Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2026-74394 (GCVE-0-2026-74394)
Vulnerability from cvelistv5 – Published: 2026-08-15 05:59 – Updated: 2026-08-17 05:46| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
5dabcd0456d7ee17c2c7a17d7c2305444d2b9639 , < c82c860f8c8e4f4f454c9f14d0ad0c0466965f7d
(git)
Affected: 5dabcd0456d7ee17c2c7a17d7c2305444d2b9639 , < 3efa5301137140a3ca3677a9098c0a93a0acfd49 (git) Affected: 5dabcd0456d7ee17c2c7a17d7c2305444d2b9639 , < 067b9556eeb007f28b7c2033b4dcde5b6d88418f (git) Affected: 5dabcd0456d7ee17c2c7a17d7c2305444d2b9639 , < dcf7a986f377cce0749ed53f1d64195fbd5fdf91 (git) Affected: 5dabcd0456d7ee17c2c7a17d7c2305444d2b9639 , < 07dec3f6dcb6c6cc891162d252b800eb0e6d5e8e (git) Affected: 5dabcd0456d7ee17c2c7a17d7c2305444d2b9639 , < 65572fbd86033ae2370125593d59b8be34253aaf (git) Affected: 5dabcd0456d7ee17c2c7a17d7c2305444d2b9639 , < 72497172a4799119a0282a5eb5e2b8ddcc821921 (git) Affected: 5dabcd0456d7ee17c2c7a17d7c2305444d2b9639 , < eb4ecdf631fe00e8020bf461503cb9b7017ed796 (git) |
guessed | |
| Linux | Linux |
Affected:
5.0
Unaffected: 0 , < 5.0 (semver) Unaffected: 5.10.261 , ≤ 5.10.* (semver) Unaffected: 5.15.212 , ≤ 5.15.* (semver) Unaffected: 6.1.178 , ≤ 6.1.* (semver) Unaffected: 6.6.145 , ≤ 6.6.* (semver) Unaffected: 6.12.97 , ≤ 6.12.* (semver) Unaffected: 6.18.40 , ≤ 6.18.* (semver) Unaffected: 7.1.5 , ≤ 7.1.* (semver) Unaffected: 7.2 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/infiniband/ulp/srpt/ib_srpt.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "c82c860f8c8e4f4f454c9f14d0ad0c0466965f7d",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "3efa5301137140a3ca3677a9098c0a93a0acfd49",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "067b9556eeb007f28b7c2033b4dcde5b6d88418f",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "dcf7a986f377cce0749ed53f1d64195fbd5fdf91",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "07dec3f6dcb6c6cc891162d252b800eb0e6d5e8e",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "65572fbd86033ae2370125593d59b8be34253aaf",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "72497172a4799119a0282a5eb5e2b8ddcc821921",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "eb4ecdf631fe00e8020bf461503cb9b7017ed796",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/infiniband/ulp/srpt/ib_srpt.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.0"
},
{
"lessThan": "5.0",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.261",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.212",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.178",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.145",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.97",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.40",
"versionType": "semver"
},
{
"lessThanOrEqual": "7.1.*",
"status": "unaffected",
"version": "7.1.5",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.2",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.261",
"versionStartIncluding": "5.0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.212",
"versionStartIncluding": "5.0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.178",
"versionStartIncluding": "5.0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.145",
"versionStartIncluding": "5.0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.12.97",
"versionStartIncluding": "5.0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.18.40",
"versionStartIncluding": "5.0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "7.1.5",
"versionStartIncluding": "5.0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "7.2",
"versionStartIncluding": "5.0",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/srpt: fix integer overflow in immediate data length check\n\nimm_buf-\u003elen is a user-controlled uint32_t received from the network.\nAdding it to imm_data_offset without overflow checking allows a\nmalicious initiator to send len=0xFFFFFFFF, causing req_size to wrap\naround to a small value, bypassing the bounds check, and subsequently\npassing a ~4GB length to sg_init_one().\n\nUse check_add_overflow() to detect wrapping before the comparison."
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 9.8,
"baseSeverity": "CRITICAL",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:N - SRPT is an in-kernel SCSI RDMA target reached by remote initiators over InfiniBand/RoCE via RDMA/IB CM; malicious SRP_CMD IUs are delivered through `srpt_recv_done()` without any local syscall or physical access.\nAC:L - Once connected on an immediate-data SRPT target (use_srq=0), a malicious initiator deterministically sets `imm_buf-\u003elen=0xFFFFFFFF` to wrap `req_size` and bypass checks; no race or attacker-uncontrollable condition is required.\nPR:N - SRPT enables LIO demo mode (`srpt_check_true`), so any remote initiator that completes SRP login on an enabled target gets a dynamic ACL without target-local credentials, root, or CAP_NET_ADMIN on the victim host.\nUI:N - Exploitation requires only attacker-initiated RDMA connection, SRP login, and crafted SRP_CMD traffic; no administrator or other user must mount storage or perform any action on the target.\nS:U - The integer overflow corrupts kernel heap memory and SCSI-target processing within the host kernel\u0027s own security authority; it does not cross VM, IOMMU, or container sandbox boundaries.\nC:H - Passing a ~4GB length to `sg_init_one()` on a small receive buffer creates a massive out-of-bounds scatterlist; subsequent target-core DMA/map operations can read far beyond the buffer, enabling arbitrary kernel memory disclosure.\nI:H - The bogus scatterlist gives the block/SCSI target path an attacker-controlled ~4GB kernel memory write/read primitive over adjacent heap objects, exploitable for control-flow hijacking and privilege escalation.\nA:H - Out-of-bounds access from a ~4GB scatterlist on a kilobyte-scale receive buffer readily triggers kernel oops, KASAN faults, or panic, denying availability even before full exploitation."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-17T05:46:39.840Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/c82c860f8c8e4f4f454c9f14d0ad0c0466965f7d"
},
{
"url": "https://git.kernel.org/stable/c/3efa5301137140a3ca3677a9098c0a93a0acfd49"
},
{
"url": "https://git.kernel.org/stable/c/067b9556eeb007f28b7c2033b4dcde5b6d88418f"
},
{
"url": "https://git.kernel.org/stable/c/dcf7a986f377cce0749ed53f1d64195fbd5fdf91"
},
{
"url": "https://git.kernel.org/stable/c/07dec3f6dcb6c6cc891162d252b800eb0e6d5e8e"
},
{
"url": "https://git.kernel.org/stable/c/65572fbd86033ae2370125593d59b8be34253aaf"
},
{
"url": "https://git.kernel.org/stable/c/72497172a4799119a0282a5eb5e2b8ddcc821921"
},
{
"url": "https://git.kernel.org/stable/c/eb4ecdf631fe00e8020bf461503cb9b7017ed796"
}
],
"title": "RDMA/srpt: fix integer overflow in immediate data length check",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2026-74394",
"datePublished": "2026-08-15T05:59:07.144Z",
"dateReserved": "2026-08-15T05:44:03.891Z",
"dateUpdated": "2026-08-17T05:46:39.840Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2026-74394",
"date": "2026-10-01",
"epss": "0.0054",
"percentile": "0.43331"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/infiniband/ulp/srpt/ib_srpt.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "c82c860f8c8e4f4f454c9f14d0ad0c0466965f7d",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "3efa5301137140a3ca3677a9098c0a93a0acfd49",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "067b9556eeb007f28b7c2033b4dcde5b6d88418f",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "dcf7a986f377cce0749ed53f1d64195fbd5fdf91",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "07dec3f6dcb6c6cc891162d252b800eb0e6d5e8e",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "65572fbd86033ae2370125593d59b8be34253aaf",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "72497172a4799119a0282a5eb5e2b8ddcc821921",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "eb4ecdf631fe00e8020bf461503cb9b7017ed796",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/infiniband/ulp/srpt/ib_srpt.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.0"
},
{
"lessThan": "5.0",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.261",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.212",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.178",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.145",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.97",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.40",
"versionType": "semver"
},
{
"lessThanOrEqual": "7.1.*",
"status": "unaffected",
"version": "7.1.5",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.2",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/srpt: fix integer overflow in immediate data length check\n\nimm_buf-\u003elen is a user-controlled uint32_t received from the network.\nAdding it to imm_data_offset without overflow checking allows a\nmalicious initiator to send len=0xFFFFFFFF, causing req_size to wrap\naround to a small value, bypassing the bounds check, and subsequently\npassing a ~4GB length to sg_init_one().\n\nUse check_add_overflow() to detect wrapping before the comparison."
}
],
"id": "CVE-2026-74394",
"lastModified": "2026-08-17T06:19:34.430",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 9.8,
"baseSeverity": "CRITICAL",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 3.9,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
}
]
},
"published": "2026-08-15T06:22:41.363",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/067b9556eeb007f28b7c2033b4dcde5b6d88418f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/07dec3f6dcb6c6cc891162d252b800eb0e6d5e8e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/3efa5301137140a3ca3677a9098c0a93a0acfd49"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/65572fbd86033ae2370125593d59b8be34253aaf"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/72497172a4799119a0282a5eb5e2b8ddcc821921"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/c82c860f8c8e4f4f454c9f14d0ad0c0466965f7d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/dcf7a986f377cce0749ed53f1d64195fbd5fdf91"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/eb4ecdf631fe00e8020bf461503cb9b7017ed796"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Received"
}
},
"redhat_vex": {
"aggregate_severity": "Important",
"current_release_date": "2026-08-20T22:17:33+00:00",
"cve": "CVE-2026-74394",
"id": "CVE-2026-74394",
"initial_release_date": "2026-08-15T00:00:00+00:00",
"product_status:known_affected": "232",
"product_status:known_not_affected": "42",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: RDMA/srpt: fix integer overflow in immediate data length check",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2026/cve-2026-74394.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "important",
"current_release_date": "2026-10-01T16:18:21Z",
"cve": "CVE-2026-74394",
"id": "CVE-2026-74394",
"initial_release_date": "2026-08-29T01:08:26Z",
"product_status:known_affected": "551",
"product_status:known_not_affected": "129",
"product_status:recommended": "359",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2026-74394",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2026-74394.json",
"version": "15"
}
}
}
BELL-CVE-2026-74394 (CVE-2026-74394)
Vulnerability from osv_bellsoft – Published: 2026-08-18 06:06 – Updated: 2026-08-18 06:25 – Source website| URL | Type | |
|---|---|---|
{
"affected": [
{
"package": {
"ecosystem": "Alpaquita:23",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=23"
},
"ranges": [
{
"events": [
{
"introduced": "6.1.177-r0"
},
{
"fixed": "6.1.182-r0"
}
],
"type": "ECOSYSTEM"
}
]
},
{
"package": {
"ecosystem": "Alpaquita:25",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=25"
},
"ranges": [
{
"events": [
{
"introduced": "6.12.95-r0"
},
{
"fixed": "6.12.103-r0"
}
],
"type": "ECOSYSTEM"
}
]
},
{
"package": {
"ecosystem": "Alpaquita:stream",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=stream"
},
"ranges": [
{
"events": [
{
"introduced": "6.18.38-r0"
},
{
"fixed": "6.18.43-r0"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"id": "BELL-CVE-2026-74394",
"modified": "2026-08-18T06:25:42.933787Z",
"published": "2026-08-18T06:06:50.51829Z",
"references": [
{
"type": "ADVISORY",
"url": "https://docs.bell-sw.com/security/cves/CVE-2026-74394"
}
],
"schema_version": "1.7.4",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"upstream": [
"CVE-2026-74394"
]
}
CERTFR-2026-AVI-1164
Vulnerability from certfr_avis - Published: 2026-09-11 - Updated: 2026-09-11
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.1 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.0 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP7 | ||
| SUSE | SUSE Linux Micro Extras | SUSE Linux Micro Extras 6.0 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.1",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.0",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP7",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro Extras 6.0",
"product": {
"name": "SUSE Linux Micro Extras",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-68116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68116"
},
{
"name": "CVE-2025-71075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71075"
},
{
"name": "CVE-2026-64214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64214"
},
{
"name": "CVE-2026-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53091"
},
{
"name": "CVE-2026-64376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64376"
},
{
"name": "CVE-2026-74395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74395"
},
{
"name": "CVE-2026-68343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68343"
},
{
"name": "CVE-2026-64552",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64552"
},
{
"name": "CVE-2026-64287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64287"
},
{
"name": "CVE-2026-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53381"
},
{
"name": "CVE-2026-64275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64275"
},
{
"name": "CVE-2026-64274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64274"
},
{
"name": "CVE-2026-64538",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64538"
},
{
"name": "CVE-2026-74394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74394"
},
{
"name": "CVE-2026-68450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68450"
},
{
"name": "CVE-2026-68480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68480"
},
{
"name": "CVE-2026-68271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68271"
},
{
"name": "CVE-2026-74297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74297"
},
{
"name": "CVE-2026-64133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64133"
},
{
"name": "CVE-2026-31658",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31658"
},
{
"name": "CVE-2026-64047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64047"
},
{
"name": "CVE-2026-74481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74481"
},
{
"name": "CVE-2026-68138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68138"
},
{
"name": "CVE-2026-64192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64192"
},
{
"name": "CVE-2026-68193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68193"
},
{
"name": "CVE-2026-68204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68204"
},
{
"name": "CVE-2026-52925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52925"
},
{
"name": "CVE-2026-74669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74669"
},
{
"name": "CVE-2026-68302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68302"
},
{
"name": "CVE-2026-64452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64452"
},
{
"name": "CVE-2026-52929",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52929"
},
{
"name": "CVE-2026-68081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68081"
},
{
"name": "CVE-2026-64483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64483"
},
{
"name": "CVE-2026-63980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63980"
},
{
"name": "CVE-2026-74482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74482"
},
{
"name": "CVE-2026-64322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64322"
},
{
"name": "CVE-2026-43448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43448"
},
{
"name": "CVE-2026-64470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64470"
},
{
"name": "CVE-2026-63923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63923"
},
{
"name": "CVE-2026-68339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68339"
},
{
"name": "CVE-2026-64513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64513"
},
{
"name": "CVE-2026-68218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68218"
},
{
"name": "CVE-2026-68088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68088"
},
{
"name": "CVE-2026-64388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64388"
},
{
"name": "CVE-2026-64512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64512"
},
{
"name": "CVE-2026-64409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64409"
},
{
"name": "CVE-2026-68129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68129"
},
{
"name": "CVE-2026-74571",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74571"
},
{
"name": "CVE-2026-68245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68245"
},
{
"name": "CVE-2026-64268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64268"
},
{
"name": "CVE-2026-68428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68428"
},
{
"name": "CVE-2026-64099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64099"
},
{
"name": "CVE-2026-64489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64489"
},
{
"name": "CVE-2026-74581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74581"
},
{
"name": "CVE-2026-64480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64480"
},
{
"name": "CVE-2026-72494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72494"
},
{
"name": "CVE-2026-64257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64257"
},
{
"name": "CVE-2026-64006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64006"
},
{
"name": "CVE-2026-68313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68313"
},
{
"name": "CVE-2026-64385",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64385"
},
{
"name": "CVE-2026-74537",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74537"
},
{
"name": "CVE-2026-63995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63995"
},
{
"name": "CVE-2026-64217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64217"
},
{
"name": "CVE-2026-46319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46319"
},
{
"name": "CVE-2026-68326",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68326"
},
{
"name": "CVE-2026-68184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68184"
},
{
"name": "CVE-2026-64454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64454"
},
{
"name": "CVE-2026-64407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64407"
},
{
"name": "CVE-2026-68417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68417"
},
{
"name": "CVE-2026-64527",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64527"
},
{
"name": "CVE-2026-23227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23227"
},
{
"name": "CVE-2026-74563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74563"
},
{
"name": "CVE-2026-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23454"
},
{
"name": "CVE-2026-68248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68248"
},
{
"name": "CVE-2026-63886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63886"
},
{
"name": "CVE-2026-64365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64365"
},
{
"name": "CVE-2026-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53260"
},
{
"name": "CVE-2026-64128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64128"
},
{
"name": "CVE-2026-68277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68277"
},
{
"name": "CVE-2026-68288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68288"
},
{
"name": "CVE-2026-68410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68410"
},
{
"name": "CVE-2026-68437",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68437"
},
{
"name": "CVE-2026-68261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68261"
},
{
"name": "CVE-2026-74345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74345"
},
{
"name": "CVE-2025-40204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40204"
},
{
"name": "CVE-2026-72083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72083"
},
{
"name": "CVE-2026-64333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64333"
},
{
"name": "CVE-2026-68304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68304"
},
{
"name": "CVE-2026-68155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68155"
},
{
"name": "CVE-2026-63928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63928"
},
{
"name": "CVE-2026-68132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68132"
},
{
"name": "CVE-2026-64574",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64574"
},
{
"name": "CVE-2026-63879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63879"
},
{
"name": "CVE-2026-68102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68102"
},
{
"name": "CVE-2026-74488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74488"
},
{
"name": "CVE-2026-68086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68086"
},
{
"name": "CVE-2025-39939",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39939"
},
{
"name": "CVE-2026-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53220"
},
{
"name": "CVE-2026-64246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64246"
},
{
"name": "CVE-2026-68085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68085"
},
{
"name": "CVE-2026-68446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68446"
},
{
"name": "CVE-2026-68408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68408"
},
{
"name": "CVE-2026-64386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64386"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-68226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68226"
},
{
"name": "CVE-2026-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53365"
},
{
"name": "CVE-2026-68350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68350"
},
{
"name": "CVE-2026-23210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23210"
},
{
"name": "CVE-2026-68419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68419"
},
{
"name": "CVE-2026-68091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68091"
},
{
"name": "CVE-2026-68297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68297"
},
{
"name": "CVE-2026-53224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53224"
},
{
"name": "CVE-2026-68199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68199"
},
{
"name": "CVE-2026-64383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64383"
},
{
"name": "CVE-2026-68425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68425"
},
{
"name": "CVE-2026-64337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64337"
},
{
"name": "CVE-2026-63888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63888"
},
{
"name": "CVE-2026-52956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52956"
},
{
"name": "CVE-2026-80534",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80534"
},
{
"name": "CVE-2026-72466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72466"
},
{
"name": "CVE-2026-64178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64178"
},
{
"name": "CVE-2026-64497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64497"
},
{
"name": "CVE-2026-53163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53163"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-64599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64599"
},
{
"name": "CVE-2026-68293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68293"
},
{
"name": "CVE-2026-68365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68365"
},
{
"name": "CVE-2026-72254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72254"
},
{
"name": "CVE-2026-64598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64598"
},
{
"name": "CVE-2026-68320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68320"
},
{
"name": "CVE-2026-63810",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63810"
},
{
"name": "CVE-2026-31531",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31531"
},
{
"name": "CVE-2026-64098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64098"
},
{
"name": "CVE-2026-63801",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63801"
},
{
"name": "CVE-2026-63827",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63827"
},
{
"name": "CVE-2026-64304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64304"
},
{
"name": "CVE-2026-43014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43014"
},
{
"name": "CVE-2026-68280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68280"
},
{
"name": "CVE-2026-68362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68362"
},
{
"name": "CVE-2025-68179",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68179"
},
{
"name": "CVE-2026-63842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63842"
},
{
"name": "CVE-2026-68430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68430"
},
{
"name": "CVE-2026-68427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68427"
},
{
"name": "CVE-2026-43319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43319"
},
{
"name": "CVE-2026-64146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64146"
},
{
"name": "CVE-2026-72500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72500"
},
{
"name": "CVE-2026-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53309"
},
{
"name": "CVE-2026-68324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68324"
},
{
"name": "CVE-2026-68308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68308"
},
{
"name": "CVE-2026-64276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64276"
},
{
"name": "CVE-2026-64190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64190"
},
{
"name": "CVE-2026-68210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68210"
},
{
"name": "CVE-2026-64237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64237"
},
{
"name": "CVE-2026-64323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64323"
},
{
"name": "CVE-2026-68267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68267"
},
{
"name": "CVE-2026-68309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68309"
},
{
"name": "CVE-2026-68403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68403"
},
{
"name": "CVE-2026-68139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68139"
},
{
"name": "CVE-2026-64271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64271"
},
{
"name": "CVE-2026-74566",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74566"
},
{
"name": "CVE-2026-52939",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52939"
},
{
"name": "CVE-2026-63925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63925"
},
{
"name": "CVE-2026-68093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68093"
},
{
"name": "CVE-2026-72262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72262"
},
{
"name": "CVE-2026-68166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68166"
},
{
"name": "CVE-2026-63990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63990"
},
{
"name": "CVE-2026-64455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64455"
},
{
"name": "CVE-2026-72467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72467"
},
{
"name": "CVE-2026-64421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64421"
},
{
"name": "CVE-2026-64584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64584"
},
{
"name": "CVE-2026-64445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64445"
},
{
"name": "CVE-2026-52935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52935"
},
{
"name": "CVE-2026-68310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68310"
},
{
"name": "CVE-2026-64433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64433"
},
{
"name": "CVE-2026-68115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68115"
},
{
"name": "CVE-2026-68133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68133"
},
{
"name": "CVE-2026-68246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68246"
},
{
"name": "CVE-2026-64563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64563"
},
{
"name": "CVE-2026-68405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68405"
},
{
"name": "CVE-2026-68219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68219"
},
{
"name": "CVE-2026-68216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68216"
},
{
"name": "CVE-2026-64500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64500"
},
{
"name": "CVE-2026-53094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53094"
},
{
"name": "CVE-2026-64097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64097"
},
{
"name": "CVE-2026-68328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68328"
},
{
"name": "CVE-2026-68394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68394"
},
{
"name": "CVE-2026-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53330"
},
{
"name": "CVE-2025-23137",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23137"
},
{
"name": "CVE-2026-64348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64348"
},
{
"name": "CVE-2026-68196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68196"
},
{
"name": "CVE-2026-64362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64362"
},
{
"name": "CVE-2026-72464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72464"
},
{
"name": "CVE-2026-68269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68269"
},
{
"name": "CVE-2026-68255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68255"
},
{
"name": "CVE-2026-64102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64102"
},
{
"name": "CVE-2026-68363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68363"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2026-68213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68213"
},
{
"name": "CVE-2026-68278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68278"
},
{
"name": "CVE-2026-64486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64486"
},
{
"name": "CVE-2026-68145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68145"
},
{
"name": "CVE-2026-64517",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64517"
},
{
"name": "CVE-2026-74454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74454"
},
{
"name": "CVE-2026-64341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64341"
},
{
"name": "CVE-2026-72342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72342"
},
{
"name": "CVE-2026-64338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64338"
},
{
"name": "CVE-2026-68361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68361"
},
{
"name": "CVE-2026-64083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64083"
},
{
"name": "CVE-2026-68181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68181"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-64249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64249"
},
{
"name": "CVE-2026-72222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72222"
},
{
"name": "CVE-2026-64536",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64536"
},
{
"name": "CVE-2026-43213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43213"
},
{
"name": "CVE-2026-64570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64570"
},
{
"name": "CVE-2026-63850",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63850"
},
{
"name": "CVE-2026-31663",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31663"
},
{
"name": "CVE-2026-68113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68113"
},
{
"name": "CVE-2026-68286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68286"
},
{
"name": "CVE-2026-64010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64010"
},
{
"name": "CVE-2026-64243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64243"
},
{
"name": "CVE-2026-52975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52975"
},
{
"name": "CVE-2026-68160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68160"
},
{
"name": "CVE-2026-46127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46127"
},
{
"name": "CVE-2026-64553",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64553"
},
{
"name": "CVE-2026-68157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68157"
},
{
"name": "CVE-2026-64351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64351"
},
{
"name": "CVE-2026-64051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64051"
},
{
"name": "CVE-2026-23230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23230"
},
{
"name": "CVE-2026-64039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64039"
},
{
"name": "CVE-2026-68368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68368"
},
{
"name": "CVE-2026-68281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68281"
},
{
"name": "CVE-2026-74474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74474"
},
{
"name": "CVE-2026-68335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68335"
},
{
"name": "CVE-2026-53353",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53353"
},
{
"name": "CVE-2026-68426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68426"
},
{
"name": "CVE-2026-68329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68329"
},
{
"name": "CVE-2026-68189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68189"
},
{
"name": "CVE-2026-64375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64375"
},
{
"name": "CVE-2026-64296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64296"
},
{
"name": "CVE-2026-72307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72307"
},
{
"name": "CVE-2026-64546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64546"
},
{
"name": "CVE-2026-63926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63926"
},
{
"name": "CVE-2026-68212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68212"
