Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2026-43139 (GCVE-0-2026-43139)
Vulnerability from cvelistv5 – Published: 2026-05-06 11:27 – Updated: 2026-08-05 12:26| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
a1e59abf824969554b90facd44a4ab16e265afa4 , < 4f28141786e1fe884ce42a5197ba9beed540f0ea
(git)
Affected: a1e59abf824969554b90facd44a4ab16e265afa4 , < 6535867673bf301d52aa00593a4d1d18cc3922fa (git) Affected: a1e59abf824969554b90facd44a4ab16e265afa4 , < eb2ee15290af14c60b45cf2b73f5687d1d077d9b (git) Affected: a1e59abf824969554b90facd44a4ab16e265afa4 , < 719918fc88df6da023dfff370cd965151a5afd7f (git) Affected: a1e59abf824969554b90facd44a4ab16e265afa4 , < dc0abce055134cb83b0d981d31ceb20dda419787 (git) Affected: a1e59abf824969554b90facd44a4ab16e265afa4 , < c7221e7bd8fc2ef38a0b27be580d9d202281306b (git) Affected: a1e59abf824969554b90facd44a4ab16e265afa4 , < 3dcd1664ac15eee6a690daec7c4ffc59190406f7 (git) Affected: a1e59abf824969554b90facd44a4ab16e265afa4 , < 1799d8abeabc68ec05679292aaf6cba93b343c05 (git) |
guessed | |
| Linux | Linux |
Affected:
2.6.19
Unaffected: 0 , < 2.6.19 (semver) Unaffected: 5.10.252 , ≤ 5.10.* (semver) Unaffected: 5.15.202 , ≤ 5.15.* (semver) Unaffected: 6.1.165 , ≤ 6.1.* (semver) Unaffected: 6.6.128 , ≤ 6.6.* (semver) Unaffected: 6.12.75 , ≤ 6.12.* (semver) Unaffected: 6.18.16 , ≤ 6.18.* (semver) Unaffected: 6.19.6 , ≤ 6.19.* (semver) Unaffected: 7.0 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/ipv6/xfrm6_policy.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "4f28141786e1fe884ce42a5197ba9beed540f0ea",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "6535867673bf301d52aa00593a4d1d18cc3922fa",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "eb2ee15290af14c60b45cf2b73f5687d1d077d9b",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "719918fc88df6da023dfff370cd965151a5afd7f",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "dc0abce055134cb83b0d981d31ceb20dda419787",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "c7221e7bd8fc2ef38a0b27be580d9d202281306b",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "3dcd1664ac15eee6a690daec7c4ffc59190406f7",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "1799d8abeabc68ec05679292aaf6cba93b343c05",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/ipv6/xfrm6_policy.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.19"
},
{
"lessThan": "2.6.19",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.252",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.202",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.165",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.128",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.75",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.16",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.19.*",
"status": "unaffected",
"version": "6.19.6",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.0",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.252",
"versionStartIncluding": "2.6.19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.202",
"versionStartIncluding": "2.6.19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.165",
"versionStartIncluding": "2.6.19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.128",
"versionStartIncluding": "2.6.19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.12.75",
"versionStartIncluding": "2.6.19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.18.16",
"versionStartIncluding": "2.6.19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.19.6",
"versionStartIncluding": "2.6.19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "7.0",
"versionStartIncluding": "2.6.19",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nxfrm6: fix uninitialized saddr in xfrm6_get_saddr()\n\nxfrm6_get_saddr() does not check the return value of\nipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable\nsource address (returns -EADDRNOTAVAIL), saddr-\u003ein6 is left\nuninitialized, but xfrm6_get_saddr() still returns 0 (success).\n\nThis causes the caller xfrm_tmpl_resolve_one() to use the uninitialized\naddress in xfrm_state_find(), triggering KMSAN warning:\n\n=====================================================\nBUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940\n xfrm_state_find+0x2424/0xa940\n xfrm_resolve_and_create_bundle+0x906/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n xfrm_lookup_route+0x63/0x2b0\n ip_route_output_flow+0x1ce/0x270\n udp_sendmsg+0x2ce1/0x3400\n inet_sendmsg+0x1ef/0x2a0\n __sock_sendmsg+0x278/0x3d0\n __sys_sendto+0x593/0x720\n __x64_sys_sendto+0x130/0x200\n x64_sys_call+0x332b/0x3e70\n do_syscall_64+0xd3/0xf80\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\n\nLocal variable tmp.i.i created at:\n xfrm_resolve_and_create_bundle+0x3e3/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n=====================================================\n\nFix by checking the return value of ipv6_dev_get_saddr() and propagating\nthe error."
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 8.6,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:L/I:L/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:N - A network-triggered path exists on an IPv6/IPsec endpoint: received IPv6 traffic that causes kernel-generated output, such as ICMPv6/NDISC replies or service responses, enters xfrm_lookup_route() and reaches xfrm_tmpl_resolve_one()-\u003exfrm6_get_saddr(). The same code is locally reachable with sendmsg(), but a reasonably configured XFRM/IPsec host can be triggered by network traffic.\nAC:L - No race, heap grooming, or timing condition is required; once the affected outbound XFRM template has a wildcard IPv6 tunnel source and source address selection fails, the unchecked error path is deterministic. Matching output traffic can be triggered repeatedly.\nPR:N - The network trigger does not require the attacker to authenticate or hold local privileges. Creating the XFRM policy requires CAP_NET_ADMIN, including via a user/net namespace for local testing, but in the network scenario that policy is preexisting victim configuration.\nUI:N - No victim user action is required after the vulnerable XFRM/IPsec configuration is present. Packets or local sends directly drive the kernel output path.\nS:U - The bug affects kernel XFRM/IPv6 processing within the same host security authority. It does not cross a VM, IOMMU, or separate security scope boundary.\nC:L - The uninitialized value is a bounded 16-byte IPv6 source address from kernel stack, used in hashes/comparisons and potentially copied into XFRM acquire state/messages. This is limited kernel memory disclosure, not an arbitrary read primitive.\nI:L - The uninitialized source address can influence XFRM state lookup/acquire behavior and create or notify state using an unintended local tunnel endpoint. This is limited integrity impact to IPsec/XFRM state handling, not arbitrary modification.\nA:H - Syzbot reported a kernel BUG/KMSAN finding in xfrm_state_find(), and the bad value is consumed in core XFRM state lookup/acquire paths that can be triggered repeatedly. Kernel warning/oops/panic conditions are high availability impact."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T12:26:11.398Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/4f28141786e1fe884ce42a5197ba9beed540f0ea"
},
{
"url": "https://git.kernel.org/stable/c/6535867673bf301d52aa00593a4d1d18cc3922fa"
},
{
"url": "https://git.kernel.org/stable/c/eb2ee15290af14c60b45cf2b73f5687d1d077d9b"
},
{
"url": "https://git.kernel.org/stable/c/719918fc88df6da023dfff370cd965151a5afd7f"
},
{
"url": "https://git.kernel.org/stable/c/dc0abce055134cb83b0d981d31ceb20dda419787"
},
{
"url": "https://git.kernel.org/stable/c/c7221e7bd8fc2ef38a0b27be580d9d202281306b"
},
{
"url": "https://git.kernel.org/stable/c/3dcd1664ac15eee6a690daec7c4ffc59190406f7"
},
{
"url": "https://git.kernel.org/stable/c/1799d8abeabc68ec05679292aaf6cba93b343c05"
}
],
"title": "xfrm6: fix uninitialized saddr in xfrm6_get_saddr()",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2026-43139",
"datePublished": "2026-05-06T11:27:24.898Z",
"dateReserved": "2026-05-01T14:12:55.988Z",
"dateUpdated": "2026-08-05T12:26:11.398Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2026-43139",
"date": "2026-09-28",
"epss": "0.00536",
"percentile": "0.4293"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/ipv6/xfrm6_policy.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "4f28141786e1fe884ce42a5197ba9beed540f0ea",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "6535867673bf301d52aa00593a4d1d18cc3922fa",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "eb2ee15290af14c60b45cf2b73f5687d1d077d9b",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "719918fc88df6da023dfff370cd965151a5afd7f",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "dc0abce055134cb83b0d981d31ceb20dda419787",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "c7221e7bd8fc2ef38a0b27be580d9d202281306b",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "3dcd1664ac15eee6a690daec7c4ffc59190406f7",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "1799d8abeabc68ec05679292aaf6cba93b343c05",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/ipv6/xfrm6_policy.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.19"
},
{
"lessThan": "2.6.19",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.252",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.202",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.165",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.128",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.75",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.16",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.19.*",
"status": "unaffected",
"version": "6.19.6",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.0",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "128F081F-CEB9-49AD-8832-F177C6299DED",
"versionEndExcluding": "5.10.252",
"versionStartIncluding": "2.6.19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "4002FC2B-1456-4666-B240-0EBF590C4671",
"versionEndExcluding": "5.15.202",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "797C7F46-D0BE-4FB8-A502-C5EF8E6B6654",
"versionEndExcluding": "6.1.165",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "851E9353-6C09-4CC9-877E-E09DB164A3C2",
"versionEndExcluding": "6.6.128",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "BCE16369-98ED-41CF-8995-DFDC10B288D2",
"versionEndExcluding": "6.12.75",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B4B8CDA9-BADF-4CF5-8B3B-702DE8EEA40B",
"versionEndExcluding": "6.18.16",
"versionStartIncluding": "6.13",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "373EEEDA-FAA1-4FB4-B6ED-DB4DD99DBE67",
"versionEndExcluding": "6.19.6",
"versionStartIncluding": "6.19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:7.0:rc1:*:*:*:*:*:*",
"matchCriteriaId": "F253B622-8837-4245-BCE5-A7BF8FC76A16",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nxfrm6: fix uninitialized saddr in xfrm6_get_saddr()\n\nxfrm6_get_saddr() does not check the return value of\nipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable\nsource address (returns -EADDRNOTAVAIL), saddr-\u003ein6 is left\nuninitialized, but xfrm6_get_saddr() still returns 0 (success).\n\nThis causes the caller xfrm_tmpl_resolve_one() to use the uninitialized\naddress in xfrm_state_find(), triggering KMSAN warning:\n\n=====================================================\nBUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940\n xfrm_state_find+0x2424/0xa940\n xfrm_resolve_and_create_bundle+0x906/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n xfrm_lookup_route+0x63/0x2b0\n ip_route_output_flow+0x1ce/0x270\n udp_sendmsg+0x2ce1/0x3400\n inet_sendmsg+0x1ef/0x2a0\n __sock_sendmsg+0x278/0x3d0\n __sys_sendto+0x593/0x720\n __x64_sys_sendto+0x130/0x200\n x64_sys_call+0x332b/0x3e70\n do_syscall_64+0xd3/0xf80\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\n\nLocal variable tmp.i.i created at:\n xfrm_resolve_and_create_bundle+0x3e3/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n=====================================================\n\nFix by checking the return value of ipv6_dev_get_saddr() and propagating\nthe error."
}
],
"id": "CVE-2026-43139",
"lastModified": "2026-06-17T10:49:00.497",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 8.6,
"baseSeverity": "HIGH",
"confidentialityImpact": "LOW",
"integrityImpact": "LOW",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:L/I:L/A:H",
"version": "3.1"
},
"exploitabilityScore": 3.9,
"impactScore": 4.7,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
}
]
},
"published": "2026-05-06T12:16:31.227",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/1799d8abeabc68ec05679292aaf6cba93b343c05"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3dcd1664ac15eee6a690daec7c4ffc59190406f7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4f28141786e1fe884ce42a5197ba9beed540f0ea"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/6535867673bf301d52aa00593a4d1d18cc3922fa"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/719918fc88df6da023dfff370cd965151a5afd7f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/c7221e7bd8fc2ef38a0b27be580d9d202281306b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/dc0abce055134cb83b0d981d31ceb20dda419787"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/eb2ee15290af14c60b45cf2b73f5687d1d077d9b"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-908"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2026-07-02T21:44:49+00:00",
"cve": "CVE-2026-43139",
"id": "CVE-2026-43139",
"initial_release_date": "2026-05-06T00:00:00+00:00",
"product_status:known_affected": "274",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: xfrm6: fix uninitialized saddr in xfrm6_get_saddr()",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2026/cve-2026-43139.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-09-11T01:20:36Z",
"cve": "CVE-2026-43139",
"id": "CVE-2026-43139",
"initial_release_date": "2026-05-07T02:17:47Z",
"product_status:first_fixed": "2",
"product_status:known_affected": "643",
"product_status:recommended": "287",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2026-43139",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2026-43139.json",
"version": "14"
}
}
}
CERTFR-2026-AVI-0956
Vulnerability from certfr_avis - Published: 2026-07-31 - Updated: 2026-07-31
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une atteinte à la confidentialité des données, une atteinte à l'intégrité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 16.0 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise Server High Availability Extension 16.0 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Micro Extras | SUSE Linux Micro Extras 6.1 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP applications 16.0 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.1 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.0 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | SUSE Linux Micro Extras | SUSE Linux Micro Extras 6.0 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 16.0",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server High Availability Extension 16.0",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro Extras 6.1",
"product": {
"name": "SUSE Linux Micro Extras",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP applications 16.0",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.1",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.0",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro Extras 6.0",
"product": {
"name": "SUSE Linux Micro Extras",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-43198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43198"
},
{
"name": "CVE-2026-43366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43366"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-43298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43298"
},
{
"name": "CVE-2026-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53272"
},
{
"name": "CVE-2026-53049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53049"
},
{
"name": "CVE-2026-52955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52955"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2026-52957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52957"
},
{
"name": "CVE-2026-43468",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43468"
},
{
"name": "CVE-2026-45884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45884"
},
{
"name": "CVE-2026-43374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43374"
},
{
"name": "CVE-2026-43373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43373"
},
{
"name": "CVE-2026-53090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53090"
},
{
"name": "CVE-2026-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53287"
},
{
"name": "CVE-2026-46124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46124"
},
{
"name": "CVE-2026-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53274"
},
{
"name": "CVE-2026-31758",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31758"
},
{
"name": "CVE-2026-46076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46076"
},
{
"name": "CVE-2026-53041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53041"
},
{
"name": "CVE-2026-43161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43161"
},
{
"name": "CVE-2026-43457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43457"
},
{
"name": "CVE-2026-45922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45922"
},
{
"name": "CVE-2026-43119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43119"
},
{
"name": "CVE-2026-31685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31685"
},
{
"name": "CVE-2026-43240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43240"
},
{
"name": "CVE-2026-52958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52958"
},
{
"name": "CVE-2026-46319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46319"
},
{
"name": "CVE-2026-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53229"
},
{
"name": "CVE-2026-43470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43470"
},
{
"name": "CVE-2026-43492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43492"
},
{
"name": "CVE-2026-46065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46065"
},
{
"name": "CVE-2026-46227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46227"
},
{
"name": "CVE-2026-53040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53040"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-43294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43294"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-43339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43339"
},
{
"name": "CVE-2026-31664",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31664"
},
{
"name": "CVE-2023-20585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-20585"
},
{
"name": "CVE-2026-46112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46112"
},
{
"name": "CVE-2026-31752",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31752"
},
{
"name": "CVE-2026-46063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46063"
},
{
"name": "CVE-2026-52924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52924"
},
{
"name": "CVE-2026-45901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45901"
},
{
"name": "CVE-2026-43167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43167"
},
{
"name": "CVE-2026-43248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43248"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-43092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43092"
},
{
"name": "CVE-2026-31680",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31680"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53181"
},
{
"name": "CVE-2026-43465",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43465"
},
{
"name": "CVE-2026-45888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45888"
},
{
"name": "CVE-2026-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53286"
},
{
"name": "CVE-2026-31738",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31738"
},
{
"name": "CVE-2026-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53081"
},
{
"name": "CVE-2026-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52993"
},
{
"name": "CVE-2026-43284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43284"
},
{
"name": "CVE-2026-43010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43010"
},
{
"name": "CVE-2026-52956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52956"
},
{
"name": "CVE-2026-52943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52943"
},
{
"name": "CVE-2026-43025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43025"
},
{
"name": "CVE-2026-46173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46173"
},
{
"name": "CVE-2026-46214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46214"
},
{
"name": "CVE-2026-43053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43053"
},
{
"name": "CVE-2026-53103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53103"
},
{
"name": "CVE-2026-31502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31502"
},
{
"name": "CVE-2026-43014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43014"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-43445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43445"
},
{
"name": "CVE-2026-46320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46320"
},
{
"name": "CVE-2026-43028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43028"
},
{
"name": "CVE-2026-46113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46113"
},
{
"name": "CVE-2026-43415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43415"
},
{
"name": "CVE-2026-46071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46071"
},
{
"name": "CVE-2026-45841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45841"
},
{
"name": "CVE-2026-43022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43022"
},
{
"name": "CVE-2026-31505",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31505"
},
{
"name": "CVE-2026-46331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46331"
},
{
"name": "CVE-2026-53015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53015"
},
{
"name": "CVE-2026-52961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52961"
},
{
"name": "CVE-2026-43458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43458"
},
{
"name": "CVE-2026-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52919"
},
{
"name": "CVE-2026-43450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43450"
},
{
"name": "CVE-2026-43345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43345"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-53266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53266"
},
{
"name": "CVE-2026-45861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45861"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-46116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46116"
},
{
"name": "CVE-2026-43213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43213"
},
{
"name": "CVE-2026-43057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43057"
},
{
"name": "CVE-2026-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53176"
},
{
"name": "CVE-2026-31663",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31663"
},
{
"name": "CVE-2026-43074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43074"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-43383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43383"
},
{
"name": "CVE-2026-52975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52975"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-31647",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31647"
},
{
"name": "CVE-2026-53050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53050"
},
{
"name": "CVE-2026-43080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43080"
},
{
"name": "CVE-2026-31693",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31693"
},
{
"name": "CVE-2026-46178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46178"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-43036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43036"
},
{
"name": "CVE-2026-53021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53021"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2025-39894",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39894"
},
{
"name": "CVE-2026-46005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46005"
},
{
"name": "CVE-2026-45894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45894"
},
{
"name": "CVE-2026-46069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46069"
},
{
"name": "CVE-2026-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53178"
},
{
"name": "CVE-2026-31670",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31670"
},
{
"name": "CVE-2026-23240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23240"
},
{
"name": "CVE-2026-31533",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31533"
},
{
"name": "CVE-2026-46059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46059"
},
{
"name": "CVE-2026-31469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31469"
},
{
"name": "CVE-2026-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46120"
},
{
"name": "CVE-2026-43336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43336"
},
{
"name": "CVE-2026-52954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52954"
},
{
"name": "CVE-2026-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53249"
},
{
"name": "CVE-2026-53139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53139"
},
{
"name": "CVE-2026-43466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43466"
},
{
"name": "CVE-2026-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53217"
},
{
"name": "CVE-2026-53262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53262"
},
{
"name": "CVE-2026-31555",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31555"
},
{
"name": "CVE-2026-43253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43253"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-43491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43491"
},
{
"name": "CVE-2026-46242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46242"
},
{
"name": "CVE-2026-43403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43403"
},
{
"name": "CVE-2026-43452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43452"
},
{
"name": "CVE-2026-45999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45999"
},
{
"name": "CVE-2026-43019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43019"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2026-43260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43260"
},
{
"name": "CVE-2026-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53362"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53168"
},
{
"name": "CVE-2026-53053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53053"
},
{
"name": "CVE-2026-53086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53086"
},
{
"name": "CVE-2026-43449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43449"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-45940",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45940"
},
{
"name": "CVE-2025-10263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10263"
},
{
"name": "CVE-2026-31450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31450"
},
{
"name": "CVE-2026-43024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43024"
},
{
"name": "CVE-2026-45985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45985"
},
{
"name": "CVE-2026-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53167"
},
{
"name": "CVE-2026-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53060"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-52908",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52908"
},
{
"name": "CVE-2026-45899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45899"
},
{
"name": "CVE-2026-53035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53035"
},
{
"name": "CVE-2026-45997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45997"
},
{
"name": "CVE-2026-43405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43405"
},
{
"name": "CVE-2025-40341",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40341"
},
{
"name": "CVE-2026-43437",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43437"
},
{
"name": "CVE-2026-45920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45920"
},
{
"name": "CVE-2026-46150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46150"
},
{
"name": "CVE-2026-45840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45840"
},
{
"name": "CVE-2026-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53245"
},
{
"name": "CVE-2026-43035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43035"
},
{
"name": "CVE-2026-46172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46172"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2026-31429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31429"
},
{
"name": "CVE-2026-31665",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31665"
},
{
"name": "CVE-2026-46161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46161"
},
{
"name": "CVE-2026-53285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53285"
},
{
"name": "CVE-2026-31743",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31743"
},
{
"name": "CVE-2026-43304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43304"
},
{
"name": "CVE-2026-45961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45961"
},
{
"name": "CVE-2026-43384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43384"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-43501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43501"
},
{
"name": "CVE-2026-53133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53133"
},
{
"name": "CVE-2026-43093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43093"
},
{
"name": "CVE-2026-31479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31479"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-43337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43337"
},
{
"name": "CVE-2026-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53263"
},
{
"name": "CVE-2026-46111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46111"
},
{
"name": "CVE-2026-43238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43238"
},
{
"name": "CVE-2026-46291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46291"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-43086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43086"
},
{
"name": "CVE-2026-31771",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31771"
},
{
"name": "CVE-2026-52980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52980"
},
{
"name": "CVE-2026-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53194"
},
{
"name": "CVE-2026-43034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43034"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-43094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43094"
},
{
"name": "CVE-2026-43204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43204"
},
{
"name": "CVE-2026-43015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43015"
},
{
"name": "CVE-2026-43120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43120"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2026-43469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43469"
},
{
"name": "CVE-2026-43085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43085"
},
{
"name": "CVE-2026-43199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43199"
},
{
"name": "CVE-2026-31466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31466"
},
{
"name": "CVE-2026-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53258"
},
{
"name": "CVE-2026-31414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31414"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-53039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53039"
},
{
"name": "CVE-2026-43191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43191"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53357"
},
{
"name": "CVE-2026-43456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43456"
},
{
"name": "CVE-2026-43406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43406"
},
{
"name": "CVE-2026-31570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31570"
},
{
"name": "CVE-2026-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53215"
},
{
"name": "CVE-2026-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53216"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-46314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46314"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-43081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43081"
},
{
"name": "CVE-2026-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53359"
},
{
"name": "CVE-2026-31495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31495"
},
{
"name": "CVE-2026-46160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46160"
},
{
"name": "CVE-2026-46079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46079"
},
{
"name": "CVE-2026-53256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53256"
},
{
"name": "CVE-2026-53306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53306"
},
{
"name": "CVE-2026-43303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43303"
},
{
"name": "CVE-2026-43386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43386"
},
{
"name": "CVE-2026-31492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31492"
},
{
"name": "CVE-2026-43089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43089"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-46162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46162"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-43083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43083"
},
{
"name": "CVE-2026-23393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23393"
},
{
"name": "CVE-2026-43502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43502"
},
{
"name": "CVE-2026-31674",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31674"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43027"
},
{
"name": "CVE-2026-52909",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52909"
},
{
"name": "CVE-2026-45858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45858"
},
{
"name": "CVE-2026-23394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23394"
},
{
"name": "CVE-2026-45838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45838"
},
{
"name": "CVE-2026-45933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45933"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-31560",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31560"
},
{
"name": "CVE-2026-52962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52962"
},
{
"name": "CVE-2026-43101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43101"
},
{
"name": "CVE-2026-53075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53075"
},
{
"name": "CVE-2026-45837",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45837"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-43471",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43471"
},
{
"name": "CVE-2026-46093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46093"
},
{
"name": "CVE-2026-31503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31503"
},
{
"name": "CVE-2026-43016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43016"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-43175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43175"
},
{
"name": "CVE-2026-31646",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31646"
},
{
"name": "CVE-2026-43320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43320"
},
{
"name": "CVE-2026-23451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23451"
},
{
"name": "CVE-2026-53078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53078"
},
{
"name": "CVE-2026-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53281"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-43473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43473"
},
{
"name": "CVE-2026-43107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43107"
},
{
"name": "CVE-2026-23248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23248"
},
{
"name": "CVE-2026-53366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53366"
},
{
"name": "CVE-2026-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52923"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-43351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43351"
},
{
"name": "CVE-2026-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52933"
},
{
"name": "CVE-2026-43128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43128"
},
{
"name": "CVE-2026-43090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43090"
},
{
"name": "CVE-2026-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53122"
},
{
"name": "CVE-2026-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53196"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53156"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-46052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46052"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-31452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31452"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2026-31499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31499"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-43157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43157"
},
{
"name": "CVE-2026-46322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46322"
},
{
"name": "CVE-2026-53036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53036"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-46254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46254"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-31438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31438"
},
{
"name": "CVE-2026-43494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43494"
},
{
"name": "CVE-2026-31673",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31673"
}
],
"initial_release_date": "2026-07-31T00:00:00",
"last_revision_date": "2026-07-31T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0956",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-07-31T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es, une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2026-07-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22835-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622835-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3345-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263345-1"
},
{
"published_at": "2026-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22809-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622809-1"
},
{
"published_at": "2026-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22811-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622811-1"
},
{
"published_at": "2026-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22810-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622810-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3350-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263350-1"
},
{
"published_at": "2026-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22916-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622916-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3351-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263351-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3376-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263376-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3343-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263343-1"
},
{
"published_at": "2026-07-27",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3286-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263286-1"
},
{
"published_at": "2026-07-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22794-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622794-1"
},
{
"published_at": "2026-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22883-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622883-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3393-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263393-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3369-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263369-1"
},
{
"published_at": "2026-07-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22812-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622812-1"
},
{
"published_at": "2026-07-27",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3289-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263289-1"
},
{
"published_at": "2026-07-27",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3301-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263301-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3354-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263354-1"
},
{
"published_at": "2026-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22790-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622790-1"
},
{
"published_at": "2026-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22903-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622903-1"
},
{
"published_at": "2026-07-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20263246-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263246-1"
},
{
"published_at": "2026-07-27",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3264-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263264-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3321-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263321-1"
},
{
"published_at": "2026-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22791-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622791-1"
},
{
"published_at": "2026-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22911-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622911-1"
},
{
"published_at": "2026-07-27",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20263256-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263256-1"
},
{
"published_at": "2026-07-27",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3316-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263316-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3344-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263344-1"
},
{
"published_at": "2026-07-26",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3254-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263254-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3392-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263392-1"
},
{
"published_at": "2026-07-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20263248-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263248-1"
},
{
"published_at": "2026-07-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20263253-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263253-1"
},
{
"published_at": "2026-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22904-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622904-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3372-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263372-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3319-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263319-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3383-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263383-1"
},
{
"published_at": "2026-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22808-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622808-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3388-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263388-1"
},
{
"published_at": "2026-07-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22795-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622795-1"
}
]
}
CERTFR-2026-AVI-0985
Vulnerability from certfr_avis - Published: 2026-08-07 - Updated: 2026-08-07
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et un problème de sécurité non spécifié par l'éditeur.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||
|---|---|---|---|---|---|---|---|---|
|
||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-45842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45842"
},
{
"name": "CVE-2026-31483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31483"
},
{
"name": "CVE-2026-64046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64046"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-31409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31409"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-43113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43113"
},
{
"name": "CVE-2026-31522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31522"
},
{
"name": "CVE-2026-43068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43068"
},
{
"name": "CVE-2026-31770",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31770"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2026-46184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46184"
},
{
"name": "CVE-2026-64133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64133"
},
{
"name": "CVE-2026-53049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53049"
},
{
"name": "CVE-2025-22107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22107"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31658",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31658"
},
{
"name": "CVE-2026-64047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64047"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2026-31756",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31756"
},
{
"name": "CVE-2026-31467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31467"
},
{
"name": "CVE-2026-52955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52955"
},
{
"name": "CVE-2026-23318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23318"
},
{
"name": "CVE-2026-23368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23368"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2026-52957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52957"
},
{
"name": "CVE-2026-52925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52925"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-46307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46307"
},
{
"name": "CVE-2026-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53061"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-31485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31485"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-43373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43373"
},
{
"name": "CVE-2026-53002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53002"
},
{
"name": "CVE-2026-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53287"
},
{
"name": "CVE-2026-46124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46124"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2026-31754",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31754"
},
{
"name": "CVE-2026-53128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53128"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53320"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-31758",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31758"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2024-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53221"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2026-53041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53041"
},
{
"name": "CVE-2026-23281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23281"
},
{
"name": "CVE-2026-64179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64179"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2026-43060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43060"
},
{
"name": "CVE-2025-71221",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71221"
},
{
"name": "CVE-2026-52970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52970"
},
{
"name": "CVE-2026-52958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52958"
},
{
"name": "CVE-2023-53629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53629"
},
{
"name": "CVE-2026-46319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46319"
},
{
"name": "CVE-2026-31416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31416"
},
{
"name": "CVE-2026-31656",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31656"
},
{
"name": "CVE-2026-52999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52999"
},
{
"name": "CVE-2026-46227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46227"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2026-53040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53040"
},
{
"name": "CVE-2026-23438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23438"
},
{
"name": "CVE-2026-43062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43062"
},
{
"name": "CVE-2026-23293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23293"
},
{
"name": "CVE-2026-23463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23463"
},
{
"name": "CVE-2026-23227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23227"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23454"
},
{
"name": "CVE-2026-31405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31405"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-43339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43339"
},
{
"name": "CVE-2026-64221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64221"
},
{
"name": "CVE-2026-43054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43054"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-31664",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31664"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2026-46112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46112"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2026-31473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31473"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-31550",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31550"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-23290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23290"
},
{
"name": "CVE-2026-31549",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31549"
},
{
"name": "CVE-2025-40103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40103"
},
{
"name": "CVE-2026-31752",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31752"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2026-43476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43476"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53291"
},
{
"name": "CVE-2026-23303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23303"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-31396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31396"
},
{
"name": "CVE-2026-31680",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31680"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-23340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23340"
},
{
"name": "CVE-2026-43046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43046"
},
{
"name": "CVE-2026-46233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46233"
},
{
"name": "CVE-2026-52963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52963"
},
{
"name": "CVE-2026-46303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46303"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-31738",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31738"
},
{
"name": "CVE-2025-68307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68307"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2026-43411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43411"
},
{
"name": "CVE-2026-31751",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31751"
},
{
"name": "CVE-2026-43429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43429"
},
{
"name": "CVE-2026-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52993"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2025-71287",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71287"
},
{
"name": "CVE-2026-46231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46231"
},
{
"name": "CVE-2026-45835",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45835"
},
{
"name": "CVE-2026-43382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43382"
},
{
"name": "CVE-2026-23439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23439"
},
{
"name": "CVE-2026-23253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23253"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-31721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31721"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-43052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43052"
},
{
"name": "CVE-2026-43496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43496"
},
{
"name": "CVE-2026-64178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64178"
},
{
"name": "CVE-2026-43324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43324"
},
{
"name": "CVE-2026-52915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52915"
},
{
"name": "CVE-2026-64177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64177"
},
{
"name": "CVE-2026-46214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46214"
},
{
"name": "CVE-2026-23434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23434"
},
{
"name": "CVE-2026-43014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43014"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-31447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31447"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53309"
},
{
"name": "CVE-2026-43445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43445"
},
{
"name": "CVE-2026-43387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43387"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2025-21712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21712"
},
{
"name": "CVE-2026-43028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43028"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-46236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46236"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-43475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43475"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2026-23304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23304"
},
{
"name": "CVE-2026-31683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31683"
},
{
"name": "CVE-2024-56557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56557"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2026-64220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64220"
},
{
"name": "CVE-2026-23357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23357"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-31408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31408"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2025-38105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38105"
},
{
"name": "CVE-2026-53071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53071"
},
{
"name": "CVE-2026-45841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45841"
},
{
"name": "CVE-2026-31524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31524"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-23066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23066"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2026-31546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31546"
},
{
"name": "CVE-2026-45956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45956"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-64165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64165"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-53064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53064"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-23324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23324"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-52995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52995"
},
{
"name": "CVE-2026-46209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46209"
},
{
"name": "CVE-2026-52931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52931"
},
{
"name": "CVE-2026-43047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43047"
},
{
"name": "CVE-2026-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53047"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2026-43432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43432"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-53296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53296"
},
{
"name": "CVE-2024-46715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46715"
},
{
"name": "CVE-2026-31545",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31545"
},
{
"name": "CVE-2026-31681",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31681"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-23456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23456"
},
{
"name": "CVE-2026-46186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46186"
},
{
"name": "CVE-2026-43458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43458"
},
{
"name": "CVE-2026-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52919"
},
{
"name": "CVE-2026-53006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53006"
},
{
"name": "CVE-2026-43450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43450"
},
{
"name": "CVE-2026-31510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31510"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-43079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43079"
},
{
"name": "CVE-2026-23457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23457"
},
{
"name": "CVE-2026-64102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64102"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-43103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43103"
},
{
"name": "CVE-2026-43069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43069"
},
{
"name": "CVE-2026-43425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43425"
},
{
"name": "CVE-2026-31642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31642"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-23399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23399"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2026-43480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43480"
},
{
"name": "CVE-2026-64083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64083"
},
{
"name": "CVE-2026-23401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23401"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2026-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53048"
},
{
"name": "CVE-2026-43426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43426"
},
{
"name": "CVE-2026-43030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43030"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2026-43074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43074"
},
{
"name": "CVE-2026-46151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46151"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-45911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45911"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2026-46220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46220"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-43334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43334"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-23391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23391"
},
{
"name": "CVE-2026-31415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31415"
},
{
"name": "CVE-2026-46127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46127"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2024-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47809"
},
{
"name": "CVE-2026-23204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23204"
},
{
"name": "CVE-2026-23462",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23462"
},
{
"name": "CVE-2026-53046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53046"
},
{
"name": "CVE-2026-53050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53050"
},
{
"name": "CVE-2026-23372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23372"
},
{
"name": "CVE-2026-43080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43080"
},
{
"name": "CVE-2026-46146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46146"
},
{
"name": "CVE-2026-45836",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45836"
},
{
"name": "CVE-2026-64039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64039"
},
{
"name": "CVE-2026-46178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46178"
},
{
"name": "CVE-2026-45846",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45846"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-46174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46174"
},
{
"name": "CVE-2026-53021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53021"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-43327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43327"
},
{
"name": "CVE-2024-56719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56719"
},
{
"name": "CVE-2026-46133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46133"
},
{
"name": "CVE-2026-31494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31494"
},
{
"name": "CVE-2026-31565",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31565"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-43381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43381"
},
{
"name": "CVE-2026-23270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23270"
},
{
"name": "CVE-2026-31763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31763"
},
{
"name": "CVE-2026-23279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23279"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2026-31670",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31670"
},
{
"name": "CVE-2026-46122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46122"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2026-63865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63865"
},
{
"name": "CVE-2026-31422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31422"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-23286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23286"
},
{
"name": "CVE-2026-23359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23359"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-23298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23298"
},
{
"name": "CVE-2026-31469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31469"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-31498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31498"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-64085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64085"
},
{
"name": "CVE-2026-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46120"
},
{
"name": "CVE-2026-46198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46198"
},
{
"name": "CVE-2026-43336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43336"
},
{
"name": "CVE-2026-43104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43104"
},
{
"name": "CVE-2026-52954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52954"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-64166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64166"
},
{
"name": "CVE-2026-46189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46189"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-43466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43466"
},
{
"name": "CVE-2026-23296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23296"
},
{
"name": "CVE-2026-53130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53130"
},
{
"name": "CVE-2026-46128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46128"
},
{
"name": "CVE-2026-52984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52984"
},
{
"name": "CVE-2026-31427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31427"
},
{
"name": "CVE-2026-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53088"
},
{
"name": "CVE-2026-31555",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31555"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2026-64155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64155"
},
{
"name": "CVE-2026-43439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43439"
},
{
"name": "CVE-2022-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50073"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-43099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43099"
},
{
"name": "CVE-2026-53065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53065"
},
{
"name": "CVE-2026-31515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31515"
},
{
"name": "CVE-2026-31661",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31661"
},
{
"name": "CVE-2026-43380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43380"
},
{
"name": "CVE-2026-43452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43452"
},
{
"name": "CVE-2026-31737",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31737"
},
{
"name": "CVE-2025-68358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68358"
},
{
"name": "CVE-2026-46197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46197"
},
{
"name": "CVE-2026-46301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46301"
},
{
"name": "CVE-2026-52914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52914"
},
{
"name": "CVE-2026-52916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52916"
},
{
"name": "CVE-2026-53294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53294"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-64125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64125"
},
{
"name": "CVE-2026-43043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43043"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31684"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-23396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23396"
},
{
"name": "CVE-2026-31423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31423"
},
{
"name": "CVE-2026-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52922"
},
{
"name": "CVE-2026-64089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64089"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-43051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43051"
},
{
"name": "CVE-2026-31759",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31759"
},
{
"name": "CVE-2026-52992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52992"
},
{
"name": "CVE-2023-45896",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45896"
},
{
"name": "CVE-2026-23370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23370"
},
{
"name": "CVE-2026-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53112"
},
{
"name": "CVE-2026-46206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46206"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-31781",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31781"
},
{
"name": "CVE-2026-43449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43449"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-31523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31523"
},
{
"name": "CVE-2026-43459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43459"
},
{
"name": "CVE-2026-31450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31450"
},
{
"name": "CVE-2026-31671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31671"
},
{
"name": "CVE-2026-31749",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31749"
},
{
"name": "CVE-2026-46234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46234"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-43328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43328"
},
{
"name": "CVE-2026-64018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64018"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2026-43024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43024"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-45985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45985"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2026-46108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46108"
},
{
"name": "CVE-2026-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53060"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-23352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23352"
},
{
"name": "CVE-2026-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53096"
},
{
"name": "CVE-2026-31720",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31720"
},
{
"name": "CVE-2026-31748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31748"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-43472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43472"
},
{
"name": "CVE-2026-23367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23367"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-45899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45899"
},
{
"name": "CVE-2026-31662",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31662"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2026-43026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43026"
},
{
"name": "CVE-2026-31480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31480"
},
{
"name": "CVE-2026-64055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64055"
},
{
"name": "CVE-2026-43405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43405"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-43430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43430"
},
{
"name": "CVE-2026-45920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45920"
},
{
"name": "CVE-2026-46150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46150"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-45840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45840"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-23446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23446"
},
{
"name": "CVE-2026-46219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46219"
},
{
"name": "CVE-2026-64173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64173"
},
{
"name": "CVE-2026-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53043"
},
{
"name": "CVE-2026-43075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43075"
},
{
"name": "CVE-2026-43035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43035"
},
{
"name": "CVE-2026-46172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46172"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2024-56657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56657"
},
{
"name": "CVE-2026-31665",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31665"
},
{
"name": "CVE-2026-46161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46161"
},
{
"name": "CVE-2026-23300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23300"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-23444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23444"
},
{
"name": "CVE-2026-64115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64115"
},
{
"name": "CVE-2026-45844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45844"
},
{
"name": "CVE-2026-52985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52985"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-31672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31672"
},
{
"name": "CVE-2026-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53059"
},
{
"name": "CVE-2026-43093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43093"
},
{
"name": "CVE-2026-31780",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31780"
},
{
"name": "CVE-2026-43342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43342"
},
{
"name": "CVE-2026-64164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64164"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-31521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31521"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2026-43357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43357"
},
{
"name": "CVE-2026-31634",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31634"
},
{
"name": "CVE-2026-43061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43061"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-53012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53012"
},
{
"name": "CVE-2026-43453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43453"
},
{
"name": "CVE-2026-64096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64096"
},
{
"name": "CVE-2026-43032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43032"
},
{
"name": "CVE-2026-43484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43484"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-23362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23362"
},
{
"name": "CVE-2026-23379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23379"
},
{
"name": "CVE-2026-43076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43076"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-43427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43427"
},
{
"name": "CVE-2022-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50116"
},
{
"name": "CVE-2026-31421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31421"
},
{
"name": "CVE-2026-53069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53069"
},
{
"name": "CVE-2026-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53073"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2026-43365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43365"
},
{
"name": "CVE-2022-50552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50552"
},
{
"name": "CVE-2026-23381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23381"
},
{
"name": "CVE-2026-31518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31518"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2025-68256",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68256"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-31660",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31660"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-46294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46294"
},
{
"name": "CVE-2026-31728",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31728"
},
{
"name": "CVE-2026-64084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64084"
},
{
"name": "CVE-2026-31400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31400"
},
{
"name": "CVE-2026-31512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31512"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-31726",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31726"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2026-43370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43370"
},
{
"name": "CVE-2026-31773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31773"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2023-52682",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52682"
},
{
"name": "CVE-2025-71150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71150"
},
{
"name": "CVE-2026-46167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46167"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-43015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43015"
},
{
"name": "CVE-2026-31509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31509"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2026-43066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43066"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-31679",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31679"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2026-43469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43469"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-43085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43085"
},
{
"name": "CVE-2026-64113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64113"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-64103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64103"
},
{
"name": "CVE-2026-46274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46274"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2026-43020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43020"
},
{
"name": "CVE-2026-31417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31417"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2026-43041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43041"
},
{
"name": "CVE-2026-31761",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31761"
},
{
"name": "CVE-2026-31466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31466"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53304"
},
{
"name": "CVE-2026-64174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64174"
},
{
"name": "CVE-2025-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54518"
},
{
"name": "CVE-2026-43111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43111"
},
{
"name": "CVE-2024-56584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56584"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2026-64034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64034"
},
{
"name": "CVE-2026-45958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45958"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-31778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31778"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2026-53039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53039"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-53004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53004"
},
{
"name": "CVE-2022-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49961"
},
{
"name": "CVE-2026-43040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43040"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-52912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52912"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-31552",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31552"
},
{
"name": "CVE-2026-64218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64218"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-43428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43428"
},
{
"name": "CVE-2026-52998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52998"
},
{
"name": "CVE-2026-53011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53011"
},
{
"name": "CVE-2026-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52920"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-53001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53001"
},
{
"name": "CVE-2026-23397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23397"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-23452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23452"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-23474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23474"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2026-52911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52911"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-43065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43065"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53295"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-23336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23336"
},
{
"name": "CVE-2026-45843",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45843"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-64219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64219"
},
{
"name": "CVE-2026-31497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31497"
},
{
"name": "CVE-2026-43451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43451"
},
{
"name": "CVE-2026-31570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31570"
},
{
"name": "CVE-2026-23289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23289"
},
{
"name": "CVE-2026-31755",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31755"
},
{
"name": "CVE-2026-64168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64168"
},
{
"name": "CVE-2026-46230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46230"
},
{
"name": "CVE-2026-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23141"
},
{
"name": "CVE-2025-21739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21739"
},
{
"name": "CVE-2026-23277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23277"
},
{
"name": "CVE-2026-31399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31399"
},
{
"name": "CVE-2026-31489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31489"
},
{
"name": "CVE-2026-53003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53003"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-43343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43343"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-46149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46149"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2026-64086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64086"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-46205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46205"
},
{
"name": "CVE-2026-53016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53016"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-23335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23335"
},
{
"name": "CVE-2026-52986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52986"
},
{
"name": "CVE-2026-31551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31551"
},
{
"name": "CVE-2026-53077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53077"
},
{
"name": "CVE-2026-31495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31495"
},
{
"name": "CVE-2026-46132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46132"
},
{
"name": "CVE-2026-46177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46177"
},
{
"name": "CVE-2026-43110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43110"
},
{
"name": "CVE-2026-31507",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31507"
},
{
"name": "CVE-2026-53306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53306"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-31762",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31762"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-31788",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31788"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-31428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31428"
},
{
"name": "CVE-2026-23420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23420"
},
{
"name": "CVE-2026-23388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23388"
},
{
"name": "CVE-2026-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53045"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2026-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43098"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-43386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43386"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2026-43089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43089"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-31676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31676"
},
{
"name": "CVE-2026-43112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43112"
},
{
"name": "CVE-2026-23442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23442"
},
{
"name": "CVE-2026-31476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31476"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-46107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46107"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-46273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46273"
},
{
"name": "CVE-2026-23458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23458"
},
{
"name": "CVE-2026-43502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43502"
},
{
"name": "CVE-2026-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53379"
},
{
"name": "CVE-2026-31674",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31674"
},
{
"name": "CVE-2026-31393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31393"
},
{
"name": "CVE-2026-43420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43420"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43027"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2025-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68206"
},
{
"name": "CVE-2026-46163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46163"
},
{
"name": "CVE-2022-49803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49803"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-64032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64032"
},
{
"name": "CVE-2026-45838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45838"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-23339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23339"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-53023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53023"
},
{
"name": "CVE-2026-31433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31433"
},
{
"name": "CVE-2026-43497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43497"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-45924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45924"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-64056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64056"
},
{
"name": "CVE-2026-52962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52962"
},
{
"name": "CVE-2026-63860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63860"
},
{
"name": "CVE-2026-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53093"
},
{
"name": "CVE-2026-64033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64033"
},
{
"name": "CVE-2026-23460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23460"
},
{
"name": "CVE-2026-46187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46187"
},
{
"name": "CVE-2026-43281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43281"
},
{
"name": "CVE-2025-71161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71161"
},
{
"name": "CVE-2026-46168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46168"
},
{
"name": "CVE-2026-53075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53075"
},
{
"name": "CVE-2026-31540",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31540"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-23395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23395"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-31651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31651"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2025-21863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21863"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-31747",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31747"
},
{
"name": "CVE-2026-31455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31455"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2026-43340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43340"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-23031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23031"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2026-64153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64153"
},
{
"name": "CVE-2026-23291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23291"
},
{
"name": "CVE-2026-53037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53037"
},
{
"name": "CVE-2026-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53072"
},
{
"name": "CVE-2026-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52921"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53068"
},
{
"name": "CVE-2026-46304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46304"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2025-68239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68239"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-23382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23382"
},
{
"name": "CVE-2026-43473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43473"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2026-31446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31446"
},
{
"name": "CVE-2026-46275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46275"
},
{
"name": "CVE-2026-23113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23113"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23157"
},
{
"name": "CVE-2026-31464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31464"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-64087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64087"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2026-46212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46212"
},
{
"name": "CVE-2026-45834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45834"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-31695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31695"
},
{
"name": "CVE-2026-31630",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31630"
},
{
"name": "CVE-2026-43333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43333"
},
{
"name": "CVE-2026-43105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43105"
},
{
"name": "CVE-2026-23312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23312"
},
{
"name": "CVE-2026-31508",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31508"
},
{
"name": "CVE-2026-64185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64185"
},
{
"name": "CVE-2026-23365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23365"
},
{
"name": "CVE-2025-40323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40323"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-46123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46123"
},
{
"name": "CVE-2026-43329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43329"
},
{
"name": "CVE-2026-31424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31424"
},
{
"name": "CVE-2026-23356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23356"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23307"
},
{
"name": "CVE-2026-52969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52969"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2026-53062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53062"
},
{
"name": "CVE-2026-64114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64114"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-43363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43363"
},
{
"name": "CVE-2026-64088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64088"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2026-31454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31454"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-31452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31452"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2026-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53369"
},
{
"name": "CVE-2026-31407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31407"
},
{
"name": "CVE-2026-23398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23398"
},
{
"name": "CVE-2026-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53082"
},
{
"name": "CVE-2026-52926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52926"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-31425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31425"
},
{
"name": "CVE-2026-46238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46238"
},
{
"name": "CVE-2026-64135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64135"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53074"
},
{
"name": "CVE-2026-45839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45839"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-52982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52982"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-43050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43050"
},
{
"name": "CVE-2026-53022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53022"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
},
{
"name": "CVE-2026-31673",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31673"
},
{
"name": "CVE-2026-31667",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31667"
}
],
"initial_release_date": "2026-08-07T00:00:00",
"last_revision_date": "2026-08-07T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0985",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-08-07T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et un probl\u00e8me de s\u00e9curit\u00e9 non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-07-31",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8620-3",
"url": "https://ubuntu.com/security/notices/USN-8620-3"
},
{
"published_at": "2026-07-31",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8620-4",
"url": "https://ubuntu.com/security/notices/USN-8620-4"
}
]
}
CERTFR-2026-AVI-1093
Vulnerability from certfr_avis - Published: 2026-08-28 - Updated: 2026-08-28
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 16.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-46325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46325"
},
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-43198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43198"
},
{
"name": "CVE-2026-45842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45842"
},
{
"name": "CVE-2026-31483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31483"
},
{
"name": "CVE-2026-64046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64046"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-31409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31409"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-43113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43113"
},
{
"name": "CVE-2026-31522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31522"
},
{
"name": "CVE-2025-71187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71187"
},
{
"name": "CVE-2026-43068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43068"
},
{
"name": "CVE-2026-23167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23167"
},
{
"name": "CVE-2026-31770",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31770"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-23129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23129"
},
{
"name": "CVE-2026-46184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46184"
},
{
"name": "CVE-2026-64133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64133"
},
{
"name": "CVE-2026-53049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53049"
},
{
"name": "CVE-2025-22107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22107"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31658",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31658"
},
{
"name": "CVE-2026-64047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64047"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2026-31756",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31756"
},
{
"name": "CVE-2026-31467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31467"
},
{
"name": "CVE-2026-52955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52955"
},
{
"name": "CVE-2026-23318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23318"
},
{
"name": "CVE-2026-23098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23098"
},
{
"name": "CVE-2026-23092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23092"
},
{
"name": "CVE-2026-23368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23368"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2026-52957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52957"
},
{
"name": "CVE-2026-52925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52925"
},
{
"name": "CVE-2026-23079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23079"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-46307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46307"
},
{
"name": "CVE-2025-27558",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27558"
},
{
"name": "CVE-2026-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53061"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-31485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31485"
},
{
"name": "CVE-2026-23022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23022"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-43373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43373"
},
{
"name": "CVE-2026-53002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53002"
},
{
"name": "CVE-2026-23126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23126"
},
{
"name": "CVE-2026-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53287"
},
{
"name": "CVE-2026-46124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46124"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2026-23054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23054"
},
{
"name": "CVE-2026-31754",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31754"
},
{
"name": "CVE-2026-53128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53128"
},
{
"name": "CVE-2026-23014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23014"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53320"
},
{
"name": "CVE-2026-31402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31402"
},
{
"name": "CVE-2026-23122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23122"
},
{
"name": "CVE-2026-23072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23072"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-31758",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31758"
},
{
"name": "CVE-2026-23159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23159"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2024-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53221"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2026-23045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23045"
},
{
"name": "CVE-2026-53041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53041"
},
{
"name": "CVE-2026-23281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23281"
},
{
"name": "CVE-2026-64179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64179"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2026-43060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43060"
},
{
"name": "CVE-2026-23114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23114"
},
{
"name": "CVE-2025-71221",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71221"
},
{
"name": "CVE-2026-52970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52970"
},
{
"name": "CVE-2026-52958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52958"
},
{
"name": "CVE-2023-53629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53629"
},
{
"name": "CVE-2026-46319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46319"
},
{
"name": "CVE-2026-31416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31416"
},
{
"name": "CVE-2026-23069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23069"
},
{
"name": "CVE-2026-64531",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64531"
},
{
"name": "CVE-2026-31656",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31656"
},
{
"name": "CVE-2026-52999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52999"
},
{
"name": "CVE-2026-22992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22992"
},
{
"name": "CVE-2026-46227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46227"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2026-23004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23004"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2025-71191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71191"
},
{
"name": "CVE-2026-53040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53040"
},
{
"name": "CVE-2026-23438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23438"
},
{
"name": "CVE-2026-43062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43062"
},
{
"name": "CVE-2026-23293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23293"
},
{
"name": "CVE-2026-23463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23463"
},
{
"name": "CVE-2026-23227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23227"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23454"
},
{
"name": "CVE-2026-31405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31405"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-23009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23009"
},
{
"name": "CVE-2026-43339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43339"
},
{
"name": "CVE-2026-64221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64221"
},
{
"name": "CVE-2026-43054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43054"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-23143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23143"
},
{
"name": "CVE-2026-45988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45988"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-31664",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31664"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2026-46112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46112"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2026-31473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31473"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-22981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22981"
},
{
"name": "CVE-2026-31550",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31550"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-23290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23290"
},
{
"name": "CVE-2026-31549",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31549"
},
{
"name": "CVE-2025-40103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40103"
},
{
"name": "CVE-2026-23020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23020"
},
{
"name": "CVE-2026-31752",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31752"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2026-43476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43476"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-52989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52989"
},
{
"name": "CVE-2026-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53291"
},
{
"name": "CVE-2025-71201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71201"
},
{
"name": "CVE-2026-52924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52924"
},
{
"name": "CVE-2026-23303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23303"
},
{
"name": "CVE-2026-43011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43011"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-31396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31396"
},
{
"name": "CVE-2026-23136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23136"
},
{
"name": "CVE-2026-23139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23139"
},
{
"name": "CVE-2026-31680",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31680"
},
{
"name": "CVE-2026-23017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23017"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-43465",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43465"
},
{
"name": "CVE-2026-23340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23340"
},
{
"name": "CVE-2026-43046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43046"
},
{
"name": "CVE-2026-46233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46233"
},
{
"name": "CVE-2025-71189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71189"
},
{
"name": "CVE-2026-52963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52963"
},
{
"name": "CVE-2026-46303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46303"
},
{
"name": "CVE-2026-23090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23090"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-23007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23007"
},
{
"name": "CVE-2026-31738",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31738"
},
{
"name": "CVE-2026-23035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23035"
},
{
"name": "CVE-2025-68307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68307"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2026-43411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43411"
},
{
"name": "CVE-2026-31751",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31751"
},
{
"name": "CVE-2026-43429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43429"
},
{
"name": "CVE-2026-53224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53224"
},
{
"name": "CVE-2026-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52993"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2026-23064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23064"
},
{
"name": "CVE-2025-71287",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71287"
},
{
"name": "CVE-2026-46231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46231"
},
{
"name": "CVE-2026-45835",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45835"
},
{
"name": "CVE-2026-43382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43382"
},
{
"name": "CVE-2026-22987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22987"
},
{
"name": "CVE-2026-23439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23439"
},
{
"name": "CVE-2026-23253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23253"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-31721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31721"
},
{
"name": "CVE-2026-23061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23061"
},
{
"name": "CVE-2026-23059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23059"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-23115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23115"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-43052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43052"
},
{
"name": "CVE-2026-43496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43496"
},
{
"name": "CVE-2026-64178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64178"
},
{
"name": "CVE-2026-23135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23135"
},
{
"name": "CVE-2026-43324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43324"
},
{
"name": "CVE-2026-52915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52915"
},
{
"name": "CVE-2026-64177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64177"
},
{
"name": "CVE-2026-23047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23047"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-46214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46214"
},
{
"name": "CVE-2026-23119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23119"
},
{
"name": "CVE-2026-23173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23173"
},
{
"name": "CVE-2026-23434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23434"
},
{
"name": "CVE-2026-23123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23123"
},
{
"name": "CVE-2026-23137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23137"
},
{
"name": "CVE-2026-43014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43014"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-31447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31447"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-31431",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31431"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53309"
},
{
"name": "CVE-2026-43445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43445"
},
{
"name": "CVE-2026-23094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23094"
},
{
"name": "CVE-2026-23049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23049"
},
{
"name": "CVE-2026-43387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43387"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2025-21712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21712"
},
{
"name": "CVE-2026-43028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43028"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-46236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46236"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-43475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43475"
},
{
"name": "CVE-2026-23042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23042"
},
{
"name": "CVE-2026-46113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46113"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2026-23304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23304"
},
{
"name": "CVE-2026-31683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31683"
},
{
"name": "CVE-2024-56557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56557"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2026-64220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64220"
},
{
"name": "CVE-2026-23101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23101"
},
{
"name": "CVE-2026-23357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23357"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-23099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23099"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-31408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31408"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2025-38105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38105"
},
{
"name": "CVE-2026-53071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53071"
},
{
"name": "CVE-2026-45841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45841"
},
{
"name": "CVE-2026-31524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31524"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-23066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23066"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2026-31478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31478"
},
{
"name": "CVE-2026-31546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31546"
},
{
"name": "CVE-2026-45956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45956"
},
{
"name": "CVE-2026-46331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46331"
},
{
"name": "CVE-2026-22989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22989"
},
{
"name": "CVE-2026-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23085"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23150"
},
{
"name": "CVE-2026-64165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64165"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-53064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53064"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-23324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23324"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-23109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23109"
},
{
"name": "CVE-2026-52995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52995"
},
{
"name": "CVE-2026-46209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46209"
},
{
"name": "CVE-2026-52931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52931"
},
{
"name": "CVE-2026-23130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23130"
},
{
"name": "CVE-2026-23163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23163"
},
{
"name": "CVE-2026-43047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43047"
},
{
"name": "CVE-2026-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53047"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2026-43432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43432"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-53296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53296"
},
{
"name": "CVE-2026-23057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23057"
},
{
"name": "CVE-2024-46715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46715"
},
{
"name": "CVE-2026-31545",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31545"
},
{
"name": "CVE-2026-31681",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31681"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-23456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23456"
},
{
"name": "CVE-2026-46186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46186"
},
{
"name": "CVE-2026-43458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43458"
},
{
"name": "CVE-2026-23166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23166"
},
{
"name": "CVE-2026-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52919"
},
{
"name": "CVE-2026-53006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53006"
},
{
"name": "CVE-2026-43450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43450"
},
{
"name": "CVE-2026-31510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31510"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-22991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22991"
},
{
"name": "CVE-2026-43079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43079"
},
{
"name": "CVE-2026-23457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23457"
},
{
"name": "CVE-2026-23081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23081"
},
{
"name": "CVE-2026-64102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64102"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-43103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43103"
