTID operation is always sent immediately, breaking the nfs tcp connection.)ip netns exec netns_1 timeout -s 9 300 mount -t nfs -o proto=tcp,vers=4.1 11.11.0.254:/mnt/nfsshare /mnt/nfs/netns_1ip netns del netns_1The reason here is that the tcp socket in netns_1 (nfs side) has beenshutdown and closed (done in xs_destroy), but the FIN message (with ack)is discarded, and the nfsd side keeps sending retransmission messages.As a result, when the tcp sock in netns_1 processes the received message,it sends the message (FIN message) in the sending queue, and the tcp timeris re-established. When the network namespace is deleted, the net structureaccessed by tcp s timer handler function causes problems.To fix this problem, let s hold netns refcnt for the tcp kernel socket asdone in other modules. This is an ugly hack which can easily be backportedto earlier kernels. A proper fix which cleans up the interfaces willfollow, but may not be so easy to backport.(CVE-2024-53168)
In the Linux kernel, the following vulnerability has been resolved:vfio/pci: Properly hide first-in-list PCIe extended capabilityThere are cases where a PCIe extended capability should be hidden fromthe user. For example, an unknown capability (i.e., capability with IDgreater than PCI_EXT_CAP_ID_MAX) or a capability that is intentionallychosen to be hidden from the user.Hiding a capability is done by virtualizing and modifying the NextCapability Offset field of the previous capability so it points to thecapability after the one that should be hidden.The special case where the first capability in the list should be hiddenis handled differently because there is no previous capability that canbe modified. In this case, the capability ID and version are zeroedwhile leaving the next pointer intact. This hides the capability andleaves an anchor for the rest of the capability list.However, today, hiding the first capability in the list is not doneproperly if the capability is unknown, as structvfio_pci_core_device->pci_config_map is set to the capability ID duringinitialization but the capability ID is not properly checked later whenused in vfio_config_do_rw(). This leads to the following warning [1] andto an out-of-bounds access to ecap_perms array.Fix it by checking cap_id in vfio_config_do_rw(), and if it is greaterthan PCI_EXT_CAP_ID_MAX, use an alternative struct perm_bits for directread only access instead of the ecap_perms array.Note that this is safe since the above is the only case where cap_id canexceed PCI_EXT_CAP_ID_MAX (except for the special capabilities, whichare already checked before).[1]WARNING: CPU: 118 PID: 5329 at drivers/vfio/pci/vfio_pci_config.c:1900 vfio_pci_config_rw+0x395/0x430 [vfio_pci_core]CPU: 118 UID: 0 PID: 5329 Comm: simx-qemu-syste Not tainted 6.12.0+ #1(snip)Call Trace: <TASK> ? show_regs+0x69/0x80 ? __warn+0x8d/0x140 ? vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] ? report_bug+0x18f/0x1a0 ? handle_bug+0x63/0xa0 ? exc_invalid_op+0x19/0x70 ? asm_exc_invalid_op+0x1b/0x20 ? vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] ? vfio_pci_config_rw+0x244/0x430 [vfio_pci_core] vfio_pci_rw+0x101/0x1b0 [vfio_pci_core] vfio_pci_core_read+0x1d/0x30 [vfio_pci_core] vfio_device_fops_read+0x27/0x40 [vfio] vfs_read+0xbd/0x340 ? vfio_device_fops_unl_ioctl+0xbb/0x740 [vfio] ? __rseq_handle_notify_resume+0xa4/0x4b0 __x64_sys_pread64+0x96/0xc0 x64_sys_call+0x1c3d/0x20d0 do_syscall_64+0x4d/0x120 entry_SYSCALL_64_after_hwframe+0x76/0x7e(CVE-2024-53214)
In the Linux kernel, the following vulnerability has been resolved:net: ieee802154: do not leave a dangling sk pointer in ieee802154_create()sock_init_data() attaches the allocated sk object to the provided sockobject. If ieee802154_create() fails later, the allocated sk object isfreed, but the dangling pointer remains in the provided sock object, whichmay allow use-after-free.Clear the sk pointer in the sock object on error.(CVE-2024-56602)
In the Linux kernel, the following vulnerability has been resolved:drm/dp_mst: Fix MST sideband message body length checkFix the MST sideband message body length check, which must be at least 1byte accounting for the message body CRC (aka message data CRC) at theend of the message.This fixes a case where an MST branch device returns a header with acorrect header CRC (indicating a correctly received body length), withthe body length being incorrectly set to 0. This will later lead to amemory corruption in drm_dp_sideband_append_payload() and the followingerrors in dmesg: UBSAN: array-index-out-of-bounds in drivers/gpu/drm/display/drm_dp_mst_topology.c:786:25 index -1 is out of range for type u8 [48] Call Trace: drm_dp_sideband_append_payload+0x33d/0x350 [drm_display_helper] drm_dp_get_one_sb_msg+0x3ce/0x5f0 [drm_display_helper] drm_dp_mst_hpd_irq_handle_event+0xc8/0x1580 [drm_display_helper] memcpy: detected field-spanning write (size 18446744073709551615) of single field &msg->msg[msg->curlen] at drivers/gpu/drm/display/drm_dp_mst_topology.c:791 (size 256) Call Trace: drm_dp_sideband_append_payload+0x324/0x350 [drm_display_helper] drm_dp_get_one_sb_msg+0x3ce/0x5f0 [drm_display_helper] drm_dp_mst_hpd_irq_handle_event+0xc8/0x1580 drm_display_helper
In the Linux kernel, the following vulnerability has been resolved:iio: adc: at91: call input_free_device() on allocated iio_devCurrent implementation of at91_ts_register() calls input_free_deivce()on st->ts_input, however, the err label can be reached before theallocated iio_dev is stored to st->ts_input. Thus callinput_free_device() on input instead of st->ts_input.(CVE-2024-57904)
In the Linux kernel, the following vulnerability has been resolved:iio: adc: ti-ads8688: fix information leak in triggered bufferThe buffer local array is used to push data to user space from atriggered buffer, but it does not set values for inactive channels, asit only uses iio_for_each_active_channel() to assign new values.Initialize the array to zero before using it to avoid pushinguninitialized information to userspace.(CVE-2024-57906)
In the Linux kernel, the following vulnerability has been resolved:selinux: ignore unknown extended permissionsWhen evaluating extended permissions, ignore unknown permissions insteadof calling BUG(). This commit ensures that future permissions can beadded without interfering with older kernels.(CVE-2024-57931)
In the Linux kernel, the following vulnerability has been resolved:drm/amdgpu: Fix potential NULL pointer dereference in atomctrl_get_smc_sclk_range_tableThe function atomctrl_get_smc_sclk_range_table() does not check the returnvalue of smu_atom_get_data_table(). If smu_atom_get_data_table() fails toretrieve SMU_Info table, it returns NULL which is later dereferenced.Found by Linux Verification Center (linuxtesting.org) with SVACE.In practice this should never happen as this code only gets calledon polaris chips and the vbios data table will always be present onthose chips.(CVE-2024-58052)
In the Linux kernel, the following vulnerability has been resolved:PCI/ASPM: Fix link state exit during switch upstream function removalBefore 456d8aa37d0f ( PCI/ASPM: Disable ASPM on MFD function removal toavoid use-after-free ), we would free the ASPM link only after the lastfunction on the bus pertaining to the given link was removed.That was too late. If function 0 is removed before sibling function,link->downstream would point to free d memory after.After above change, we freed the ASPM parent link state upon any functionremoval on the bus pertaining to a given link.That is too early. If the link is to a PCIe switch with MFD on the upstreamport, then removing functions other than 0 first would free a link whichstill remains parent_link to the remaining downstream ports.The resulting GPFs are especially frequent during hot-unplug, becausepciehp removes devices on the link bus in reverse order.On that switch, function 0 is the virtual P2P bridge to the internal bus.Free exactly when function 0 is removed -- before the parent link isobsolete, but after all subordinate links are gone.kwilczynski: commit log
In the Linux kernel, the following vulnerability has been resolved:
bpf: consider that tail calls invalidate packet pointers
Tail-called programs could execute any of the helpers that invalidate packet pointers. Hence, conservatively assume that each tail call invalidates packet pointers.
Making the change in bpf_helper_changes_pkt_data() automatically makes use of check_cfg() logic that computes 'changes_pkt_data' effect for global sub-programs, such that the following program could be rejected:
int tail_call(struct __sk_buff *sk)
{
bpf_tail_call_static(sk, &jmp_table, 0);
return 0;
}
SEC("tc")
int not_safe(struct __sk_buff *sk)
{
int *p = (void *)(long)sk->data;
... make p valid ...
tail_call(sk);
*p = 42; /* this is unsafe */
...
}
The tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that can invalidate packet pointers. Otherwise, it can't be freplaced with tailcall_freplace.c:entry_freplace() that does a tail call.(CVE-2024-58237)
In the Linux kernel, the following vulnerability has been resolved:filemap: avoid truncating 64-bit offset to 32 bitsOn 32-bit kernels, folio_seek_hole_data() was inadvertently truncating a64-bit value to 32 bits, leading to a possible infinite loop when writingto an xfs filesystem.(CVE-2025-21665)
In the Linux kernel, the following vulnerability has been resolved:partitions: mac: fix handling of bogus partition tableFix several issues in partition probing: - The bailout for a bad partoffset must use put_dev_sector(), since the preceding read_part_sector() succeeded. - If the partition table claims a silly sector size like 0xfff bytes (which results in partition table entries straddling sector boundaries), bail out instead of accessing out-of-bounds memory. - We must not assume that the partition table contains proper NUL termination - use strnlen() and strncmp() instead of strlen() and strcmp().(CVE-2025-21772)
In the Linux kernel, the following vulnerability has been resolved:
net: hns3: fix oops when unload drivers paralleling
When unload hclge driver, it tries to disable sriov first for each ae_dev node from hnae3_ae_dev_list. If user unloads hns3 driver at the time, because it removes all the ae_dev nodes, and it may cause oops.
But we can't simply use hnae3_common_lock for this. Because in the process flow of pci_disable_sriov(), it will trigger the remove flow of VF, which will also take hnae3_common_lock.
To fixes it, introduce a new mutex to protect the unload process.(CVE-2025-21802)
In the Linux kernel, the following vulnerability has been resolved:
sctp: detect and prevent references to a freed transport in sendmsg
sctp_sendmsg() re-uses associations and transports when possible by doing a lookup based on the socket endpoint and the message destination address, and then sctp_sendmsg_to_asoc() sets the selected transport in all the message chunks to be sent.
There's a possible race condition if another thread triggers the removal of that selected transport, for instance, by explicitly unbinding an address with setsockopt(SCTP_SOCKOPT_BINDX_REM), after the chunks have been set up and before the message is sent. This can happen if the send buffer is full, during the period when the sender thread temporarily releases the socket lock in sctp_wait_for_sndbuf().
This causes the access to the transport data in sctp_outq_select_transport(), when the association outqueue is flushed, to result in a use-after-free read.