},
{
"name": "CVE-2026-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53110"
},
{
"name": "CVE-2026-64593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64593"
},
{
"name": "CVE-2026-23240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23240"
},
{
"name": "CVE-2026-64568",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64568"
},
{
"name": "CVE-2026-63865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63865"
},
{
"name": "CVE-2026-64052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64052"
},
{
"name": "CVE-2026-68389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68389"
},
{
"name": "CVE-2026-64603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64603"
},
{
"name": "CVE-2026-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53219"
},
{
"name": "CVE-2026-68215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68215"
},
{
"name": "CVE-2026-64109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64109"
},
{
"name": "CVE-2026-64085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64085"
},
{
"name": "CVE-2026-64166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64166"
},
{
"name": "CVE-2026-31418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31418"
},
{
"name": "CVE-2026-64504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64504"
},
{
"name": "CVE-2026-68369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68369"
},
{
"name": "CVE-2026-63898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63898"
},
{
"name": "CVE-2026-64148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64148"
},
{
"name": "CVE-2026-72495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72495"
},
{
"name": "CVE-2026-64004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64004"
},
{
"name": "CVE-2026-31392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31392"
},
{
"name": "CVE-2026-63992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63992"
},
{
"name": "CVE-2026-64155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64155"
},
{
"name": "CVE-2026-72084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72084"
},
{
"name": "CVE-2026-68340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68340"
},
{
"name": "CVE-2026-72317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72317"
},
{
"name": "CVE-2026-68352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68352"
},
{
"name": "CVE-2026-68106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68106"
},
{
"name": "CVE-2026-46242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46242"
},
{
"name": "CVE-2026-63996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63996"
},
{
"name": "CVE-2026-68197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68197"
},
{
"name": "CVE-2026-64343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64343"
},
{
"name": "CVE-2026-64021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64021"
},
{
"name": "CVE-2026-68315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68315"
},
{
"name": "CVE-2026-68346",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68346"
},
{
"name": "CVE-2026-68377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68377"
},
{
"name": "CVE-2026-68413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68413"
},
{
"name": "CVE-2026-68372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68372"
},
{
"name": "CVE-2026-64471",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64471"
},
{
"name": "CVE-2026-64180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64180"
},
{
"name": "CVE-2026-68357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68357"
},
{
"name": "CVE-2026-53034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53034"
},
{
"name": "CVE-2024-57841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57841"
},
{
"name": "CVE-2026-74318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74318"
},
{
"name": "CVE-2026-68399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68399"
},
{
"name": "CVE-2026-64539",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64539"
},
{
"name": "CVE-2026-64602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64602"
},
{
"name": "CVE-2026-64583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64583"
},
{
"name": "CVE-2026-64125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64125"
},
{
"name": "CVE-2026-68418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68418"
},
{
"name": "CVE-2026-64551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64551"
},
{
"name": "CVE-2026-53111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53111"
},
{
"name": "CVE-2026-68312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68312"
},
{
"name": "CVE-2026-80529",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80529"
},
{
"name": "CVE-2026-68262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68262"
},
{
"name": "CVE-2026-68194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68194"
},
{
"name": "CVE-2026-64131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64131"
},
{
"name": "CVE-2026-64048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64048"
},
{
"name": "CVE-2026-31759",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31759"
},
{
"name": "CVE-2026-68127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68127"
},
{
"name": "CVE-2026-72341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72341"
},
{
"name": "CVE-2026-68112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68112"
},
{
"name": "CVE-2026-64306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64306"
},
{
"name": "CVE-2026-64313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64313"
},
{
"name": "CVE-2026-52994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52994"
},
{
"name": "CVE-2026-64112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64112"
},
{
"name": "CVE-2026-64442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64442"
},
{
"name": "CVE-2026-64554",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64554"
},
{
"name": "CVE-2026-64477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64477"
},
{
"name": "CVE-2026-64463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64463"
},
{
"name": "CVE-2026-64401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64401"
},
{
"name": "CVE-2026-68159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68159"
},
{
"name": "CVE-2026-74694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74694"
},
{
"name": "CVE-2026-64018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64018"
},
{
"name": "CVE-2026-64541",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64541"
},
{
"name": "CVE-2026-64332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64332"
},
{
"name": "CVE-2026-63920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63920"
},
{
"name": "CVE-2026-68202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68202"
},
{
"name": "CVE-2026-72389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72389"
},
{
"name": "CVE-2026-72498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72498"
},
{
"name": "CVE-2026-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53096"
},
{
"name": "CVE-2026-72499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72499"
},
{
"name": "CVE-2026-43077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43077"
},
{
"name": "CVE-2026-64127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64127"
},
{
"name": "CVE-2026-68104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68104"
},
{
"name": "CVE-2026-64378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64378"
},
{
"name": "CVE-2026-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53076"
},
{
"name": "CVE-2026-64549",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64549"
},
{
"name": "CVE-2026-68137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68137"
},
{
"name": "CVE-2026-68143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68143"
},
{
"name": "CVE-2026-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53182"
},
{
"name": "CVE-2026-64055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64055"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53207"
},
{
"name": "CVE-2026-68349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68349"
},
{
"name": "CVE-2026-64244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64244"
},
{
"name": "CVE-2025-40199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40199"
},
{
"name": "CVE-2026-74496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74496"
},
{
"name": "CVE-2026-68257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68257"
},
{
"name": "CVE-2026-53126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53126"
},
{
"name": "CVE-2026-68252",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68252"
},
{
"name": "CVE-2026-63970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63970"
},
{
"name": "CVE-2026-72502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72502"
},
{
"name": "CVE-2026-68351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68351"
},
{
"name": "CVE-2026-68289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68289"
},
{
"name": "CVE-2026-43271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43271"
},
{
"name": "CVE-2026-68402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68402"
},
{
"name": "CVE-2026-72463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72463"
},
{
"name": "CVE-2026-64224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64224"
},
{
"name": "CVE-2026-68117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68117"
},
{
"name": "CVE-2026-64559",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64559"
},
{
"name": "CVE-2026-68333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68333"
},
{
"name": "CVE-2026-64544",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64544"
},
{
"name": "CVE-2026-68386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68386"
},
{
"name": "CVE-2025-71104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71104"
},
{
"name": "CVE-2026-68111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68111"
},
{
"name": "CVE-2026-64577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64577"
},
{
"name": "CVE-2026-64115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64115"
},
{
"name": "CVE-2026-52946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52946"
},
{
"name": "CVE-2026-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53059"
},
{
"name": "CVE-2026-72308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72308"
},
{
"name": "CVE-2026-53133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53133"
},
{
"name": "CVE-2026-74334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74334"
},
{
"name": "CVE-2026-68142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68142"
},
{
"name": "CVE-2026-64427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64427"
},
{
"name": "CVE-2026-68243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68243"
},
{
"name": "CVE-2026-64164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64164"
},
{
"name": "CVE-2026-64346",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64346"
},
{
"name": "CVE-2026-68209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68209"
},
{
"name": "CVE-2026-68306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68306"
},
{
"name": "CVE-2026-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53263"
},
{
"name": "CVE-2026-63891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63891"
},
{
"name": "CVE-2026-68207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68207"
},
{
"name": "CVE-2026-64342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64342"
},
{
"name": "CVE-2026-68373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68373"
},
{
"name": "CVE-2026-63985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63985"
},
{
"name": "CVE-2026-64478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64478"
},
{
"name": "CVE-2026-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68206"
},
{
"name": "CVE-2026-68110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68110"
},
{
"name": "CVE-2026-74577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74577"
},
{
"name": "CVE-2026-64472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64472"
},
{
"name": "CVE-2026-74516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74516"
},
{
"name": "CVE-2026-64581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64581"
},
{
"name": "CVE-2026-64585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64585"
},
{
"name": "CVE-2026-72132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72132"
},
{
"name": "CVE-2026-64335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64335"
},
{
"name": "CVE-2026-68391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68391"
},
{
"name": "CVE-2026-53228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53228"
},
{
"name": "CVE-2026-64315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64315"
},
{
"name": "CVE-2026-68227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68227"
},
{
"name": "CVE-2026-68348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68348"
},
{
"name": "CVE-2026-64273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64273"
},
{
"name": "CVE-2026-63828",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63828"
},
{
"name": "CVE-2026-68331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68331"
},
{
"name": "CVE-2026-74567",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74567"
},
{
"name": "CVE-2026-68238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68238"
},
{
"name": "CVE-2026-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53336"
},
{
"name": "CVE-2026-74582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74582"
},
{
"name": "CVE-2026-68432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68432"
},
{
"name": "CVE-2026-64084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64084"
},
{
"name": "CVE-2026-64014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64014"
},
{
"name": "CVE-2026-74548",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74548"
},
{
"name": "CVE-2026-64001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64001"
},
{
"name": "CVE-2026-64545",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64545"
},
{
"name": "CVE-2026-74518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74518"
},
{
"name": "CVE-2026-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53388"
},
{
"name": "CVE-2026-63937",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63937"
},
{
"name": "CVE-2026-45897",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45897"
},
{
"name": "CVE-2026-64305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64305"
},
{
"name": "CVE-2026-80590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80590"
},
{
"name": "CVE-2026-43015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43015"
},
{
"name": "CVE-2026-68398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68398"
},
{
"name": "CVE-2026-68322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68322"
},
{
"name": "CVE-2026-64381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64381"
},
{
"name": "CVE-2026-64604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64604"
},
{
"name": "CVE-2026-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53337"
},
{
"name": "CVE-2026-68429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68429"
},
{
"name": "CVE-2026-64597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64597"
},
{
"name": "CVE-2026-63887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63887"
},
{
"name": "CVE-2026-68136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68136"
},
{
"name": "CVE-2026-64496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64496"
},
{
"name": "CVE-2025-39964",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39964"
},
{
"name": "CVE-2026-64113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64113"
},
{
"name": "CVE-2026-64387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64387"
},
{
"name": "CVE-2026-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68263"
},
{
"name": "CVE-2026-68299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68299"
},
{
"name": "CVE-2026-63972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63972"
},
{
"name": "CVE-2026-68082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68082"
},
{
"name": "CVE-2026-68366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68366"
},
{
"name": "CVE-2026-46274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46274"
},
{
"name": "CVE-2026-64408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64408"
},
{
"name": "CVE-2026-68156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68156"
},
{
"name": "CVE-2026-74695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74695"
},
{
"name": "CVE-2026-64136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64136"
},
{
"name": "CVE-2026-68121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68121"
},
{
"name": "CVE-2026-68231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68231"
},
{
"name": "CVE-2026-68182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68182"
},
{
"name": "CVE-2026-74717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74717"
},
{
"name": "CVE-2026-64481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64481"
},
{
"name": "CVE-2026-64316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64316"
},
{
"name": "CVE-2026-72036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72036"
},
{
"name": "CVE-2026-68422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68422"
},
{
"name": "CVE-2026-64000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64000"
},
{
"name": "CVE-2026-68327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68327"
},
{
"name": "CVE-2026-64582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64582"
},
{
"name": "CVE-2026-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53223"
},
{
"name": "CVE-2026-64423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64423"
},
{
"name": "CVE-2026-64034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64034"
},
{
"name": "CVE-2026-74610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74610"
},
{
"name": "CVE-2026-64443",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64443"
},
{
"name": "CVE-2026-68433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68433"
},
{
"name": "CVE-2026-68195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68195"
},
{
"name": "CVE-2026-31557",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31557"
},
{
"name": "CVE-2026-63868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63868"
},
{
"name": "CVE-2026-72123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72123"
},
{
"name": "CVE-2026-64269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64269"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-64540",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64540"
},
{
"name": "CVE-2026-72296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72296"
},
{
"name": "CVE-2024-44981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44981"
},
{
"name": "CVE-2026-64482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64482"
},
{
"name": "CVE-2026-64218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64218"
},
{
"name": "CVE-2026-64495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64495"
},
{
"name": "CVE-2026-72072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72072"
},
{
"name": "CVE-2026-68279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68279"
},
{
"name": "CVE-2026-68205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68205"
},
{
"name": "CVE-2026-68234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68234"
},
{
"name": "CVE-2026-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52920"
},
{
"name": "CVE-2026-53001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53001"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-74510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74510"
},
{
"name": "CVE-2026-68256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68256"
},
{
"name": "CVE-2026-68303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68303"
},
{
"name": "CVE-2026-53269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53269"
},
{
"name": "CVE-2026-68445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68445"
},
{
"name": "CVE-2026-64479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64479"
},
{
"name": "CVE-2026-74512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74512"
},
{
"name": "CVE-2026-64329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64329"
},
{
"name": "CVE-2026-64434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64434"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-63997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63997"
},
{
"name": "CVE-2026-64219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64219"
},
{
"name": "CVE-2026-64277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64277"
},
{
"name": "CVE-2026-64126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64126"
},
{
"name": "CVE-2026-64503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64503"
},
{
"name": "CVE-2026-64562",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64562"
},
{
"name": "CVE-2026-68434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68434"
},
{
"name": "CVE-2026-64168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64168"
},
{
"name": "CVE-2026-68105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68105"
},
{
"name": "CVE-2026-68444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68444"
},
{
"name": "CVE-2026-72035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72035"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2026-68153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68153"
},
{
"name": "CVE-2026-64558",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64558"
},
{
"name": "CVE-2026-63881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63881"
},
{
"name": "CVE-2026-64571",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64571"
},
{
"name": "CVE-2026-72496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72496"
},
{
"name": "CVE-2026-63969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63969"
},
{
"name": "CVE-2026-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53089"
},
{
"name": "CVE-2026-68188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68188"
},
{
"name": "CVE-2026-68161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68161"
},
{
"name": "CVE-2026-64436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64436"
},
{
"name": "CVE-2026-64403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64403"
},
{
"name": "CVE-2026-64222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64222"
},
{
"name": "CVE-2026-64121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64121"
},
{
"name": "CVE-2026-68259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68259"
},
{
"name": "CVE-2026-68235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68235"
},
{
"name": "CVE-2026-68223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68223"
},
{
"name": "CVE-2026-64412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64412"
},
{
"name": "CVE-2026-74556",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74556"
},
{
"name": "CVE-2026-64188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64188"
},
{
"name": "CVE-2026-64144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64144"
},
{
"name": "CVE-2026-64487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64487"
},
{
"name": "CVE-2026-64303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64303"
},
{
"name": "CVE-2026-74296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74296"
},
{
"name": "CVE-2026-64086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64086"
},
{
"name": "CVE-2026-68414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68414"
},
{
"name": "CVE-2026-64429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64429"
},
{
"name": "CVE-2026-64344",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64344"
},
{
"name": "CVE-2026-64286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64286"
},
{
"name": "CVE-2026-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68214"
},
{
"name": "CVE-2026-64029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64029"
},
{
"name": "CVE-2026-68217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68217"
},
{
"name": "CVE-2026-68222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68222"
},
{
"name": "CVE-2026-74692",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74692"
},
{
"name": "CVE-2026-68124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68124"
},
{
"name": "CVE-2026-53077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53077"
},
{
"name": "CVE-2026-64350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64350"
},
{
"name": "CVE-2026-68250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68250"
},
{
"name": "CVE-2026-72473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72473"
},
{
"name": "CVE-2026-43110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43110"
},
{
"name": "CVE-2026-68397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68397"
},
{
"name": "CVE-2026-64572",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64572"
},
{
"name": "CVE-2026-64411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64411"
},
{
"name": "CVE-2026-68126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68126"
},
{
"name": "CVE-2026-74321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74321"
},
{
"name": "CVE-2026-63998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63998"
},
{
"name": "CVE-2026-64137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64137"
},
{
"name": "CVE-2026-23449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23449"
},
{
"name": "CVE-2026-43386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43386"
},
{
"name": "CVE-2026-64537",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64537"
},
{
"name": "CVE-2026-64334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64334"
},
{
"name": "CVE-2026-74495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74495"
},
{
"name": "CVE-2026-64448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64448"
},
{
"name": "CVE-2026-72497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72497"
},
{
"name": "CVE-2026-68125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68125"
},
{
"name": "CVE-2026-68135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68135"
},
{
"name": "CVE-2026-53033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53033"
},
{
"name": "CVE-2026-72032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72032"
},
{
"name": "CVE-2026-72221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72221"
},
{
"name": "CVE-2026-72289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72289"
},
{
"name": "CVE-2026-72251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72251"
},
{
"name": "CVE-2026-64134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64134"
},
{
"name": "CVE-2026-68254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68254"
},
{
"name": "CVE-2026-64005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64005"
},
{
"name": "CVE-2026-68360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68360"
},
{
"name": "CVE-2026-46107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46107"
},
{
"name": "CVE-2026-64524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64524"
},
{
"name": "CVE-2026-80654",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80654"
},
{
"name": "CVE-2025-38469",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38469"
},
{
"name": "CVE-2026-68244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68244"
},
{
"name": "CVE-2026-64382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64382"
},
{
"name": "CVE-2026-68249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68249"
},
{
"name": "CVE-2026-68107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68107"
},
{
"name": "CVE-2026-68392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68392"
},
{
"name": "CVE-2026-68300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68300"
},
{
"name": "CVE-2026-64444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64444"
},
{
"name": "CVE-2026-68260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68260"
},
{
"name": "CVE-2026-68229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68229"
},
{
"name": "CVE-2026-64225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64225"
},
{
"name": "CVE-2026-64331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64331"
},
{
"name": "CVE-2026-64511",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64511"
},
{
"name": "CVE-2026-68284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68284"
},
{
"name": "CVE-2026-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53264"
},
{
"name": "CVE-2026-63999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63999"
},
{
"name": "CVE-2026-43109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43109"
},
{
"name": "CVE-2026-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53142"
},
{
"name": "CVE-2026-68152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68152"
},
{
"name": "CVE-2026-68353",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68353"
},
{
"name": "CVE-2026-63944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63944"
},
{
"name": "CVE-2026-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53273"
},
{
"name": "CVE-2026-64547",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64547"
},
{
"name": "CVE-2026-64056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64056"
},
{
"name": "CVE-2026-63860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63860"
},
{
"name": "CVE-2026-64494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64494"
},
{
"name": "CVE-2026-68108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68108"
},
{
"name": "CVE-2026-64033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64033"
},
{
"name": "CVE-2026-64565",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64565"
},
{
"name": "CVE-2026-68158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68158"
},
{
"name": "CVE-2026-64543",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64543"
},
{
"name": "CVE-2026-64573",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64573"
},
{
"name": "CVE-2026-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53246"
},
{
"name": "CVE-2026-64245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64245"
},
{
"name": "CVE-2026-43278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43278"
},
{
"name": "CVE-2026-63823",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63823"
},
{
"name": "CVE-2026-68325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68325"
},
{
"name": "CVE-2026-68253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68253"
},
{
"name": "CVE-2026-72501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72501"
},
{
"name": "CVE-2026-68355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68355"
},
{
"name": "CVE-2026-64530",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64530"
},
{
"name": "CVE-2026-64015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64015"
},
{
"name": "CVE-2026-64294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64294"
},
{
"name": "CVE-2026-43125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43125"
},
{
"name": "CVE-2026-68470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68470"
},
{
"name": "CVE-2026-63808",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63808"
},
{
"name": "CVE-2026-72343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72343"
},
{
"name": "CVE-2026-63973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63973"
},
{
"name": "CVE-2026-68180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68180"
},
{
"name": "CVE-2026-68247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68247"
},
{
"name": "CVE-2026-74722",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74722"
},
{
"name": "CVE-2026-68407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68407"
},
{
"name": "CVE-2026-64247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64247"
},
{
"name": "CVE-2026-68123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68123"
},
{
"name": "CVE-2026-64420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64420"
},
{
"name": "CVE-2026-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53180"
},
{
"name": "CVE-2026-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53238"
},
{
"name": "CVE-2026-43416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43416"
},
{
"name": "CVE-2026-64548",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64548"
},
{
"name": "CVE-2026-64118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64118"
},
{
"name": "CVE-2026-68162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68162"
},
{
"name": "CVE-2026-68220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68220"
},
{
"name": "CVE-2026-64384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64384"
},
{
"name": "CVE-2026-64406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64406"
},
{
"name": "CVE-2026-68354",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68354"
},
{
"name": "CVE-2026-64600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64600"
},
{
"name": "CVE-2026-68149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68149"
},
{
"name": "CVE-2026-64312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64312"
},
{
"name": "CVE-2026-72469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72469"
},
{
"name": "CVE-2026-63889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63889"
},
{
"name": "CVE-2026-68375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68375"
},
{
"name": "CVE-2026-64505",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64505"
},
{
"name": "CVE-2026-53366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53366"
},
{
"name": "CVE-2026-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52923"
},
{
"name": "CVE-2026-64087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64087"
},
{
"name": "CVE-2026-68251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68251"