},
{
"name": "CVE-2026-43069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43069"
},
{
"name": "CVE-2026-43425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43425"
},
{
"name": "CVE-2026-31642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31642"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-23399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23399"
},
{
"name": "CVE-2026-23012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23012"
},
{
"name": "CVE-2026-23116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23116"
},
{
"name": "CVE-2026-31659",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31659"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2026-43480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43480"
},
{
"name": "CVE-2026-64083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64083"
},
{
"name": "CVE-2026-23401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23401"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2026-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53048"
},
{
"name": "CVE-2025-71200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71200"
},
{
"name": "CVE-2026-43426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43426"
},
{
"name": "CVE-2026-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53176"
},
{
"name": "CVE-2026-43030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43030"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2026-43074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43074"
},
{
"name": "CVE-2026-46151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46151"
},
{
"name": "CVE-2026-22980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22980"
},
{
"name": "CVE-2026-23138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23138"
},
{
"name": "CVE-2026-23172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23172"
},
{
"name": "CVE-2026-23046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23046"
},
{
"name": "CVE-2026-43493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43493"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-45911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45911"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2026-46220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46220"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-43334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43334"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-23391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23391"
},
{
"name": "CVE-2026-31415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31415"
},
{
"name": "CVE-2026-46127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46127"
},
{
"name": "CVE-2026-23133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23133"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-23131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23131"
},
{
"name": "CVE-2026-23212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23212"
},
{
"name": "CVE-2026-23032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23032"
},
{
"name": "CVE-2026-23170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23170"
},
{
"name": "CVE-2024-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47809"
},
{
"name": "CVE-2026-23204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23204"
},
{
"name": "CVE-2026-23462",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23462"
},
{
"name": "CVE-2026-53046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53046"
},
{
"name": "CVE-2026-53050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53050"
},
{
"name": "CVE-2026-23019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23019"
},
{
"name": "CVE-2026-23372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23372"
},
{
"name": "CVE-2026-43080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43080"
},
{
"name": "CVE-2026-46146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46146"
},
{
"name": "CVE-2025-71188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71188"
},
{
"name": "CVE-2026-45836",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45836"
},
{
"name": "CVE-2026-64039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64039"
},
{
"name": "CVE-2026-23055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23055"
},
{
"name": "CVE-2026-46178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46178"
},
{
"name": "CVE-2026-45846",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45846"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-23125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23125"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-46174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46174"
},
{
"name": "CVE-2026-53021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53021"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-43327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43327"
},
{
"name": "CVE-2026-23005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23005"
},
{
"name": "CVE-2024-56719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56719"
},
{
"name": "CVE-2026-46133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46133"
},
{
"name": "CVE-2026-31494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31494"
},
{
"name": "CVE-2026-31565",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31565"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-43381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43381"
},
{
"name": "CVE-2026-23270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23270"
},
{
"name": "CVE-2026-31763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31763"
},
{
"name": "CVE-2026-23030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23030"
},
{
"name": "CVE-2026-23279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23279"
},
{
"name": "CVE-2026-22997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22997"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2026-31670",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31670"
},
{
"name": "CVE-2026-46122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46122"
},
{
"name": "CVE-2026-53131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53131"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2025-71196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71196"
},
{
"name": "CVE-2026-63865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63865"
},
{
"name": "CVE-2026-31422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31422"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-23286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23286"
},
{
"name": "CVE-2026-23359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23359"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-23298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23298"
},
{
"name": "CVE-2026-31469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31469"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-31498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31498"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-64085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64085"
},
{
"name": "CVE-2026-46043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46043"
},
{
"name": "CVE-2026-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46120"
},
{
"name": "CVE-2026-46198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46198"
},
{
"name": "CVE-2026-43336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43336"
},
{
"name": "CVE-2026-43104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43104"
},
{
"name": "CVE-2026-52954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52954"
},
{
"name": "CVE-2026-23078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23078"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-64166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64166"
},
{
"name": "CVE-2026-46189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46189"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-43466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43466"
},
{
"name": "CVE-2026-43197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43197"
},
{
"name": "CVE-2026-23296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23296"
},
{
"name": "CVE-2026-53130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53130"
},
{
"name": "CVE-2026-46128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46128"
},
{
"name": "CVE-2026-52984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52984"
},
{
"name": "CVE-2026-31427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31427"
},
{
"name": "CVE-2026-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53088"
},
{
"name": "CVE-2026-31555",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31555"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2026-46317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46317"
},
{
"name": "CVE-2026-64155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64155"
},
{
"name": "CVE-2026-43439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43439"
},
{
"name": "CVE-2022-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50073"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-23103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23103"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-43099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43099"
},
{
"name": "CVE-2026-46242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46242"
},
{
"name": "CVE-2026-53065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53065"
},
{
"name": "CVE-2025-71199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71199"
},
{
"name": "CVE-2026-31515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31515"
},
{
"name": "CVE-2026-31661",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31661"
},
{
"name": "CVE-2026-43380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43380"
},
{
"name": "CVE-2026-43452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43452"
},
{
"name": "CVE-2026-31737",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31737"
},
{
"name": "CVE-2025-68358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68358"
},
{
"name": "CVE-2026-46197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46197"
},
{
"name": "CVE-2026-46301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46301"
},
{
"name": "CVE-2026-52914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52914"
},
{
"name": "CVE-2026-52916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52916"
},
{
"name": "CVE-2026-53225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53225"
},
{
"name": "CVE-2026-23006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23006"
},
{
"name": "CVE-2026-53294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53294"
},
{
"name": "CVE-2026-23165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23165"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2026-23013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23013"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-64125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64125"
},
{
"name": "CVE-2026-43043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43043"
},
{
"name": "CVE-2025-71195",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71195"
},
{
"name": "CVE-2026-22994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22994"
},
{
"name": "CVE-2026-31705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31705"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31684"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-23396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23396"
},
{
"name": "CVE-2026-23083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23083"
},
{
"name": "CVE-2026-31423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31423"
},
{
"name": "CVE-2026-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52922"
},
{
"name": "CVE-2026-23088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23088"
},
{
"name": "CVE-2026-64089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64089"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-43051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43051"
},
{
"name": "CVE-2026-31759",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31759"
},
{
"name": "CVE-2026-52992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52992"
},
{
"name": "CVE-2023-45896",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45896"
},
{
"name": "CVE-2026-23370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23370"
},
{
"name": "CVE-2026-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53112"
},
{
"name": "CVE-2026-46206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46206"
},
{
"name": "CVE-2026-23108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23108"
},
{
"name": "CVE-2025-71180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71180"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-53086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53086"
},
{
"name": "CVE-2026-31781",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31781"
},
{
"name": "CVE-2026-43449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43449"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2025-71194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71194"
},
{
"name": "CVE-2026-31523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31523"
},
{
"name": "CVE-2026-23023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23023"
},
{
"name": "CVE-2026-43459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43459"
},
{
"name": "CVE-2026-31450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31450"
},
{
"name": "CVE-2026-31671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31671"
},
{
"name": "CVE-2026-31749",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31749"
},
{
"name": "CVE-2026-22999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22999"
},
{
"name": "CVE-2026-46234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46234"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-43328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43328"
},
{
"name": "CVE-2026-23068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23068"
},
{
"name": "CVE-2026-64018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64018"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2026-23089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23089"
},
{
"name": "CVE-2026-43024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43024"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-45985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45985"
},
{
"name": "CVE-2026-23071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23071"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2026-23056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23056"
},
{
"name": "CVE-2026-46108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46108"
},
{
"name": "CVE-2026-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53060"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-23352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23352"
},
{
"name": "CVE-2026-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53096"
},
{
"name": "CVE-2026-31720",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31720"
},
{
"name": "CVE-2026-31748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31748"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-43472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43472"
},
{
"name": "CVE-2026-23367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23367"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-23063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23063"
},
{
"name": "CVE-2026-45899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45899"
},
{
"name": "CVE-2026-31662",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31662"
},
{
"name": "CVE-2026-23073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23073"
},
{
"name": "CVE-2026-23058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23058"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2025-71182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71182"
},
{
"name": "CVE-2026-43026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43026"
},
{
"name": "CVE-2026-31480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31480"
},
{
"name": "CVE-2026-64055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64055"
},
{
"name": "CVE-2026-43405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43405"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-23038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23038"
},
{
"name": "CVE-2026-43430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43430"
},
{
"name": "CVE-2026-45920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45920"
},
{
"name": "CVE-2026-46150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46150"
},
{
"name": "CVE-2026-22990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22990"
},
{
"name": "CVE-2026-23000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23000"
},
{
"name": "CVE-2025-71186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71186"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-45840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45840"
},
{
"name": "CVE-2026-23026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23026"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-23446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23446"
},
{
"name": "CVE-2026-23128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23128"
},
{
"name": "CVE-2026-46219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46219"
},
{
"name": "CVE-2026-64173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64173"
},
{
"name": "CVE-2026-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53043"
},
{
"name": "CVE-2026-43075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43075"
},
{
"name": "CVE-2026-43035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43035"
},
{
"name": "CVE-2025-71190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71190"
},
{
"name": "CVE-2026-23140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23140"
},
{
"name": "CVE-2026-46172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46172"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2024-56657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56657"
},
{
"name": "CVE-2026-31665",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31665"
},
{
"name": "CVE-2026-46161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46161"
},
{
"name": "CVE-2026-23300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23300"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-23067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23067"
},
{
"name": "CVE-2026-23107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23107"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-23444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23444"
},
{
"name": "CVE-2026-43304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43304"
},
{
"name": "CVE-2026-22978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22978"
},
{
"name": "CVE-2026-43185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43185"
},
{
"name": "CVE-2026-43378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43378"
},
{
"name": "CVE-2026-64115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64115"
},
{
"name": "CVE-2026-45844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45844"
},
{
"name": "CVE-2026-52985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52985"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-31672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31672"
},
{
"name": "CVE-2026-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23146"
},
{
"name": "CVE-2026-43501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43501"
},
{
"name": "CVE-2026-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53059"
},
{
"name": "CVE-2026-23018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23018"
},
{
"name": "CVE-2026-43093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43093"
},
{
"name": "CVE-2026-31780",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31780"
},
{
"name": "CVE-2026-43342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43342"
},
{
"name": "CVE-2026-43379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43379"
},
{
"name": "CVE-2026-64164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64164"
},
{
"name": "CVE-2026-23037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23037"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-31521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31521"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2026-23106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23106"
},
{
"name": "CVE-2026-23001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23001"
},
{
"name": "CVE-2026-43357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43357"
},
{
"name": "CVE-2026-31634",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31634"
},
{
"name": "CVE-2026-43061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43061"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-53012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53012"
},
{
"name": "CVE-2026-43453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43453"
},
{
"name": "CVE-2026-64096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64096"
},
{
"name": "CVE-2026-43032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43032"
},
{
"name": "CVE-2026-43484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43484"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-23025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23025"
},
{
"name": "CVE-2026-23362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23362"
},
{
"name": "CVE-2026-23379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23379"
},
{
"name": "CVE-2026-23118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23118"
},
{
"name": "CVE-2026-43076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43076"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-43427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43427"
},
{
"name": "CVE-2022-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50116"
},
{
"name": "CVE-2026-31421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31421"
},
{
"name": "CVE-2026-53069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53069"
},
{
"name": "CVE-2026-23162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23162"
},
{
"name": "CVE-2026-53228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53228"
},
{
"name": "CVE-2026-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53073"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2026-43365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43365"
},
{
"name": "CVE-2022-50552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50552"
},
{
"name": "CVE-2026-23381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23381"
},
{
"name": "CVE-2026-31518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31518"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2025-68256",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68256"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-23151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23151"
},
{
"name": "CVE-2026-31660",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31660"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-46294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46294"
},
{
"name": "CVE-2026-31728",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31728"
},
{
"name": "CVE-2026-23008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23008"
},
{
"name": "CVE-2026-23152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23152"
},
{
"name": "CVE-2026-22982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22982"
},
{
"name": "CVE-2026-46290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46290"
},
{
"name": "CVE-2026-64084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64084"
},
{
"name": "CVE-2026-31400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31400"
},
{
"name": "CVE-2026-31512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31512"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-46135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46135"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-31726",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31726"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2026-43370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43370"
},
{
"name": "CVE-2026-31773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31773"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2023-52682",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52682"
},
{
"name": "CVE-2026-23142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23142"
},
{
"name": "CVE-2025-71150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71150"
},
{
"name": "CVE-2026-46167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46167"
},
{
"name": "CVE-2026-31607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31607"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-53212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53212"
},
{
"name": "CVE-2026-43015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43015"
},
{
"name": "CVE-2026-31509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31509"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2026-43066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43066"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-31679",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31679"
},
{
"name": "CVE-2026-31636",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31636"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2025-71192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71192"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2026-43469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43469"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-43085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43085"
},
{
"name": "CVE-2026-23121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23121"
},
{
"name": "CVE-2026-31637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31637"
},
{
"name": "CVE-2026-23051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23051"
},
{
"name": "CVE-2026-23428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23428"
},
{
"name": "CVE-2026-64113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64113"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-23034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23034"
},
{
"name": "CVE-2026-64103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64103"
},
{
"name": "CVE-2026-22993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22993"
},
{
"name": "CVE-2026-46274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46274"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2026-43020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43020"
},
{
"name": "CVE-2026-31417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31417"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2026-43041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43041"
},
{
"name": "CVE-2026-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53247"
},
{
"name": "CVE-2026-31761",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31761"
},
{
"name": "CVE-2026-31466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31466"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53304"
},
{
"name": "CVE-2026-64174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64174"
},
{
"name": "CVE-2025-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54518"
},
{
"name": "CVE-2026-43111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43111"
},
{
"name": "CVE-2024-56584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56584"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2026-22985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22985"
},
{
"name": "CVE-2026-23144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23144"
},
{
"name": "CVE-2026-23087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23087"
},
{
"name": "CVE-2026-31414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31414"
},
{
"name": "CVE-2026-64034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64034"
},
{
"name": "CVE-2026-45958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45958"
},
{
"name": "CVE-2025-71185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71185"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-31778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31778"
},
{
"name": "CVE-2026-23096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23096"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2026-53039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53039"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-23044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23044"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-53004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53004"
},
{
"name": "CVE-2022-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49961"
},
{
"name": "CVE-2026-43040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43040"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-52912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52912"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-31552",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31552"
},
{
"name": "CVE-2026-64218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64218"
},
{
"name": "CVE-2026-23164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23164"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-43428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43428"
},
{
"name": "CVE-2026-52998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52998"
},
{
"name": "CVE-2026-53011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53011"
},
{
"name": "CVE-2026-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52920"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-23124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23124"
},
{
"name": "CVE-2026-53001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53001"
},
{
"name": "CVE-2026-23397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23397"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-23452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23452"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-23002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23002"
},
{
"name": "CVE-2026-23474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23474"
},
{
"name": "CVE-2025-71160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71160"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2026-52911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52911"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-43065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43065"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53295"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2025-71162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71162"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-23075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23075"
},
{
"name": "CVE-2026-23077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23077"
},
{
"name": "CVE-2026-23120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23120"
},
{
"name": "CVE-2026-23336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23336"
},
{
"name": "CVE-2026-45843",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45843"
},
{
"name": "CVE-2026-22996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22996"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-23168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23168"
},
{
"name": "CVE-2026-64219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64219"
},
{
"name": "CVE-2026-31497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31497"
},
{
"name": "CVE-2026-43451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43451"
},
{
"name": "CVE-2026-23105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23105"
},
{
"name": "CVE-2026-22976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22976"
},
{
"name": "CVE-2026-43406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43406"
},
{
"name": "CVE-2026-31570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31570"
},
{
"name": "CVE-2026-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53215"
},
{
"name": "CVE-2026-23289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23289"
},
{
"name": "CVE-2026-31755",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31755"
},
{
"name": "CVE-2026-64168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64168"
},
{
"name": "CVE-2026-46230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46230"
},
{
"name": "CVE-2026-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23141"
},
{
"name": "CVE-2026-23065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23065"
},
{
"name": "CVE-2025-21739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21739"
},
{
"name": "CVE-2026-23277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23277"
},
{
"name": "CVE-2026-31399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31399"
},
{
"name": "CVE-2026-22986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22986"
},
{
"name": "CVE-2026-31489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31489"
},
{
"name": "CVE-2026-23086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23086"
},
{
"name": "CVE-2026-53003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53003"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-43343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43343"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-31444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31444"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-46149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46149"
},
{
"name": "CVE-2026-23455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23455"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2026-64086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64086"
},
{
"name": "CVE-2026-43341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43341"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-46205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46205"
},
{
"name": "CVE-2026-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53359"
},
{
"name": "CVE-2026-53016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53016"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-23335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23335"
},
{
"name": "CVE-2026-52986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52986"
},
{
"name": "CVE-2026-31551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31551"
},
{
"name": "CVE-2026-53077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53077"
},
{
"name": "CVE-2026-31495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31495"
},
{
"name": "CVE-2026-46132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46132"
},
{
"name": "CVE-2026-23156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23156"
},
{
"name": "CVE-2026-23158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23158"
},
{
"name": "CVE-2025-71193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71193"
},
{
"name": "CVE-2026-23095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23095"
},
{
"name": "CVE-2026-46177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46177"
},
{
"name": "CVE-2026-43110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43110"
},
{
"name": "CVE-2025-71163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71163"
},
{
"name": "CVE-2026-23062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23062"
},
{
"name": "CVE-2026-31507",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31507"
},
{
"name": "CVE-2026-53306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53306"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53277"
},
{
"name": "CVE-2026-64587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64587"
},
{
"name": "CVE-2026-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23160"
},
{
"name": "CVE-2026-31762",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31762"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-43071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43071"
},
{
"name": "CVE-2026-31788",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31788"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-31428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31428"
},
{
"name": "CVE-2026-23420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23420"
},
{
"name": "CVE-2026-23388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23388"
},
{
"name": "CVE-2026-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53045"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2026-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43098"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-43386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43386"
},
{
"name": "CVE-2026-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47333"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2026-43089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43089"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-23070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23070"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-23033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23033"
},
{
"name": "CVE-2026-31676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31676"
},
{
"name": "CVE-2026-22977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22977"
},
{
"name": "CVE-2026-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23145"
},
{
"name": "CVE-2026-43186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43186"
},
{
"name": "CVE-2026-43112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43112"
},
{
"name": "CVE-2026-43083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43083"
},
{
"name": "CVE-2026-23442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23442"
},
{
"name": "CVE-2026-31476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31476"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-23104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23104"
},
{
"name": "CVE-2026-46107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46107"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-46273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46273"
},
{
"name": "CVE-2026-23458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23458"
},
{
"name": "CVE-2026-23003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23003"
},
{
"name": "CVE-2026-43502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43502"
},
{
"name": "CVE-2026-31649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31649"
},
{
"name": "CVE-2026-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53379"
},
{
"name": "CVE-2026-31674",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31674"
},
{
"name": "CVE-2026-31393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31393"
},
{
"name": "CVE-2026-43420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43420"
},
{
"name": "CVE-2026-23076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23076"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43027"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2025-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68206"
},
{
"name": "CVE-2026-46163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46163"
},
{
"name": "CVE-2025-71158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71158"
},
{
"name": "CVE-2022-49803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49803"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-64032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64032"
},
{
"name": "CVE-2026-45838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45838"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-23339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23339"
},
{
"name": "CVE-2026-23171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23171"
},
{
"name": "CVE-2026-23010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23010"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-53023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53023"
},
{
"name": "CVE-2026-31433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31433"
},
{
"name": "CVE-2026-43497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43497"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-45924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45924"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-64056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64056"
},
{
"name": "CVE-2026-52962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52962"
},
{
"name": "CVE-2026-63860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63860"
},
{
"name": "CVE-2026-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53093"
},
{
"name": "CVE-2026-31589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31589"
},
{
"name": "CVE-2026-23084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23084"
},
{
"name": "CVE-2026-22979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22979"
},
{
"name": "CVE-2026-64033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64033"
},
{
"name": "CVE-2026-23460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23460"
},
{
"name": "CVE-2026-46187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46187"
},
{
"name": "CVE-2026-43281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43281"
},
{
"name": "CVE-2026-23011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23011"
},
{
"name": "CVE-2026-23015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23015"
},
{
"name": "CVE-2025-71161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71161"
},
{
"name": "CVE-2026-46168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46168"
},
{
"name": "CVE-2026-53075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53075"
},
{
"name": "CVE-2026-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53246"
},
{
"name": "CVE-2026-31540",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31540"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-23395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23395"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-31651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31651"
},
{
"name": "CVE-2026-23110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23110"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2025-21863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21863"
},
{
"name": "CVE-2026-31657",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31657"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-31747",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31747"
},
{
"name": "CVE-2026-31455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31455"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2026-43340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43340"
},
{
"name": "CVE-2026-23148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23148"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2025-71197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71197"
},
{
"name": "CVE-2026-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53151"
},
{
"name": "CVE-2026-23031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23031"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2026-23102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23102"
},
{
"name": "CVE-2026-22998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22998"
},
{
"name": "CVE-2026-23050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23050"
},
{
"name": "CVE-2026-23161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23161"
},
{
"name": "CVE-2026-64153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64153"
},
{
"name": "CVE-2026-23291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23291"
},
{
"name": "CVE-2026-53037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53037"
},
{
"name": "CVE-2026-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53072"
},
{
"name": "CVE-2026-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52921"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53068"
},
{
"name": "CVE-2026-46304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46304"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2025-68239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68239"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-23382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23382"
},
{
"name": "CVE-2026-31633",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31633"
},
{
"name": "CVE-2026-43473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43473"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2026-31446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31446"
},
{
"name": "CVE-2026-46275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46275"
},
{
"name": "CVE-2026-23024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23024"
},
{
"name": "CVE-2026-23113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23113"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23157"
},
{
"name": "CVE-2026-31464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31464"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-64087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64087"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2026-46212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46212"
},
{
"name": "CVE-2026-45834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45834"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-23097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23097"
},
{
"name": "CVE-2026-31695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31695"
},
{
"name": "CVE-2026-31630",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31630"
},
{
"name": "CVE-2025-71198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71198"
},
{
"name": "CVE-2026-43333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43333"
},
{
"name": "CVE-2026-23036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23036"
},
{
"name": "CVE-2026-43105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43105"
},
{
"name": "CVE-2026-23312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23312"
},
{
"name": "CVE-2026-31508",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31508"
},
{
"name": "CVE-2026-23052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23052"
},
{
"name": "CVE-2026-64185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64185"
},
{
"name": "CVE-2026-23021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23021"
},
{
"name": "CVE-2026-23365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23365"
},
{
"name": "CVE-2025-40323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40323"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-46123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46123"
},
{
"name": "CVE-2026-43329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43329"
},
{
"name": "CVE-2026-31424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31424"
},
{
"name": "CVE-2026-23093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23093"
},
{
"name": "CVE-2026-23356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23356"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23307"
},
{
"name": "CVE-2026-52969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52969"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2025-71183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71183"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-53062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53062"
},
{
"name": "CVE-2026-64114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64114"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-23053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23053"
},
{
"name": "CVE-2026-43363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43363"
},
{
"name": "CVE-2026-64088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64088"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2026-31454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31454"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2025-71184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71184"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-31452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31452"
},
{
"name": "CVE-2026-31501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31501"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2026-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53369"
},
{
"name": "CVE-2026-31407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31407"
},
{
"name": "CVE-2026-23398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23398"
},
{
"name": "CVE-2025-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68263"
},
{
"name": "CVE-2026-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53082"
},
{
"name": "CVE-2026-52926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52926"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-31425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31425"
},
{
"name": "CVE-2026-46238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46238"
},
{
"name": "CVE-2026-64135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64135"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53074"
},
{
"name": "CVE-2026-45839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45839"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-23147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23147"
},
{
"name": "CVE-2026-52982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52982"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-23080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23080"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-43050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43050"
},
{
"name": "CVE-2026-53022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53022"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
},
{
"name": "CVE-2026-23154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23154"
},
{
"name": "CVE-2026-31673",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31673"
},
{
"name": "CVE-2026-31667",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31667"
}
],
"initial_release_date": "2026-08-28T00:00:00",
"last_revision_date": "2026-08-28T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-1093",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-08-28T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-08-27",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8666-3",
"url": "https://ubuntu.com/security/notices/USN-8666-3"
},
{
"published_at": "2026-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8643-3",
"url": "https://ubuntu.com/security/notices/USN-8643-3"
},
{
"published_at": "2026-08-26",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8659-4",
"url": "https://ubuntu.com/security/notices/USN-8659-4"
},
{
"published_at": "2026-08-27",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu LSN-0121-1",
"url": "https://ubuntu.com/security/notices/LSN-0121-1"
},
{
"published_at": "2026-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8669-1",
"url": "https://ubuntu.com/security/notices/USN-8669-1"
},
{
"published_at": "2026-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8667-1",
"url": "https://ubuntu.com/security/notices/USN-8667-1"
},
{
"published_at": "2026-08-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8643-4",
"url": "https://ubuntu.com/security/notices/USN-8643-4"
},
{
"published_at": "2026-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8662-2",
"url": "https://ubuntu.com/security/notices/USN-8662-2"
},
{
"published_at": "2026-08-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8666-2",
"url": "https://ubuntu.com/security/notices/USN-8666-2"
},
{
"published_at": "2026-08-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8659-3",
"url": "https://ubuntu.com/security/notices/USN-8659-3"
},
{
"published_at": "2026-08-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8630-5",
"url": "https://ubuntu.com/security/notices/USN-8630-5"
},
{
"published_at": "2026-08-27",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8658-4",
"url": "https://ubuntu.com/security/notices/USN-8658-4"
},
{
"published_at": "2026-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8668-1",
"url": "https://ubuntu.com/security/notices/USN-8668-1"
},
{
"published_at": "2026-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8661-2",
"url": "https://ubuntu.com/security/notices/USN-8661-2"
},
{
"published_at": "2026-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8659-2",
"url": "https://ubuntu.com/security/notices/USN-8659-2"
},
{
"published_at": "2026-08-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8658-2",
"url": "https://ubuntu.com/security/notices/USN-8658-2"
},
{
"published_at": "2026-08-27",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8644-3",
"url": "https://ubuntu.com/security/notices/USN-8644-3"
},
{
"published_at": "2026-08-27",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8643-5",
"url": "https://ubuntu.com/security/notices/USN-8643-5"
},
{
"published_at": "2026-08-27",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8661-3",
"url": "https://ubuntu.com/security/notices/USN-8661-3"
},
{
"published_at": "2026-08-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8658-3",
"url": "https://ubuntu.com/security/notices/USN-8658-3"
}
]
}
CERTFR-2026-AVI-1229
Vulnerability from certfr_avis - Published: 2026-09-25 - Updated: 2026-09-25
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-64141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64141"
},
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-72436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72436"
},
{
"name": "CVE-2026-43198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43198"
},
{
"name": "CVE-2026-45842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45842"
},
{
"name": "CVE-2026-31483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31483"
},
{
"name": "CVE-2026-64353",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64353"
},
{
"name": "CVE-2026-64214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64214"
},
{
"name": "CVE-2026-64046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64046"
},
{
"name": "CVE-2026-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53091"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-68459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68459"
},
{
"name": "CVE-2026-31409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31409"
},
{
"name": "CVE-2026-64376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64376"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-64186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64186"
},
{
"name": "CVE-2026-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53192"
},
{
"name": "CVE-2026-64590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64590"
},
{
"name": "CVE-2026-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53230"
},
{
"name": "CVE-2026-53398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53398"
},
{
"name": "CVE-2026-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53349"
},
{
"name": "CVE-2026-43113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43113"
},
{
"name": "CVE-2026-53038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53038"
},
{
"name": "CVE-2026-31522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31522"
},
{
"name": "CVE-2026-43068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43068"
},
{
"name": "CVE-2026-64287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64287"
},
{
"name": "CVE-2026-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53381"
},
{
"name": "CVE-2026-64270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64270"
},
{
"name": "CVE-2026-53132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53132"
},
{
"name": "CVE-2026-64275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64275"
},
{
"name": "CVE-2026-64274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64274"
},
{
"name": "CVE-2026-31770",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31770"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-74394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74394"
},
{
"name": "CVE-2026-64485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64485"
},
{
"name": "CVE-2026-46211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46211"
},
{
"name": "CVE-2026-63957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63957"
},
{
"name": "CVE-2026-46118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46118"
},
{
"name": "CVE-2026-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53272"
},
{
"name": "CVE-2026-53119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53119"
},
{
"name": "CVE-2026-52934",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52934"
},
{
"name": "CVE-2026-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53179"
},
{
"name": "CVE-2026-46184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46184"
},
{
"name": "CVE-2026-64133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64133"
},
{
"name": "CVE-2026-63864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63864"
},
{
"name": "CVE-2026-53049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53049"
},
{
"name": "CVE-2025-22107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22107"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31658",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31658"
},
{
"name": "CVE-2026-64047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64047"
},
{
"name": "CVE-2026-64143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64143"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2026-64067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64067"
},
{
"name": "CVE-2026-74439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74439"
},
{
"name": "CVE-2026-63854",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63854"
},
{
"name": "CVE-2026-31756",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31756"
},
{
"name": "CVE-2026-64192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64192"
},
{
"name": "CVE-2026-31467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31467"
},
{
"name": "CVE-2026-52955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52955"
},
{
"name": "CVE-2026-23318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23318"
},
{
"name": "CVE-2026-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53350"
},
{
"name": "CVE-2026-23368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23368"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2026-52957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52957"
},
{
"name": "CVE-2026-63974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63974"
},
{
"name": "CVE-2026-53116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53116"
},
{
"name": "CVE-2026-53214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53214"
},
{
"name": "CVE-2026-52925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52925"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-46307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46307"
},
{
"name": "CVE-2026-46130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46130"
},
{
"name": "CVE-2025-27558",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27558"
},
{
"name": "CVE-2026-64452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64452"
},
{
"name": "CVE-2026-63943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63943"
},
{
"name": "CVE-2026-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53210"
},
{
"name": "CVE-2026-52929",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52929"
},
{
"name": "CVE-2026-64492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64492"
},
{
"name": "CVE-2026-64483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64483"
},
{
"name": "CVE-2026-63980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63980"
},
{
"name": "CVE-2026-52968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52968"
},
{
"name": "CVE-2026-64322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64322"
},
{
"name": "CVE-2026-45845",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45845"
},
{
"name": "CVE-2026-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53061"
},
{
"name": "CVE-2026-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53292"
},
{
"name": "CVE-2026-64470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64470"
},
{
"name": "CVE-2026-64172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64172"
},
{
"name": "CVE-2026-53027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53027"
},
{
"name": "CVE-2026-64074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64074"
},
{
"name": "CVE-2026-63843",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63843"
},
{
"name": "CVE-2026-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53364"
},
{
"name": "CVE-2026-64461",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64461"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-64501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64501"
},
{
"name": "CVE-2026-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53374"
},
{
"name": "CVE-2026-31485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31485"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-63923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63923"
},
{
"name": "CVE-2026-43373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43373"
},
{
"name": "CVE-2026-53002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53002"
},
{
"name": "CVE-2026-53090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53090"
},
{
"name": "CVE-2026-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53287"
},
{
"name": "CVE-2026-46124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46124"
},
{
"name": "CVE-2026-53301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53301"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53274"
},
{
"name": "CVE-2026-64094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64094"
},
{
"name": "CVE-2026-53202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53202"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-63921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63921"
},
{
"name": "CVE-2026-63966",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63966"
},
{
"name": "CVE-2026-64513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64513"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2026-64413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64413"
},
{
"name": "CVE-2026-63841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63841"
},
{
"name": "CVE-2026-68088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68088"
},
{
"name": "CVE-2026-64388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64388"
},
{
"name": "CVE-2026-53117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53117"
},
{
"name": "CVE-2026-64512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64512"
},
{
"name": "CVE-2026-63882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63882"
},
{
"name": "CVE-2026-31754",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31754"
},
{
"name": "CVE-2026-53128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53128"
},
{
"name": "CVE-2026-64409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64409"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53320"
},
{
"name": "CVE-2026-63838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63838"
},
{
"name": "CVE-2026-52947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52947"
},
{
"name": "CVE-2026-53218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53218"
},
{
"name": "CVE-2026-46134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46134"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-64367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64367"
},
{
"name": "CVE-2026-31758",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31758"
},
{
"name": "CVE-2026-64516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64516"
},
{
"name": "CVE-2026-64077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64077"
},
{
"name": "CVE-2026-64380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64380"
},
{
"name": "CVE-2026-64268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64268"
},
{
"name": "CVE-2026-53092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53092"
},
{
"name": "CVE-2026-53010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53010"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2026-64023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64023"
},
{
"name": "CVE-2024-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53221"
},
{
"name": "CVE-2026-46121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46121"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2026-53378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53378"
},
{
"name": "CVE-2026-53169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53169"
},
{
"name": "CVE-2026-53041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53041"
},
{
"name": "CVE-2026-23281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23281"
},
{
"name": "CVE-2026-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53066"
},
{
"name": "CVE-2026-64099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64099"
},
{
"name": "CVE-2026-64179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64179"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-64489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64489"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2026-64510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64510"
},
{
"name": "CVE-2026-53143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53143"
},
{
"name": "CVE-2026-64480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64480"
},
{
"name": "CVE-2026-64399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64399"
},
{
"name": "CVE-2026-43060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43060"
},
{
"name": "CVE-2026-72494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72494"
},
{
"name": "CVE-2025-71221",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71221"
},
{
"name": "CVE-2026-80665",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80665"
},
{
"name": "CVE-2026-74376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74376"
},
{
"name": "CVE-2026-53161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53161"
},
{
"name": "CVE-2026-53271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53271"
},
{
"name": "CVE-2026-63852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63852"
},
{
"name": "CVE-2026-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53109"
},
{
"name": "CVE-2026-52970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52970"
},
{
"name": "CVE-2026-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53367"
},
{
"name": "CVE-2026-52958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52958"
},
{
"name": "CVE-2026-64006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64006"
},
{
"name": "CVE-2026-64385",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64385"
},
{
"name": "CVE-2026-53193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53193"
},
{
"name": "CVE-2026-64405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64405"
},
{
"name": "CVE-2026-72130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72130"
},
{
"name": "CVE-2026-53140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53140"
},
{
"name": "CVE-2026-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53297"
},
{
"name": "CVE-2026-63995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63995"
},
{
"name": "CVE-2023-53629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53629"
},
{
"name": "CVE-2026-64217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64217"
},
{
"name": "CVE-2026-63818",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63818"
},
{
"name": "CVE-2026-63911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63911"
},
{
"name": "CVE-2026-46319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46319"
},
{
"name": "CVE-2026-64414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64414"
},
{
"name": "CVE-2026-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53229"
},
{
"name": "CVE-2026-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53104"
},
{
"name": "CVE-2026-64042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64042"
},
{
"name": "CVE-2026-31416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31416"
},
{
"name": "CVE-2026-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53244"
},
{
"name": "CVE-2026-43492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43492"
},
{
"name": "CVE-2026-64502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64502"
},
{
"name": "CVE-2026-64454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64454"
},
{
"name": "CVE-2026-31486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31486"
},
{
"name": "CVE-2026-64531",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64531"
},
{
"name": "CVE-2026-63993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63993"
},
{
"name": "CVE-2026-31656",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31656"
},
{
"name": "CVE-2026-64308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64308"
},
{
"name": "CVE-2026-53014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53014"
},
{
"name": "CVE-2026-64407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64407"
},
{
"name": "CVE-2026-52999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52999"
},
{
"name": "CVE-2026-63832",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63832"
},
{
"name": "CVE-2026-46227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46227"
},
{
"name": "CVE-2026-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53305"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2026-64402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64402"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2026-64527",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64527"
},
{
"name": "CVE-2026-63807",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63807"
},
{
"name": "CVE-2026-53040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53040"
},
{
"name": "CVE-2026-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53231"
},
{
"name": "CVE-2026-23438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23438"
},
{
"name": "CVE-2026-43062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43062"
},
{
"name": "CVE-2026-23293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23293"
},
{
"name": "CVE-2026-23463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23463"
},
{
"name": "CVE-2026-63988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63988"
},
{
"name": "CVE-2026-23227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23227"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-63839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63839"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-64151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64151"
},
{
"name": "CVE-2026-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23454"
},
{
"name": "CVE-2026-31405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31405"
},
{
"name": "CVE-2026-53399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53399"
},
{
"name": "CVE-2026-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53400"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-63886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63886"
},
{
"name": "CVE-2026-64045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64045"
},
{
"name": "CVE-2026-43339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43339"
},
{
"name": "CVE-2026-64221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64221"
},
{
"name": "CVE-2026-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53106"
},
{
"name": "CVE-2026-64365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64365"
},
{
"name": "CVE-2026-64025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64025"
},
{
"name": "CVE-2026-63931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63931"
},
{
"name": "CVE-2026-43054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43054"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-46298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46298"
},
{
"name": "CVE-2026-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53260"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-31664",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31664"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2026-46112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46112"
},
{
"name": "CVE-2026-64264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64264"
},
{
"name": "CVE-2026-64176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64176"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2026-64128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64128"
},
{
"name": "CVE-2026-31473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31473"
},
{
"name": "CVE-2026-53278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53278"
},
{
"name": "CVE-2026-72320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72320"
},
{
"name": "CVE-2026-46196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46196"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-46170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46170"
},
{
"name": "CVE-2026-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53185"
},
{
"name": "CVE-2026-64059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64059"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-53020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53020"
},
{
"name": "CVE-2026-53121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53121"
},
{
"name": "CVE-2026-64132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64132"
},
{
"name": "CVE-2026-53138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53138"
},
{
"name": "CVE-2026-31550",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31550"
},
{
"name": "CVE-2026-64241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64241"
},
{
"name": "CVE-2026-63830",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63830"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-23290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23290"
},
{
"name": "CVE-2026-31549",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31549"
},
{
"name": "CVE-2025-40103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40103"
},
{
"name": "CVE-2026-64256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64256"
},
{
"name": "CVE-2026-31752",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31752"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2026-64319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64319"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2026-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53391"
},
{
"name": "CVE-2026-74345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74345"
},
{
"name": "CVE-2026-43476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43476"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-52989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52989"
},
{
"name": "CVE-2026-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53370"
},
{
"name": "CVE-2026-63924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63924"
},
{
"name": "CVE-2026-72083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72083"
},
{
"name": "CVE-2026-64591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64591"
},
{
"name": "CVE-2026-64333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64333"
},
{
"name": "CVE-2026-53141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53141"
},
{
"name": "CVE-2026-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53291"
},
{
"name": "CVE-2026-52924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52924"
},
{
"name": "CVE-2026-53227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53227"
},
{
"name": "CVE-2026-63979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63979"
},
{
"name": "CVE-2026-64404",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64404"
},
{
"name": "CVE-2026-23303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23303"
},
{
"name": "CVE-2026-63928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63928"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-64467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64467"
},
{
"name": "CVE-2026-63940",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63940"
},
{
"name": "CVE-2026-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53239"
},
{
"name": "CVE-2026-31396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31396"
},
{
"name": "CVE-2026-53029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53029"
},
{
"name": "CVE-2026-63879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63879"
},
{
"name": "CVE-2026-31680",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31680"
},
{
"name": "CVE-2026-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53342"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53181"
},
{
"name": "CVE-2026-23340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23340"
},
{
"name": "CVE-2026-43046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43046"
},
{
"name": "CVE-2026-46233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46233"
},
{
"name": "CVE-2026-52918",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52918"
},
{
"name": "CVE-2026-64424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64424"
},
{
"name": "CVE-2026-64389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64389"
},
{
"name": "CVE-2026-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53220"
},
{
"name": "CVE-2026-46117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46117"
},
{
"name": "CVE-2026-64246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64246"
},
{
"name": "CVE-2026-64223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64223"
},
{
"name": "CVE-2025-71289",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71289"
},
{
"name": "CVE-2026-52963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52963"
},
{
"name": "CVE-2026-46140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46140"
},
{
"name": "CVE-2026-64326",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64326"
},
{
"name": "CVE-2026-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53373"
},
{
"name": "CVE-2026-63933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63933"
},
{
"name": "CVE-2026-68085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68085"
},
{
"name": "CVE-2026-74401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74401"
},
{
"name": "CVE-2026-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53286"
},
{
"name": "CVE-2026-46303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46303"
},
{
"name": "CVE-2026-46114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46114"
},
{
"name": "CVE-2026-63870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63870"
},
{
"name": "CVE-2026-64386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64386"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-72319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72319"
},
{
"name": "CVE-2026-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53331"
},
{
"name": "CVE-2026-31738",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31738"
},
{
"name": "CVE-2026-64460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64460"
},
{
"name": "CVE-2026-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53365"
},
{
"name": "CVE-2026-64514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64514"
},
{
"name": "CVE-2026-64082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64082"
},
{
"name": "CVE-2026-63821",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63821"
},
{
"name": "CVE-2025-68307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68307"
},
{
"name": "CVE-2026-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53081"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2026-68091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68091"
},
{
"name": "CVE-2026-64260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64260"
},
{
"name": "CVE-2026-63805",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63805"
},
{
"name": "CVE-2026-43411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43411"
},
{
"name": "CVE-2026-64279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64279"
},
{
"name": "CVE-2026-31751",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31751"
},
{
"name": "CVE-2026-63915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63915"
},
{
"name": "CVE-2026-43429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43429"
},
{
"name": "CVE-2026-53224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53224"
},
{
"name": "CVE-2026-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53360"
},
{
"name": "CVE-2026-46141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46141"
},
{
"name": "CVE-2026-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52993"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2026-64383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64383"
},
{
"name": "CVE-2026-63847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63847"
},
{
"name": "CVE-2026-64337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64337"
},
{
"name": "CVE-2025-71287",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71287"
},
{
"name": "CVE-2026-46231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46231"
},
{
"name": "CVE-2026-52996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52996"
},
{
"name": "CVE-2026-63888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63888"
},
{
"name": "CVE-2026-64430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64430"
},
{
"name": "CVE-2026-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53095"
},
{
"name": "CVE-2026-45835",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45835"
},
{
"name": "CVE-2026-68083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68083"
},
{
"name": "CVE-2026-53007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53007"
},
{
"name": "CVE-2026-43382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43382"
},
{
"name": "CVE-2026-64162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64162"
},
{
"name": "CVE-2026-64104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64104"
},
{
"name": "CVE-2026-23439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23439"
},
{
"name": "CVE-2026-52956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52956"
},
{
"name": "CVE-2026-64459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64459"
},
{
"name": "CVE-2026-23253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23253"
},
{
"name": "CVE-2026-64232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64232"
},
{
"name": "CVE-2026-52943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52943"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-31721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31721"
},
{
"name": "CVE-2026-63896",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63896"
},
{
"name": "CVE-2026-64295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64295"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-46229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46229"
},
{
"name": "CVE-2026-68089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68089"
},
{
"name": "CVE-2026-72466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72466"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-43052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43052"
},
{
"name": "CVE-2026-43496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43496"
},
{
"name": "CVE-2026-64592",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64592"
},
{
"name": "CVE-2026-64178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64178"
},
{
"name": "CVE-2026-43324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43324"
},
{
"name": "CVE-2026-52915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52915"
},
{
"name": "CVE-2026-64177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64177"
},
{
"name": "CVE-2026-64497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64497"
},
{
"name": "CVE-2026-53163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53163"
},
{
"name": "CVE-2026-46173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46173"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-64258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64258"
},
{
"name": "CVE-2026-68090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68090"
},
{
"name": "CVE-2026-46204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46204"
},
{
"name": "CVE-2026-46214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46214"
},
{
"name": "CVE-2026-53146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53146"
},
{
"name": "CVE-2026-63956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63956"
},
{
"name": "CVE-2026-64599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64599"
},
{
"name": "CVE-2026-68461",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68461"
},
{
"name": "CVE-2026-64189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64189"
},
{
"name": "CVE-2026-72339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72339"
},
{
"name": "CVE-2026-63798",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63798"
},
{
"name": "CVE-2026-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53354"
},
{
"name": "CVE-2026-23434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23434"
},
{
"name": "CVE-2026-46182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46182"
},
{
"name": "CVE-2026-63845",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63845"
},
{
"name": "CVE-2026-64598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64598"
},
{
"name": "CVE-2026-53103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53103"
},
{
"name": "CVE-2026-64017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64017"
},
{
"name": "CVE-2026-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53313"
},
{
"name": "CVE-2026-64230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64230"
},
{
"name": "CVE-2026-53345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53345"
},
{
"name": "CVE-2026-46183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46183"
},
{
"name": "CVE-2026-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53205"
},
{
"name": "CVE-2026-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53321"
},
{
"name": "CVE-2026-63810",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63810"
},
{
"name": "CVE-2026-64098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64098"
},
{
"name": "CVE-2026-63801",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63801"
},
{
"name": "CVE-2026-63815",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63815"
},
{
"name": "CVE-2026-63827",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63827"
},
{
"name": "CVE-2026-64304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64304"
},
{
"name": "CVE-2026-43014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43014"
},
{
"name": "CVE-2026-64451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64451"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-63842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63842"
},
{
"name": "CVE-2026-46158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46158"
},
{
"name": "CVE-2026-74267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74267"
},
{
"name": "CVE-2026-63929",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63929"
},
{
"name": "CVE-2026-31447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31447"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-64226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64226"
},
{
"name": "CVE-2026-64146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64146"
},
{
"name": "CVE-2026-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53397"
},
{
"name": "CVE-2026-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53309"
},
{
"name": "CVE-2026-43445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43445"
},
{
"name": "CVE-2026-68457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68457"
},
{
"name": "CVE-2026-72366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72366"
},
{
"name": "CVE-2026-46320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46320"
},
{
"name": "CVE-2026-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53201"
},
{
"name": "CVE-2026-63910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63910"
},
{
"name": "CVE-2026-43387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43387"
},
{
"name": "CVE-2026-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53097"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2026-64276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64276"
},
{
"name": "CVE-2025-21712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21712"
},
{
"name": "CVE-2026-43028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43028"
},
{
"name": "CVE-2026-63948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63948"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-46236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46236"
},
{
"name": "CVE-2026-64475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64475"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-43475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43475"
},
{
"name": "CVE-2026-64508",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64508"
},
{
"name": "CVE-2026-64013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64013"
},
{
"name": "CVE-2026-52913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52913"
},
{
"name": "CVE-2026-64237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64237"
},
{
"name": "CVE-2026-64323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64323"
},
{
"name": "CVE-2026-64438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64438"
},
{
"name": "CVE-2026-46113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46113"
},
{
"name": "CVE-2026-64261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64261"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2026-23304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23304"
},
{
"name": "CVE-2026-31683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31683"
},
{
"name": "CVE-2024-56557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56557"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2026-64220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64220"
},
{
"name": "CVE-2026-23357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23357"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-31408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31408"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2025-38105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38105"
},
{
"name": "CVE-2026-53071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53071"
},
{
"name": "CVE-2026-52941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52941"
},
{
"name": "CVE-2026-45841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45841"
},
{
"name": "CVE-2026-53102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53102"
},
{
"name": "CVE-2026-31524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31524"
},
{
"name": "CVE-2026-64271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64271"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53150"
},
{
"name": "CVE-2026-53327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53327"
},
{
"name": "CVE-2026-53044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53044"
},
{
"name": "CVE-2026-63913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63913"
},
{
"name": "CVE-2026-46188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46188"
},
{
"name": "CVE-2026-64068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64068"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-52939",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52939"
},
{
"name": "CVE-2026-64038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64038"
},
{
"name": "CVE-2026-64107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64107"
},
{
"name": "CVE-2026-64462",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64462"
},
{
"name": "CVE-2026-23066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23066"
},
{
"name": "CVE-2026-63925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63925"
},
{
"name": "CVE-2026-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53147"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2026-46159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46159"
},
{
"name": "CVE-2026-63990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63990"
},
{
"name": "CVE-2026-64455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64455"
},
{
"name": "CVE-2026-52942",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52942"
},
{
"name": "CVE-2026-31546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31546"
},
{
"name": "CVE-2026-45956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45956"
},
{
"name": "CVE-2026-46190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46190"
},
{
"name": "CVE-2026-46331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46331"
},
{
"name": "CVE-2026-53051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53051"
},
{
"name": "CVE-2026-46142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46142"
},
{
"name": "CVE-2026-53015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53015"
},
{
"name": "CVE-2026-64421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64421"
},
{
"name": "CVE-2026-64302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64302"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2026-72129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72129"
},
{
"name": "CVE-2026-72299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72299"
},
{
"name": "CVE-2026-64445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64445"
},
{
"name": "CVE-2026-52935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52935"
},
{
"name": "CVE-2026-64328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64328"
},
{
"name": "CVE-2026-72417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72417"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-53013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53013"
},
{
"name": "CVE-2026-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53317"
},
{
"name": "CVE-2026-53200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53200"
},
{
"name": "CVE-2026-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53183"
},
{
"name": "CVE-2026-64433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64433"
},
{
"name": "CVE-2026-53054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53054"
},
{
"name": "CVE-2026-64165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64165"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-53064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53064"
},
{
"name": "CVE-2026-64272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64272"
},
{
"name": "CVE-2026-23469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23469"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-72278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72278"
},
{
"name": "CVE-2026-23324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23324"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-52995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52995"
},
{
"name": "CVE-2026-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53257"
},
{
"name": "CVE-2026-46209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46209"
},
{
"name": "CVE-2026-52931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52931"
},
{
"name": "CVE-2026-53113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53113"
},
{
"name": "CVE-2026-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53338"
},
{
"name": "CVE-2026-64003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64003"
},
{
"name": "CVE-2026-64253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64253"
},
{
"name": "CVE-2026-64213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64213"
},
{
"name": "CVE-2026-46153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46153"
},
{
"name": "CVE-2026-68476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68476"
},
{
"name": "CVE-2026-64076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64076"
},
{
"name": "CVE-2026-68477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68477"
},
{
"name": "CVE-2026-52951",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52951"
},
{
"name": "CVE-2026-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53058"
},
{
"name": "CVE-2026-64500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64500"
},
{
"name": "CVE-2026-53094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53094"
},
{
"name": "CVE-2026-43047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43047"
},
{
"name": "CVE-2026-63806",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63806"
},
{
"name": "CVE-2026-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53047"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2026-52961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52961"
},
{
"name": "CVE-2026-43432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43432"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53368"
},
{
"name": "CVE-2026-53296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53296"
},
{
"name": "CVE-2026-64239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64239"
},
{
"name": "CVE-2026-64097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64097"
},
{
"name": "CVE-2024-46715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46715"
},
{
"name": "CVE-2026-72351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72351"
},
{
"name": "CVE-2026-63816",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63816"
},
{
"name": "CVE-2026-64330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64330"
},
{
"name": "CVE-2026-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53330"
},
{
"name": "CVE-2026-31545",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31545"
},
{
"name": "CVE-2026-31681",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31681"
},
{
"name": "CVE-2026-72277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72277"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-23456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23456"
},
{
"name": "CVE-2026-46186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46186"
},
{
"name": "CVE-2026-64348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64348"
},
{
"name": "CVE-2026-53383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53383"
},
{
"name": "CVE-2026-64469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64469"
},
{
"name": "CVE-2026-53348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53348"
},
{
"name": "CVE-2026-43458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43458"
},
{
"name": "CVE-2026-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53101"
},
{
"name": "CVE-2026-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52919"
},
{
"name": "CVE-2026-46169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46169"
},
{
"name": "CVE-2026-74361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74361"
},
{
"name": "CVE-2026-64310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64310"
},
{
"name": "CVE-2026-53006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53006"
},
{
"name": "CVE-2026-43450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43450"
},
{
"name": "CVE-2026-64280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64280"
},
{
"name": "CVE-2026-63880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63880"
},
{
"name": "CVE-2026-64362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64362"
},
{
"name": "CVE-2026-64327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64327"
},
{
"name": "CVE-2026-64415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64415"
},
{
"name": "CVE-2026-31510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31510"
},
{
"name": "CVE-2026-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53324"
},
{
"name": "CVE-2026-63989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63989"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-64289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64289"
},
{
"name": "CVE-2026-43079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43079"
},
{
"name": "CVE-2026-23457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23457"
},
{
"name": "CVE-2026-64523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64523"
},
{
"name": "CVE-2026-63800",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63800"
},
{
"name": "CVE-2026-63964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63964"
},
{
"name": "CVE-2026-64102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64102"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-64255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64255"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-43103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43103"
},
{
"name": "CVE-2026-43069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43069"
},
{
"name": "CVE-2026-64041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64041"
},
{
"name": "CVE-2026-43425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43425"
},
{
"name": "CVE-2026-64071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64071"
},
{
"name": "CVE-2026-64314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64314"
},
{
"name": "CVE-2026-63863",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63863"
},
{
"name": "CVE-2026-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53377"
},
{
"name": "CVE-2026-64486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64486"
},
{
"name": "CVE-2026-31642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31642"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-64129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64129"
},
{
"name": "CVE-2026-64267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64267"
},
{
"name": "CVE-2026-23399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23399"
},
{
"name": "CVE-2026-72220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72220"
},
{
"name": "CVE-2026-53028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53028"
},
{
"name": "CVE-2026-90386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-90386"
},
{
"name": "CVE-2026-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53312"
},
{
"name": "CVE-2026-64517",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64517"
},
{
"name": "CVE-2026-64341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64341"
},
{
"name": "CVE-2026-46106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46106"
},
{
"name": "CVE-2026-31420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31420"
},
{
"name": "CVE-2026-72194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72194"
},
{
"name": "CVE-2026-63817",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63817"
},
{
"name": "CVE-2026-64446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64446"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2026-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53339"
},
{
"name": "CVE-2026-64534",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64534"
},
{
"name": "CVE-2026-53266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53266"
},
{
"name": "CVE-2026-64338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64338"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2026-43480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43480"
},
{
"name": "CVE-2026-64083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64083"
},
{
"name": "CVE-2026-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53234"
},
{
"name": "CVE-2026-64169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64169"
},
{
"name": "CVE-2026-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53149"
},
{
"name": "CVE-2026-23401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23401"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2026-63795",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63795"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-46116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46116"
},
{
"name": "CVE-2026-64106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64106"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2026-64418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64418"
},
{
"name": "CVE-2026-64249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64249"
},
{
"name": "CVE-2026-72222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72222"
},
{
"name": "CVE-2026-64536",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64536"
},
{
"name": "CVE-2026-46203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46203"
},
{
"name": "CVE-2026-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53048"
},
{
"name": "CVE-2026-63873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63873"
},
{
"name": "CVE-2026-63932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63932"
},
{
"name": "CVE-2026-43426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43426"
},
{
"name": "CVE-2026-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53176"
},
{
"name": "CVE-2026-63892",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63892"
},
{
"name": "CVE-2026-63850",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63850"
},
{
"name": "CVE-2026-43030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43030"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2026-53172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53172"
},
{
"name": "CVE-2026-43074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43074"
},
{
"name": "CVE-2026-46151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46151"
},
{
"name": "CVE-2026-64010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64010"
},
{
"name": "CVE-2026-64364",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64364"
},
{
"name": "CVE-2026-63947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63947"
},
{
"name": "CVE-2026-63950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63950"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-64243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64243"
},
{
"name": "CVE-2026-45911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45911"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2026-46220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46220"
},
{
"name": "CVE-2026-52975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52975"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-64008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64008"
},
{
"name": "CVE-2026-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53315"
},
{
"name": "CVE-2026-64163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64163"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-43334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43334"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-23391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23391"
},
{
"name": "CVE-2026-64050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64050"
},
{
"name": "CVE-2026-31415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31415"
},
{
"name": "CVE-2026-46127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46127"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-63975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63975"
},
{
"name": "CVE-2026-53233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53233"
},
{
"name": "CVE-2026-63859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63859"
},
{
"name": "CVE-2026-63952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63952"
},
{
"name": "CVE-2026-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53114"
},
{
"name": "CVE-2026-53402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53402"
},
{
"name": "CVE-2024-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47809"
},
{
"name": "CVE-2026-63965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63965"
},
{
"name": "CVE-2026-64351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64351"
},
{
"name": "CVE-2026-23204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23204"
},
{
"name": "CVE-2026-64051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64051"
},
{
"name": "CVE-2026-23462",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23462"
},
{
"name": "CVE-2026-53046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53046"
},
{
"name": "CVE-2026-63835",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63835"
},
{
"name": "CVE-2026-53050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53050"
},
{
"name": "CVE-2026-64432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64432"
},
{
"name": "CVE-2026-46176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46176"
},
{
"name": "CVE-2026-23372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23372"
},
{
"name": "CVE-2026-43080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43080"
},
{
"name": "CVE-2026-46146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46146"
},
{
"name": "CVE-2026-45836",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45836"
},
{
"name": "CVE-2026-46318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46318"
},
{
"name": "CVE-2026-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53386"
},
{
"name": "CVE-2026-64181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64181"
},
{
"name": "CVE-2026-64293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64293"
},
{
"name": "CVE-2026-64039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64039"
},
{
"name": "CVE-2026-63855",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63855"
},
{
"name": "CVE-2026-68087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68087"
},
{
"name": "CVE-2026-63833",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63833"
},
{
"name": "CVE-2026-46178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46178"
},
{
"name": "CVE-2026-45846",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45846"
},
{
"name": "CVE-2026-63796",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63796"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-53332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53332"
},
{
"name": "CVE-2026-64363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64363"
},
{
"name": "CVE-2026-46174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46174"
},
{
"name": "CVE-2026-43495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43495"
},
{
"name": "CVE-2026-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53401"
},
{
"name": "CVE-2026-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53334"
},
{
"name": "CVE-2026-53021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53021"
},
{
"name": "CVE-2026-46171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46171"
},
{
"name": "CVE-2026-64263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64263"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-43327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43327"
},
{
"name": "CVE-2026-64061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64061"
},
{
"name": "CVE-2024-56719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56719"
},
{
"name": "CVE-2026-53353",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53353"
},
{
"name": "CVE-2026-64375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64375"
},
{
"name": "CVE-2026-46133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46133"
},
{
"name": "CVE-2026-31494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31494"
},
{
"name": "CVE-2026-64296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64296"
},
{
"name": "CVE-2026-64040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64040"
},
{
"name": "CVE-2026-63917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63917"
},
{
"name": "CVE-2026-31565",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31565"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-43381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43381"
},
{
"name": "CVE-2026-46308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46308"
},
{
"name": "CVE-2026-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53335"
},
{
"name": "CVE-2026-23270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23270"
},
{
"name": "CVE-2026-31763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31763"
},
{
"name": "CVE-2026-63926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63926"
},
{
"name": "CVE-2026-64370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64370"
},
{
"name": "CVE-2026-23279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23279"
},
{
"name": "CVE-2026-64150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64150"
},
{
"name": "CVE-2026-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53178"
},
{
"name": "CVE-2026-53389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53389"
},
{
"name": "CVE-2026-64439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64439"
},
{