This change avoids this scenario by having sctp_transport_free() signal the freeing of the transport, tagging it as "dead". In order to do this, the patch restores the "dead" bit in struct sctp_transport, which was removed in commit 47faa1e4c50e ("sctp: remove the dead field of sctp_transport").
Then, in the scenario where the sender thread has released the socket lock in sctp_wait_for_sndbuf(), the bit is checked again after re-acquiring the socket lock to detect the deletion. This is done while holding a reference to the transport to prevent it from being freed in the process.
If the transport was deleted while the socket lock was relinquished, sctp_sendmsg_to_asoc() will return -EAGAIN to let userspace retry the send.
The bug was found by a private syzbot instance (see the error report [1] and the C reproducer that triggers it [2]).(CVE-2025-23142)
In the Linux kernel, the following vulnerability has been resolved:
net_sched: hfsc: Fix a potential UAF in hfsc_dequeue() too
Similarly to the previous patch, we need to safe guard hfsc_dequeue() too. But for this one, we don't have a reliable reproducer.(CVE-2025-37823)
In the Linux kernel, the following vulnerability has been resolved:
net_sched: drr: Fix double list add in class with netem as child qdisc
As described in Gerrard's report [1], there are use cases where a netem child qdisc will make the parent qdisc's enqueue callback reentrant. In the case of drr, there won't be a UAF, but the code will add the same classifier to the list twice, which will cause memory corruption.
In addition to checking for qlen being zero, this patch checks whether the class was already added to the active_list (cl_is_active) before adding to the list to cover for the reentrant case.
[1] https://lore.kernel.org/netdev/CAHcdcOm+03OD2j6R0=YHKqmy=VgJ8xEOKuP6c7mSgnp-TEJJbw@mail.gmail.com/(CVE-2025-37915)
In the Linux kernel, the following vulnerability has been resolved:
net_sched: Flush gso_skb list too during ->change()
Previously, when reducing a qdisc's limit via the ->change() operation, only the main skb queue was trimmed, potentially leaving packets in the gso_skb list. This could result in NULL pointer dereference when we only check sch->limit against sch->q.qlen.
This patch introduces a new helper, qdisc_dequeue_internal(), which ensures both the gso_skb list and the main queue are properly flushed when trimming excess packets. All relevant qdiscs (codel, fq, fq_codel, fq_pie, hhf, pie) are updated to use this helper in their ->change() routines.(CVE-2025-37992)
In the Linux kernel, the following vulnerability has been resolved:
nfsd: handle get_client_locked() failure in nfsd4_setclientid_confirm()
Lei Lu recently reported that nfsd4_setclientid_confirm() did not check the return value from get_client_locked(). a SETCLIENTID_CONFIRM could race with a confirmed client expiring and fail to get a reference. That could later lead to a UAF.
Fix this by getting a reference early in the case where there is an extant confirmed client. If that fails then treat it as if there were no confirmed client found at all.
In the case where the unconfirmed client is expiring, just fail and return the result from get_client_locked().(CVE-2025-38724)
Rejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2025-39898)
In the Linux kernel, the following vulnerability has been resolved: i40e: fix idx validation in config queues msg. Ensure idx is within range of active/initialized TCs when iterating over vf->ch[idx] in i40e_vc_config_queues_msg().(CVE-2025-39971)
In the Linux kernel, a buffer overflow vulnerability exists in the target_lu_gp_members_show function in target_core_configfs.c. The vulnerability arises from the usage of snprintf to write into the buffer "buf" without checking the return value length. When the total formatted string length exceeds LU_GROUP_NAME_BUF (256 bytes), it may cause a buffer overflow. Since snprintf() returns the total number of bytes that would have been written, this value may exceed the buffer length (256 bytes) passed to memcpy(), ultimately causing the memcpy function to report a buffer overflow error. Adding an additional check of the return value of snprintf() can avoid this buffer overflow.(CVE-2025-39998)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm",
"kernel-debuginfo-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm",
"kernel-debugsource-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm",
"kernel-devel-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm",
"kernel-headers-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm",
"kernel-source-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm",
"kernel-tools-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm",
"kernel-tools-devel-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm",
"perf-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm",
"perf-debuginfo-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm",
"python3-perf-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-287.0.0.189.oe2203sp3.aarch64.rpm"
],
"src": [
"kernel-5.10.0-287.0.0.189.oe2203sp3.src.rpm"
],
"x86_64": [
"kernel-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm",
"kernel-debuginfo-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm",
"kernel-debugsource-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm",
"kernel-devel-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm",
"kernel-headers-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm",
"kernel-source-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm",
"kernel-tools-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm",
"kernel-tools-devel-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm",
"perf-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm",
"perf-debuginfo-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm",
"python3-perf-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-287.0.0.189.oe2203sp3.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP3",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP3"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-287.0.0.189.oe2203sp3"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\next4: fix potential out of bound read in ext4_fc_replay_scan()\n\nFor scan loop must ensure that at least EXT4_FC_TAG_BASE_LEN space. If remain\nspace less than EXT4_FC_TAG_BASE_LEN which will lead to out of bound read\nwhen mounting corrupt file system image.\nADD_RANGE/HEAD/TAIL is needed to add extra check when do journal scan, as this\nthree tags will read data during scan, tag length couldn\u0026apos;t less than data length\nwhich will read.(CVE-2022-50306)\n\nA use-after-free vulnerability in the Linux kernel s netfilter: nf_tables component can be exploited to achieve local privilege escalation.Due to a race condition between nf_tables netlink control plane transaction and nft_set element garbage collection, it is possible to underflow the reference counter causing a use-after-free vulnerability.We recommend upgrading past commit 3e91b0ebd994635df2346353322ac51ce84ce6d8.(CVE-2023-4244)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nHID: multitouch: Correct devm device reference for hidinput input_dev name\n\nReference the HID device rather than the input device for the devm\nallocation of the input_dev name. Referencing the input_dev would lead to a\nuse-after-free when the input_dev was unregistered and subsequently fires a\nuevent that depends on the name. At the point of firing the uevent, the\nname would be freed by devres management.\n\nUse devm_kasprintf to simplify the logic for allocating memory and\nformatting the input_dev name string.(CVE-2023-53454)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: qla2xxx: Fix deletion race condition\n\nSystem crash when using debug kernel due to link list corruption. The cause\nof the link list corruption is due to session deletion was allowed to queue\nup twice. Here\u0026apos;s the internal trace that show the same port was allowed to\ndouble queue for deletion on different cpu.\n\n20808683956 015 qla2xxx [0000:13:00.1]-e801:4: Scheduling sess ffff93ebf9306800 for deletion 50:06:0e:80:12:48:ff:50 fc4_type 1\n20808683957 027 qla2xxx [0000:13:00.1]-e801:4: Scheduling sess ffff93ebf9306800 for deletion 50:06:0e:80:12:48:ff:50 fc4_type 1\n\nMove the clearing/setting of deleted flag lock.(CVE-2023-53615)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: ses: Fix possible desc_ptr out-of-bounds accesses\n\nSanitize possible desc_ptr out-of-bounds accesses in\nses_enclosure_data_process().(CVE-2023-53675)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nNFS: Fix a potential data corruption\n\nWe must ensure that the subrequests are joined back into the head before we can retransmit a request. If the head was not on the commit lists, because the server wrote it synchronously, we still need to add it back to the retransmission list.\nAdd a call that mirrors the effect of nfs_cancel_remove_inode() for O_DIRECT.(CVE-2023-53711)\n\nIn the Linux kernel, the following vulnerability has been resolved: md: raid1: fix potential OOB in raid1_remove_disk(). If rddev-\u0026gt;raid_disk is greater than mddev-\u0026gt;raid_disks, there will be an out-of-bounds in raid1_remove_disk(). We have already found similar reports as follows: 1) commit d17f744e883b (\u0026quot;md-raid10: fix KASAN warning\u0026quot;) 2) commit 1ebc2cec0b7d (\u0026quot;dm raid: fix KASAN warning in raid5_remove_disk\u0026quot;). Fix this bug by checking whether the \u0026quot;number\u0026quot; variable is valid.(CVE-2023-53722)\n\nIn the Linux kernel, the following vulnerability has been resolved:posix-timers: Ensure timer ID search-loop limit is validposix_timer_add() tries to allocate a posix timer ID by starting from thecached ID which was stored by the last successful allocation.This is done in a loop searching the ID space for a free slot one byone. The loop has to terminate when the search wrapped around to thestarting point.But that s racy vs. establishing the starting point. That is read outlockless, which leads to the following problem:CPU0 CPU1posix_timer_add() start = sig-\u0026gt;posix_timer_id; lock(hash_lock); ... posix_timer_add() if (++sig-\u0026gt;posix_timer_id \u0026lt; 0) start = sig-\u0026gt;posix_timer_id; sig-\u0026gt;posix_timer_id = 0;So CPU1 can observe a negative start value, i.e. -1, and the loop breaknever happens because the condition can never be true: if (sig-\u0026gt;posix_timer_id == start) break;While this is unlikely to ever turn into an endless loop as the ID space ishuge (INT_MAX), the racy read of the start value caught the attention ofKCSAN and Dmitry unearthed that incorrectness.Rewrite it so that all id operations are under the hash lock.(CVE-2023-53728)\n\nIn the Linux kernel, the following vulnerability has been resolved:posix-clock: posix-clock: Fix unbalanced locking in pc_clock_settime()If get_clock_desc() succeeds, it calls fget() for the clockid s fd,and get the clk-\u0026gt;rwsem read lock, so the error path should releasethe lock to make the lock balance and fput the clockid s fd to makethe refcount balance and release the fd related resource.However the below commit left the error path locked behind resulting inunbalanced locking. Check timespec64_valid_strict() beforeget_clock_desc() to fix it, because the ts is not changedafter that.