},
{
"name": "CVE-2026-74584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74584"
},
{
"name": "CVE-2026-53154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53154"
},
{
"name": "CVE-2026-64358",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64358"
},
{
"name": "CVE-2026-64355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64355"
},
{
"name": "CVE-2026-64515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64515"
},
{
"name": "CVE-2026-72069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72069"
},
{
"name": "CVE-2026-68359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68359"
},
{
"name": "CVE-2026-64185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64185"
},
{
"name": "CVE-2026-72020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72020"
},
{
"name": "CVE-2026-68370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68370"
},
{
"name": "CVE-2026-43116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43116"
},
{
"name": "CVE-2026-64340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64340"
},
{
"name": "CVE-2026-64007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64007"
},
{
"name": "CVE-2026-64567",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64567"
},
{
"name": "CVE-2026-64450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64450"
},
{
"name": "CVE-2026-64484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64484"
},
{
"name": "CVE-2026-52990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52990"
},
{
"name": "CVE-2026-64114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64114"
},
{
"name": "CVE-2026-64266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64266"
},
{
"name": "CVE-2025-40022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40022"
},
{
"name": "CVE-2026-43363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43363"
},
{
"name": "CVE-2026-68236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68236"
},
{
"name": "CVE-2026-64088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64088"
},
{
"name": "CVE-2026-64073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64073"
},
{
"name": "CVE-2026-64576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64576"
},
{
"name": "CVE-2026-68192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68192"
},
{
"name": "CVE-2026-74712",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74712"
},
{
"name": "CVE-2026-74550",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74550"
},
{
"name": "CVE-2026-74269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74269"
},
{
"name": "CVE-2026-74509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74509"
},
{
"name": "CVE-2026-64002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64002"
},
{
"name": "CVE-2026-72288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72288"
},
{
"name": "CVE-2026-68272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68272"
},
{
"name": "CVE-2026-64135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64135"
},
{
"name": "CVE-2026-64440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64440"
},
{
"name": "CVE-2026-52977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52977"
},
{
"name": "CVE-2026-52972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52972"
},
{
"name": "CVE-2026-74527",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74527"
},
{
"name": "CVE-2026-72046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72046"
},
{
"name": "CVE-2026-68406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68406"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-64011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64011"
},
{
"name": "CVE-2026-64317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64317"
},
{
"name": "CVE-2026-68336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68336"
},
{
"name": "CVE-2026-64569",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64569"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-68154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68154"
}
],
"initial_release_date": "2026-09-11T00:00:00",
"last_revision_date": "2026-09-11T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-1164",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-09-11T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23490-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623490-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23485-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623485-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23479-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623479-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23486-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623486-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23477-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623477-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23484-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623484-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23487-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623487-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23488-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623488-1"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4120-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264120-1"
},
{
"published_at": "2026-08-31",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23439-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623439-1"
},
{
"published_at": "2026-08-31",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23440-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623440-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23482-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623482-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23481-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623481-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23483-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623483-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23489-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623489-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23491-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623491-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23480-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623480-1"
}
]
}
CERTFR-2026-AVI-1202
Vulnerability from certfr_avis - Published: 2026-09-18 - Updated: 2026-09-18
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | Public Cloud Module | Public Cloud Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Micro Extras | SUSE Linux Micro Extras 6.1 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP7 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.2 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.1 | ||
| SUSE | Legacy Module | Legacy Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Public Cloud Module 15-SP7",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro Extras 6.1",
"product": {
"name": "SUSE Linux Micro Extras",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP7",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.2",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.1",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP7",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP7",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-68116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68116"
},
{
"name": "CVE-2025-71075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71075"
},
{
"name": "CVE-2026-64214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64214"
},
{
"name": "CVE-2026-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53091"
},
{
"name": "CVE-2026-64376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64376"
},
{
"name": "CVE-2026-74395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74395"
},
{
"name": "CVE-2026-68343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68343"
},
{
"name": "CVE-2026-64552",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64552"
},
{
"name": "CVE-2026-64287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64287"
},
{
"name": "CVE-2026-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53381"
},
{
"name": "CVE-2026-64275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64275"
},
{
"name": "CVE-2026-64274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64274"
},
{
"name": "CVE-2026-64538",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64538"
},
{
"name": "CVE-2026-74394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74394"
},
{
"name": "CVE-2026-68450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68450"
},
{
"name": "CVE-2026-68480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68480"
},
{
"name": "CVE-2026-68271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68271"
},
{
"name": "CVE-2026-74297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74297"
},
{
"name": "CVE-2026-64561",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64561"
},
{
"name": "CVE-2026-64133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64133"
},
{
"name": "CVE-2026-31658",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31658"
},
{
"name": "CVE-2026-64047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64047"
},
{
"name": "CVE-2026-74481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74481"
},
{
"name": "CVE-2026-68138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68138"
},
{
"name": "CVE-2026-64192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64192"
},
{
"name": "CVE-2026-52955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52955"
},
{
"name": "CVE-2026-68193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68193"
},
{
"name": "CVE-2026-68204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68204"
},
{
"name": "CVE-2026-52925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52925"
},
{
"name": "CVE-2026-74669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74669"
},
{
"name": "CVE-2026-68302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68302"
},
{
"name": "CVE-2026-64452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64452"
},
{
"name": "CVE-2026-52929",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52929"
},
{
"name": "CVE-2026-68081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68081"
},
{
"name": "CVE-2026-64483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64483"
},
{
"name": "CVE-2026-63980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63980"
},
{
"name": "CVE-2026-74482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74482"
},
{
"name": "CVE-2026-64322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64322"
},
{
"name": "CVE-2026-43448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43448"
},
{
"name": "CVE-2026-64470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64470"
},
{
"name": "CVE-2026-63923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63923"
},
{
"name": "CVE-2026-68339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68339"
},
{
"name": "CVE-2026-64513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64513"
},
{
"name": "CVE-2026-68218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68218"
},
{
"name": "CVE-2026-68088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68088"
},
{
"name": "CVE-2026-64388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64388"
},
{
"name": "CVE-2026-64512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64512"
},
{
"name": "CVE-2026-64409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64409"
},
{
"name": "CVE-2026-68129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68129"
},
{
"name": "CVE-2026-74571",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74571"
},
{
"name": "CVE-2026-68245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68245"
},
{
"name": "CVE-2026-64268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64268"
},
{
"name": "CVE-2026-68428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68428"
},
{
"name": "CVE-2026-64099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64099"
},
{
"name": "CVE-2026-64489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64489"
},
{
"name": "CVE-2026-74581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74581"
},
{
"name": "CVE-2026-64480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64480"
},
{
"name": "CVE-2026-72494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72494"
},
{
"name": "CVE-2026-64257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64257"
},
{
"name": "CVE-2026-64006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64006"
},
{
"name": "CVE-2026-68313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68313"
},
{
"name": "CVE-2026-64385",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64385"
},
{
"name": "CVE-2026-74537",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74537"
},
{
"name": "CVE-2026-63995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63995"
},
{
"name": "CVE-2026-64217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64217"
},
{
"name": "CVE-2026-46319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46319"
},
{
"name": "CVE-2026-68326",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68326"
},
{
"name": "CVE-2026-68184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68184"
},
{
"name": "CVE-2026-64454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64454"
},
{
"name": "CVE-2026-64407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64407"
},
{
"name": "CVE-2026-68417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68417"
},
{
"name": "CVE-2026-64527",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64527"
},
{
"name": "CVE-2026-23227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23227"
},
{
"name": "CVE-2026-74563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74563"
},
{
"name": "CVE-2026-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23454"
},
{
"name": "CVE-2026-68248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68248"
},
{
"name": "CVE-2026-63886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63886"
},
{
"name": "CVE-2026-64365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64365"
},
{
"name": "CVE-2026-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53260"
},
{
"name": "CVE-2026-64128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64128"
},
{
"name": "CVE-2026-68277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68277"
},
{
"name": "CVE-2026-68288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68288"
},
{
"name": "CVE-2026-68410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68410"
},
{
"name": "CVE-2026-68437",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68437"
},
{
"name": "CVE-2026-68261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68261"
},
{
"name": "CVE-2026-74345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74345"
},
{
"name": "CVE-2025-40204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40204"
},
{
"name": "CVE-2026-72083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72083"
},
{
"name": "CVE-2026-64333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64333"
},
{
"name": "CVE-2026-68304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68304"
},
{
"name": "CVE-2026-68155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68155"
},
{
"name": "CVE-2026-63928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63928"
},
{
"name": "CVE-2026-68132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68132"
},
{
"name": "CVE-2026-64574",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64574"
},
{
"name": "CVE-2026-63879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63879"
},
{
"name": "CVE-2026-68102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68102"
},
{
"name": "CVE-2026-74488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74488"
},
{
"name": "CVE-2026-68086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68086"
},
{
"name": "CVE-2025-39939",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39939"
},
{
"name": "CVE-2026-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53220"
},
{
"name": "CVE-2026-64246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64246"
},
{
"name": "CVE-2026-68085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68085"
},
{
"name": "CVE-2026-68446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68446"
},
{
"name": "CVE-2026-68408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68408"
},
{
"name": "CVE-2026-64386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64386"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-68226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68226"
},
{
"name": "CVE-2026-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53365"
},
{
"name": "CVE-2026-68350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68350"
},
{
"name": "CVE-2026-23210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23210"
},
{
"name": "CVE-2026-68419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68419"
},
{
"name": "CVE-2026-68091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68091"
},
{
"name": "CVE-2026-68297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68297"
},
{
"name": "CVE-2026-53224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53224"
},
{
"name": "CVE-2026-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53360"
},
{
"name": "CVE-2026-68199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68199"
},
{
"name": "CVE-2026-64383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64383"
},
{
"name": "CVE-2026-68425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68425"
},
{
"name": "CVE-2026-64337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64337"
},
{
"name": "CVE-2026-63888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63888"
},
{
"name": "CVE-2026-52956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52956"
},
{
"name": "CVE-2026-80534",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80534"
},
{
"name": "CVE-2026-72466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72466"
},
{
"name": "CVE-2026-64178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64178"
},
{
"name": "CVE-2026-64497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64497"
},
{
"name": "CVE-2026-53163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53163"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-64599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64599"
},
{
"name": "CVE-2026-68293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68293"
},
{
"name": "CVE-2026-68365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68365"
},
{
"name": "CVE-2026-72254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72254"
},
{
"name": "CVE-2026-64598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64598"
},
{
"name": "CVE-2026-68320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68320"
},
{
"name": "CVE-2026-63810",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63810"
},
{
"name": "CVE-2026-31531",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31531"
},
{
"name": "CVE-2026-64098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64098"
},
{
"name": "CVE-2026-63801",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63801"
},
{
"name": "CVE-2026-63827",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63827"
},
{
"name": "CVE-2026-64304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64304"
},
{
"name": "CVE-2026-43014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43014"
},
{
"name": "CVE-2026-68280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68280"
},
{
"name": "CVE-2026-68362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68362"
},
{
"name": "CVE-2025-68179",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68179"
},
{
"name": "CVE-2026-63842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63842"
},
{
"name": "CVE-2026-68430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68430"
},
{
"name": "CVE-2026-68427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68427"
},
{
"name": "CVE-2026-43319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43319"
},
{
"name": "CVE-2026-64146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64146"
},
{
"name": "CVE-2026-72500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72500"
},
{
"name": "CVE-2026-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53309"
},
{
"name": "CVE-2026-68324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68324"
},
{
"name": "CVE-2026-68308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68308"
},
{
"name": "CVE-2026-64276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64276"
},
{
"name": "CVE-2026-64190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64190"
},
{
"name": "CVE-2026-68210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68210"
},
{
"name": "CVE-2026-64237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64237"
},
{
"name": "CVE-2026-64323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64323"
},
{
"name": "CVE-2026-68267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68267"
},
{
"name": "CVE-2026-68309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68309"
},
{
"name": "CVE-2026-68403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68403"
},
{
"name": "CVE-2026-68139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68139"
},
{
"name": "CVE-2026-64271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64271"
},
{
"name": "CVE-2026-74566",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74566"
},
{
"name": "CVE-2026-52939",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52939"
},
{
"name": "CVE-2026-63925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63925"
},
{
"name": "CVE-2026-68093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68093"
},
{
"name": "CVE-2026-72262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72262"
},
{
"name": "CVE-2026-68166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68166"
},
{
"name": "CVE-2026-63990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63990"
},
{
"name": "CVE-2026-64455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64455"
},
{
"name": "CVE-2026-72467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72467"
},
{
"name": "CVE-2026-64421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64421"
},
{
"name": "CVE-2026-64584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64584"
},
{
"name": "CVE-2026-64445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64445"
},
{
"name": "CVE-2026-52935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52935"
},
{
"name": "CVE-2026-68310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68310"
},
{
"name": "CVE-2026-64433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64433"
},
{
"name": "CVE-2026-68115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68115"
},
{
"name": "CVE-2026-68133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68133"
},
{
"name": "CVE-2026-68246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68246"
},
{
"name": "CVE-2026-64563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64563"
},
{
"name": "CVE-2026-68405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68405"
},
{
"name": "CVE-2026-68219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68219"
},
{
"name": "CVE-2026-68216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68216"
},
{
"name": "CVE-2026-64500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64500"
},
{
"name": "CVE-2026-53094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53094"
},
{
"name": "CVE-2026-64097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64097"
},
{
"name": "CVE-2026-68328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68328"
},
{
"name": "CVE-2026-68394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68394"
},
{
"name": "CVE-2026-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53330"
},
{
"name": "CVE-2025-23137",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23137"
},
{
"name": "CVE-2026-64348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64348"
},
{
"name": "CVE-2026-68196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68196"
},
{
"name": "CVE-2026-64362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64362"
},
{
"name": "CVE-2026-72464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72464"
},
{
"name": "CVE-2026-68269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68269"
},
{
"name": "CVE-2026-68255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68255"
},
{
"name": "CVE-2026-64102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64102"
},
{
"name": "CVE-2026-68363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68363"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2026-68213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68213"
},
{
"name": "CVE-2026-68278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68278"
},
{
"name": "CVE-2026-64486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64486"
},
{
"name": "CVE-2026-68145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68145"
},
{
"name": "CVE-2026-64517",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64517"
},
{
"name": "CVE-2026-74454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74454"
},
{
"name": "CVE-2026-64341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64341"
},
{
"name": "CVE-2026-72342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72342"
},
{
"name": "CVE-2026-80580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80580"
},
{
"name": "CVE-2026-64338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64338"
},
{
"name": "CVE-2026-68361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68361"
},
{
"name": "CVE-2026-64083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64083"
},
{
"name": "CVE-2026-68181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68181"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-46116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46116"
},
{
"name": "CVE-2026-64249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64249"
},
{
"name": "CVE-2026-72222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72222"
},
{
"name": "CVE-2026-64536",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64536"
},
{
"name": "CVE-2026-43213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43213"
},
{
"name": "CVE-2026-64570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64570"
},
{
"name": "CVE-2026-63850",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63850"
},
{
"name": "CVE-2026-31663",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31663"
},
{
"name": "CVE-2026-68113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68113"
},
{
"name": "CVE-2026-68286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68286"
},
{
"name": "CVE-2026-64010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64010"
},
{
"name": "CVE-2026-64243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64243"
},
{
"name": "CVE-2026-52975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52975"
},
{
"name": "CVE-2026-68160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68160"
},
{
"name": "CVE-2026-46127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46127"
},
{
"name": "CVE-2026-64553",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64553"
},
{
"name": "CVE-2026-68157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68157"
},
{
"name": "CVE-2026-64351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64351"
},
{
"name": "CVE-2026-64051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64051"
},
{
"name": "CVE-2026-23230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23230"
},
{
"name": "CVE-2026-64039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64039"
},
{
"name": "CVE-2026-68368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68368"
},
{
"name": "CVE-2026-68281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68281"
},
{
"name": "CVE-2026-74474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74474"
},
{
"name": "CVE-2026-68335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68335"
},
{
"name": "CVE-2026-53353",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53353"
},
{
"name": "CVE-2026-68426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68426"
},
{
"name": "CVE-2026-68329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68329"
},
{
"name": "CVE-2026-68189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68189"
},
{
"name": "CVE-2026-64375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64375"
},
{
"name": "CVE-2026-64296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64296"
},
{
"name": "CVE-2026-72307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72307"
},
{
"name": "CVE-2026-64546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64546"
},
{
"name": "CVE-2026-63926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63926"
},
{
"name": "CVE-2026-68212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68212"
},
{
"name": "CVE-2026-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53110"
},
{
"name": "CVE-2026-64593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64593"
},
{
"name": "CVE-2026-23240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23240"
},
{
"name": "CVE-2026-64568",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64568"
},
{
"name": "CVE-2026-63865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63865"
},
{
"name": "CVE-2026-64052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64052"
},
{
"name": "CVE-2026-68389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68389"
},
{
"name": "CVE-2026-64603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64603"
},
{
"name": "CVE-2026-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53219"
},
{
"name": "CVE-2026-68215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68215"
},
{
"name": "CVE-2026-64109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64109"
},
{
"name": "CVE-2026-64085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64085"
},
{
"name": "CVE-2026-64166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64166"
},
{
"name": "CVE-2026-31418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31418"
},
{
"name": "CVE-2026-64504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64504"
},
{
"name": "CVE-2026-68369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68369"
},
{
"name": "CVE-2026-63898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63898"
},
{
"name": "CVE-2026-64148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64148"
},
{
"name": "CVE-2026-72495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72495"
},
{
"name": "CVE-2026-64004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64004"
},
{
"name": "CVE-2026-31392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31392"
},
{
"name": "CVE-2026-63992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63992"
},
{
"name": "CVE-2026-64155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64155"
},
{
"name": "CVE-2026-72084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72084"
},
{
"name": "CVE-2026-68340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68340"
},
{
"name": "CVE-2026-72317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72317"
},
{
"name": "CVE-2026-68352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68352"
},
{
"name": "CVE-2026-68106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68106"
},
{
"name": "CVE-2026-46242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46242"
},
{
"name": "CVE-2026-63996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63996"
},
{
"name": "CVE-2026-68197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68197"
},
{
"name": "CVE-2026-64343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64343"
},
{
"name": "CVE-2026-64021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64021"
},
{
"name": "CVE-2026-68315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68315"
},
{
"name": "CVE-2026-68346",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68346"
},
{
"name": "CVE-2026-68377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68377"
},
{
"name": "CVE-2026-68413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68413"
},
{
"name": "CVE-2026-68372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68372"
},
{
"name": "CVE-2026-64471",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64471"
},
{
"name": "CVE-2026-64180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64180"
},
{
"name": "CVE-2026-68357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68357"
},
{
"name": "CVE-2026-53034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53034"
},
{
"name": "CVE-2024-57841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57841"
},
{
"name": "CVE-2026-74318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74318"
},
{
"name": "CVE-2026-68399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68399"
},
{
"name": "CVE-2026-64539",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64539"
},
{
"name": "CVE-2026-64602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64602"
},
{
"name": "CVE-2026-64583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64583"
},
{
"name": "CVE-2026-64125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64125"
},
{
"name": "CVE-2026-68418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68418"
},
{
"name": "CVE-2026-64551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64551"
},
{
"name": "CVE-2026-53111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53111"
},
{
"name": "CVE-2026-68312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68312"
},
{
"name": "CVE-2026-80529",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80529"
},
{
"name": "CVE-2026-68262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68262"
},
{
"name": "CVE-2026-68194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68194"
},
{
"name": "CVE-2026-64131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64131"
},
{
"name": "CVE-2026-64048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64048"
},
{
"name": "CVE-2026-31759",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31759"
},
{
"name": "CVE-2026-68127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68127"
},
{
"name": "CVE-2026-72341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72341"
},
{