"name": "CVE-2026-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53110"
},
{
"name": "CVE-2026-52937",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52937"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2026-72322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72322"
},
{
"name": "CVE-2026-31670",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31670"
},
{
"name": "CVE-2026-64593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64593"
},
{
"name": "CVE-2026-64254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64254"
},
{
"name": "CVE-2026-64231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64231"
},
{
"name": "CVE-2026-46122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46122"
},
{
"name": "CVE-2026-64022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64022"
},
{
"name": "CVE-2026-53158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53158"
},
{
"name": "CVE-2026-53131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53131"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2026-64210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64210"
},
{
"name": "CVE-2026-64091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64091"
},
{
"name": "CVE-2026-46241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46241"
},
{
"name": "CVE-2026-64299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64299"
},
{
"name": "CVE-2026-63865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63865"
},
{
"name": "CVE-2026-64052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64052"
},
{
"name": "CVE-2026-72422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72422"
},
{
"name": "CVE-2026-31422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31422"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-23286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23286"
},
{
"name": "CVE-2026-23359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23359"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-23298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23298"
},
{
"name": "CVE-2026-64374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64374"
},
{
"name": "CVE-2026-46181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46181"
},
{
"name": "CVE-2026-64357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64357"
},
{
"name": "CVE-2026-31469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31469"
},
{
"name": "CVE-2026-64488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64488"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-46213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46213"
},
{
"name": "CVE-2026-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53288"
},
{
"name": "CVE-2026-31498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31498"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-64603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64603"
},
{
"name": "CVE-2026-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53219"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-64109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64109"
},
{
"name": "CVE-2026-53190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53190"
},
{
"name": "CVE-2026-64345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64345"
},
{
"name": "CVE-2026-64085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64085"
},
{
"name": "CVE-2026-46226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46226"
},
{
"name": "CVE-2026-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46120"
},
{
"name": "CVE-2026-46198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46198"
},
{
"name": "CVE-2026-43336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43336"
},
{
"name": "CVE-2026-64368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64368"
},
{
"name": "CVE-2026-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53251"
},
{
"name": "CVE-2026-64518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64518"
},
{
"name": "CVE-2026-43104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43104"
},
{
"name": "CVE-2026-52954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52954"
},
{
"name": "CVE-2026-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53249"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-64166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64166"
},
{
"name": "CVE-2026-53329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53329"
},
{
"name": "CVE-2026-46189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46189"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-52997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52997"
},
{
"name": "CVE-2026-53139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53139"
},
{
"name": "CVE-2026-53382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53382"
},
{
"name": "CVE-2026-43466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43466"
},
{
"name": "CVE-2026-64504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64504"
},
{
"name": "CVE-2026-46315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46315"
},
{
"name": "CVE-2026-64020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64020"
},
{
"name": "CVE-2026-63875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63875"
},
{
"name": "CVE-2026-63898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63898"
},
{
"name": "CVE-2026-52987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52987"
},
{
"name": "CVE-2026-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53217"
},
{
"name": "CVE-2026-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53276"
},
{
"name": "CVE-2026-23296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23296"
},
{
"name": "CVE-2026-46296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46296"
},
{
"name": "CVE-2026-64148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64148"
},
{
"name": "CVE-2026-53262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53262"
},
{
"name": "CVE-2026-53346",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53346"
},
{
"name": "CVE-2026-64090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64090"
},
{
"name": "CVE-2026-53130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53130"
},
{
"name": "CVE-2026-46128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46128"
},
{
"name": "CVE-2026-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53070"
},
{
"name": "CVE-2026-52984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52984"
},
{
"name": "CVE-2026-72495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72495"
},
{
"name": "CVE-2026-64004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64004"
},
{
"name": "CVE-2026-31427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31427"
},
{
"name": "CVE-2026-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53088"
},
{
"name": "CVE-2026-31555",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31555"
},
{
"name": "CVE-2026-63813",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63813"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2026-64320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64320"
},
{
"name": "CVE-2026-63992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63992"
},
{
"name": "CVE-2026-72287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72287"
},
{
"name": "CVE-2026-46317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46317"
},
{
"name": "CVE-2026-64155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64155"
},
{
"name": "CVE-2026-43439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43439"
},
{
"name": "CVE-2022-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50073"
},
{
"name": "CVE-2026-64398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64398"
},
{
"name": "CVE-2026-64147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64147"
},
{
"name": "CVE-2026-72084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72084"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-64464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64464"
},
{
"name": "CVE-2026-64297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64297"
},
{
"name": "CVE-2026-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53243"
},
{
"name": "CVE-2026-72317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72317"
},
{
"name": "CVE-2026-72137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72137"
},
{
"name": "CVE-2026-63909",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63909"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-43099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43099"
},
{
"name": "CVE-2026-46242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46242"
},
{
"name": "CVE-2026-53065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53065"
},
{
"name": "CVE-2026-63976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63976"
},
{
"name": "CVE-2026-52960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52960"
},
{
"name": "CVE-2026-63996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63996"
},
{
"name": "CVE-2026-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53079"
},
{
"name": "CVE-2026-68092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68092"
},
{
"name": "CVE-2026-31515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31515"
},
{
"name": "CVE-2026-64343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64343"
},
{
"name": "CVE-2026-31661",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31661"
},
{
"name": "CVE-2026-46293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46293"
},
{
"name": "CVE-2026-43380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43380"
},
{
"name": "CVE-2026-43452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43452"
},
{
"name": "CVE-2026-64473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64473"
},
{
"name": "CVE-2026-64021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64021"
},
{
"name": "CVE-2026-64397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64397"
},
{
"name": "CVE-2026-31737",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31737"
},
{
"name": "CVE-2025-68358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68358"
},
{
"name": "CVE-2026-64152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64152"
},
{
"name": "CVE-2026-46197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46197"
},
{
"name": "CVE-2026-52952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52952"
},
{
"name": "CVE-2026-63984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63984"
},
{
"name": "CVE-2026-53361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53361"
},
{
"name": "CVE-2026-64371",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64371"
},
{
"name": "CVE-2026-52973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52973"
},
{
"name": "CVE-2026-46301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46301"
},
{
"name": "CVE-2026-46223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46223"
},
{
"name": "CVE-2026-64057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64057"
},
{
"name": "CVE-2026-46224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46224"
},
{
"name": "CVE-2026-64520",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64520"
},
{
"name": "CVE-2026-52914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52914"
},
{
"name": "CVE-2026-52916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52916"
},
{
"name": "CVE-2026-53009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53009"
},
{
"name": "CVE-2026-64167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64167"
},
{
"name": "CVE-2026-53236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53236"
},
{
"name": "CVE-2026-64471",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64471"
},
{
"name": "CVE-2026-53225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53225"
},
{
"name": "CVE-2026-64180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64180"
},
{
"name": "CVE-2026-64468",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64468"
},
{
"name": "CVE-2026-53034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53034"
},
{
"name": "CVE-2026-53294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53294"
},
{
"name": "CVE-2026-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53222"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2026-53084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53084"
},
{
"name": "CVE-2026-72033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72033"
},
{
"name": "CVE-2026-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53105"
},
{
"name": "CVE-2026-64449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64449"
},
{
"name": "CVE-2026-63866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63866"
},
{
"name": "CVE-2026-64105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64105"
},
{
"name": "CVE-2026-64602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64602"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2026-64125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64125"
},
{
"name": "CVE-2026-53283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53283"
},
{
"name": "CVE-2026-43043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43043"
},
{
"name": "CVE-2026-63884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63884"
},
{
"name": "CVE-2026-64551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64551"
},
{
"name": "CVE-2026-31705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31705"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-72472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72472"
},
{
"name": "CVE-2026-53111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53111"
},
{
"name": "CVE-2026-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53362"
},
{
"name": "CVE-2026-64410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64410"
},
{
"name": "CVE-2026-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31684"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53168"
},
{
"name": "CVE-2026-23396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23396"
},
{
"name": "CVE-2026-64212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64212"
},
{
"name": "CVE-2026-31423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31423"
},
{
"name": "CVE-2026-53173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53173"
},
{
"name": "CVE-2026-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52922"
},
{
"name": "CVE-2026-46180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46180"
},
{
"name": "CVE-2026-64528",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64528"
},
{
"name": "CVE-2026-53053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53053"
},
{
"name": "CVE-2026-64089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64089"
},
{
"name": "CVE-2026-46295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46295"
},
{
"name": "CVE-2026-53403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53403"
},
{
"name": "CVE-2026-63871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63871"
},
{
"name": "CVE-2026-64131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64131"
},
{
"name": "CVE-2026-64048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64048"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-43051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43051"
},
{
"name": "CVE-2026-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53209"
},
{
"name": "CVE-2026-31759",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31759"
},
{
"name": "CVE-2026-52992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52992"
},
{
"name": "CVE-2026-63797",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63797"
},
{
"name": "CVE-2026-63987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63987"
},
{
"name": "CVE-2023-45896",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45896"
},
{
"name": "CVE-2026-64080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64080"
},
{
"name": "CVE-2026-23370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23370"
},
{
"name": "CVE-2026-64456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64456"
},
{
"name": "CVE-2026-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53112"
},
{
"name": "CVE-2026-72491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72491"
},
{
"name": "CVE-2026-63858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63858"
},
{
"name": "CVE-2026-64170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64170"
},
{
"name": "CVE-2026-46206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46206"
},
{
"name": "CVE-2026-72393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72393"
},
{
"name": "CVE-2026-53124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53124"
},
{
"name": "CVE-2026-52979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52979"
},
{
"name": "CVE-2026-64100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64100"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-53086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53086"
},
{
"name": "CVE-2026-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53371"
},
{
"name": "CVE-2026-64306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64306"
},
{
"name": "CVE-2026-31781",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31781"
},
{
"name": "CVE-2026-43449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43449"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-64465",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64465"
},
{
"name": "CVE-2026-64313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64313"
},
{
"name": "CVE-2026-52965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52965"
},
{
"name": "CVE-2026-63978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63978"
},
{
"name": "CVE-2026-31523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31523"
},
{
"name": "CVE-2026-53067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53067"
},
{
"name": "CVE-2026-52994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52994"
},
{
"name": "CVE-2026-52988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52988"
},
{
"name": "CVE-2026-46297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46297"
},
{
"name": "CVE-2026-53157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53157"
},
{
"name": "CVE-2026-64112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64112"
},
{
"name": "CVE-2026-43459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43459"
},
{
"name": "CVE-2026-46154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46154"
},
{
"name": "CVE-2025-10263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10263"
},
{
"name": "CVE-2026-31450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31450"
},
{
"name": "CVE-2026-53135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53135"
},
{
"name": "CVE-2026-74434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74434"
},
{
"name": "CVE-2026-63853",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63853"
},
{
"name": "CVE-2026-64442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64442"
},
{
"name": "CVE-2026-46302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46302"
},
{
"name": "CVE-2026-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53333"
},
{
"name": "CVE-2026-64477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64477"
},
{
"name": "CVE-2026-64463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64463"
},
{
"name": "CVE-2026-64401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64401"
},
{
"name": "CVE-2026-31671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31671"
},
{
"name": "CVE-2026-31749",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31749"
},
{
"name": "CVE-2026-52971",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52971"
},
{
"name": "CVE-2026-46234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46234"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-43328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43328"
},
{
"name": "CVE-2026-72064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72064"
},
{
"name": "CVE-2026-53188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53188"
},
{
"name": "CVE-2026-53392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53392"
},
{
"name": "CVE-2026-64259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64259"
},
{
"name": "CVE-2026-64018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64018"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2026-43024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43024"
},
{
"name": "CVE-2026-53099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53099"
},
{
"name": "CVE-2026-46109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46109"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-53279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53279"
},
{
"name": "CVE-2026-45985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45985"
},
{
"name": "CVE-2026-64541",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64541"
},
{
"name": "CVE-2026-64069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64069"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-63916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63916"
},
{
"name": "CVE-2026-64332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64332"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2026-63920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63920"
},
{
"name": "CVE-2026-52981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52981"
},
{
"name": "CVE-2026-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53170"
},
{
"name": "CVE-2026-46108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46108"
},
{
"name": "CVE-2026-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53167"
},
{
"name": "CVE-2026-52927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52927"
},
{
"name": "CVE-2026-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53060"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-23352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23352"
},
{
"name": "CVE-2026-64191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64191"
},
{
"name": "CVE-2026-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53096"
},
{
"name": "CVE-2026-31720",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31720"
},
{
"name": "CVE-2026-46321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46321"
},
{
"name": "CVE-2026-31748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31748"
},
{
"name": "CVE-2026-63930",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63930"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-64458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64458"
},
{
"name": "CVE-2026-64171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64171"
},
{
"name": "CVE-2026-64127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64127"
},
{
"name": "CVE-2026-64476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64476"
},
{
"name": "CVE-2026-64027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64027"
},
{
"name": "CVE-2026-64378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64378"
},
{
"name": "CVE-2026-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53076"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-72323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72323"
},
{
"name": "CVE-2026-72065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72065"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-64318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64318"
},
{
"name": "CVE-2026-43472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43472"
},
{
"name": "CVE-2026-23367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23367"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-64521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64521"
},
{
"name": "CVE-2026-64300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64300"
},
{
"name": "CVE-2026-72398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72398"
},
{
"name": "CVE-2026-52908",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52908"
},
{
"name": "CVE-2026-63861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63861"
},
{
"name": "CVE-2026-45899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45899"
},
{
"name": "CVE-2026-63794",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63794"
},
{
"name": "CVE-2026-31662",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31662"
},
{
"name": "CVE-2026-53018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53018"
},
{
"name": "CVE-2026-64394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64394"
},
{
"name": "CVE-2026-74398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74398"
},
{
"name": "CVE-2026-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53237"
},
{
"name": "CVE-2026-80591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80591"
},
{
"name": "CVE-2026-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53302"
},
{
"name": "CVE-2026-53035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53035"
},
{
"name": "CVE-2026-53186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53186"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2026-53340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53340"
},
{
"name": "CVE-2026-43026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43026"
},
{
"name": "CVE-2026-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53182"
},
{
"name": "CVE-2026-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53177"
},
{
"name": "CVE-2026-31480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31480"
},
{
"name": "CVE-2026-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53208"
},
{
"name": "CVE-2026-64055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64055"
},
{
"name": "CVE-2026-43405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43405"
},
{
"name": "CVE-2026-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53255"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53207"
},
{
"name": "CVE-2026-43430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43430"
},
{
"name": "CVE-2026-64244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64244"
},
{
"name": "CVE-2026-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53375"
},
{
"name": "CVE-2026-45920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45920"
},
{
"name": "CVE-2026-46150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46150"
},
{
"name": "CVE-2026-63938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63938"
},
{
"name": "CVE-2026-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53314"
},
{
"name": "CVE-2026-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53123"
},
{
"name": "CVE-2026-53347",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53347"
},
{
"name": "CVE-2026-53126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53126"
},
{
"name": "CVE-2026-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53187"
},
{
"name": "CVE-2026-64060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64060"
},
{
"name": "CVE-2026-64026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64026"
},
{
"name": "CVE-2026-46228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46228"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53311"
},
{
"name": "CVE-2026-45840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45840"
},
{
"name": "CVE-2026-64228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64228"
},
{
"name": "CVE-2026-52950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52950"
},
{
"name": "CVE-2026-72355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72355"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-53160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53160"
},
{
"name": "CVE-2026-74384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74384"
},
{
"name": "CVE-2026-63970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63970"
},
{
"name": "CVE-2026-23446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23446"
},
{
"name": "CVE-2026-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53245"
},
{
"name": "CVE-2026-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53195"
},
{
"name": "CVE-2026-64309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64309"
},
{
"name": "CVE-2026-46219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46219"
},
{
"name": "CVE-2026-64173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64173"
},
{
"name": "CVE-2026-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53043"
},
{
"name": "CVE-2026-63824",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63824"
},
{
"name": "CVE-2026-72139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72139"
},
{
"name": "CVE-2026-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53171"
},
{
"name": "CVE-2026-43075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43075"
},
{
"name": "CVE-2026-43035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43035"
},
{
"name": "CVE-2026-63914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63914"
},
{
"name": "CVE-2026-46172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46172"
},
{
"name": "CVE-2026-63935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63935"
},
{
"name": "CVE-2026-64556",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64556"
},
{
"name": "CVE-2026-63825",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63825"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2026-46311",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46311"
},
{
"name": "CVE-2026-74433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74433"
},
{
"name": "CVE-2026-53164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53164"
},
{
"name": "CVE-2024-56657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56657"
},
{
"name": "CVE-2026-31665",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31665"
},
{
"name": "CVE-2026-46161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46161"
},
{
"name": "CVE-2026-72463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72463"
},
{
"name": "CVE-2026-63874",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63874"
},
{
"name": "CVE-2026-53285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53285"
},
{
"name": "CVE-2026-64224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64224"
},
{
"name": "CVE-2026-63901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63901"
},
{
"name": "CVE-2026-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53232"
},
{
"name": "CVE-2026-23300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23300"
},
{
"name": "CVE-2026-64435",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64435"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-64184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64184"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-23444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23444"
},
{
"name": "CVE-2026-64336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64336"
},
{
"name": "CVE-2026-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53148"
},
{
"name": "CVE-2026-63951",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63951"
},
{
"name": "CVE-2026-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53189"
},
{
"name": "CVE-2026-64352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64352"
},
{
"name": "CVE-2026-72318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72318"
},
{
"name": "CVE-2026-43378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43378"
},
{
"name": "CVE-2026-64474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64474"
},
{
"name": "CVE-2026-52949",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52949"
},
{
"name": "CVE-2026-64115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64115"
},
{
"name": "CVE-2026-45844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45844"
},
{
"name": "CVE-2026-52985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52985"
},
{
"name": "CVE-2026-46110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46110"
},
{
"name": "CVE-2026-64356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64356"
},
{
"name": "CVE-2026-63867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63867"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-31672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31672"
},
{
"name": "CVE-2026-64031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64031"
},
{
"name": "CVE-2026-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53059"
},
{
"name": "CVE-2026-53133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53133"
},
{
"name": "CVE-2026-64377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64377"
},
{
"name": "CVE-2026-43093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43093"
},
{
"name": "CVE-2026-31780",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31780"
},
{
"name": "CVE-2026-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53204"
},
{
"name": "CVE-2026-43342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43342"
},
{
"name": "CVE-2026-64164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64164"
},
{
"name": "CVE-2026-63918",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63918"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-64346",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64346"
},
{
"name": "CVE-2026-53351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53351"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-53024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53024"
},
{
"name": "CVE-2026-31521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31521"
},
{
"name": "CVE-2026-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53307"
},
{
"name": "CVE-2026-64522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64522"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2026-53087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53087"
},
{
"name": "CVE-2026-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53344"
},
{
"name": "CVE-2026-43357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43357"
},
{
"name": "CVE-2026-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53263"
},
{
"name": "CVE-2026-64160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64160"
},
{
"name": "CVE-2026-63891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63891"
},
{
"name": "CVE-2026-46111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46111"
},
{
"name": "CVE-2026-31634",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31634"
},
{
"name": "CVE-2026-43061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43061"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2026-63945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63945"
},
{
"name": "CVE-2026-52932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52932"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-63822",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63822"
},
{
"name": "CVE-2026-72329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72329"
},
{
"name": "CVE-2026-46240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46240"
},
{
"name": "CVE-2026-74310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74310"
},
{
"name": "CVE-2026-72041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72041"
},
{
"name": "CVE-2026-64187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64187"
},
{
"name": "CVE-2026-64342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64342"
},
{
"name": "CVE-2026-46104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46104"
},
{
"name": "CVE-2026-64392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64392"
},
{
"name": "CVE-2026-64360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64360"
},
{
"name": "CVE-2026-53012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53012"
},
{
"name": "CVE-2026-46179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46179"
},
{
"name": "CVE-2026-43453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43453"
},
{
"name": "CVE-2026-64096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64096"
},
{
"name": "CVE-2026-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53118"
},
{
"name": "CVE-2026-43032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43032"
},
{
"name": "CVE-2026-43484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43484"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-63985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63985"
},
{
"name": "CVE-2026-63848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63848"
},
{
"name": "CVE-2026-64478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64478"
},
{
"name": "CVE-2026-64140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64140"
},
{
"name": "CVE-2026-23362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23362"
},
{
"name": "CVE-2026-23379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23379"
},
{
"name": "CVE-2026-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53152"
},
{
"name": "CVE-2026-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53356"
},
{
"name": "CVE-2026-43076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43076"
},
{
"name": "CVE-2026-63799",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63799"
},
{
"name": "CVE-2026-64472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64472"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-63968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63968"
},
{
"name": "CVE-2026-64035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64035"
},
{
"name": "CVE-2026-43427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43427"
},
{
"name": "CVE-2026-43498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43498"
},
{
"name": "CVE-2026-46291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46291"
},
{
"name": "CVE-2022-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50116"
},
{
"name": "CVE-2026-31421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31421"
},
{
"name": "CVE-2026-53069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53069"
},
{
"name": "CVE-2026-64335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64335"
},
{
"name": "CVE-2026-46215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46215"
},
{
"name": "CVE-2026-53228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53228"
},
{
"name": "CVE-2026-63906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63906"
},
{
"name": "CVE-2026-72399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72399"
},
{
"name": "CVE-2026-63877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63877"
},
{
"name": "CVE-2026-64301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64301"
},
{
"name": "CVE-2026-64315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64315"
},
{
"name": "CVE-2026-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53073"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2026-46312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46312"
},
{
"name": "CVE-2026-43365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43365"
},
{
"name": "CVE-2022-50552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50552"
},
{
"name": "CVE-2026-64395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64395"
},
{
"name": "CVE-2026-23381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23381"
},
{
"name": "CVE-2026-31518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31518"
},
{
"name": "CVE-2026-64273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64273"
},
{
"name": "CVE-2026-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53259"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-63828",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63828"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-52944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52944"
},
{
"name": "CVE-2025-68256",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68256"
},
{
"name": "CVE-2026-63904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63904"
},
{
"name": "CVE-2026-46145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46145"
},
{
"name": "CVE-2026-53031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53031"
},
{
"name": "CVE-2026-72226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72226"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-63820",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63820"
},
{
"name": "CVE-2026-31660",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31660"
},
{
"name": "CVE-2026-64262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64262"
},
{
"name": "CVE-2026-46156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46156"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-64142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64142"
},
{
"name": "CVE-2026-64211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64211"
},
{
"name": "CVE-2026-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53336"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-64139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64139"
},
{
"name": "CVE-2026-46294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46294"
},
{
"name": "CVE-2026-31728",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31728"
},
{
"name": "CVE-2026-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53125"
},
{
"name": "CVE-2026-53107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53107"
},
{
"name": "CVE-2026-46125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46125"
},
{
"name": "CVE-2026-72348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72348"
},
{
"name": "CVE-2026-46152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46152"
},
{
"name": "CVE-2026-46290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46290"
},
{
"name": "CVE-2026-64509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64509"
},
{
"name": "CVE-2026-52980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52980"
},
{
"name": "CVE-2026-64117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64117"
},
{
"name": "CVE-2026-64079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64079"
},
{
"name": "CVE-2026-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53194"
},
{
"name": "CVE-2026-64084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64084"
},
{
"name": "CVE-2026-64014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64014"
},
{
"name": "CVE-2026-31400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31400"
},
{
"name": "CVE-2026-31512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31512"
},
{
"name": "CVE-2026-64307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64307"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-64001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64001"
},
{
"name": "CVE-2026-64036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64036"
},
{
"name": "CVE-2026-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53242"
},
{
"name": "CVE-2026-53293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53293"
},
{
"name": "CVE-2026-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53248"
},
{
"name": "CVE-2026-46135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46135"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-31726",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31726"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2026-43370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43370"
},
{
"name": "CVE-2026-31773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31773"
},
{
"name": "CVE-2026-53341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53341"
},
{
"name": "CVE-2026-64238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64238"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-52910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52910"
},
{
"name": "CVE-2026-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53206"
},
{
"name": "CVE-2026-64339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64339"
},
{
"name": "CVE-2026-64108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64108"
},
{
"name": "CVE-2026-64529",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64529"
},
{
"name": "CVE-2026-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53388"
},
{
"name": "CVE-2026-63937",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63937"
},
{
"name": "CVE-2023-52682",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52682"
},
{
"name": "CVE-2025-71150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71150"
},
{
"name": "CVE-2026-46167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46167"
},
{
"name": "CVE-2026-63804",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63804"
},
{
"name": "CVE-2026-64305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64305"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-64119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64119"
},
{
"name": "CVE-2026-53212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53212"
},
{
"name": "CVE-2026-43015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43015"
},
{
"name": "CVE-2026-53137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53137"
},
{
"name": "CVE-2026-31509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31509"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2026-43066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43066"
},
{
"name": "CVE-2026-46139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46139"
},
{
"name": "CVE-2026-64175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64175"
},
{
"name": "CVE-2026-72429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72429"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-64400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64400"
},
{
"name": "CVE-2026-72248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72248"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-31679",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31679"
},
{
"name": "CVE-2026-64381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64381"
},
{
"name": "CVE-2026-64066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64066"
},
{
"name": "CVE-2026-46191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46191"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2026-64604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64604"
},
{
"name": "CVE-2026-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53393"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2026-52978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52978"
},
{
"name": "CVE-2026-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53337"
},
{
"name": "CVE-2026-64597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64597"
},
{
"name": "CVE-2026-53310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53310"
},
{
"name": "CVE-2026-64095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64095"
},
{
"name": "CVE-2026-63812",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63812"
},
{
"name": "CVE-2026-63887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63887"
},
{
"name": "CVE-2026-43469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43469"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53199"
},
{
"name": "CVE-2026-43085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43085"
},
{
"name": "CVE-2026-64496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64496"
},
{
"name": "CVE-2026-64062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64062"
},
{
"name": "CVE-2026-64251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64251"
},
{
"name": "CVE-2026-53025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53025"
},
{
"name": "CVE-2026-64113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64113"
},
{
"name": "CVE-2026-64387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64387"
},
{
"name": "CVE-2026-53008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53008"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-46192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46192"
},
{
"name": "CVE-2026-52938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52938"
},
{
"name": "CVE-2026-63972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63972"
},
{
"name": "CVE-2026-64103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64103"
},
{
"name": "CVE-2026-64078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64078"
},
{
"name": "CVE-2026-46105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46105"
},
{
"name": "CVE-2026-46274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46274"
},
{
"name": "CVE-2026-63849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63849"
},
{
"name": "CVE-2026-64408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64408"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2026-43020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43020"
},
{
"name": "CVE-2026-31417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31417"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2026-43041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43041"
},
{
"name": "CVE-2026-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53247"
},
{
"name": "CVE-2026-31761",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31761"
},
{
"name": "CVE-2026-31466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31466"
},
{
"name": "CVE-2026-63900",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63900"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-64136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64136"
},
{
"name": "CVE-2026-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53165"
},
{
"name": "CVE-2026-63953",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63953"
},
{
"name": "CVE-2026-64227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64227"
},
{
"name": "CVE-2026-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53197"
},
{
"name": "CVE-2026-64481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64481"
},
{
"name": "CVE-2026-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53042"
},
{
"name": "CVE-2026-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53258"
},
{
"name": "CVE-2026-64316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64316"
},
{
"name": "CVE-2026-53289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53289"
},
{
"name": "CVE-2026-64208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64208"
},
{
"name": "CVE-2026-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53304"
},
{
"name": "CVE-2026-64174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64174"
},
{
"name": "CVE-2026-64000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64000"
},
{
"name": "CVE-2025-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54518"
},
{
"name": "CVE-2026-43111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43111"
},
{
"name": "CVE-2024-56584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56584"
},
{
"name": "CVE-2026-63967",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63967"
},
{
"name": "CVE-2026-63897",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63897"
},
{
"name": "CVE-2026-52936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52936"
},
{
"name": "CVE-2026-64417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64417"
},
{
"name": "CVE-2026-53376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53376"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2026-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53268"
},
{
"name": "CVE-2026-64457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64457"
},
{
"name": "CVE-2026-46313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46313"
},
{
"name": "CVE-2026-63819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63819"
},
{
"name": "CVE-2026-80952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80952"
},
{
"name": "CVE-2026-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53241"
},
{
"name": "CVE-2026-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53223"
},
{
"name": "CVE-2026-64423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64423"
},
{
"name": "CVE-2026-31414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31414"
},
{
"name": "CVE-2026-53005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53005"
},
{
"name": "CVE-2026-46309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46309"
},
{
"name": "CVE-2026-64034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64034"
},
{
"name": "CVE-2026-64443",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64443"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-53159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53159"
},
{
"name": "CVE-2026-64588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64588"
},
{
"name": "CVE-2026-45958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45958"
},
{
"name": "CVE-2026-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53298"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-64229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64229"
},
{
"name": "CVE-2026-31778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31778"
},
{
"name": "CVE-2026-53372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53372"
},
{
"name": "CVE-2026-64093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64093"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2026-53039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53039"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-63868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63868"
},
{
"name": "CVE-2026-53290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53290"
},
{
"name": "CVE-2026-64269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64269"
},
{
"name": "CVE-2026-53080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53080"
},
{
"name": "CVE-2026-43490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43490"
},
{
"name": "CVE-2026-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53316"
},
{
"name": "CVE-2026-53267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53267"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-53004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53004"
},
{
"name": "CVE-2022-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49961"
},
{
"name": "CVE-2026-43040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43040"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-72296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72296"
},
{
"name": "CVE-2026-52912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52912"
},
{
"name": "CVE-2026-63955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63955"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-46129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46129"
},
{
"name": "CVE-2026-31552",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31552"
},
{
"name": "CVE-2026-64101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64101"
},
{
"name": "CVE-2026-64482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64482"
},
{
"name": "CVE-2026-64218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64218"
},
{
"name": "CVE-2026-52976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52976"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-46292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46292"
},
{
"name": "CVE-2026-64495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64495"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53221"
},
{
"name": "CVE-2026-43428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43428"
},
{
"name": "CVE-2026-52998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52998"
},
{
"name": "CVE-2026-63811",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63811"
},
{
"name": "CVE-2026-53011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53011"
},
{
"name": "CVE-2026-63991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63991"
},
{
"name": "CVE-2026-64282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64282"
},
{
"name": "CVE-2026-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53275"
},
{
"name": "CVE-2026-63982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63982"
},
{
"name": "CVE-2026-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52920"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-64366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64366"
},
{
"name": "CVE-2026-53001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53001"
},
{
"name": "CVE-2026-23397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23397"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-23452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23452"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-64594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64594"
},
{
"name": "CVE-2026-64278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64278"
},
{
"name": "CVE-2026-63960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63960"
},
{
"name": "CVE-2026-23474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23474"
},
{
"name": "CVE-2026-64396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64396"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2026-53203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53203"
},
{
"name": "CVE-2026-52911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52911"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-43065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43065"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53295"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-53269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53269"
},
{
"name": "CVE-2026-64235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64235"
},
{
"name": "CVE-2026-64479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64479"
},
{
"name": "CVE-2026-63963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63963"
},
{
"name": "CVE-2026-23336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23336"
},
{
"name": "CVE-2026-63890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63890"
},
{
"name": "CVE-2026-64324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64324"
},
{
"name": "CVE-2026-64329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64329"
},
{
"name": "CVE-2026-45843",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45843"
},
{
"name": "CVE-2026-64434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64434"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-64373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64373"
},
{
"name": "CVE-2026-63997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63997"
},
{
"name": "CVE-2026-46148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46148"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-46136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46136"
},
{
"name": "CVE-2026-64219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64219"
},
{
"name": "CVE-2026-64277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64277"
},
{
"name": "CVE-2026-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53357"
},
{
"name": "CVE-2026-46324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46324"
},
{
"name": "CVE-2026-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53052"
},
{
"name": "CVE-2026-31497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31497"
},
{
"name": "CVE-2026-43451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43451"
},
{
"name": "CVE-2026-53318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53318"
},
{
"name": "CVE-2026-64070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64070"
},
{
"name": "CVE-2026-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46316"
},
{
"name": "CVE-2026-64126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64126"
},
{
"name": "CVE-2026-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53280"
},
{
"name": "CVE-2026-53136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53136"
},
{
"name": "CVE-2026-64503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64503"
},
{
"name": "CVE-2026-63977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63977"
},
{
"name": "CVE-2026-31570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31570"
},
{
"name": "CVE-2026-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53215"
},
{
"name": "CVE-2026-23289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23289"
},
{
"name": "CVE-2026-31755",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31755"
},
{
"name": "CVE-2026-64168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64168"
},
{
"name": "CVE-2026-53108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53108"
},
{
"name": "CVE-2026-46230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46230"
},
{
"name": "CVE-2026-72381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72381"
},
{
"name": "CVE-2026-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23141"
},
{
"name": "CVE-2026-64161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64161"
},
{
"name": "CVE-2026-63881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63881"
},
{
"name": "CVE-2026-52964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52964"
},
{
"name": "CVE-2026-46138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46138"
},
{
"name": "CVE-2026-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53216"
},
{
"name": "CVE-2025-21739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21739"
},
{
"name": "CVE-2026-23277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23277"
},
{
"name": "CVE-2026-74350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74350"
},
{
"name": "CVE-2026-31399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31399"
},
{
"name": "CVE-2026-72496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72496"
},
{
"name": "CVE-2026-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53153"
},
{
"name": "CVE-2026-63969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63969"
},
{
"name": "CVE-2026-64291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64291"
},
{
"name": "CVE-2026-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53226"
},
{
"name": "CVE-2026-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53089"
},
{
"name": "CVE-2026-63809",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63809"
},
{
"name": "CVE-2026-53253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53253"
},
{
"name": "CVE-2026-31489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31489"
},
{
"name": "CVE-2026-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53250"
},
{
"name": "CVE-2026-64453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64453"
},
{
"name": "CVE-2026-53003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53003"
},
{
"name": "CVE-2026-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53394"
},
{
"name": "CVE-2026-46225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46225"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-64436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64436"
},
{
"name": "CVE-2026-64403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64403"
},
{
"name": "CVE-2026-52948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52948"
},
{
"name": "CVE-2026-64222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64222"
},
{
"name": "CVE-2026-64121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64121"
},
{
"name": "CVE-2026-63939",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63939"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-63962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63962"
},
{
"name": "CVE-2026-63836",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63836"
},
{
"name": "CVE-2026-63814",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63814"
},
{
"name": "CVE-2026-64053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64053"
},
{
"name": "CVE-2026-63936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63936"
},
{
"name": "CVE-2026-43343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43343"
},
{
"name": "CVE-2026-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53252"
},
{
"name": "CVE-2026-64216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64216"
},
{
"name": "CVE-2026-63927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63927"
},
{
"name": "CVE-2026-64412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64412"
},
{
"name": "CVE-2026-64284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64284"
},
{
"name": "CVE-2026-53355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53355"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-46314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46314"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-64188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64188"
},
{
"name": "CVE-2026-46149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46149"
},
{
"name": "CVE-2026-64491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64491"
},
{
"name": "CVE-2026-74287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74287"
},
{
"name": "CVE-2026-53017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53017"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2026-64144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64144"
},
{
"name": "CVE-2026-64487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64487"
},
{
"name": "CVE-2026-64391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64391"
},
{
"name": "CVE-2026-64303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64303"
},
{
"name": "CVE-2026-46208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46208"
},
{
"name": "CVE-2026-63971",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63971"
},
{
"name": "CVE-2026-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53174"
},
{
"name": "CVE-2026-64086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64086"
},
{
"name": "CVE-2026-64429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64429"
},
{
"name": "CVE-2026-64344",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64344"
},
{
"name": "CVE-2026-53134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53134"
},
{
"name": "CVE-2026-63831",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63831"
},
{
"name": "CVE-2026-63983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63983"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-46205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46205"
},
{
"name": "CVE-2026-64286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64286"
},
{
"name": "CVE-2026-72412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72412"
},
{
"name": "CVE-2026-64292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64292"
},
{
"name": "CVE-2026-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53359"
},
{
"name": "CVE-2026-64029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64029"
},
{
"name": "CVE-2026-53016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53016"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46218"
},
{
"name": "CVE-2026-63834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63834"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-23335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23335"
},
{
"name": "CVE-2026-52986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52986"
},
{
"name": "CVE-2026-31551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31551"
},
{
"name": "CVE-2026-63919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63919"
},
{
"name": "CVE-2026-53077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53077"
},
{
"name": "CVE-2026-31495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31495"
},
{
"name": "CVE-2026-64350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64350"
},
{
"name": "CVE-2026-64321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64321"
},
{
"name": "CVE-2026-46132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46132"
},
{
"name": "CVE-2026-72473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72473"
},
{
"name": "CVE-2026-64111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64111"
},
{
"name": "CVE-2026-64447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64447"
},
{
"name": "CVE-2026-46160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46160"
},
{
"name": "CVE-2026-46177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46177"
},
{
"name": "CVE-2026-46131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46131"
},
{
"name": "CVE-2026-43110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43110"
},
{
"name": "CVE-2026-64149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64149"
},
{
"name": "CVE-2026-53256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53256"
},
{
"name": "CVE-2026-64075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64075"
},
{
"name": "CVE-2026-31507",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31507"
},
{
"name": "CVE-2026-72014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72014"
},
{
"name": "CVE-2026-64411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64411"
},
{
"name": "CVE-2026-63876",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63876"
},
{
"name": "CVE-2026-53306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53306"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53235"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-53129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53129"
},
{
"name": "CVE-2026-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53396"
},
{
"name": "CVE-2026-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53277"
},
{
"name": "CVE-2026-64587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64587"
},
{
"name": "CVE-2026-63998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63998"
},
{
"name": "CVE-2026-31762",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31762"
},
{
"name": "CVE-2026-64137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64137"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-31788",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31788"
},
{
"name": "CVE-2026-63959",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63959"
},
{
"name": "CVE-2026-53115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53115"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-31428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31428"
},
{
"name": "CVE-2026-64043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64043"
},
{
"name": "CVE-2026-53308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53308"
},
{
"name": "CVE-2026-23420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23420"
},
{
"name": "CVE-2026-23388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23388"
},
{
"name": "CVE-2026-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53045"
},
{
"name": "CVE-2026-72098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72098"
},
{
"name": "CVE-2026-72249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72249"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2026-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43098"
},
{
"name": "CVE-2026-63862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63862"
},
{
"name": "CVE-2026-63954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63954"
},
{
"name": "CVE-2026-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53282"
},
{
"name": "CVE-2026-63840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63840"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-46306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46306"
},
{
"name": "CVE-2026-64242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64242"
},
{
"name": "CVE-2026-43386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43386"
},
{
"name": "CVE-2026-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53085"
},
{
"name": "CVE-2026-64334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64334"
},
{
"name": "CVE-2026-64049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64049"
},
{
"name": "CVE-2026-46210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46210"
},
{
"name": "CVE-2026-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53384"
},
{
"name": "CVE-2026-53155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53155"
},
{
"name": "CVE-2026-72442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72442"
},
{
"name": "CVE-2026-64183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64183"
},
{
"name": "CVE-2026-64448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64448"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2026-64120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64120"
},
{
"name": "CVE-2026-43089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43089"
},
{
"name": "CVE-2026-72493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72493"
},
{
"name": "CVE-2026-53033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53033"
},
{
"name": "CVE-2026-72221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72221"
},
{
"name": "CVE-2026-72289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72289"
},
{
"name": "CVE-2026-72251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72251"
},
{
"name": "CVE-2026-46162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46162"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53319"
},
{
"name": "CVE-2026-64347",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64347"
},
{
"name": "CVE-2026-63826",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63826"
},
{
"name": "CVE-2026-31676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31676"
},
{
"name": "CVE-2026-52959",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52959"
},
{
"name": "CVE-2026-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53120"
},
{
"name": "CVE-2026-64393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64393"
},
{
"name": "CVE-2026-64134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64134"
},
{
"name": "CVE-2026-53026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53026"
},
{
"name": "CVE-2026-43112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43112"
},
{
"name": "CVE-2026-64005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64005"
},
{
"name": "CVE-2026-23442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23442"
},
{
"name": "CVE-2026-64466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64466"
},
{
"name": "CVE-2026-31476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31476"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-64419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64419"
},
{
"name": "CVE-2026-46107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46107"
},
{
"name": "CVE-2026-64524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64524"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-46273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46273"
},
{
"name": "CVE-2026-23458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23458"
},
{
"name": "CVE-2026-53145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53145"
},
{
"name": "CVE-2026-63981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63981"
},
{
"name": "CVE-2026-43502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43502"
},
{
"name": "CVE-2026-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53270"
},
{
"name": "CVE-2026-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53379"
},
{
"name": "CVE-2026-31674",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31674"
},
{
"name": "CVE-2026-31393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31393"
},
{
"name": "CVE-2026-43420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43420"
},
{
"name": "CVE-2026-53198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53198"
},
{
"name": "CVE-2026-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53056"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2026-64382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64382"
},
{
"name": "CVE-2026-64589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64589"
},
{
"name": "CVE-2026-63946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63946"
},
{
"name": "CVE-2026-63903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63903"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-53240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53240"
},
{
"name": "CVE-2026-64372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64372"
},
{
"name": "CVE-2026-64490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64490"
},
{
"name": "CVE-2026-43027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43027"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-52909",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52909"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-64236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64236"
},
{
"name": "CVE-2026-63922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63922"
},
{
"name": "CVE-2026-64283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64283"
},
{
"name": "CVE-2026-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53395"
},
{
"name": "CVE-2026-63949",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63949"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2025-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68206"
},
{
"name": "CVE-2026-46163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46163"
},
{
"name": "CVE-2026-64444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64444"
},
{
"name": "CVE-2026-46202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46202"
},
{
"name": "CVE-2022-49803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49803"
},
{
"name": "CVE-2026-64233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64233"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-46164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46164"
},
{
"name": "CVE-2026-46235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46235"
},
{
"name": "CVE-2026-64225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64225"
},
{
"name": "CVE-2026-64331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64331"
},
{
"name": "CVE-2026-64511",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64511"
},
{
"name": "CVE-2026-63907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63907"
},
{
"name": "CVE-2026-64032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64032"
},
{
"name": "CVE-2026-45838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45838"
},
{
"name": "CVE-2026-64361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64361"
},
{
"name": "CVE-2026-64209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64209"
},
{
"name": "CVE-2026-31506",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31506"
},
{
"name": "CVE-2026-64182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64182"
},
{
"name": "CVE-2026-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53264"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-23339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23339"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-63999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63999"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-53023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53023"
},
{
"name": "CVE-2026-31433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31433"
},
{
"name": "CVE-2026-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53142"
},
{
"name": "CVE-2026-53098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53098"
},
{
"name": "CVE-2026-43497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43497"
},
{
"name": "CVE-2026-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53063"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-64369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64369"
},
{
"name": "CVE-2026-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53175"
},
{
"name": "CVE-2026-64024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64024"
},
{
"name": "CVE-2026-64215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64215"
},
{
"name": "CVE-2026-45924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45924"
},
{
"name": "CVE-2026-63944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63944"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53273"
},
{
"name": "CVE-2026-64054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64054"
},
{
"name": "CVE-2026-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53184"
},
{
"name": "CVE-2026-64019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64019"
},
{
"name": "CVE-2026-31560",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31560"
},
{
"name": "CVE-2026-64056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64056"
},
{
"name": "CVE-2026-52962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52962"
},
{
"name": "CVE-2026-63860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63860"
},
{
"name": "CVE-2026-64265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64265"
},
{
"name": "CVE-2026-52953",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52953"
},
{
"name": "CVE-2026-64494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64494"
},
{
"name": "CVE-2026-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53093"
},
{
"name": "CVE-2026-63899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63899"
},
{
"name": "CVE-2026-74268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74268"
},
{
"name": "CVE-2026-46200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46200"
},
{
"name": "CVE-2026-72451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72451"
},
{
"name": "CVE-2026-53144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53144"
},
{
"name": "CVE-2026-64033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64033"
},
{
"name": "CVE-2026-63893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63893"
},
{
"name": "CVE-2026-64124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64124"
},
{
"name": "CVE-2026-23460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23460"
},
{
"name": "CVE-2026-46222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46222"
},
{
"name": "CVE-2026-46187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46187"
},
{
"name": "CVE-2026-43281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43281"
},
{
"name": "CVE-2026-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53385"
},
{
"name": "CVE-2026-64030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64030"
},
{
"name": "CVE-2025-71161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71161"
},
{
"name": "CVE-2026-46168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46168"
},
{
"name": "CVE-2026-53075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53075"
},
{
"name": "CVE-2026-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53246"
},
{
"name": "CVE-2026-64245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64245"
},
{
"name": "CVE-2026-72279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72279"
},
{
"name": "CVE-2026-31540",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31540"
},
{
"name": "CVE-2026-64072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64072"
},
{
"name": "CVE-2026-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53326"
},
{
"name": "CVE-2026-64240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64240"
},
{
"name": "CVE-2026-63823",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63823"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-46175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46175"
},
{
"name": "CVE-2026-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53325"
},
{
"name": "CVE-2026-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53323"
},
{
"name": "CVE-2026-72501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72501"
},
{
"name": "CVE-2026-64354",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64354"
},
{
"name": "CVE-2026-53030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53030"
},
{
"name": "CVE-2026-23395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23395"
},
{
"name": "CVE-2026-64206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64206"
},
{
"name": "CVE-2026-45837",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45837"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-31651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31651"
},
{
"name": "CVE-2026-64530",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64530"
},
{
"name": "CVE-2026-64015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64015"
},
{
"name": "CVE-2026-64110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64110"
},
{
"name": "CVE-2026-46299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46299"
},
{
"name": "CVE-2026-64294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64294"
},
{
"name": "CVE-2026-63851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63851"
},
{
"name": "CVE-2026-63934",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63934"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2026-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53303"
},
{
"name": "CVE-2026-46239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46239"
},
{
"name": "CVE-2026-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53299"
},
{
"name": "CVE-2026-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53055"
},
{
"name": "CVE-2026-64288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64288"
},
{
"name": "CVE-2025-21863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21863"
},
{
"name": "CVE-2026-64285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64285"
},
{
"name": "CVE-2026-64123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64123"
},
{
"name": "CVE-2026-53019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53019"
},
{
"name": "CVE-2026-46201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46201"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-31747",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31747"
},
{
"name": "CVE-2026-31455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31455"
},
{
"name": "CVE-2026-64156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64156"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-53363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53363"
},
{
"name": "CVE-2026-74436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74436"
},
{
"name": "CVE-2026-52991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52991"
},
{
"name": "CVE-2026-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53322"
},
{
"name": "CVE-2026-64122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64122"
},
{
"name": "CVE-2026-63808",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63808"
},
{
"name": "CVE-2026-53191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53191"
},
{
"name": "CVE-2026-72217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72217"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-64493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64493"
},
{
"name": "CVE-2026-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53100"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-46221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46221"
},
{
"name": "CVE-2026-52940",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52940"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2026-43340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43340"
},
{
"name": "CVE-2026-53358",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53358"
},
{
"name": "CVE-2026-63905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63905"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-64535",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64535"
},
{
"name": "CVE-2026-63973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63973"
},
{
"name": "CVE-2026-63857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63857"
},
{
"name": "CVE-2026-46144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46144"
},
{
"name": "CVE-2026-63837",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63837"
},
{
"name": "CVE-2026-63895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63895"
},
{
"name": "CVE-2026-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53352"
},
{
"name": "CVE-2026-64234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64234"
},
{
"name": "CVE-2026-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53151"
},
{
"name": "CVE-2026-64416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64416"
},
{
"name": "CVE-2026-72234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72234"
},
{
"name": "CVE-2026-64157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64157"
},
{
"name": "CVE-2026-23031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23031"
},
{
"name": "CVE-2026-64247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64247"
},
{
"name": "CVE-2026-64379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64379"
},
{
"name": "CVE-2026-53254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53254"
},
{
"name": "CVE-2026-53078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53078"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2026-52928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52928"
},
{
"name": "CVE-2026-64420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64420"
},
{
"name": "CVE-2026-64138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64138"
},
{
"name": "CVE-2026-64153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64153"
},
{
"name": "CVE-2026-23291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23291"
},
{
"name": "CVE-2026-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53180"
},
{
"name": "CVE-2026-53037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53037"
},
{
"name": "CVE-2026-63986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63986"
},
{
"name": "CVE-2026-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53238"
},
{
"name": "CVE-2026-64205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64205"
},
{
"name": "CVE-2026-46305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46305"
},
{
"name": "CVE-2026-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53072"
},
{
"name": "CVE-2026-53284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53284"
},
{
"name": "CVE-2026-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52921"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53281"
},
{
"name": "CVE-2026-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53068"
},
{
"name": "CVE-2026-64012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64012"
},
{
"name": "CVE-2026-52967",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52967"
},
{
"name": "CVE-2026-46304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46304"
},
{
"name": "CVE-2026-64118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64118"
},
{
"name": "CVE-2026-46166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46166"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-64058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64058"
},
{
"name": "CVE-2026-64325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64325"
},
{
"name": "CVE-2026-74427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74427"
},
{
"name": "CVE-2026-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53213"
},
{
"name": "CVE-2026-64525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64525"
},
{
"name": "CVE-2025-68239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68239"
},
{
"name": "CVE-2026-64596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64596"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-53387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53387"
},
{
"name": "CVE-2026-23382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23382"
},
{
"name": "CVE-2026-64384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64384"
},
{
"name": "CVE-2026-64037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64037"
},
{
"name": "CVE-2026-68084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68084"
},
{
"name": "CVE-2026-64406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64406"
},
{
"name": "CVE-2026-63912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63912"
},
{
"name": "CVE-2026-64425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64425"
},
{
"name": "CVE-2026-64600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64600"
},
{
"name": "CVE-2026-43473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43473"
},
{
"name": "CVE-2026-52983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52983"
},
{
"name": "CVE-2026-46216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46216"
},
{
"name": "CVE-2026-74406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74406"
},
{
"name": "CVE-2026-52930",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52930"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-63942",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63942"
},
{
"name": "CVE-2026-64064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64064"
},
{
"name": "CVE-2026-64116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64116"
},
{
"name": "CVE-2026-64312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64312"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2026-31446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31446"
},
{
"name": "CVE-2026-46275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46275"
},
{
"name": "CVE-2026-68460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68460"
},
{
"name": "CVE-2026-23113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23113"
},
{
"name": "CVE-2026-63889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63889"
},
{
"name": "CVE-2026-46126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46126"
},
{
"name": "CVE-2026-46193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46193"
},
{
"name": "CVE-2026-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53265"
},
{
"name": "CVE-2026-64526",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64526"
},
{
"name": "CVE-2026-64428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64428"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-64505",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64505"
},
{
"name": "CVE-2026-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53057"
},
{
"name": "CVE-2026-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23157"
},
{
"name": "CVE-2026-64426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64426"
},
{
"name": "CVE-2026-52974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52974"
},
{
"name": "CVE-2026-64507",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64507"
},
{
"name": "CVE-2026-53127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53127"
},
{
"name": "CVE-2026-31464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31464"
},
{
"name": "CVE-2026-63941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63941"
},
{
"name": "CVE-2026-53366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53366"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-46143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46143"
},
{
"name": "CVE-2026-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52923"
},
{
"name": "CVE-2026-64087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64087"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2026-63958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63958"
},
{
"name": "CVE-2026-46212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46212"
},
{
"name": "CVE-2026-64499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64499"
},
{
"name": "CVE-2026-45834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45834"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-31695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31695"
},
{
"name": "CVE-2026-63856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63856"
},
{
"name": "CVE-2026-31630",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31630"
},
{
"name": "CVE-2026-74584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74584"
},
{
"name": "CVE-2026-43333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43333"
},
{
"name": "CVE-2026-53154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53154"
},
{
"name": "CVE-2026-64358",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64358"
},
{
"name": "CVE-2026-64355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64355"
},
{
"name": "CVE-2026-46199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46199"
},
{
"name": "CVE-2026-64515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64515"
},
{
"name": "CVE-2026-43105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43105"
},
{
"name": "CVE-2026-23312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23312"
},
{
"name": "CVE-2026-64130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64130"
},
{
"name": "CVE-2026-72069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72069"
},
{
"name": "CVE-2026-31508",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31508"
},
{
"name": "CVE-2026-64044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64044"
},
{
"name": "CVE-2026-64290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64290"
},
{
"name": "CVE-2026-64185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64185"
},
{
"name": "CVE-2026-64422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64422"
},
{
"name": "CVE-2026-64519",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64519"
},
{
"name": "CVE-2026-72020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72020"
},
{
"name": "CVE-2026-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53122"
},
{
"name": "CVE-2026-23365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23365"
},
{
"name": "CVE-2025-40323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40323"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53196"
},
{
"name": "CVE-2026-63878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63878"
},
{
"name": "CVE-2026-46310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46310"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-46123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46123"
},
{
"name": "CVE-2026-64340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64340"
},
{
"name": "CVE-2026-64092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64092"
},
{
"name": "CVE-2026-43329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43329"
},
{
"name": "CVE-2026-31424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31424"
},
{
"name": "CVE-2026-53000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53000"
},
{
"name": "CVE-2026-64007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64007"
},
{
"name": "CVE-2026-64450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64450"
},
{
"name": "CVE-2026-23356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23356"
},
{
"name": "CVE-2026-46207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46207"
},
{
"name": "CVE-2026-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53156"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-64484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64484"
},
{
"name": "CVE-2026-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23307"
},
{
"name": "CVE-2026-53300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53300"
},
{
"name": "CVE-2026-64298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64298"
},
{
"name": "CVE-2026-52969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52969"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2026-46157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46157"
},
{
"name": "CVE-2026-64207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64207"
},
{
"name": "CVE-2026-63994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63994"
},
{
"name": "CVE-2026-53062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53062"
},
{
"name": "CVE-2026-52990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52990"
},
{
"name": "CVE-2026-64114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64114"
},
{
"name": "CVE-2026-64390",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64390"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53390"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-74255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74255"
},
{
"name": "CVE-2026-72191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72191"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-64266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64266"
},
{
"name": "CVE-2026-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53380"
},
{
"name": "CVE-2026-53032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53032"
},
{
"name": "CVE-2026-46232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46232"
},
{
"name": "CVE-2026-53211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53211"
},
{
"name": "CVE-2026-43363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43363"
},
{
"name": "CVE-2026-64159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64159"
},
{
"name": "CVE-2026-64088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64088"
},
{
"name": "CVE-2026-46165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46165"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2026-64073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64073"
},
{
"name": "CVE-2026-31454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31454"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2026-64441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64441"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-31452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31452"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2026-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53369"
},
{
"name": "CVE-2026-31407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31407"
},
{
"name": "CVE-2026-53162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53162"
},
{
"name": "CVE-2026-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53343"
},
{
"name": "CVE-2026-23398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23398"
},
{
"name": "CVE-2026-74269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74269"
},
{
"name": "CVE-2026-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53082"
},
{
"name": "CVE-2026-52926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52926"
},
{
"name": "CVE-2026-63908",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63908"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-64145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64145"
},
{
"name": "CVE-2026-63829",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63829"
},
{
"name": "CVE-2026-72192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72192"
},
{
"name": "CVE-2026-31425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31425"
},
{
"name": "CVE-2026-64002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64002"
},
{
"name": "CVE-2026-63894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63894"
},
{
"name": "CVE-2026-46238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46238"
},
{
"name": "CVE-2026-72288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72288"
},
{
"name": "CVE-2026-64081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64081"
},
{
"name": "CVE-2026-64135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64135"
},
{
"name": "CVE-2026-63844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63844"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-64440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64440"
},
{
"name": "CVE-2026-64063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64063"
},
{
"name": "CVE-2026-52977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52977"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-63803",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63803"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-46155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46155"
},
{
"name": "CVE-2026-52917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52917"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-64601",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64601"
},
{
"name": "CVE-2026-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53074"
},
{
"name": "CVE-2026-63961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63961"
},
{
"name": "CVE-2026-64154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64154"
},
{
"name": "CVE-2026-46322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46322"
},
{
"name": "CVE-2026-53036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53036"
},
{
"name": "CVE-2026-45839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45839"
},
{
"name": "CVE-2026-72477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72477"
},
{
"name": "CVE-2026-72046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72046"
},
{
"name": "CVE-2026-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53261"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-64065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64065"
},
{
"name": "CVE-2026-72085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72085"
},
{
"name": "CVE-2026-52982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52982"
},
{
"name": "CVE-2026-74428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74428"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-63902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63902"
},
{
"name": "CVE-2026-64011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64011"
},
{
"name": "CVE-2026-64359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64359"
},
{
"name": "CVE-2026-63846",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63846"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-64317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64317"
},
{
"name": "CVE-2026-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53328"
},
{
"name": "CVE-2026-64009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64009"
},
{
"name": "CVE-2026-43050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43050"
},
{
"name": "CVE-2026-53022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53022"
},
{
"name": "CVE-2026-63883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63883"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
},
{
"name": "CVE-2026-63802",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63802"
},
{
"name": "CVE-2026-31673",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31673"
},
{
"name": "CVE-2026-63869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63869"
},
{
"name": "CVE-2026-31667",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31667"
},
{
"name": "CVE-2026-53083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53083"
}
],
"initial_release_date": "2026-09-25T00:00:00",
"last_revision_date": "2026-09-25T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-1229",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-09-25T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8800-1",
"url": "https://ubuntu.com/security/notices/USN-8800-1"
},
{
"published_at": "2026-09-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8668-2",
"url": "https://ubuntu.com/security/notices/USN-8668-2"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8801-1",
"url": "https://ubuntu.com/security/notices/USN-8801-1"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8760-2",
"url": "https://ubuntu.com/security/notices/USN-8760-2"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8728-2",
"url": "https://ubuntu.com/security/notices/USN-8728-2"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8802-1",
"url": "https://ubuntu.com/security/notices/USN-8802-1"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8729-4",
"url": "https://ubuntu.com/security/notices/USN-8729-4"
},
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8816-1",
"url": "https://ubuntu.com/security/notices/USN-8816-1"
},
{
"published_at": "2026-09-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8729-3",
"url": "https://ubuntu.com/security/notices/USN-8729-3"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8793-2",
"url": "https://ubuntu.com/security/notices/USN-8793-2"
},
{
"published_at": "2026-09-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8761-3",
"url": "https://ubuntu.com/security/notices/USN-8761-3"
},
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8818-1",
"url": "https://ubuntu.com/security/notices/USN-8818-1"
},
{
"published_at": "2026-09-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8726-3",
"url": "https://ubuntu.com/security/notices/USN-8726-3"
},
{
"published_at": "2026-09-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8730-4",
"url": "https://ubuntu.com/security/notices/USN-8730-4"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8730-5",
"url": "https://ubuntu.com/security/notices/USN-8730-5"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8661-5",
"url": "https://ubuntu.com/security/notices/USN-8661-5"
},
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8817-1",
"url": "https://ubuntu.com/security/notices/USN-8817-1"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8726-4",
"url": "https://ubuntu.com/security/notices/USN-8726-4"
},
{
"published_at": "2026-09-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8793-1",
"url": "https://ubuntu.com/security/notices/USN-8793-1"
}
]
}
FKIE_CVE-2026-43139
Vulnerability from fkie_nvd - Published: 2026-05-06 12:16 - Updated: 2026-06-17 10:49| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/1799d8abeabc68ec05679292aaf6cba93b343c05 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/3dcd1664ac15eee6a690daec7c4ffc59190406f7 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/4f28141786e1fe884ce42a5197ba9beed540f0ea | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/6535867673bf301d52aa00593a4d1d18cc3922fa | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/719918fc88df6da023dfff370cd965151a5afd7f | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/c7221e7bd8fc2ef38a0b27be580d9d202281306b | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/dc0abce055134cb83b0d981d31ceb20dda419787 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/eb2ee15290af14c60b45cf2b73f5687d1d077d9b | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | 7.0 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/ipv6/xfrm6_policy.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "4f28141786e1fe884ce42a5197ba9beed540f0ea",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "6535867673bf301d52aa00593a4d1d18cc3922fa",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "eb2ee15290af14c60b45cf2b73f5687d1d077d9b",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "719918fc88df6da023dfff370cd965151a5afd7f",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "dc0abce055134cb83b0d981d31ceb20dda419787",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "c7221e7bd8fc2ef38a0b27be580d9d202281306b",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "3dcd1664ac15eee6a690daec7c4ffc59190406f7",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
},
{
"lessThan": "1799d8abeabc68ec05679292aaf6cba93b343c05",
"status": "affected",
"version": "a1e59abf824969554b90facd44a4ab16e265afa4",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/ipv6/xfrm6_policy.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.19"
},
{
"lessThan": "2.6.19",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.252",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.202",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.165",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.128",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.75",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.16",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.19.*",
"status": "unaffected",
"version": "6.19.6",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.0",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "128F081F-CEB9-49AD-8832-F177C6299DED",
"versionEndExcluding": "5.10.252",
"versionStartIncluding": "2.6.19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "4002FC2B-1456-4666-B240-0EBF590C4671",
"versionEndExcluding": "5.15.202",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "797C7F46-D0BE-4FB8-A502-C5EF8E6B6654",
"versionEndExcluding": "6.1.165",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "851E9353-6C09-4CC9-877E-E09DB164A3C2",
"versionEndExcluding": "6.6.128",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "BCE16369-98ED-41CF-8995-DFDC10B288D2",
"versionEndExcluding": "6.12.75",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B4B8CDA9-BADF-4CF5-8B3B-702DE8EEA40B",
"versionEndExcluding": "6.18.16",
"versionStartIncluding": "6.13",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "373EEEDA-FAA1-4FB4-B6ED-DB4DD99DBE67",
"versionEndExcluding": "6.19.6",
"versionStartIncluding": "6.19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:7.0:rc1:*:*:*:*:*:*",
"matchCriteriaId": "F253B622-8837-4245-BCE5-A7BF8FC76A16",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nxfrm6: fix uninitialized saddr in xfrm6_get_saddr()\n\nxfrm6_get_saddr() does not check the return value of\nipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable\nsource address (returns -EADDRNOTAVAIL), saddr-\u003ein6 is left\nuninitialized, but xfrm6_get_saddr() still returns 0 (success).\n\nThis causes the caller xfrm_tmpl_resolve_one() to use the uninitialized\naddress in xfrm_state_find(), triggering KMSAN warning:\n\n=====================================================\nBUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940\n xfrm_state_find+0x2424/0xa940\n xfrm_resolve_and_create_bundle+0x906/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n xfrm_lookup_route+0x63/0x2b0\n ip_route_output_flow+0x1ce/0x270\n udp_sendmsg+0x2ce1/0x3400\n inet_sendmsg+0x1ef/0x2a0\n __sock_sendmsg+0x278/0x3d0\n __sys_sendto+0x593/0x720\n __x64_sys_sendto+0x130/0x200\n x64_sys_call+0x332b/0x3e70\n do_syscall_64+0xd3/0xf80\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\n\nLocal variable tmp.i.i created at:\n xfrm_resolve_and_create_bundle+0x3e3/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n=====================================================\n\nFix by checking the return value of ipv6_dev_get_saddr() and propagating\nthe error."