[pabeni@redhat.com: fixed commit message typo](CVE-2024-50210)\n\nIn the Linux kernel, the following vulnerability has been resolved:sunrpc: fix one UAF issue caused by sunrpc kernel tcp socketBUG: KASAN: slab-use-after-free in tcp_write_timer_handler+0x156/0x3e0Read of size 1 at addr ffff888111f322cd by task swapper/0/0CPU: 0 UID: 0 PID: 0 Comm: swapper/0 Not tainted 6.12.0-rc4-dirty #7Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1Call Trace: \u0026lt;IRQ\u0026gt; dump_stack_lvl+0x68/0xa0 print_address_description.constprop.0+0x2c/0x3d0 print_report+0xb4/0x270 kasan_report+0xbd/0xf0 tcp_write_timer_handler+0x156/0x3e0 tcp_write_timer+0x66/0x170 call_timer_fn+0xfb/0x1d0 __run_timers+0x3f8/0x480 run_timer_softirq+0x9b/0x100 handle_softirqs+0x153/0x390 __irq_exit_rcu+0x103/0x120 irq_exit_rcu+0xe/0x20 sysvec_apic_timer_interrupt+0x76/0x90 \u0026lt;/IRQ\u0026gt; \u0026lt;TASK\u0026gt; asm_sysvec_apic_timer_interrupt+0x1a/0x20RIP: 0010:default_idle+0xf/0x20Code: 4c 01 c7 4c 29 c2 e9 72 ff ff ff 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 f3 0f 1e fa 66 90 0f 00 2d 33 f8 25 00 fb f4 \u0026lt;fa\u0026gt; c3 cc cc cc cc 66 66 2e 0f 1f 84 00 00 00 00 00 90 90 90 90 90RSP: 0018:ffffffffa2007e28 EFLAGS: 00000242RAX: 00000000000f3b31 RBX: 1ffffffff4400fc7 RCX: ffffffffa09c3196RDX: 0000000000000000 RSI: 0000000000000000 RDI: ffffffff9f00590fRBP: 0000000000000000 R08: 0000000000000001 R09: ffffed102360835dR10: ffff88811b041aeb R11: 0000000000000001 R12: 0000000000000000R13: ffffffffa202d7c0 R14: 0000000000000000 R15: 00000000000147d0 default_idle_call+0x6b/0xa0 cpuidle_idle_call+0x1af/0x1f0 do_idle+0xbc/0x130 cpu_startup_entry+0x33/0x40 rest_init+0x11f/0x210 start_kernel+0x39a/0x420 x86_64_start_reservations+0x18/0x30 x86_64_start_kernel+0x97/0xa0 common_startup_64+0x13e/0x141 \u0026lt;/TASK\u0026gt;Allocated by task 595: kasan_save_stack+0x24/0x50 kasan_save_track+0x14/0x30 __kasan_slab_alloc+0x87/0x90 kmem_cache_alloc_noprof+0x12b/0x3f0 copy_net_ns+0x94/0x380 create_new_namespaces+0x24c/0x500 unshare_nsproxy_namespaces+0x75/0xf0 ksys_unshare+0x24e/0x4f0 __x64_sys_unshare+0x1f/0x30 do_syscall_64+0x70/0x180 entry_SYSCALL_64_after_hwframe+0x76/0x7eFreed by task 100: kasan_save_stack+0x24/0x50 kasan_save_track+0x14/0x30 kasan_save_free_info+0x3b/0x60 __kasan_slab_free+0x54/0x70 kmem_cache_free+0x156/0x5d0 cleanup_net+0x5d3/0x670 process_one_work+0x776/0xa90 worker_thread+0x2e2/0x560 kthread+0x1a8/0x1f0 ret_from_fork+0x34/0x60 ret_from_fork_asm+0x1a/0x30Reproduction script:mkdir -p /mnt/nfssharemkdir -p /mnt/nfs/netns_1mkfs.ext4 /dev/sdbmount /dev/sdb /mnt/nfssharesystemctl restart nfs-serverchmod 777 /mnt/nfsshareexportfs -i -o rw,no_root_squash *:/mnt/nfsshareip netns add netns_1ip link add name veth_1_peer type veth peer veth_1ifconfig veth_1_peer 11.11.0.254 upip link set veth_1 netns netns_1ip netns exec netns_1 ifconfig veth_1 11.11.0.1ip netns exec netns_1 /root/iptables -A OUTPUT -d 11.11.0.254 -p tcp --tcp-flags FIN FIN -j DROP(note: In my environment, a DESTROY_CLIENTID operation is always sent immediately, breaking the nfs tcp connection.)ip netns exec netns_1 timeout -s 9 300 mount -t nfs -o proto=tcp,vers=4.1 11.11.0.254:/mnt/nfsshare /mnt/nfs/netns_1ip netns del netns_1The reason here is that the tcp socket in netns_1 (nfs side) has beenshutdown and closed (done in xs_destroy), but the FIN message (with ack)is discarded, and the nfsd side keeps sending retransmission messages.As a result, when the tcp sock in netns_1 processes the received message,it sends the message (FIN message) in the sending queue, and the tcp timeris re-established. When the network namespace is deleted, the net structureaccessed by tcp s timer handler function causes problems.To fix this problem, let s hold netns refcnt for the tcp kernel socket asdone in other modules. This is an ugly hack which can easily be backportedto earlier kernels. A proper fix which cleans up the interfaces willfollow, but may not be so easy to backport.(CVE-2024-53168)\n\nIn the Linux kernel, the following vulnerability has been resolved:vfio/pci: Properly hide first-in-list PCIe extended capabilityThere are cases where a PCIe extended capability should be hidden fromthe user. For example, an unknown capability (i.e., capability with IDgreater than PCI_EXT_CAP_ID_MAX) or a capability that is intentionallychosen to be hidden from the user.Hiding a capability is done by virtualizing and modifying the NextCapability Offset field of the previous capability so it points to thecapability after the one that should be hidden.The special case where the first capability in the list should be hiddenis handled differently because there is no previous capability that canbe modified. In this case, the capability ID and version are zeroedwhile leaving the next pointer intact. This hides the capability andleaves an anchor for the rest of the capability list.However, today, hiding the first capability in the list is not doneproperly if the capability is unknown, as structvfio_pci_core_device-\u0026gt;pci_config_map is set to the capability ID duringinitialization but the capability ID is not properly checked later whenused in vfio_config_do_rw(). This leads to the following warning [1] andto an out-of-bounds access to ecap_perms array.Fix it by checking cap_id in vfio_config_do_rw(), and if it is greaterthan PCI_EXT_CAP_ID_MAX, use an alternative struct perm_bits for directread only access instead of the ecap_perms array.Note that this is safe since the above is the only case where cap_id canexceed PCI_EXT_CAP_ID_MAX (except for the special capabilities, whichare already checked before).[1]WARNING: CPU: 118 PID: 5329 at drivers/vfio/pci/vfio_pci_config.c:1900 vfio_pci_config_rw+0x395/0x430 [vfio_pci_core]CPU: 118 UID: 0 PID: 5329 Comm: simx-qemu-syste Not tainted 6.12.0+ #1(snip)Call Trace: \u0026lt;TASK\u0026gt; ? show_regs+0x69/0x80 ? __warn+0x8d/0x140 ? vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] ? report_bug+0x18f/0x1a0 ? handle_bug+0x63/0xa0 ? exc_invalid_op+0x19/0x70 ? asm_exc_invalid_op+0x1b/0x20 ? vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] ? vfio_pci_config_rw+0x244/0x430 [vfio_pci_core] vfio_pci_rw+0x101/0x1b0 [vfio_pci_core] vfio_pci_core_read+0x1d/0x30 [vfio_pci_core] vfio_device_fops_read+0x27/0x40 [vfio] vfs_read+0xbd/0x340 ? vfio_device_fops_unl_ioctl+0xbb/0x740 [vfio] ? __rseq_handle_notify_resume+0xa4/0x4b0 __x64_sys_pread64+0x96/0xc0 x64_sys_call+0x1c3d/0x20d0 do_syscall_64+0x4d/0x120 entry_SYSCALL_64_after_hwframe+0x76/0x7e(CVE-2024-53214)\n\nIn the Linux kernel, the following vulnerability has been resolved:net: ieee802154: do not leave a dangling sk pointer in ieee802154_create()sock_init_data() attaches the allocated sk object to the provided sockobject. If ieee802154_create() fails later, the allocated sk object isfreed, but the dangling pointer remains in the provided sock object, whichmay allow use-after-free.Clear the sk pointer in the sock object on error.(CVE-2024-56602)\n\nIn the Linux kernel, the following vulnerability has been resolved:drm/dp_mst: Fix MST sideband message body length checkFix the MST sideband message body length check, which must be at least 1byte accounting for the message body CRC (aka message data CRC) at theend of the message.This fixes a case where an MST branch device returns a header with acorrect header CRC (indicating a correctly received body length), withthe body length being incorrectly set to 0. This will later lead to amemory corruption in drm_dp_sideband_append_payload() and the followingerrors in dmesg: UBSAN: array-index-out-of-bounds in drivers/gpu/drm/display/drm_dp_mst_topology.c:786:25 index -1 is out of range for type u8 [48] Call Trace: drm_dp_sideband_append_payload+0x33d/0x350 [drm_display_helper] drm_dp_get_one_sb_msg+0x3ce/0x5f0 [drm_display_helper] drm_dp_mst_hpd_irq_handle_event+0xc8/0x1580 [drm_display_helper] memcpy: detected field-spanning write (size 18446744073709551615) of single field \u0026amp;msg-\u0026gt;msg[msg-\u0026gt;curlen] at drivers/gpu/drm/display/drm_dp_mst_topology.c:791 (size 256) Call Trace: drm_dp_sideband_append_payload+0x324/0x350 [drm_display_helper] drm_dp_get_one_sb_msg+0x3ce/0x5f0 [drm_display_helper] drm_dp_mst_hpd_irq_handle_event+0xc8/0x1580 [drm_display_helper](CVE-2024-56616)\n\nIn the Linux kernel, the following vulnerability has been resolved:iio: adc: at91: call input_free_device() on allocated iio_devCurrent implementation of at91_ts_register() calls input_free_deivce()on st-\u0026gt;ts_input, however, the err label can be reached before theallocated iio_dev is stored to st-\u0026gt;ts_input. Thus callinput_free_device() on input instead of st-\u0026gt;ts_input.(CVE-2024-57904)\n\nIn the Linux kernel, the following vulnerability has been resolved:iio: adc: ti-ads8688: fix information leak in triggered bufferThe buffer local array is used to push data to user space from atriggered buffer, but it does not set values for inactive channels, asit only uses iio_for_each_active_channel() to assign new values.Initialize the array to zero before using it to avoid pushinguninitialized information to userspace.(CVE-2024-57906)\n\nIn the Linux kernel, the following vulnerability has been resolved:selinux: ignore unknown extended permissionsWhen evaluating extended permissions, ignore unknown permissions insteadof calling BUG(). This commit ensures that future permissions can beadded without interfering with older kernels.(CVE-2024-57931)\n\nIn the Linux kernel, the following vulnerability has been resolved:drm/amdgpu: Fix potential NULL pointer dereference in atomctrl_get_smc_sclk_range_tableThe function atomctrl_get_smc_sclk_range_table() does not check the returnvalue of smu_atom_get_data_table(). If smu_atom_get_data_table() fails toretrieve SMU_Info table, it returns NULL which is later dereferenced.Found by Linux Verification Center (linuxtesting.org) with SVACE.In practice this should never happen as this code only gets calledon polaris chips and the vbios data table will always be present onthose chips.(CVE-2024-58052)\n\nIn the Linux kernel, the following vulnerability has been resolved:PCI/ASPM: Fix link state exit during switch upstream function removalBefore 456d8aa37d0f ( PCI/ASPM: Disable ASPM on MFD function removal toavoid use-after-free ), we would free the ASPM link only after the lastfunction on the bus pertaining to the given link was removed.That was too late. If function 0 is removed before sibling function,link-\u0026gt;downstream would point to free d memory after.After above change, we freed the ASPM parent link state upon any functionremoval on the bus pertaining to a given link.That is too early. If the link is to a PCIe switch with MFD on the upstreamport, then removing functions other than 0 first would free a link whichstill remains parent_link to the remaining downstream ports.The resulting GPFs are especially frequent during hot-unplug, becausepciehp removes devices on the link bus in reverse order.On that switch, function 0 is the virtual P2P bridge to the internal bus.Free exactly when function 0 is removed -- before the parent link isobsolete, but after all subordinate links are gone.[kwilczynski: commit log](CVE-2024-58093)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbpf: consider that tail calls invalidate packet pointers\n\nTail-called programs could execute any of the helpers that invalidate\npacket pointers. Hence, conservatively assume that each tail call\ninvalidates packet pointers.\n\nMaking the change in bpf_helper_changes_pkt_data() automatically makes\nuse of check_cfg() logic that computes \u0026apos;changes_pkt_data\u0026apos; effect for\nglobal sub-programs, such that the following program could be\nrejected:\n\n int tail_call(struct __sk_buff *sk)\n {\n \tbpf_tail_call_static(sk, \u0026amp;jmp_table, 0);\n \treturn 0;\n }\n\n SEC(\u0026quot;tc\u0026quot;)\n int not_safe(struct __sk_buff *sk)\n {\n \tint *p = (void *)(long)sk-\u0026gt;data;\n \t... make p valid ...