"name": "CVE-2026-68112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68112"
},
{
"name": "CVE-2026-64306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64306"
},
{
"name": "CVE-2026-64313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64313"
},
{
"name": "CVE-2026-52994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52994"
},
{
"name": "CVE-2026-64112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64112"
},
{
"name": "CVE-2026-64442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64442"
},
{
"name": "CVE-2026-64554",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64554"
},
{
"name": "CVE-2026-64477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64477"
},
{
"name": "CVE-2026-64463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64463"
},
{
"name": "CVE-2026-64401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64401"
},
{
"name": "CVE-2026-68159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68159"
},
{
"name": "CVE-2026-74694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74694"
},
{
"name": "CVE-2026-64018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64018"
},
{
"name": "CVE-2026-64541",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64541"
},
{
"name": "CVE-2026-64332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64332"
},
{
"name": "CVE-2026-63920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63920"
},
{
"name": "CVE-2026-68202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68202"
},
{
"name": "CVE-2026-72389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72389"
},
{
"name": "CVE-2026-72498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72498"
},
{
"name": "CVE-2026-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53096"
},
{
"name": "CVE-2026-72499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72499"
},
{
"name": "CVE-2026-43077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43077"
},
{
"name": "CVE-2026-64127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64127"
},
{
"name": "CVE-2026-68104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68104"
},
{
"name": "CVE-2026-64378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64378"
},
{
"name": "CVE-2026-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53076"
},
{
"name": "CVE-2026-64549",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64549"
},
{
"name": "CVE-2026-68137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68137"
},
{
"name": "CVE-2026-68143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68143"
},
{
"name": "CVE-2026-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53182"
},
{
"name": "CVE-2026-64055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64055"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53207"
},
{
"name": "CVE-2026-68349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68349"
},
{
"name": "CVE-2026-64244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64244"
},
{
"name": "CVE-2025-40199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40199"
},
{
"name": "CVE-2026-74496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74496"
},
{
"name": "CVE-2026-46150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46150"
},
{
"name": "CVE-2026-68257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68257"
},
{
"name": "CVE-2026-53126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53126"
},
{
"name": "CVE-2026-68252",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68252"
},
{
"name": "CVE-2026-63970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63970"
},
{
"name": "CVE-2026-72502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72502"
},
{
"name": "CVE-2026-68351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68351"
},
{
"name": "CVE-2026-68289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68289"
},
{
"name": "CVE-2026-43271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43271"
},
{
"name": "CVE-2026-68402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68402"
},
{
"name": "CVE-2026-72463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72463"
},
{
"name": "CVE-2026-64224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64224"
},
{
"name": "CVE-2026-68117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68117"
},
{
"name": "CVE-2026-64559",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64559"
},
{
"name": "CVE-2026-68333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68333"
},
{
"name": "CVE-2026-64544",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64544"
},
{
"name": "CVE-2026-68386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68386"
},
{
"name": "CVE-2025-71104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71104"
},
{
"name": "CVE-2026-68111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68111"
},
{
"name": "CVE-2026-64577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64577"
},
{
"name": "CVE-2026-64115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64115"
},
{
"name": "CVE-2026-52946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52946"
},
{
"name": "CVE-2026-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53059"
},
{
"name": "CVE-2026-72308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72308"
},
{
"name": "CVE-2026-53133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53133"
},
{
"name": "CVE-2026-74334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74334"
},
{
"name": "CVE-2026-68142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68142"
},
{
"name": "CVE-2026-64427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64427"
},
{
"name": "CVE-2026-68243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68243"
},
{
"name": "CVE-2026-64164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64164"
},
{
"name": "CVE-2026-64346",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64346"
},
{
"name": "CVE-2026-68209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68209"
},
{
"name": "CVE-2026-68306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68306"
},
{
"name": "CVE-2026-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53263"
},
{
"name": "CVE-2026-63891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63891"
},
{
"name": "CVE-2026-68207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68207"
},
{
"name": "CVE-2026-64342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64342"
},
{
"name": "CVE-2026-68373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68373"
},
{
"name": "CVE-2026-63985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63985"
},
{
"name": "CVE-2026-64478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64478"
},
{
"name": "CVE-2026-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68206"
},
{
"name": "CVE-2026-68110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68110"
},
{
"name": "CVE-2026-74577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74577"
},
{
"name": "CVE-2026-64472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64472"
},
{
"name": "CVE-2026-74516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74516"
},
{
"name": "CVE-2026-64581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64581"
},
{
"name": "CVE-2026-64585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64585"
},
{
"name": "CVE-2026-72132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72132"
},
{
"name": "CVE-2026-64335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64335"
},
{
"name": "CVE-2026-68391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68391"
},
{
"name": "CVE-2026-53228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53228"
},
{
"name": "CVE-2026-64315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64315"
},
{
"name": "CVE-2026-68227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68227"
},
{
"name": "CVE-2026-68348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68348"
},
{
"name": "CVE-2026-64273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64273"
},
{
"name": "CVE-2026-63828",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63828"
},
{
"name": "CVE-2026-68331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68331"
},
{
"name": "CVE-2026-74567",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74567"
},
{
"name": "CVE-2026-68238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68238"
},
{
"name": "CVE-2026-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53336"
},
{
"name": "CVE-2026-74582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74582"
},
{
"name": "CVE-2026-68432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68432"
},
{
"name": "CVE-2026-64084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64084"
},
{
"name": "CVE-2026-64014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64014"
},
{
"name": "CVE-2026-74548",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74548"
},
{
"name": "CVE-2026-64001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64001"
},
{
"name": "CVE-2026-64545",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64545"
},
{
"name": "CVE-2026-74518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74518"
},
{
"name": "CVE-2026-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53388"
},
{
"name": "CVE-2026-63937",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63937"
},
{
"name": "CVE-2026-45897",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45897"
},
{
"name": "CVE-2026-64305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64305"
},
{
"name": "CVE-2026-80590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80590"
},
{
"name": "CVE-2026-43015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43015"
},
{
"name": "CVE-2026-68398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68398"
},
{
"name": "CVE-2026-68322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68322"
},
{
"name": "CVE-2026-64381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64381"
},
{
"name": "CVE-2026-64604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64604"
},
{
"name": "CVE-2026-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53337"
},
{
"name": "CVE-2026-68429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68429"
},
{
"name": "CVE-2026-64597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64597"
},
{
"name": "CVE-2026-63887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63887"
},
{
"name": "CVE-2026-68136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68136"
},
{
"name": "CVE-2026-64496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64496"
},
{
"name": "CVE-2025-39964",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39964"
},
{
"name": "CVE-2026-64113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64113"
},
{
"name": "CVE-2026-64387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64387"
},
{
"name": "CVE-2026-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68263"
},
{
"name": "CVE-2026-68299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68299"
},
{
"name": "CVE-2026-63972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63972"
},
{
"name": "CVE-2026-68082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68082"
},
{
"name": "CVE-2026-68366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68366"
},
{
"name": "CVE-2026-46274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46274"
},
{
"name": "CVE-2026-64408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64408"
},
{
"name": "CVE-2026-68156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68156"
},
{
"name": "CVE-2026-74695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74695"
},
{
"name": "CVE-2026-64136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64136"
},
{
"name": "CVE-2026-68121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68121"
},
{
"name": "CVE-2026-68231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68231"
},
{
"name": "CVE-2026-68182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68182"
},
{
"name": "CVE-2026-74717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74717"
},
{
"name": "CVE-2026-64481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64481"
},
{
"name": "CVE-2026-64316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64316"
},
{
"name": "CVE-2026-72036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72036"
},
{
"name": "CVE-2026-68422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68422"
},
{
"name": "CVE-2026-64000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64000"
},
{
"name": "CVE-2026-68327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68327"
},
{
"name": "CVE-2026-64582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64582"
},
{
"name": "CVE-2026-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53223"
},
{
"name": "CVE-2026-64423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64423"
},
{
"name": "CVE-2026-64034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64034"
},
{
"name": "CVE-2026-74610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74610"
},
{
"name": "CVE-2026-64443",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64443"
},
{
"name": "CVE-2026-68433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68433"
},
{
"name": "CVE-2026-68195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68195"
},
{
"name": "CVE-2026-31557",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31557"
},
{
"name": "CVE-2026-63868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63868"
},
{
"name": "CVE-2026-72123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72123"
},
{
"name": "CVE-2026-64269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64269"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-64540",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64540"
},
{
"name": "CVE-2026-72296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72296"
},
{
"name": "CVE-2024-44981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44981"
},
{
"name": "CVE-2026-64482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64482"
},
{
"name": "CVE-2026-64218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64218"
},
{
"name": "CVE-2026-64495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64495"
},
{
"name": "CVE-2026-72072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72072"
},
{
"name": "CVE-2026-68279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68279"
},
{
"name": "CVE-2026-68205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68205"
},
{
"name": "CVE-2026-68234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68234"
},
{
"name": "CVE-2026-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52920"
},
{
"name": "CVE-2026-53001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53001"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-74510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74510"
},
{
"name": "CVE-2026-68256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68256"
},
{
"name": "CVE-2026-68303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68303"
},
{
"name": "CVE-2026-53269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53269"
},
{
"name": "CVE-2026-68445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68445"
},
{
"name": "CVE-2026-64479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64479"
},
{
"name": "CVE-2026-74512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74512"
},
{
"name": "CVE-2026-64329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64329"
},
{
"name": "CVE-2026-64434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64434"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-63997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63997"
},
{
"name": "CVE-2026-64219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64219"
},
{
"name": "CVE-2026-64277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64277"
},
{
"name": "CVE-2026-64126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64126"
},
{
"name": "CVE-2026-64503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64503"
},
{
"name": "CVE-2026-64562",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64562"
},
{
"name": "CVE-2026-68434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68434"
},
{
"name": "CVE-2026-64168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64168"
},
{
"name": "CVE-2026-68105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68105"
},
{
"name": "CVE-2026-68444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68444"
},
{
"name": "CVE-2026-72035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72035"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2026-68153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68153"
},
{
"name": "CVE-2026-64558",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64558"
},
{
"name": "CVE-2026-63881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63881"
},
{
"name": "CVE-2026-64571",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64571"
},
{
"name": "CVE-2026-72496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72496"
},
{
"name": "CVE-2026-63969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63969"
},
{
"name": "CVE-2026-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53089"
},
{
"name": "CVE-2026-68188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68188"
},
{
"name": "CVE-2026-68161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68161"
},
{
"name": "CVE-2026-64436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64436"
},
{
"name": "CVE-2026-64403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64403"
},
{
"name": "CVE-2026-64222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64222"
},
{
"name": "CVE-2026-64121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64121"
},
{
"name": "CVE-2026-68259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68259"
},
{
"name": "CVE-2026-68235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68235"
},
{
"name": "CVE-2026-68223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68223"
},
{
"name": "CVE-2026-64412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64412"
},
{
"name": "CVE-2026-74556",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74556"
},
{
"name": "CVE-2026-64188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64188"
},
{
"name": "CVE-2026-64144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64144"
},
{
"name": "CVE-2026-64487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64487"
},
{
"name": "CVE-2026-64303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64303"
},
{
"name": "CVE-2026-74296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74296"
},
{
"name": "CVE-2026-64086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64086"
},
{
"name": "CVE-2026-68414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68414"
},
{
"name": "CVE-2026-64429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64429"
},
{
"name": "CVE-2026-64344",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64344"
},
{
"name": "CVE-2026-64286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64286"
},
{
"name": "CVE-2026-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68214"
},
{
"name": "CVE-2026-64029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64029"
},
{
"name": "CVE-2026-68217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68217"
},
{
"name": "CVE-2026-68222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68222"
},
{
"name": "CVE-2026-74692",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74692"
},
{
"name": "CVE-2026-68124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68124"
},
{
"name": "CVE-2026-53077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53077"
},
{
"name": "CVE-2026-64350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64350"
},
{
"name": "CVE-2026-68250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68250"
},
{
"name": "CVE-2026-72473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72473"
},
{
"name": "CVE-2026-43110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43110"
},
{
"name": "CVE-2026-68397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68397"
},
{
"name": "CVE-2026-64572",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64572"
},
{
"name": "CVE-2026-64411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64411"
},
{
"name": "CVE-2026-68126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68126"
},
{
"name": "CVE-2026-74321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74321"
},
{
"name": "CVE-2026-63998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63998"
},
{
"name": "CVE-2026-64137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64137"
},
{
"name": "CVE-2026-23449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23449"
},
{
"name": "CVE-2026-43386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43386"
},
{
"name": "CVE-2026-64537",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64537"
},
{
"name": "CVE-2026-64334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64334"
},
{
"name": "CVE-2026-74495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74495"
},
{
"name": "CVE-2026-64448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64448"
},
{
"name": "CVE-2026-72497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72497"
},
{
"name": "CVE-2026-68125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68125"
},
{
"name": "CVE-2026-68135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68135"
},
{
"name": "CVE-2026-53033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53033"
},
{
"name": "CVE-2026-72032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72032"
},
{
"name": "CVE-2026-72221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72221"
},
{
"name": "CVE-2026-72289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72289"
},
{
"name": "CVE-2026-72251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72251"
},
{
"name": "CVE-2026-64134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64134"
},
{
"name": "CVE-2026-68254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68254"
},
{
"name": "CVE-2026-64005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64005"
},
{
"name": "CVE-2026-68360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68360"
},
{
"name": "CVE-2026-46107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46107"
},
{
"name": "CVE-2026-64524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64524"
},
{
"name": "CVE-2026-80654",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80654"
},
{
"name": "CVE-2025-38469",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38469"
},
{
"name": "CVE-2026-68244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68244"
},
{
"name": "CVE-2026-64382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64382"
},
{
"name": "CVE-2026-68249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68249"
},
{
"name": "CVE-2026-68107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68107"
},
{
"name": "CVE-2026-68392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68392"
},
{
"name": "CVE-2026-68300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68300"
},
{
"name": "CVE-2026-64444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64444"
},
{
"name": "CVE-2026-68260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68260"
},
{
"name": "CVE-2026-68229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68229"
},
{
"name": "CVE-2026-64225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64225"
},
{
"name": "CVE-2026-64331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64331"
},
{
"name": "CVE-2026-64511",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64511"
},
{
"name": "CVE-2026-68284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68284"
},
{
"name": "CVE-2026-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53264"
},
{
"name": "CVE-2026-63999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63999"
},
{
"name": "CVE-2026-43109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43109"
},
{
"name": "CVE-2026-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53142"
},
{
"name": "CVE-2026-68152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68152"
},
{
"name": "CVE-2026-68353",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68353"
},
{
"name": "CVE-2026-63944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63944"
},
{
"name": "CVE-2026-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53273"
},
{
"name": "CVE-2026-64547",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64547"
},
{
"name": "CVE-2026-64056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64056"
},
{
"name": "CVE-2026-63860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63860"
},
{
"name": "CVE-2026-64494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64494"
},
{
"name": "CVE-2026-68108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68108"
},
{
"name": "CVE-2026-64033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64033"
},
{
"name": "CVE-2026-64565",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64565"
},
{
"name": "CVE-2026-68158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68158"
},
{
"name": "CVE-2026-64543",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64543"
},
{
"name": "CVE-2026-64573",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64573"
},
{
"name": "CVE-2026-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53246"
},
{
"name": "CVE-2026-64245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64245"
},
{
"name": "CVE-2026-43278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43278"
},
{
"name": "CVE-2026-63823",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63823"
},
{
"name": "CVE-2026-68325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68325"
},
{
"name": "CVE-2026-68253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68253"
},
{
"name": "CVE-2026-72501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72501"
},
{
"name": "CVE-2026-68355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68355"
},
{
"name": "CVE-2026-64530",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64530"
},
{
"name": "CVE-2026-64015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64015"
},
{
"name": "CVE-2026-64294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64294"
},
{
"name": "CVE-2026-43125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43125"
},
{
"name": "CVE-2026-68470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68470"
},
{
"name": "CVE-2026-63808",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63808"
},
{
"name": "CVE-2026-72343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72343"
},
{
"name": "CVE-2026-63973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63973"
},
{
"name": "CVE-2026-68180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68180"
},
{
"name": "CVE-2026-68247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68247"
},
{
"name": "CVE-2026-74722",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74722"
},
{
"name": "CVE-2026-68407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68407"
},
{
"name": "CVE-2026-64247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64247"
},
{
"name": "CVE-2026-68123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68123"
},
{
"name": "CVE-2026-64420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64420"
},
{
"name": "CVE-2026-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53180"
},
{
"name": "CVE-2026-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53238"
},
{
"name": "CVE-2026-43416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43416"
},
{
"name": "CVE-2026-64548",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64548"
},
{
"name": "CVE-2026-64118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64118"
},
{
"name": "CVE-2026-68162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68162"
},
{
"name": "CVE-2026-68220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68220"
},
{
"name": "CVE-2026-64384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64384"
},
{
"name": "CVE-2026-64406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64406"
},
{
"name": "CVE-2026-68354",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68354"
},
{
"name": "CVE-2026-64600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64600"
},
{
"name": "CVE-2026-68149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68149"
},
{
"name": "CVE-2026-64312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64312"
},
{
"name": "CVE-2026-72469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72469"
},
{
"name": "CVE-2026-63889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63889"
},
{
"name": "CVE-2026-68375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68375"
},
{
"name": "CVE-2026-64505",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64505"
},
{
"name": "CVE-2026-53366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53366"
},
{
"name": "CVE-2026-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52923"
},
{
"name": "CVE-2026-64087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64087"
},
{
"name": "CVE-2026-68251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68251"
},
{
"name": "CVE-2026-74584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74584"
},
{
"name": "CVE-2026-53154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53154"
},
{
"name": "CVE-2026-64358",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64358"
},
{
"name": "CVE-2026-64355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64355"
},
{
"name": "CVE-2026-64515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64515"
},
{
"name": "CVE-2026-72069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72069"
},
{
"name": "CVE-2026-68359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68359"
},
{
"name": "CVE-2026-64185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64185"
},
{
"name": "CVE-2026-72020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72020"
},
{
"name": "CVE-2026-68370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68370"
},
{
"name": "CVE-2026-43116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43116"
},
{
"name": "CVE-2026-64340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64340"
},
{
"name": "CVE-2026-64007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64007"
},
{
"name": "CVE-2026-64567",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64567"
},
{
"name": "CVE-2026-64450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64450"
},
{
"name": "CVE-2026-64484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64484"
},
{
"name": "CVE-2026-52990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52990"
},
{
"name": "CVE-2026-64114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64114"
},
{
"name": "CVE-2026-64266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64266"
},
{
"name": "CVE-2025-40022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40022"
},
{
"name": "CVE-2026-43363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43363"
},
{
"name": "CVE-2026-68236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68236"
},
{
"name": "CVE-2026-64088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64088"
},
{
"name": "CVE-2026-64073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64073"
},
{
"name": "CVE-2026-64576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64576"
},
{
"name": "CVE-2026-68192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68192"
},
{
"name": "CVE-2026-74712",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74712"
},
{
"name": "CVE-2026-74550",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74550"
},
{
"name": "CVE-2026-74269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74269"
},
{
"name": "CVE-2026-74509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74509"
},
{
"name": "CVE-2026-64002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64002"
},
{
"name": "CVE-2026-72288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72288"
},
{
"name": "CVE-2026-68272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68272"
},
{
"name": "CVE-2026-64135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64135"
},
{
"name": "CVE-2026-64440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64440"
},
{
"name": "CVE-2026-52977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52977"
},
{
"name": "CVE-2026-64564",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64564"
},
{
"name": "CVE-2026-52972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52972"
},
{
"name": "CVE-2026-74527",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74527"
},
{
"name": "CVE-2026-72046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72046"
},
{
"name": "CVE-2026-68406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68406"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-64011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64011"
},
{
"name": "CVE-2026-64317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64317"
},
{
"name": "CVE-2026-68336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68336"
},
{
"name": "CVE-2026-64569",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64569"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-68154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68154"
}
],
"initial_release_date": "2026-09-18T00:00:00",
"last_revision_date": "2026-09-18T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-1202",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-09-18T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23540-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623540-1"
},
{
"published_at": "2026-09-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4256-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264256-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23686-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623686-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23681-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623681-1"
},
{
"published_at": "2026-09-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4172-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264172-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23536-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623536-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23674-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623674-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23678-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623678-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23685-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623685-1"