}
],
"id": "CVE-2026-43139",
"lastModified": "2026-06-17T10:49:00.497",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 8.6,
"baseSeverity": "HIGH",
"confidentialityImpact": "LOW",
"integrityImpact": "LOW",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:L/I:L/A:H",
"version": "3.1"
},
"exploitabilityScore": 3.9,
"impactScore": 4.7,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
}
]
},
"published": "2026-05-06T12:16:31.227",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/1799d8abeabc68ec05679292aaf6cba93b343c05"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3dcd1664ac15eee6a690daec7c4ffc59190406f7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4f28141786e1fe884ce42a5197ba9beed540f0ea"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/6535867673bf301d52aa00593a4d1d18cc3922fa"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/719918fc88df6da023dfff370cd965151a5afd7f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/c7221e7bd8fc2ef38a0b27be580d9d202281306b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/dc0abce055134cb83b0d981d31ceb20dda419787"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/eb2ee15290af14c60b45cf2b73f5687d1d077d9b"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-908"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-HR53-GF94-W7MP
Vulnerability from github – Published: 2026-05-06 12:30 – Updated: 2026-05-08 15:31In the Linux kernel, the following vulnerability has been resolved:
xfrm6: fix uninitialized saddr in xfrm6_get_saddr()
xfrm6_get_saddr() does not check the return value of ipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable source address (returns -EADDRNOTAVAIL), saddr->in6 is left uninitialized, but xfrm6_get_saddr() still returns 0 (success).
This causes the caller xfrm_tmpl_resolve_one() to use the uninitialized address in xfrm_state_find(), triggering KMSAN warning:
===================================================== BUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940 xfrm_state_find+0x2424/0xa940 xfrm_resolve_and_create_bundle+0x906/0x5a20 xfrm_lookup_with_ifid+0xcc0/0x3770 xfrm_lookup_route+0x63/0x2b0 ip_route_output_flow+0x1ce/0x270 udp_sendmsg+0x2ce1/0x3400 inet_sendmsg+0x1ef/0x2a0 __sock_sendmsg+0x278/0x3d0 __sys_sendto+0x593/0x720 __x64_sys_sendto+0x130/0x200 x64_sys_call+0x332b/0x3e70 do_syscall_64+0xd3/0xf80 entry_SYSCALL_64_after_hwframe+0x77/0x7f
Local variable tmp.i.i created at: xfrm_resolve_and_create_bundle+0x3e3/0x5a20 xfrm_lookup_with_ifid+0xcc0/0x3770 =====================================================
Fix by checking the return value of ipv6_dev_get_saddr() and propagating the error.
{
"affected": [],
"aliases": [
"CVE-2026-43139"
],
"database_specific": {
"cwe_ids": [
"CWE-908"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2026-05-06T12:16:31Z",
"severity": "HIGH"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nxfrm6: fix uninitialized saddr in xfrm6_get_saddr()\n\nxfrm6_get_saddr() does not check the return value of\nipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable\nsource address (returns -EADDRNOTAVAIL), saddr-\u003ein6 is left\nuninitialized, but xfrm6_get_saddr() still returns 0 (success).\n\nThis causes the caller xfrm_tmpl_resolve_one() to use the uninitialized\naddress in xfrm_state_find(), triggering KMSAN warning:\n\n=====================================================\nBUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940\n xfrm_state_find+0x2424/0xa940\n xfrm_resolve_and_create_bundle+0x906/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n xfrm_lookup_route+0x63/0x2b0\n ip_route_output_flow+0x1ce/0x270\n udp_sendmsg+0x2ce1/0x3400\n inet_sendmsg+0x1ef/0x2a0\n __sock_sendmsg+0x278/0x3d0\n __sys_sendto+0x593/0x720\n __x64_sys_sendto+0x130/0x200\n x64_sys_call+0x332b/0x3e70\n do_syscall_64+0xd3/0xf80\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\n\nLocal variable tmp.i.i created at:\n xfrm_resolve_and_create_bundle+0x3e3/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n=====================================================\n\nFix by checking the return value of ipv6_dev_get_saddr() and propagating\nthe error.",
"id": "GHSA-hr53-gf94-w7mp",
"modified": "2026-05-08T15:31:16Z",
"published": "2026-05-06T12:30:30Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43139"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/1799d8abeabc68ec05679292aaf6cba93b343c05"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/3dcd1664ac15eee6a690daec7c4ffc59190406f7"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/4f28141786e1fe884ce42a5197ba9beed540f0ea"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/6535867673bf301d52aa00593a4d1d18cc3922fa"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/719918fc88df6da023dfff370cd965151a5afd7f"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/c7221e7bd8fc2ef38a0b27be580d9d202281306b"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/dc0abce055134cb83b0d981d31ceb20dda419787"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/eb2ee15290af14c60b45cf2b73f5687d1d077d9b"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:L/I:L/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2026-2579 (CVE-2025-38263)
Vulnerability from osv_openeuler – Published: 2026-06-05 11:11 – Updated: 2026-08-06 11:11 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
bcache: fix NULL pointer in cache_set_flush()
- LINE#1794 - LINE#1887 is some codes about function of bch_cache_set_alloc().
- LINE#2078 - LINE#2142 is some codes about function of register_cache_set().
- register_cache_set() will call bch_cache_set_alloc() in LINE#2098.
1794 struct cache_set bch_cache_set_alloc(struct cache_sb sb) 1795 { ... 1860 if (!(c->devices = kcalloc(c->nr_uuids, sizeof(void ), GFP_KERNEL)) || 1861 mempool_init_slab_pool(&c->search, 32, bch_search_cache) || 1862 mempool_init_kmalloc_pool(&c->bio_meta, 2, 1863 sizeof(struct bbio) + sizeof(struct bio_vec) * 1864 bucket_pages(c)) || 1865 mempool_init_kmalloc_pool(&c->fill_iter, 1, iter_size) || 1866 bioset_init(&c->bio_split, 4, offsetof(struct bbio, bio), 1867 BIOSET_NEED_BVECS|BIOSET_NEED_RESCUER) || 1868 !(c->uuids = alloc_bucket_pages(GFP_KERNEL, c)) || 1869 !(c->moving_gc_wq = alloc_workqueue("bcache_gc", 1870 WQ_MEM_RECLAIM, 0)) || 1871 bch_journal_alloc(c) || 1872 bch_btree_cache_alloc(c) || 1873 bch_open_buckets_alloc(c) || 1874 bch_bset_sort_state_init(&c->sort, ilog2(c->btree_pages))) 1875 goto err; ^^^^^^^^ 1876 ... 1883 return c; 1884 err: 1885 bch_cache_set_unregister(c); ^^^^^^^^^^^^^^^^^^^^^^^^^^^ 1886 return NULL; 1887 } ... 2078 static const char register_cache_set(struct cache *ca) 2079 { ... 2098 c = bch_cache_set_alloc(&ca->sb); 2099 if (!c) 2100 return err; ^^^^^^^^^^ ... 2128 ca->set = c; 2129 ca->set->cache[ca->sb.nr_this_dev] = ca; ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ ... 2138 return NULL; 2139 err: 2140 bch_cache_set_unregister(c); 2141 return err; 2142 }
(1) If LINE#1860 - LINE#1874 is true, then do 'goto err'(LINE#1875) and call bch_cache_set_unregister()(LINE#1885). (2) As (1) return NULL(LINE#1886), LINE#2098 - LINE#2100 would return. (3) As (2) has returned, LINE#2128 - LINE#2129 would do not give the value to c->cache[], it means that c->cache[] is NULL.
LINE#1624 - LINE#1665 is some codes about function of cache_set_flush(). As (1), in LINE#1885 call bch_cache_set_unregister() ---> bch_cache_set_stop() ---> closure_queue() -.-> cache_set_flush() (as below LINE#1624)
1624 static void cache_set_flush(struct closure *cl) 1625 { ... 1654 for_each_cache(ca, c, i) 1655 if (ca->alloc_thread) ^^ 1656 kthread_stop(ca->alloc_thread); ... 1665 }
(4) In LINE#1655 ca is NULL(see (3)) in cache_set_flush() then the kernel crash occurred as below: [ 846.712887] bcache: register_cache() error drbd6: cannot allocate memory [ 846.713242] bcache: register_bcache() error : failed to register device [ 846.713336] bcache: cache_set_free() Cache set 2f84bdc1-498a-4f2f-98a7-01946bf54287 unregistered [ 846.713768] BUG: unable to handle kernel NULL pointer dereference at 00000000000009f8 [ 846.714790] PGD 0 P4D 0 [ 846.715129] Oops: 0000 [#1] SMP PTI [ 846.715472] CPU: 19 PID: 5057 Comm: kworker/19:16 Kdump: loaded Tainted: G OE --------- - - 4.18.0-147.5.1.el8_1.5es.3.x86_64 #1 [ 846.716082] Hardware name: ESPAN GI-25212/X11DPL-i, BIOS 2.1 06/15/2018 [ 846.716451] Workqueue: events cache_set_flush [bcache] [ 846.716808] RIP: 0010:cache_set_flush+0xc9/0x1b0 [bcache] [ 846.717155] Code: 00 4c 89 a5 b0 03 00 00 48 8b 85 68 f6 ff ff a8 08 0f 84 88 00 00 00 31 db 66 83 bd 3c f7 ff ff 00 48 8b 85 48 ff ff ff 74 28 <48> 8b b8 f8 09 00 0 ---truncated---(CVE-2025-38263)
In the Linux kernel, the following vulnerability has been resolved:
vsock/vmci: Clear the vmci transport packet properly when initializing it
In vmci_transport_packet_init memset the vmci_transport_packet before populating the fields to avoid any uninitialised data being left in the structure.(CVE-2025-38403)
In the Linux kernel, the following vulnerability has been resolved:
atm: clip: Fix infinite recursive call of clip_push().
syzbot reported the splat below. [0]
This happens if we call ioctl(ATMARP_MKIP) more than once.
During the first call, clip_mkip() sets clip_push() to vcc->push(), and the second call copies it to clip_vcc->old_push().
Later, when the socket is close()d, vcc_destroy_socket() passes NULL skb to clip_push(), which calls clip_vcc->old_push(), triggering the infinite recursion.
Let's prevent the second ioctl(ATMARP_MKIP) by checking vcc->user_back, which is allocated by the first call as clip_vcc.
Note also that we use lock_sock() to prevent racy calls.
[0]: BUG: TASK stack guard page was hit at ffffc9000d66fff8 (stack is ffffc9000d670000..ffffc9000d678000) Oops: stack guard page: 0000 [#1] SMP KASAN NOPTI CPU: 0 UID: 0 PID: 5322 Comm: syz.0.0 Not tainted 6.16.0-rc4-syzkaller #0 PREEMPT(full) Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-debian-1.16.3-2~bpo12+1 04/01/2014 RIP: 0010:clip_push+0x5/0x720 net/atm/clip.c:191 Code: e0 8f aa 8c e8 1c ad 5b fa eb ae 66 2e 0f 1f 84 00 00 00 00 00 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 f3 0f 1e fa 55 <41> 57 41 56 41 55 41 54 53 48 83 ec 20 48 89 f3 49 89 fd 48 bd 00 RSP: 0018:ffffc9000d670000 EFLAGS: 00010246 RAX: 1ffff1100235a4a5 RBX: ffff888011ad2508 RCX: ffff8880003c0000 RDX: 0000000000000000 RSI: 0000000000000000 RDI: ffff888037f01000 RBP: dffffc0000000000 R08: ffffffff8fa104f7 R09: 1ffffffff1f4209e R10: dffffc0000000000 R11: ffffffff8a99b300 R12: ffffffff8a99b300 R13: ffff888037f01000 R14: ffff888011ad2500 R15: ffff888037f01578 FS: 000055557ab6d500(0000) GS:ffff88808d250000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: ffffc9000d66fff8 CR3: 0000000043172000 CR4: 0000000000352ef0 Call Trace: <TASK> clip_push+0x6dc/0x720 net/atm/clip.c:200 clip_push+0x6dc/0x720 net/atm/clip.c:200 clip_push+0x6dc/0x720 net/atm/clip.c:200 ... clip_push+0x6dc/0x720 net/atm/clip.c:200 clip_push+0x6dc/0x720 net/atm/clip.c:200 clip_push+0x6dc/0x720 net/atm/clip.c:200 vcc_destroy_socket net/atm/common.c:183 [inline] vcc_release+0x157/0x460 net/atm/common.c:205 __sock_release net/socket.c:647 [inline] sock_close+0xc0/0x240 net/socket.c:1391 __fput+0x449/0xa70 fs/file_table.c:465 task_work_run+0x1d1/0x260 kernel/task_work.c:227 resume_user_mode_work include/linux/resume_user_mode.h:50 [inline] exit_to_user_mode_loop+0xec/0x110 kernel/entry/common.c:114 exit_to_user_mode_prepare include/linux/entry-common.h:330 [inline] syscall_exit_to_user_mode_work include/linux/entry-common.h:414 [inline] syscall_exit_to_user_mode include/linux/entry-common.h:449 [inline] do_syscall_64+0x2bd/0x3b0 arch/x86/entry/syscall_64.c:100 entry_SYSCALL_64_after_hwframe+0x77/0x7f RIP: 0033:0x7ff31c98e929 Code: ff ff c3 66 2e 0f 1f 84 00 00 00 00 00 0f 1f 40 00 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 a8 ff ff ff f7 d8 64 89 01 48 RSP: 002b:00007fffb5aa1f78 EFLAGS: 00000246 ORIG_RAX: 00000000000001b4 RAX: 0000000000000000 RBX: 0000000000012747 RCX: 00007ff31c98e929 RDX: 0000000000000000 RSI: 000000000000001e RDI: 0000000000000003 RBP: 00007ff31cbb7ba0 R08: 0000000000000001 R09: 0000000db5aa226f R10: 00007ff31c7ff030 R11: 0000000000000246 R12: 00007ff31cbb608c R13: 00007ff31cbb6080 R14: ffffffffffffffff R15: 00007fffb5aa2090 </TASK> Modules linked in:(CVE-2025-38459)
In the Linux kernel, the following vulnerability has been resolved:
iwlwifi: Add missing check for alloc_ordered_workqueue
Add check for the return value of alloc_ordered_workqueue since it may return NULL pointer.(CVE-2025-38602)
In the Linux kernel, the following vulnerability has been resolved:
wifi: mac80211: reject TDLS operations when station is not associated
syzbot triggered a WARN in ieee80211_tdls_oper() by sending NL80211_TDLS_ENABLE_LINK immediately after NL80211_CMD_CONNECT, before association completed and without prior TDLS setup.
This left internal state like sdata->u.mgd.tdls_peer uninitialized, leading to a WARN_ON() in code paths that assumed it was valid.
Reject the operation early if not in station mode or not associated.(CVE-2025-38644)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: do not allow relocation of partially dropped subvolumes
[BUG] There is an internal report that balance triggered transaction abort, with the following call trace:
item 85 key (594509824 169 0) itemoff 12599 itemsize 33 extent refs 1 gen 197740 flags 2 ref#0: tree block backref root 7 item 86 key (594558976 169 0) itemoff 12566 itemsize 33 extent refs 1 gen 197522 flags 2 ref#0: tree block backref root 7 ... BTRFS error (device loop0): extent item not found for insert, bytenr 594526208 num_bytes 16384 parent 449921024 root_objectid 934 owner 1 offset 0 BTRFS error (device loop0): failed to run delayed ref for logical 594526208 num_bytes 16384 type 182 action 1 ref_mod 1: -117 ------------[ cut here ]------------ BTRFS: Transaction aborted (error -117) WARNING: CPU: 1 PID: 6963 at ../fs/btrfs/extent-tree.c:2168 btrfs_run_delayed_refs+0xfa/0x110 [btrfs]
And btrfs check doesn't report anything wrong related to the extent tree.
[CAUSE] The cause is a little complex, firstly the extent tree indeed doesn't have the backref for 594526208.
The extent tree only have the following two backrefs around that bytenr on-disk:
item 65 key (594509824 METADATA_ITEM 0) itemoff 13880 itemsize 33
refs 1 gen 197740 flags TREE_BLOCK
tree block skinny level 0
(176 0x7) tree block backref root CSUM_TREE
item 66 key (594558976 METADATA_ITEM 0) itemoff 13847 itemsize 33
refs 1 gen 197522 flags TREE_BLOCK
tree block skinny level 0
(176 0x7) tree block backref root CSUM_TREE
But the such missing backref item is not an corruption on disk, as the offending delayed ref belongs to subvolume 934, and that subvolume is being dropped:
item 0 key (934 ROOT_ITEM 198229) itemoff 15844 itemsize 439
generation 198229 root_dirid 256 bytenr 10741039104 byte_limit 0 bytes_used 345571328
last_snapshot 198229 flags 0x1000000000001(RDONLY) refs 0
drop_progress key (206324 EXTENT_DATA 2711650304) drop_level 2
level 2 generation_v2 198229
And that offending tree block 594526208 is inside the dropped range of that subvolume. That explains why there is no backref item for that bytenr and why btrfs check is not reporting anything wrong.
But this also shows another problem, as btrfs will do all the orphan subvolume cleanup at a read-write mount.
So half-dropped subvolume should not exist after an RW mount, and balance itself is also exclusive to subvolume cleanup, meaning we shouldn't hit a subvolume half-dropped during relocation.
The root cause is, there is no orphan item for this subvolume. In fact there are 5 subvolumes from around 2021 that have the same problem.
It looks like the original report has some older kernels running, and caused those zombie subvolumes.
Thankfully upstream commit 8d488a8c7ba2 ("btrfs: fix subvolume/snapshot deletion not triggered on mount") has long fixed the bug.
[ENHANCEMENT] For repairing such old fs, btrfs-progs will be enhanced.
Considering how delayed the problem will show up (at run delayed ref time) and at that time we have to abort transaction already, it is too late.
Instead here we reject any half-dropped subvolume for reloc tree at the earliest time, preventing confusion and extra time wasted on debugging similar bugs.(CVE-2025-39738)
In the Linux kernel, the following vulnerability has been resolved:
can: peak_usb: fix shift-out-of-bounds issue
Explicitly uses a 64-bit constant when the number of bits used for its shifting is 32 (which is the case for PC CAN FD interfaces supported by this driver).
mkl: update subject, apply manually
In the Linux kernel, the following vulnerability has been resolved:
team: Move team device type change at the end of team_port_add
Attempting to add a port device that is already up will expectedly fail, but not before modifying the team device header_ops.
In the case of the syzbot reproducer the gre0 device is already in state UP when it attempts to add it as a port device of team0, this fails but before that header_ops->create of team0 is changed from eth_header to ipgre_header in the call to team_dev_type_check_change.
Later when we end up in ipgre_header() struct ip_tunnel* points to nonsense as the private data of the device still holds a struct team.
Example sequence of iproute2 commands to reproduce the hang/BUG(): ip link add dev team0 type team ip link add dev gre0 type gre ip link set dev gre0 up ip link set dev gre0 master team0 ip link set dev team0 up ping -I team0 1.1.1.1
Move team_dev_type_check_change down where all other checks have passed as it changes the dev type with no way to restore it in case one of the checks that follow it fail.
Also make sure to preserve the origial mtu assignment: - If port_dev is not the same type as dev, dev takes mtu from port_dev - If port_dev is the same type as dev, port_dev takes mtu from dev
This is done by adding a conditional before the call to dev_set_mtu to prevent it from assigning port_dev->mtu = dev->mtu and instead letting team_dev_type_check_change assign dev->mtu = port_dev->mtu. The conditional is needed because the patch moves the call to team_dev_type_check_change past dev_set_mtu.
Testing: - team device driver in-tree selftests - Add/remove various devices as slaves of team device - syzbot(CVE-2025-68340)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/umad: Reject negative data_len in ib_umad_write
ib_umad_write computes data_len from user-controlled count and the MAD header sizes. With a mismatched user MAD header size and RMPP header length, data_len can become negative and reach ib_create_send_mad(). This can make the padding calculation exceed the segment size and trigger an out-of-bounds memset in alloc_send_rmpp_list().
Add an explicit check to reject negative data_len before creating the send buffer.
KASAN splat: [ 211.363464] BUG: KASAN: slab-out-of-bounds in ib_create_send_mad+0xa01/0x11b0 [ 211.364077] Write of size 220 at addr ffff88800c3fa1f8 by task spray_thread/102 [ 211.365867] ib_create_send_mad+0xa01/0x11b0 [ 211.365887] ib_umad_write+0x853/0x1c80(CVE-2026-23243)
In the Linux kernel, the following vulnerability has been resolved:
macvlan: observe an RCU grace period in macvlan_common_newlink() error path
valis reported that a race condition still happens after my prior patch.
macvlan_common_newlink() might have made @dev visible before detecting an error, and its caller will directly call free_netdev(dev).
We must respect an RCU period, either in macvlan or the core networking stack.
After adding a temporary mdelay(1000) in macvlan_forward_source_one() to open the race window, valis repro was:
ip link add p1 type veth peer p2 ip link set address 00:00:00:00:00:20 dev p1 ip link set up dev p1 ip link set up dev p2 ip link add mv0 link p2 type macvlan mode source
(ip link add invalid% link p2 type macvlan mode source macaddr add 00:00:00:00:00:20 &) ; sleep 0.5 ; ping -c1 -I p1 1.2.3.4 PING 1.2.3.4 (1.2.3.4): 56 data bytes RTNETLINK answers: Invalid argument
BUG: KASAN: slab-use-after-free in macvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444) Read of size 8 at addr ffff888016bb89c0 by task e/175
CPU: 1 UID: 1000 PID: 175 Comm: e Not tainted 6.19.0-rc8+ #33 NONE Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.14.0-2 04/01/2014 Call Trace: <IRQ> dump_stack_lvl (lib/dump_stack.c:123) print_report (mm/kasan/report.c:379 mm/kasan/report.c:482) ? macvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444) kasan_report (mm/kasan/report.c:597) ? macvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444) macvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444) ? tasklet_init (kernel/softirq.c:983) macvlan_handle_frame (drivers/net/macvlan.c:501)
Allocated by task 169: kasan_save_stack (mm/kasan/common.c:58) kasan_save_track (./arch/x86/include/asm/current.h:25 mm/kasan/common.c:70 mm/kasan/common.c:79) __kasan_kmalloc (mm/kasan/common.c:419) __kvmalloc_node_noprof (./include/linux/kasan.h:263 mm/slub.c:5657 mm/slub.c:7140) alloc_netdev_mqs (net/core/dev.c:12012) rtnl_create_link (net/core/rtnetlink.c:3648) rtnl_newlink (net/core/rtnetlink.c:3830 net/core/rtnetlink.c:3957 net/core/rtnetlink.c:4072) rtnetlink_rcv_msg (net/core/rtnetlink.c:6958) netlink_rcv_skb (net/netlink/af_netlink.c:2550) netlink_unicast (net/netlink/af_netlink.c:1319 net/netlink/af_netlink.c:1344) netlink_sendmsg (net/netlink/af_netlink.c:1894) __sys_sendto (net/socket.c:727 net/socket.c:742 net/socket.c:2206) __x64_sys_sendto (net/socket.c:2209) do_syscall_64 (arch/x86/entry/syscall_64.c:63 arch/x86/entry/syscall_64.c:94) entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:131)
Freed by task 169: kasan_save_stack (mm/kasan/common.c:58) kasan_save_track (./arch/x86/include/asm/current.h:25 mm/kasan/common.c:70 mm/kasan/common.c:79) kasan_save_free_info (mm/kasan/generic.c:587) __kasan_slab_free (mm/kasan/common.c:287) kfree (mm/slub.c:6674 mm/slub.c:6882) rtnl_newlink (net/core/rtnetlink.c:3845 net/core/rtnetlink.c:3957 net/core/rtnetlink.c:4072) rtnetlink_rcv_msg (net/core/rtnetlink.c:6958) netlink_rcv_skb (net/netlink/af_netlink.c:2550) netlink_unicast (net/netlink/af_netlink.c:1319 net/netlink/af_netlink.c:1344) netlink_sendmsg (net/netlink/af_netlink.c:1894) __sys_sendto (net/socket.c:727 net/socket.c:742 net/socket.c:2206) __x64_sys_sendto (net/socket.c:2209) do_syscall_64 (arch/x86/entry/syscall_64.c:63 arch/x86/entry/syscall_64.c:94) entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:131)(CVE-2026-23273)
In the Linux kernel, the following vulnerability has been resolved:
mm: blk-cgroup: fix use-after-free in cgwb_release_workfn()
cgwb_release_workfn() calls css_put(wb->blkcg_css) and then later accesses wb->blkcg_css again via blkcg_unpin_online(). If css_put() drops the last reference, the blkcg can be freed asynchronously (css_free_rwork_fn -> blkcg_css_free -> kfree) before blkcg_unpin_online() dereferences the pointer to access blkcg->online_pin, resulting in a use-after-free:
BUG: KASAN: slab-use-after-free in blkcg_unpin_online (./include/linux/instrumented.h:112 ./include/linux/atomic/atomic-instrumented.h:400 ./include/linux/refcount.h:389 ./include/linux/refcount.h:432 ./include/linux/refcount.h:450 block/blk-cgroup.c:1367) Write of size 4 at addr ff11000117aa6160 by task kworker/71:1/531 Workqueue: cgwb_release cgwb_release_workfn Call Trace: <TASK> blkcg_unpin_online (./include/linux/instrumented.h:112 ./include/linux/atomic/atomic-instrumented.h:400 ./include/linux/refcount.h:389 ./include/linux/refcount.h:432 ./include/linux/refcount.h:450 block/blk-cgroup.c:1367) cgwb_release_workfn (mm/backing-dev.c:629) process_scheduled_works (kernel/workqueue.c:3278 kernel/workqueue.c:3385)
Freed by task 1016: kfree (./include/linux/kasan.h:235 mm/slub.c:2689 mm/slub.c:6246 mm/slub.c:6561) css_free_rwork_fn (kernel/cgroup/cgroup.c:5542) process_scheduled_works (kernel/workqueue.c:3302 kernel/workqueue.c:3385)
** Stack based on commit 66672af7a095 ("Add linux-next specific files for 20260410")
I am seeing this crash sporadically in Meta fleet across multiple kernel versions. A full reproducer is available at: https://github.com/leitao/debug/blob/main/reproducers/repro_blkcg_uaf.sh
(The race window is narrow. To make it easily reproducible, inject a msleep(100) between css_put() and blkcg_unpin_online() in cgwb_release_workfn(). With that delay and a KASAN-enabled kernel, the reproducer triggers the splat reliably in less than a second.)
Fix this by moving blkcg_unpin_online() before css_put(), so the cgwb's CSS reference keeps the blkcg alive while blkcg_unpin_online() accesses it.(CVE-2026-31586)
In the Linux kernel, the following vulnerability has been resolved:
KVM: x86: Use scratch field in MMIO fragment to hold small write values
When exiting to userspace to service an emulated MMIO write, copy the to-be-written value to a scratch field in the MMIO fragment if the size of the data payload is 8 bytes or less, i.e. can fit in a single chunk, instead of pointing the fragment directly at the source value.
This fixes a class of use-after-free bugs that occur when the emulator initiates a write using an on-stack, local variable as the source, the write splits a page boundary, and both pages are MMIO pages. Because KVM's ABI only allows for physically contiguous MMIO requests, accesses that split MMIO pages are separated into two fragments, and are sent to userspace one at a time. When KVM attempts to complete userspace MMIO in response to KVM_RUN after the first fragment, KVM will detect the second fragment and generate a second userspace exit, and reference the on-stack variable.
The issue is most visible if the second KVM_RUN is performed by a separate task, in which case the stack of the initiating task can show up as truly freed data.
================================================================== BUG: KASAN: use-after-free in complete_emulated_mmio+0x305/0x420 Read of size 1 at addr ffff888009c378d1 by task syz-executor417/984
CPU: 1 PID: 984 Comm: syz-executor417 Not tainted 5.10.0-182.0.0.95.h2627.eulerosv2r13.x86_64 #3 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.15.0-0-g2dd4b9b3f840-prebuilt.qemu.org 04/01/2014 Call Trace: dump_stack+0xbe/0xfd print_address_description.constprop.0+0x19/0x170 __kasan_report.cold+0x6c/0x84 kasan_report+0x3a/0x50 check_memory_region+0xfd/0x1f0 memcpy+0x20/0x60 complete_emulated_mmio+0x305/0x420 kvm_arch_vcpu_ioctl_run+0x63f/0x6d0 kvm_vcpu_ioctl+0x413/0xb20 __se_sys_ioctl+0x111/0x160 do_syscall_64+0x30/0x40 entry_SYSCALL_64_after_hwframe+0x67/0xd1 RIP: 0033:0x42477d Code: <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48 RSP: 002b:00007faa8e6890e8 EFLAGS: 00000246 ORIG_RAX: 0000000000000010 RAX: ffffffffffffffda RBX: 00000000004d7338 RCX: 000000000042477d RDX: 0000000000000000 RSI: 000000000000ae80 RDI: 0000000000000005 RBP: 00000000004d7330 R08: 00007fff28d546df R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000246 R12: 00000000004d733c R13: 0000000000000000 R14: 000000000040a200 R15: 00007fff28d54720
The buggy address belongs to the page: page:0000000029f6a428 refcount:0 mapcount:0 mapping:0000000000000000 index:0x0 pfn:0x9c37 flags: 0xfffffc0000000(node=0|zone=1|lastcpupid=0x1fffff) raw: 000fffffc0000000 0000000000000000 ffffea0000270dc8 0000000000000000 raw: 0000000000000000 0000000000000000 00000000ffffffff 0000000000000000 page dumped because: kasan: bad access detected
Memory state around the buggy address: ffff888009c37780: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ffff888009c37800: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff >ffff888009c37880: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ^ ffff888009c37900: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ffff888009c37980: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ==================================================================
The bug can also be reproduced with a targeted KVM-Unit-Test by hacking KVM to fill a large on-stack variable in complete_emulated_mmio(), i.e. by overwrite the data value with garbage.
Limit the use of the scratch fields to 8-byte or smaller accesses, and to just writes, as larger accesses and reads are not affected thanks to implementation details in the emulator, but add a sanity check to ensure those details don't change in the future. Specifically, KVM never uses on-stack variables for accesses larger that 8 bytes, e.g. uses an operand in the emulator context, and *al ---truncated---(CVE-2026-31588)
In the Linux kernel, the following vulnerability has been resolved:
openvswitch: defer tunnel netdev_put to RCU release
ovs_netdev_tunnel_destroy() may run after NETDEV_UNREGISTER already detached the device. Dropping the netdev reference in destroy can race with concurrent readers that still observe vport->dev.
Do not release vport->dev in ovs_netdev_tunnel_destroy(). Instead, let vport_netdev_free() drop the reference from the RCU callback, matching the non-tunnel destroy path and avoiding additional synchronization under RTNL.(CVE-2026-31678)
In the Linux kernel, the following vulnerability has been resolved:
usb: ulpi: fix double free in ulpi_register_interface() error path
When device_register() fails, ulpi_register() calls put_device() on ulpi->dev.
The device release callback ulpi_dev_release() drops the OF node reference and frees ulpi, but the current error path in ulpi_register_interface() then calls kfree(ulpi) again, causing a double free.
Let put_device() handle the cleanup through ulpi_dev_release() and avoid freeing ulpi again in ulpi_register_interface().(CVE-2026-31759)
In the Linux kernel, the following vulnerability has been resolved:
drm/ioc32: stop speculation on the drm_compat_ioctl path
The drm compat ioctl path takes a user controlled pointer, and then dereferences it into a table of function pointers, the signature method of spectre problems. Fix this up by calling array_index_nospec() on the index to the function pointer list.(CVE-2026-31781)
In the Linux kernel, the following vulnerability has been resolved:
ip6_tunnel: clear skb2->cb[] in ip4ip6_err()
Oskar Kjos reported the following problem.
ip4ip6_err() calls icmp_send() on a cloned skb whose cb[] was written by the IPv6 receive path as struct inet6_skb_parm. icmp_send() passes IPCB(skb2) to __ip_options_echo(), which interprets that cb[] region as struct inet_skb_parm (IPv4). The layouts differ: inet6_skb_parm.nhoff at offset 14 overlaps inet_skb_parm.opt.rr, producing a non-zero rr value. __ip_options_echo() then reads optlen from attacker-controlled packet data at sptr[rr+1] and copies that many bytes into dopt->__data, a fixed 40-byte stack buffer (IP_OPTIONS_DATA_FIXED_SIZE).
To fix this we clear skb2->cb[], as suggested by Oskar Kjos.
Also add minimal IPv4 header validation (version == 4, ihl >= 5).(CVE-2026-43037)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: icmp: clear skb2->cb[] in ip6_err_gen_icmpv6_unreach()
Sashiko AI-review observed:
In ip6_err_gen_icmpv6_unreach(), the skb is an outer IPv4 ICMP error packet where its cb contains an IPv4 inet_skb_parm. When skb is cloned into skb2 and passed to icmp6_send(), it uses IP6CB(skb2).
IP6CB interprets the IPv4 inet_skb_parm as an inet6_skb_parm. The cipso offset in inet_skb_parm.opt directly overlaps with dsthao in inet6_skb_parm at offset 18.
If an attacker sends a forged ICMPv4 error with a CIPSO IP option, dsthao would be a non-zero offset. Inside icmp6_send(), mip6_addr_swap() is called and uses ipv6_find_tlv(skb, opt->dsthao, IPV6_TLV_HAO).
This would scan the inner, attacker-controlled IPv6 packet starting at that offset, potentially returning a fake TLV without checking if the remaining packet length can hold the full 18-byte struct ipv6_destopt_hao.
Could mip6_addr_swap() then perform a 16-byte swap that extends past the end of the packet data into skb_shared_info?
Should the cb array also be cleared in ip6_err_gen_icmpv6_unreach() and ip6ip6_err() to prevent this?
This patch implements the first suggestion.
I am not sure if ip6ip6_err() needs to be changed. A separate patch would be better anyway.(CVE-2026-43038)
In the Linux kernel, the following vulnerability has been resolved:
xfrm6: fix uninitialized saddr in xfrm6_get_saddr()
xfrm6_get_saddr() does not check the return value of ipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable source address (returns -EADDRNOTAVAIL), saddr->in6 is left uninitialized, but xfrm6_get_saddr() still returns 0 (success).
This causes the caller xfrm_tmpl_resolve_one() to use the uninitialized address in xfrm_state_find(), triggering KMSAN warning:
===================================================== BUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940 xfrm_state_find+0x2424/0xa940 xfrm_resolve_and_create_bundle+0x906/0x5a20 xfrm_lookup_with_ifid+0xcc0/0x3770 xfrm_lookup_route+0x63/0x2b0 ip_route_output_flow+0x1ce/0x270 udp_sendmsg+0x2ce1/0x3400 inet_sendmsg+0x1ef/0x2a0 __sock_sendmsg+0x278/0x3d0 __sys_sendto+0x593/0x720 __x64_sys_sendto+0x130/0x200 x64_sys_call+0x332b/0x3e70 do_syscall_64+0xd3/0xf80 entry_SYSCALL_64_after_hwframe+0x77/0x7f
Local variable tmp.i.i created at: xfrm_resolve_and_create_bundle+0x3e3/0x5a20 xfrm_lookup_with_ifid+0xcc0/0x3770 =====================================================
Fix by checking the return value of ipv6_dev_get_saddr() and propagating the error.(CVE-2026-43139)
In the Linux kernel, the following vulnerability has been resolved:
xfs: fix freemap adjustments when adding xattrs to leaf blocks
xfs/592 and xfs/794 both trip this assertion in the leaf block freemap adjustment code after ~20 minutes of running on my test VMs:
ASSERT(ichdr->firstused >= ichdr->count * sizeof(xfs_attr_leaf_entry_t) + xfs_attr3_leaf_hdr_size(leaf));
Upon enabling quite a lot more debugging code, I narrowed this down to fsstress trying to set a local extended attribute with namelen=3 and valuelen=71. This results in an entry size of 80 bytes.
At the start of xfs_attr3_leaf_add_work, the freemap looks like this:
i 0 base 448 size 0 rhs 448 count 46 i 1 base 388 size 132 rhs 448 count 46 i 2 base 2120 size 4 rhs 448 count 46 firstused = 520
where "rhs" is the first byte past the end of the leaf entry array. This is inconsistent -- the entries array ends at byte 448, but freemap[1] says there's free space starting at byte 388!
By the end of the function, the freemap is in worse shape:
i 0 base 456 size 0 rhs 456 count 47 i 1 base 388 size 52 rhs 456 count 47 i 2 base 2120 size 4 rhs 456 count 47 firstused = 440
Important note: 388 is not aligned with the entries array element size of 8 bytes.
Based on the incorrect freemap, the name area starts at byte 440, which is below the end of the entries array! That's why the assertion triggers and the filesystem shuts down.
How did we end up here? First, recall from the previous patch that the freemap array in an xattr leaf block is not intended to be a comprehensive map of all free space in the leaf block. In other words, it's perfectly legal to have a leaf block with:
- 376 bytes in use by the entries array
- freemap[0] has [base = 376, size = 8]
- freemap[1] has [base = 388, size = 1500]
- the space between 376 and 388 is free, but the freemap stopped tracking that some time ago
If we add one xattr, the entries array grows to 384 bytes, and freemap[0] becomes [base = 384, size = 0]. So far, so good. But if we add a second xattr, the entries array grows to 392 bytes, and freemap[0] gets pushed up to [base = 392, size = 0]. This is bad, because freemap[1] hasn't been updated, and now the entries array and the free space claim the same space.
The fix here is to adjust all freemap entries so that none of them collide with the entries array. Note that this fix relies on commit 2a2b5932db6758 ("xfs: fix attr leaf header freemap.size underflow") and the previous patch that resets zero length freemap entries to have base = 0.(CVE-2026-43158)
In the Linux kernel, the following vulnerability has been resolved:
net: usb: kaweth: remove TX queue manipulation in kaweth_set_rx_mode
kaweth_set_rx_mode(), the ndo_set_rx_mode callback, calls netif_stop_queue() and netif_wake_queue(). These are TX queue flow control functions unrelated to RX multicast configuration.
The premature netif_wake_queue() can re-enable TX while tx_urb is still in-flight, leading to a double usb_submit_urb() on the same URB:
kaweth_start_xmit() { netif_stop_queue(); usb_submit_urb(kaweth->tx_urb); }
kaweth_set_rx_mode() { netif_stop_queue(); netif_wake_queue(); // wakes TX queue before URB is done }
kaweth_start_xmit() { netif_stop_queue(); usb_submit_urb(kaweth->tx_urb); // URB submitted while active }
This triggers the WARN in usb_submit_urb():
"URB submitted while active"
This is a similar class of bug fixed in rtl8150 by
- commit 958baf5eaee3 ("net: usb: Remove disruptive netif_wake_queue in rtl8150_set_multicast").
Also kaweth_set_rx_mode() is already functionally broken, the real set_rx_mode action is performed by kaweth_async_set_rx_mode(), which in turn is not a no-op only at ndo_open() time.(CVE-2026-43180)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: xt_tcpmss: check remaining length before reading optlen
Quoting reporter: In net/netfilter/xt_tcpmss.c (lines 53-68), the TCP option parser reads op[i+1] directly without validating the remaining option length.
If the last byte of the option field is not EOL/NOP (0/1), the code attempts to index op[i+1]. In the case where i + 1 == optlen, this causes an out-of-bounds read, accessing memory past the optlen boundary (either reading beyond the stack buffer _opt or the following payload).(CVE-2026-43190)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_conntrack_h323: fix OOB read in decode_choice()
In decode_choice(), the boundary check before get_len() uses the
variable len, which is still 0 from its initialization at the top of
the function:
unsigned int type, ext, len = 0;
...
if (ext || (son->attr & OPEN)) {
BYTE_ALIGN(bs);
if (nf_h323_error_boundary(bs, len, 0)) /* len is 0 here */
return H323_ERROR_BOUND;
len = get_len(bs); /* OOB read */
When the bitstream is exactly consumed (bs->cur == bs->end), the check nf_h323_error_boundary(bs, 0, 0) evaluates to (bs->cur + 0 > bs->end), which is false. The subsequent get_len() call then dereferences *bs->cur++, reading 1 byte past the end of the buffer. If that byte has bit 7 set, get_len() reads a second byte as well.
This can be triggered remotely by sending a crafted Q.931 SETUP message with a User-User Information Element containing exactly 2 bytes of PER-encoded data ({0x08, 0x00}) to port 1720 through a firewall with the nf_conntrack_h323 helper active. The decoder fully consumes the PER buffer before reaching this code path, resulting in a 1-2 byte heap-buffer-overflow read confirmed by AddressSanitizer.
Fix this by checking for 2 bytes (the maximum that get_len() may read)
instead of the uninitialized len. This matches the pattern used at
every other get_len() call site in the same file, where the caller
checks for 2 bytes of available data before calling get_len().(CVE-2026-43233)
In the Linux kernel, the following vulnerability has been resolved:
mailbox: Prevent out-of-bounds access in fw_mbox_index_xlate()
Although it is guided that #mbox-cells must be at least 1, there are
many instances of #mbox-cells = <0>; in the device tree. If that is
the case and the corresponding mailbox controller does not provide
fw_xlate and of_xlatefunction pointers,fw_mbox_index_xlate()` will
be used by default and out-of-bounds accesses could occur due to lack of
bounds check in that function.(CVE-2026-43281)
In the Linux kernel, there is a double free vulnerability in the error handling path of cpufreq_dbs_governor_init() function. When kobject_init_and_add() fails, cpufreq_dbs_governor_init() calls kobject_put(&dbs_data->attr_set.kobj). The kobject release callback cpufreq_dbs_data_release() calls gov->exit(dbs_data) and kfree(dbs_data), but the current error path then calls gov->exit(dbs_data) and kfree(dbs_data) again, causing a double free. Keep the direct kfree(dbs_data) for the gov->init() failure path, but after kobject_init_and_add() has been called, let kobject_put() handle the cleanup through cpufreq_dbs_data_release().(CVE-2026-43328)
In the Linux kernel, the following vulnerability has been resolved:
lib/crypto: chacha: Zeroize permuted_state before it leaves scope
Since the ChaCha permutation is invertible, the local variable 'permuted_state' is sufficient to compute the original 'state', and thus the key, even after the permutation has been done.
While the kernel is quite inconsistent about zeroizing secrets on the stack (and some prominent userspace crypto libraries don't bother at all since it's not guaranteed to work anyway), the kernel does try to do it as a best practice, especially in cases involving the RNG.
Thus, explicitly zeroize 'permuted_state' before it goes out of scope.(CVE-2026-43336)
In the Linux kernel, the following vulnerability has been resolved:
usb: class: cdc-wdm: fix reordering issue in read code path
Quoting the bug report:
Due to compiler optimization or CPU out-of-order execution, the desc->length update can be reordered before the memmove. If this happens, wdm_read() can see the new length and call copy_to_user() on uninitialized memory. This also violates LKMM data race rules [1].
Fix it by using WRITE_ONCE and memory barriers.(CVE-2026-43427)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5e: Fix DMA FIFO desync on error CQE SQ recovery
In case of a TX error CQE, a recovery flow is triggered, mlx5e_reset_txqsq_cc_pc() resets dma_fifo_cc to 0 but not dma_fifo_pc, desyncing the DMA FIFO producer and consumer.
After recovery, the producer pushes new DMA entries at the old dma_fifo_pc, while the consumer reads from position 0. This causes us to unmap stale DMA addresses from before the recovery.
The DMA FIFO is a purely software construct with no HW counterpart. At the point of reset, all WQEs have been flushed so dma_fifo_cc is already equal to dma_fifo_pc. There is no need to reset either counter, similar to how skb_fifo pc/cc are untouched.
Remove the 'dma_fifo_cc = 0' reset.