\n \ttail_call(sk);\n \t*p = 42; /* this is unsafe */\n \t...\n }\n\nThe tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that\ncan invalidate packet pointers. Otherwise, it can\u0026apos;t be freplaced with\ntailcall_freplace.c:entry_freplace() that does a tail call.(CVE-2024-58237)\n\nIn the Linux kernel, the following vulnerability has been resolved:filemap: avoid truncating 64-bit offset to 32 bitsOn 32-bit kernels, folio_seek_hole_data() was inadvertently truncating a64-bit value to 32 bits, leading to a possible infinite loop when writingto an xfs filesystem.(CVE-2025-21665)\n\nIn the Linux kernel, the following vulnerability has been resolved:partitions: mac: fix handling of bogus partition tableFix several issues in partition probing: - The bailout for a bad partoffset must use put_dev_sector(), since the preceding read_part_sector() succeeded. - If the partition table claims a silly sector size like 0xfff bytes (which results in partition table entries straddling sector boundaries), bail out instead of accessing out-of-bounds memory. - We must not assume that the partition table contains proper NUL termination - use strnlen() and strncmp() instead of strlen() and strcmp().(CVE-2025-21772)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: hns3: fix oops when unload drivers paralleling\n\nWhen unload hclge driver, it tries to disable sriov first for each\nae_dev node from hnae3_ae_dev_list. If user unloads hns3 driver at\nthe time, because it removes all the ae_dev nodes, and it may cause\noops.\n\nBut we can\u0026apos;t simply use hnae3_common_lock for this. Because in the\nprocess flow of pci_disable_sriov(), it will trigger the remove flow\nof VF, which will also take hnae3_common_lock.\n\nTo fixes it, introduce a new mutex to protect the unload process.(CVE-2025-21802)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: detect and prevent references to a freed transport in sendmsg\n\nsctp_sendmsg() re-uses associations and transports when possible by\ndoing a lookup based on the socket endpoint and the message destination\naddress, and then sctp_sendmsg_to_asoc() sets the selected transport in\nall the message chunks to be sent.\n\nThere\u0026apos;s a possible race condition if another thread triggers the removal\nof that selected transport, for instance, by explicitly unbinding an\naddress with setsockopt(SCTP_SOCKOPT_BINDX_REM), after the chunks have\nbeen set up and before the message is sent. This can happen if the send\nbuffer is full, during the period when the sender thread temporarily\nreleases the socket lock in sctp_wait_for_sndbuf().\n\nThis causes the access to the transport data in\nsctp_outq_select_transport(), when the association outqueue is flushed,\nto result in a use-after-free read.\n\nThis change avoids this scenario by having sctp_transport_free() signal\nthe freeing of the transport, tagging it as \u0026quot;dead\u0026quot;. In order to do this,\nthe patch restores the \u0026quot;dead\u0026quot; bit in struct sctp_transport, which was\nremoved in\ncommit 47faa1e4c50e (\u0026quot;sctp: remove the dead field of sctp_transport\u0026quot;).\n\nThen, in the scenario where the sender thread has released the socket\nlock in sctp_wait_for_sndbuf(), the bit is checked again after\nre-acquiring the socket lock to detect the deletion. This is done while\nholding a reference to the transport to prevent it from being freed in\nthe process.\n\nIf the transport was deleted while the socket lock was relinquished,\nsctp_sendmsg_to_asoc() will return -EAGAIN to let userspace retry the\nsend.\n\nThe bug was found by a private syzbot instance (see the error report [1]\nand the C reproducer that triggers it [2]).(CVE-2025-23142)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet_sched: hfsc: Fix a potential UAF in hfsc_dequeue() too\n\nSimilarly to the previous patch, we need to safe guard hfsc_dequeue()\ntoo. But for this one, we don\u0026apos;t have a reliable reproducer.(CVE-2025-37823)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet_sched: drr: Fix double list add in class with netem as child qdisc\n\nAs described in Gerrard\u0026apos;s report [1], there are use cases where a netem\nchild qdisc will make the parent qdisc\u0026apos;s enqueue callback reentrant.\nIn the case of drr, there won\u0026apos;t be a UAF, but the code will add the same\nclassifier to the list twice, which will cause memory corruption.\n\nIn addition to checking for qlen being zero, this patch checks whether the\nclass was already added to the active_list (cl_is_active) before adding\nto the list to cover for the reentrant case.\n\n[1] https://lore.kernel.org/netdev/CAHcdcOm+03OD2j6R0=YHKqmy=VgJ8xEOKuP6c7mSgnp-TEJJbw@mail.gmail.com/(CVE-2025-37915)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet_sched: Flush gso_skb list too during -\u0026gt;change()\n\nPreviously, when reducing a qdisc\u0026apos;s limit via the -\u0026gt;change() operation, only\nthe main skb queue was trimmed, potentially leaving packets in the gso_skb\nlist. This could result in NULL pointer dereference when we only check\nsch-\u0026gt;limit against sch-\u0026gt;q.qlen.\n\nThis patch introduces a new helper, qdisc_dequeue_internal(), which ensures\nboth the gso_skb list and the main queue are properly flushed when trimming\nexcess packets. All relevant qdiscs (codel, fq, fq_codel, fq_pie, hhf, pie)\nare updated to use this helper in their -\u0026gt;change() routines.(CVE-2025-37992)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnfsd: handle get_client_locked() failure in nfsd4_setclientid_confirm()\n\nLei Lu recently reported that nfsd4_setclientid_confirm() did not check\nthe return value from get_client_locked(). a SETCLIENTID_CONFIRM could\nrace with a confirmed client expiring and fail to get a reference. That\ncould later lead to a UAF.\n\nFix this by getting a reference early in the case where there is an\nextant confirmed client. If that fails then treat it as if there were no\nconfirmed client found at all.\n\nIn the case where the unconfirmed client is expiring, just fail and\nreturn the result from get_client_locked().(CVE-2025-38724)\n\nRejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2025-39898)\n\nIn the Linux kernel, the following vulnerability has been resolved: i40e: fix idx validation in config queues msg. Ensure idx is within range of active/initialized TCs when iterating over vf-\u0026gt;ch[idx] in i40e_vc_config_queues_msg().(CVE-2025-39971)\n\nIn the Linux kernel, a buffer overflow vulnerability exists in the target_lu_gp_members_show function in target_core_configfs.c. The vulnerability arises from the usage of snprintf to write into the buffer \u0026quot;buf\u0026quot; without checking the return value length. When the total formatted string length exceeds LU_GROUP_NAME_BUF (256 bytes), it may cause a buffer overflow. Since snprintf() returns the total number of bytes that would have been written, this value may exceed the buffer length (256 bytes) passed to memcpy(), ultimately causing the memcpy function to report a buffer overflow error. Adding an additional check of the return value of snprintf() can avoid this buffer overflow.(CVE-2025-39998)",
"id": "OESA-2025-2554",
"modified": "2026-08-06T11:09:38Z",
"published": "2025-10-31T11:09:38Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2025-2554"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50306"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-4244"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53454"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53615"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53675"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53711"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53722"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53728"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50210"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53168"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53214"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56602"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56616"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-57904"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-57906"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-57931"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-58052"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-58093"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-58237"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21665"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21772"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21802"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-23142"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37823"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37915"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37992"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38724"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39898"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39971"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39998"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2022-50306",
"CVE-2023-4244",
"CVE-2023-53454",
"CVE-2023-53615",
"CVE-2023-53675",
"CVE-2023-53711",
"CVE-2023-53722",
"CVE-2023-53728",
"CVE-2024-50210",
"CVE-2024-53168",
"CVE-2024-53214",
"CVE-2024-56602",
"CVE-2024-56616",
"CVE-2024-57904",
"CVE-2024-57906",
"CVE-2024-57931",
"CVE-2024-58052",
"CVE-2024-58093",
"CVE-2024-58237",
"CVE-2025-21665",
"CVE-2025-21772",
"CVE-2025-21802",
"CVE-2025-23142",
"CVE-2025-37823",
"CVE-2025-37915",
"CVE-2025-37992",
"CVE-2025-38724",
"CVE-2025-39898",
"CVE-2025-39971",
"CVE-2025-39998"
]
}
OESA-2025-2555 (CVE-2022-50306)
Vulnerability from osv_openeuler – Published: 2025-10-31 11:09 – Updated: 2026-08-06 11:09 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
ext4: fix potential out of bound read in ext4_fc_replay_scan()
For scan loop must ensure that at least EXT4_FC_TAG_BASE_LEN space. If remain space less than EXT4_FC_TAG_BASE_LEN which will lead to out of bound read when mounting corrupt file system image. ADD_RANGE/HEAD/TAIL is needed to add extra check when do journal scan, as this three tags will read data during scan, tag length couldn't less than data length which will read.(CVE-2022-50306)
In the Linux kernel, the following vulnerability has been resolved:posix-timers: Ensure timer ID search-loop limit is validposix_timer_add() tries to allocate a posix timer ID by starting from thecached ID which was stored by the last successful allocation.This is done in a loop searching the ID space for a free slot one byone. The loop has to terminate when the search wrapped around to thestarting point.But that s racy vs. establishing the starting point. That is read outlockless, which leads to the following problem:CPU0 CPU1posix_timer_add() start = sig->posix_timer_id; lock(hash_lock); ... posix_timer_add() if (++sig->posix_timer_id < 0) start = sig->posix_timer_id; sig->posix_timer_id = 0;So CPU1 can observe a negative start value, i.e. -1, and the loop breaknever happens because the condition can never be true: if (sig->posix_timer_id == start) break;While this is unlikely to ever turn into an endless loop as the ID space ishuge (INT_MAX), the racy read of the start value caught the attention ofKCSAN and Dmitry unearthed that incorrectness.Rewrite it so that all id operations are under the hash lock.(CVE-2023-53728)