},
{
"published_at": "2026-09-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4170-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264170-1"
},
{
"published_at": "2026-09-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23687-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623687-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23676-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623676-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23680-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623680-1"
},
{
"published_at": "2026-09-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4224-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264224-1"
},
{
"published_at": "2026-09-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4190-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264190-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23537-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623537-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23528-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623528-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23682-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623682-1"
},
{
"published_at": "2026-09-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4231-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264231-1"
},
{
"published_at": "2026-09-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4244-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264244-1"
},
{
"published_at": "2026-09-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4185-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264185-1"
},
{
"published_at": "2026-09-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4254-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264254-1"
},
{
"published_at": "2026-09-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4162-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264162-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23510-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623510-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23679-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623679-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23684-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623684-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23535-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623535-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23531-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623531-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23529-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623529-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23672-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623672-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23541-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623541-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23673-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623673-1"
},
{
"published_at": "2026-09-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4193-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264193-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23533-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623533-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23683-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623683-1"
},
{
"published_at": "2026-09-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4215-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264215-1"
},
{
"published_at": "2026-09-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4168-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264168-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23677-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623677-1"
},
{
"published_at": "2026-09-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4243-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264243-1"
},
{
"published_at": "2026-09-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4183-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264183-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23532-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623532-1"
},
{
"published_at": "2026-09-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4192-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264192-1"
},
{
"published_at": "2026-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23675-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623675-1"
},
{
"published_at": "2026-09-08",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23534-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623534-1"
},
{
"published_at": "2026-09-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4255-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264255-1"
}
]
}
CERTFR-2026-AVI-1203
Vulnerability from certfr_avis - Published: 2026-09-18 - Updated: 2026-09-18
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Elles permettent à un attaquant de provoquer un problème de sécurité non spécifié par l'éditeur.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 16.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-72436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72436"
},
{
"name": "CVE-2026-43198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43198"
},
{
"name": "CVE-2026-64353",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64353"
},
{
"name": "CVE-2026-64214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64214"
},
{
"name": "CVE-2026-64046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64046"
},
{
"name": "CVE-2026-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53091"
},
{
"name": "CVE-2026-68459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68459"
},
{
"name": "CVE-2026-64376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64376"
},
{
"name": "CVE-2025-40064",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40064"
},
{
"name": "CVE-2026-68147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68147"
},
{
"name": "CVE-2026-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53192"
},
{
"name": "CVE-2026-64590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64590"
},
{
"name": "CVE-2026-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53230"
},
{
"name": "CVE-2026-68343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68343"
},
{
"name": "CVE-2026-53398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53398"
},
{
"name": "CVE-2026-64552",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64552"
},
{
"name": "CVE-2026-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53349"
},
{
"name": "CVE-2026-64287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64287"
},
{
"name": "CVE-2026-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53381"
},
{
"name": "CVE-2026-64270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64270"
},
{
"name": "CVE-2026-53132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53132"
},
{
"name": "CVE-2026-64275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64275"
},
{
"name": "CVE-2026-64274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64274"
},
{
"name": "CVE-2026-74394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74394"
},
{
"name": "CVE-2026-64485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64485"
},
{
"name": "CVE-2026-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53272"
},
{
"name": "CVE-2026-64561",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64561"
},
{
"name": "CVE-2026-52934",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52934"
},
{
"name": "CVE-2026-31493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31493"
},
{
"name": "CVE-2026-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53179"
},
{
"name": "CVE-2026-64133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64133"
},
{
"name": "CVE-2026-64047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64047"
},
{
"name": "CVE-2026-74439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74439"
},
{
"name": "CVE-2026-68138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68138"
},
{
"name": "CVE-2026-64192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64192"
},
{
"name": "CVE-2026-52955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52955"
},
{
"name": "CVE-2026-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53350"
},
{
"name": "CVE-2026-63974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63974"
},
{
"name": "CVE-2026-68388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68388"
},
{
"name": "CVE-2026-53214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53214"
},
{
"name": "CVE-2026-46130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46130"
},
{
"name": "CVE-2026-68302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68302"
},
{
"name": "CVE-2025-27558",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27558"
},
{
"name": "CVE-2026-64452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64452"
},
{
"name": "CVE-2026-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53210"
},
{
"name": "CVE-2026-52929",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52929"
},
{
"name": "CVE-2026-64492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64492"
},
{
"name": "CVE-2026-64483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64483"
},
{
"name": "CVE-2026-63980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63980"
},
{
"name": "CVE-2026-64322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64322"
},
{
"name": "CVE-2024-58094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58094"
},
{
"name": "CVE-2026-64470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64470"
},
{
"name": "CVE-2026-64461",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64461"
},
{
"name": "CVE-2026-64501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64501"
},
{
"name": "CVE-2026-53002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53002"
},
{
"name": "CVE-2026-53090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53090"
},
{
"name": "CVE-2026-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53274"
},
{
"name": "CVE-2026-53202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53202"
},
{
"name": "CVE-2026-74440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74440"
},
{
"name": "CVE-2026-63921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63921"
},
{
"name": "CVE-2026-64513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64513"
},
{
"name": "CVE-2026-64413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64413"
},
{
"name": "CVE-2026-68088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68088"
},
{
"name": "CVE-2026-64388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64388"
},
{
"name": "CVE-2026-64512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64512"
},
{
"name": "CVE-2026-64409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64409"
},
{
"name": "CVE-2026-52947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52947"
},
{
"name": "CVE-2026-53218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53218"
},
{
"name": "CVE-2026-64367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64367"
},
{
"name": "CVE-2026-64077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64077"
},
{
"name": "CVE-2026-64380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64380"
},
{
"name": "CVE-2026-64268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64268"
},
{
"name": "CVE-2026-53169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53169"
},
{
"name": "CVE-2026-64099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64099"
},
{
"name": "CVE-2026-74417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74417"
},
{
"name": "CVE-2026-64179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64179"
},
{
"name": "CVE-2026-74569",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74569"
},
{
"name": "CVE-2026-64489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64489"
},
{
"name": "CVE-2026-64510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64510"
},
{
"name": "CVE-2026-53143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53143"
},
{
"name": "CVE-2026-64480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64480"
},
{
"name": "CVE-2026-64399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64399"
},
{
"name": "CVE-2026-72488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72488"
},
{
"name": "CVE-2026-72494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72494"
},
{
"name": "CVE-2026-74376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74376"
},
{
"name": "CVE-2026-53161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53161"
},
{
"name": "CVE-2026-53271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53271"
},
{
"name": "CVE-2026-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53109"
},
{
"name": "CVE-2026-52958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52958"
},
{
"name": "CVE-2026-64385",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64385"
},
{
"name": "CVE-2026-53193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53193"
},
{
"name": "CVE-2026-64405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64405"
},
{
"name": "CVE-2026-72130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72130"
},
{
"name": "CVE-2026-53140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53140"
},
{
"name": "CVE-2026-72255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72255"
},
{
"name": "CVE-2026-64217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64217"
},
{
"name": "CVE-2026-63818",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63818"
},
{
"name": "CVE-2026-64414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64414"
},
{
"name": "CVE-2026-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53229"
},
{
"name": "CVE-2026-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53244"
},
{
"name": "CVE-2026-64502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64502"
},
{
"name": "CVE-2026-64454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64454"
},
{
"name": "CVE-2026-31486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31486"
},
{
"name": "CVE-2026-64531",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64531"
},
{
"name": "CVE-2026-63993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63993"
},
{
"name": "CVE-2026-64308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64308"
},
{
"name": "CVE-2026-64407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64407"
},
{
"name": "CVE-2026-52999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52999"
},
{
"name": "CVE-2026-63832",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63832"
},
{
"name": "CVE-2026-64402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64402"
},
{
"name": "CVE-2026-68228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68228"
},
{
"name": "CVE-2026-72125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72125"
},
{
"name": "CVE-2026-63807",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63807"
},
{
"name": "CVE-2026-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53231"
},
{
"name": "CVE-2024-52560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52560"
},
{
"name": "CVE-2026-31405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31405"
},
{
"name": "CVE-2026-53399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53399"
},
{
"name": "CVE-2026-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53400"
},
{
"name": "CVE-2026-63886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63886"
},
{
"name": "CVE-2026-64221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64221"
},
{
"name": "CVE-2026-64365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64365"
},
{
"name": "CVE-2026-64025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64025"
},
{
"name": "CVE-2025-38717",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38717"
},
{
"name": "CVE-2026-64264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64264"
},
{
"name": "CVE-2026-64128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64128"
},
{
"name": "CVE-2026-72320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72320"
},
{
"name": "CVE-2026-46170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46170"
},
{
"name": "CVE-2026-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53185"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-53138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53138"
},
{
"name": "CVE-2026-63830",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63830"
},
{
"name": "CVE-2026-64256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64256"
},
{
"name": "CVE-2026-64319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64319"
},
{
"name": "CVE-2026-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53391"
},
{
"name": "CVE-2026-74345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74345"
},
{
"name": "CVE-2026-52989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52989"
},
{
"name": "CVE-2026-63924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63924"
},
{
"name": "CVE-2026-72083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72083"
},
{
"name": "CVE-2026-64591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64591"
},
{
"name": "CVE-2026-64333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64333"
},
{
"name": "CVE-2026-53141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53141"
},
{
"name": "CVE-2025-38187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38187"
},
{
"name": "CVE-2026-52924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52924"
},
{
"name": "CVE-2026-53227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53227"
},
{
"name": "CVE-2026-63979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63979"
},
{
"name": "CVE-2026-64404",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64404"
},
{
"name": "CVE-2026-64467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64467"
},
{
"name": "CVE-2026-63940",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63940"
},
{
"name": "CVE-2026-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53239"
},
{
"name": "CVE-2026-74521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74521"
},
{
"name": "CVE-2026-23208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23208"
},
{
"name": "CVE-2026-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53342"
},
{
"name": "CVE-2025-40139",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40139"
},
{
"name": "CVE-2026-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53181"
},
{
"name": "CVE-2026-52918",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52918"
},
{
"name": "CVE-2026-64424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64424"
},
{
"name": "CVE-2026-64389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64389"
},
{
"name": "CVE-2026-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53220"
},
{
"name": "CVE-2026-64246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64246"
},
{
"name": "CVE-2025-71289",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71289"
},
{
"name": "CVE-2026-64326",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64326"
},
{
"name": "CVE-2026-68085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68085"
},
{
"name": "CVE-2026-74401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74401"
},
{
"name": "CVE-2026-63870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63870"
},
{
"name": "CVE-2024-49932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49932"
},
{
"name": "CVE-2026-64386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64386"
},
{
"name": "CVE-2026-72319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72319"
},
{
"name": "CVE-2026-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53331"
},
{
"name": "CVE-2025-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38563"
},
{
"name": "CVE-2026-64460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64460"
},
{
"name": "CVE-2026-64514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64514"
},
{
"name": "CVE-2026-64082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64082"
},
{
"name": "CVE-2026-63821",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63821"
},
{
"name": "CVE-2026-68091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68091"
},
{
"name": "CVE-2026-64260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64260"
},
{
"name": "CVE-2026-63805",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63805"
},
{
"name": "CVE-2026-64279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64279"
},
{
"name": "CVE-2026-63915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63915"
},
{
"name": "CVE-2026-53224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53224"
},
{
"name": "CVE-2026-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52993"
},
{
"name": "CVE-2026-64383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64383"
},
{
"name": "CVE-2026-64337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64337"
},
{
"name": "CVE-2024-14040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-14040"
},
{
"name": "CVE-2026-63888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63888"
},
{
"name": "CVE-2026-64430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64430"
},
{
"name": "CVE-2025-40054",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40054"
},
{
"name": "CVE-2026-68083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68083"
},
{
"name": "CVE-2026-52956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52956"
},
{
"name": "CVE-2026-64459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64459"
},
{
"name": "CVE-2025-71074",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71074"
},
{
"name": "CVE-2026-64295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64295"
},
{
"name": "CVE-2026-68089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68089"
},
{
"name": "CVE-2026-72466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72466"
},
{
"name": "CVE-2026-64592",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64592"
},
{
"name": "CVE-2026-64178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64178"
},
{
"name": "CVE-2026-52915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52915"
},
{
"name": "CVE-2026-64177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64177"
},
{
"name": "CVE-2026-64497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64497"
},
{
"name": "CVE-2026-53163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53163"
},
{
"name": "CVE-2026-64258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64258"
},
{
"name": "CVE-2026-68090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68090"
},
{
"name": "CVE-2026-53146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53146"
},
{
"name": "CVE-2026-64599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64599"
},
{
"name": "CVE-2026-68461",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68461"
},
{
"name": "CVE-2026-64189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64189"
},
{
"name": "CVE-2026-72339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72339"
},
{
"name": "CVE-2026-63798",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63798"
},
{
"name": "CVE-2026-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53354"
},
{
"name": "CVE-2026-64598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64598"
},
{
"name": "CVE-2026-53345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53345"
},
{
"name": "CVE-2026-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53205"
},
{
"name": "CVE-2026-63810",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63810"
},
{
"name": "CVE-2026-64098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64098"
},
{
"name": "CVE-2026-63801",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63801"
},
{
"name": "CVE-2026-63815",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63815"
},
{
"name": "CVE-2026-63827",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63827"
},
{
"name": "CVE-2026-64304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64304"
},
{
"name": "CVE-2026-64451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64451"
},
{
"name": "CVE-2026-64557",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64557"
},
{
"name": "CVE-2026-46158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46158"
},
{
"name": "CVE-2026-74267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74267"
},
{
"name": "CVE-2026-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53397"
},
{
"name": "CVE-2026-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53309"
},
{
"name": "CVE-2026-68457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68457"
},
{
"name": "CVE-2026-46320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46320"
},
{
"name": "CVE-2026-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53201"
},
{
"name": "CVE-2026-64276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64276"
},
{
"name": "CVE-2026-63948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63948"
},
{
"name": "CVE-2026-64475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64475"
},
{
"name": "CVE-2026-64508",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64508"
},
{
"name": "CVE-2025-39933",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39933"
},
{
"name": "CVE-2026-68210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68210"
},
{
"name": "CVE-2026-64237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64237"
},
{
"name": "CVE-2025-39990",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39990"
},
{
"name": "CVE-2026-64323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64323"
},
{
"name": "CVE-2026-64438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64438"
},
{
"name": "CVE-2025-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38565"
},
{
"name": "CVE-2026-64261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64261"
},
{
"name": "CVE-2026-64220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64220"
},
{
"name": "CVE-2026-52941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52941"
},
{
"name": "CVE-2026-64271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64271"
},
{
"name": "CVE-2026-31568",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31568"
},
{
"name": "CVE-2026-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53150"
},
{
"name": "CVE-2026-53327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53327"
},
{
"name": "CVE-2026-74478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74478"
},
{
"name": "CVE-2026-52939",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52939"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-64462",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64462"
},
{
"name": "CVE-2026-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53147"
},
{
"name": "CVE-2026-64455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64455"
},
{
"name": "CVE-2026-72383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72383"
},
{
"name": "CVE-2026-52942",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52942"
},
{
"name": "CVE-2026-46331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46331"
},
{
"name": "CVE-2026-64421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64421"
},
{
"name": "CVE-2026-64302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64302"
},
{
"name": "CVE-2026-74305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74305"
},
{
"name": "CVE-2026-72129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72129"
},
{
"name": "CVE-2026-72299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72299"
},
{
"name": "CVE-2026-74473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74473"
},
{
"name": "CVE-2026-64445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64445"
},
{
"name": "CVE-2026-52935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52935"
},
{
"name": "CVE-2026-64328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64328"
},
{
"name": "CVE-2026-53200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53200"
},
{
"name": "CVE-2025-71073",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71073"
},
{
"name": "CVE-2026-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53183"
},
{
"name": "CVE-2026-64433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64433"
},
{
"name": "CVE-2026-64165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64165"
},
{
"name": "CVE-2026-64272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64272"
},
{
"name": "CVE-2026-23469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23469"
},
{
"name": "CVE-2026-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53257"
},
{
"name": "CVE-2026-52931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52931"
},
{
"name": "CVE-2026-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53338"
},
{
"name": "CVE-2026-64253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64253"
},
{
"name": "CVE-2026-68476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68476"
},
{
"name": "CVE-2026-43464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43464"
},
{
"name": "CVE-2026-64076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64076"
},
{
"name": "CVE-2026-68477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68477"
},
{
"name": "CVE-2026-74405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74405"
},
{
"name": "CVE-2026-64500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64500"
},
{
"name": "CVE-2026-63806",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63806"
},
{
"name": "CVE-2026-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53368"
},
{
"name": "CVE-2026-64097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64097"
},
{
"name": "CVE-2026-74476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74476"
},
{
"name": "CVE-2026-72351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72351"
},
{
"name": "CVE-2025-39859",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39859"
},
{
"name": "CVE-2026-63816",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63816"
},
{
"name": "CVE-2026-64330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64330"
},
{
"name": "CVE-2026-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53330"
},
{
"name": "CVE-2026-64348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64348"
},
{
"name": "CVE-2026-53383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53383"
},
{
"name": "CVE-2026-64469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64469"
},
{
"name": "CVE-2026-53348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53348"
},
{
"name": "CVE-2026-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52919"
},
{
"name": "CVE-2026-64310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64310"
},
{
"name": "CVE-2026-53006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53006"
},
{
"name": "CVE-2026-64280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64280"
},
{
"name": "CVE-2026-64362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64362"
},
{
"name": "CVE-2026-64327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64327"
},
{
"name": "CVE-2026-64415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64415"
},
{
"name": "CVE-2025-38064",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38064"
},
{
"name": "CVE-2026-64289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64289"
},
{
"name": "CVE-2026-64523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64523"
},
{
"name": "CVE-2026-63800",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63800"
},
{
"name": "CVE-2026-64102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64102"
},
{
"name": "CVE-2026-64255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64255"
},
{
"name": "CVE-2026-68213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68213"
},
{
"name": "CVE-2026-64314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64314"
},
{
"name": "CVE-2026-64486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64486"
},
{
"name": "CVE-2024-50217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50217"
},
{
"name": "CVE-2026-43009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43009"
},
{
"name": "CVE-2026-64267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64267"
},
{
"name": "CVE-2025-68822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68822"
},
{
"name": "CVE-2026-64341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64341"
},
{
"name": "CVE-2026-74493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74493"
},
{
"name": "CVE-2026-31420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31420"
},
{
"name": "CVE-2026-72194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72194"
},
{
"name": "CVE-2026-63817",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63817"
},
{
"name": "CVE-2026-64446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64446"
},
{
"name": "CVE-2026-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53339"
},
{
"name": "CVE-2026-64534",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64534"
},
{
"name": "CVE-2026-53266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53266"
},
{
"name": "CVE-2026-64338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64338"
},
{
"name": "CVE-2026-64083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64083"
},
{
"name": "CVE-2026-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53234"
},
{
"name": "CVE-2026-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53149"
},
{
"name": "CVE-2026-63795",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63795"
},
{
"name": "CVE-2026-64106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64106"
},
{
"name": "CVE-2026-64418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64418"
},
{
"name": "CVE-2026-64249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64249"
},
{
"name": "CVE-2026-72222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72222"
},
{
"name": "CVE-2026-64536",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64536"
},
{
"name": "CVE-2026-46203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46203"
},
{
"name": "CVE-2026-43213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43213"