This fixes the following WARNING: WARNING: CPU: 0 PID: 0 at drivers/iommu/dma-iommu.c:1240 iommu_dma_unmap_page+0x79/0x90 Modules linked in: mlx5_vdpa vringh vdpa bonding mlx5_ib mlx5_vfio_pci ipip mlx5_fwctl tunnel4 mlx5_core ib_ipoib geneve ip6_gre ip_gre gre nf_tables ip6_tunnel rdma_ucm ib_uverbs ib_umad vfio_pci vfio_pci_core act_mirred act_skbedit act_vlan vhost_net vhost tap ip6table_mangle ip6table_nat ip6table_filter ip6_tables iptable_mangle cls_matchall nfnetlink_cttimeout act_gact cls_flower sch_ingress vhost_iotlb iptable_raw tunnel6 vfio_iommu_type1 vfio openvswitch nsh rpcsec_gss_krb5 auth_rpcgss oid_registry xt_conntrack xt_MASQUERADE nf_conntrack_netlink nfnetlink iptable_nat nf_nat xt_addrtype br_netfilter overlay zram zsmalloc rpcrdma ib_iser libiscsi scsi_transport_iscsi rdma_cm iw_cm ib_cm ib_core fuse [last unloaded: nf_tables] CPU: 0 UID: 0 PID: 0 Comm: swapper/0 Not tainted 6.13.0-rc5_for_upstream_min_debug_2024_12_30_21_33 #1 Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.13.0-0-gf21b5a4aeb02-prebuilt.qemu.org 04/01/2014 RIP: 0010:iommu_dma_unmap_page+0x79/0x90 Code: 2b 4d 3b 21 72 26 4d 3b 61 08 73 20 49 89 d8 44 89 f9 5b 4c 89 f2 4c 89 e6 48 89 ef 5d 41 5c 41 5d 41 5e 41 5f e9 c7 ae 9e ff <0f> 0b 5b 5d 41 5c 41 5d 41 5e 41 5f c3 66 2e 0f 1f 84 00 00 00 00 Call Trace: <IRQ> ? __warn+0x7d/0x110 ? iommu_dma_unmap_page+0x79/0x90 ? report_bug+0x16d/0x180 ? handle_bug+0x4f/0x90 ? exc_invalid_op+0x14/0x70 ? asm_exc_invalid_op+0x16/0x20 ? iommu_dma_unmap_page+0x79/0x90 ? iommu_dma_unmap_page+0x2e/0x90 dma_unmap_page_attrs+0x10d/0x1b0 mlx5e_tx_wi_dma_unmap+0xbe/0x120 [mlx5_core] mlx5e_poll_tx_cq+0x16d/0x690 [mlx5_core] mlx5e_napi_poll+0x8b/0xac0 [mlx5_core] __napi_poll+0x24/0x190 net_rx_action+0x32a/0x3b0 ? mlx5_eq_comp_int+0x7e/0x270 [mlx5_core] ? notifier_call_chain+0x35/0xa0 handle_softirqs+0xc9/0x270 irq_exit_rcu+0x71/0xd0 common_interrupt+0x7f/0xa0 </IRQ> <TASK> asm_common_interrupt+0x22/0x40(CVE-2026-43466)
In the Linux kernel's openvswitch module, the vport netlink reply helpers allocate a fixed-size skb with nlmsg_new(NLMSG_DEFAULT_SIZE, ...) but serialize the full upcall PID array via ovs_vport_get_upcall_portids(). Since ovs_vport_set_upcall_portids() accepts any non-zero multiple of sizeof(u32) with no upper bound, a CAP_NET_ADMIN user can install a PID array large enough to overflow the reply buffer, causing nla_put() to fail with -EMSGSIZE and hitting BUG_ON(err < 0), leading to a kernel panic. On systems with unprivileged user namespaces enabled (e.g., Ubuntu default), this is reachable via unshare -Urn.(CVE-2026-45840)
In the Linux kernel, the following vulnerability has been resolved: drm/nouveau: fix u32 overflow in pushbuf reloc bounds check nouveau_gem_pushbuf_reloc_apply() validates each relocation with if (r->reloc_bo_offset + 4 > nvbo->bo.base.size) but reloc_bo_offset is __u32 (uapi/drm/nouveau_drm.h) and the integer literal 4 promotes to unsigned int, so the addition is performed in 32 bits and wraps before the comparison against the size_t bo size. Cast to u64 so the addition happens in 64-bit arithmetic. [ Add Fixes: tag. - Danilo ] The Linux kernel CVE team has assigned CVE-2026-46006 to this issue.(CVE-2026-46006)
In the Linux kernel, the following vulnerability has been resolved:
thermal: core: Fix thermal zone governor cleanup issues
If thermal_zone_device_register_with_trips() fails after adding a thermal governor to the thermal zone being registered, the governor is not removed from it as appropriate which may lead to a memory leak.
In turn, thermal_zone_device_unregister() calls thermal_set_governor() without acquiring the thermal zone lock beforehand which may race with a governor update via sysfs and may lead to a use-after-free in that case.
Address these issues by adding two thermal_set_governor() calls, one to thermal_release() to remove the governor from the given thermal zone, and one to the thermal zone registration error path to cover failures preceding the thermal zone device registration.(CVE-2026-46021)
In the Linux kernel, the following vulnerability has been resolved: dm mirror: fix integer overflow in create_dirty_log() The argument count calculation in create_dirty_log() performs *args_used = 2 + param_count before validating against argc. When a user provides a param_count close to UINT_MAX via the device mapper table string, this unsigned addition wraps around to a small value, causing the subsequent argc < *args_used check to be bypassed. The overflowed param_count is then passed as argc to dm_dirty_log_create(), where it can cause out-of-bounds reads on the argv array. Fix by comparing param_count against argc - 2 before performing the addition, following the same pattern used by parse_features() in the same file. Since argc >= 2 is already guaranteed, the subtraction is safe. The Linux kernel CVE team has assigned CVE-2026-46023 to this issue.(CVE-2026-46023)
In the Linux kernel, the following vulnerability has been resolved: crypto: authencesn - reject short ahash digests during instance creation authencesn requires either a zero authsize or an authsize of at least 4 bytes because the ESN encrypt/decrypt paths always move 4 bytes of high-order sequence number data at the end of the authenticated data. While crypto_authenc_esn_setauthsize() already rejects explicit non-zero authsizes in the range 1..3, crypto_authenc_esn_create() still copied auth->digestsize into inst->alg.maxauthsize without validating it. The AEAD core then initialized the tfm's default authsize from that value. As a result, selecting an ahash with digest size 1..3, such as cbcmac(cipher_null), exposed authencesn instances whose default authsize was invalid even though setauthsize() would have rejected the same value. AF_ALG could then trigger the ESN tail handling with a too-short tag and hit an out-of-bounds access. Reject authencesn instances whose ahash digest size is in the invalid non-zero range 1..3 so that no tfm can inherit an unsupported default authsize. The Linux kernel CVE team has assigned CVE-2026-46033 to this issue.(CVE-2026-46033)
In the Linux kernel, the following vulnerability has been resolved:
ceph: only d_add() negative dentries when they are unhashed
Ceph can call d_add(dentry, NULL) on a negative dentry that is already present in the primary dcache hash.
In the current VFS that is not safe. d_add() goes through __d_add() to __d_rehash(), which unconditionally reinserts dentry->d_hash into the hlist_bl bucket. If the dentry is already hashed, reinserting the same node can corrupt the bucket, including creating a self-loop. Once that happens, __d_lookup() can spin forever in the hlist_bl walk, typically looping only on the d_name.hash mismatch check and eventually triggering RCU stall reports like this one:
rcu: INFO: rcu_sched self-detected stall on CPU rcu: 87-....: (2100 ticks this GP) idle=3a4c/1/0x4000000000000000 softirq=25003319/25003319 fqs=829 rcu: (t=2101 jiffies g=79058445 q=698988 ncpus=192) CPU: 87 UID: 2952868916 PID: 3933303 Comm: php-cgi8.3 Not tainted 6.18.17-i1-amd #950 NONE Hardware name: Dell Inc. PowerEdge R7615/0G9DHV, BIOS 1.6.6 09/22/2023 RIP: 0010:__d_lookup+0x46/0xb0 Code: c1 e8 07 48 8d 04 c2 48 8b 00 49 89 fc 49 89 f5 48 89 c3 48 83 e3 fe 48 83 f8 01 77 0f eb 2d 0f 1f 44 00 00 48 8b 1b 48 85 db <74> 20 39 6b 18 75 f3 48 8d 7b 78 e8 ba 85 d0 00 4c 39 63 10 74 1f RSP: 0018:ff745a70c8253898 EFLAGS: 00000282 RAX: ff26e470054cb208 RBX: ff26e470054cb208 RCX: 000000006e958966 RDX: ff26e48267340000 RSI: ff745a70c82539b0 RDI: ff26e458f74655c0 RBP: 000000006e958966 R08: 0000000000000180 R09: 9cd08d909b919a89 R10: ff26e458f74655c0 R11: 0000000000000000 R12: ff26e458f74655c0 R13: ff745a70c82539b0 R14: d0d0d0d0d0d0d0d0 R15: 2f2f2f2f2f2f2f2f FS: 00007f5770896980(0000) GS:ff26e482c5d88000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007f5764de50c0 CR3: 000000a72abb5001 CR4: 0000000000771ef0 PKRU: 55555554 Call Trace: <TASK> lookup_fast+0x9f/0x100 walk_component+0x1f/0x150 link_path_walk+0x20e/0x3d0 path_lookupat+0x68/0x180 filename_lookup+0xdc/0x1e0 vfs_statx+0x6c/0x140 vfs_fstatat+0x67/0xa0 __do_sys_newfstatat+0x24/0x60 do_syscall_64+0x6a/0x230 entry_SYSCALL_64_after_hwframe+0x76/0x7e
This is reachable with reused cached negative dentries. A Ceph lookup or atomic_open can be handed a negative dentry that is already hashed, and fs/ceph/dir.c then hits one of two paths that incorrectly assume "negative" also means "unhashed":
-
ceph_finish_lookup(): MDS reply is -ENOENT with no trace -> d_add(dentry, NULL)
-
ceph_lookup(): local ENOENT fast path for a complete directory with shared caps -> d_add(dentry, NULL)
Both paths can therefore re-add an already-hashed negative dentry.
Ceph already uses the correct pattern elsewhere: ceph_fill_trace() only calls d_add(dn, NULL) for a negative null-dentry reply when d_unhashed(dn) is true.
Fix both fs/ceph/dir.c sites the same way: only call d_add() for a negative dentry when it is actually unhashed. If the negative dentry is already hashed, leave it in place and reuse it as-is.
This preserves the existing behavior for unhashed dentries while avoiding d_hash list corruption for reused hashed negatives.(CVE-2026-46052)
In the Linux kernel, the following vulnerability has been resolved: sctp: revalidate list cursor after sctp_sendmsg_to_asoc() in SCTP_SENDALL. The SCTP_SENDALL path in sctp_sendmsg() iterates ep->asocs with list_for_each_entry_safe(), which caches the next entry in @tmp before the loop body runs. The body calls sctp_sendmsg_to_asoc(), which may drop the socket lock inside sctp_wait_for_sndbuf(). While the lock is dropped, another thread can SCTP_SOCKOPT_PEELOFF the association cached in @tmp, migrating it to a new endpoint via sctp_sock_migrate() (list_del_init() + list_add_tail() to newep->asocs), and optionally close the new socket which frees the association via kfree_rcu(). The cached @tmp can also be freed by a network ABORT for that association, processed in softirq while the lock is dropped. sctp_wait_for_sndbuf() revalidates @asoc (the current entry) on re-lock via the "sk != asoc->base.sk" and "asoc->base.dead" checks, but nothing revalidates @tmp. After a successful return, the iterator advances to the stale @tmp, yielding either a use-after-free (if the peeled socket was closed) or a list-walk onto the new endpoint's list head (type confusion of &newep->asocs as a struct sctp_association *). Both are reachable from CapEff=0; the type-confusion path gives controlled indirect call via the outqueue.sched->init_sid pointer. Fix by re-deriving @tmp from @asoc after sctp_sendmsg_to_asoc() returns. @asoc is known to still be on ep->asocs at that point: the only callers that list_del an association from ep->asocs are sctp_association_free() (which sets asoc->base.dead) and sctp_assoc_migrate() (which changes asoc->base.sk), and sctp_wait_for_sndbuf() checks both under the lock before any successful return; a tripped check propagates as err < 0 and the loop bails before the re-derive. The SCTP_ABORT path in sctp_sendmsg_check_sflags() returns 0 and the loop hits 'continue' before sctp_sendmsg_to_asoc() is ever called, so the @tmp cached by list_for_each_entry_safe() still covers the lock-held free that ba59fb027307 ("sctp: walk the list of asocs safely") was added for.(CVE-2026-46227)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"perf-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2606.1.0.0375.oe2003sp4.src.rpm"
],
"x86_64": [
"bpftool-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"perf-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2606.1.0.0375.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbcache: fix NULL pointer in cache_set_flush()\n\n1. LINE#1794 - LINE#1887 is some codes about function of\n bch_cache_set_alloc().\n2. LINE#2078 - LINE#2142 is some codes about function of\n register_cache_set().\n3. register_cache_set() will call bch_cache_set_alloc() in LINE#2098.\n\n 1794 struct cache_set *bch_cache_set_alloc(struct cache_sb *sb)\n 1795 {\n ...\n 1860 if (!(c-\u0026gt;devices = kcalloc(c-\u0026gt;nr_uuids, sizeof(void *), GFP_KERNEL)) ||\n 1861 mempool_init_slab_pool(\u0026amp;c-\u0026gt;search, 32, bch_search_cache) ||\n 1862 mempool_init_kmalloc_pool(\u0026amp;c-\u0026gt;bio_meta, 2,\n 1863 sizeof(struct bbio) + sizeof(struct bio_vec) *\n 1864 bucket_pages(c)) ||\n 1865 mempool_init_kmalloc_pool(\u0026amp;c-\u0026gt;fill_iter, 1, iter_size) ||\n 1866 bioset_init(\u0026amp;c-\u0026gt;bio_split, 4, offsetof(struct bbio, bio),\n 1867 BIOSET_NEED_BVECS|BIOSET_NEED_RESCUER) ||\n 1868 !(c-\u0026gt;uuids = alloc_bucket_pages(GFP_KERNEL, c)) ||\n 1869 !(c-\u0026gt;moving_gc_wq = alloc_workqueue(\u0026quot;bcache_gc\u0026quot;,\n 1870 WQ_MEM_RECLAIM, 0)) ||\n 1871 bch_journal_alloc(c) ||\n 1872 bch_btree_cache_alloc(c) ||\n 1873 bch_open_buckets_alloc(c) ||\n 1874 bch_bset_sort_state_init(\u0026amp;c-\u0026gt;sort, ilog2(c-\u0026gt;btree_pages)))\n 1875 goto err;\n ^^^^^^^^\n 1876\n ...\n 1883 return c;\n 1884 err:\n 1885 bch_cache_set_unregister(c);\n ^^^^^^^^^^^^^^^^^^^^^^^^^^^\n 1886 return NULL;\n 1887 }\n ...\n 2078 static const char *register_cache_set(struct cache *ca)\n 2079 {\n ...\n 2098 c = bch_cache_set_alloc(\u0026amp;ca-\u0026gt;sb);\n 2099 if (!c)\n 2100 return err;\n ^^^^^^^^^^\n ...\n 2128 ca-\u0026gt;set = c;\n 2129 ca-\u0026gt;set-\u0026gt;cache[ca-\u0026gt;sb.nr_this_dev] = ca;\n ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^\n ...\n 2138 return NULL;\n 2139 err:\n 2140 bch_cache_set_unregister(c);\n 2141 return err;\n 2142 }\n\n(1) If LINE#1860 - LINE#1874 is true, then do \u0026apos;goto err\u0026apos;(LINE#1875) and\n call bch_cache_set_unregister()(LINE#1885).\n(2) As (1) return NULL(LINE#1886), LINE#2098 - LINE#2100 would return.\n(3) As (2) has returned, LINE#2128 - LINE#2129 would do *not* give the\n value to c-\u0026gt;cache[], it means that c-\u0026gt;cache[] is NULL.\n\nLINE#1624 - LINE#1665 is some codes about function of cache_set_flush().\nAs (1), in LINE#1885 call\nbch_cache_set_unregister()\n---\u0026gt; bch_cache_set_stop()\n ---\u0026gt; closure_queue()\n -.-\u0026gt; cache_set_flush() (as below LINE#1624)\n\n 1624 static void cache_set_flush(struct closure *cl)\n 1625 {\n ...\n 1654 for_each_cache(ca, c, i)\n 1655 if (ca-\u0026gt;alloc_thread)\n ^^\n 1656 kthread_stop(ca-\u0026gt;alloc_thread);\n ...\n 1665 }\n\n(4) In LINE#1655 ca is NULL(see (3)) in cache_set_flush() then the\n kernel crash occurred as below:\n[ 846.712887] bcache: register_cache() error drbd6: cannot allocate memory\n[ 846.713242] bcache: register_bcache() error : failed to register device\n[ 846.713336] bcache: cache_set_free() Cache set 2f84bdc1-498a-4f2f-98a7-01946bf54287 unregistered\n[ 846.713768] BUG: unable to handle kernel NULL pointer dereference at 00000000000009f8\n[ 846.714790] PGD 0 P4D 0\n[ 846.715129] Oops: 0000 [#1] SMP PTI\n[ 846.715472] CPU: 19 PID: 5057 Comm: kworker/19:16 Kdump: loaded Tainted: G OE --------- - - 4.18.0-147.5.1.el8_1.5es.3.x86_64 #1\n[ 846.716082] Hardware name: ESPAN GI-25212/X11DPL-i, BIOS 2.1 06/15/2018\n[ 846.716451] Workqueue: events cache_set_flush [bcache]\n[ 846.716808] RIP: 0010:cache_set_flush+0xc9/0x1b0 [bcache]\n[ 846.717155] Code: 00 4c 89 a5 b0 03 00 00 48 8b 85 68 f6 ff ff a8 08 0f 84 88 00 00 00 31 db 66 83 bd 3c f7 ff ff 00 48 8b 85 48 ff ff ff 74 28 \u0026lt;48\u0026gt; 8b b8 f8 09 00 0\n---truncated---(CVE-2025-38263)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nvsock/vmci: Clear the vmci transport packet properly when initializing it\n\nIn vmci_transport_packet_init memset the vmci_transport_packet before\npopulating the fields to avoid any uninitialised data being left in the\nstructure.(CVE-2025-38403)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\natm: clip: Fix infinite recursive call of clip_push().\n\nsyzbot reported the splat below. [0]\n\nThis happens if we call ioctl(ATMARP_MKIP) more than once.\n\nDuring the first call, clip_mkip() sets clip_push() to vcc-\u0026gt;push(),\nand the second call copies it to clip_vcc-\u0026gt;old_push().\n\nLater, when the socket is close()d, vcc_destroy_socket() passes\nNULL skb to clip_push(), which calls clip_vcc-\u0026gt;old_push(),\ntriggering the infinite recursion.\n\nLet\u0026apos;s prevent the second ioctl(ATMARP_MKIP) by checking\nvcc-\u0026gt;user_back, which is allocated by the first call as clip_vcc.\n\nNote also that we use lock_sock() to prevent racy calls.\n\n[0]:\nBUG: TASK stack guard page was hit at ffffc9000d66fff8 (stack is ffffc9000d670000..ffffc9000d678000)\nOops: stack guard page: 0000 [#1] SMP KASAN NOPTI\nCPU: 0 UID: 0 PID: 5322 Comm: syz.0.0 Not tainted 6.16.0-rc4-syzkaller #0 PREEMPT(full)\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-debian-1.16.3-2~bpo12+1 04/01/2014\nRIP: 0010:clip_push+0x5/0x720 net/atm/clip.c:191\nCode: e0 8f aa 8c e8 1c ad 5b fa eb ae 66 2e 0f 1f 84 00 00 00 00 00 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 f3 0f 1e fa 55 \u0026lt;41\u0026gt; 57 41 56 41 55 41 54 53 48 83 ec 20 48 89 f3 49 89 fd 48 bd 00\nRSP: 0018:ffffc9000d670000 EFLAGS: 00010246\nRAX: 1ffff1100235a4a5 RBX: ffff888011ad2508 RCX: ffff8880003c0000\nRDX: 0000000000000000 RSI: 0000000000000000 RDI: ffff888037f01000\nRBP: dffffc0000000000 R08: ffffffff8fa104f7 R09: 1ffffffff1f4209e\nR10: dffffc0000000000 R11: ffffffff8a99b300 R12: ffffffff8a99b300\nR13: ffff888037f01000 R14: ffff888011ad2500 R15: ffff888037f01578\nFS: 000055557ab6d500(0000) GS:ffff88808d250000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: ffffc9000d66fff8 CR3: 0000000043172000 CR4: 0000000000352ef0\nCall Trace:\n \u0026lt;TASK\u0026gt;\n clip_push+0x6dc/0x720 net/atm/clip.c:200\n clip_push+0x6dc/0x720 net/atm/clip.c:200\n clip_push+0x6dc/0x720 net/atm/clip.c:200\n...\n clip_push+0x6dc/0x720 net/atm/clip.c:200\n clip_push+0x6dc/0x720 net/atm/clip.c:200\n clip_push+0x6dc/0x720 net/atm/clip.c:200\n vcc_destroy_socket net/atm/common.c:183 [inline]\n vcc_release+0x157/0x460 net/atm/common.c:205\n __sock_release net/socket.c:647 [inline]\n sock_close+0xc0/0x240 net/socket.c:1391\n __fput+0x449/0xa70 fs/file_table.c:465\n task_work_run+0x1d1/0x260 kernel/task_work.c:227\n resume_user_mode_work include/linux/resume_user_mode.h:50 [inline]\n exit_to_user_mode_loop+0xec/0x110 kernel/entry/common.c:114\n exit_to_user_mode_prepare include/linux/entry-common.h:330 [inline]\n syscall_exit_to_user_mode_work include/linux/entry-common.h:414 [inline]\n syscall_exit_to_user_mode include/linux/entry-common.h:449 [inline]\n do_syscall_64+0x2bd/0x3b0 arch/x86/entry/syscall_64.c:100\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\nRIP: 0033:0x7ff31c98e929\nCode: ff ff c3 66 2e 0f 1f 84 00 00 00 00 00 0f 1f 40 00 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 c7 c1 a8 ff ff ff f7 d8 64 89 01 48\nRSP: 002b:00007fffb5aa1f78 EFLAGS: 00000246 ORIG_RAX: 00000000000001b4\nRAX: 0000000000000000 RBX: 0000000000012747 RCX: 00007ff31c98e929\nRDX: 0000000000000000 RSI: 000000000000001e RDI: 0000000000000003\nRBP: 00007ff31cbb7ba0 R08: 0000000000000001 R09: 0000000db5aa226f\nR10: 00007ff31c7ff030 R11: 0000000000000246 R12: 00007ff31cbb608c\nR13: 00007ff31cbb6080 R14: ffffffffffffffff R15: 00007fffb5aa2090\n \u0026lt;/TASK\u0026gt;\nModules linked in:(CVE-2025-38459)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niwlwifi: Add missing check for alloc_ordered_workqueue\n\nAdd check for the return value of alloc_ordered_workqueue since it may\nreturn NULL pointer.(CVE-2025-38602)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: mac80211: reject TDLS operations when station is not associated\n\nsyzbot triggered a WARN in ieee80211_tdls_oper() by sending\nNL80211_TDLS_ENABLE_LINK immediately after NL80211_CMD_CONNECT,\nbefore association completed and without prior TDLS setup.\n\nThis left internal state like sdata-\u0026gt;u.mgd.tdls_peer uninitialized,\nleading to a WARN_ON() in code paths that assumed it was valid.\n\nReject the operation early if not in station mode or not associated.(CVE-2025-38644)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbtrfs: do not allow relocation of partially dropped subvolumes\n\n[BUG]\nThere is an internal report that balance triggered transaction abort,\nwith the following call trace:\n\n item 85 key (594509824 169 0) itemoff 12599 itemsize 33\n extent refs 1 gen 197740 flags 2\n ref#0: tree block backref root 7\n item 86 key (594558976 169 0) itemoff 12566 itemsize 33\n extent refs 1 gen 197522 flags 2\n ref#0: tree block backref root 7\n ...\n BTRFS error (device loop0): extent item not found for insert, bytenr 594526208 num_bytes 16384 parent 449921024 root_objectid 934 owner 1 offset 0\n BTRFS error (device loop0): failed to run delayed ref for logical 594526208 num_bytes 16384 type 182 action 1 ref_mod 1: -117\n ------------[ cut here ]------------\n BTRFS: Transaction aborted (error -117)\n WARNING: CPU: 1 PID: 6963 at ../fs/btrfs/extent-tree.c:2168 btrfs_run_delayed_refs+0xfa/0x110 [btrfs]\n\nAnd btrfs check doesn\u0026apos;t report anything wrong related to the extent\ntree.\n\n[CAUSE]\nThe cause is a little complex, firstly the extent tree indeed doesn\u0026apos;t\nhave the backref for 594526208.\n\nThe extent tree only have the following two backrefs around that bytenr\non-disk:\n\n item 65 key (594509824 METADATA_ITEM 0) itemoff 13880 itemsize 33\n refs 1 gen 197740 flags TREE_BLOCK\n tree block skinny level 0\n (176 0x7) tree block backref root CSUM_TREE\n item 66 key (594558976 METADATA_ITEM 0) itemoff 13847 itemsize 33\n refs 1 gen 197522 flags TREE_BLOCK\n tree block skinny level 0\n (176 0x7) tree block backref root CSUM_TREE\n\nBut the such missing backref item is not an corruption on disk, as the\noffending delayed ref belongs to subvolume 934, and that subvolume is\nbeing dropped:\n\n item 0 key (934 ROOT_ITEM 198229) itemoff 15844 itemsize 439\n generation 198229 root_dirid 256 bytenr 10741039104 byte_limit 0 bytes_used 345571328\n last_snapshot 198229 flags 0x1000000000001(RDONLY) refs 0\n drop_progress key (206324 EXTENT_DATA 2711650304) drop_level 2\n level 2 generation_v2 198229\n\nAnd that offending tree block 594526208 is inside the dropped range of\nthat subvolume. That explains why there is no backref item for that\nbytenr and why btrfs check is not reporting anything wrong.\n\nBut this also shows another problem, as btrfs will do all the orphan\nsubvolume cleanup at a read-write mount.\n\nSo half-dropped subvolume should not exist after an RW mount, and\nbalance itself is also exclusive to subvolume cleanup, meaning we\nshouldn\u0026apos;t hit a subvolume half-dropped during relocation.\n\nThe root cause is, there is no orphan item for this subvolume.\nIn fact there are 5 subvolumes from around 2021 that have the same\nproblem.\n\nIt looks like the original report has some older kernels running, and\ncaused those zombie subvolumes.\n\nThankfully upstream commit 8d488a8c7ba2 (\u0026quot;btrfs: fix subvolume/snapshot\ndeletion not triggered on mount\u0026quot;) has long fixed the bug.\n\n[ENHANCEMENT]\nFor repairing such old fs, btrfs-progs will be enhanced.\n\nConsidering how delayed the problem will show up (at run delayed ref\ntime) and at that time we have to abort transaction already, it is too\nlate.\n\nInstead here we reject any half-dropped subvolume for reloc tree at the\nearliest time, preventing confusion and extra time wasted on debugging\nsimilar bugs.(CVE-2025-39738)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncan: peak_usb: fix shift-out-of-bounds issue\n\nExplicitly uses a 64-bit constant when the number of bits used for its\nshifting is 32 (which is the case for PC CAN FD interfaces supported by\nthis driver).\n\n[mkl: update subject, apply manually](CVE-2025-40020)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nteam: Move team device type change at the end of team_port_add\n\nAttempting to add a port device that is already up will expectedly fail,\nbut not before modifying the team device header_ops.\n\nIn the case of the syzbot reproducer the gre0 device is\nalready in state UP when it attempts to add it as a\nport device of team0, this fails but before that\nheader_ops-\u0026gt;create of team0 is changed from eth_header to ipgre_header\nin the call to team_dev_type_check_change.\n\nLater when we end up in ipgre_header() struct ip_tunnel* points to nonsense\nas the private data of the device still holds a struct team.\n\nExample sequence of iproute2 commands to reproduce the hang/BUG():\nip link add dev team0 type team\nip link add dev gre0 type gre\nip link set dev gre0 up\nip link set dev gre0 master team0\nip link set dev team0 up\nping -I team0 1.1.1.1\n\nMove team_dev_type_check_change down where all other checks have passed\nas it changes the dev type with no way to restore it in case\none of the checks that follow it fail.\n\nAlso make sure to preserve the origial mtu assignment:\n - If port_dev is not the same type as dev, dev takes mtu from port_dev\n - If port_dev is the same type as dev, port_dev takes mtu from dev\n\nThis is done by adding a conditional before the call to dev_set_mtu\nto prevent it from assigning port_dev-\u0026gt;mtu = dev-\u0026gt;mtu and instead\nletting team_dev_type_check_change assign dev-\u0026gt;mtu = port_dev-\u0026gt;mtu.\nThe conditional is needed because the patch moves the call to\nteam_dev_type_check_change past dev_set_mtu.\n\nTesting:\n - team device driver in-tree selftests\n - Add/remove various devices as slaves of team device\n - syzbot(CVE-2025-68340)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/umad: Reject negative data_len in ib_umad_write\n\nib_umad_write computes data_len from user-controlled count and the\nMAD header sizes. With a mismatched user MAD header size and RMPP\nheader length, data_len can become negative and reach ib_create_send_mad().\nThis can make the padding calculation exceed the segment size and trigger\nan out-of-bounds memset in alloc_send_rmpp_list().\n\nAdd an explicit check to reject negative data_len before creating the\nsend buffer.\n\nKASAN splat:\n[ 211.363464] BUG: KASAN: slab-out-of-bounds in ib_create_send_mad+0xa01/0x11b0\n[ 211.364077] Write of size 220 at addr ffff88800c3fa1f8 by task spray_thread/102\n[ 211.365867] ib_create_send_mad+0xa01/0x11b0\n[ 211.365887] ib_umad_write+0x853/0x1c80(CVE-2026-23243)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmacvlan: observe an RCU grace period in macvlan_common_newlink() error path\n\nvalis reported that a race condition still happens after my prior patch.\n\nmacvlan_common_newlink() might have made @dev visible before\ndetecting an error, and its caller will directly call free_netdev(dev).\n\nWe must respect an RCU period, either in macvlan or the core networking\nstack.\n\nAfter adding a temporary mdelay(1000) in macvlan_forward_source_one()\nto open the race window, valis repro was:\n\nip link add p1 type veth peer p2\nip link set address 00:00:00:00:00:20 dev p1\nip link set up dev p1\nip link set up dev p2\nip link add mv0 link p2 type macvlan mode source\n\n(ip link add invalid% link p2 type macvlan mode source macaddr add\n00:00:00:00:00:20 \u0026amp;) ; sleep 0.5 ; ping -c1 -I p1 1.2.3.4\nPING 1.2.3.4 (1.2.3.4): 56 data bytes\nRTNETLINK answers: Invalid argument\n\nBUG: KASAN: slab-use-after-free in macvlan_forward_source\n(drivers/net/macvlan.c:408 drivers/net/macvlan.c:444)\nRead of size 8 at addr ffff888016bb89c0 by task e/175\n\nCPU: 1 UID: 1000 PID: 175 Comm: e Not tainted 6.19.0-rc8+ #33 NONE\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.14.0-2 04/01/2014\nCall Trace:\n\u0026lt;IRQ\u0026gt;\ndump_stack_lvl (lib/dump_stack.c:123)\nprint_report (mm/kasan/report.c:379 mm/kasan/report.c:482)\n? macvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444)\nkasan_report (mm/kasan/report.c:597)\n? macvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444)\nmacvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444)\n? tasklet_init (kernel/softirq.c:983)\nmacvlan_handle_frame (drivers/net/macvlan.c:501)\n\nAllocated by task 169:\nkasan_save_stack (mm/kasan/common.c:58)\nkasan_save_track (./arch/x86/include/asm/current.h:25\nmm/kasan/common.c:70 mm/kasan/common.c:79)\n__kasan_kmalloc (mm/kasan/common.c:419)\n__kvmalloc_node_noprof (./include/linux/kasan.h:263 mm/slub.c:5657\nmm/slub.c:7140)\nalloc_netdev_mqs (net/core/dev.c:12012)\nrtnl_create_link (net/core/rtnetlink.c:3648)\nrtnl_newlink (net/core/rtnetlink.c:3830 net/core/rtnetlink.c:3957\nnet/core/rtnetlink.c:4072)\nrtnetlink_rcv_msg (net/core/rtnetlink.c:6958)\nnetlink_rcv_skb (net/netlink/af_netlink.c:2550)\nnetlink_unicast (net/netlink/af_netlink.c:1319 net/netlink/af_netlink.c:1344)\nnetlink_sendmsg (net/netlink/af_netlink.c:1894)\n__sys_sendto (net/socket.c:727 net/socket.c:742 net/socket.c:2206)\n__x64_sys_sendto (net/socket.c:2209)\ndo_syscall_64 (arch/x86/entry/syscall_64.c:63 arch/x86/entry/syscall_64.c:94)\nentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:131)\n\nFreed by task 169:\nkasan_save_stack (mm/kasan/common.c:58)\nkasan_save_track (./arch/x86/include/asm/current.h:25\nmm/kasan/common.c:70 mm/kasan/common.c:79)\nkasan_save_free_info (mm/kasan/generic.c:587)\n__kasan_slab_free (mm/kasan/common.c:287)\nkfree (mm/slub.c:6674 mm/slub.c:6882)\nrtnl_newlink (net/core/rtnetlink.c:3845 net/core/rtnetlink.c:3957\nnet/core/rtnetlink.c:4072)\nrtnetlink_rcv_msg (net/core/rtnetlink.c:6958)\nnetlink_rcv_skb (net/netlink/af_netlink.c:2550)\nnetlink_unicast (net/netlink/af_netlink.c:1319 net/netlink/af_netlink.c:1344)\nnetlink_sendmsg (net/netlink/af_netlink.c:1894)\n__sys_sendto (net/socket.c:727 net/socket.c:742 net/socket.c:2206)\n__x64_sys_sendto (net/socket.c:2209)\ndo_syscall_64 (arch/x86/entry/syscall_64.c:63 arch/x86/entry/syscall_64.c:94)\nentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:131)(CVE-2026-23273)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmm: blk-cgroup: fix use-after-free in cgwb_release_workfn()\n\ncgwb_release_workfn() calls css_put(wb-\u0026gt;blkcg_css) and then later accesses\nwb-\u0026gt;blkcg_css again via blkcg_unpin_online(). If css_put() drops the last\nreference, the blkcg can be freed asynchronously (css_free_rwork_fn -\u0026gt;\nblkcg_css_free -\u0026gt; kfree) before blkcg_unpin_online() dereferences the\npointer to access blkcg-\u0026gt;online_pin, resulting in a use-after-free:\n\n BUG: KASAN: slab-use-after-free in blkcg_unpin_online (./include/linux/instrumented.h:112 ./include/linux/atomic/atomic-instrumented.h:400 ./include/linux/refcount.h:389 ./include/linux/refcount.h:432 ./include/linux/refcount.h:450 block/blk-cgroup.c:1367)\n Write of size 4 at addr ff11000117aa6160 by task kworker/71:1/531\n Workqueue: cgwb_release cgwb_release_workfn\n Call Trace:\n \u0026lt;TASK\u0026gt;\n blkcg_unpin_online (./include/linux/instrumented.h:112 ./include/linux/atomic/atomic-instrumented.h:400 ./include/linux/refcount.h:389 ./include/linux/refcount.h:432 ./include/linux/refcount.h:450 block/blk-cgroup.c:1367)\n cgwb_release_workfn (mm/backing-dev.c:629)\n process_scheduled_works (kernel/workqueue.c:3278 kernel/workqueue.c:3385)\n\n Freed by task 1016:\n kfree (./include/linux/kasan.h:235 mm/slub.c:2689 mm/slub.c:6246 mm/slub.c:6561)\n css_free_rwork_fn (kernel/cgroup/cgroup.c:5542)\n process_scheduled_works (kernel/workqueue.c:3302 kernel/workqueue.c:3385)\n\n** Stack based on commit 66672af7a095 (\u0026quot;Add linux-next specific files\nfor 20260410\u0026quot;)\n\nI am seeing this crash sporadically in Meta fleet across multiple kernel\nversions. A full reproducer is available at:\nhttps://github.com/leitao/debug/blob/main/reproducers/repro_blkcg_uaf.sh\n\n(The race window is narrow. To make it easily reproducible, inject a\nmsleep(100) between css_put() and blkcg_unpin_online() in\ncgwb_release_workfn(). With that delay and a KASAN-enabled kernel, the\nreproducer triggers the splat reliably in less than a second.)\n\nFix this by moving blkcg_unpin_online() before css_put(), so the\ncgwb\u0026apos;s CSS reference keeps the blkcg alive while blkcg_unpin_online()\naccesses it.(CVE-2026-31586)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nKVM: x86: Use scratch field in MMIO fragment to hold small write values\n\nWhen exiting to userspace to service an emulated MMIO write, copy the\nto-be-written value to a scratch field in the MMIO fragment if the size\nof the data payload is 8 bytes or less, i.e. can fit in a single chunk,\ninstead of pointing the fragment directly at the source value.\n\nThis fixes a class of use-after-free bugs that occur when the emulator\ninitiates a write using an on-stack, local variable as the source, the\nwrite splits a page boundary, *and* both pages are MMIO pages. Because\nKVM\u0026apos;s ABI only allows for physically contiguous MMIO requests, accesses\nthat split MMIO pages are separated into two fragments, and are sent to\nuserspace one at a time. When KVM attempts to complete userspace MMIO in\nresponse to KVM_RUN after the first fragment, KVM will detect the second\nfragment and generate a second userspace exit, and reference the on-stack\nvariable.\n\nThe issue is most visible if the second KVM_RUN is performed by a separate\ntask, in which case the stack of the initiating task can show up as truly\nfreed data.\n\n ==================================================================\n BUG: KASAN: use-after-free in complete_emulated_mmio+0x305/0x420\n Read of size 1 at addr ffff888009c378d1 by task syz-executor417/984\n\n CPU: 1 PID: 984 Comm: syz-executor417 Not tainted 5.10.0-182.0.0.95.h2627.eulerosv2r13.x86_64 #3\n Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.15.0-0-g2dd4b9b3f840-prebuilt.qemu.org 04/01/2014 Call Trace:\n dump_stack+0xbe/0xfd\n print_address_description.constprop.0+0x19/0x170\n __kasan_report.cold+0x6c/0x84\n kasan_report+0x3a/0x50\n check_memory_region+0xfd/0x1f0\n memcpy+0x20/0x60\n complete_emulated_mmio+0x305/0x420\n kvm_arch_vcpu_ioctl_run+0x63f/0x6d0\n kvm_vcpu_ioctl+0x413/0xb20\n __se_sys_ioctl+0x111/0x160\n do_syscall_64+0x30/0x40\n entry_SYSCALL_64_after_hwframe+0x67/0xd1\n RIP: 0033:0x42477d\n Code: \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48\n RSP: 002b:00007faa8e6890e8 EFLAGS: 00000246 ORIG_RAX: 0000000000000010\n RAX: ffffffffffffffda RBX: 00000000004d7338 RCX: 000000000042477d\n RDX: 0000000000000000 RSI: 000000000000ae80 RDI: 0000000000000005\n RBP: 00000000004d7330 R08: 00007fff28d546df R09: 0000000000000000\n R10: 0000000000000000 R11: 0000000000000246 R12: 00000000004d733c\n R13: 0000000000000000 R14: 000000000040a200 R15: 00007fff28d54720\n\n The buggy address belongs to the page:\n page:0000000029f6a428 refcount:0 mapcount:0 mapping:0000000000000000 index:0x0 pfn:0x9c37\n flags: 0xfffffc0000000(node=0|zone=1|lastcpupid=0x1fffff)\n raw: 000fffffc0000000 0000000000000000 ffffea0000270dc8 0000000000000000\n raw: 0000000000000000 0000000000000000 00000000ffffffff 0000000000000000 page dumped because: kasan: bad access detected\n\n Memory state around the buggy address:\n ffff888009c37780: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff\n ffff888009c37800: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff\n \u0026gt;ffff888009c37880: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff\n ^\n ffff888009c37900: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff\n ffff888009c37980: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff\n ==================================================================\n\nThe bug can also be reproduced with a targeted KVM-Unit-Test by hacking\nKVM to fill a large on-stack variable in complete_emulated_mmio(), i.e. by\noverwrite the data value with garbage.\n\nLimit the use of the scratch fields to 8-byte or smaller accesses, and to\njust writes, as larger accesses and reads are not affected thanks to\nimplementation details in the emulator, but add a sanity check to ensure\nthose details don\u0026apos;t change in the future. Specifically, KVM never uses\non-stack variables for accesses larger that 8 bytes, e.g. uses an operand\nin the emulator context, and *al\n---truncated---(CVE-2026-31588)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nopenvswitch: defer tunnel netdev_put to RCU release\n\novs_netdev_tunnel_destroy() may run after NETDEV_UNREGISTER already\ndetached the device. Dropping the netdev reference in destroy can race\nwith concurrent readers that still observe vport-\u0026gt;dev.\n\nDo not release vport-\u0026gt;dev in ovs_netdev_tunnel_destroy(). Instead, let\nvport_netdev_free() drop the reference from the RCU callback, matching\nthe non-tunnel destroy path and avoiding additional synchronization\nunder RTNL.(CVE-2026-31678)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: ulpi: fix double free in ulpi_register_interface() error path\n\nWhen device_register() fails, ulpi_register() calls put_device() on\nulpi-\u0026gt;dev.\n\nThe device release callback ulpi_dev_release() drops the OF node\nreference and frees ulpi, but the current error path in\nulpi_register_interface() then calls kfree(ulpi) again, causing a\ndouble free.\n\nLet put_device() handle the cleanup through ulpi_dev_release() and\navoid freeing ulpi again in ulpi_register_interface().(CVE-2026-31759)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrm/ioc32: stop speculation on the drm_compat_ioctl path\n\nThe drm compat ioctl path takes a user controlled pointer, and then\ndereferences it into a table of function pointers, the signature method\nof spectre problems. Fix this up by calling array_index_nospec() on the\nindex to the function pointer list.(CVE-2026-31781)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nip6_tunnel: clear skb2-\u0026gt;cb[] in ip4ip6_err()\n\nOskar Kjos reported the following problem.\n\nip4ip6_err() calls icmp_send() on a cloned skb whose cb[] was written\nby the IPv6 receive path as struct inet6_skb_parm. icmp_send() passes\nIPCB(skb2) to __ip_options_echo(), which interprets that cb[] region\nas struct inet_skb_parm (IPv4). The layouts differ: inet6_skb_parm.nhoff\nat offset 14 overlaps inet_skb_parm.opt.rr, producing a non-zero rr\nvalue. __ip_options_echo() then reads optlen from attacker-controlled\npacket data at sptr[rr+1] and copies that many bytes into dopt-\u0026gt;__data,\na fixed 40-byte stack buffer (IP_OPTIONS_DATA_FIXED_SIZE).\n\nTo fix this we clear skb2-\u0026gt;cb[], as suggested by Oskar Kjos.\n\nAlso add minimal IPv4 header validation (version == 4, ihl \u0026gt;= 5).(CVE-2026-43037)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipv6: icmp: clear skb2-\u0026gt;cb[] in ip6_err_gen_icmpv6_unreach()\n\nSashiko AI-review observed:\n\n In ip6_err_gen_icmpv6_unreach(), the skb is an outer IPv4 ICMP error packet\n where its cb contains an IPv4 inet_skb_parm. When skb is cloned into skb2\n and passed to icmp6_send(), it uses IP6CB(skb2).\n\n IP6CB interprets the IPv4 inet_skb_parm as an inet6_skb_parm. The cipso\n offset in inet_skb_parm.opt directly overlaps with dsthao in inet6_skb_parm\n at offset 18.\n\n If an attacker sends a forged ICMPv4 error with a CIPSO IP option, dsthao\n would be a non-zero offset. Inside icmp6_send(), mip6_addr_swap() is called\n and uses ipv6_find_tlv(skb, opt-\u0026gt;dsthao, IPV6_TLV_HAO).\n\n This would scan the inner, attacker-controlled IPv6 packet starting at that\n offset, potentially returning a fake TLV without checking if the remaining\n packet length can hold the full 18-byte struct ipv6_destopt_hao.\n\n Could mip6_addr_swap() then perform a 16-byte swap that extends past the end\n of the packet data into skb_shared_info?\n\n Should the cb array also be cleared in ip6_err_gen_icmpv6_unreach() and\n ip6ip6_err() to prevent this?\n\nThis patch implements the first suggestion.\n\nI am not sure if ip6ip6_err() needs to be changed.\nA separate patch would be better anyway.(CVE-2026-43038)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm6: fix uninitialized saddr in xfrm6_get_saddr()\n\nxfrm6_get_saddr() does not check the return value of\nipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable\nsource address (returns -EADDRNOTAVAIL), saddr-\u0026gt;in6 is left\nuninitialized, but xfrm6_get_saddr() still returns 0 (success).\n\nThis causes the caller xfrm_tmpl_resolve_one() to use the uninitialized\naddress in xfrm_state_find(), triggering KMSAN warning:\n\n=====================================================\nBUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940\n xfrm_state_find+0x2424/0xa940\n xfrm_resolve_and_create_bundle+0x906/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n xfrm_lookup_route+0x63/0x2b0\n ip_route_output_flow+0x1ce/0x270\n udp_sendmsg+0x2ce1/0x3400\n inet_sendmsg+0x1ef/0x2a0\n __sock_sendmsg+0x278/0x3d0\n __sys_sendto+0x593/0x720\n __x64_sys_sendto+0x130/0x200\n x64_sys_call+0x332b/0x3e70\n do_syscall_64+0xd3/0xf80\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\n\nLocal variable tmp.i.i created at:\n xfrm_resolve_and_create_bundle+0x3e3/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n=====================================================\n\nFix by checking the return value of ipv6_dev_get_saddr() and propagating\nthe error.(CVE-2026-43139)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfs: fix freemap adjustments when adding xattrs to leaf blocks\n\nxfs/592 and xfs/794 both trip this assertion in the leaf block freemap\nadjustment code after ~20 minutes of running on my test VMs:\n\n ASSERT(ichdr-\u0026gt;firstused \u0026gt;= ichdr-\u0026gt;count * sizeof(xfs_attr_leaf_entry_t)\n\t\t\t\t\t+ xfs_attr3_leaf_hdr_size(leaf));\n\nUpon enabling quite a lot more debugging code, I narrowed this down to\nfsstress trying to set a local extended attribute with namelen=3 and\nvaluelen=71. This results in an entry size of 80 bytes.\n\nAt the start of xfs_attr3_leaf_add_work, the freemap looks like this:\n\ni 0 base 448 size 0 rhs 448 count 46\ni 1 base 388 size 132 rhs 448 count 46\ni 2 base 2120 size 4 rhs 448 count 46\nfirstused = 520\n\nwhere \u0026quot;rhs\u0026quot; is the first byte past the end of the leaf entry array.\nThis is inconsistent -- the entries array ends at byte 448, but\nfreemap[1] says there\u0026apos;s free space starting at byte 388!\n\nBy the end of the function, the freemap is in worse shape:\n\ni 0 base 456 size 0 rhs 456 count 47\ni 1 base 388 size 52 rhs 456 count 47\ni 2 base 2120 size 4 rhs 456 count 47\nfirstused = 440\n\nImportant note: 388 is not aligned with the entries array element size\nof 8 bytes.\n\nBased on the incorrect freemap, the name area starts at byte 440, which\nis below the end of the entries array! That\u0026apos;s why the assertion\ntriggers and the filesystem shuts down.\n\nHow did we end up here? First, recall from the previous patch that the\nfreemap array in an xattr leaf block is not intended to be a\ncomprehensive map of all free space in the leaf block. In other words,\nit\u0026apos;s perfectly legal to have a leaf block with:\n\n * 376 bytes in use by the entries array\n * freemap[0] has [base = 376, size = 8]\n * freemap[1] has [base = 388, size = 1500]\n * the space between 376 and 388 is free, but the freemap stopped\n tracking that some time ago\n\nIf we add one xattr, the entries array grows to 384 bytes, and\nfreemap[0] becomes [base = 384, size = 0]. So far, so good. But if we\nadd a second xattr, the entries array grows to 392 bytes, and freemap[0]\ngets pushed up to [base = 392, size = 0]. This is bad, because\nfreemap[1] hasn\u0026apos;t been updated, and now the entries array and the free\nspace claim the same space.\n\nThe fix here is to adjust all freemap entries so that none of them\ncollide with the entries array. Note that this fix relies on commit\n2a2b5932db6758 (\u0026quot;xfs: fix attr leaf header freemap.size underflow\u0026quot;) and\nthe previous patch that resets zero length freemap entries to have\nbase = 0.(CVE-2026-43158)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: usb: kaweth: remove TX queue manipulation in kaweth_set_rx_mode\n\nkaweth_set_rx_mode(), the ndo_set_rx_mode callback, calls\nnetif_stop_queue() and netif_wake_queue(). These are TX queue flow\ncontrol functions unrelated to RX multicast configuration.\n\nThe premature netif_wake_queue() can re-enable TX while tx_urb is still\nin-flight, leading to a double usb_submit_urb() on the same URB:\n\nkaweth_start_xmit() {\n netif_stop_queue();\n usb_submit_urb(kaweth-\u0026gt;tx_urb);\n}\n\nkaweth_set_rx_mode() {\n netif_stop_queue();\n netif_wake_queue(); // wakes TX queue before URB is done\n}\n\nkaweth_start_xmit() {\n netif_stop_queue();\n usb_submit_urb(kaweth-\u0026gt;tx_urb); // URB submitted while active\n}\n\nThis triggers the WARN in usb_submit_urb():\n\n \u0026quot;URB submitted while active\u0026quot;\n\nThis is a similar class of bug fixed in rtl8150 by\n\n- commit 958baf5eaee3 (\u0026quot;net: usb: Remove disruptive netif_wake_queue in rtl8150_set_multicast\u0026quot;).\n\nAlso kaweth_set_rx_mode() is already functionally broken, the\nreal set_rx_mode action is performed by kaweth_async_set_rx_mode(),\nwhich in turn is not a no-op only at ndo_open() time.(CVE-2026-43180)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: xt_tcpmss: check remaining length before reading optlen\n\nQuoting reporter:\n In net/netfilter/xt_tcpmss.c (lines 53-68), the TCP option parser reads\n op[i+1] directly without validating the remaining option length.\n\n If the last byte of the option field is not EOL/NOP (0/1), the code attempts\n to index op[i+1]. In the case where i + 1 == optlen, this causes an\n out-of-bounds read, accessing memory past the optlen boundary\n (either reading beyond the stack buffer _opt or the\n following payload).(CVE-2026-43190)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: nf_conntrack_h323: fix OOB read in decode_choice()\n\nIn decode_choice(), the boundary check before get_len() uses the\nvariable `len`, which is still 0 from its initialization at the top of\nthe function:\n\n unsigned int type, ext, len = 0;\n ...\n if (ext || (son-\u0026gt;attr \u0026amp; OPEN)) {\n BYTE_ALIGN(bs);\n if (nf_h323_error_boundary(bs, len, 0)) /* len is 0 here */\n return H323_ERROR_BOUND;\n len = get_len(bs); /* OOB read */\n\nWhen the bitstream is exactly consumed (bs-\u0026gt;cur == bs-\u0026gt;end), the check\nnf_h323_error_boundary(bs, 0, 0) evaluates to (bs-\u0026gt;cur + 0 \u0026gt; bs-\u0026gt;end),\nwhich is false. The subsequent get_len() call then dereferences\n*bs-\u0026gt;cur++, reading 1 byte past the end of the buffer. If that byte\nhas bit 7 set, get_len() reads a second byte as well.\n\nThis can be triggered remotely by sending a crafted Q.931 SETUP message\nwith a User-User Information Element containing exactly 2 bytes of\nPER-encoded data ({0x08, 0x00}) to port 1720 through a firewall with\nthe nf_conntrack_h323 helper active. The decoder fully consumes the\nPER buffer before reaching this code path, resulting in a 1-2 byte\nheap-buffer-overflow read confirmed by AddressSanitizer.\n\nFix this by checking for 2 bytes (the maximum that get_len() may read)\ninstead of the uninitialized `len`. This matches the pattern used at\nevery other get_len() call site in the same file, where the caller\nchecks for 2 bytes of available data before calling get_len().(CVE-2026-43233)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmailbox: Prevent out-of-bounds access in fw_mbox_index_xlate()\n\nAlthough it is guided that `#mbox-cells` must be at least 1, there are\nmany instances of `#mbox-cells = \u0026lt;0\u0026gt;;` in the device tree. If that is\nthe case and the corresponding mailbox controller does not provide\n`fw_xlate` and of_xlate` function pointers, `fw_mbox_index_xlate()` will\nbe used by default and out-of-bounds accesses could occur due to lack of\nbounds check in that function.(CVE-2026-43281)\n\nIn the Linux kernel, there is a double free vulnerability in the error handling path of cpufreq_dbs_governor_init() function. When kobject_init_and_add() fails, cpufreq_dbs_governor_init() calls kobject_put(\u0026amp;dbs_data-\u0026gt;attr_set.kobj). The kobject release callback cpufreq_dbs_data_release() calls gov-\u0026gt;exit(dbs_data) and kfree(dbs_data), but the current error path then calls gov-\u0026gt;exit(dbs_data) and kfree(dbs_data) again, causing a double free. Keep the direct kfree(dbs_data) for the gov-\u0026gt;init() failure path, but after kobject_init_and_add() has been called, let kobject_put() handle the cleanup through cpufreq_dbs_data_release().(CVE-2026-43328)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nlib/crypto: chacha: Zeroize permuted_state before it leaves scope\n\nSince the ChaCha permutation is invertible, the local variable\n\u0026apos;permuted_state\u0026apos; is sufficient to compute the original \u0026apos;state\u0026apos;, and thus\nthe key, even after the permutation has been done.\n\nWhile the kernel is quite inconsistent about zeroizing secrets on the\nstack (and some prominent userspace crypto libraries don\u0026apos;t bother at all\nsince it\u0026apos;s not guaranteed to work anyway), the kernel does try to do it\nas a best practice, especially in cases involving the RNG.\n\nThus, explicitly zeroize \u0026apos;permuted_state\u0026apos; before it goes out of scope.(CVE-2026-43336)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: class: cdc-wdm: fix reordering issue in read code path\n\nQuoting the bug report:\n\nDue to compiler optimization or CPU out-of-order execution, the\ndesc-\u0026gt;length update can be reordered before the memmove. If this\nhappens, wdm_read() can see the new length and call copy_to_user() on\nuninitialized memory. This also violates LKMM data race rules [1].\n\nFix it by using WRITE_ONCE and memory barriers.(CVE-2026-43427)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/mlx5e: Fix DMA FIFO desync on error CQE SQ recovery\n\nIn case of a TX error CQE, a recovery flow is triggered,\nmlx5e_reset_txqsq_cc_pc() resets dma_fifo_cc to 0 but not dma_fifo_pc,\ndesyncing the DMA FIFO producer and consumer.\n\nAfter recovery, the producer pushes new DMA entries at the old\ndma_fifo_pc, while the consumer reads from position 0.\nThis causes us to unmap stale DMA addresses from before the recovery.\n\nThe DMA FIFO is a purely software construct with no HW counterpart.\nAt the point of reset, all WQEs have been flushed so dma_fifo_cc is\nalready equal to dma_fifo_pc. There is no need to reset either counter,\nsimilar to how skb_fifo pc/cc are untouched.\n\nRemove the \u0026apos;dma_fifo_cc = 0\u0026apos; reset.\n\nThis fixes the following WARNING:\n WARNING: CPU: 0 PID: 0 at drivers/iommu/dma-iommu.c:1240 iommu_dma_unmap_page+0x79/0x90\n Modules linked in: mlx5_vdpa vringh vdpa bonding mlx5_ib mlx5_vfio_pci ipip mlx5_fwctl tunnel4 mlx5_core ib_ipoib geneve ip6_gre ip_gre gre nf_tables ip6_tunnel rdma_ucm ib_uverbs ib_umad vfio_pci vfio_pci_core act_mirred act_skbedit act_vlan vhost_net vhost tap ip6table_mangle ip6table_nat ip6table_filter ip6_tables iptable_mangle cls_matchall nfnetlink_cttimeout act_gact cls_flower sch_ingress vhost_iotlb iptable_raw tunnel6 vfio_iommu_type1 vfio openvswitch nsh rpcsec_gss_krb5 auth_rpcgss oid_registry xt_conntrack xt_MASQUERADE nf_conntrack_netlink nfnetlink iptable_nat nf_nat xt_addrtype br_netfilter overlay zram zsmalloc rpcrdma ib_iser libiscsi scsi_transport_iscsi rdma_cm iw_cm ib_cm ib_core fuse [last unloaded: nf_tables]\n CPU: 0 UID: 0 PID: 0 Comm: swapper/0 Not tainted 6.13.0-rc5_for_upstream_min_debug_2024_12_30_21_33 #1\n Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.13.0-0-gf21b5a4aeb02-prebuilt.qemu.org 04/01/2014\n RIP: 0010:iommu_dma_unmap_page+0x79/0x90\n Code: 2b 4d 3b 21 72 26 4d 3b 61 08 73 20 49 89 d8 44 89 f9 5b 4c 89 f2 4c 89 e6 48 89 ef 5d 41 5c 41 5d 41 5e 41 5f e9 c7 ae 9e ff \u0026lt;0f\u0026gt; 0b 5b 5d 41 5c 41 5d 41 5e 41 5f c3 66 2e 0f 1f 84 00 00 00 00\n Call Trace:\n \u0026lt;IRQ\u0026gt;\n ? __warn+0x7d/0x110\n ? iommu_dma_unmap_page+0x79/0x90\n ? report_bug+0x16d/0x180\n ? handle_bug+0x4f/0x90\n ? exc_invalid_op+0x14/0x70\n ? asm_exc_invalid_op+0x16/0x20\n ? iommu_dma_unmap_page+0x79/0x90\n ? iommu_dma_unmap_page+0x2e/0x90\n dma_unmap_page_attrs+0x10d/0x1b0\n mlx5e_tx_wi_dma_unmap+0xbe/0x120 [mlx5_core]\n mlx5e_poll_tx_cq+0x16d/0x690 [mlx5_core]\n mlx5e_napi_poll+0x8b/0xac0 [mlx5_core]\n __napi_poll+0x24/0x190\n net_rx_action+0x32a/0x3b0\n ? mlx5_eq_comp_int+0x7e/0x270 [mlx5_core]\n ? notifier_call_chain+0x35/0xa0\n handle_softirqs+0xc9/0x270\n irq_exit_rcu+0x71/0xd0\n common_interrupt+0x7f/0xa0\n \u0026lt;/IRQ\u0026gt;\n \u0026lt;TASK\u0026gt;\n asm_common_interrupt+0x22/0x40(CVE-2026-43466)\n\nIn the Linux kernel\u0026apos;s openvswitch module, the vport netlink reply helpers allocate a fixed-size skb with nlmsg_new(NLMSG_DEFAULT_SIZE, ...) but serialize the full upcall PID array via ovs_vport_get_upcall_portids(). Since ovs_vport_set_upcall_portids() accepts any non-zero multiple of sizeof(u32) with no upper bound, a CAP_NET_ADMIN user can install a PID array large enough to overflow the reply buffer, causing nla_put() to fail with -EMSGSIZE and hitting BUG_ON(err \u0026lt; 0), leading to a kernel panic. On systems with unprivileged user namespaces enabled (e.g., Ubuntu default), this is reachable via unshare -Urn.(CVE-2026-45840)\n\nIn the Linux kernel, the following vulnerability has been resolved: drm/nouveau: fix u32 overflow in pushbuf reloc bounds check nouveau_gem_pushbuf_reloc_apply() validates each relocation with if (r-\u0026gt;reloc_bo_offset + 4 \u0026gt; nvbo-\u0026gt;bo.base.size) but reloc_bo_offset is __u32 (uapi/drm/nouveau_drm.h) and the integer literal 4 promotes to unsigned int, so the addition is performed in 32 bits and wraps before the comparison against the size_t bo size. Cast to u64 so the addition happens in 64-bit arithmetic. [ Add Fixes: tag. - Danilo ] The Linux kernel CVE team has assigned CVE-2026-46006 to this issue.(CVE-2026-46006)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nthermal: core: Fix thermal zone governor cleanup issues\n\nIf thermal_zone_device_register_with_trips() fails after adding\na thermal governor to the thermal zone being registered, the\ngovernor is not removed from it as appropriate which may lead to\na memory leak.\n\nIn turn, thermal_zone_device_unregister() calls thermal_set_governor()\nwithout acquiring the thermal zone lock beforehand which may race with\na governor update via sysfs and may lead to a use-after-free in that\ncase.\n\nAddress these issues by adding two thermal_set_governor() calls, one to\nthermal_release() to remove the governor from the given thermal zone,\nand one to the thermal zone registration error path to cover failures\npreceding the thermal zone device registration.(CVE-2026-46021)\n\nIn the Linux kernel, the following vulnerability has been resolved: dm mirror: fix integer overflow in create_dirty_log() The argument count calculation in create_dirty_log() performs `*args_used = 2 + param_count` before validating against argc. When a user provides a param_count close to UINT_MAX via the device mapper table string, this unsigned addition wraps around to a small value, causing the subsequent `argc \u0026lt; *args_used` check to be bypassed. The overflowed param_count is then passed as argc to dm_dirty_log_create(), where it can cause out-of-bounds reads on the argv array. Fix by comparing param_count against argc - 2 before performing the addition, following the same pattern used by parse_features() in the same file. Since argc \u0026gt;= 2 is already guaranteed, the subtraction is safe. The Linux kernel CVE team has assigned CVE-2026-46023 to this issue.(CVE-2026-46023)\n\nIn the Linux kernel, the following vulnerability has been resolved: crypto: authencesn - reject short ahash digests during instance creation authencesn requires either a zero authsize or an authsize of at least 4 bytes because the ESN encrypt/decrypt paths always move 4 bytes of high-order sequence number data at the end of the authenticated data. While crypto_authenc_esn_setauthsize() already rejects explicit non-zero authsizes in the range 1..3, crypto_authenc_esn_create() still copied auth-\u0026gt;digestsize into inst-\u0026gt;alg.maxauthsize without validating it. The AEAD core then initialized the tfm\u0026apos;s default authsize from that value. As a result, selecting an ahash with digest size 1..3, such as cbcmac(cipher_null), exposed authencesn instances whose default authsize was invalid even though setauthsize() would have rejected the same value. AF_ALG could then trigger the ESN tail handling with a too-short tag and hit an out-of-bounds access. Reject authencesn instances whose ahash digest size is in the invalid non-zero range 1..3 so that no tfm can inherit an unsupported default authsize. The Linux kernel CVE team has assigned CVE-2026-46033 to this issue.(CVE-2026-46033)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nceph: only d_add() negative dentries when they are unhashed\n\nCeph can call d_add(dentry, NULL) on a negative dentry that is already\npresent in the primary dcache hash.\n\nIn the current VFS that is not safe. d_add() goes through __d_add()\nto __d_rehash(), which unconditionally reinserts dentry-\u0026gt;d_hash into\nthe hlist_bl bucket. If the dentry is already hashed, reinserting the\nsame node can corrupt the bucket, including creating a self-loop.\nOnce that happens, __d_lookup() can spin forever in the hlist_bl walk,\ntypically looping only on the d_name.hash mismatch check and\neventually triggering RCU stall reports like this one:\n\n rcu: INFO: rcu_sched self-detected stall on CPU\n rcu: 87-....: (2100 ticks this GP) idle=3a4c/1/0x4000000000000000 softirq=25003319/25003319 fqs=829\n rcu: (t=2101 jiffies g=79058445 q=698988 ncpus=192)\n CPU: 87 UID: 2952868916 PID: 3933303 Comm: php-cgi8.3 Not tainted 6.18.17-i1-amd #950 NONE\n Hardware name: Dell Inc. PowerEdge R7615/0G9DHV, BIOS 1.6.6 09/22/2023\n RIP: 0010:__d_lookup+0x46/0xb0\n Code: c1 e8 07 48 8d 04 c2 48 8b 00 49 89 fc 49 89 f5 48 89 c3 48 83 e3 fe 48 83 f8 01 77 0f eb 2d 0f 1f 44 00 00 48 8b 1b 48 85 db \u0026lt;74\u0026gt; 20 39 6b 18 75 f3 48 8d 7b 78 e8 ba 85 d0 00 4c 39 63 10 74 1f\n RSP: 0018:ff745a70c8253898 EFLAGS: 00000282\n RAX: ff26e470054cb208 RBX: ff26e470054cb208 RCX: 000000006e958966\n RDX: ff26e48267340000 RSI: ff745a70c82539b0 RDI: ff26e458f74655c0\n RBP: 000000006e958966 R08: 0000000000000180 R09: 9cd08d909b919a89\n R10: ff26e458f74655c0 R11: 0000000000000000 R12: ff26e458f74655c0\n R13: ff745a70c82539b0 R14: d0d0d0d0d0d0d0d0 R15: 2f2f2f2f2f2f2f2f\n FS: 00007f5770896980(0000) GS:ff26e482c5d88000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 00007f5764de50c0 CR3: 000000a72abb5001 CR4: 0000000000771ef0\n PKRU: 55555554\n Call Trace:\n \u0026lt;TASK\u0026gt;\n lookup_fast+0x9f/0x100\n walk_component+0x1f/0x150\n link_path_walk+0x20e/0x3d0\n path_lookupat+0x68/0x180\n filename_lookup+0xdc/0x1e0\n vfs_statx+0x6c/0x140\n vfs_fstatat+0x67/0xa0\n __do_sys_newfstatat+0x24/0x60\n do_syscall_64+0x6a/0x230\n entry_SYSCALL_64_after_hwframe+0x76/0x7e\n\nThis is reachable with reused cached negative dentries. A Ceph lookup\nor atomic_open can be handed a negative dentry that is already hashed,\nand fs/ceph/dir.c then hits one of two paths that incorrectly assume\n\u0026quot;negative\u0026quot; also means \u0026quot;unhashed\u0026quot;:\n\n - ceph_finish_lookup():\n MDS reply is -ENOENT with no trace\n -\u0026gt; d_add(dentry, NULL)\n\n - ceph_lookup():\n local ENOENT fast path for a complete directory with shared caps\n -\u0026gt; d_add(dentry, NULL)\n\nBoth paths can therefore re-add an already-hashed negative dentry.\n\nCeph already uses the correct pattern elsewhere: ceph_fill_trace() only\ncalls d_add(dn, NULL) for a negative null-dentry reply when d_unhashed(dn)\nis true.\n\nFix both fs/ceph/dir.c sites the same way: only call d_add() for a\nnegative dentry when it is actually unhashed. If the negative dentry\nis already hashed, leave it in place and reuse it as-is.\n\nThis preserves the existing behavior for unhashed dentries while\navoiding d_hash list corruption for reused hashed negatives.(CVE-2026-46052)\n\nIn the Linux kernel, the following vulnerability has been resolved: sctp: revalidate list cursor after sctp_sendmsg_to_asoc() in SCTP_SENDALL. The SCTP_SENDALL path in sctp_sendmsg() iterates ep-\u0026gt;asocs with list_for_each_entry_safe(), which caches the next entry in @tmp before the loop body runs. The body calls sctp_sendmsg_to_asoc(), which may drop the socket lock inside sctp_wait_for_sndbuf(). While the lock is dropped, another thread can SCTP_SOCKOPT_PEELOFF the association cached in @tmp, migrating it to a new endpoint via sctp_sock_migrate() (list_del_init() + list_add_tail() to newep-\u0026gt;asocs), and optionally close the new socket which frees the association via kfree_rcu(). The cached @tmp can also be freed by a network ABORT for that association, processed in softirq while the lock is dropped. sctp_wait_for_sndbuf() revalidates @asoc (the current entry) on re-lock via the \u0026quot;sk != asoc-\u0026gt;base.sk\u0026quot; and \u0026quot;asoc-\u0026gt;base.dead\u0026quot; checks, but nothing revalidates @tmp. After a successful return, the iterator advances to the stale @tmp, yielding either a use-after-free (if the peeled socket was closed) or a list-walk onto the new endpoint\u0026apos;s list head (type confusion of \u0026amp;newep-\u0026gt;asocs as a struct sctp_association *). Both are reachable from CapEff=0; the type-confusion path gives controlled indirect call via the outqueue.sched-\u0026gt;init_sid pointer. Fix by re-deriving @tmp from @asoc after sctp_sendmsg_to_asoc() returns. @asoc is known to still be on ep-\u0026gt;asocs at that point: the only callers that list_del an association from ep-\u0026gt;asocs are sctp_association_free() (which sets asoc-\u0026gt;base.dead) and sctp_assoc_migrate() (which changes asoc-\u0026gt;base.sk), and sctp_wait_for_sndbuf() checks both under the lock before any successful return; a tripped check propagates as err \u0026lt; 0 and the loop bails before the re-derive. The SCTP_ABORT path in sctp_sendmsg_check_sflags() returns 0 and the loop hits \u0026apos;continue\u0026apos; before sctp_sendmsg_to_asoc() is ever called, so the @tmp cached by list_for_each_entry_safe() still covers the lock-held free that ba59fb027307 (\u0026quot;sctp: walk the list of asocs safely\u0026quot;) was added for.(CVE-2026-46227)",
"id": "OESA-2026-2579",
"modified": "2026-08-06T11:11:31Z",
"published": "2026-06-05T11:11:31Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-2579"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38263"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38403"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38459"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38602"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38644"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39738"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-40020"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-68340"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-23243"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-23273"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31586"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31588"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31678"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31759"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31781"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43037"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43038"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43139"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43158"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43180"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43190"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43233"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43281"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43328"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43336"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43427"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43466"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45840"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46006"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46021"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46023"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46033"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46052"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46227"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2025-38263",
"CVE-2025-38403",
"CVE-2025-38459",
"CVE-2025-38602",
"CVE-2025-38644",
"CVE-2025-39738",
"CVE-2025-40020",
"CVE-2025-68340",
"CVE-2026-23243",
"CVE-2026-23273",
"CVE-2026-31586",
"CVE-2026-31588",
"CVE-2026-31678",
"CVE-2026-31759",
"CVE-2026-31781",
"CVE-2026-43037",
"CVE-2026-43038",
"CVE-2026-43139",
"CVE-2026-43158",
"CVE-2026-43180",
"CVE-2026-43190",
"CVE-2026-43233",
"CVE-2026-43281",
"CVE-2026-43328",
"CVE-2026-43336",
"CVE-2026-43427",
"CVE-2026-43466",
"CVE-2026-45840",
"CVE-2026-46006",
"CVE-2026-46021",
"CVE-2026-46023",
"CVE-2026-46033",
"CVE-2026-46052",
"CVE-2026-46227"
]
}
OESA-2026-2674 (CVE-2025-39759)
Vulnerability from osv_openeuler – Published: 2026-06-12 11:11 – Updated: 2026-08-06 11:11 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
btrfs: qgroup: fix race between quota disable and quota rescan ioctl
There's a race between a task disabling quotas and another running the rescan ioctl that can result in a use-after-free of qgroup records from the fs_info->qgroup_tree rbtree.