In the Linux kernel, the following vulnerability has been resolved:posix-clock: posix-clock: Fix unbalanced locking in pc_clock_settime()If get_clock_desc() succeeds, it calls fget() for the clockid s fd,and get the clk->rwsem read lock, so the error path should releasethe lock to make the lock balance and fput the clockid s fd to makethe refcount balance and release the fd related resource.However the below commit left the error path locked behind resulting inunbalanced locking. Check timespec64_valid_strict() beforeget_clock_desc() to fix it, because the ts is not changedafter that.pabeni@redhat.com: fixed commit message typo
In the Linux kernel, the following vulnerability has been resolved:sunrpc: fix one UAF issue caused by sunrpc kernel tcp socketBUG: KASAN: slab-use-after-free in tcp_write_timer_handler+0x156/0x3e0Read of size 1 at addr ffff888111f322cd by task swapper/0/0CPU: 0 UID: 0 PID: 0 Comm: swapper/0 Not tainted 6.12.0-rc4-dirty #7Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1Call Trace: <IRQ> dump_stack_lvl+0x68/0xa0 print_address_description.constprop.0+0x2c/0x3d0 print_report+0xb4/0x270 kasan_report+0xbd/0xf0 tcp_write_timer_handler+0x156/0x3e0 tcp_write_timer+0x66/0x170 call_timer_fn+0xfb/0x1d0 __run_timers+0x3f8/0x480 run_timer_softirq+0x9b/0x100 handle_softirqs+0x153/0x390 __irq_exit_rcu+0x103/0x120 irq_exit_rcu+0xe/0x20 sysvec_apic_timer_interrupt+0x76/0x90 </IRQ> <TASK> asm_sysvec_apic_timer_interrupt+0x1a/0x20RIP: 0010:default_idle+0xf/0x20Code: 4c 01 c7 4c 29 c2 e9 72 ff ff ff 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 f3 0f 1e fa 66 90 0f 00 2d 33 f8 25 00 fb f4 <fa> c3 cc cc cc cc 66 66 2e 0f 1f 84 00 00 00 00 00 90 90 90 90 90RSP: 0018:ffffffffa2007e28 EFLAGS: 00000242RAX: 00000000000f3b31 RBX: 1ffffffff4400fc7 RCX: ffffffffa09c3196RDX: 0000000000000000 RSI: 0000000000000000 RDI: ffffffff9f00590fRBP: 0000000000000000 R08: 0000000000000001 R09: ffffed102360835dR10: ffff88811b041aeb R11: 0000000000000001 R12: 0000000000000000R13: ffffffffa202d7c0 R14: 0000000000000000 R15: 00000000000147d0 default_idle_call+0x6b/0xa0 cpuidle_idle_call+0x1af/0x1f0 do_idle+0xbc/0x130 cpu_startup_entry+0x33/0x40 rest_init+0x11f/0x210 start_kernel+0x39a/0x420 x86_64_start_reservations+0x18/0x30 x86_64_start_kernel+0x97/0xa0 common_startup_64+0x13e/0x141 </TASK>Allocated by task 595: kasan_save_stack+0x24/0x50 kasan_save_track+0x14/0x30 __kasan_slab_alloc+0x87/0x90 kmem_cache_alloc_noprof+0x12b/0x3f0 copy_net_ns+0x94/0x380 create_new_namespaces+0x24c/0x500 unshare_nsproxy_namespaces+0x75/0xf0 ksys_unshare+0x24e/0x4f0 __x64_sys_unshare+0x1f/0x30 do_syscall_64+0x70/0x180 entry_SYSCALL_64_after_hwframe+0x76/0x7eFreed by task 100: kasan_save_stack+0x24/0x50 kasan_save_track+0x14/0x30 kasan_save_free_info+0x3b/0x60 __kasan_slab_free+0x54/0x70 kmem_cache_free+0x156/0x5d0 cleanup_net+0x5d3/0x670 process_one_work+0x776/0xa90 worker_thread+0x2e2/0x560 kthread+0x1a8/0x1f0 ret_from_fork+0x34/0x60 ret_from_fork_asm+0x1a/0x30Reproduction script:mkdir -p /mnt/nfssharemkdir -p /mnt/nfs/netns_1mkfs.ext4 /dev/sdbmount /dev/sdb /mnt/nfssharesystemctl restart nfs-serverchmod 777 /mnt/nfsshareexportfs -i -o rw,no_root_squash *:/mnt/nfsshareip netns add netns_1ip link add name veth_1_peer type veth peer veth_1ifconfig veth_1_peer 11.11.0.254 upip link set veth_1 netns netns_1ip netns exec netns_1 ifconfig veth_1 11.11.0.1ip netns exec netns_1 /root/iptables -A OUTPUT -d 11.11.0.254 -p tcp --tcp-flags FIN FIN -j DROP(note: In my environment, a DESTROY_CLIENTID operation is always sent immediately, breaking the nfs tcp connection.)ip netns exec netns_1 timeout -s 9 300 mount -t nfs -o proto=tcp,vers=4.1 11.11.0.254:/mnt/nfsshare /mnt/nfs/netns_1ip netns del netns_1The reason here is that the tcp socket in netns_1 (nfs side) has beenshutdown and closed (done in xs_destroy), but the FIN message (with ack)is discarded, and the nfsd side keeps sending retransmission messages.As a result, when the tcp sock in netns_1 processes the received message,it sends the message (FIN message) in the sending queue, and the tcp timeris re-established. When the network namespace is deleted, the net structureaccessed by tcp s timer handler function causes problems.To fix this problem, let s hold netns refcnt for the tcp kernel socket asdone in other modules. This is an ugly hack which can easily be backportedto earlier kernels. A proper fix which cleans up the interfaces willfollow, but may not be so easy to backport.(CVE-2024-53168)
In the Linux kernel, the following vulnerability has been resolved:vfio/pci: Properly hide first-in-list PCIe extended capabilityThere are cases where a PCIe extended capability should be hidden fromthe user. For example, an unknown capability (i.e., capability with IDgreater than PCI_EXT_CAP_ID_MAX) or a capability that is intentionallychosen to be hidden from the user.Hiding a capability is done by virtualizing and modifying the NextCapability Offset field of the previous capability so it points to thecapability after the one that should be hidden.The special case where the first capability in the list should be hiddenis handled differently because there is no previous capability that canbe modified. In this case, the capability ID and version are zeroedwhile leaving the next pointer intact. This hides the capability andleaves an anchor for the rest of the capability list.However, today, hiding the first capability in the list is not doneproperly if the capability is unknown, as structvfio_pci_core_device->pci_config_map is set to the capability ID duringinitialization but the capability ID is not properly checked later whenused in vfio_config_do_rw(). This leads to the following warning [1] andto an out-of-bounds access to ecap_perms array.Fix it by checking cap_id in vfio_config_do_rw(), and if it is greaterthan PCI_EXT_CAP_ID_MAX, use an alternative struct perm_bits for directread only access instead of the ecap_perms array.Note that this is safe since the above is the only case where cap_id canexceed PCI_EXT_CAP_ID_MAX (except for the special capabilities, whichare already checked before).[1]WARNING: CPU: 118 PID: 5329 at drivers/vfio/pci/vfio_pci_config.c:1900 vfio_pci_config_rw+0x395/0x430 [vfio_pci_core]CPU: 118 UID: 0 PID: 5329 Comm: simx-qemu-syste Not tainted 6.12.0+ #1(snip)Call Trace: <TASK> ? show_regs+0x69/0x80 ? __warn+0x8d/0x140 ? vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] ? report_bug+0x18f/0x1a0 ? handle_bug+0x63/0xa0 ? exc_invalid_op+0x19/0x70 ? asm_exc_invalid_op+0x1b/0x20 ? vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] ? vfio_pci_config_rw+0x244/0x430 [vfio_pci_core] vfio_pci_rw+0x101/0x1b0 [vfio_pci_core] vfio_pci_core_read+0x1d/0x30 [vfio_pci_core] vfio_device_fops_read+0x27/0x40 [vfio] vfs_read+0xbd/0x340 ? vfio_device_fops_unl_ioctl+0xbb/0x740 [vfio] ? __rseq_handle_notify_resume+0xa4/0x4b0 __x64_sys_pread64+0x96/0xc0 x64_sys_call+0x1c3d/0x20d0 do_syscall_64+0x4d/0x120 entry_SYSCALL_64_after_hwframe+0x76/0x7e(CVE-2024-53214)
In the Linux kernel, the following vulnerability has been resolved:net: ieee802154: do not leave a dangling sk pointer in ieee802154_create()sock_init_data() attaches the allocated sk object to the provided sockobject. If ieee802154_create() fails later, the allocated sk object isfreed, but the dangling pointer remains in the provided sock object, whichmay allow use-after-free.Clear the sk pointer in the sock object on error.(CVE-2024-56602)
In the Linux kernel, the following vulnerability has been resolved:drm/dp_mst: Fix MST sideband message body length checkFix the MST sideband message body length check, which must be at least 1byte accounting for the message body CRC (aka message data CRC) at theend of the message.This fixes a case where an MST branch device returns a header with acorrect header CRC (indicating a correctly received body length), withthe body length being incorrectly set to 0. This will later lead to amemory corruption in drm_dp_sideband_append_payload() and the followingerrors in dmesg: UBSAN: array-index-out-of-bounds in drivers/gpu/drm/display/drm_dp_mst_topology.c:786:25 index -1 is out of range for type u8 [48] Call Trace: drm_dp_sideband_append_payload+0x33d/0x350 [drm_display_helper] drm_dp_get_one_sb_msg+0x3ce/0x5f0 [drm_display_helper] drm_dp_mst_hpd_irq_handle_event+0xc8/0x1580 [drm_display_helper] memcpy: detected field-spanning write (size 18446744073709551615) of single field &msg->msg[msg->curlen] at drivers/gpu/drm/display/drm_dp_mst_topology.c:791 (size 256) Call Trace: drm_dp_sideband_append_payload+0x324/0x350 [drm_display_helper] drm_dp_get_one_sb_msg+0x3ce/0x5f0 [drm_display_helper] drm_dp_mst_hpd_irq_handle_event+0xc8/0x1580 drm_display_helper
In the Linux kernel, the following vulnerability has been resolved:iio: adc: at91: call input_free_device() on allocated iio_devCurrent implementation of at91_ts_register() calls input_free_deivce()on st->ts_input, however, the err label can be reached before theallocated iio_dev is stored to st->ts_input. Thus callinput_free_device() on input instead of st->ts_input.(CVE-2024-57904)
In the Linux kernel, the following vulnerability has been resolved:iio: adc: ti-ads8688: fix information leak in triggered bufferThe buffer local array is used to push data to user space from atriggered buffer, but it does not set values for inactive channels, asit only uses iio_for_each_active_channel() to assign new values.Initialize the array to zero before using it to avoid pushinguninitialized information to userspace.(CVE-2024-57906)
In the Linux kernel, the following vulnerability has been resolved:selinux: ignore unknown extended permissionsWhen evaluating extended permissions, ignore unknown permissions insteadof calling BUG(). This commit ensures that future permissions can beadded without interfering with older kernels.(CVE-2024-57931)
In the Linux kernel, the following vulnerability has been resolved:drm/amdgpu: Fix potential NULL pointer dereference in atomctrl_get_smc_sclk_range_tableThe function atomctrl_get_smc_sclk_range_table() does not check the returnvalue of smu_atom_get_data_table(). If smu_atom_get_data_table() fails toretrieve SMU_Info table, it returns NULL which is later dereferenced.Found by Linux Verification Center (linuxtesting.org) with SVACE.In practice this should never happen as this code only gets calledon polaris chips and the vbios data table will always be present onthose chips.(CVE-2024-58052)
In the Linux kernel, the following vulnerability has been resolved:PCI/ASPM: Fix link state exit during switch upstream function removalBefore 456d8aa37d0f ( PCI/ASPM: Disable ASPM on MFD function removal toavoid use-after-free ), we would free the ASPM link only after the lastfunction on the bus pertaining to the given link was removed.That was too late. If function 0 is removed before sibling function,link->downstream would point to free d memory after.After above change, we freed the ASPM parent link state upon any functionremoval on the bus pertaining to a given link.That is too early. If the link is to a PCIe switch with MFD on the upstreamport, then removing functions other than 0 first would free a link whichstill remains parent_link to the remaining downstream ports.The resulting GPFs are especially frequent during hot-unplug, becausepciehp removes devices on the link bus in reverse order.On that switch, function 0 is the virtual P2P bridge to the internal bus.Free exactly when function 0 is removed -- before the parent link isobsolete, but after all subordinate links are gone.kwilczynski: commit log
In the Linux kernel, the following vulnerability has been resolved:
bpf: consider that tail calls invalidate packet pointers
Tail-called programs could execute any of the helpers that invalidate packet pointers. Hence, conservatively assume that each tail call invalidates packet pointers.