},
{
"name": "CVE-2026-63873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63873"
},
{
"name": "CVE-2026-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53176"
},
{
"name": "CVE-2026-31663",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31663"
},
{
"name": "CVE-2026-53172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53172"
},
{
"name": "CVE-2026-64010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64010"
},
{
"name": "CVE-2026-64364",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64364"
},
{
"name": "CVE-2026-63947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63947"
},
{
"name": "CVE-2026-43493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43493"
},
{
"name": "CVE-2026-68160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68160"
},
{
"name": "CVE-2026-64163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64163"
},
{
"name": "CVE-2025-68174",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68174"
},
{
"name": "CVE-2026-72421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72421"
},
{
"name": "CVE-2024-50106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50106"
},
{
"name": "CVE-2026-63975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63975"
},
{
"name": "CVE-2026-53233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53233"
},
{
"name": "CVE-2026-63952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63952"
},
{
"name": "CVE-2026-53402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53402"
},
{
"name": "CVE-2026-64351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64351"
},
{
"name": "CVE-2026-64051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64051"
},
{
"name": "CVE-2026-63835",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63835"
},
{
"name": "CVE-2026-64432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64432"
},
{
"name": "CVE-2025-40344",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40344"
},
{
"name": "CVE-2026-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53386"
},
{
"name": "CVE-2025-21984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21984"
},
{
"name": "CVE-2026-64293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64293"
},
{
"name": "CVE-2026-74538",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74538"
},
{
"name": "CVE-2026-64039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64039"
},
{
"name": "CVE-2025-40354",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40354"
},
{
"name": "CVE-2026-68087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68087"
},
{
"name": "CVE-2026-63833",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63833"
},
{
"name": "CVE-2026-63796",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63796"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-53332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53332"
},
{
"name": "CVE-2026-64363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64363"
},
{
"name": "CVE-2026-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53401"
},
{
"name": "CVE-2026-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53334"
},
{
"name": "CVE-2026-74474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74474"
},
{
"name": "CVE-2026-64263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64263"
},
{
"name": "CVE-2026-53353",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53353"
},
{
"name": "CVE-2026-68426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68426"
},
{
"name": "CVE-2026-64375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64375"
},
{
"name": "CVE-2026-64296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64296"
},
{
"name": "CVE-2026-63917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63917"
},
{
"name": "CVE-2026-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53335"
},
{
"name": "CVE-2026-45894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45894"
},
{
"name": "CVE-2026-63926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63926"
},
{
"name": "CVE-2026-64370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64370"
},
{
"name": "CVE-2026-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53178"
},
{
"name": "CVE-2026-53389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53389"
},
{
"name": "CVE-2025-68304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68304"
},
{
"name": "CVE-2026-64439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64439"
},
{
"name": "CVE-2025-40075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40075"
},
{
"name": "CVE-2026-72322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72322"
},
{
"name": "CVE-2026-64593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64593"
},
{
"name": "CVE-2026-64254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64254"
},
{
"name": "CVE-2026-64231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64231"
},
{
"name": "CVE-2026-53158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53158"
},
{
"name": "CVE-2026-23240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23240"
},
{
"name": "CVE-2026-53131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53131"
},
{
"name": "CVE-2025-38069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38069"
},
{
"name": "CVE-2026-64091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64091"
},
{
"name": "CVE-2026-64299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64299"
},
{
"name": "CVE-2026-72422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72422"
},
{
"name": "CVE-2026-64374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64374"
},
{
"name": "CVE-2026-46181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46181"
},
{
"name": "CVE-2026-64357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64357"
},
{
"name": "CVE-2026-64488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64488"
},
{
"name": "CVE-2026-64603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64603"
},
{
"name": "CVE-2026-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53219"
},
{
"name": "CVE-2026-64109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64109"
},
{
"name": "CVE-2026-53190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53190"
},
{
"name": "CVE-2026-64345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64345"
},
{
"name": "CVE-2026-64085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64085"
},
{
"name": "CVE-2026-64368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64368"
},
{
"name": "CVE-2026-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53251"
},
{
"name": "CVE-2026-64518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64518"
},
{
"name": "CVE-2026-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53249"
},
{
"name": "CVE-2026-64166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64166"
},
{
"name": "CVE-2026-53329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53329"
},
{
"name": "CVE-2026-53139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53139"
},
{
"name": "CVE-2026-53382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53382"
},
{
"name": "CVE-2026-64504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64504"
},
{
"name": "CVE-2026-46315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46315"
},
{
"name": "CVE-2024-41008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41008"
},
{
"name": "CVE-2026-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53217"
},
{
"name": "CVE-2026-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53276"
},
{
"name": "CVE-2026-64148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64148"
},
{
"name": "CVE-2026-53262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53262"
},
{
"name": "CVE-2026-53346",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53346"
},
{
"name": "CVE-2026-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53070"
},
{
"name": "CVE-2026-72495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72495"
},
{
"name": "CVE-2026-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53088"
},
{
"name": "CVE-2026-63813",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63813"
},
{
"name": "CVE-2026-64320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64320"
},
{
"name": "CVE-2026-63992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63992"
},
{
"name": "CVE-2026-64155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64155"
},
{
"name": "CVE-2026-64398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64398"
},
{
"name": "CVE-2026-64147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64147"
},
{
"name": "CVE-2026-72084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72084"
},
{
"name": "CVE-2026-64464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64464"
},
{
"name": "CVE-2024-35948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35948"
},
{
"name": "CVE-2026-64297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64297"
},
{
"name": "CVE-2026-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53243"
},
{
"name": "CVE-2026-72317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72317"
},
{
"name": "CVE-2026-63976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63976"
},
{
"name": "CVE-2026-68092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68092"
},
{
"name": "CVE-2025-40274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40274"
},
{
"name": "CVE-2026-64343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64343"
},
{
"name": "CVE-2026-64473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64473"
},
{
"name": "CVE-2024-53098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53098"
},
{
"name": "CVE-2026-64397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64397"
},
{
"name": "CVE-2026-72200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72200"
},
{
"name": "CVE-2026-63984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63984"
},
{
"name": "CVE-2026-53361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53361"
},
{
"name": "CVE-2026-64371",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64371"
},
{
"name": "CVE-2026-52914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52914"
},
{
"name": "CVE-2026-52916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52916"
},
{
"name": "CVE-2026-46330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46330"
},
{
"name": "CVE-2026-53009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53009"
},
{
"name": "CVE-2026-53236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53236"
},
{
"name": "CVE-2026-64471",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64471"
},
{
"name": "CVE-2026-53225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53225"
},
{
"name": "CVE-2026-64180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64180"
},
{
"name": "CVE-2026-64468",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64468"
},
{
"name": "CVE-2026-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53222"
},
{
"name": "CVE-2024-43872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43872"
},
{
"name": "CVE-2026-72487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72487"
},
{
"name": "CVE-2026-72033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72033"
},
{
"name": "CVE-2026-72434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72434"
},
{
"name": "CVE-2026-64449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64449"
},
{
"name": "CVE-2026-64602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64602"
},
{
"name": "CVE-2026-64125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64125"
},
{
"name": "CVE-2026-64551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64551"
},
{
"name": "CVE-2026-72472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72472"
},
{
"name": "CVE-2026-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53362"
},
{
"name": "CVE-2026-64410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64410"
},
{
"name": "CVE-2026-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53168"
},
{
"name": "CVE-2026-53173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53173"
},
{
"name": "CVE-2026-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52922"
},
{
"name": "CVE-2026-53053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53053"
},
{
"name": "CVE-2026-64089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64089"
},
{
"name": "CVE-2026-53403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53403"
},
{
"name": "CVE-2026-63871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63871"
},
{
"name": "CVE-2026-64048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64048"
},
{
"name": "CVE-2026-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53209"
},
{
"name": "CVE-2026-63797",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63797"
},
{
"name": "CVE-2026-74410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74410"
},
{
"name": "CVE-2024-49940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49940"
},
{
"name": "CVE-2026-64456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64456"
},
{
"name": "CVE-2026-72491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72491"
},
{
"name": "CVE-2025-71202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71202"
},
{
"name": "CVE-2026-63858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63858"
},
{
"name": "CVE-2026-64170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64170"
},
{
"name": "CVE-2026-68127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68127"
},
{
"name": "CVE-2026-64306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64306"
},
{
"name": "CVE-2026-74264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74264"
},
{
"name": "CVE-2026-64465",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64465"
},
{
"name": "CVE-2026-64313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64313"
},
{
"name": "CVE-2026-45932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45932"
},
{
"name": "CVE-2026-72071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72071"
},
{
"name": "CVE-2026-63978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63978"
},
{
"name": "CVE-2026-52988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52988"
},
{
"name": "CVE-2026-53157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53157"
},
{
"name": "CVE-2026-64112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64112"
},
{
"name": "CVE-2025-10263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10263"
},
{
"name": "CVE-2026-53135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53135"
},
{
"name": "CVE-2026-63853",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63853"
},
{
"name": "CVE-2026-64442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64442"
},
{
"name": "CVE-2026-64554",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64554"
},
{
"name": "CVE-2026-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53333"
},
{
"name": "CVE-2026-64477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64477"
},
{
"name": "CVE-2026-64463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64463"
},
{
"name": "CVE-2026-64401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64401"
},
{
"name": "CVE-2026-72380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72380"
},
{
"name": "CVE-2026-68159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68159"
},
{
"name": "CVE-2026-53188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53188"
},
{
"name": "CVE-2026-43352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43352"
},
{
"name": "CVE-2026-53392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53392"
},
{
"name": "CVE-2026-64259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64259"
},
{
"name": "CVE-2026-64018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64018"
},
{
"name": "CVE-2026-74408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74408"
},
{
"name": "CVE-2026-74302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74302"
},
{
"name": "CVE-2026-23239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23239"
},
{
"name": "CVE-2026-64541",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64541"
},
{
"name": "CVE-2026-63916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63916"
},
{
"name": "CVE-2026-64332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64332"
},
{
"name": "CVE-2026-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53170"
},
{
"name": "CVE-2026-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53167"
},
{
"name": "CVE-2026-64191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64191"
},
{
"name": "CVE-2026-72499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72499"
},
{
"name": "CVE-2026-64458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64458"
},
{
"name": "CVE-2026-64127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64127"
},
{
"name": "CVE-2026-64476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64476"
},
{
"name": "CVE-2026-64378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64378"
},
{
"name": "CVE-2026-72323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72323"
},
{
"name": "CVE-2026-72065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72065"
},
{
"name": "CVE-2026-64318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64318"
},
{
"name": "CVE-2026-68137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68137"
},
{
"name": "CVE-2026-64300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64300"
},
{
"name": "CVE-2026-72398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72398"
},
{
"name": "CVE-2026-52908",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52908"
},
{
"name": "CVE-2026-63794",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63794"
},
{
"name": "CVE-2026-64394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64394"
},
{
"name": "CVE-2026-74398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74398"
},
{
"name": "CVE-2026-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53237"
},
{
"name": "CVE-2026-80591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80591"
},
{
"name": "CVE-2026-53186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53186"
},
{
"name": "CVE-2026-53340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53340"
},
{
"name": "CVE-2026-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53182"
},
{
"name": "CVE-2026-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53177"
},
{
"name": "CVE-2026-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53208"
},
{
"name": "CVE-2026-64055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64055"
},
{
"name": "CVE-2026-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53255"
},
{
"name": "CVE-2026-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53207"
},
{
"name": "CVE-2026-64244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64244"
},
{
"name": "CVE-2025-38242",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38242"
},
{
"name": "CVE-2026-53347",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53347"
},
{
"name": "CVE-2026-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53187"
},
{
"name": "CVE-2025-39862",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39862"
},
{
"name": "CVE-2026-53160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53160"
},
{
"name": "CVE-2026-74384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74384"
},
{
"name": "CVE-2026-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53245"
},
{
"name": "CVE-2026-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53195"
},
{
"name": "CVE-2026-64309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64309"
},
{
"name": "CVE-2026-64173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64173"
},
{
"name": "CVE-2026-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53043"
},
{
"name": "CVE-2026-63824",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63824"
},
{
"name": "CVE-2026-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53171"
},
{
"name": "CVE-2026-63914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63914"
},
{
"name": "CVE-2026-64556",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64556"
},
{
"name": "CVE-2026-63825",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63825"
},
{
"name": "CVE-2025-21693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21693"
},
{
"name": "CVE-2026-53164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53164"
},
{
"name": "CVE-2025-39789",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39789"
},
{
"name": "CVE-2026-63874",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63874"
},
{
"name": "CVE-2025-38206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38206"
},
{
"name": "CVE-2026-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53232"
},
{
"name": "CVE-2026-64435",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64435"
},
{
"name": "CVE-2025-22104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22104"
},
{
"name": "CVE-2026-64184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64184"
},
{
"name": "CVE-2026-68117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68117"
},
{
"name": "CVE-2026-64336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64336"
},
{
"name": "CVE-2026-74411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74411"
},
{
"name": "CVE-2026-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53148"
},
{
"name": "CVE-2025-68745",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68745"
},
{
"name": "CVE-2026-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53189"
},
{
"name": "CVE-2026-64352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64352"
},
{
"name": "CVE-2026-72318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72318"
},
{
"name": "CVE-2026-64555",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64555"
},
{
"name": "CVE-2026-64474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64474"
},
{
"name": "CVE-2026-64115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64115"
},
{
"name": "CVE-2026-64356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64356"
},
{
"name": "CVE-2026-63867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63867"
},
{
"name": "CVE-2026-64586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64586"
},
{
"name": "CVE-2026-43048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43048"
},
{
"name": "CVE-2026-53133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53133"
},
{
"name": "CVE-2026-64377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64377"
},
{
"name": "CVE-2026-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53204"
},
{
"name": "CVE-2026-64346",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64346"
},
{
"name": "CVE-2026-53351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53351"
},
{
"name": "CVE-2026-31479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31479"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-53024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53024"
},
{
"name": "CVE-2026-68209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68209"
},
{
"name": "CVE-2026-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53344"
},
{
"name": "CVE-2026-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53263"
},
{
"name": "CVE-2026-64160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64160"
},
{
"name": "CVE-2025-40074",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40074"
},
{
"name": "CVE-2026-63945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63945"
},
{
"name": "CVE-2025-68360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68360"
},
{
"name": "CVE-2026-63822",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63822"
},
{
"name": "CVE-2026-72329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72329"
},
{
"name": "CVE-2026-74310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74310"
},
{
"name": "CVE-2026-72041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72041"
},
{
"name": "CVE-2026-64187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64187"
},
{
"name": "CVE-2026-64342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64342"
},
{
"name": "CVE-2025-40158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40158"
},
{
"name": "CVE-2026-64392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64392"
},
{
"name": "CVE-2026-64360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64360"
},
{
"name": "CVE-2026-64096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64096"
},
{
"name": "CVE-2026-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53118"
},
{
"name": "CVE-2026-64478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64478"
},
{
"name": "CVE-2026-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68206"
},
{
"name": "CVE-2026-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53152"
},
{
"name": "CVE-2026-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53356"
},
{
"name": "CVE-2026-63799",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63799"
},
{
"name": "CVE-2026-64472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64472"
},
{
"name": "CVE-2025-40168",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40168"
},
{
"name": "CVE-2026-64335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64335"
},
{
"name": "CVE-2026-53228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53228"
},
{
"name": "CVE-2026-63906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63906"
},
{
"name": "CVE-2026-72399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72399"
},
{
"name": "CVE-2026-64301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64301"
},
{
"name": "CVE-2026-64315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64315"
},
{
"name": "CVE-2026-64395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64395"
},
{
"name": "CVE-2026-64273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64273"
},
{
"name": "CVE-2026-74541",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74541"
},
{
"name": "CVE-2026-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53259"
},
{
"name": "CVE-2026-63828",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63828"
},
{
"name": "CVE-2025-37906",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37906"
},
{
"name": "CVE-2026-72226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72226"
},
{
"name": "CVE-2026-43126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43126"
},
{
"name": "CVE-2026-63820",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63820"
},
{
"name": "CVE-2026-64262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64262"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-31771",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31771"
},
{
"name": "CVE-2026-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53336"
},
{
"name": "CVE-2025-21985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21985"
},
{
"name": "CVE-2025-22109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22109"
},
{
"name": "CVE-2025-40040",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40040"
},
{
"name": "CVE-2026-72348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72348"
},
{
"name": "CVE-2025-23132",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23132"
},
{
"name": "CVE-2026-64509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64509"
},
{
"name": "CVE-2026-64117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64117"
},
{
"name": "CVE-2026-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53194"
},
{
"name": "CVE-2026-64084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64084"
},
{
"name": "CVE-2026-64307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64307"
},
{
"name": "CVE-2026-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53242"
},
{
"name": "CVE-2026-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53248"
},
{
"name": "CVE-2024-56552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56552"
},
{
"name": "CVE-2026-53341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53341"
},
{
"name": "CVE-2026-52910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52910"
},
{
"name": "CVE-2026-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53206"
},
{
"name": "CVE-2026-64339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64339"
},
{
"name": "CVE-2026-64108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64108"
},
{
"name": "CVE-2026-64529",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64529"
},
{
"name": "CVE-2026-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53388"
},
{
"name": "CVE-2026-63804",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63804"
},
{
"name": "CVE-2026-64305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64305"
},
{
"name": "CVE-2025-39958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39958"
},
{
"name": "CVE-2026-53212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53212"
},
{
"name": "CVE-2026-53137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53137"
},
{
"name": "CVE-2026-46054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46054"
},
{
"name": "CVE-2026-64400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64400"
},
{
"name": "CVE-2026-64381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64381"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2026-64604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64604"
},
{
"name": "CVE-2026-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53393"
},
{
"name": "CVE-2026-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53337"
},
{
"name": "CVE-2026-64597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64597"
},
{
"name": "CVE-2026-63812",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63812"
},
{
"name": "CVE-2026-63887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63887"
},
{
"name": "CVE-2026-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53199"
},
{
"name": "CVE-2026-68136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68136"
},
{
"name": "CVE-2026-64496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64496"
},
{
"name": "CVE-2026-64251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64251"
},
{
"name": "CVE-2026-53025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53025"
},
{
"name": "CVE-2026-68144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68144"
},
{
"name": "CVE-2026-64113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64113"
},
{
"name": "CVE-2026-64387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64387"
},
{
"name": "CVE-2026-52938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52938"
},
{
"name": "CVE-2026-64103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64103"
},
{
"name": "CVE-2026-68082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68082"
},
{
"name": "CVE-2026-64408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64408"
},
{
"name": "CVE-2026-68156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68156"
},
{
"name": "CVE-2026-72489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72489"
},
{
"name": "CVE-2026-64136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64136"
},
{
"name": "CVE-2026-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53165"
},
{
"name": "CVE-2026-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53197"
},
{
"name": "CVE-2026-64481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64481"
},
{
"name": "CVE-2026-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53258"
},
{
"name": "CVE-2026-64316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64316"
},
{
"name": "CVE-2026-64174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64174"
},
{
"name": "CVE-2026-64000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64000"
},
{
"name": "CVE-2026-64417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64417"
},
{
"name": "CVE-2026-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53268"
},
{
"name": "CVE-2026-64457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64457"
},
{
"name": "CVE-2026-63819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63819"
},
{
"name": "CVE-2026-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53241"
},
{
"name": "CVE-2026-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53223"
},
{
"name": "CVE-2026-64423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64423"
},
{
"name": "CVE-2026-31414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31414"
},
{
"name": "CVE-2026-53005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53005"
},
{
"name": "CVE-2026-64034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64034"
},
{
"name": "CVE-2026-64443",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64443"
},
{
"name": "CVE-2026-53159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53159"
},
{
"name": "CVE-2026-64588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64588"
},
{
"name": "CVE-2026-64093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64093"
},
{
"name": "CVE-2026-63868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63868"
},
{
"name": "CVE-2022-50401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50401"
},
{
"name": "CVE-2026-64269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64269"
},
{
"name": "CVE-2026-53267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53267"
},
{
"name": "CVE-2026-72296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72296"
},
{
"name": "CVE-2026-52912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52912"
},
{
"name": "CVE-2024-58098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58098"
},
{
"name": "CVE-2026-64482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64482"
},
{
"name": "CVE-2026-64218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64218"
},
{
"name": "CVE-2026-64495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64495"
},
{
"name": "CVE-2026-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53221"
},
{
"name": "CVE-2026-63811",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63811"
},
{
"name": "CVE-2026-64282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64282"
},
{
"name": "CVE-2026-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53275"
},
{
"name": "CVE-2026-64366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64366"
},
{
"name": "CVE-2026-64594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64594"
},
{
"name": "CVE-2026-64278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64278"
},
{
"name": "CVE-2025-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38636"