This happens as follows:
1) Task A enters btrfs_ioctl_quota_rescan() -> btrfs_qgroup_rescan();
2) Task B enters btrfs_quota_disable() and calls btrfs_qgroup_wait_for_completion(), which does nothing because at that point fs_info->qgroup_rescan_running is false (it wasn't set yet by task A);
3) Task B calls btrfs_free_qgroup_config() which starts freeing qgroups from fs_info->qgroup_tree without taking the lock fs_info->qgroup_lock;
4) Task A enters qgroup_rescan_zero_tracking() which starts iterating the fs_info->qgroup_tree tree while holding fs_info->qgroup_lock, but task B is freeing qgroup records from that tree without holding the lock, resulting in a use-after-free.
Fix this by taking fs_info->qgroup_lock at btrfs_free_qgroup_config(). Also at btrfs_qgroup_rescan() don't start the rescan worker if quotas were already disabled.(CVE-2025-39759)
In the Linux kernel, the following vulnerability has been resolved:
wifi: wilc1000: avoid buffer overflow in WID string configuration
Fix the following copy overflow warning identified by Smatch checker.
drivers/net/wireless/microchip/wilc1000/wlan_cfg.c:184 wilc_wlan_parse_response_frame() error: '__memcpy()' 'cfg->s[i]->str' copy overflow (512 vs 65537)
This patch introduces size check before accessing the memory buffer. The checks are base on the WID type of received data from the firmware. For WID string configuration, the size limit is determined by individual element size in 'struct wilc_cfg_str_vals' that is maintained in 'len' field of 'struct wilc_cfg_str'.(CVE-2025-39952)
In the Linux kernel, the following vulnerability has been resolved:
iio: accel: bmc150: Fix irq assumption regression
The code in bmc150-accel-core.c unconditionally calls bmc150_accel_set_interrupt() in the iio_buffer_setup_ops, such as on the runtime PM resume path giving a kernel splat like this if the device has no interrupts:
Unable to handle kernel NULL pointer dereference at virtual address 00000001 when read
PC is at bmc150_accel_set_interrupt+0x98/0x194 LR is at __pm_runtime_resume+0x5c/0x64 (...) Call trace: bmc150_accel_set_interrupt from bmc150_accel_buffer_postenable+0x40/0x108 bmc150_accel_buffer_postenable from __iio_update_buffers+0xbe0/0xcbc __iio_update_buffers from enable_store+0x84/0xc8 enable_store from kernfs_fop_write_iter+0x154/0x1b4
This bug seems to have been in the driver since the beginning, but it only manifests recently, I do not know why.
Store the IRQ number in the state struct, as this is a common pattern in other drivers, then use this to determine if we have IRQ support or not.(CVE-2025-68330)
In the Linux kernel, the following vulnerability has been resolved:
staging: most: remove broken i2c driver
The MOST I2C driver has been completely broken for five years without anyone noticing so remove the driver from staging.
Specifically, commit 723de0f9171e ("staging: most: remove device from interface structure") started requiring drivers to set the interface device pointer before registration, but the I2C driver was never updated which results in a NULL pointer dereference if anyone ever tries to probe it.(CVE-2025-68755)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: fix NULL dereference on root when tracing inode eviction
When evicting an inode the first thing we do is to setup tracing for it, which implies fetching the root's id. But in btrfs_evict_inode() the root might be NULL, as implied in the next check that we do in btrfs_evict_inode().
Hence, we either should set the ->root_objectid to 0 in case the root is NULL, or we move tracing setup after checking that the root is not NULL. Setting the rootid to 0 at least gives us the possibility to trace this call even in the case when the root is NULL, so that's the solution taken here.(CVE-2025-71184)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: udlfb: avoid divide-by-zero on FBIOPUT_VSCREENINFO
Much like commit 19f953e74356 ("fbdev: fb_pm2fb: Avoid potential divide by zero error"), we also need to prevent that same crash from happening in the udlfb driver as it uses pixclock directly when dividing, which will crash.(CVE-2026-31605)
In the Linux kernel, the following vulnerability has been resolved:
usbip: validate number_of_packets in usbip_pack_ret_submit()
When a USB/IP client receives a RET_SUBMIT response, usbip_pack_ret_submit() unconditionally overwrites urb->number_of_packets from the network PDU. This value is subsequently used as the loop bound in usbip_recv_iso() and usbip_pad_iso() to iterate over urb->iso_frame_desc[], a flexible array whose size was fixed at URB allocation time based on the original number_of_packets from the CMD_SUBMIT.
A malicious USB/IP server can set number_of_packets in the response to a value larger than what was originally submitted, causing a heap out-of-bounds write when usbip_recv_iso() writes to urb->iso_frame_desc[i] beyond the allocated region.
KASAN confirmed this with kernel 7.0.0-rc5:
BUG: KASAN: slab-out-of-bounds in usbip_recv_iso+0x46a/0x640 Write of size 4 at addr ffff888106351d40 by task vhci_rx/69
The buggy address is located 0 bytes to the right of allocated 320-byte region [ffff888106351c00, ffff888106351d40)
The server side (stub_rx.c) and gadget side (vudc_rx.c) already validate number_of_packets in the CMD_SUBMIT path since commits c6688ef9f297 ("usbip: fix stub_rx: harden CMD_SUBMIT path to handle malicious input") and b78d830f0049 ("usbip: fix vudc_rx: harden CMD_SUBMIT path to handle malicious input"). The server side validates against USBIP_MAX_ISO_PACKETS because no URB exists yet at that point. On the client side we have the original URB, so we can use the tighter bound: the response must not exceed the original number_of_packets.
This mirrors the existing validation of actual_length against transfer_buffer_length in usbip_recv_xbuff(), which checks the response value against the original allocation size.
Kelvin Mbogo's series ("usb: usbip: fix integer overflow in usbip_recv_iso()", v2) hardens the receive-side functions themselves; this patch complements that work by catching the bad value at its source -- in usbip_pack_ret_submit() before the overwrite -- and using the tighter per-URB allocation bound rather than the global USBIP_MAX_ISO_PACKETS limit.
Fix this by checking rpdu->number_of_packets against urb->number_of_packets in usbip_pack_ret_submit() before the overwrite. On violation, clamp to zero so that usbip_recv_iso() and usbip_pad_iso() safely return early.(CVE-2026-31607)
In the Linux kernel, the following vulnerability has been resolved:
usb: gadget: renesas_usb3: validate endpoint index in standard request handlers
The GET_STATUS and SET/CLEAR_FEATURE handlers extract the endpoint number from the host-supplied wIndex without any sort of validation. Fix this up by validating the number of endpoints actually match up with the number the device has before attempting to dereference a pointer based on this math.
This is just like what was done in commit ee0d382feb44 ("usb: gadget: aspeed_udc: validate endpoint index for ast udc") for the aspeed driver.(CVE-2026-31615)
In the Linux kernel, the following vulnerability has been resolved:
usb: gadget: f_phonet: fix skb frags[] overflow in pn_rx_complete()
A broken/bored/mean USB host can overflow the skb_shared_info->frags[] array on a Linux gadget exposing a Phonet function by sending an unbounded sequence of full-page OUT transfers.
pn_rx_complete() finalizes the skb only when req->actual < req->length, where req->length is set to PAGE_SIZE by the gadget. If the host always sends exactly PAGE_SIZE bytes per transfer, fp->rx.skb will never be reset and each completion will add another fragment via skb_add_rx_frag(). Once nr_frags exceeds MAX_SKB_FRAGS (default 17), subsequent frag stores overwrite memory adjacent to the shinfo on the heap.
Drop the skb and account a length error when the frag limit is reached, matching the fix applied in t7xx by commit f0813bcd2d9d ("net: wwan: t7xx: fix potential skb->frags overflow in RX path").(CVE-2026-31616)
In the Linux kernel, the following vulnerability has been resolved:
usb: gadget: f_ncm: validate minimum block_len in ncm_unwrap_ntb()
The block_len read from the host-supplied NTB header is checked against ntb_max but has no lower bound. When block_len is smaller than opts->ndp_size, the bounds check of: ndp_index > (block_len - opts->ndp_size) will underflow producing a huge unsigned value that ndp_index can never exceed, defeating the check entirely.
The same underflow occurs in the datagram index checks against block_len - opts->dpe_size. With those checks neutered, a malicious USB host can choose ndp_index and datagram offsets that point past the actual transfer, and the skb_put_data() copies adjacent kernel memory into the network skb.
Fix this by rejecting block lengths that cannot hold at least the NTB header plus one NDP. This will make block_len - opts->ndp_size and block_len - opts->dpe_size both well-defined.
Commit 8d2b1a1ec9f5 ("CDC-NCM: avoid overflow in sanity checking") fixed a related class of issues on the host side of NCM.(CVE-2026-31617)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: tdfxfb: avoid divide-by-zero on FBIOPUT_VSCREENINFO
Much like commit 19f953e74356 ("fbdev: fb_pm2fb: Avoid potential divide by zero error"), we also need to prevent that same crash from happening in the udlfb driver as it uses pixclock directly when dividing, which will crash.(CVE-2026-31618)
In the Linux kernel, the following vulnerability has been resolved:
net/packet: fix TOCTOU race on mmap'd vnet_hdr in tpacket_snd()
In tpacket_snd(), when PACKET_VNET_HDR is enabled, vnet_hdr points directly into the mmap'd TX ring buffer shared with userspace. The kernel validates the header via __packet_snd_vnet_parse() but then re-reads all fields later in virtio_net_hdr_to_skb(). A concurrent userspace thread can modify the vnet_hdr fields between validation and use, bypassing all safety checks.
The non-TPACKET path (packet_snd()) already correctly copies vnet_hdr to a stack-local variable. All other vnet_hdr consumers in the kernel (tun.c, tap.c, virtio_net.c) also use stack copies. The TPACKET TX path is the only caller of virtio_net_hdr_to_skb() that reads directly from user-controlled shared memory.
Fix this by copying vnet_hdr from the mmap'd ring buffer to a stack-local variable before validation and use, consistent with the approach used in packet_snd() and all other callers.(CVE-2026-31700)
In the Linux kernel, the following vulnerability has been resolved:
Buffer overflow in drivers/xen/sys-hypervisor.c
The build id returned by HYPERVISOR_xen_version(XENVER_build_id) is neither NUL terminated nor a string.
The first causes a buffer overflow as sprintf in buildid_show will read and copy till it finds a NUL.
00000000 f4 91 51 f4 dd 38 9e 9d 65 47 52 eb 10 71 db 50 |..Q..8..eGR..q.P| 00000010 b9 a8 01 42 6f 2e 32 |...Bo.2| 00000017
So use a memcpy instead of sprintf to have the correct value:
00000000 f4 91 51 f4 dd 00 9e 9d 65 47 52 eb 10 71 db 50 |..Q.....eGR..q.P| 00000010 b9 a8 01 42 |...B| 00000014
(the above have a hack to embed a zero inside and check it's returned correctly).
This is XSA-485 / CVE-2026-31786(CVE-2026-31786)
In the Linux kernel, the following vulnerability has been resolved:
crypto: algif_aead - Fix minimum RX size check for decryption
The check for the minimum receive buffer size did not take the tag size into account during decryption. Fix this by adding the required extra length.(CVE-2026-43077)
In the Linux kernel, the following vulnerability has been resolved:
crypto: af_alg - Fix page reassignment overflow in af_alg_pull_tsgl
When page reassignment was added to af_alg_pull_tsgl the original loop wasn't updated so it may try to reassign one more page than necessary.
Add the check to the reassignment so that this does not happen.
Also update the comment which still refers to the obsolete offset argument.(CVE-2026-43078)
In the Linux kernel, the following vulnerability has been resolved:
xfrm: Wait for RCU readers during policy netns exit
xfrm_policy_fini() frees the policy_bydst hash tables after flushing the policy work items and deleting all policies, but it does not wait for concurrent RCU readers to leave their read-side critical sections first.
The policy_bydst tables are published via rcu_assign_pointer() and are looked up through rcu_dereference_check(), so netns teardown must also wait for an RCU grace period before freeing the table memory.
Fix this by adding synchronize_rcu() before freeing the policy hash tables.(CVE-2026-43091)
In the Linux kernel, the following vulnerability has been resolved:
xsk: tighten UMEM headroom validation to account for tailroom and min frame
The current headroom validation in xdp_umem_reg() could leave us with insufficient space dedicated to even receive minimum-sized ethernet frame. Furthermore if multi-buffer would come to play then skb_shared_info stored at the end of XSK frame would be corrupted.
HW typically works with 128-aligned sizes so let us provide this value as bare minimum.
Multi-buffer setting is known later in the configuration process so besides accounting for 128 bytes, let us also take care of tailroom space upfront.(CVE-2026-43093)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: ctnetlink: ensure safe access to master conntrack
Holding reference on the expectation is not sufficient, the master conntrack object can just go away, making exp->master invalid.
To access exp->master safely:
-
Grab the nf_conntrack_expect_lock, this gets serialized with clean_from_lists() which also holds this lock when the master conntrack goes away.
-
Hold reference on master conntrack via nf_conntrack_find_get(). Not so easy since the master tuple to look up for the master conntrack is not available in the existing problematic paths.
This patch goes for extending the nf_conntrack_expect_lock section to address this issue for simplicity, in the cases that are described below this is just slightly extending the lock section.
The add expectation command already holds a reference to the master conntrack from ctnetlink_create_expect().
However, the delete expectation command needs to grab the spinlock before looking up for the expectation. Expand the existing spinlock section to address this to cover the expectation lookup. Note that, the nf_ct_expect_iterate_net() calls already grabs the spinlock while iterating over the expectation table, which is correct.
The get expectation command needs to grab the spinlock to ensure master conntrack does not go away. This also expands the existing spinlock section to cover the expectation lookup too. I needed to move the netlink skb allocation out of the spinlock to keep it GFP_KERNEL.
For the expectation events, the IPEXP_DESTROY event is already delivered under the spinlock, just move the delivery of IPEXP_NEW under the spinlock too because the master conntrack event cache is reached through exp->master.
While at it, add lockdep notations to help identify what codepaths need to grab the spinlock.(CVE-2026-43116)
In the Linux kernel, the following vulnerability has been resolved:
dlm: validate length in dlm_search_rsb_tree
The len parameter in dlm_dump_rsb_name() is not validated and comes from network messages. When it exceeds DLM_RESNAME_MAXLEN, it can cause out-of-bounds write in dlm_search_rsb_tree().
Add length validation to prevent potential buffer overflow.(CVE-2026-43125)
In the Linux kernel, the following vulnerability has been resolved:
iommu/vt-d: Flush dev-IOTLB only when PCIe device is accessible in scalable mode
Commit 4fc82cd907ac ("iommu/vt-d: Don't issue ATS Invalidation request when device is disconnected") relies on pci_dev_is_disconnected() to skip ATS invalidation for safely-removed devices, but it does not cover link-down caused by faults, which can still hard-lock the system.
For example, if a VM fails to connect to the PCIe device, "virsh destroy" is executed to release resources and isolate the fault, but a hard-lockup occurs while releasing the group fd.
Call Trace: qi_submit_sync qi_flush_dev_iotlb intel_pasid_tear_down_entry device_block_translation blocking_domain_attach_dev __iommu_attach_device __iommu_device_set_domain __iommu_group_set_domain_internal iommu_detach_group vfio_iommu_type1_detach_group vfio_group_detach_container vfio_group_fops_release __fput
Although pci_device_is_present() is slower than pci_dev_is_disconnected(), it still takes only ~70 µs on a ConnectX-5 (8 GT/s, x2) and becomes even faster as PCIe speed and width increase.
Besides, devtlb_invalidation_with_pasid() is called only in the paths below, which are far less frequent than memory map/unmap.
- mm-struct release
- {attach,release}_dev
- set/remove PASID
- dirty-tracking setup
The gain in system stability far outweighs the negligible cost of using pci_device_is_present() instead of pci_dev_is_disconnected() to decide when to skip ATS invalidation, especially under GDR high-load conditions.(CVE-2026-43130)
In the Linux kernel, the following vulnerability has been resolved:
xfrm6: fix uninitialized saddr in xfrm6_get_saddr()
xfrm6_get_saddr() does not check the return value of ipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable source address (returns -EADDRNOTAVAIL), saddr->in6 is left uninitialized, but xfrm6_get_saddr() still returns 0 (success).
This causes the caller xfrm_tmpl_resolve_one() to use the uninitialized address in xfrm_state_find(), triggering KMSAN warning:
===================================================== BUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940 xfrm_state_find+0x2424/0xa940 xfrm_resolve_and_create_bundle+0x906/0x5a20 xfrm_lookup_with_ifid+0xcc0/0x3770 xfrm_lookup_route+0x63/0x2b0 ip_route_output_flow+0x1ce/0x270 udp_sendmsg+0x2ce1/0x3400 inet_sendmsg+0x1ef/0x2a0 __sock_sendmsg+0x278/0x3d0 __sys_sendto+0x593/0x720 __x64_sys_sendto+0x130/0x200 x64_sys_call+0x332b/0x3e70 do_syscall_64+0xd3/0xf80 entry_SYSCALL_64_after_hwframe+0x77/0x7f
Local variable tmp.i.i created at: xfrm_resolve_and_create_bundle+0x3e3/0x5a20 xfrm_lookup_with_ifid+0xcc0/0x3770 =====================================================
Fix by checking the return value of ipv6_dev_get_saddr() and propagating the error.(CVE-2026-43139)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: xt_tcpmss: check remaining length before reading optlen
Quoting reporter: In net/netfilter/xt_tcpmss.c (lines 53-68), the TCP option parser reads op[i+1] directly without validating the remaining option length.
If the last byte of the option field is not EOL/NOP (0/1), the code attempts to index op[i+1]. In the case where i + 1 == optlen, this causes an out-of-bounds read, accessing memory past the optlen boundary (either reading beyond the stack buffer _opt or the following payload).(CVE-2026-43190)
In the Linux kernel, the following vulnerability has been resolved:
tcp: fix potential race in tcp_v6_syn_recv_sock()
Code in tcp_v6_syn_recv_sock() after the call to tcp_v4_syn_recv_sock() is done too late.
After tcp_v4_syn_recv_sock(), the child socket is already visible from TCP ehash table and other cpus might use it.
Since newinet->pinet6 is still pointing to the listener ipv6_pinfo bad things can happen as syzbot found.
Move the problematic code in tcp_v6_mapped_child_init() and call this new helper from tcp_v4_syn_recv_sock() before the ehash insertion.
This allows the removal of one tcp_sync_mss(), since tcp_v4_syn_recv_sock() will call it with the correct context.(CVE-2026-43198)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_conntrack_h323: fix OOB read in decode_choice()
In decode_choice(), the boundary check before get_len() uses the
variable len, which is still 0 from its initialization at the top of
the function:
unsigned int type, ext, len = 0;
...
if (ext || (son->attr & OPEN)) {
BYTE_ALIGN(bs);
if (nf_h323_error_boundary(bs, len, 0)) /* len is 0 here */
return H323_ERROR_BOUND;
len = get_len(bs); /* OOB read */
When the bitstream is exactly consumed (bs->cur == bs->end), the check nf_h323_error_boundary(bs, 0, 0) evaluates to (bs->cur + 0 > bs->end), which is false. The subsequent get_len() call then dereferences *bs->cur++, reading 1 byte past the end of the buffer. If that byte has bit 7 set, get_len() reads a second byte as well.
This can be triggered remotely by sending a crafted Q.931 SETUP message with a User-User Information Element containing exactly 2 bytes of PER-encoded data ({0x08, 0x00}) to port 1720 through a firewall with the nf_conntrack_h323 helper active. The decoder fully consumes the PER buffer before reaching this code path, resulting in a 1-2 byte heap-buffer-overflow read confirmed by AddressSanitizer.
Fix this by checking for 2 bytes (the maximum that get_len() may read)
instead of the uninitialized len. This matches the pattern used at
every other get_len() call site in the same file, where the caller
checks for 2 bytes of available data before calling get_len().(CVE-2026-43233)
In the Linux kernel, the following vulnerability has been resolved:
iommu/amd: move wait_on_sem() out of spinlock
With iommu.strict=1, the existing completion wait path can cause soft lockups under stressed environment, as wait_on_sem() busy-waits under the spinlock with interrupts disabled.
Move the completion wait in iommu_completion_wait() out of the spinlock. wait_on_sem() only polls the hardware-updated cmd_sem and does not require iommu->lock, so holding the lock during the busy wait unnecessarily increases contention and extends the time with interrupts disabled.(CVE-2026-43253)
In the Linux kernel, the following vulnerability has been resolved:
spi: spidev: fix lock inversion between spi_lock and buf_lock
The spidev driver previously used two mutexes, spi_lock and buf_lock, but acquired them in different orders depending on the code path:
write()/read(): buf_lock -> spi_lock ioctl(): spi_lock -> buf_lock
This AB-BA locking pattern triggers lockdep warnings and can cause real deadlocks:
WARNING: possible circular locking dependency detected spidev_ioctl() -> mutex_lock(&spidev->buf_lock) spidev_sync_write() -> mutex_lock(&spidev->spi_lock) *** DEADLOCK ***
The issue is reproducible with a simple userspace program that performs write() and SPI_IOC_WR_MAX_SPEED_HZ ioctl() calls from separate threads on the same spidev file descriptor.
Fix this by simplifying the locking model and removing the lock inversion entirely. spidev_sync() no longer performs any locking, and all callers serialize access using spi_lock.
buf_lock is removed since its functionality is fully covered by spi_lock, eliminating the possibility of lock ordering issues.
This removes the lock inversion and prevents deadlocks without changing userspace ABI or behaviour.(CVE-2026-43319)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: prevent possible UaF in addrconf_permanent_addr()
The mentioned helper try to warn the user about an exceptional condition, but the message is delivered too late, accessing the ipv6 after its possible deletion.
Reorder the statement to avoid the possible UaF; while at it, place the warning outside the idev->lock as it needs no protection.(CVE-2026-43339)
In the Linux kernel, the following vulnerability has been resolved:
net/tcp-md5: Fix MAC comparison to be constant-time
To prevent timing attacks, MACs need to be compared in constant time. Use the appropriate helper function for this.(CVE-2026-43383)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nfnetlink_cthelper: fix OOB read in nfnl_cthelper_dump_table()
nfnl_cthelper_dump_table() has a 'goto restart' that jumps to a label inside the for loop body. When the "last" helper saved in cb->args[1] is deleted between dump rounds, every entry fails the (cur != last) check, so cb->args[1] is never cleared. The for loop finishes with cb->args[0] == nf_ct_helper_hsize, and the 'goto restart' jumps back into the loop body bypassing the bounds check, causing an 8-byte out-of-bounds read on nf_ct_helper_hash[nf_ct_helper_hsize].
The 'goto restart' block was meant to re-traverse the current bucket when "last" is no longer found, but it was placed after the for loop instead of inside it. Move the block into the for loop body so that the restart only occurs while cb->args[0] is still within bounds.
BUG: KASAN: slab-out-of-bounds in nfnl_cthelper_dump_table+0x9f/0x1b0 Read of size 8 at addr ffff888104ca3000 by task poc_cthelper/131 Call Trace: nfnl_cthelper_dump_table+0x9f/0x1b0 netlink_dump+0x333/0x880 netlink_recvmsg+0x3e2/0x4b0 sock_recvmsg+0xde/0xf0 __sys_recvfrom+0x150/0x200 __x64_sys_recvfrom+0x76/0x90 do_syscall_64+0xc3/0x6e0
Allocated by task 1: __kvmalloc_node_noprof+0x21b/0x700 nf_ct_alloc_hashtable+0x65/0xd0 nf_conntrack_helper_init+0x21/0x60 nf_conntrack_init_start+0x18d/0x300 nf_conntrack_standalone_init+0x12/0xc0(CVE-2026-43450)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: x_tables: guard option walkers against 1-byte tail reads
When the last byte of options is a non-single-byte option kind, walkers that advance with i += op[i + 1] ? : 1 can read op[i + 1] past the end of the option area.
Add an explicit i == optlen - 1 check before dereferencing op[i + 1] in xt_tcpudp and xt_dccp option walkers.(CVE-2026-43452)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nft_set_pipapo: fix stack out-of-bounds read in pipapo_drop()
pipapo_drop() passes rulemap[i + 1].n to pipapo_unmap() as the to_offset argument on every iteration, including the last one where i == m->field_count - 1. This reads one element past the end of the stack-allocated rulemap array (declared as rulemap[NFT_PIPAPO_MAX_FIELDS] with NFT_PIPAPO_MAX_FIELDS == 16).
Although pipapo_unmap() returns early when is_last is true without using the to_offset value, the argument is evaluated at the call site before the function body executes, making this a genuine out-of-bounds stack read confirmed by KASAN:
BUG: KASAN: stack-out-of-bounds in pipapo_drop+0x50c/0x57c [nf_tables] Read of size 4 at addr ffff8000810e71a4
This frame has 1 object: [32, 160) 'rulemap'
The buggy address is at offset 164 -- exactly 4 bytes past the end of the rulemap array.
Pass 0 instead of rulemap[i + 1].n on the last iteration to avoid the out-of-bounds read.(CVE-2026-43453)
In the Linux kernel, the following vulnerability has been resolved:
rtmutex: Use waiter::task instead of current in remove_waiter()
remove_waiter() is used by the slowlock paths, but it is also used for proxy-lock rollback in rt_mutex_start_proxy_lock() when invoked from futex_requeue().
In the latter case waiter::task is not current, but remove_waiter() operates on current for the dequeue operation. That results in several problems:
1) the rbtree dequeue happens without waiter::task::pi_lock being held
2) the waiter task's pi_blocked_on state is not cleared, which leaves a dangling pointer primed for UAF around.
3) rt_mutex_adjust_prio_chain() operates on the wrong top priority waiter task
Use waiter::task instead of current in all related operations in remove_waiter() to cure those problems.
tglx: Fixup rt_mutex_adjust_prio_chain(), add a comment and amend the changelog
In the Linux kernel, the following vulnerability has been resolved:
openvswitch: cap upcall PID array size and pre-size vport replies
The vport netlink reply helpers allocate a fixed-size skb with nlmsg_new(NLMSG_DEFAULT_SIZE, ...) but serialize the full upcall PID array via ovs_vport_get_upcall_portids(). Since ovs_vport_set_upcall_portids() accepts any non-zero multiple of sizeof(u32) with no upper bound, a CAP_NET_ADMIN user can install a PID array large enough to overflow the reply buffer, causing nla_put() to fail with -EMSGSIZE and hitting BUG_ON(err < 0). On systems with unprivileged user namespaces enabled (e.g., Ubuntu default), this is reachable via unshare -Urn since OVS vport mutation operations use GENL_UNS_ADMIN_PERM.
kernel BUG at net/openvswitch/datapath.c:2414! Oops: invalid opcode: 0000 [#1] SMP KASAN NOPTI CPU: 1 UID: 0 PID: 65 Comm: poc Not tainted 7.0.0-rc7-00195-geb216e422044 #1 RIP: 0010:ovs_vport_cmd_set+0x34c/0x400 Call Trace: <TASK> genl_family_rcv_msg_doit (net/netlink/genetlink.c:1116) genl_rcv_msg (net/netlink/genetlink.c:1194) netlink_rcv_skb (net/netlink/af_netlink.c:2550) genl_rcv (net/netlink/genetlink.c:1219) netlink_unicast (net/netlink/af_netlink.c:1344) netlink_sendmsg (net/netlink/af_netlink.c:1894) __sys_sendto (net/socket.c:2206) __x64_sys_sendto (net/socket.c:2209) do_syscall_64 (arch/x86/entry/syscall_64.c:63) entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130) </TASK> Kernel panic - not syncing: Fatal exception
Reject attempts to set more PIDs than nr_cpu_ids in ovs_vport_set_upcall_portids(), and pre-compute the worst-case reply size in ovs_vport_cmd_msg_size() based on that bound, similar to the existing ovs_dp_cmd_msg_size(). nr_cpu_ids matches the cap already used by the per-CPU dispatch configuration on the datapath side (ovs_dp_cmd_fill_info() serialises at most nr_cpu_ids PIDs), so the two sides stay consistent.(CVE-2026-45840)
In the Linux kernel, the following vulnerability has been resolved:
slip: bound decode() reads against the compressed packet length
slhc_uncompress() parses a VJ-compressed TCP header by advancing a pointer through the packet via decode() and pull16(). Neither helper bounds-checks against isize, and decode() masks its return with & 0xffff so it can never return the -1 that callers test for -- those error paths are dead code.
A short compressed frame whose change byte requests optional fields lets decode() read past the end of the packet. The over-read bytes are folded into the cached cstate and reflected into subsequent reconstructed packets.
Make decode() and pull16() take the packet end pointer and return -1 when exhausted. Add a bounds check before the TCP-checksum read. The existing == -1 tests now do what they were always meant to.(CVE-2026-45843)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/rxe: Fix double free in rxe_srq_from_init
In rxe_srq_from_init(), the queue pointer 'q' is assigned to 'srq->rq.queue' before copying the SRQ number to user space. If copy_to_user() fails, the function calls rxe_queue_cleanup() to free the queue, but leaves the now-invalid pointer in 'srq->rq.queue'.
The caller of rxe_srq_from_init() (rxe_create_srq) eventually calls rxe_srq_cleanup() upon receiving the error, which triggers a second rxe_queue_cleanup() on the same memory, leading to a double free.
The call trace looks like this: kmem_cache_free+0x.../0x... rxe_queue_cleanup+0x1a/0x30 [rdma_rxe] rxe_srq_cleanup+0x42/0x60 [rdma_rxe] rxe_elem_release+0x31/0x70 [rdma_rxe] rxe_create_srq+0x12b/0x1a0 [rdma_rxe] ib_create_srq_user+0x9a/0x150 [ib_core]
Fix this by moving 'srq->rq.queue = q' after copy_to_user.(CVE-2026-45852)
In the Linux kernel, the following vulnerability has been resolved:
iommu/vt-d: Flush cache for PASID table before using it
When writing the address of a freshly allocated zero-initialized PASID table to a PASID directory entry, do that after the CPU cache flush for this PASID table, not before it, to avoid the time window when this PASID table may be already used by non-coherent IOMMU hardware while its contents in RAM is still some random old data, not zero-initialized.(CVE-2026-45862)
In the Linux kernel, the following vulnerability has been resolved:
iommu/vt-d: Clear Present bit before tearing down PASID entry
The Intel VT-d Scalable Mode PASID table entry consists of 512 bits (64 bytes). When tearing down an entry, the current implementation zeros the entire 64-byte structure immediately using multiple 64-bit writes.
Since the IOMMU hardware may fetch these 64 bytes using multiple internal transactions (e.g., four 128-bit bursts), updating or zeroing the entire entry while it is active (P=1) risks a "torn" read. If a hardware fetch occurs simultaneously with the CPU zeroing the entry, the hardware could observe an inconsistent state, leading to unpredictable behavior or spurious faults.
Follow the "Guidance to Software for Invalidations" in the VT-d spec (Section 6.5.3.3) by implementing the recommended ownership handshake:
- Clear only the 'Present' (P) bit of the PASID entry.
- Use a dma_wmb() to ensure the cleared bit is visible to hardware before proceeding.
- Execute the required invalidation sequence (PASID cache, IOTLB, and Device-TLB flush) to ensure the hardware has released all cached references.
- Only after the flushes are complete, zero out the remaining fields of the PASID entry.
Also, add a dma_wmb() in pasid_set_present() to ensure that all other fields of the PASID entry are visible to the hardware before the Present bit is set.(CVE-2026-45894)
In the Linux kernel, the following vulnerability has been resolved:
xfrm: fix ip_rt_bug race in icmp_route_lookup reverse path
icmp_route_lookup() performs multiple route lookups to find a suitable route for sending ICMP error messages, with special handling for XFRM (IPsec) policies.
The lookup sequence is: 1. First, lookup output route for ICMP reply (dst = original src) 2. Pass through xfrm_lookup() for policy check 3. If blocked (-EPERM) or dst is not local, enter "reverse path" 4. In reverse path, call xfrm_decode_session_reverse() to get fl4_dec which reverses the original packet's flow (saddr<->daddr swapped) 5. If fl4_dec.saddr is local (we are the original destination), use __ip_route_output_key() for output route lookup 6. If fl4_dec.saddr is NOT local (we are a forwarding node), use ip_route_input() to simulate the reverse packet's input path 7. Finally, pass rt2 through xfrm_lookup() with XFRM_LOOKUP_ICMP flag
The bug occurs in step 6: ip_route_input() is called with fl4_dec.daddr (original packet's source) as destination. If this address becomes local between the initial check and ip_route_input() call (e.g., due to concurrent "ip addr add"), ip_route_input() returns a LOCAL route with dst.output set to ip_rt_bug.
This route is then used for ICMP output, causing dst_output() to call ip_rt_bug(), triggering a WARN_ON:
------------[ cut here ]------------ WARNING: net/ipv4/route.c:1275 at ip_rt_bug+0x21/0x30, CPU#1 Call Trace: <TASK> ip_push_pending_frames+0x202/0x240 icmp_push_reply+0x30d/0x430 __icmp_send+0x1149/0x24f0 ip_options_compile+0xa2/0xd0 ip_rcv_finish_core+0x829/0x1950 ip_rcv+0x2d7/0x420 __netif_receive_skb_one_core+0x185/0x1f0 netif_receive_skb+0x90/0x450 tun_get_user+0x3413/0x3fb0 tun_chr_write_iter+0xe4/0x220 ...
Fix this by checking rt2->rt_type after ip_route_input(). If it's RTN_LOCAL, the route cannot be used for output, so treat it as an error.
The reproducer requires kernel modification to widen the race window, making it unsuitable as a selftest. It is available at:
https://gist.github.com/mrpre/eae853b72ac6a750f5d45d64ddac1e81(CVE-2026-45905)
In the Linux kernel, the following vulnerability has been resolved:
Revert "hwmon: (ibmpex) fix use-after-free in high/low store"
This reverts commit 6946c726c3f4c36f0f049e6f97e88c510b15f65d.
Jean Delvare points out that the patch does not completely fix the reported problem, that it in fact introduces a (new) race condition, and that it may actually not be needed in the first place.
Various AI reviews agree. Specific and relevant AI feedback:
" This reordering sets the driver data to NULL before removing the sensor attributes in the loop below.
ibmpex_show_sensor() retrieves this driver data via dev_get_drvdata() but does not check if it is NULL before dereferencing it to access data->sensors[].
If a userspace process reads a sensor file (like temp1_input) while this delete function is running, could it race with the dev_set_drvdata(..., NULL) call here and crash in ibmpex_show_sensor()?
Would it be safer to keep the original order where device_remove_file() is called before clearing the driver data? device_remove_file() should wait for any active sysfs callbacks to complete, which might already prevent the use-after-free this patch intends to fix. "
Revert the offending patch. If it can be shown that the originally reported alleged race condition does indeed exist, it can always be re-introduced with a complete fix.(CVE-2026-45914)
In the Linux kernel, the following vulnerability has been resolved:
fat: avoid parent link count underflow in rmdir
Corrupted FAT images can leave a directory inode with an incorrect i_nlink (e.g. 2 even though subdirectories exist). rmdir then unconditionally calls drop_nlink(dir) and can drive i_nlink to 0, triggering the WARN_ON in drop_nlink().
Add a sanity check in vfat_rmdir() and msdos_rmdir(): only drop the parent link count when it is at least 3, otherwise report a filesystem error.(CVE-2026-45915)
In the Linux kernel, the following vulnerability has been resolved:
sched/rt: Skip currently executing CPU in rto_next_cpu()
CPU0 becomes overloaded when hosting a CPU-bound RT task, a non-CPU-bound RT task, and a CFS task stuck in kernel space. When other CPUs switch from RT to non-RT tasks, RT load balancing (LB) is triggered; with HAVE_RT_PUSH_IPI enabled, they send IPIs to CPU0 to drive the execution of rto_push_irq_work_func. During push_rt_task on CPU0, if next_task->prio < rq->donor->prio, resched_curr() sets NEED_RESCHED and after the push operation completes, CPU0 calls rto_next_cpu(). Since only CPU0 is overloaded in this scenario, rto_next_cpu() should ideally return -1 (no further IPI needed).
However, multiple CPUs invoking tell_cpu_to_push() during LB increments rd->rto_loop_next. Even when rd->rto_cpu is set to -1, the mismatch between rd->rto_loop and rd->rto_loop_next forces rto_next_cpu() to restart its search from -1. With CPU0 remaining overloaded (satisfying rt_nr_migratory && rt_nr_total > 1), it gets reselected, causing CPU0 to queue irq_work to itself and send self-IPIs repeatedly. As long as CPU0 stays overloaded and other CPUs run pull_rt_tasks(), it falls into an infinite self-IPI loop, which triggers a CPU hardlockup due to continuous self-interrupts.
The trigging scenario is as follows:
cpu0 cpu1 cpu2
pull_rt_task
tell_cpu_to_push
<------------irq_work_queue_on
rto_push_irq_work_func push_rt_task resched_curr(rq) pull_rt_task rto_next_cpu tell_cpu_to_push <-------------------------- atomic_inc(rto_loop_next) rd->rto_loop != next rto_next_cpu irq_work_queue_on rto_push_irq_work_func
Fix redundant self-IPI by filtering the initiating CPU in rto_next_cpu(). This solution has been verified to effectively eliminate spurious self-IPIs and prevent CPU hardlockup scenarios.(CVE-2026-45919)
In the Linux kernel, the following vulnerability has been resolved:
ext4: fix dirtyclusters double decrement on fs shutdown
fstests test generic/388 occasionally reproduces a warning in ext4_put_super() associated with the dirty clusters count:
WARNING: CPU: 7 PID: 76064 at fs/ext4/super.c:1324 ext4_put_super+0x48c/0x590 [ext4]
Tracing the failure shows that the warning fires due to an s_dirtyclusters_counter value of -1. IOW, this appears to be a spurious decrement as opposed to some sort of leak. Further tracing of the dirty cluster count deltas and an LLM scan of the resulting output identified the cause as a double decrement in the error path between ext4_mb_mark_diskspace_used() and the caller ext4_mb_new_blocks().
First, note that generic/388 is a shutdown vs. fsstress test and so produces a random set of operations and shutdown injections. In the problematic case, the shutdown triggers an error return from the ext4_handle_dirty_metadata() call(s) made from ext4_mb_mark_context(). The changed value is non-zero at this point, so ext4_mb_mark_diskspace_used() does not exit after the error bubbles up from ext4_mb_mark_context(). Instead, the former decrements both cluster counters and returns the error up to ext4_mb_new_blocks(). The latter falls into the !ar->len out path which decrements the dirty clusters counter a second time, creating the inconsistency.
To avoid this problem and simplify ownership of the cluster reservation in this codepath, lift the counter reduction to a single place in the caller. This makes it more clear that ext4_mb_new_blocks() is responsible for acquiring cluster reservation (via ext4_claim_free_clusters()) in the !delalloc case as well as releasing it, regardless of whether it ends up consumed or returned due to failure.(CVE-2026-45920)
In the Linux kernel, the following vulnerability has been resolved:
fs/ntfs3: Fix slab-out-of-bounds read in DeleteIndexEntryRoot
In the 'DeleteIndexEntryRoot' case of the 'do_action' function, the entry size ('esize') is retrieved from the log record without adequate bounds checking.
Specifically, the code calculates the end of the entry ('e2') using: e2 = Add2Ptr(e1, esize);
It then calculates the size for memmove using 'PtrOffset(e2, ...)', which subtracts the end pointer from the buffer limit. If 'esize' is maliciously large, 'e2' exceeds the used buffer size. This results in a negative offset which, when cast to size_t for memmove, interprets as a massive unsigned integer, leading to a heap buffer overflow.
This commit adds a check to ensure that the entry size ('esize') strictly fits within the remaining used space of the index header before performing memory operations.(CVE-2026-45935)
In the Linux kernel, the following vulnerability has been resolved:
iommu/vt-d: Clear Present bit before tearing down context entry
When tearing down a context entry, the current implementation zeros the entire 128-bit entry using multiple 64-bit writes. This creates a window where the hardware can fetch a "torn" entry — where some fields are already zeroed while the 'Present' bit is still set — leading to unpredictable behavior or spurious faults.
While x86 provides strong write ordering, the compiler may reorder writes to the two 64-bit halves of the context entry. Even without compiler reordering, the hardware fetch is not guaranteed to be atomic with respect to multiple CPU writes.
Align with the "Guidance to Software for Invalidations" in the VT-d spec (Section 6.5.3.3) by implementing the recommended ownership handshake:
- Clear only the 'Present' (P) bit of the context entry first to signal the transition of ownership from hardware to software.
- Use dma_wmb() to ensure the cleared bit is visible to the IOMMU.
- Perform the required cache and context-cache invalidation to ensure hardware no longer has cached references to the entry.
- Fully zero out the entry only after the invalidation is complete.
Also, add a dma_wmb() to context_set_present() to ensure the entry is fully initialized before the 'Present' bit becomes visible.(CVE-2026-45944)
In the Linux kernel, the following vulnerability has been resolved:
ext4: fix memory leak in ext4_ext_shift_extents()
In ext4_ext_shift_extents(), if the extent is NULL in the while loop, the function returns immediately without releasing the path obtained via ext4_find_extent(), leading to a memory leak.
Fix this by jumping to the out label to ensure the path is properly released.(CVE-2026-45948)
In the Linux kernel, the following vulnerability has been resolved:
nfsd: never defer requests during idmap lookup
During v4 request compound arg decoding, some ops (e.g. SETATTR) can trigger idmap lookup upcalls. When those upcall responses get delayed beyond the allowed time limit, cache_check() will mark the request for deferral and cause it to be dropped.
This prevents nfs4svc_encode_compoundres from being executed, and thus the session slot flag NFSD4_SLOT_INUSE never gets cleared. Subsequent client requests will fail with NFSERR_JUKEBOX, given that the slot will be marked as in-use, making the SEQUENCE op fail.
Fix this by making sure that the RQ_USEDEFERRAL flag is always clear during nfs4svc_decode_compoundargs(), since no v4 request should ever be deferred.(CVE-2026-45983)
In the Linux kernel, the following vulnerability has been resolved:
ext4: don't set EXT4_GET_BLOCKS_CONVERT when splitting before submitting I/O
When allocating blocks during within-EOF DIO and writeback with dioread_nolock enabled, EXT4_GET_BLOCKS_PRE_IO was set to split an existing large unwritten extent. However, EXT4_GET_BLOCKS_CONVERT was set when calling ext4_split_convert_extents(), which may potentially result in stale data issues.
Assume we have an unwritten extent, and then DIO writes the second half.
[UUUUUUUUUUUUUUUU] on-disk extent U: unwritten extent [UUUUUUUUUUUUUUUU] extent status tree |<- ->| ----> dio write this range
First, ext4_iomap_alloc() call ext4_map_blocks() with EXT4_GET_BLOCKS_PRE_IO, EXT4_GET_BLOCKS_UNWRIT_EXT and EXT4_GET_BLOCKS_CREATE flags set. ext4_map_blocks() find this extent and call ext4_split_convert_extents() with EXT4_GET_BLOCKS_CONVERT and the above flags set.