Making the change in bpf_helper_changes_pkt_data() automatically makes use of check_cfg() logic that computes 'changes_pkt_data' effect for global sub-programs, such that the following program could be rejected:
int tail_call(struct __sk_buff *sk)
{
bpf_tail_call_static(sk, &jmp_table, 0);
return 0;
}
SEC("tc")
int not_safe(struct __sk_buff *sk)
{
int *p = (void *)(long)sk->data;
... make p valid ...
tail_call(sk);
*p = 42; /* this is unsafe */
...
}
The tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that can invalidate packet pointers. Otherwise, it can't be freplaced with tailcall_freplace.c:entry_freplace() that does a tail call.(CVE-2024-58237)
In the Linux kernel, the following vulnerability has been resolved:filemap: avoid truncating 64-bit offset to 32 bitsOn 32-bit kernels, folio_seek_hole_data() was inadvertently truncating a64-bit value to 32 bits, leading to a possible infinite loop when writingto an xfs filesystem.(CVE-2025-21665)
In the Linux kernel, the following vulnerability has been resolved:partitions: mac: fix handling of bogus partition tableFix several issues in partition probing: - The bailout for a bad partoffset must use put_dev_sector(), since the preceding read_part_sector() succeeded. - If the partition table claims a silly sector size like 0xfff bytes (which results in partition table entries straddling sector boundaries), bail out instead of accessing out-of-bounds memory. - We must not assume that the partition table contains proper NUL termination - use strnlen() and strncmp() instead of strlen() and strcmp().(CVE-2025-21772)
In the Linux kernel, the following vulnerability has been resolved:
net: hns3: fix oops when unload drivers paralleling
When unload hclge driver, it tries to disable sriov first for each ae_dev node from hnae3_ae_dev_list. If user unloads hns3 driver at the time, because it removes all the ae_dev nodes, and it may cause oops.
But we can't simply use hnae3_common_lock for this. Because in the process flow of pci_disable_sriov(), it will trigger the remove flow of VF, which will also take hnae3_common_lock.
To fixes it, introduce a new mutex to protect the unload process.(CVE-2025-21802)
In the Linux kernel, the following vulnerability has been resolved:
sctp: detect and prevent references to a freed transport in sendmsg
sctp_sendmsg() re-uses associations and transports when possible by doing a lookup based on the socket endpoint and the message destination address, and then sctp_sendmsg_to_asoc() sets the selected transport in all the message chunks to be sent.
There's a possible race condition if another thread triggers the removal of that selected transport, for instance, by explicitly unbinding an address with setsockopt(SCTP_SOCKOPT_BINDX_REM), after the chunks have been set up and before the message is sent. This can happen if the send buffer is full, during the period when the sender thread temporarily releases the socket lock in sctp_wait_for_sndbuf().
This causes the access to the transport data in sctp_outq_select_transport(), when the association outqueue is flushed, to result in a use-after-free read.
This change avoids this scenario by having sctp_transport_free() signal the freeing of the transport, tagging it as "dead". In order to do this, the patch restores the "dead" bit in struct sctp_transport, which was removed in commit 47faa1e4c50e ("sctp: remove the dead field of sctp_transport").
Then, in the scenario where the sender thread has released the socket lock in sctp_wait_for_sndbuf(), the bit is checked again after re-acquiring the socket lock to detect the deletion. This is done while holding a reference to the transport to prevent it from being freed in the process.
If the transport was deleted while the socket lock was relinquished, sctp_sendmsg_to_asoc() will return -EAGAIN to let userspace retry the send.
The bug was found by a private syzbot instance (see the error report [1] and the C reproducer that triggers it [2]).(CVE-2025-23142)
In the Linux kernel, the following vulnerability has been resolved:
net_sched: hfsc: Fix a potential UAF in hfsc_dequeue() too
Similarly to the previous patch, we need to safe guard hfsc_dequeue() too. But for this one, we don't have a reliable reproducer.(CVE-2025-37823)
In the Linux kernel, the following vulnerability has been resolved:
net_sched: drr: Fix double list add in class with netem as child qdisc
As described in Gerrard's report [1], there are use cases where a netem child qdisc will make the parent qdisc's enqueue callback reentrant. In the case of drr, there won't be a UAF, but the code will add the same classifier to the list twice, which will cause memory corruption.
In addition to checking for qlen being zero, this patch checks whether the class was already added to the active_list (cl_is_active) before adding to the list to cover for the reentrant case.
[1] https://lore.kernel.org/netdev/CAHcdcOm+03OD2j6R0=YHKqmy=VgJ8xEOKuP6c7mSgnp-TEJJbw@mail.gmail.com/(CVE-2025-37915)
In the Linux kernel, the following vulnerability has been resolved:
net_sched: Flush gso_skb list too during ->change()
Previously, when reducing a qdisc's limit via the ->change() operation, only the main skb queue was trimmed, potentially leaving packets in the gso_skb list. This could result in NULL pointer dereference when we only check sch->limit against sch->q.qlen.
This patch introduces a new helper, qdisc_dequeue_internal(), which ensures both the gso_skb list and the main queue are properly flushed when trimming excess packets. All relevant qdiscs (codel, fq, fq_codel, fq_pie, hhf, pie) are updated to use this helper in their ->change() routines.(CVE-2025-37992)
In the Linux kernel, the following vulnerability has been resolved:
nfsd: handle get_client_locked() failure in nfsd4_setclientid_confirm()
Lei Lu recently reported that nfsd4_setclientid_confirm() did not check the return value from get_client_locked(). a SETCLIENTID_CONFIRM could race with a confirmed client expiring and fail to get a reference. That could later lead to a UAF.
Fix this by getting a reference early in the case where there is an extant confirmed client. If that fails then treat it as if there were no confirmed client found at all.
In the case where the unconfirmed client is expiring, just fail and return the result from get_client_locked().(CVE-2025-38724)
Rejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2025-39898)
In the Linux kernel, the following vulnerability has been resolved: i40e: fix idx validation in config queues msg. Ensure idx is within range of active/initialized TCs when iterating over vf->ch[idx] in i40e_vc_config_queues_msg().(CVE-2025-39971)
In the Linux kernel, a buffer overflow vulnerability exists in the target_lu_gp_members_show function in target_core_configfs.c. The vulnerability arises from the usage of snprintf to write into the buffer "buf" without checking the return value length. When the total formatted string length exceeds LU_GROUP_NAME_BUF (256 bytes), it may cause a buffer overflow. Since snprintf() returns the total number of bytes that would have been written, this value may exceed the buffer length (256 bytes) passed to memcpy(), ultimately causing the memcpy function to report a buffer overflow error. Adding an additional check of the return value of snprintf() can avoid this buffer overflow.(CVE-2025-39998)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"bpftool-debuginfo-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"kernel-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"kernel-debuginfo-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"kernel-debugsource-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"kernel-devel-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"kernel-headers-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"kernel-source-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"kernel-tools-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"kernel-tools-devel-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"perf-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"perf-debuginfo-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"python3-perf-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-287.0.0.190.oe2203sp4.aarch64.rpm"
],
"src": [
"kernel-5.10.0-287.0.0.190.oe2203sp4.src.rpm"
],
"x86_64": [
"bpftool-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"bpftool-debuginfo-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"kernel-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"kernel-debuginfo-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"kernel-debugsource-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"kernel-devel-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"kernel-headers-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"kernel-source-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"kernel-tools-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"kernel-tools-devel-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"perf-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"perf-debuginfo-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"python3-perf-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-287.0.0.190.oe2203sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-287.0.0.190.oe2203sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\next4: fix potential out of bound read in ext4_fc_replay_scan()\n\nFor scan loop must ensure that at least EXT4_FC_TAG_BASE_LEN space. If remain\nspace less than EXT4_FC_TAG_BASE_LEN which will lead to out of bound read\nwhen mounting corrupt file system image.\nADD_RANGE/HEAD/TAIL is needed to add extra check when do journal scan, as this\nthree tags will read data during scan, tag length couldn\u0026apos;t less than data length\nwhich will read.(CVE-2022-50306)\n\nIn the Linux kernel, the following vulnerability has been resolved:posix-timers: Ensure timer ID search-loop limit is validposix_timer_add() tries to allocate a posix timer ID by starting from thecached ID which was stored by the last successful allocation.This is done in a loop searching the ID space for a free slot one byone. The loop has to terminate when the search wrapped around to thestarting point.But that s racy vs. establishing the starting point. That is read outlockless, which leads to the following problem:CPU0 CPU1posix_timer_add() start = sig-\u0026gt;posix_timer_id; lock(hash_lock); ... posix_timer_add() if (++sig-\u0026gt;posix_timer_id \u0026lt; 0) start = sig-\u0026gt;posix_timer_id; sig-\u0026gt;posix_timer_id = 0;So CPU1 can observe a negative start value, i.e. -1, and the loop breaknever happens because the condition can never be true: if (sig-\u0026gt;posix_timer_id == start) break;While this is unlikely to ever turn into an endless loop as the ID space ishuge (INT_MAX), the racy read of the start value caught the attention ofKCSAN and Dmitry unearthed that incorrectness.Rewrite it so that all id operations are under the hash lock.