},
{
"name": "CVE-2026-64396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64396"
},
{
"name": "CVE-2026-53203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53203"
},
{
"name": "CVE-2026-53269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53269"
},
{
"name": "CVE-2026-64479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64479"
},
{
"name": "CVE-2026-64324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64324"
},
{
"name": "CVE-2026-64329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64329"
},
{
"name": "CVE-2026-64434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64434"
},
{
"name": "CVE-2026-64373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64373"
},
{
"name": "CVE-2026-64219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64219"
},
{
"name": "CVE-2026-64277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64277"
},
{
"name": "CVE-2026-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53357"
},
{
"name": "CVE-2026-46324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46324"
},
{
"name": "CVE-2026-64126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64126"
},
{
"name": "CVE-2026-53136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53136"
},
{
"name": "CVE-2026-64503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64503"
},
{
"name": "CVE-2026-64562",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64562"
},
{
"name": "CVE-2026-64168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64168"
},
{
"name": "CVE-2026-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53216"
},
{
"name": "CVE-2026-74350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74350"
},
{
"name": "CVE-2026-72496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72496"
},
{
"name": "CVE-2026-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53153"
},
{
"name": "CVE-2026-64291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64291"
},
{
"name": "CVE-2026-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53226"
},
{
"name": "CVE-2025-40203",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40203"
},
{
"name": "CVE-2026-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53089"
},
{
"name": "CVE-2026-63809",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63809"
},
{
"name": "CVE-2026-43172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43172"
},
{
"name": "CVE-2026-53253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53253"
},
{
"name": "CVE-2026-68161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68161"
},
{
"name": "CVE-2026-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53250"
},
{
"name": "CVE-2026-64453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64453"
},
{
"name": "CVE-2026-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53394"
},
{
"name": "CVE-2026-64436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64436"
},
{
"name": "CVE-2026-64403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64403"
},
{
"name": "CVE-2026-52948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52948"
},
{
"name": "CVE-2026-64121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64121"
},
{
"name": "CVE-2026-63836",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63836"
},
{
"name": "CVE-2026-63814",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63814"
},
{
"name": "CVE-2026-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53252"
},
{
"name": "CVE-2026-64412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64412"
},
{
"name": "CVE-2026-64284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64284"
},
{
"name": "CVE-2026-53355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53355"
},
{
"name": "CVE-2026-43029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43029"
},
{
"name": "CVE-2026-74556",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74556"
},
{
"name": "CVE-2026-64188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64188"
},
{
"name": "CVE-2026-64491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64491"
},
{
"name": "CVE-2026-74287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74287"
},
{
"name": "CVE-2026-72454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72454"
},
{
"name": "CVE-2026-64144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64144"
},
{
"name": "CVE-2026-64487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64487"
},
{
"name": "CVE-2026-64391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64391"
},
{
"name": "CVE-2025-40170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40170"
},
{
"name": "CVE-2026-64303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64303"
},
{
"name": "CVE-2026-64086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64086"
},
{
"name": "CVE-2026-45944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45944"
},
{
"name": "CVE-2026-64429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64429"
},
{
"name": "CVE-2024-57857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57857"
},
{
"name": "CVE-2026-64344",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64344"
},
{
"name": "CVE-2026-53134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53134"
},
{
"name": "CVE-2026-63831",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63831"
},
{
"name": "CVE-2026-64286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64286"
},
{
"name": "CVE-2026-64292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64292"
},
{
"name": "CVE-2026-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53359"
},
{
"name": "CVE-2026-64029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64029"
},
{
"name": "CVE-2026-63834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63834"
},
{
"name": "CVE-2026-52986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52986"
},
{
"name": "CVE-2026-63919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63919"
},
{
"name": "CVE-2026-68124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68124"
},
{
"name": "CVE-2026-68381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68381"
},
{
"name": "CVE-2026-64350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64350"
},
{
"name": "CVE-2026-64321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64321"
},
{
"name": "CVE-2026-72473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72473"
},
{
"name": "CVE-2026-64111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64111"
},
{
"name": "CVE-2026-64447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64447"
},
{
"name": "CVE-2026-53256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53256"
},
{
"name": "CVE-2026-72014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72014"
},
{
"name": "CVE-2026-64411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64411"
},
{
"name": "CVE-2026-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53235"
},
{
"name": "CVE-2024-44964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44964"
},
{
"name": "CVE-2026-74279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74279"
},
{
"name": "CVE-2026-53129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53129"
},
{
"name": "CVE-2026-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53396"
},
{
"name": "CVE-2026-43353",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43353"
},
{
"name": "CVE-2026-64137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64137"
},
{
"name": "CVE-2026-43071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43071"
},
{
"name": "CVE-2026-68431",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68431"
},
{
"name": "CVE-2026-43303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43303"
},
{
"name": "CVE-2026-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53045"
},
{
"name": "CVE-2026-72098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72098"
},
{
"name": "CVE-2025-37876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37876"
},
{
"name": "CVE-2024-58089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58089"
},
{
"name": "CVE-2026-64334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64334"
},
{
"name": "CVE-2026-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53384"
},
{
"name": "CVE-2026-53155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53155"
},
{
"name": "CVE-2026-74495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74495"
},
{
"name": "CVE-2026-64183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64183"
},
{
"name": "CVE-2026-64448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64448"
},
{
"name": "CVE-2026-72111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72111"
},
{
"name": "CVE-2026-74407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74407"
},
{
"name": "CVE-2026-74280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74280"
},
{
"name": "CVE-2026-72221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72221"
},
{
"name": "CVE-2026-72289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72289"
},
{
"name": "CVE-2026-72251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72251"
},
{
"name": "CVE-2026-64347",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64347"
},
{
"name": "CVE-2026-63826",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63826"
},
{
"name": "CVE-2026-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53120"
},
{
"name": "CVE-2026-64393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64393"
},
{
"name": "CVE-2026-64134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64134"
},
{
"name": "CVE-2026-64466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64466"
},
{
"name": "CVE-2026-64419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64419"
},
{
"name": "CVE-2026-23393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23393"
},
{
"name": "CVE-2026-53145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53145"
},
{
"name": "CVE-2026-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53270"
},
{
"name": "CVE-2026-53198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53198"
},
{
"name": "CVE-2026-64382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64382"
},
{
"name": "CVE-2026-64589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64589"
},
{
"name": "CVE-2026-63946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63946"
},
{
"name": "CVE-2026-53240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53240"
},
{
"name": "CVE-2026-64372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64372"
},
{
"name": "CVE-2026-64490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64490"
},
{
"name": "CVE-2026-52909",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52909"
},
{
"name": "CVE-2026-68300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68300"
},
{
"name": "CVE-2026-63922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63922"
},
{
"name": "CVE-2026-64283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64283"
},
{
"name": "CVE-2026-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53395"
},
{
"name": "CVE-2026-43263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43263"
},
{
"name": "CVE-2026-64444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64444"
},
{
"name": "CVE-2026-72126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72126"
},
{
"name": "CVE-2026-68229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68229"
},
{
"name": "CVE-2026-64225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64225"
},
{
"name": "CVE-2026-64331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64331"
},
{
"name": "CVE-2026-64511",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64511"
},
{
"name": "CVE-2026-64032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64032"
},
{
"name": "CVE-2026-64361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64361"
},
{
"name": "CVE-2026-64182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64182"
},
{
"name": "CVE-2026-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53264"
},
{
"name": "CVE-2026-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53142"
},
{
"name": "CVE-2026-68152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68152"
},
{
"name": "CVE-2026-64369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64369"
},
{
"name": "CVE-2025-37776",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37776"
},
{
"name": "CVE-2026-63944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63944"
},
{
"name": "CVE-2026-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53273"
},
{
"name": "CVE-2025-39896",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39896"
},
{
"name": "CVE-2026-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53184"
},
{
"name": "CVE-2026-31560",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31560"
},
{
"name": "CVE-2026-64056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64056"
},
{
"name": "CVE-2026-43101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43101"
},
{
"name": "CVE-2026-64265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64265"
},
{
"name": "CVE-2026-64494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64494"
},
{
"name": "CVE-2026-74268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74268"
},
{
"name": "CVE-2026-43042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43042"
},
{
"name": "CVE-2026-72451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72451"
},
{
"name": "CVE-2026-74475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74475"
},
{
"name": "CVE-2026-53144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53144"
},
{
"name": "CVE-2026-64033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64033"
},
{
"name": "CVE-2026-63893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63893"
},
{
"name": "CVE-2026-68158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68158"
},
{
"name": "CVE-2026-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53385"
},
{
"name": "CVE-2026-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53246"
},
{
"name": "CVE-2026-64245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64245"
},
{
"name": "CVE-2026-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53326"
},
{
"name": "CVE-2026-63823",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63823"
},
{
"name": "CVE-2026-46175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46175"
},
{
"name": "CVE-2026-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53325"
},
{
"name": "CVE-2026-64354",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64354"
},
{
"name": "CVE-2026-64206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64206"
},
{
"name": "CVE-2026-64530",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64530"
},
{
"name": "CVE-2026-64015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64015"
},
{
"name": "CVE-2026-64294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64294"
},
{
"name": "CVE-2024-58241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58241"
},
{
"name": "CVE-2026-64288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64288"
},
{
"name": "CVE-2026-64285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64285"
},
{
"name": "CVE-2026-31657",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31657"
},
{
"name": "CVE-2025-22108",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22108"
},
{
"name": "CVE-2026-68470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68470"
},
{
"name": "CVE-2026-53363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53363"
},
{
"name": "CVE-2026-74436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74436"
},
{
"name": "CVE-2026-52991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52991"
},
{
"name": "CVE-2026-63808",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63808"
},
{
"name": "CVE-2025-40025",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40025"
},
{
"name": "CVE-2026-53191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53191"
},
{
"name": "CVE-2026-72217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72217"
},
{
"name": "CVE-2026-64493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64493"
},
{
"name": "CVE-2026-52940",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52940"
},
{
"name": "CVE-2026-53358",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53358"
},
{
"name": "CVE-2026-64535",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64535"
},
{
"name": "CVE-2026-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53352"
},
{
"name": "CVE-2026-68198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68198"
},
{
"name": "CVE-2026-64416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64416"
},
{
"name": "CVE-2026-72234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72234"
},
{
"name": "CVE-2026-64247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64247"
},
{
"name": "CVE-2026-64379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64379"
},
{
"name": "CVE-2026-53254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53254"
},
{
"name": "CVE-2026-68123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68123"
},
{
"name": "CVE-2026-53078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53078"
},
{
"name": "CVE-2025-38498",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38498"
},
{
"name": "CVE-2026-23327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23327"
},
{
"name": "CVE-2026-64420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64420"
},
{
"name": "CVE-2024-58100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58100"
},
{
"name": "CVE-2026-64138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64138"
},
{
"name": "CVE-2026-64153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64153"
},
{
"name": "CVE-2026-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53180"
},
{
"name": "CVE-2026-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53238"
},
{
"name": "CVE-2026-64205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64205"
},
{
"name": "CVE-2026-53284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53284"
},
{
"name": "CVE-2026-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52921"
},
{
"name": "CVE-2026-64548",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64548"
},
{
"name": "CVE-2026-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53281"
},
{
"name": "CVE-2024-44932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44932"
},
{
"name": "CVE-2026-64118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64118"
},
{
"name": "CVE-2026-68162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68162"
},
{
"name": "CVE-2026-64325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64325"
},
{
"name": "CVE-2026-74427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74427"
},
{
"name": "CVE-2026-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53213"
},
{
"name": "CVE-2026-64596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64596"
},
{
"name": "CVE-2026-53387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53387"
},
{
"name": "CVE-2026-64384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64384"
},
{
"name": "CVE-2026-68084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68084"
},
{
"name": "CVE-2026-64406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64406"
},
{
"name": "CVE-2026-63912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63912"
},
{
"name": "CVE-2026-64425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64425"
},
{
"name": "CVE-2026-64600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64600"
},
{
"name": "CVE-2026-74406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74406"
},
{
"name": "CVE-2026-52930",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52930"
},
{
"name": "CVE-2026-64064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64064"
},
{
"name": "CVE-2026-64116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64116"
},
{
"name": "CVE-2026-64312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64312"
},
{
"name": "CVE-2026-74480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74480"
},
{
"name": "CVE-2026-46275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46275"
},
{
"name": "CVE-2026-68460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68460"
},
{
"name": "CVE-2026-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53265"
},
{
"name": "CVE-2026-64428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64428"
},
{
"name": "CVE-2026-64505",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64505"
},
{
"name": "CVE-2026-64426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64426"
},
{
"name": "CVE-2026-64507",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64507"
},
{
"name": "CVE-2026-53366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53366"
},
{
"name": "CVE-2026-64087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64087"
},
{
"name": "CVE-2026-45850",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45850"
},
{
"name": "CVE-2026-64499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64499"
},
{
"name": "CVE-2024-56591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56591"
},
{
"name": "CVE-2026-31630",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31630"
},
{
"name": "CVE-2026-74584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74584"
},
{
"name": "CVE-2026-53154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53154"
},
{
"name": "CVE-2026-64358",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64358"
},
{
"name": "CVE-2026-64355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64355"
},
{
"name": "CVE-2026-72069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72069"
},
{
"name": "CVE-2026-64290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64290"
},
{
"name": "CVE-2026-64185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64185"
},
{
"name": "CVE-2026-64422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64422"
},
{
"name": "CVE-2026-72020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72020"
},
{
"name": "CVE-2026-43116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43116"
},
{
"name": "CVE-2026-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53196"
},
{
"name": "CVE-2026-64340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64340"
},
{
"name": "CVE-2025-38204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38204"
},
{
"name": "CVE-2026-64092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64092"
},
{
"name": "CVE-2026-53000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53000"
},
{
"name": "CVE-2026-64007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64007"
},
{
"name": "CVE-2026-64450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64450"
},
{
"name": "CVE-2026-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53156"
},
{
"name": "CVE-2026-64484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64484"
},
{
"name": "CVE-2026-64298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64298"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2026-64207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64207"
},
{
"name": "CVE-2026-63994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63994"
},
{
"name": "CVE-2026-64114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64114"
},
{
"name": "CVE-2026-64390",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64390"
},
{
"name": "CVE-2026-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53390"
},
{
"name": "CVE-2026-74255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74255"
},
{
"name": "CVE-2026-72191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72191"
},
{
"name": "CVE-2026-64266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64266"
},
{
"name": "CVE-2026-53211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53211"
},
{
"name": "CVE-2026-64088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64088"
},
{
"name": "CVE-2026-64073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64073"
},
{
"name": "CVE-2026-64441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64441"
},
{
"name": "CVE-2025-21687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21687"
},
{
"name": "CVE-2026-53162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53162"
},
{
"name": "CVE-2026-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53343"
},
{
"name": "CVE-2026-74269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74269"
},
{
"name": "CVE-2026-52926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52926"
},
{
"name": "CVE-2026-72124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72124"
},
{
"name": "CVE-2026-63829",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63829"
},
{
"name": "CVE-2026-72192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72192"
},
{
"name": "CVE-2026-72288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72288"
},
{
"name": "CVE-2026-64135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64135"
},
{
"name": "CVE-2026-64440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64440"
},
{
"name": "CVE-2026-63803",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63803"
},
{
"name": "CVE-2026-64564",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64564"
},
{
"name": "CVE-2026-52917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52917"
},
{
"name": "CVE-2026-64601",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64601"
},
{
"name": "CVE-2026-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53261"
},
{
"name": "CVE-2026-72085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72085"
},
{
"name": "CVE-2026-52982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52982"
},
{
"name": "CVE-2026-64011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64011"
},
{
"name": "CVE-2026-64359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64359"
},
{
"name": "CVE-2026-64317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64317"
},
{
"name": "CVE-2026-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53328"
},
{
"name": "CVE-2026-68154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68154"
},
{
"name": "CVE-2026-63802",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63802"
},
{
"name": "CVE-2026-63869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63869"
}
],
"initial_release_date": "2026-09-18T00:00:00",
"last_revision_date": "2026-09-18T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-1203",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-09-18T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Elles permettent \u00e0 un attaquant de provoquer un probl\u00e8me de s\u00e9curit\u00e9 non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8726-2",
"url": "https://ubuntu.com/security/notices/USN-8726-2"
},
{
"published_at": "2026-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8761-2",
"url": "https://ubuntu.com/security/notices/USN-8761-2"
},
{
"published_at": "2026-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8730-3",
"url": "https://ubuntu.com/security/notices/USN-8730-3"
},
{
"published_at": "2026-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8714-3",
"url": "https://ubuntu.com/security/notices/USN-8714-3"
},
{
"published_at": "2026-09-15",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8730-2",
"url": "https://ubuntu.com/security/notices/USN-8730-2"
},
{
"published_at": "2026-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8725-2",
"url": "https://ubuntu.com/security/notices/USN-8725-2"
},
{
"published_at": "2026-09-15",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8760-1",
"url": "https://ubuntu.com/security/notices/USN-8760-1"
},
{
"published_at": "2026-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8781-1",
"url": "https://ubuntu.com/security/notices/USN-8781-1"
},
{
"published_at": "2026-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8729-2",
"url": "https://ubuntu.com/security/notices/USN-8729-2"
},
{
"published_at": "2026-09-15",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8761-1",
"url": "https://ubuntu.com/security/notices/USN-8761-1"
},
{
"published_at": "2026-09-18",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8715-2",
"url": "https://ubuntu.com/security/notices/USN-8715-2"
}
]
}
CERTFR-2026-AVI-1229
Vulnerability from certfr_avis - Published: 2026-09-25 - Updated: 2026-09-25
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-64141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64141"
},
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-72436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72436"
},
{
"name": "CVE-2026-43198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43198"
},
{
"name": "CVE-2026-45842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45842"
},
{
"name": "CVE-2026-31483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31483"
},
{
"name": "CVE-2026-64353",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64353"
},
{
"name": "CVE-2026-64214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64214"
},
{
"name": "CVE-2026-64046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64046"
},
{
"name": "CVE-2026-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53091"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-68459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68459"
},
{
"name": "CVE-2026-31409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31409"
},
{
"name": "CVE-2026-64376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64376"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-64186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64186"
},
{
"name": "CVE-2026-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53192"
},
{
"name": "CVE-2026-64590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64590"
},
{
"name": "CVE-2026-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53230"
},
{
"name": "CVE-2026-53398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53398"
},
{
"name": "CVE-2026-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53349"
},
{
"name": "CVE-2026-43113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43113"
},
{
"name": "CVE-2026-53038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53038"
},
{
"name": "CVE-2026-31522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31522"
},
{
"name": "CVE-2026-43068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43068"
},
{
"name": "CVE-2026-64287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64287"
},
{
"name": "CVE-2026-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53381"
},
{
"name": "CVE-2026-64270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64270"
},
{
"name": "CVE-2026-53132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53132"
},
{
"name": "CVE-2026-64275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64275"
},
{
"name": "CVE-2026-64274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64274"
},
{
"name": "CVE-2026-31770",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31770"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-74394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74394"
},
{
"name": "CVE-2026-64485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64485"
},
{
"name": "CVE-2026-46211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46211"
},
{
"name": "CVE-2026-63957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63957"
},
{
"name": "CVE-2026-46118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46118"
},
{
"name": "CVE-2026-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53272"
},
{
"name": "CVE-2026-53119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53119"
},
{
"name": "CVE-2026-52934",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52934"
},
{
"name": "CVE-2026-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53179"
},
{
"name": "CVE-2026-46184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46184"
},
{
"name": "CVE-2026-64133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64133"
},
{
"name": "CVE-2026-63864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63864"
},
{
"name": "CVE-2026-53049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53049"
},
{
"name": "CVE-2025-22107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22107"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31658",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31658"
},
{
"name": "CVE-2026-64047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64047"
},
{
"name": "CVE-2026-64143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64143"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2026-64067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64067"
},
{
"name": "CVE-2026-74439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74439"
},
{
"name": "CVE-2026-63854",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63854"
},
{
"name": "CVE-2026-31756",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31756"
},
{
"name": "CVE-2026-64192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64192"
},
{
"name": "CVE-2026-31467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31467"
},
{
"name": "CVE-2026-52955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52955"
},
{
"name": "CVE-2026-23318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23318"
},
{
"name": "CVE-2026-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53350"
},
{
"name": "CVE-2026-23368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23368"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2026-52957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52957"
},
{
"name": "CVE-2026-63974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63974"
},
{
"name": "CVE-2026-53116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53116"
},
{
"name": "CVE-2026-53214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53214"
},
{
"name": "CVE-2026-52925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52925"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-46307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46307"
},
{
"name": "CVE-2026-46130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46130"
},
{
"name": "CVE-2025-27558",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27558"
},
{
"name": "CVE-2026-64452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64452"
},
{
"name": "CVE-2026-63943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63943"
},
{
"name": "CVE-2026-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53210"
},
{
"name": "CVE-2026-52929",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52929"