Then, ext4_split_convert_extents() calls ext4_split_extent() with EXT4_EXT_MAY_ZEROOUT, EXT4_EXT_MARK_UNWRIT2 and EXT4_EXT_DATA_VALID2 flags set, and it calls ext4_split_extent_at() to split the second half with EXT4_EXT_DATA_VALID2, EXT4_EXT_MARK_UNWRIT1, EXT4_EXT_MAY_ZEROOUT and EXT4_EXT_MARK_UNWRIT2 flags set. However, ext4_split_extent_at() failed to insert extent since a temporary lack -ENOSPC. It zeroes out the first half but convert the entire on-disk extent to written since the EXT4_EXT_DATA_VALID2 flag set, but left the second half as unwritten in the extent status tree.
[0000000000SSSSSS] data S: stale data, 0: zeroed [WWWWWWWWWWWWWWWW] on-disk extent W: written extent [WWWWWWWWWWUUUUUU] extent status tree
Finally, if the DIO failed to write data to the disk, the stale data in the second half will be exposed once the cached extent entry is gone.
Fix this issue by not passing EXT4_GET_BLOCKS_CONVERT when splitting an unwritten extent before submitting I/O, and make ext4_split_convert_extents() to zero out the entire extent range to zero for this case, and also mark the extent in the extent status tree for consistency.(CVE-2026-45985)
In the Linux kernel, the following vulnerability has been resolved:
KVM: nSVM: Sync interrupt shadow to cached vmcb12 after VMRUN of L2
After VMRUN in guest mode, nested_sync_control_from_vmcb02() syncs fields written by the CPU from vmcb02 to the cached vmcb12. This is because the cached vmcb12 is used as the authoritative copy of some of the controls, and is the payload when saving/restoring nested state.
int_state is also written by the CPU, specifically bit 0 (i.e. SVM_INTERRUPT_SHADOW_MASK) for nested VMs, but it is not sync'd to cached vmcb12. This does not cause a problem if KVM_SET_NESTED_STATE preceeds KVM_SET_VCPU_EVENTS in the restore path, as an interrupt shadow would be correctly restored to vmcb02 (KVM_SET_VCPU_EVENTS overwrites what KVM_SET_NESTED_STATE restored in int_state).
However, if KVM_SET_VCPU_EVENTS preceeds KVM_SET_NESTED_STATE, an interrupt shadow would be restored into vmcb01 instead of vmcb02. This would mostly be benign for L1 (delays an interrupt), but not for L2. For L2, the vCPU could hang (e.g. if a wakeup interrupt is delivered before a HLT that should have been in an interrupt shadow).
Sync int_state to the cached vmcb12 in nested_sync_control_from_vmcb02() to avoid this problem. With that, KVM_SET_NESTED_STATE restores the correct interrupt shadow state, and if KVM_SET_VCPU_EVENTS follows it would overwrite it with the same value.(CVE-2026-45987)
In the Linux kernel, the following vulnerability has been resolved:
udf: fix partition descriptor append bookkeeping
Mounting a crafted UDF image with repeated partition descriptors can trigger a heap out-of-bounds write in part_descs_loc[].
handle_partition_descriptor() deduplicates entries by partition number, but appended slots never record partnum. As a result duplicate Partition Descriptors are appended repeatedly and num_part_descs keeps growing.
Once the table is full, the growth path still sizes the allocation from partnum even though inserts are indexed by num_part_descs. If partnum is already aligned to PART_DESC_ALLOC_STEP, ALIGN(partnum, step) can keep the old capacity and the next append writes past the end of the table.
Store partnum in the appended slot and size growth from the next append count so deduplication and capacity tracking follow the same model.(CVE-2026-45991)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: usb-audio: stop parsing UAC2 rates at MAX_NR_RATES
parse_uac2_sample_rate_range() caps the number of enumerated rates at MAX_NR_RATES, but it only breaks out of the current rate loop. A malformed UAC2 RANGE response with additional triplets continues parsing the remaining triplets and repeatedly prints "invalid uac2 rates" while probe still holds register_mutex.
Stop the whole parse once the cap is reached and return the number of rates collected so far.(CVE-2026-46018)
In the Linux kernel, the following vulnerability has been resolved:
dm mirror: fix integer overflow in create_dirty_log()
The argument count calculation in create_dirty_log() performs
*args_used = 2 + param_count before validating against argc. When a
user provides a param_count close to UINT_MAX via the device mapper
table string, this unsigned addition wraps around to a small value,
causing the subsequent argc < *args_used check to be bypassed.
The overflowed param_count is then passed as argc to dm_dirty_log_create(), where it can cause out-of-bounds reads on the argv array.
Fix by comparing param_count against argc - 2 before performing the addition, following the same pattern used by parse_features() in the same file. Since argc >= 2 is already guaranteed, the subtraction is safe.(CVE-2026-46023)
In the Linux kernel, the following vulnerability has been resolved:
crypto: algif_aead - snapshot IV for async AEAD requests
AF_ALG AEAD AIO requests currently use the socket-wide IV buffer during request processing. For async requests, later socket activity can update that shared state before the original request has fully completed, which can lead to inconsistent IV handling.
Snapshot the IV into per-request storage when preparing the AEAD request, so in-flight operations no longer depend on mutable socket state.(CVE-2026-46028)
In the Linux kernel, the following vulnerability has been resolved:
KVM: nSVM: Triple fault if restore host CR3 fails on nested #VMEXIT
If loading L1's CR3 fails on a nested #VMEXIT, nested_svm_vmexit() returns an error code that is ignored by most callers, and continues to run L1 with corrupted state. A sane recovery is not possible in this case, and HW behavior is to cause a shutdown. Inject a triple fault instead, and do not return early from nested_svm_vmexit(). Continue cleaning up the vCPU state (e.g. clear pending exceptions), to handle the failure as gracefully as possible.
From the APM:
Upon #VMEXIT, the processor performs the following actions in order to return to the host execution context:
...
if (illegal host state loaded, or exception while loading host state) shutdown else execute first host instruction following the VMRUN
Remove the return value of nested_svm_vmexit(), which is mostly unchecked anyway.(CVE-2026-46032)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/rxe: Validate pad and ICRC before payload_size() in rxe_rcv
rxe_rcv() currently checks only that the incoming packet is at least header_size(pkt) bytes long before payload_size() is used.
However, payload_size() subtracts both the attacker-controlled BTH pad field and RXE_ICRC_SIZE from pkt->paylen:
payload_size = pkt->paylen - offset[RXE_PAYLOAD] - bth_pad(pkt) - RXE_ICRC_SIZE
This means a short packet can still make payload_size() underflow even if it includes enough bytes for the fixed headers. Simply requiring header_size(pkt) + RXE_ICRC_SIZE is not sufficient either, because a packet with a forged non-zero BTH pad can still leave payload_size() negative and pass an underflowed value to later receive-path users.
Fix this by validating pkt->paylen against the full minimum length required by payload_size(): header_size(pkt) + bth_pad(pkt) + RXE_ICRC_SIZE.(CVE-2026-46043)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: ctxfi: Add fallback to default RSR for S/PDIF
spdif_passthru_playback_get_resources() uses atc->pll_rate as the RSR for the MSR calculation loop. However, pll_rate is only updated in atc_pll_init() and not in hw_pll_init(), so it remains 0 after the card init.
When spdif_passthru_playback_setup() skips atc_pll_init() for 32000 Hz, (rsr * desc.msr) always becomes 0, causing the loop to spin indefinitely.
Add fallback to use atc->rsr when atc->pll_rate is 0. This reflects the hardware state, since hw_card_init() already configures the PLL to the default RSR.(CVE-2026-46049)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: hci_event: fix potential UAF in SSP passkey handlers
hci_conn lookup and field access must be covered by hdev lock in hci_user_passkey_notify_evt() and hci_keypress_notify_evt(), otherwise the connection can be freed concurrently.
Extend the hci_dev_lock critical section to cover all conn usage in both handlers.
Keep the existing keypress notification behavior unchanged by routing the early exits through a common unlock path.(CVE-2026-46056)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: defio: Disconnect deferred I/O from the lifetime of struct fb_info
Hold state of deferred I/O in struct fb_deferred_io_state. Allocate an instance as part of initializing deferred I/O and remove it only after the final mapping has been closed. If the fb_info and the contained deferred I/O meanwhile goes away, clear struct fb_deferred_io_state.info to invalidate the mapping. Any access will then result in a SIGBUS signal.
Fixes a long-standing problem, where a device hot-unplug happens while user space still has an active mapping of the graphics memory. The hot- unplug frees the instance of struct fb_info. Accessing the memory will operate on undefined state.(CVE-2026-46065)
In the Linux kernel, the following vulnerability has been resolved:
spi: fix resource leaks on device setup failure
Make sure to call controller cleanup() if spi_setup() fails while registering a device to avoid leaking any resources allocated by setup().(CVE-2026-46083)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: control: Validate buf_len before strnlen() in snd_ctl_elem_init_enum_names()
snd_ctl_elem_init_enum_names() advances pointer p through the names buffer while decrementing buf_len. If buf_len reaches zero but items remain, the next iteration calls strnlen(p, 0).
While strnlen(p, 0) returns 0 and would hit the existing name_len == 0 error path, CONFIG_FORTIFY_SOURCE's fortified strnlen() first checks maxlen against __builtin_dynamic_object_size(). When Clang loses track of p's object size inside the loop, this triggers a BRK exception panic before the return value is examined.
Add a buf_len == 0 guard at the loop entry to prevent calling fortified strnlen() on an exhausted buffer.
Found by kernel fuzz testing through Xiaomi Smartphone.(CVE-2026-46088)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: reject zero shift in nft_bitwise
Reject zero shift operands for nft_bitwise left and right shift expressions during initialization.
The carry propagation logic computes the carry from the adjacent 32-bit word using BITS_PER_TYPE(u32) - shift. A zero shift operand turns this into a 32-bit shift, which is undefined behaviour.
Reject zero shift operands in the control plane, alongside the existing check for values greater than or equal to 32, so malformed rules never reach the packet path.(CVE-2026-46101)
In the Linux kernel, the following vulnerability has been resolved:
net: strparser: fix skb_head leak in strp_abort_strp()
When the stream parser is aborted, for example after a message assembly timeout, it can still hold a reference to a partially assembled message in strp->skb_head.
That skb is not released in strp_abort_strp(), which leaks the partially assembled message and can be triggered repeatedly to exhaust memory.
Fix this by freeing strp->skb_head and resetting the parser state in the abort path. Leave strp_stop() unchanged so final cleanup still happens in strp_done() after the work and timer have been synchronized.(CVE-2026-46102)
In the Linux kernel, the following vulnerability has been resolved:
dm-thin: fix metadata refcount underflow
There's a bug in dm-thin in the function rebalance_children. If the internal btree node has one entry, the code tries to copy all btree entries from the node's child to the node itself and then decrement the child's reference count.
If the child node is shared (it has reference count > 1), we won't free it, so there would be two pointers to each of the grandchildren nodes. But the reference counts of the grandchildren is not increased, thus the reference count doesn't match the number of pointers that point to the grandchildren. This results in "device mapper: space map common: unable to decrement block" errors.
Fix this bug by incrementing reference counts on the grandchildren if the btree node is shared.(CVE-2026-46107)
In the Linux kernel, the following vulnerability has been resolved:
xfrm: defensively unhash xfrm_state lists in __xfrm_state_delete
KASAN reproduces a slab-use-after-free in __xfrm_state_delete()'s hlist_del_rcu calls under syzkaller load on linux-6.12.y stable (reproduced on 6.12.47, also reachable via the same code path on torvalds/master and on the ipsec tree). Nine unique signatures cluster in the xfrm_state lifecycle, the load-bearing one being:
BUG: KASAN: slab-use-after-free in __hlist_del include/linux/list.h:990 [inline] BUG: KASAN: slab-use-after-free in hlist_del_rcu include/linux/rculist.h:516 [inline] BUG: KASAN: slab-use-after-free in __xfrm_state_delete net/xfrm/xfrm_state.c Write of size 8 at addr ffff8881198bcb70 by task kworker/u8:9/435
Workqueue: netns cleanup_net Call Trace: __hlist_del / hlist_del_rcu __xfrm_state_delete xfrm_state_delete xfrm_state_flush xfrm_state_fini ops_exit_list cleanup_net
The other observed signatures hit the same slab object from __xfrm_state_lookup, xfrm_alloc_spi, __xfrm_state_insert and an OOB write variant of __xfrm_state_delete, all on the byseq/byspi hash chains.
__xfrm_state_delete() guards its byseq and byspi unhashes with value-based predicates:
if (x->km.seq)
hlist_del_rcu(&x->byseq);
if (x->id.spi)
hlist_del_rcu(&x->byspi);
while everywhere else in the file (e.g. state_cache, state_cache_input) the safer hlist_unhashed() check is used. xfrm_alloc_spi() sets x->id.spi = newspi inside xfrm_state_lock and then immediately inserts into byspi, but a path that observes x->id.spi != 0 outside of xfrm_state_lock can still skip-or-hit the byspi unhash inconsistently with whether x is actually on the list. The same holds for x->km.seq versus byseq, and the bydst/bysrc unhashes have no predicate at all, so a second __xfrm_state_delete() on the same object writes through LIST_POISON pprev.
The defensive change here:
- Use hlist_del_init_rcu() instead of hlist_del_rcu() on bydst, bysrc, byseq and byspi so a second deletion is a no-op rather than a write through LIST_POISON pprev. The byseq/byspi nodes are already initialised in xfrm_state_alloc().
- Test hlist_unhashed() rather than the value predicate for byseq/byspi, so the unhash decision tracks list state rather than mutable scalar fields.
Empirical verification: applied this patch on top of v6.12.47, rebuilt, and re-ran the same syzkaller harness for 1h16m on a previously-crashy configuration that produced ~100 hits each of slab-use-after-free Read in xfrm_alloc_spi / Read in __xfrm_state_lookup / Write in __xfrm_state_delete. After the patch, 7.1M execs across 32 VMs at ~1550 exec/sec produced zero xfrm_state UAF/OOB hits. /proc/slabinfo confirms the xfrm_state slab is actively allocated and freed during the run (~143 KiB resident), so the fuzzer is still exercising those code paths -- they just no longer crash.
Reproduction:
- Linux 6.12.47 x86_64 + KASAN_GENERIC + KASAN_INLINE + KCOV
- syzkaller @ 746545b8b1e4c3a128db8652b340d3df90ce61db
- 32 QEMU/KVM VMs x 2 vCPU on AWS c5.metal bare metal
- 9 unique signatures collected in ~9h, all within xfrm_state lifecycle(CVE-2026-46116)
In the Linux kernel, the following vulnerability has been resolved:
net: rtnetlink: zero ifla_vf_broadcast to avoid stack infoleak in rtnl_fill_vfinfo
rtnl_fill_vfinfo() declares struct ifla_vf_broadcast on the stack without initialisation:
struct ifla_vf_broadcast vf_broadcast;
The struct contains a single fixed 32-byte field:
/* include/uapi/linux/if_link.h */
struct ifla_vf_broadcast {
__u8 broadcast[32];
};
The function then copies dev->broadcast into it using dev->addr_len as the length:
memcpy(vf_broadcast.broadcast, dev->broadcast, dev->addr_len);
On Ethernet devices (the overwhelming majority of SR-IOV NICs) dev->addr_len is 6, so only the first 6 bytes of broadcast[] are written. The remaining 26 bytes retain whatever was previously on the kernel stack. The full struct is then handed to userspace via:
nla_put(skb, IFLA_VF_BROADCAST,
sizeof(vf_broadcast), &vf_broadcast)
leaking up to 26 bytes of uninitialised kernel stack per VF per RTM_GETLINK request, repeatable.
The other vf_* structs in the same function are explicitly zeroed for exactly this reason - see the memset() calls for ivi, vf_vlan_info, node_guid and port_guid a few lines above. vf_broadcast was simply missed when it was added.
Reachability: any unprivileged local process can open AF_NETLINK / NETLINK_ROUTE without capabilities and send RTM_GETLINK with an IFLA_EXT_MASK attribute carrying RTEXT_FILTER_VF. The kernel walks each VF and emits IFLA_VF_BROADCAST, leaking 26 bytes of stack per VF per request. Stack residue at this call site can include return addresses and transient sensitive data; KASAN with stack instrumentation, or KMSAN, will flag the nla_put() when reproduced.
Zero the on-stack struct before the partial memcpy, matching the existing pattern used for the other vf_* structs in the same function.(CVE-2026-46132)
In the Linux kernel, xfrm6_rcv_encap() performs an IPv6 route lookup when the skb does not already have a dst attached. ip6_route_input_lookup() returns a referenced dst entry even when the lookup resolves to an error route. If dst->error is set, xfrm6_rcv_encap() drops the skb without attaching the dst to the skb and without releasing the reference returned by the lookup. Repeated packets hitting this path therefore leak dst entries.(CVE-2026-46172)
In the Linux kernel, the mlx4_ib_create_srq() function fails to release resources allocated by mlx4_srq_alloc() in error handling paths, leading to a resource leak. An attacker could exploit this vulnerability to cause resource exhaustion or denial of service.(CVE-2026-46178)
In the Linux kernel, the ua101 driver has a division by zero vulnerability at probe. The detect_usb_format() function lacks a sanity check for the bNrChannels field. When a malicious USB audio device provides bNrChannels=0, frame_bytes becomes zero and is later used as a divisor in playback_urb_complete() and capture_urb_complete(), causing a kernel crash. USB core does not validate class-specific descriptor fields, so drivers must verify them before use.(CVE-2026-46184)
In the Linux kernel, drm_gem_fb_init_with_funcs() computes sub-sampled plane dimensions using plain integer division, while the ioctl-level framebuffer_check() uses DIV_ROUND_UP via drm_format_info_plane_width/height(). This inconsistency causes incorrect GEM object size validation for certain pixel formats and dimensions, e.g., NV12 with height=1 results in height=0, leading to an integer overflow in size check and allowing undersized GEM objects to pass, potentially causing out-of-bounds memory access by the GPU.(CVE-2026-46209)
In the Linux kernel, the following vulnerability has been resolved: MIPS: Work around LLVM bug when gp is used as global register variable On MIPS, __current_thread_info is defined as global register variable locating in $gp, and is simply assigned with new address during kernel relocation. This however is broken with LLVM, which always restores $gp if it finds $gp is clobbered in any form, including when intentionally through a global register variable. This is against GCC's documentation[1], which requires a callee-saved register used as global register variable not to be restored if it's clobbered. As a result, $gp will continue to point to the unrelocated kernel after the epilog of relocate_kernel(), leading to an early crash in init_idle, [ 0.000000] CPU 0 Unable to handle kernel paging request at virtual address 0000000000000000, epc == ffffffff81afada8, ra == ffffffff81afad90 [ 0.000000] Oops[#1]: [ 0.000000] CPU: 0 UID: 0 PID: 0 Comm: swapper Tainted: G W 6.19.0-rc5-00262-gd3eeb99bbc99-dirty #188 VOLUNTARY [ 0.000000] Tainted: [W]=WARN [ 0.000000] Hardware name: loongson,loongson64v-4core-virtio [ 0.000000] $ 0 : 0000000000000000 0000000000000000 0000000000000001 0000000000000000 [ 0.000000] $ 4 : ffffffff80b80ec0 ffffffff80b53d48 0000000000000000 00000000000f4240 [ 0.000000] $ 8 : 0000000000000100 ffffffff81d82f80 ffffffff81d82f80 0000000000000001 [ 0.000000] $12 : 0000000000000000 ffffffff81776f58 00000000000005da 0000000000000002 [ 0.000000] $16 : ffffffff80b80e40 0000000000000000 ffffffff80b81614 9800000005dfbe80 [ 0.000000] $20 : 00000000540000e0 ffffffff81980000 0000000000000000 ffffffff80f81c80 [ 0.000000] $24 : 0000000000000a26 ffffffff8114fb90 [ 0.000000] $28 : ffffffff80b50000 ffffffff80b53d40 0000000000000000 ffffffff81afad90 [ 0.000000] Hi : 0000000000000000 [ 0.000000] Lo : 0000000000000000 [ 0.000000] epc : ffffffff81afada8 init_idle+0x130/0x270 [ 0.000000] ra : ffffffff81afad90 init_idle+0x118/0x270 [ 0.000000] Status: 540000e2 KX SX UX KERNEL EXL [ 0.000000] Cause : 00000008 (ExcCode 02) [ 0.000000] BadVA : 0000000000000000 [ 0.000000] PrId : 00006305 (ICT Loongson-3) [ 0.000000] Process swapper (pid: 0, threadinfo=(_ptrval_), task=(_ptrval_), tls=0000000000000000) [ 0.000000] Stack : 9800000005dfbf00 ffffffff8178e950 0000000000000000 0000000000000000 [ 0.000000] 0000000000000000 ffffffff81970000 000000000000003f ffffffff810a6528 [ 0.000000] 0000000000000001 9800000005dfbe80 9800000005dfbf00 ffffffff81980000 [ 0.000000] ffffffff810a6450 ffffffff81afb6c0 0000000000000000 ffffffff810a2258 [ 0.000000] ffffffff81d82ec8 ffffffff8198d010 ffffffff81b67e80 ffffffff8197dd98 [ 0.000000] ffffffff81d81c80 ffffffff81930000 0000000000000040 0000000000000000 [ 0.000000] 0000000000000000 0000000000000000 0000000000000000 0000000000000000 [ 0.000000] 0000000000000000 000000000000009e ffffffff9fc01000 0000000000000000 [ 0.000000] 0000000000000000 0000000000000000 0000000000000000 0000000000000000 [ 0.000000] 0000000000000000 ffffffff81ae86dc ffffffff81b3c741 0000000000000002 [ 0.000000] ... [ 0.000000] Call Trace: [ 0.000000] [<ffffffff81afada8>] init_idle+0x130/0x270 [ 0.000000] [<ffffffff81afb6c0>] sched_init+0x5c8/0x6c0 [ 0.000000] [<ffffffff81ae86dc>] start_kernel+0x27c/0x7a8 This bug has been reported to LLVM[2] and affects version from (at least) 18 to 21. Let's work around this by using inline assembly to assign $gp before a fix is widely available. The Linux kernel CVE team has assigned CVE-2026-46250 to this issue.(CVE-2026-46250)
In the Linux kernel, the following vulnerability has been resolved: pstore/ram: fix buffer overflow in persistent_ram_save_old() persistent_ram_save_old() can be called multiple times for the same persistent_ram_zone (e.g., via ramoops_pstore_read -> ramoops_get_next_prz for PSTORE_TYPE_DMESG records). Currently, the function only allocates prz->old_log when it is NULL, but it unconditionally updates prz->old_log_size to the current buffer size and then performs memcpy_fromio() using this new size. If the buffer size has grown since the first allocation (which can happen across different kernel boot cycles), this leads to: 1. A heap buffer overflow (OOB write) in the memcpy_fromio() calls 2. A subsequent OOB read when ramoops_pstore_read() accesses the buffer using the incorrect (larger) old_log_size The KASAN splat would look similar to: BUG: KASAN: slab-out-of-bounds in ramoops_pstore_read+0x... Read of size N at addr ... by task ... The conditions are likely extremely hard to hit: 0. Crash with a ramoops write of less-than-record-max-size bytes. 1. Reboot: ramoops registers, pstore_get_records(0) reads old crash, allocates old_log with size X 2. Crash handler registered, timer started (if pstore_update_ms >= 0) 3. Oops happens (non-fatal, system continues) 4. pstore_dump() writes oops via ramoops_pstore_write() size Y (>X) 5. pstore_new_entry = 1, pstore_timer_kick() called 6. System continues running (not a panic oops) 7. Timer fires after pstore_update_ms milliseconds 8. pstore_timefunc() → schedule_work() → pstore_dowork() → pstore_get_records(1) 9. ramoops_get_next_prz() → persistent_ram_save_old() 10. buffer_size() returns Y, but old_log is X bytes 11. Y > X: memcpy_fromio() overflows heap Requirements: - a prior crash record exists that did not fill the record size (almost impossible since the crash handler writes as much as it can possibly fit into the record, capped by max record size and the kmsg buffer almost always exceeds the max record size) - pstore_update_ms >= 0 (disabled by default) - Non-fatal oops (system survives) Free and reallocate the buffer when the new size differs from the previously allocated size. This ensures old_log always has sufficient space for the data being copied. The Linux kernel CVE team has assigned CVE-2026-46253 to this issue.(CVE-2026-46253)
In the Linux kernel, the following vulnerability has been resolved: procfs: fix missing RCU protection when reading real_parent in do_task_stat() When reading /proc/[pid]/stat, do_task_stat() accesses task->real_parent without proper RCU protection, which leads to: cpu 0 cpu 1 ----- ----- do_task_stat var = task->real_parent release_task call_rcu(delayed_put_task_struct) task_tgid_nr_ns(var) rcu_read_lock <--- Too late to protect task->real_parent! task_pid_ptr <--- UAF! rcu_read_unlock This patch uses task_ppid_nr_ns() instead of task_tgid_nr_ns() to add proper RCU protection for accessing task->real_parent. The Linux kernel CVE team has assigned CVE-2026-46259 to this issue.(CVE-2026-46259)
In the Linux kernel, the following vulnerability has been resolved: RDMA/hns: Fix WQ_MEM_RECLAIM warning When sunrpc is used, if a reset triggered, our wq may lead the following trace: workqueue: WQ_MEM_RECLAIM xprtiod:xprt_rdma_connect_worker [rpcrdma] is flushing !WQ_MEM_RECLAIM hns_roce_irq_workq:flush_work_handle [hns_roce_hw_v2] WARNING: CPU: 0 PID: 8250 at kernel/workqueue.c:2644 check_flush_dependency+0xe0/0x144 Call trace: check_flush_dependency+0xe0/0x144 start_flush_work.constprop.0+0x1d0/0x2f0 __flush_work.isra.0+0x40/0xb0 flush_work+0x14/0x30 hns_roce_v2_destroy_qp+0xac/0x1e0 [hns_roce_hw_v2] ib_destroy_qp_user+0x9c/0x2b4 rdma_destroy_qp+0x34/0xb0 rpcrdma_ep_destroy+0x28/0xcc [rpcrdma] rpcrdma_ep_put+0x74/0xb4 [rpcrdma] rpcrdma_xprt_disconnect+0x1d8/0x260 [rpcrdma] xprt_rdma_connect_worker+0xc0/0x120 [rpcrdma] process_one_work+0x1cc/0x4d0 worker_thread+0x154/0x414 kthread+0x104/0x144 ret_from_fork+0x10/0x18 Since QP destruction frees memory, this wq should have the WQ_MEM_RECLAIM. The Linux kernel CVE team has assigned CVE-2026-46265 to this issue.(CVE-2026-46265)
| URL | Type | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"bpftool-debuginfo-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-debuginfo-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-debugsource-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-devel-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-headers-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-source-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-tools-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-tools-devel-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"perf-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"perf-debuginfo-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"python3-perf-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm"
],
"src": [
"kernel-5.10.0-318.0.0.221.oe2203sp4.src.rpm"
],
"x86_64": [
"bpftool-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"bpftool-debuginfo-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-debuginfo-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-debugsource-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-devel-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-headers-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-source-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-tools-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-tools-devel-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"perf-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"perf-debuginfo-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"python3-perf-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-318.0.0.221.oe2203sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbtrfs: qgroup: fix race between quota disable and quota rescan ioctl\n\nThere\u0026apos;s a race between a task disabling quotas and another running the\nrescan ioctl that can result in a use-after-free of qgroup records from\nthe fs_info-\u0026gt;qgroup_tree rbtree.\n\nThis happens as follows:\n\n1) Task A enters btrfs_ioctl_quota_rescan() -\u0026gt; btrfs_qgroup_rescan();\n\n2) Task B enters btrfs_quota_disable() and calls\n btrfs_qgroup_wait_for_completion(), which does nothing because at that\n point fs_info-\u0026gt;qgroup_rescan_running is false (it wasn\u0026apos;t set yet by\n task A);\n\n3) Task B calls btrfs_free_qgroup_config() which starts freeing qgroups\n from fs_info-\u0026gt;qgroup_tree without taking the lock fs_info-\u0026gt;qgroup_lock;\n\n4) Task A enters qgroup_rescan_zero_tracking() which starts iterating\n the fs_info-\u0026gt;qgroup_tree tree while holding fs_info-\u0026gt;qgroup_lock,\n but task B is freeing qgroup records from that tree without holding\n the lock, resulting in a use-after-free.\n\nFix this by taking fs_info-\u0026gt;qgroup_lock at btrfs_free_qgroup_config().\nAlso at btrfs_qgroup_rescan() don\u0026apos;t start the rescan worker if quotas\nwere already disabled.(CVE-2025-39759)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: wilc1000: avoid buffer overflow in WID string configuration\n\nFix the following copy overflow warning identified by Smatch checker.\n\n drivers/net/wireless/microchip/wilc1000/wlan_cfg.c:184 wilc_wlan_parse_response_frame()\n error: \u0026apos;__memcpy()\u0026apos; \u0026apos;cfg-\u0026gt;s[i]-\u0026gt;str\u0026apos; copy overflow (512 vs 65537)\n\nThis patch introduces size check before accessing the memory buffer.\nThe checks are base on the WID type of received data from the firmware.\nFor WID string configuration, the size limit is determined by individual\nelement size in \u0026apos;struct wilc_cfg_str_vals\u0026apos; that is maintained in \u0026apos;len\u0026apos; field\nof \u0026apos;struct wilc_cfg_str\u0026apos;.(CVE-2025-39952)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niio: accel: bmc150: Fix irq assumption regression\n\nThe code in bmc150-accel-core.c unconditionally calls\nbmc150_accel_set_interrupt() in the iio_buffer_setup_ops,\nsuch as on the runtime PM resume path giving a kernel\nsplat like this if the device has no interrupts:\n\nUnable to handle kernel NULL pointer dereference at virtual\n address 00000001 when read\n\nPC is at bmc150_accel_set_interrupt+0x98/0x194\nLR is at __pm_runtime_resume+0x5c/0x64\n(...)\nCall trace:\nbmc150_accel_set_interrupt from bmc150_accel_buffer_postenable+0x40/0x108\nbmc150_accel_buffer_postenable from __iio_update_buffers+0xbe0/0xcbc\n__iio_update_buffers from enable_store+0x84/0xc8\nenable_store from kernfs_fop_write_iter+0x154/0x1b4\n\nThis bug seems to have been in the driver since the beginning,\nbut it only manifests recently, I do not know why.\n\nStore the IRQ number in the state struct, as this is a common\npattern in other drivers, then use this to determine if we have\nIRQ support or not.(CVE-2025-68330)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nstaging: most: remove broken i2c driver\n\nThe MOST I2C driver has been completely broken for five years without\nanyone noticing so remove the driver from staging.\n\nSpecifically, commit 723de0f9171e (\u0026quot;staging: most: remove device from\ninterface structure\u0026quot;) started requiring drivers to set the interface\ndevice pointer before registration, but the I2C driver was never updated\nwhich results in a NULL pointer dereference if anyone ever tries to\nprobe it.(CVE-2025-68755)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbtrfs: fix NULL dereference on root when tracing inode eviction\n\nWhen evicting an inode the first thing we do is to setup tracing for it,\nwhich implies fetching the root\u0026apos;s id. But in btrfs_evict_inode() the\nroot might be NULL, as implied in the next check that we do in\nbtrfs_evict_inode().\n\nHence, we either should set the -\u0026gt;root_objectid to 0 in case the root is\nNULL, or we move tracing setup after checking that the root is not\nNULL. Setting the rootid to 0 at least gives us the possibility to trace\nthis call even in the case when the root is NULL, so that\u0026apos;s the solution\ntaken here.(CVE-2025-71184)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfbdev: udlfb: avoid divide-by-zero on FBIOPUT_VSCREENINFO\n\nMuch like commit 19f953e74356 (\u0026quot;fbdev: fb_pm2fb: Avoid potential divide\nby zero error\u0026quot;), we also need to prevent that same crash from happening\nin the udlfb driver as it uses pixclock directly when dividing, which\nwill crash.(CVE-2026-31605)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusbip: validate number_of_packets in usbip_pack_ret_submit()\n\nWhen a USB/IP client receives a RET_SUBMIT response,\nusbip_pack_ret_submit() unconditionally overwrites\nurb-\u0026gt;number_of_packets from the network PDU. This value is\nsubsequently used as the loop bound in usbip_recv_iso() and\nusbip_pad_iso() to iterate over urb-\u0026gt;iso_frame_desc[], a flexible\narray whose size was fixed at URB allocation time based on the\n*original* number_of_packets from the CMD_SUBMIT.\n\nA malicious USB/IP server can set number_of_packets in the response\nto a value larger than what was originally submitted, causing a heap\nout-of-bounds write when usbip_recv_iso() writes to\nurb-\u0026gt;iso_frame_desc[i] beyond the allocated region.\n\nKASAN confirmed this with kernel 7.0.0-rc5:\n\n BUG: KASAN: slab-out-of-bounds in usbip_recv_iso+0x46a/0x640\n Write of size 4 at addr ffff888106351d40 by task vhci_rx/69\n\n The buggy address is located 0 bytes to the right of\n allocated 320-byte region [ffff888106351c00, ffff888106351d40)\n\nThe server side (stub_rx.c) and gadget side (vudc_rx.c) already\nvalidate number_of_packets in the CMD_SUBMIT path since commits\nc6688ef9f297 (\u0026quot;usbip: fix stub_rx: harden CMD_SUBMIT path to handle\nmalicious input\u0026quot;) and b78d830f0049 (\u0026quot;usbip: fix vudc_rx: harden\nCMD_SUBMIT path to handle malicious input\u0026quot;). The server side validates\nagainst USBIP_MAX_ISO_PACKETS because no URB exists yet at that point.\nOn the client side we have the original URB, so we can use the tighter\nbound: the response must not exceed the original number_of_packets.\n\nThis mirrors the existing validation of actual_length against\ntransfer_buffer_length in usbip_recv_xbuff(), which checks the\nresponse value against the original allocation size.\n\nKelvin Mbogo\u0026apos;s series (\u0026quot;usb: usbip: fix integer overflow in\nusbip_recv_iso()\u0026quot;, v2) hardens the receive-side functions themselves;\nthis patch complements that work by catching the bad value at its\nsource -- in usbip_pack_ret_submit() before the overwrite -- and\nusing the tighter per-URB allocation bound rather than the global\nUSBIP_MAX_ISO_PACKETS limit.\n\nFix this by checking rpdu-\u0026gt;number_of_packets against\nurb-\u0026gt;number_of_packets in usbip_pack_ret_submit() before the\noverwrite. On violation, clamp to zero so that usbip_recv_iso() and\nusbip_pad_iso() safely return early.(CVE-2026-31607)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: gadget: renesas_usb3: validate endpoint index in standard request handlers\n\nThe GET_STATUS and SET/CLEAR_FEATURE handlers extract the endpoint\nnumber from the host-supplied wIndex without any sort of validation.\nFix this up by validating the number of endpoints actually match up with\nthe number the device has before attempting to dereference a pointer\nbased on this math.\n\nThis is just like what was done in commit ee0d382feb44 (\u0026quot;usb: gadget:\naspeed_udc: validate endpoint index for ast udc\u0026quot;) for the aspeed driver.(CVE-2026-31615)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: gadget: f_phonet: fix skb frags[] overflow in pn_rx_complete()\n\nA broken/bored/mean USB host can overflow the skb_shared_info-\u0026gt;frags[]\narray on a Linux gadget exposing a Phonet function by sending an\nunbounded sequence of full-page OUT transfers.\n\npn_rx_complete() finalizes the skb only when req-\u0026gt;actual \u0026lt; req-\u0026gt;length,\nwhere req-\u0026gt;length is set to PAGE_SIZE by the gadget. If the host always\nsends exactly PAGE_SIZE bytes per transfer, fp-\u0026gt;rx.skb will never be\nreset and each completion will add another fragment via\nskb_add_rx_frag(). Once nr_frags exceeds MAX_SKB_FRAGS (default 17),\nsubsequent frag stores overwrite memory adjacent to the shinfo on the\nheap.\n\nDrop the skb and account a length error when the frag limit is reached,\nmatching the fix applied in t7xx by commit f0813bcd2d9d (\u0026quot;net: wwan:\nt7xx: fix potential skb-\u0026gt;frags overflow in RX path\u0026quot;).(CVE-2026-31616)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: gadget: f_ncm: validate minimum block_len in ncm_unwrap_ntb()\n\nThe block_len read from the host-supplied NTB header is checked against\nntb_max but has no lower bound. When block_len is smaller than\nopts-\u0026gt;ndp_size, the bounds check of:\n\tndp_index \u0026gt; (block_len - opts-\u0026gt;ndp_size)\nwill underflow producing a huge unsigned value that ndp_index can never\nexceed, defeating the check entirely.\n\nThe same underflow occurs in the datagram index checks against block_len\n- opts-\u0026gt;dpe_size. With those checks neutered, a malicious USB host can\nchoose ndp_index and datagram offsets that point past the actual\ntransfer, and the skb_put_data() copies adjacent kernel memory into the\nnetwork skb.\n\nFix this by rejecting block lengths that cannot hold at least the NTB\nheader plus one NDP. This will make block_len - opts-\u0026gt;ndp_size and\nblock_len - opts-\u0026gt;dpe_size both well-defined.\n\nCommit 8d2b1a1ec9f5 (\u0026quot;CDC-NCM: avoid overflow in sanity checking\u0026quot;) fixed\na related class of issues on the host side of NCM.(CVE-2026-31617)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfbdev: tdfxfb: avoid divide-by-zero on FBIOPUT_VSCREENINFO\n\nMuch like commit 19f953e74356 (\u0026quot;fbdev: fb_pm2fb: Avoid potential divide\nby zero error\u0026quot;), we also need to prevent that same crash from happening\nin the udlfb driver as it uses pixclock directly when dividing, which\nwill crash.(CVE-2026-31618)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/packet: fix TOCTOU race on mmap\u0026apos;d vnet_hdr in tpacket_snd()\n\nIn tpacket_snd(), when PACKET_VNET_HDR is enabled, vnet_hdr points\ndirectly into the mmap\u0026apos;d TX ring buffer shared with userspace. The\nkernel validates the header via __packet_snd_vnet_parse() but then\nre-reads all fields later in virtio_net_hdr_to_skb(). A concurrent\nuserspace thread can modify the vnet_hdr fields between validation\nand use, bypassing all safety checks.\n\nThe non-TPACKET path (packet_snd()) already correctly copies vnet_hdr\nto a stack-local variable. All other vnet_hdr consumers in the kernel\n(tun.c, tap.c, virtio_net.c) also use stack copies. The TPACKET TX\npath is the only caller of virtio_net_hdr_to_skb() that reads directly\nfrom user-controlled shared memory.\n\nFix this by copying vnet_hdr from the mmap\u0026apos;d ring buffer to a\nstack-local variable before validation and use, consistent with the\napproach used in packet_snd() and all other callers.(CVE-2026-31700)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBuffer overflow in drivers/xen/sys-hypervisor.c\n\nThe build id returned by HYPERVISOR_xen_version(XENVER_build_id) is\nneither NUL terminated nor a string.\n\nThe first causes a buffer overflow as sprintf in buildid_show will\nread and copy till it finds a NUL.\n\n00000000 f4 91 51 f4 dd 38 9e 9d 65 47 52 eb 10 71 db 50 |..Q..8..eGR..q.P|\n00000010 b9 a8 01 42 6f 2e 32 |...Bo.2|\n00000017\n\nSo use a memcpy instead of sprintf to have the correct value:\n\n00000000 f4 91 51 f4 dd 00 9e 9d 65 47 52 eb 10 71 db 50 |..Q.....eGR..q.P|\n00000010 b9 a8 01 42 |...B|\n00000014\n\n(the above have a hack to embed a zero inside and check it\u0026apos;s\nreturned correctly).\n\nThis is XSA-485 / CVE-2026-31786(CVE-2026-31786)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: algif_aead - Fix minimum RX size check for decryption\n\nThe check for the minimum receive buffer size did not take the\ntag size into account during decryption. Fix this by adding the\nrequired extra length.(CVE-2026-43077)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: af_alg - Fix page reassignment overflow in af_alg_pull_tsgl\n\nWhen page reassignment was added to af_alg_pull_tsgl the original\nloop wasn\u0026apos;t updated so it may try to reassign one more page than\nnecessary.\n\nAdd the check to the reassignment so that this does not happen.\n\nAlso update the comment which still refers to the obsolete offset\nargument.(CVE-2026-43078)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm: Wait for RCU readers during policy netns exit\n\nxfrm_policy_fini() frees the policy_bydst hash tables after flushing the\npolicy work items and deleting all policies, but it does not wait for\nconcurrent RCU readers to leave their read-side critical sections first.\n\nThe policy_bydst tables are published via rcu_assign_pointer() and are\nlooked up through rcu_dereference_check(), so netns teardown must also\nwait for an RCU grace period before freeing the table memory.\n\nFix this by adding synchronize_rcu() before freeing the policy hash tables.(CVE-2026-43091)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxsk: tighten UMEM headroom validation to account for tailroom and min frame\n\nThe current headroom validation in xdp_umem_reg() could leave us with\ninsufficient space dedicated to even receive minimum-sized ethernet\nframe. Furthermore if multi-buffer would come to play then\nskb_shared_info stored at the end of XSK frame would be corrupted.\n\nHW typically works with 128-aligned sizes so let us provide this value\nas bare minimum.\n\nMulti-buffer setting is known later in the configuration process so\nbesides accounting for 128 bytes, let us also take care of tailroom space\nupfront.(CVE-2026-43093)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: ctnetlink: ensure safe access to master conntrack\n\nHolding reference on the expectation is not sufficient, the master\nconntrack object can just go away, making exp-\u0026gt;master invalid.\n\nTo access exp-\u0026gt;master safely:\n\n- Grab the nf_conntrack_expect_lock, this gets serialized with\n clean_from_lists() which also holds this lock when the master\n conntrack goes away.\n\n- Hold reference on master conntrack via nf_conntrack_find_get().\n Not so easy since the master tuple to look up for the master conntrack\n is not available in the existing problematic paths.\n\nThis patch goes for extending the nf_conntrack_expect_lock section\nto address this issue for simplicity, in the cases that are described\nbelow this is just slightly extending the lock section.\n\nThe add expectation command already holds a reference to the master\nconntrack from ctnetlink_create_expect().\n\nHowever, the delete expectation command needs to grab the spinlock\nbefore looking up for the expectation. Expand the existing spinlock\nsection to address this to cover the expectation lookup. Note that,\nthe nf_ct_expect_iterate_net() calls already grabs the spinlock while\niterating over the expectation table, which is correct.\n\nThe get expectation command needs to grab the spinlock to ensure master\nconntrack does not go away. This also expands the existing spinlock\nsection to cover the expectation lookup too. I needed to move the\nnetlink skb allocation out of the spinlock to keep it GFP_KERNEL.\n\nFor the expectation events, the IPEXP_DESTROY event is already delivered\nunder the spinlock, just move the delivery of IPEXP_NEW under the\nspinlock too because the master conntrack event cache is reached through\nexp-\u0026gt;master.\n\nWhile at it, add lockdep notations to help identify what codepaths need\nto grab the spinlock.(CVE-2026-43116)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndlm: validate length in dlm_search_rsb_tree\n\nThe len parameter in dlm_dump_rsb_name() is not validated and comes\nfrom network messages. When it exceeds DLM_RESNAME_MAXLEN, it can\ncause out-of-bounds write in dlm_search_rsb_tree().\n\nAdd length validation to prevent potential buffer overflow.(CVE-2026-43125)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/vt-d: Flush dev-IOTLB only when PCIe device is accessible in scalable mode\n\nCommit 4fc82cd907ac (\u0026quot;iommu/vt-d: Don\u0026apos;t issue ATS Invalidation\nrequest when device is disconnected\u0026quot;) relies on\npci_dev_is_disconnected() to skip ATS invalidation for\nsafely-removed devices, but it does not cover link-down caused\nby faults, which can still hard-lock the system.\n\nFor example, if a VM fails to connect to the PCIe device,\n\u0026quot;virsh destroy\u0026quot; is executed to release resources and isolate\nthe fault, but a hard-lockup occurs while releasing the group fd.\n\nCall Trace:\n qi_submit_sync\n qi_flush_dev_iotlb\n intel_pasid_tear_down_entry\n device_block_translation\n blocking_domain_attach_dev\n __iommu_attach_device\n __iommu_device_set_domain\n __iommu_group_set_domain_internal\n iommu_detach_group\n vfio_iommu_type1_detach_group\n vfio_group_detach_container\n vfio_group_fops_release\n __fput\n\nAlthough pci_device_is_present() is slower than\npci_dev_is_disconnected(), it still takes only ~70 \u00b5s on a\nConnectX-5 (8 GT/s, x2) and becomes even faster as PCIe speed\nand width increase.\n\nBesides, devtlb_invalidation_with_pasid() is called only in the\npaths below, which are far less frequent than memory map/unmap.\n\n1. mm-struct release\n2. {attach,release}_dev\n3. set/remove PASID\n4. dirty-tracking setup\n\nThe gain in system stability far outweighs the negligible cost\nof using pci_device_is_present() instead of pci_dev_is_disconnected()\nto decide when to skip ATS invalidation, especially under GDR\nhigh-load conditions.(CVE-2026-43130)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm6: fix uninitialized saddr in xfrm6_get_saddr()\n\nxfrm6_get_saddr() does not check the return value of\nipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable\nsource address (returns -EADDRNOTAVAIL), saddr-\u0026gt;in6 is left\nuninitialized, but xfrm6_get_saddr() still returns 0 (success).\n\nThis causes the caller xfrm_tmpl_resolve_one() to use the uninitialized\naddress in xfrm_state_find(), triggering KMSAN warning:\n\n=====================================================\nBUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940\n xfrm_state_find+0x2424/0xa940\n xfrm_resolve_and_create_bundle+0x906/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n xfrm_lookup_route+0x63/0x2b0\n ip_route_output_flow+0x1ce/0x270\n udp_sendmsg+0x2ce1/0x3400\n inet_sendmsg+0x1ef/0x2a0\n __sock_sendmsg+0x278/0x3d0\n __sys_sendto+0x593/0x720\n __x64_sys_sendto+0x130/0x200\n x64_sys_call+0x332b/0x3e70\n do_syscall_64+0xd3/0xf80\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\n\nLocal variable tmp.i.i created at:\n xfrm_resolve_and_create_bundle+0x3e3/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n=====================================================\n\nFix by checking the return value of ipv6_dev_get_saddr() and propagating\nthe error.(CVE-2026-43139)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: xt_tcpmss: check remaining length before reading optlen\n\nQuoting reporter:\n In net/netfilter/xt_tcpmss.c (lines 53-68), the TCP option parser reads\n op[i+1] directly without validating the remaining option length.\n\n If the last byte of the option field is not EOL/NOP (0/1), the code attempts\n to index op[i+1]. In the case where i + 1 == optlen, this causes an\n out-of-bounds read, accessing memory past the optlen boundary\n (either reading beyond the stack buffer _opt or the\n following payload).(CVE-2026-43190)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntcp: fix potential race in tcp_v6_syn_recv_sock()\n\nCode in tcp_v6_syn_recv_sock() after the call to tcp_v4_syn_recv_sock()\nis done too late.\n\nAfter tcp_v4_syn_recv_sock(), the child socket is already visible\nfrom TCP ehash table and other cpus might use it.\n\nSince newinet-\u0026gt;pinet6 is still pointing to the listener ipv6_pinfo\nbad things can happen as syzbot found.\n\nMove the problematic code in tcp_v6_mapped_child_init()\nand call this new helper from tcp_v4_syn_recv_sock() before\nthe ehash insertion.\n\nThis allows the removal of one tcp_sync_mss(), since\ntcp_v4_syn_recv_sock() will call it with the correct\ncontext.(CVE-2026-43198)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: nf_conntrack_h323: fix OOB read in decode_choice()\n\nIn decode_choice(), the boundary check before get_len() uses the\nvariable `len`, which is still 0 from its initialization at the top of\nthe function:\n\n unsigned int type, ext, len = 0;\n ...\n if (ext || (son-\u0026gt;attr \u0026amp; OPEN)) {\n BYTE_ALIGN(bs);\n if (nf_h323_error_boundary(bs, len, 0)) /* len is 0 here */\n return H323_ERROR_BOUND;\n len = get_len(bs); /* OOB read */\n\nWhen the bitstream is exactly consumed (bs-\u0026gt;cur == bs-\u0026gt;end), the check\nnf_h323_error_boundary(bs, 0, 0) evaluates to (bs-\u0026gt;cur + 0 \u0026gt; bs-\u0026gt;end),\nwhich is false. The subsequent get_len() call then dereferences\n*bs-\u0026gt;cur++, reading 1 byte past the end of the buffer. If that byte\nhas bit 7 set, get_len() reads a second byte as well.\n\nThis can be triggered remotely by sending a crafted Q.931 SETUP message\nwith a User-User Information Element containing exactly 2 bytes of\nPER-encoded data ({0x08, 0x00}) to port 1720 through a firewall with\nthe nf_conntrack_h323 helper active. The decoder fully consumes the\nPER buffer before reaching this code path, resulting in a 1-2 byte\nheap-buffer-overflow read confirmed by AddressSanitizer.\n\nFix this by checking for 2 bytes (the maximum that get_len() may read)\ninstead of the uninitialized `len`. This matches the pattern used at\nevery other get_len() call site in the same file, where the caller\nchecks for 2 bytes of available data before calling get_len().(CVE-2026-43233)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/amd: move wait_on_sem() out of spinlock\n\nWith iommu.strict=1, the existing completion wait path can cause soft\nlockups under stressed environment, as wait_on_sem() busy-waits under the\nspinlock with interrupts disabled.\n\nMove the completion wait in iommu_completion_wait() out of the spinlock.\nwait_on_sem() only polls the hardware-updated cmd_sem and does not require\niommu-\u0026gt;lock, so holding the lock during the busy wait unnecessarily\nincreases contention and extends the time with interrupts disabled.(CVE-2026-43253)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nspi: spidev: fix lock inversion between spi_lock and buf_lock\n\nThe spidev driver previously used two mutexes, spi_lock and buf_lock,\nbut acquired them in different orders depending on the code path:\n\n write()/read(): buf_lock -\u0026gt; spi_lock\n ioctl(): spi_lock -\u0026gt; buf_lock\n\nThis AB-BA locking pattern triggers lockdep warnings and can\ncause real deadlocks:\n\n WARNING: possible circular locking dependency detected\n spidev_ioctl() -\u0026gt; mutex_lock(\u0026amp;spidev-\u0026gt;buf_lock)\n spidev_sync_write() -\u0026gt; mutex_lock(\u0026amp;spidev-\u0026gt;spi_lock)\n *** DEADLOCK ***\n\nThe issue is reproducible with a simple userspace program that\nperforms write() and SPI_IOC_WR_MAX_SPEED_HZ ioctl() calls from\nseparate threads on the same spidev file descriptor.\n\nFix this by simplifying the locking model and removing the lock\ninversion entirely. spidev_sync() no longer performs any locking,\nand all callers serialize access using spi_lock.\n\nbuf_lock is removed since its functionality is fully covered by\nspi_lock, eliminating the possibility of lock ordering issues.\n\nThis removes the lock inversion and prevents deadlocks without\nchanging userspace ABI or behaviour.(CVE-2026-43319)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipv6: prevent possible UaF in addrconf_permanent_addr()\n\nThe mentioned helper try to warn the user about an exceptional\ncondition, but the message is delivered too late, accessing the ipv6\nafter its possible deletion.\n\nReorder the statement to avoid the possible UaF; while at it, place the\nwarning outside the idev-\u0026gt;lock as it needs no protection.(CVE-2026-43339)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/tcp-md5: Fix MAC comparison to be constant-time\n\nTo prevent timing attacks, MACs need to be compared in constant\ntime. Use the appropriate helper function for this.(CVE-2026-43383)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: nfnetlink_cthelper: fix OOB read in nfnl_cthelper_dump_table()\n\nnfnl_cthelper_dump_table() has a \u0026apos;goto restart\u0026apos; that jumps to a label\ninside the for loop body. When the \u0026quot;last\u0026quot; helper saved in cb-\u0026gt;args[1]\nis deleted between dump rounds, every entry fails the (cur != last)\ncheck, so cb-\u0026gt;args[1] is never cleared. The for loop finishes with\ncb-\u0026gt;args[0] == nf_ct_helper_hsize, and the \u0026apos;goto restart\u0026apos; jumps back\ninto the loop body bypassing the bounds check, causing an 8-byte\nout-of-bounds read on nf_ct_helper_hash[nf_ct_helper_hsize].\n\nThe \u0026apos;goto restart\u0026apos; block was meant to re-traverse the current bucket\nwhen \u0026quot;last\u0026quot; is no longer found, but it was placed after the for loop\ninstead of inside it. Move the block into the for loop body so that\nthe restart only occurs while cb-\u0026gt;args[0] is still within bounds.\n\n BUG: KASAN: slab-out-of-bounds in nfnl_cthelper_dump_table+0x9f/0x1b0\n Read of size 8 at addr ffff888104ca3000 by task poc_cthelper/131\n Call Trace:\n nfnl_cthelper_dump_table+0x9f/0x1b0\n netlink_dump+0x333/0x880\n netlink_recvmsg+0x3e2/0x4b0\n sock_recvmsg+0xde/0xf0\n __sys_recvfrom+0x150/0x200\n __x64_sys_recvfrom+0x76/0x90\n do_syscall_64+0xc3/0x6e0\n\n Allocated by task 1:\n __kvmalloc_node_noprof+0x21b/0x700\n nf_ct_alloc_hashtable+0x65/0xd0\n nf_conntrack_helper_init+0x21/0x60\n nf_conntrack_init_start+0x18d/0x300\n nf_conntrack_standalone_init+0x12/0xc0(CVE-2026-43450)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: x_tables: guard option walkers against 1-byte tail reads\n\nWhen the last byte of options is a non-single-byte option kind, walkers\nthat advance with i += op[i + 1] ? : 1 can read op[i + 1] past the end\nof the option area.\n\nAdd an explicit i == optlen - 1 check before dereferencing op[i + 1]\nin xt_tcpudp and xt_dccp option walkers.(CVE-2026-43452)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: nft_set_pipapo: fix stack out-of-bounds read in pipapo_drop()\n\npipapo_drop() passes rulemap[i + 1].n to pipapo_unmap() as the\nto_offset argument on every iteration, including the last one where\ni == m-\u0026gt;field_count - 1. This reads one element past the end of the\nstack-allocated rulemap array (declared as rulemap[NFT_PIPAPO_MAX_FIELDS]\nwith NFT_PIPAPO_MAX_FIELDS == 16).\n\nAlthough pipapo_unmap() returns early when is_last is true without\nusing the to_offset value, the argument is evaluated at the call site\nbefore the function body executes, making this a genuine out-of-bounds\nstack read confirmed by KASAN:\n\n BUG: KASAN: stack-out-of-bounds in pipapo_drop+0x50c/0x57c [nf_tables]\n Read of size 4 at addr ffff8000810e71a4\n\n This frame has 1 object:\n [32, 160) \u0026apos;rulemap\u0026apos;\n\n The buggy address is at offset 164 -- exactly 4 bytes past the end\n of the rulemap array.\n\nPass 0 instead of rulemap[i + 1].n on the last iteration to avoid\nthe out-of-bounds read.(CVE-2026-43453)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nrtmutex: Use waiter::task instead of current in remove_waiter()\n\nremove_waiter() is used by the slowlock paths, but it is also used for\nproxy-lock rollback in rt_mutex_start_proxy_lock() when invoked from\nfutex_requeue().