(CVE-2023-53728)\n\nIn the Linux kernel, the following vulnerability has been resolved:posix-clock: posix-clock: Fix unbalanced locking in pc_clock_settime()If get_clock_desc() succeeds, it calls fget() for the clockid s fd,and get the clk-\u0026gt;rwsem read lock, so the error path should releasethe lock to make the lock balance and fput the clockid s fd to makethe refcount balance and release the fd related resource.However the below commit left the error path locked behind resulting inunbalanced locking. Check timespec64_valid_strict() beforeget_clock_desc() to fix it, because the ts is not changedafter that.[pabeni@redhat.com: fixed commit message typo](CVE-2024-50210)\n\nIn the Linux kernel, the following vulnerability has been resolved:sunrpc: fix one UAF issue caused by sunrpc kernel tcp socketBUG: KASAN: slab-use-after-free in tcp_write_timer_handler+0x156/0x3e0Read of size 1 at addr ffff888111f322cd by task swapper/0/0CPU: 0 UID: 0 PID: 0 Comm: swapper/0 Not tainted 6.12.0-rc4-dirty #7Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1Call Trace: \u0026lt;IRQ\u0026gt; dump_stack_lvl+0x68/0xa0 print_address_description.constprop.0+0x2c/0x3d0 print_report+0xb4/0x270 kasan_report+0xbd/0xf0 tcp_write_timer_handler+0x156/0x3e0 tcp_write_timer+0x66/0x170 call_timer_fn+0xfb/0x1d0 __run_timers+0x3f8/0x480 run_timer_softirq+0x9b/0x100 handle_softirqs+0x153/0x390 __irq_exit_rcu+0x103/0x120 irq_exit_rcu+0xe/0x20 sysvec_apic_timer_interrupt+0x76/0x90 \u0026lt;/IRQ\u0026gt; \u0026lt;TASK\u0026gt; asm_sysvec_apic_timer_interrupt+0x1a/0x20RIP: 0010:default_idle+0xf/0x20Code: 4c 01 c7 4c 29 c2 e9 72 ff ff ff 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 f3 0f 1e fa 66 90 0f 00 2d 33 f8 25 00 fb f4 \u0026lt;fa\u0026gt; c3 cc cc cc cc 66 66 2e 0f 1f 84 00 00 00 00 00 90 90 90 90 90RSP: 0018:ffffffffa2007e28 EFLAGS: 00000242RAX: 00000000000f3b31 RBX: 1ffffffff4400fc7 RCX: ffffffffa09c3196RDX: 0000000000000000 RSI: 0000000000000000 RDI: ffffffff9f00590fRBP: 0000000000000000 R08: 0000000000000001 R09: ffffed102360835dR10: ffff88811b041aeb R11: 0000000000000001 R12: 0000000000000000R13: ffffffffa202d7c0 R14: 0000000000000000 R15: 00000000000147d0 default_idle_call+0x6b/0xa0 cpuidle_idle_call+0x1af/0x1f0 do_idle+0xbc/0x130 cpu_startup_entry+0x33/0x40 rest_init+0x11f/0x210 start_kernel+0x39a/0x420 x86_64_start_reservations+0x18/0x30 x86_64_start_kernel+0x97/0xa0 common_startup_64+0x13e/0x141 \u0026lt;/TASK\u0026gt;Allocated by task 595: kasan_save_stack+0x24/0x50 kasan_save_track+0x14/0x30 __kasan_slab_alloc+0x87/0x90 kmem_cache_alloc_noprof+0x12b/0x3f0 copy_net_ns+0x94/0x380 create_new_namespaces+0x24c/0x500 unshare_nsproxy_namespaces+0x75/0xf0 ksys_unshare+0x24e/0x4f0 __x64_sys_unshare+0x1f/0x30 do_syscall_64+0x70/0x180 entry_SYSCALL_64_after_hwframe+0x76/0x7eFreed by task 100: kasan_save_stack+0x24/0x50 kasan_save_track+0x14/0x30 kasan_save_free_info+0x3b/0x60 __kasan_slab_free+0x54/0x70 kmem_cache_free+0x156/0x5d0 cleanup_net+0x5d3/0x670 process_one_work+0x776/0xa90 worker_thread+0x2e2/0x560 kthread+0x1a8/0x1f0 ret_from_fork+0x34/0x60 ret_from_fork_asm+0x1a/0x30Reproduction script:mkdir -p /mnt/nfssharemkdir -p /mnt/nfs/netns_1mkfs.ext4 /dev/sdbmount /dev/sdb /mnt/nfssharesystemctl restart nfs-serverchmod 777 /mnt/nfsshareexportfs -i -o rw,no_root_squash *:/mnt/nfsshareip netns add netns_1ip link add name veth_1_peer type veth peer veth_1ifconfig veth_1_peer 11.11.0.254 upip link set veth_1 netns netns_1ip netns exec netns_1 ifconfig veth_1 11.11.0.1ip netns exec netns_1 /root/iptables -A OUTPUT -d 11.11.0.254 -p tcp --tcp-flags FIN FIN -j DROP(note: In my environment, a DESTROY_CLIENTID operation is always sent immediately, breaking the nfs tcp connection.)ip netns exec netns_1 timeout -s 9 300 mount -t nfs -o proto=tcp,vers=4.1 11.11.0.254:/mnt/nfsshare /mnt/nfs/netns_1ip netns del netns_1The reason here is that the tcp socket in netns_1 (nfs side) has beenshutdown and closed (done in xs_destroy), but the FIN message (with ack)is discarded, and the nfsd side keeps sending retransmission messages.As a result, when the tcp sock in netns_1 processes the received message,it sends the message (FIN message) in the sending queue, and the tcp timeris re-established. When the network namespace is deleted, the net structureaccessed by tcp s timer handler function causes problems.To fix this problem, let s hold netns refcnt for the tcp kernel socket asdone in other modules. This is an ugly hack which can easily be backportedto earlier kernels. A proper fix which cleans up the interfaces willfollow, but may not be so easy to backport.(CVE-2024-53168)\n\nIn the Linux kernel, the following vulnerability has been resolved:vfio/pci: Properly hide first-in-list PCIe extended capabilityThere are cases where a PCIe extended capability should be hidden fromthe user. For example, an unknown capability (i.e., capability with IDgreater than PCI_EXT_CAP_ID_MAX) or a capability that is intentionallychosen to be hidden from the user.Hiding a capability is done by virtualizing and modifying the NextCapability Offset field of the previous capability so it points to thecapability after the one that should be hidden.The special case where the first capability in the list should be hiddenis handled differently because there is no previous capability that canbe modified. In this case, the capability ID and version are zeroedwhile leaving the next pointer intact. This hides the capability andleaves an anchor for the rest of the capability list.However, today, hiding the first capability in the list is not doneproperly if the capability is unknown, as structvfio_pci_core_device-\u0026gt;pci_config_map is set to the capability ID duringinitialization but the capability ID is not properly checked later whenused in vfio_config_do_rw(). This leads to the following warning [1] andto an out-of-bounds access to ecap_perms array.Fix it by checking cap_id in vfio_config_do_rw(), and if it is greaterthan PCI_EXT_CAP_ID_MAX, use an alternative struct perm_bits for directread only access instead of the ecap_perms array.Note that this is safe since the above is the only case where cap_id canexceed PCI_EXT_CAP_ID_MAX (except for the special capabilities, whichare already checked before).[1]WARNING: CPU: 118 PID: 5329 at drivers/vfio/pci/vfio_pci_config.c:1900 vfio_pci_config_rw+0x395/0x430 [vfio_pci_core]CPU: 118 UID: 0 PID: 5329 Comm: simx-qemu-syste Not tainted 6.12.0+ #1(snip)Call Trace: \u0026lt;TASK\u0026gt; ? show_regs+0x69/0x80 ? __warn+0x8d/0x140 ? vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] ? report_bug+0x18f/0x1a0 ? handle_bug+0x63/0xa0 ? exc_invalid_op+0x19/0x70 ? asm_exc_invalid_op+0x1b/0x20 ? vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] ? vfio_pci_config_rw+0x244/0x430 [vfio_pci_core] vfio_pci_rw+0x101/0x1b0 [vfio_pci_core] vfio_pci_core_read+0x1d/0x30 [vfio_pci_core] vfio_device_fops_read+0x27/0x40 [vfio] vfs_read+0xbd/0x340 ? vfio_device_fops_unl_ioctl+0xbb/0x740 [vfio] ? __rseq_handle_notify_resume+0xa4/0x4b0 __x64_sys_pread64+0x96/0xc0 x64_sys_call+0x1c3d/0x20d0 do_syscall_64+0x4d/0x120 entry_SYSCALL_64_after_hwframe+0x76/0x7e(CVE-2024-53214)\n\nIn the Linux kernel, the following vulnerability has been resolved:net: ieee802154: do not leave a dangling sk pointer in ieee802154_create()sock_init_data() attaches the allocated sk object to the provided sockobject. If ieee802154_create() fails later, the allocated sk object isfreed, but the dangling pointer remains in the provided sock object, whichmay allow use-after-free.Clear the sk pointer in the sock object on error.(CVE-2024-56602)\n\nIn the Linux kernel, the following vulnerability has been resolved:drm/dp_mst: Fix MST sideband message body length checkFix the MST sideband message body length check, which must be at least 1byte accounting for the message body CRC (aka message data CRC) at theend of the message.This fixes a case where an MST branch device returns a header with acorrect header CRC (indicating a correctly received body length), withthe body length being incorrectly set to 0. This will later lead to amemory corruption in drm_dp_sideband_append_payload() and the followingerrors in dmesg: UBSAN: array-index-out-of-bounds in drivers/gpu/drm/display/drm_dp_mst_topology.c:786:25 index -1 is out of range for type u8 [48] Call Trace: drm_dp_sideband_append_payload+0x33d/0x350 [drm_display_helper] drm_dp_get_one_sb_msg+0x3ce/0x5f0 [drm_display_helper] drm_dp_mst_hpd_irq_handle_event+0xc8/0x1580 [drm_display_helper] memcpy: detected field-spanning write (size 18446744073709551615) of single field \u0026amp;msg-\u0026gt;msg[msg-\u0026gt;curlen] at drivers/gpu/drm/display/drm_dp_mst_topology.c:791 (size 256) Call Trace: drm_dp_sideband_append_payload+0x324/0x350 [drm_display_helper] drm_dp_get_one_sb_msg+0x3ce/0x5f0 [drm_display_helper] drm_dp_mst_hpd_irq_handle_event+0xc8/0x1580 [drm_display_helper](CVE-2024-56616)\n\nIn the Linux kernel, the following vulnerability has been resolved:iio: adc: at91: call input_free_device() on allocated iio_devCurrent implementation of at91_ts_register() calls input_free_deivce()on st-\u0026gt;ts_input, however, the err label can be reached before theallocated iio_dev is stored to st-\u0026gt;ts_input. Thus callinput_free_device() on input instead of st-\u0026gt;ts_input.(CVE-2024-57904)\n\nIn the Linux kernel, the following vulnerability has been resolved:iio: adc: ti-ads8688: fix information leak in triggered bufferThe buffer local array is used to push data to user space from atriggered buffer, but it does not set values for inactive channels, asit only uses iio_for_each_active_channel() to assign new values.Initialize the array to zero before using it to avoid pushinguninitialized information to userspace.(CVE-2024-57906)\n\nIn the Linux kernel, the following vulnerability has been resolved:selinux: ignore unknown extended permissionsWhen evaluating extended permissions, ignore unknown permissions insteadof calling BUG(). This commit ensures that future permissions can beadded without interfering with older kernels.(CVE-2024-57931)\n\nIn the Linux kernel, the following vulnerability has been resolved:drm/amdgpu: Fix potential NULL pointer dereference in atomctrl_get_smc_sclk_range_tableThe function atomctrl_get_smc_sclk_range_table() does not check the returnvalue of smu_atom_get_data_table(). If smu_atom_get_data_table() fails toretrieve SMU_Info table, it returns NULL which is later dereferenced.Found by Linux Verification Center (linuxtesting.org) with SVACE.In practice this should never happen as this code only gets calledon polaris chips and the vbios data table will always be present onthose chips.