\n\nIn the latter case waiter::task is not current, but remove_waiter()\noperates on current for the dequeue operation. That results in several\nproblems:\n\n 1) the rbtree dequeue happens without waiter::task::pi_lock being held\n\n 2) the waiter task\u0026apos;s pi_blocked_on state is not cleared, which leaves a\n dangling pointer primed for UAF around.\n\n 3) rt_mutex_adjust_prio_chain() operates on the wrong top priority waiter\n task\n\nUse waiter::task instead of current in all related operations in\nremove_waiter() to cure those problems.\n\n[ tglx: Fixup rt_mutex_adjust_prio_chain(), add a comment and amend the\n \tchangelog ](CVE-2026-43499)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nopenvswitch: cap upcall PID array size and pre-size vport replies\n\nThe vport netlink reply helpers allocate a fixed-size skb with\nnlmsg_new(NLMSG_DEFAULT_SIZE, ...) but serialize the full upcall PID\narray via ovs_vport_get_upcall_portids(). Since\novs_vport_set_upcall_portids() accepts any non-zero multiple of\nsizeof(u32) with no upper bound, a CAP_NET_ADMIN user can install a PID\narray large enough to overflow the reply buffer, causing nla_put() to\nfail with -EMSGSIZE and hitting BUG_ON(err \u0026lt; 0). On systems with\nunprivileged user namespaces enabled (e.g., Ubuntu default), this is\nreachable via unshare -Urn since OVS vport mutation operations use\nGENL_UNS_ADMIN_PERM.\n\n kernel BUG at net/openvswitch/datapath.c:2414!\n Oops: invalid opcode: 0000 [#1] SMP KASAN NOPTI\n CPU: 1 UID: 0 PID: 65 Comm: poc Not tainted 7.0.0-rc7-00195-geb216e422044 #1\n RIP: 0010:ovs_vport_cmd_set+0x34c/0x400\n Call Trace:\n \u0026lt;TASK\u0026gt;\n genl_family_rcv_msg_doit (net/netlink/genetlink.c:1116)\n genl_rcv_msg (net/netlink/genetlink.c:1194)\n netlink_rcv_skb (net/netlink/af_netlink.c:2550)\n genl_rcv (net/netlink/genetlink.c:1219)\n netlink_unicast (net/netlink/af_netlink.c:1344)\n netlink_sendmsg (net/netlink/af_netlink.c:1894)\n __sys_sendto (net/socket.c:2206)\n __x64_sys_sendto (net/socket.c:2209)\n do_syscall_64 (arch/x86/entry/syscall_64.c:63)\n entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\n \u0026lt;/TASK\u0026gt;\n Kernel panic - not syncing: Fatal exception\n\nReject attempts to set more PIDs than nr_cpu_ids in\novs_vport_set_upcall_portids(), and pre-compute the worst-case reply\nsize in ovs_vport_cmd_msg_size() based on that bound, similar to the\nexisting ovs_dp_cmd_msg_size(). nr_cpu_ids matches the cap already\nused by the per-CPU dispatch configuration on the datapath side\n(ovs_dp_cmd_fill_info() serialises at most nr_cpu_ids PIDs), so the\ntwo sides stay consistent.(CVE-2026-45840)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nslip: bound decode() reads against the compressed packet length\n\nslhc_uncompress() parses a VJ-compressed TCP header by advancing a\npointer through the packet via decode() and pull16(). Neither helper\nbounds-checks against isize, and decode() masks its return with\n\u0026amp; 0xffff so it can never return the -1 that callers test for -- those\nerror paths are dead code.\n\nA short compressed frame whose change byte requests optional fields\nlets decode() read past the end of the packet. The over-read bytes\nare folded into the cached cstate and reflected into subsequent\nreconstructed packets.\n\nMake decode() and pull16() take the packet end pointer and return -1\nwhen exhausted. Add a bounds check before the TCP-checksum read.\nThe existing == -1 tests now do what they were always meant to.(CVE-2026-45843)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/rxe: Fix double free in rxe_srq_from_init\n\nIn rxe_srq_from_init(), the queue pointer \u0026apos;q\u0026apos; is assigned to\n\u0026apos;srq-\u0026gt;rq.queue\u0026apos; before copying the SRQ number to user space.\nIf copy_to_user() fails, the function calls rxe_queue_cleanup()\nto free the queue, but leaves the now-invalid pointer in\n\u0026apos;srq-\u0026gt;rq.queue\u0026apos;.\n\nThe caller of rxe_srq_from_init() (rxe_create_srq) eventually\ncalls rxe_srq_cleanup() upon receiving the error, which triggers\na second rxe_queue_cleanup() on the same memory, leading to a\ndouble free.\n\nThe call trace looks like this:\n kmem_cache_free+0x.../0x...\n rxe_queue_cleanup+0x1a/0x30 [rdma_rxe]\n rxe_srq_cleanup+0x42/0x60 [rdma_rxe]\n rxe_elem_release+0x31/0x70 [rdma_rxe]\n rxe_create_srq+0x12b/0x1a0 [rdma_rxe]\n ib_create_srq_user+0x9a/0x150 [ib_core]\n\nFix this by moving \u0026apos;srq-\u0026gt;rq.queue = q\u0026apos; after copy_to_user.(CVE-2026-45852)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/vt-d: Flush cache for PASID table before using it\n\nWhen writing the address of a freshly allocated zero-initialized PASID\ntable to a PASID directory entry, do that after the CPU cache flush for\nthis PASID table, not before it, to avoid the time window when this\nPASID table may be already used by non-coherent IOMMU hardware while\nits contents in RAM is still some random old data, not zero-initialized.(CVE-2026-45862)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/vt-d: Clear Present bit before tearing down PASID entry\n\nThe Intel VT-d Scalable Mode PASID table entry consists of 512 bits (64\nbytes). When tearing down an entry, the current implementation zeros the\nentire 64-byte structure immediately using multiple 64-bit writes.\n\nSince the IOMMU hardware may fetch these 64 bytes using multiple\ninternal transactions (e.g., four 128-bit bursts), updating or zeroing\nthe entire entry while it is active (P=1) risks a \u0026quot;torn\u0026quot; read. If a\nhardware fetch occurs simultaneously with the CPU zeroing the entry, the\nhardware could observe an inconsistent state, leading to unpredictable\nbehavior or spurious faults.\n\nFollow the \u0026quot;Guidance to Software for Invalidations\u0026quot; in the VT-d spec\n(Section 6.5.3.3) by implementing the recommended ownership handshake:\n\n1. Clear only the \u0026apos;Present\u0026apos; (P) bit of the PASID entry.\n2. Use a dma_wmb() to ensure the cleared bit is visible to hardware\n before proceeding.\n3. Execute the required invalidation sequence (PASID cache, IOTLB, and\n Device-TLB flush) to ensure the hardware has released all cached\n references.\n4. Only after the flushes are complete, zero out the remaining fields\n of the PASID entry.\n\nAlso, add a dma_wmb() in pasid_set_present() to ensure that all other\nfields of the PASID entry are visible to the hardware before the Present\nbit is set.(CVE-2026-45894)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm: fix ip_rt_bug race in icmp_route_lookup reverse path\n\nicmp_route_lookup() performs multiple route lookups to find a suitable\nroute for sending ICMP error messages, with special handling for XFRM\n(IPsec) policies.\n\nThe lookup sequence is:\n1. First, lookup output route for ICMP reply (dst = original src)\n2. Pass through xfrm_lookup() for policy check\n3. If blocked (-EPERM) or dst is not local, enter \u0026quot;reverse path\u0026quot;\n4. In reverse path, call xfrm_decode_session_reverse() to get fl4_dec\n which reverses the original packet\u0026apos;s flow (saddr\u0026lt;-\u0026gt;daddr swapped)\n5. If fl4_dec.saddr is local (we are the original destination), use\n __ip_route_output_key() for output route lookup\n6. If fl4_dec.saddr is NOT local (we are a forwarding node), use\n ip_route_input() to simulate the reverse packet\u0026apos;s input path\n7. Finally, pass rt2 through xfrm_lookup() with XFRM_LOOKUP_ICMP flag\n\nThe bug occurs in step 6: ip_route_input() is called with fl4_dec.daddr\n(original packet\u0026apos;s source) as destination. If this address becomes local\nbetween the initial check and ip_route_input() call (e.g., due to\nconcurrent \u0026quot;ip addr add\u0026quot;), ip_route_input() returns a LOCAL route with\ndst.output set to ip_rt_bug.\n\nThis route is then used for ICMP output, causing dst_output() to call\nip_rt_bug(), triggering a WARN_ON:\n\n ------------[ cut here ]------------\n WARNING: net/ipv4/route.c:1275 at ip_rt_bug+0x21/0x30, CPU#1\n Call Trace:\n \u0026lt;TASK\u0026gt;\n ip_push_pending_frames+0x202/0x240\n icmp_push_reply+0x30d/0x430\n __icmp_send+0x1149/0x24f0\n ip_options_compile+0xa2/0xd0\n ip_rcv_finish_core+0x829/0x1950\n ip_rcv+0x2d7/0x420\n __netif_receive_skb_one_core+0x185/0x1f0\n netif_receive_skb+0x90/0x450\n tun_get_user+0x3413/0x3fb0\n tun_chr_write_iter+0xe4/0x220\n ...\n\nFix this by checking rt2-\u0026gt;rt_type after ip_route_input(). If it\u0026apos;s\nRTN_LOCAL, the route cannot be used for output, so treat it as an error.\n\nThe reproducer requires kernel modification to widen the race window,\nmaking it unsuitable as a selftest. It is available at:\n\n https://gist.github.com/mrpre/eae853b72ac6a750f5d45d64ddac1e81(CVE-2026-45905)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRevert \u0026quot;hwmon: (ibmpex) fix use-after-free in high/low store\u0026quot;\n\nThis reverts commit 6946c726c3f4c36f0f049e6f97e88c510b15f65d.\n\nJean Delvare points out that the patch does not completely\nfix the reported problem, that it in fact introduces a\n(new) race condition, and that it may actually not be needed in\nthe first place.\n\nVarious AI reviews agree. Specific and relevant AI feedback:\n\n\u0026quot;\nThis reordering sets the driver data to NULL before removing the sensor\nattributes in the loop below.\n\nibmpex_show_sensor() retrieves this driver data via dev_get_drvdata() but\ndoes not check if it is NULL before dereferencing it to access\ndata-\u0026gt;sensors[].\n\nIf a userspace process reads a sensor file (like temp1_input) while this\ndelete function is running, could it race with the dev_set_drvdata(...,\nNULL) call here and crash in ibmpex_show_sensor()?\n\nWould it be safer to keep the original order where device_remove_file() is\ncalled before clearing the driver data? device_remove_file() should wait\nfor any active sysfs callbacks to complete, which might already prevent the\nuse-after-free this patch intends to fix.\n\u0026quot;\n\nRevert the offending patch. If it can be shown that the originally reported\nalleged race condition does indeed exist, it can always be re-introduced\nwith a complete fix.(CVE-2026-45914)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfat: avoid parent link count underflow in rmdir\n\nCorrupted FAT images can leave a directory inode with an incorrect\ni_nlink (e.g. 2 even though subdirectories exist). rmdir then\nunconditionally calls drop_nlink(dir) and can drive i_nlink to 0,\ntriggering the WARN_ON in drop_nlink().\n\nAdd a sanity check in vfat_rmdir() and msdos_rmdir(): only drop the\nparent link count when it is at least 3, otherwise report a filesystem\nerror.(CVE-2026-45915)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsched/rt: Skip currently executing CPU in rto_next_cpu()\n\nCPU0 becomes overloaded when hosting a CPU-bound RT task, a non-CPU-bound\nRT task, and a CFS task stuck in kernel space. When other CPUs switch from\nRT to non-RT tasks, RT load balancing (LB) is triggered; with\nHAVE_RT_PUSH_IPI enabled, they send IPIs to CPU0 to drive the execution\nof rto_push_irq_work_func. During push_rt_task on CPU0,\nif next_task-\u0026gt;prio \u0026lt; rq-\u0026gt;donor-\u0026gt;prio, resched_curr() sets NEED_RESCHED\nand after the push operation completes, CPU0 calls rto_next_cpu().\nSince only CPU0 is overloaded in this scenario, rto_next_cpu() should\nideally return -1 (no further IPI needed).\n\nHowever, multiple CPUs invoking tell_cpu_to_push() during LB increments\nrd-\u0026gt;rto_loop_next. Even when rd-\u0026gt;rto_cpu is set to -1, the mismatch between\nrd-\u0026gt;rto_loop and rd-\u0026gt;rto_loop_next forces rto_next_cpu() to restart its\nsearch from -1. With CPU0 remaining overloaded (satisfying rt_nr_migratory\n\u0026amp;\u0026amp; rt_nr_total \u0026gt; 1), it gets reselected, causing CPU0 to queue irq_work to\nitself and send self-IPIs repeatedly. As long as CPU0 stays overloaded and\nother CPUs run pull_rt_tasks(), it falls into an infinite self-IPI loop,\nwhich triggers a CPU hardlockup due to continuous self-interrupts.\n\nThe trigging scenario is as follows:\n\n cpu0 cpu1 cpu2\n pull_rt_task\n tell_cpu_to_push\n \u0026lt;------------irq_work_queue_on\nrto_push_irq_work_func\n push_rt_task\n resched_curr(rq) pull_rt_task\n rto_next_cpu tell_cpu_to_push\n \u0026lt;-------------------------- atomic_inc(rto_loop_next)\nrd-\u0026gt;rto_loop != next\n rto_next_cpu\n irq_work_queue_on\nrto_push_irq_work_func\n\nFix redundant self-IPI by filtering the initiating CPU in rto_next_cpu().\nThis solution has been verified to effectively eliminate spurious self-IPIs\nand prevent CPU hardlockup scenarios.(CVE-2026-45919)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\next4: fix dirtyclusters double decrement on fs shutdown\n\nfstests test generic/388 occasionally reproduces a warning in\next4_put_super() associated with the dirty clusters count:\n\n WARNING: CPU: 7 PID: 76064 at fs/ext4/super.c:1324 ext4_put_super+0x48c/0x590 [ext4]\n\nTracing the failure shows that the warning fires due to an\ns_dirtyclusters_counter value of -1. IOW, this appears to be a\nspurious decrement as opposed to some sort of leak. Further tracing\nof the dirty cluster count deltas and an LLM scan of the resulting\noutput identified the cause as a double decrement in the error path\nbetween ext4_mb_mark_diskspace_used() and the caller\next4_mb_new_blocks().\n\nFirst, note that generic/388 is a shutdown vs. fsstress test and so\nproduces a random set of operations and shutdown injections. In the\nproblematic case, the shutdown triggers an error return from the\next4_handle_dirty_metadata() call(s) made from\next4_mb_mark_context(). The changed value is non-zero at this point,\nso ext4_mb_mark_diskspace_used() does not exit after the error\nbubbles up from ext4_mb_mark_context(). Instead, the former\ndecrements both cluster counters and returns the error up to\next4_mb_new_blocks(). The latter falls into the !ar-\u0026gt;len out path\nwhich decrements the dirty clusters counter a second time, creating\nthe inconsistency.\n\nTo avoid this problem and simplify ownership of the cluster\nreservation in this codepath, lift the counter reduction to a single\nplace in the caller. This makes it more clear that\next4_mb_new_blocks() is responsible for acquiring cluster\nreservation (via ext4_claim_free_clusters()) in the !delalloc case\nas well as releasing it, regardless of whether it ends up consumed\nor returned due to failure.(CVE-2026-45920)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfs/ntfs3: Fix slab-out-of-bounds read in DeleteIndexEntryRoot\n\nIn the \u0026apos;DeleteIndexEntryRoot\u0026apos; case of the \u0026apos;do_action\u0026apos; function, the\nentry size (\u0026apos;esize\u0026apos;) is retrieved from the log record without adequate\nbounds checking.\n\nSpecifically, the code calculates the end of the entry (\u0026apos;e2\u0026apos;) using:\n e2 = Add2Ptr(e1, esize);\n\nIt then calculates the size for memmove using \u0026apos;PtrOffset(e2, ...)\u0026apos;,\nwhich subtracts the end pointer from the buffer limit. If \u0026apos;esize\u0026apos; is\nmaliciously large, \u0026apos;e2\u0026apos; exceeds the used buffer size. This results in\na negative offset which, when cast to size_t for memmove, interprets\nas a massive unsigned integer, leading to a heap buffer overflow.\n\nThis commit adds a check to ensure that the entry size (\u0026apos;esize\u0026apos;) strictly\nfits within the remaining used space of the index header before performing\nmemory operations.(CVE-2026-45935)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/vt-d: Clear Present bit before tearing down context entry\n\nWhen tearing down a context entry, the current implementation zeros the\nentire 128-bit entry using multiple 64-bit writes. This creates a window\nwhere the hardware can fetch a \u0026quot;torn\u0026quot; entry \u2014 where some fields are\nalready zeroed while the \u0026apos;Present\u0026apos; bit is still set \u2014 leading to\nunpredictable behavior or spurious faults.\n\nWhile x86 provides strong write ordering, the compiler may reorder writes\nto the two 64-bit halves of the context entry. Even without compiler\nreordering, the hardware fetch is not guaranteed to be atomic with\nrespect to multiple CPU writes.\n\nAlign with the \u0026quot;Guidance to Software for Invalidations\u0026quot; in the VT-d spec\n(Section 6.5.3.3) by implementing the recommended ownership handshake:\n\n1. Clear only the \u0026apos;Present\u0026apos; (P) bit of the context entry first to\n signal the transition of ownership from hardware to software.\n2. Use dma_wmb() to ensure the cleared bit is visible to the IOMMU.\n3. Perform the required cache and context-cache invalidation to ensure\n hardware no longer has cached references to the entry.\n4. Fully zero out the entry only after the invalidation is complete.\n\nAlso, add a dma_wmb() to context_set_present() to ensure the entry\nis fully initialized before the \u0026apos;Present\u0026apos; bit becomes visible.(CVE-2026-45944)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\next4: fix memory leak in ext4_ext_shift_extents()\n\nIn ext4_ext_shift_extents(), if the extent is NULL in the while loop, the\nfunction returns immediately without releasing the path obtained via\next4_find_extent(), leading to a memory leak.\n\nFix this by jumping to the out label to ensure the path is properly\nreleased.(CVE-2026-45948)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnfsd: never defer requests during idmap lookup\n\nDuring v4 request compound arg decoding, some ops (e.g. SETATTR)\ncan trigger idmap lookup upcalls. When those upcall responses get\ndelayed beyond the allowed time limit, cache_check() will mark the\nrequest for deferral and cause it to be dropped.\n\nThis prevents nfs4svc_encode_compoundres from being executed, and\nthus the session slot flag NFSD4_SLOT_INUSE never gets cleared.\nSubsequent client requests will fail with NFSERR_JUKEBOX, given\nthat the slot will be marked as in-use, making the SEQUENCE op\nfail.\n\nFix this by making sure that the RQ_USEDEFERRAL flag is always\nclear during nfs4svc_decode_compoundargs(), since no v4 request\nshould ever be deferred.(CVE-2026-45983)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\next4: don\u0026apos;t set EXT4_GET_BLOCKS_CONVERT when splitting before submitting I/O\n\nWhen allocating blocks during within-EOF DIO and writeback with\ndioread_nolock enabled, EXT4_GET_BLOCKS_PRE_IO was set to split an\nexisting large unwritten extent. However, EXT4_GET_BLOCKS_CONVERT was\nset when calling ext4_split_convert_extents(), which may potentially\nresult in stale data issues.\n\nAssume we have an unwritten extent, and then DIO writes the second half.\n\n [UUUUUUUUUUUUUUUU] on-disk extent U: unwritten extent\n [UUUUUUUUUUUUUUUU] extent status tree\n |\u0026lt;- -\u0026gt;| ----\u0026gt; dio write this range\n\nFirst, ext4_iomap_alloc() call ext4_map_blocks() with\nEXT4_GET_BLOCKS_PRE_IO, EXT4_GET_BLOCKS_UNWRIT_EXT and\nEXT4_GET_BLOCKS_CREATE flags set. ext4_map_blocks() find this extent and\ncall ext4_split_convert_extents() with EXT4_GET_BLOCKS_CONVERT and the\nabove flags set.\n\nThen, ext4_split_convert_extents() calls ext4_split_extent() with\nEXT4_EXT_MAY_ZEROOUT, EXT4_EXT_MARK_UNWRIT2 and EXT4_EXT_DATA_VALID2\nflags set, and it calls ext4_split_extent_at() to split the second half\nwith EXT4_EXT_DATA_VALID2, EXT4_EXT_MARK_UNWRIT1, EXT4_EXT_MAY_ZEROOUT\nand EXT4_EXT_MARK_UNWRIT2 flags set. However, ext4_split_extent_at()\nfailed to insert extent since a temporary lack -ENOSPC. It zeroes out\nthe first half but convert the entire on-disk extent to written since\nthe EXT4_EXT_DATA_VALID2 flag set, but left the second half as unwritten\nin the extent status tree.\n\n [0000000000SSSSSS] data S: stale data, 0: zeroed\n [WWWWWWWWWWWWWWWW] on-disk extent W: written extent\n [WWWWWWWWWWUUUUUU] extent status tree\n\nFinally, if the DIO failed to write data to the disk, the stale data in\nthe second half will be exposed once the cached extent entry is gone.\n\nFix this issue by not passing EXT4_GET_BLOCKS_CONVERT when splitting\nan unwritten extent before submitting I/O, and make\next4_split_convert_extents() to zero out the entire extent range\nto zero for this case, and also mark the extent in the extent status\ntree for consistency.(CVE-2026-45985)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nKVM: nSVM: Sync interrupt shadow to cached vmcb12 after VMRUN of L2\n\nAfter VMRUN in guest mode, nested_sync_control_from_vmcb02() syncs\nfields written by the CPU from vmcb02 to the cached vmcb12. This is\nbecause the cached vmcb12 is used as the authoritative copy of some of\nthe controls, and is the payload when saving/restoring nested state.\n\nint_state is also written by the CPU, specifically bit 0 (i.e.\nSVM_INTERRUPT_SHADOW_MASK) for nested VMs, but it is not sync\u0026apos;d to\ncached vmcb12. This does not cause a problem if KVM_SET_NESTED_STATE\npreceeds KVM_SET_VCPU_EVENTS in the restore path, as an interrupt shadow\nwould be correctly restored to vmcb02 (KVM_SET_VCPU_EVENTS overwrites\nwhat KVM_SET_NESTED_STATE restored in int_state).\n\nHowever, if KVM_SET_VCPU_EVENTS preceeds KVM_SET_NESTED_STATE, an\ninterrupt shadow would be restored into vmcb01 instead of vmcb02. This\nwould mostly be benign for L1 (delays an interrupt), but not for L2. For\nL2, the vCPU could hang (e.g. if a wakeup interrupt is delivered before\na HLT that should have been in an interrupt shadow).\n\nSync int_state to the cached vmcb12 in nested_sync_control_from_vmcb02()\nto avoid this problem. With that, KVM_SET_NESTED_STATE restores the\ncorrect interrupt shadow state, and if KVM_SET_VCPU_EVENTS follows it\nwould overwrite it with the same value.(CVE-2026-45987)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nudf: fix partition descriptor append bookkeeping\n\nMounting a crafted UDF image with repeated partition descriptors can\ntrigger a heap out-of-bounds write in part_descs_loc[].\n\nhandle_partition_descriptor() deduplicates entries by partition number,\nbut appended slots never record partnum. As a result duplicate\nPartition Descriptors are appended repeatedly and num_part_descs keeps\ngrowing.\n\nOnce the table is full, the growth path still sizes the allocation from\npartnum even though inserts are indexed by num_part_descs. If partnum is\nalready aligned to PART_DESC_ALLOC_STEP, ALIGN(partnum, step) can keep\nthe old capacity and the next append writes past the end of the table.\n\nStore partnum in the appended slot and size growth from the next append\ncount so deduplication and capacity tracking follow the same model.(CVE-2026-45991)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nALSA: usb-audio: stop parsing UAC2 rates at MAX_NR_RATES\n\nparse_uac2_sample_rate_range() caps the number of enumerated\nrates at MAX_NR_RATES, but it only breaks out of the current\nrate loop. A malformed UAC2 RANGE response with additional\ntriplets continues parsing the remaining triplets and repeatedly\nprints \u0026quot;invalid uac2 rates\u0026quot; while probe still holds\nregister_mutex.\n\nStop the whole parse once the cap is reached and return the\nnumber of rates collected so far.(CVE-2026-46018)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndm mirror: fix integer overflow in create_dirty_log()\n\nThe argument count calculation in create_dirty_log() performs\n`*args_used = 2 + param_count` before validating against argc. When a\nuser provides a param_count close to UINT_MAX via the device mapper\ntable string, this unsigned addition wraps around to a small value,\ncausing the subsequent `argc \u0026lt; *args_used` check to be bypassed.\n\nThe overflowed param_count is then passed as argc to dm_dirty_log_create(),\nwhere it can cause out-of-bounds reads on the argv array.\n\nFix by comparing param_count against argc - 2 before performing the\naddition, following the same pattern used by parse_features() in the\nsame file. Since argc \u0026gt;= 2 is already guaranteed, the subtraction is\nsafe.(CVE-2026-46023)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: algif_aead - snapshot IV for async AEAD requests\n\nAF_ALG AEAD AIO requests currently use the socket-wide IV buffer during\nrequest processing. For async requests, later socket activity can\nupdate that shared state before the original request has fully\ncompleted, which can lead to inconsistent IV handling.\n\nSnapshot the IV into per-request storage when preparing the AEAD\nrequest, so in-flight operations no longer depend on mutable socket\nstate.(CVE-2026-46028)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nKVM: nSVM: Triple fault if restore host CR3 fails on nested #VMEXIT\n\nIf loading L1\u0026apos;s CR3 fails on a nested #VMEXIT, nested_svm_vmexit()\nreturns an error code that is ignored by most callers, and continues to\nrun L1 with corrupted state. A sane recovery is not possible in this\ncase, and HW behavior is to cause a shutdown. Inject a triple fault\ninstead, and do not return early from nested_svm_vmexit(). Continue\ncleaning up the vCPU state (e.g. clear pending exceptions), to handle\nthe failure as gracefully as possible.\n\nFrom the APM:\n\n Upon #VMEXIT, the processor performs the following actions in order to\n return to the host execution context:\n\n ...\n\n if (illegal host state loaded, or exception while loading host state)\n shutdown\n else\n execute first host instruction following the VMRUN\n\nRemove the return value of nested_svm_vmexit(), which is mostly\nunchecked anyway.(CVE-2026-46032)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/rxe: Validate pad and ICRC before payload_size() in rxe_rcv\n\nrxe_rcv() currently checks only that the incoming packet is at least\nheader_size(pkt) bytes long before payload_size() is used.\n\nHowever, payload_size() subtracts both the attacker-controlled BTH pad\nfield and RXE_ICRC_SIZE from pkt-\u0026gt;paylen:\n\n payload_size = pkt-\u0026gt;paylen - offset[RXE_PAYLOAD] - bth_pad(pkt)\n - RXE_ICRC_SIZE\n\nThis means a short packet can still make payload_size() underflow even\nif it includes enough bytes for the fixed headers. Simply requiring\nheader_size(pkt) + RXE_ICRC_SIZE is not sufficient either, because a\npacket with a forged non-zero BTH pad can still leave payload_size()\nnegative and pass an underflowed value to later receive-path users.\n\nFix this by validating pkt-\u0026gt;paylen against the full minimum length\nrequired by payload_size(): header_size(pkt) + bth_pad(pkt) +\nRXE_ICRC_SIZE.(CVE-2026-46043)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nALSA: ctxfi: Add fallback to default RSR for S/PDIF\n\nspdif_passthru_playback_get_resources() uses atc-\u0026gt;pll_rate as the RSR\nfor the MSR calculation loop. However, pll_rate is only updated in\natc_pll_init() and not in hw_pll_init(), so it remains 0 after the\ncard init.\n\nWhen spdif_passthru_playback_setup() skips atc_pll_init() for\n32000 Hz, (rsr * desc.msr) always becomes 0, causing the loop to spin\nindefinitely.\n\nAdd fallback to use atc-\u0026gt;rsr when atc-\u0026gt;pll_rate is 0. This reflects\nthe hardware state, since hw_card_init() already configures the PLL\nto the default RSR.(CVE-2026-46049)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBluetooth: hci_event: fix potential UAF in SSP passkey handlers\n\nhci_conn lookup and field access must be covered by hdev lock in\nhci_user_passkey_notify_evt() and hci_keypress_notify_evt(), otherwise\nthe connection can be freed concurrently.\n\nExtend the hci_dev_lock critical section to cover all conn usage in both\nhandlers.\n\nKeep the existing keypress notification behavior unchanged by routing\nthe early exits through a common unlock path.(CVE-2026-46056)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfbdev: defio: Disconnect deferred I/O from the lifetime of struct fb_info\n\nHold state of deferred I/O in struct fb_deferred_io_state. Allocate an\ninstance as part of initializing deferred I/O and remove it only after\nthe final mapping has been closed. If the fb_info and the contained\ndeferred I/O meanwhile goes away, clear struct fb_deferred_io_state.info\nto invalidate the mapping. Any access will then result in a SIGBUS\nsignal.\n\nFixes a long-standing problem, where a device hot-unplug happens while\nuser space still has an active mapping of the graphics memory. The hot-\nunplug frees the instance of struct fb_info. Accessing the memory will\noperate on undefined state.(CVE-2026-46065)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nspi: fix resource leaks on device setup failure\n\nMake sure to call controller cleanup() if spi_setup() fails while\nregistering a device to avoid leaking any resources allocated by\nsetup().(CVE-2026-46083)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nALSA: control: Validate buf_len before strnlen() in snd_ctl_elem_init_enum_names()\n\nsnd_ctl_elem_init_enum_names() advances pointer p through the names\nbuffer while decrementing buf_len. If buf_len reaches zero but items\nremain, the next iteration calls strnlen(p, 0).\n\nWhile strnlen(p, 0) returns 0 and would hit the existing name_len == 0\nerror path, CONFIG_FORTIFY_SOURCE\u0026apos;s fortified strnlen() first checks\nmaxlen against __builtin_dynamic_object_size(). When Clang loses track\nof p\u0026apos;s object size inside the loop, this triggers a BRK exception panic\nbefore the return value is examined.\n\nAdd a buf_len == 0 guard at the loop entry to prevent calling fortified\nstrnlen() on an exhausted buffer.\n\nFound by kernel fuzz testing through Xiaomi Smartphone.(CVE-2026-46088)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: reject zero shift in nft_bitwise\n\nReject zero shift operands for nft_bitwise left and right shift\nexpressions during initialization.\n\nThe carry propagation logic computes the carry from the adjacent 32-bit\nword using BITS_PER_TYPE(u32) - shift. A zero shift operand turns this\ninto a 32-bit shift, which is undefined behaviour.\n\nReject zero shift operands in the control plane, alongside the existing\ncheck for values greater than or equal to 32, so malformed rules never\nreach the packet path.(CVE-2026-46101)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: strparser: fix skb_head leak in strp_abort_strp()\n\nWhen the stream parser is aborted, for example after a message assembly timeout,\nit can still hold a reference to a partially assembled message in\nstrp-\u0026gt;skb_head.\n\nThat skb is not released in strp_abort_strp(), which leaks the partially\nassembled message and can be triggered repeatedly to exhaust memory.\n\nFix this by freeing strp-\u0026gt;skb_head and resetting the parser state in the\nabort path. Leave strp_stop() unchanged so final cleanup still happens in\nstrp_done() after the work and timer have been synchronized.(CVE-2026-46102)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndm-thin: fix metadata refcount underflow\n\nThere\u0026apos;s a bug in dm-thin in the function rebalance_children. If the\ninternal btree node has one entry, the code tries to copy all btree\nentries from the node\u0026apos;s child to the node itself and then decrement the\nchild\u0026apos;s reference count.\n\nIf the child node is shared (it has reference count \u0026gt; 1), we won\u0026apos;t free\nit, so there would be two pointers to each of the grandchildren nodes.\nBut the reference counts of the grandchildren is not increased, thus the\nreference count doesn\u0026apos;t match the number of pointers that point to the\ngrandchildren. This results in \u0026quot;device mapper: space map common: unable\nto decrement block\u0026quot; errors.\n\nFix this bug by incrementing reference counts on the grandchildren if the\nbtree node is shared.(CVE-2026-46107)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm: defensively unhash xfrm_state lists in __xfrm_state_delete\n\nKASAN reproduces a slab-use-after-free in __xfrm_state_delete()\u0026apos;s\nhlist_del_rcu calls under syzkaller load on linux-6.12.y stable\n(reproduced on 6.12.47, also reachable via the same code path on\ntorvalds/master and on the ipsec tree). Nine unique signatures cluster\nin the xfrm_state lifecycle, the load-bearing one being:\n\n BUG: KASAN: slab-use-after-free in __hlist_del include/linux/list.h:990 [inline]\n BUG: KASAN: slab-use-after-free in hlist_del_rcu include/linux/rculist.h:516 [inline]\n BUG: KASAN: slab-use-after-free in __xfrm_state_delete net/xfrm/xfrm_state.c\n Write of size 8 at addr ffff8881198bcb70 by task kworker/u8:9/435\n\n Workqueue: netns cleanup_net\n Call Trace:\n __hlist_del / hlist_del_rcu\n __xfrm_state_delete\n xfrm_state_delete\n xfrm_state_flush\n xfrm_state_fini\n ops_exit_list\n cleanup_net\n\nThe other observed signatures hit the same slab object from\n__xfrm_state_lookup, xfrm_alloc_spi, __xfrm_state_insert and an OOB\nwrite variant of __xfrm_state_delete, all on the byseq/byspi\nhash chains.\n\n__xfrm_state_delete() guards its byseq and byspi unhashes with\nvalue-based predicates:\n\n\tif (x-\u0026gt;km.seq)\n\t\thlist_del_rcu(\u0026amp;x-\u0026gt;byseq);\n\tif (x-\u0026gt;id.spi)\n\t\thlist_del_rcu(\u0026amp;x-\u0026gt;byspi);\n\nwhile everywhere else in the file (e.g. state_cache, state_cache_input)\nthe safer hlist_unhashed() check is used. xfrm_alloc_spi() sets\nx-\u0026gt;id.spi = newspi inside xfrm_state_lock and then immediately inserts\ninto byspi, but a path that observes x-\u0026gt;id.spi != 0 outside of\nxfrm_state_lock can still skip-or-hit the byspi unhash inconsistently\nwith whether x is actually on the list. The same holds for x-\u0026gt;km.seq\nversus byseq, and the bydst/bysrc unhashes have no predicate at all,\nso a second __xfrm_state_delete() on the same object writes through\nLIST_POISON pprev.\n\nThe defensive change here:\n\n - Use hlist_del_init_rcu() instead of hlist_del_rcu() on bydst,\n bysrc, byseq and byspi so a second deletion is a no-op rather\n than a write through LIST_POISON pprev. The byseq/byspi nodes\n are already initialised in xfrm_state_alloc().\n - Test hlist_unhashed() rather than the value predicate for\n byseq/byspi, so the unhash decision tracks list state rather than\n mutable scalar fields.\n\nEmpirical verification: applied this patch on top of v6.12.47, rebuilt,\nand re-ran the same syzkaller harness for 1h16m on a previously-crashy\nconfiguration that produced ~100 hits each of slab-use-after-free\nRead in xfrm_alloc_spi / Read in __xfrm_state_lookup / Write in\n__xfrm_state_delete. After the patch, 7.1M execs across 32 VMs at\n~1550 exec/sec produced zero xfrm_state UAF/OOB hits. /proc/slabinfo\nconfirms the xfrm_state slab is actively allocated and freed during\nthe run (~143 KiB resident), so the fuzzer is still exercising those\ncode paths -- they just no longer crash.\n\nReproduction:\n\n - Linux 6.12.47 x86_64 + KASAN_GENERIC + KASAN_INLINE + KCOV\n - syzkaller @ 746545b8b1e4c3a128db8652b340d3df90ce61db\n - 32 QEMU/KVM VMs x 2 vCPU on AWS c5.metal bare metal\n - 9 unique signatures collected in ~9h, all within xfrm_state\n lifecycle(CVE-2026-46116)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: rtnetlink: zero ifla_vf_broadcast to avoid stack infoleak in rtnl_fill_vfinfo\n\nrtnl_fill_vfinfo() declares struct ifla_vf_broadcast on the stack\nwithout initialisation:\n\n\tstruct ifla_vf_broadcast vf_broadcast;\n\nThe struct contains a single fixed 32-byte field:\n\n\t/* include/uapi/linux/if_link.h */\n\tstruct ifla_vf_broadcast {\n\t\t__u8 broadcast[32];\n\t};\n\nThe function then copies dev-\u0026gt;broadcast into it using dev-\u0026gt;addr_len\nas the length:\n\n\tmemcpy(vf_broadcast.broadcast, dev-\u0026gt;broadcast, dev-\u0026gt;addr_len);\n\nOn Ethernet devices (the overwhelming majority of SR-IOV NICs)\ndev-\u0026gt;addr_len is 6, so only the first 6 bytes of broadcast[] are\nwritten. The remaining 26 bytes retain whatever was previously on\nthe kernel stack. The full struct is then handed to userspace via:\n\n\tnla_put(skb, IFLA_VF_BROADCAST,\n\t\tsizeof(vf_broadcast), \u0026amp;vf_broadcast)\n\nleaking up to 26 bytes of uninitialised kernel stack per VF per\nRTM_GETLINK request, repeatable.\n\nThe other vf_* structs in the same function are explicitly zeroed\nfor exactly this reason - see the memset() calls for ivi,\nvf_vlan_info, node_guid and port_guid a few lines above.\nvf_broadcast was simply missed when it was added.\n\nReachability: any unprivileged local process can open AF_NETLINK /\nNETLINK_ROUTE without capabilities and send RTM_GETLINK with an\nIFLA_EXT_MASK attribute carrying RTEXT_FILTER_VF. The kernel walks\neach VF and emits IFLA_VF_BROADCAST, leaking 26 bytes of stack per\nVF per request. Stack residue at this call site can include return\naddresses and transient sensitive data; KASAN with stack\ninstrumentation, or KMSAN, will flag the nla_put() when reproduced.\n\nZero the on-stack struct before the partial memcpy, matching the\nexisting pattern used for the other vf_* structs in the same\nfunction.(CVE-2026-46132)\n\nIn the Linux kernel, xfrm6_rcv_encap() performs an IPv6 route lookup when the skb does not already have a dst attached. ip6_route_input_lookup() returns a referenced dst entry even when the lookup resolves to an error route. If dst-\u0026gt;error is set, xfrm6_rcv_encap() drops the skb without attaching the dst to the skb and without releasing the reference returned by the lookup. Repeated packets hitting this path therefore leak dst entries.(CVE-2026-46172)\n\nIn the Linux kernel, the mlx4_ib_create_srq() function fails to release resources allocated by mlx4_srq_alloc() in error handling paths, leading to a resource leak. An attacker could exploit this vulnerability to cause resource exhaustion or denial of service.(CVE-2026-46178)\n\nIn the Linux kernel, the ua101 driver has a division by zero vulnerability at probe. The detect_usb_format() function lacks a sanity check for the bNrChannels field. When a malicious USB audio device provides bNrChannels=0, frame_bytes becomes zero and is later used as a divisor in playback_urb_complete() and capture_urb_complete(), causing a kernel crash. USB core does not validate class-specific descriptor fields, so drivers must verify them before use.(CVE-2026-46184)\n\nIn the Linux kernel, drm_gem_fb_init_with_funcs() computes sub-sampled plane dimensions using plain integer division, while the ioctl-level framebuffer_check() uses DIV_ROUND_UP via drm_format_info_plane_width/height(). This inconsistency causes incorrect GEM object size validation for certain pixel formats and dimensions, e.g., NV12 with height=1 results in height=0, leading to an integer overflow in size check and allowing undersized GEM objects to pass, potentially causing out-of-bounds memory access by the GPU.(CVE-2026-46209)\n\n[\u0026apos;This has been assigned CVE-2026-46243, see\u0026apos;, \u0026apos;On Thursday, May 28th, 2026 at 12:07 AM, manizada \u0026lt;manizada () pm me\u0026gt; wrote:\u0026apos;, \u0026apos;Hi folks,\\n\\nEmailing here now that the embargo agreed upon with linux-distros@ has expired.\\n\\nFlagging a local root vulnerability spanning both CIFS in the kernel and\\ncifs-utils in userspace (originally reported to kernel/cifs maintainers on May 16).\\nThe kernel-side (only) fix has now been public for over a week and is queued for stable:\\n\\n3da1fdf4efbc (\u0026quot;smb: client: reject userspace cifs.spnego descriptions\u0026quot;)\\n\\nImpact:\\n Unprivileged user -\u0026gt; root code exec on any system where:\\n - cifs-utils is installed (with the default cifs.spnego rule)\\n - CIFS kernel module is loadable/compiled-in (typically the case), and\\n - unprivileged user/mount namespaces are enabled.\\n\\nSome default AppArmor/SELinux profiles block this.\\n\\nBug:\\n An unprivileged user can call request_key(\u0026quot;cifs.spnego\u0026quot;, ...) with a forged\\n CIFS SPNEGO description. The request-key rule starts cifs.upcall as root.\\n cifs.upcall then trusts attacker-supplied pid, uid, creduid, and\\n upcall_target fields as if they came from kernel CIFS.\\n\\n For upcall_target=app, affected cifs-utils versions switch into the supplied\\n process\\\u0026apos;s namespaces and perform NSS lookup before final privilege drop.\\n A private mount namespace containing attacker-controlled /etc/nsswitch.conf\\n and libnss_*.so.2 is therefore sufficient for code execution in the root\\n helper.\\n\\nAffected distros:\\n This a non-exhaustive summary of some tested distros. The full table, including\\n the cases where stock policy blocks exploitation (but relaxing AppArmor/SELinux/etc.\\n enables exploitation), is in the attachment (and in an easier-to-read format in\\n the writeup linked below).\\n\\n Stock-default exploitable distros\\n (cifs-utils comes preinstalled in the profile + unprivileged namespaces permitted by default\\n + the AA/SELinux policies, if any, do not block the attack):\\n\\n - Linux Mint Cinnamon 21.3 and 22.3\\n - CentOS Stream 9 GNOME\\n - Rocky Linux 9 Workstation\\n - Kali Linux headless 2021.4/2022.4/2023.4/2024.4/2025.4/2026.1\\n - AlmaLinux 9.7 Workstation/Azure cloud image\\n - SLES 15 SP7/SAP 15 SP7/SAP 16\\n\\n Exploitable if cifs-utils is installed, with no other default config changes:\\n - Ubuntu 18.04/20.04/22.04 Desktop/Server\\n - Pop!_OS 22.04 Intel/24.04 Generic\\n - Ubuntu 24.04 Desktop minimal/full and Server\\n - Debian 11/12/13 netinst standard and GNOME/KDE/standard/XFCE\\n - CentOS Stream 9 Cinnamon/KDE/MATE/XFCE\\n - Rocky Linux 9 KDE/Workstation-Lite\\n - openSUSE Leap 15.6 GNOME/KDE\\n - openSUSE Tumbleweed GNOME/KDE\\n - Rocky Linux 8 GenericCloud\\n - Oracle Linux 8/9 KVM\\n - Amazon Linux 2023 KVM\\n\\nImmediate-term mitigations (aside from backporting the kernel fix):\\n - Blocking the CIFS module from loading (assuming it\\\u0026apos;s not built-in)/uninstalling cifs-utils if not used\\n - Deleting/overriding the default cifs.spnego request-key rule (if Kerberos cifs is not required),\\n e.g., after adjusting for your keyctl path:\\n\\n cat \u0026gt;/etc/request-key.d/cifs.spnego.conf \u0026lt;\u0026lt;\\\u0026apos;EOF\\\u0026apos;\\n create cifs.spnego * * /usr/sbin/keyctl negate %k 30 %S\\n EOF\\n\\n - Disabling unprivileged user namespaces\\n\\nThe CVE # assignment is still pending.\\n\\nFull writeup:\u0026apos;, \u0026apos;PoC to validate mitigations:\u0026apos;, \u0026apos;Thanks,\\n-Asim Manizada\u0026apos;](CVE-2026-46243)\n\nIn the Linux kernel, the following vulnerability has been resolved: MIPS: Work around LLVM bug when gp is used as global register variable On MIPS, __current_thread_info is defined as global register variable locating in $gp, and is simply assigned with new address during kernel relocation. This however is broken with LLVM, which always restores $gp if it finds $gp is clobbered in any form, including when intentionally through a global register variable. This is against GCC\u0026apos;s documentation[1], which requires a callee-saved register used as global register variable not to be restored if it\u0026apos;s clobbered. As a result, $gp will continue to point to the unrelocated kernel after the epilog of relocate_kernel(), leading to an early crash in init_idle, [ 0.000000] CPU 0 Unable to handle kernel paging request at virtual address 0000000000000000, epc == ffffffff81afada8, ra == ffffffff81afad90 [ 0.000000] Oops[#1]: [ 0.000000] CPU: 0 UID: 0 PID: 0 Comm: swapper Tainted: G W 6.19.0-rc5-00262-gd3eeb99bbc99-dirty #188 VOLUNTARY [ 0.000000] Tainted: [W]=WARN [ 0.000000] Hardware name: loongson,loongson64v-4core-virtio [ 0.000000] $ 0 : 0000000000000000 0000000000000000 0000000000000001 0000000000000000 [ 0.000000] $ 4 : ffffffff80b80ec0 ffffffff80b53d48 0000000000000000 00000000000f4240 [ 0.000000] $ 8 : 0000000000000100 ffffffff81d82f80 ffffffff81d82f80 0000000000000001 [ 0.000000] $12 : 0000000000000000 ffffffff81776f58 00000000000005da 0000000000000002 [ 0.000000] $16 : ffffffff80b80e40 0000000000000000 ffffffff80b81614 9800000005dfbe80 [ 0.000000] $20 : 00000000540000e0 ffffffff81980000 0000000000000000 ffffffff80f81c80 [ 0.000000] $24 : 0000000000000a26 ffffffff8114fb90 [ 0.000000] $28 : ffffffff80b50000 ffffffff80b53d40 0000000000000000 ffffffff81afad90 [ 0.000000] Hi : 0000000000000000 [ 0.000000] Lo : 0000000000000000 [ 0.000000] epc : ffffffff81afada8 init_idle+0x130/0x270 [ 0.000000] ra : ffffffff81afad90 init_idle+0x118/0x270 [ 0.000000] Status: 540000e2\tKX SX UX KERNEL EXL [ 0.000000] Cause : 00000008 (ExcCode 02) [ 0.000000] BadVA : 0000000000000000 [ 0.000000] PrId : 00006305 (ICT Loongson-3) [ 0.000000] Process swapper (pid: 0, threadinfo=(____ptrval____), task=(____ptrval____), tls=0000000000000000) [ 0.000000] Stack : 9800000005dfbf00 ffffffff8178e950 0000000000000000 0000000000000000 [ 0.000000] 0000000000000000 ffffffff81970000 000000000000003f ffffffff810a6528 [ 0.000000] 0000000000000001 9800000005dfbe80 9800000005dfbf00 ffffffff81980000 [ 0.000000] ffffffff810a6450 ffffffff81afb6c0 0000000000000000 ffffffff810a2258 [ 0.000000] ffffffff81d82ec8 ffffffff8198d010 ffffffff81b67e80 ffffffff8197dd98 [ 0.000000] ffffffff81d81c80 ffffffff81930000 0000000000000040 0000000000000000 [ 0.000000] 0000000000000000 0000000000000000 0000000000000000 0000000000000000 [ 0.000000] 0000000000000000 000000000000009e ffffffff9fc01000 0000000000000000 [ 0.000000] 0000000000000000 0000000000000000 0000000000000000 0000000000000000 [ 0.000000] 0000000000000000 ffffffff81ae86dc ffffffff81b3c741 0000000000000002 [ 0.000000] ... [ 0.000000] Call Trace: [ 0.000000] [\u0026lt;ffffffff81afada8\u0026gt;] init_idle+0x130/0x270 [ 0.000000] [\u0026lt;ffffffff81afb6c0\u0026gt;] sched_init+0x5c8/0x6c0 [ 0.000000] [\u0026lt;ffffffff81ae86dc\u0026gt;] start_kernel+0x27c/0x7a8 This bug has been reported to LLVM[2] and affects version from (at least) 18 to 21. Let\u0026apos;s work around this by using inline assembly to assign $gp before a fix is widely available. The Linux kernel CVE team has assigned CVE-2026-46250 to this issue.(CVE-2026-46250)\n\nIn the Linux kernel, the following vulnerability has been resolved: pstore/ram: fix buffer overflow in persistent_ram_save_old() persistent_ram_save_old() can be called multiple times for the same persistent_ram_zone (e.g., via ramoops_pstore_read -\u0026gt; ramoops_get_next_prz for PSTORE_TYPE_DMESG records). Currently, the function only allocates prz-\u0026gt;old_log when it is NULL, but it unconditionally updates prz-\u0026gt;old_log_size to the current buffer size and then performs memcpy_fromio() using this new size. If the buffer size has grown since the first allocation (which can happen across different kernel boot cycles), this leads to: 1. A heap buffer overflow (OOB write) in the memcpy_fromio() calls 2. A subsequent OOB read when ramoops_pstore_read() accesses the buffer using the incorrect (larger) old_log_size The KASAN splat would look similar to: BUG: KASAN: slab-out-of-bounds in ramoops_pstore_read+0x... Read of size N at addr ... by task ... The conditions are likely extremely hard to hit: 0. Crash with a ramoops write of less-than-record-max-size bytes. 1. Reboot: ramoops registers, pstore_get_records(0) reads old crash, allocates old_log with size X 2. Crash handler registered, timer started (if pstore_update_ms \u0026gt;= 0) 3. Oops happens (non-fatal, system continues) 4. pstore_dump() writes oops via ramoops_pstore_write() size Y (\u0026gt;X) 5. pstore_new_entry = 1, pstore_timer_kick() called 6. System continues running (not a panic oops) 7. Timer fires after pstore_update_ms milliseconds 8. pstore_timefunc() \u2192 schedule_work() \u2192 pstore_dowork() \u2192 pstore_get_records(1) 9. ramoops_get_next_prz() \u2192 persistent_ram_save_old() 10. buffer_size() returns Y, but old_log is X bytes 11. Y \u0026gt; X: memcpy_fromio() overflows heap Requirements: - a prior crash record exists that did not fill the record size (almost impossible since the crash handler writes as much as it can possibly fit into the record, capped by max record size and the kmsg buffer almost always exceeds the max record size) - pstore_update_ms \u0026gt;= 0 (disabled by default) - Non-fatal oops (system survives) Free and reallocate the buffer when the new size differs from the previously allocated size. This ensures old_log always has sufficient space for the data being copied. The Linux kernel CVE team has assigned CVE-2026-46253 to this issue.(CVE-2026-46253)\n\nIn the Linux kernel, the following vulnerability has been resolved: procfs: fix missing RCU protection when reading real_parent in do_task_stat() When reading /proc/[pid]/stat, do_task_stat() accesses task-\u0026gt;real_parent without proper RCU protection, which leads to: cpu 0 cpu 1 ----- ----- do_task_stat var = task-\u0026gt;real_parent release_task call_rcu(delayed_put_task_struct) task_tgid_nr_ns(var) rcu_read_lock \u0026lt;--- Too late to protect task-\u0026gt;real_parent! task_pid_ptr \u0026lt;--- UAF! rcu_read_unlock This patch uses task_ppid_nr_ns() instead of task_tgid_nr_ns() to add proper RCU protection for accessing task-\u0026gt;real_parent. The Linux kernel CVE team has assigned CVE-2026-46259 to this issue.(CVE-2026-46259)\n\nIn the Linux kernel, the following vulnerability has been resolved: RDMA/hns: Fix WQ_MEM_RECLAIM warning When sunrpc is used, if a reset triggered, our wq may lead the following trace: workqueue: WQ_MEM_RECLAIM xprtiod:xprt_rdma_connect_worker [rpcrdma] is flushing !WQ_MEM_RECLAIM hns_roce_irq_workq:flush_work_handle [hns_roce_hw_v2] WARNING: CPU: 0 PID: 8250 at kernel/workqueue.c:2644 check_flush_dependency+0xe0/0x144 Call trace: check_flush_dependency+0xe0/0x144 start_flush_work.constprop.0+0x1d0/0x2f0 __flush_work.isra.0+0x40/0xb0 flush_work+0x14/0x30 hns_roce_v2_destroy_qp+0xac/0x1e0 [hns_roce_hw_v2] ib_destroy_qp_user+0x9c/0x2b4 rdma_destroy_qp+0x34/0xb0 rpcrdma_ep_destroy+0x28/0xcc [rpcrdma] rpcrdma_ep_put+0x74/0xb4 [rpcrdma] rpcrdma_xprt_disconnect+0x1d8/0x260 [rpcrdma] xprt_rdma_connect_worker+0xc0/0x120 [rpcrdma] process_one_work+0x1cc/0x4d0 worker_thread+0x154/0x414 kthread+0x104/0x144 ret_from_fork+0x10/0x18 Since QP destruction frees memory, this wq should have the WQ_MEM_RECLAIM. The Linux kernel CVE team has assigned CVE-2026-46265 to this issue.(CVE-2026-46265)",
"id": "OESA-2026-2674",
"modified": "2026-08-06T11:11:36Z",
"published": "2026-06-12T11:11:36Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-2674"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39759"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39952"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-68330"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-68755"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-71184"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31605"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31607"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31615"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31616"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31617"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31618"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31700"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31786"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43077"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43078"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43091"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43093"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43116"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43125"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43130"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43139"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43190"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43198"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43233"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43253"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43319"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43339"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43383"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43450"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43452"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43453"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43499"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45840"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45843"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45852"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45862"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45894"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45905"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45914"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45915"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45919"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45920"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45935"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45944"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45948"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45983"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45985"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45987"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45991"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46018"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46023"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46028"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46032"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46043"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46049"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46056"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46065"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46083"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46088"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46101"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46102"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46107"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46116"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46132"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46172"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46178"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46184"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46209"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46243"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46250"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46253"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46259"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46265"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2025-39759",
"CVE-2025-39952",
"CVE-2025-68330",
"CVE-2025-68755",
"CVE-2025-71184",
"CVE-2026-31605",
"CVE-2026-31607",
"CVE-2026-31615",
"CVE-2026-31616",
"CVE-2026-31617",
"CVE-2026-31618",
"CVE-2026-31700",
"CVE-2026-31786",
"CVE-2026-43077",
"CVE-2026-43078",
"CVE-2026-43091",
"CVE-2026-43093",
"CVE-2026-43116",
"CVE-2026-43125",
"CVE-2026-43130",
"CVE-2026-43139",
"CVE-2026-43190",
"CVE-2026-43198",
"CVE-2026-43233",
"CVE-2026-43253",
"CVE-2026-43319",
"CVE-2026-43339",
"CVE-2026-43383",
"CVE-2026-43450",
"CVE-2026-43452",
"CVE-2026-43453",
"CVE-2026-43499",
"CVE-2026-45840",
"CVE-2026-45843",
"CVE-2026-45852",
"CVE-2026-45862",
"CVE-2026-45894",
"CVE-2026-45905",
"CVE-2026-45914",
"CVE-2026-45915",
"CVE-2026-45919",
"CVE-2026-45920",
"CVE-2026-45935",
"CVE-2026-45944",
"CVE-2026-45948",
"CVE-2026-45983",
"CVE-2026-45985",
"CVE-2026-45987",
"CVE-2026-45991",
"CVE-2026-46018",
"CVE-2026-46023",
"CVE-2026-46028",
"CVE-2026-46032",
"CVE-2026-46043",
"CVE-2026-46049",
"CVE-2026-46056",
"CVE-2026-46065",
"CVE-2026-46083",
"CVE-2026-46088",
"CVE-2026-46101",
"CVE-2026-46102",
"CVE-2026-46107",
"CVE-2026-46116",
"CVE-2026-46132",
"CVE-2026-46172",
"CVE-2026-46178",
"CVE-2026-46184",
"CVE-2026-46209",
"CVE-2026-46243",
"CVE-2026-46250",
"CVE-2026-46253",
"CVE-2026-46259",
"CVE-2026-46265"
]
}
OPENSUSE-SU-2026:21388-1
Vulnerability from csaf_opensuse - Published: 2026-07-21 08:27 - Updated: 2026-09-17 17:39SUSE-SU-2026:22521-1
Vulnerability from csaf_suse - Published: 2026-07-06 13:11 - Updated: 2026-09-20 18:39Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.