(CVE-2024-58052)\n\nIn the Linux kernel, the following vulnerability has been resolved:PCI/ASPM: Fix link state exit during switch upstream function removalBefore 456d8aa37d0f ( PCI/ASPM: Disable ASPM on MFD function removal toavoid use-after-free ), we would free the ASPM link only after the lastfunction on the bus pertaining to the given link was removed.That was too late. If function 0 is removed before sibling function,link-\u0026gt;downstream would point to free d memory after.After above change, we freed the ASPM parent link state upon any functionremoval on the bus pertaining to a given link.That is too early. If the link is to a PCIe switch with MFD on the upstreamport, then removing functions other than 0 first would free a link whichstill remains parent_link to the remaining downstream ports.The resulting GPFs are especially frequent during hot-unplug, becausepciehp removes devices on the link bus in reverse order.On that switch, function 0 is the virtual P2P bridge to the internal bus.Free exactly when function 0 is removed -- before the parent link isobsolete, but after all subordinate links are gone.[kwilczynski: commit log](CVE-2024-58093)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbpf: consider that tail calls invalidate packet pointers\n\nTail-called programs could execute any of the helpers that invalidate\npacket pointers. Hence, conservatively assume that each tail call\ninvalidates packet pointers.\n\nMaking the change in bpf_helper_changes_pkt_data() automatically makes\nuse of check_cfg() logic that computes \u0026apos;changes_pkt_data\u0026apos; effect for\nglobal sub-programs, such that the following program could be\nrejected:\n\n int tail_call(struct __sk_buff *sk)\n {\n \tbpf_tail_call_static(sk, \u0026amp;jmp_table, 0);\n \treturn 0;\n }\n\n SEC(\u0026quot;tc\u0026quot;)\n int not_safe(struct __sk_buff *sk)\n {\n \tint *p = (void *)(long)sk-\u0026gt;data;\n \t... make p valid ...\n \ttail_call(sk);\n \t*p = 42; /* this is unsafe */\n \t...\n }\n\nThe tc_bpf2bpf.c:subprog_tc() needs change: mark it as a function that\ncan invalidate packet pointers. Otherwise, it can\u0026apos;t be freplaced with\ntailcall_freplace.c:entry_freplace() that does a tail call.(CVE-2024-58237)\n\nIn the Linux kernel, the following vulnerability has been resolved:filemap: avoid truncating 64-bit offset to 32 bitsOn 32-bit kernels, folio_seek_hole_data() was inadvertently truncating a64-bit value to 32 bits, leading to a possible infinite loop when writingto an xfs filesystem.(CVE-2025-21665)\n\nIn the Linux kernel, the following vulnerability has been resolved:partitions: mac: fix handling of bogus partition tableFix several issues in partition probing: - The bailout for a bad partoffset must use put_dev_sector(), since the preceding read_part_sector() succeeded. - If the partition table claims a silly sector size like 0xfff bytes (which results in partition table entries straddling sector boundaries), bail out instead of accessing out-of-bounds memory. - We must not assume that the partition table contains proper NUL termination - use strnlen() and strncmp() instead of strlen() and strcmp().(CVE-2025-21772)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: hns3: fix oops when unload drivers paralleling\n\nWhen unload hclge driver, it tries to disable sriov first for each\nae_dev node from hnae3_ae_dev_list. If user unloads hns3 driver at\nthe time, because it removes all the ae_dev nodes, and it may cause\noops.\n\nBut we can\u0026apos;t simply use hnae3_common_lock for this. Because in the\nprocess flow of pci_disable_sriov(), it will trigger the remove flow\nof VF, which will also take hnae3_common_lock.\n\nTo fixes it, introduce a new mutex to protect the unload process.(CVE-2025-21802)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: detect and prevent references to a freed transport in sendmsg\n\nsctp_sendmsg() re-uses associations and transports when possible by\ndoing a lookup based on the socket endpoint and the message destination\naddress, and then sctp_sendmsg_to_asoc() sets the selected transport in\nall the message chunks to be sent.\n\nThere\u0026apos;s a possible race condition if another thread triggers the removal\nof that selected transport, for instance, by explicitly unbinding an\naddress with setsockopt(SCTP_SOCKOPT_BINDX_REM), after the chunks have\nbeen set up and before the message is sent. This can happen if the send\nbuffer is full, during the period when the sender thread temporarily\nreleases the socket lock in sctp_wait_for_sndbuf().\n\nThis causes the access to the transport data in\nsctp_outq_select_transport(), when the association outqueue is flushed,\nto result in a use-after-free read.\n\nThis change avoids this scenario by having sctp_transport_free() signal\nthe freeing of the transport, tagging it as \u0026quot;dead\u0026quot;. In order to do this,\nthe patch restores the \u0026quot;dead\u0026quot; bit in struct sctp_transport, which was\nremoved in\ncommit 47faa1e4c50e (\u0026quot;sctp: remove the dead field of sctp_transport\u0026quot;).\n\nThen, in the scenario where the sender thread has released the socket\nlock in sctp_wait_for_sndbuf(), the bit is checked again after\nre-acquiring the socket lock to detect the deletion. This is done while\nholding a reference to the transport to prevent it from being freed in\nthe process.\n\nIf the transport was deleted while the socket lock was relinquished,\nsctp_sendmsg_to_asoc() will return -EAGAIN to let userspace retry the\nsend.\n\nThe bug was found by a private syzbot instance (see the error report [1]\nand the C reproducer that triggers it [2]).(CVE-2025-23142)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet_sched: hfsc: Fix a potential UAF in hfsc_dequeue() too\n\nSimilarly to the previous patch, we need to safe guard hfsc_dequeue()\ntoo. But for this one, we don\u0026apos;t have a reliable reproducer.(CVE-2025-37823)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet_sched: drr: Fix double list add in class with netem as child qdisc\n\nAs described in Gerrard\u0026apos;s report [1], there are use cases where a netem\nchild qdisc will make the parent qdisc\u0026apos;s enqueue callback reentrant.\nIn the case of drr, there won\u0026apos;t be a UAF, but the code will add the same\nclassifier to the list twice, which will cause memory corruption.\n\nIn addition to checking for qlen being zero, this patch checks whether the\nclass was already added to the active_list (cl_is_active) before adding\nto the list to cover for the reentrant case.\n\n[1] https://lore.kernel.org/netdev/CAHcdcOm+03OD2j6R0=YHKqmy=VgJ8xEOKuP6c7mSgnp-TEJJbw@mail.gmail.com/(CVE-2025-37915)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet_sched: Flush gso_skb list too during -\u0026gt;change()\n\nPreviously, when reducing a qdisc\u0026apos;s limit via the -\u0026gt;change() operation, only\nthe main skb queue was trimmed, potentially leaving packets in the gso_skb\nlist. This could result in NULL pointer dereference when we only check\nsch-\u0026gt;limit against sch-\u0026gt;q.qlen.\n\nThis patch introduces a new helper, qdisc_dequeue_internal(), which ensures\nboth the gso_skb list and the main queue are properly flushed when trimming\nexcess packets. All relevant qdiscs (codel, fq, fq_codel, fq_pie, hhf, pie)\nare updated to use this helper in their -\u0026gt;change() routines.(CVE-2025-37992)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnfsd: handle get_client_locked() failure in nfsd4_setclientid_confirm()\n\nLei Lu recently reported that nfsd4_setclientid_confirm() did not check\nthe return value from get_client_locked(). a SETCLIENTID_CONFIRM could\nrace with a confirmed client expiring and fail to get a reference. That\ncould later lead to a UAF.\n\nFix this by getting a reference early in the case where there is an\nextant confirmed client. If that fails then treat it as if there were no\nconfirmed client found at all.\n\nIn the case where the unconfirmed client is expiring, just fail and\nreturn the result from get_client_locked().(CVE-2025-38724)\n\nRejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2025-39898)\n\nIn the Linux kernel, the following vulnerability has been resolved: i40e: fix idx validation in config queues msg. Ensure idx is within range of active/initialized TCs when iterating over vf-\u0026gt;ch[idx] in i40e_vc_config_queues_msg().(CVE-2025-39971)\n\nIn the Linux kernel, a buffer overflow vulnerability exists in the target_lu_gp_members_show function in target_core_configfs.c. The vulnerability arises from the usage of snprintf to write into the buffer \u0026quot;buf\u0026quot; without checking the return value length. When the total formatted string length exceeds LU_GROUP_NAME_BUF (256 bytes), it may cause a buffer overflow. Since snprintf() returns the total number of bytes that would have been written, this value may exceed the buffer length (256 bytes) passed to memcpy(), ultimately causing the memcpy function to report a buffer overflow error. Adding an additional check of the return value of snprintf() can avoid this buffer overflow.(CVE-2025-39998)",
"id": "OESA-2025-2555",
"modified": "2026-08-06T11:09:38Z",
"published": "2025-10-31T11:09:38Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2025-2555"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50306"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53728"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50210"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53168"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53214"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56602"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56616"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-57904"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-57906"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-57931"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-58052"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-58093"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-58237"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21665"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21772"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-21802"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-23142"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37823"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37915"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37992"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38724"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39898"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39971"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39998"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2022-50306",
"CVE-2023-53728",
"CVE-2024-50210",
"CVE-2024-53168",
"CVE-2024-53214",
"CVE-2024-56602",
"CVE-2024-56616",
"CVE-2024-57904",
"CVE-2024-57906",
"CVE-2024-57931",
"CVE-2024-58052",
"CVE-2024-58093",
"CVE-2024-58237",
"CVE-2025-21665",
"CVE-2025-21772",
"CVE-2025-21802",
"CVE-2025-23142",
"CVE-2025-37823",
"CVE-2025-37915",
"CVE-2025-37992",
"CVE-2025-38724",
"CVE-2025-39898",
"CVE-2025-39971",
"CVE-2025-39998"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.