},
{
"name": "CVE-2026-64492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64492"
},
{
"name": "CVE-2026-64483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64483"
},
{
"name": "CVE-2026-63980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63980"
},
{
"name": "CVE-2026-52968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52968"
},
{
"name": "CVE-2026-64322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64322"
},
{
"name": "CVE-2026-45845",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45845"
},
{
"name": "CVE-2026-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53061"
},
{
"name": "CVE-2026-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53292"
},
{
"name": "CVE-2026-64470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64470"
},
{
"name": "CVE-2026-64172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64172"
},
{
"name": "CVE-2026-53027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53027"
},
{
"name": "CVE-2026-64074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64074"
},
{
"name": "CVE-2026-63843",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63843"
},
{
"name": "CVE-2026-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53364"
},
{
"name": "CVE-2026-64461",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64461"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-64501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64501"
},
{
"name": "CVE-2026-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53374"
},
{
"name": "CVE-2026-31485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31485"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-63923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63923"
},
{
"name": "CVE-2026-43373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43373"
},
{
"name": "CVE-2026-53002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53002"
},
{
"name": "CVE-2026-53090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53090"
},
{
"name": "CVE-2026-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53287"
},
{
"name": "CVE-2026-46124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46124"
},
{
"name": "CVE-2026-53301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53301"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53274"
},
{
"name": "CVE-2026-64094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64094"
},
{
"name": "CVE-2026-53202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53202"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-63921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63921"
},
{
"name": "CVE-2026-63966",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63966"
},
{
"name": "CVE-2026-64513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64513"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2026-64413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64413"
},
{
"name": "CVE-2026-63841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63841"
},
{
"name": "CVE-2026-68088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68088"
},
{
"name": "CVE-2026-64388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64388"
},
{
"name": "CVE-2026-53117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53117"
},
{
"name": "CVE-2026-64512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64512"
},
{
"name": "CVE-2026-63882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63882"
},
{
"name": "CVE-2026-31754",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31754"
},
{
"name": "CVE-2026-53128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53128"
},
{
"name": "CVE-2026-64409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64409"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53320"
},
{
"name": "CVE-2026-63838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63838"
},
{
"name": "CVE-2026-52947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52947"
},
{
"name": "CVE-2026-53218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53218"
},
{
"name": "CVE-2026-46134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46134"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-64367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64367"
},
{
"name": "CVE-2026-31758",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31758"
},
{
"name": "CVE-2026-64516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64516"
},
{
"name": "CVE-2026-64077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64077"
},
{
"name": "CVE-2026-64380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64380"
},
{
"name": "CVE-2026-64268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64268"
},
{
"name": "CVE-2026-53092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53092"
},
{
"name": "CVE-2026-53010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53010"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2026-64023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64023"
},
{
"name": "CVE-2024-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53221"
},
{
"name": "CVE-2026-46121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46121"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2026-53378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53378"
},
{
"name": "CVE-2026-53169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53169"
},
{
"name": "CVE-2026-53041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53041"
},
{
"name": "CVE-2026-23281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23281"
},
{
"name": "CVE-2026-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53066"
},
{
"name": "CVE-2026-64099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64099"
},
{
"name": "CVE-2026-64179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64179"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-64489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64489"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2026-64510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64510"
},
{
"name": "CVE-2026-53143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53143"
},
{
"name": "CVE-2026-64480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64480"
},
{
"name": "CVE-2026-64399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64399"
},
{
"name": "CVE-2026-43060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43060"
},
{
"name": "CVE-2026-72494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72494"
},
{
"name": "CVE-2025-71221",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71221"
},
{
"name": "CVE-2026-80665",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80665"
},
{
"name": "CVE-2026-74376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74376"
},
{
"name": "CVE-2026-53161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53161"
},
{
"name": "CVE-2026-53271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53271"
},
{
"name": "CVE-2026-63852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63852"
},
{
"name": "CVE-2026-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53109"
},
{
"name": "CVE-2026-52970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52970"
},
{
"name": "CVE-2026-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53367"
},
{
"name": "CVE-2026-52958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52958"
},
{
"name": "CVE-2026-64006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64006"
},
{
"name": "CVE-2026-64385",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64385"
},
{
"name": "CVE-2026-53193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53193"
},
{
"name": "CVE-2026-64405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64405"
},
{
"name": "CVE-2026-72130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72130"
},
{
"name": "CVE-2026-53140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53140"
},
{
"name": "CVE-2026-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53297"
},
{
"name": "CVE-2026-63995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63995"
},
{
"name": "CVE-2023-53629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53629"
},
{
"name": "CVE-2026-64217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64217"
},
{
"name": "CVE-2026-63818",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63818"
},
{
"name": "CVE-2026-63911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63911"
},
{
"name": "CVE-2026-46319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46319"
},
{
"name": "CVE-2026-64414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64414"
},
{
"name": "CVE-2026-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53229"
},
{
"name": "CVE-2026-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53104"
},
{
"name": "CVE-2026-64042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64042"
},
{
"name": "CVE-2026-31416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31416"
},
{
"name": "CVE-2026-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53244"
},
{
"name": "CVE-2026-43492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43492"
},
{
"name": "CVE-2026-64502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64502"
},
{
"name": "CVE-2026-64454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64454"
},
{
"name": "CVE-2026-31486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31486"
},
{
"name": "CVE-2026-64531",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64531"
},
{
"name": "CVE-2026-63993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63993"
},
{
"name": "CVE-2026-31656",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31656"
},
{
"name": "CVE-2026-64308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64308"
},
{
"name": "CVE-2026-53014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53014"
},
{
"name": "CVE-2026-64407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64407"
},
{
"name": "CVE-2026-52999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52999"
},
{
"name": "CVE-2026-63832",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63832"
},
{
"name": "CVE-2026-46227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46227"
},
{
"name": "CVE-2026-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53305"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2026-64402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64402"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2026-64527",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64527"
},
{
"name": "CVE-2026-63807",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63807"
},
{
"name": "CVE-2026-53040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53040"
},
{
"name": "CVE-2026-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53231"
},
{
"name": "CVE-2026-23438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23438"
},
{
"name": "CVE-2026-43062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43062"
},
{
"name": "CVE-2026-23293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23293"
},
{
"name": "CVE-2026-23463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23463"
},
{
"name": "CVE-2026-63988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63988"
},
{
"name": "CVE-2026-23227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23227"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-63839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63839"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-64151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64151"
},
{
"name": "CVE-2026-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23454"
},
{
"name": "CVE-2026-31405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31405"
},
{
"name": "CVE-2026-53399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53399"
},
{
"name": "CVE-2026-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53400"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-63886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63886"
},
{
"name": "CVE-2026-64045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64045"
},
{
"name": "CVE-2026-43339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43339"
},
{
"name": "CVE-2026-64221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64221"
},
{
"name": "CVE-2026-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53106"
},
{
"name": "CVE-2026-64365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64365"
},
{
"name": "CVE-2026-64025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64025"
},
{
"name": "CVE-2026-63931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63931"
},
{
"name": "CVE-2026-43054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43054"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-46298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46298"
},
{
"name": "CVE-2026-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53260"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-31664",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31664"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2026-46112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46112"
},
{
"name": "CVE-2026-64264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64264"
},
{
"name": "CVE-2026-64176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64176"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2026-64128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64128"
},
{
"name": "CVE-2026-31473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31473"
},
{
"name": "CVE-2026-53278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53278"
},
{
"name": "CVE-2026-72320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72320"
},
{
"name": "CVE-2026-46196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46196"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-46170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46170"
},
{
"name": "CVE-2026-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53185"
},
{
"name": "CVE-2026-64059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64059"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-53020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53020"
},
{
"name": "CVE-2026-53121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53121"
},
{
"name": "CVE-2026-64132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64132"
},
{
"name": "CVE-2026-53138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53138"
},
{
"name": "CVE-2026-31550",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31550"
},
{
"name": "CVE-2026-64241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64241"
},
{
"name": "CVE-2026-63830",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63830"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-23290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23290"
},
{
"name": "CVE-2026-31549",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31549"
},
{
"name": "CVE-2025-40103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40103"
},
{
"name": "CVE-2026-64256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64256"
},
{
"name": "CVE-2026-31752",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31752"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2026-64319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64319"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2026-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53391"
},
{
"name": "CVE-2026-74345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74345"
},
{
"name": "CVE-2026-43476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43476"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-52989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52989"
},
{
"name": "CVE-2026-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53370"
},
{
"name": "CVE-2026-63924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63924"
},
{
"name": "CVE-2026-72083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72083"
},
{
"name": "CVE-2026-64591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64591"
},
{
"name": "CVE-2026-64333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64333"
},
{
"name": "CVE-2026-53141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53141"
},
{
"name": "CVE-2026-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53291"
},
{
"name": "CVE-2026-52924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52924"
},
{
"name": "CVE-2026-53227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53227"
},
{
"name": "CVE-2026-63979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63979"
},
{
"name": "CVE-2026-64404",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64404"
},
{
"name": "CVE-2026-23303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23303"
},
{
"name": "CVE-2026-63928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63928"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-64467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64467"
},
{
"name": "CVE-2026-63940",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63940"
},
{
"name": "CVE-2026-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53239"
},
{
"name": "CVE-2026-31396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31396"
},
{
"name": "CVE-2026-53029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53029"
},
{
"name": "CVE-2026-63879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63879"
},
{
"name": "CVE-2026-31680",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31680"
},
{
"name": "CVE-2026-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53342"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53181"
},
{
"name": "CVE-2026-23340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23340"
},
{
"name": "CVE-2026-43046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43046"
},
{
"name": "CVE-2026-46233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46233"
},
{
"name": "CVE-2026-52918",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52918"
},
{
"name": "CVE-2026-64424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64424"
},
{
"name": "CVE-2026-64389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64389"
},
{
"name": "CVE-2026-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53220"
},
{
"name": "CVE-2026-46117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46117"
},
{
"name": "CVE-2026-64246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64246"
},
{
"name": "CVE-2026-64223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64223"
},
{
"name": "CVE-2025-71289",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71289"
},
{
"name": "CVE-2026-52963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52963"
},
{
"name": "CVE-2026-46140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46140"
},
{
"name": "CVE-2026-64326",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64326"
},
{
"name": "CVE-2026-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53373"
},
{
"name": "CVE-2026-63933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63933"
},
{
"name": "CVE-2026-68085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68085"
},
{
"name": "CVE-2026-74401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74401"
},
{
"name": "CVE-2026-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53286"
},
{
"name": "CVE-2026-46303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46303"
},
{
"name": "CVE-2026-46114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46114"
},
{
"name": "CVE-2026-63870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63870"
},
{
"name": "CVE-2026-64386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64386"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-72319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72319"
},
{
"name": "CVE-2026-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53331"
},
{
"name": "CVE-2026-31738",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31738"
},
{
"name": "CVE-2026-64460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64460"
},
{
"name": "CVE-2026-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53365"
},
{
"name": "CVE-2026-64514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64514"
},
{
"name": "CVE-2026-64082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64082"
},
{
"name": "CVE-2026-63821",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63821"
},
{
"name": "CVE-2025-68307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68307"
},
{
"name": "CVE-2026-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53081"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2026-68091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68091"
},
{
"name": "CVE-2026-64260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64260"
},
{
"name": "CVE-2026-63805",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63805"
},
{
"name": "CVE-2026-43411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43411"
},
{
"name": "CVE-2026-64279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64279"
},
{
"name": "CVE-2026-31751",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31751"
},
{
"name": "CVE-2026-63915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63915"
},
{
"name": "CVE-2026-43429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43429"
},
{
"name": "CVE-2026-53224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53224"
},
{
"name": "CVE-2026-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53360"
},
{
"name": "CVE-2026-46141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46141"
},
{
"name": "CVE-2026-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52993"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2026-64383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64383"
},
{
"name": "CVE-2026-63847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63847"
},
{
"name": "CVE-2026-64337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64337"
},
{
"name": "CVE-2025-71287",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71287"
},
{
"name": "CVE-2026-46231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46231"
},
{
"name": "CVE-2026-52996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52996"
},
{
"name": "CVE-2026-63888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63888"
},
{
"name": "CVE-2026-64430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64430"
},
{
"name": "CVE-2026-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53095"
},
{
"name": "CVE-2026-45835",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45835"
},
{
"name": "CVE-2026-68083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68083"
},
{
"name": "CVE-2026-53007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53007"
},
{
"name": "CVE-2026-43382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43382"
},
{
"name": "CVE-2026-64162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64162"
},
{
"name": "CVE-2026-64104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64104"
},
{
"name": "CVE-2026-23439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23439"
},
{
"name": "CVE-2026-52956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52956"
},
{
"name": "CVE-2026-64459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64459"
},
{
"name": "CVE-2026-23253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23253"
},
{
"name": "CVE-2026-64232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64232"
},
{
"name": "CVE-2026-52943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52943"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-31721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31721"
},
{
"name": "CVE-2026-63896",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63896"
},
{
"name": "CVE-2026-64295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64295"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-46229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46229"
},
{
"name": "CVE-2026-68089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68089"
},
{
"name": "CVE-2026-72466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72466"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-43052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43052"
},
{
"name": "CVE-2026-43496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43496"
},
{
"name": "CVE-2026-64592",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64592"
},
{
"name": "CVE-2026-64178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64178"
},
{
"name": "CVE-2026-43324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43324"
},
{
"name": "CVE-2026-52915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52915"
},
{
"name": "CVE-2026-64177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64177"
},
{
"name": "CVE-2026-64497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64497"
},
{
"name": "CVE-2026-53163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53163"
},
{
"name": "CVE-2026-46173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46173"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-64258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64258"
},
{
"name": "CVE-2026-68090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68090"
},
{
"name": "CVE-2026-46204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46204"
},
{
"name": "CVE-2026-46214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46214"
},
{
"name": "CVE-2026-53146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53146"
},
{
"name": "CVE-2026-63956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63956"
},
{
"name": "CVE-2026-64599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64599"
},
{
"name": "CVE-2026-68461",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68461"
},
{
"name": "CVE-2026-64189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64189"
},
{
"name": "CVE-2026-72339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72339"
},
{
"name": "CVE-2026-63798",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63798"
},
{
"name": "CVE-2026-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53354"
},
{
"name": "CVE-2026-23434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23434"
},
{
"name": "CVE-2026-46182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46182"
},
{
"name": "CVE-2026-63845",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63845"
},
{
"name": "CVE-2026-64598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64598"
},
{
"name": "CVE-2026-53103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53103"
},
{
"name": "CVE-2026-64017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64017"
},
{
"name": "CVE-2026-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53313"
},
{
"name": "CVE-2026-64230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64230"
},
{
"name": "CVE-2026-53345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53345"
},
{
"name": "CVE-2026-46183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46183"
},
{
"name": "CVE-2026-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53205"
},
{
"name": "CVE-2026-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53321"
},
{
"name": "CVE-2026-63810",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63810"
},
{
"name": "CVE-2026-64098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64098"
},
{
"name": "CVE-2026-63801",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63801"
},
{
"name": "CVE-2026-63815",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63815"
},
{
"name": "CVE-2026-63827",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63827"
},
{
"name": "CVE-2026-64304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64304"
},
{
"name": "CVE-2026-43014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43014"
},
{
"name": "CVE-2026-64451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64451"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-63842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63842"
},
{
"name": "CVE-2026-46158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46158"
},
{
"name": "CVE-2026-74267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74267"
},
{
"name": "CVE-2026-63929",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63929"
},
{
"name": "CVE-2026-31447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31447"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-64226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64226"
},
{
"name": "CVE-2026-64146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64146"
},
{
"name": "CVE-2026-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53397"
},
{
"name": "CVE-2026-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53309"
},
{
"name": "CVE-2026-43445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43445"
},
{
"name": "CVE-2026-68457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68457"
},
{
"name": "CVE-2026-72366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72366"
},
{
"name": "CVE-2026-46320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46320"
},
{
"name": "CVE-2026-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53201"
},
{
"name": "CVE-2026-63910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63910"
},
{
"name": "CVE-2026-43387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43387"
},
{
"name": "CVE-2026-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53097"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2026-64276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64276"
},
{
"name": "CVE-2025-21712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21712"
},
{
"name": "CVE-2026-43028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43028"
},
{
"name": "CVE-2026-63948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63948"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-46236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46236"
},
{
"name": "CVE-2026-64475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64475"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-43475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43475"
},
{
"name": "CVE-2026-64508",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64508"
},
{
"name": "CVE-2026-64013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64013"
},
{
"name": "CVE-2026-52913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52913"
},
{
"name": "CVE-2026-64237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64237"
},
{
"name": "CVE-2026-64323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64323"
},
{
"name": "CVE-2026-64438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64438"
},
{
"name": "CVE-2026-46113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46113"
},
{
"name": "CVE-2026-64261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64261"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2026-23304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23304"
},
{
"name": "CVE-2026-31683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31683"
},
{
"name": "CVE-2024-56557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56557"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2026-64220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64220"
},
{
"name": "CVE-2026-23357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23357"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-31408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31408"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2025-38105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38105"
},
{
"name": "CVE-2026-53071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53071"
},
{
"name": "CVE-2026-52941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52941"
},
{
"name": "CVE-2026-45841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45841"
},
{
"name": "CVE-2026-53102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53102"
},
{
"name": "CVE-2026-31524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31524"
},
{
"name": "CVE-2026-64271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64271"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53150"
},
{
"name": "CVE-2026-53327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53327"
},
{
"name": "CVE-2026-53044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53044"
},
{
"name": "CVE-2026-63913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63913"
},
{
"name": "CVE-2026-46188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46188"
},
{
"name": "CVE-2026-64068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64068"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-52939",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52939"
},
{
"name": "CVE-2026-64038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64038"
},
{
"name": "CVE-2026-64107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64107"
},
{
"name": "CVE-2026-64462",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64462"
},
{
"name": "CVE-2026-23066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23066"
},
{
"name": "CVE-2026-63925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63925"
},
{
"name": "CVE-2026-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53147"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2026-46159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46159"
},
{
"name": "CVE-2026-63990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63990"
},
{
"name": "CVE-2026-64455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64455"
},
{
"name": "CVE-2026-52942",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52942"
},
{
"name": "CVE-2026-31546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31546"
},
{
"name": "CVE-2026-45956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45956"
},
{
"name": "CVE-2026-46190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46190"
},
{
"name": "CVE-2026-46331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46331"
},
{
"name": "CVE-2026-53051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53051"
},
{
"name": "CVE-2026-46142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46142"
},
{
"name": "CVE-2026-53015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53015"
},
{
"name": "CVE-2026-64421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64421"
},
{
"name": "CVE-2026-64302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64302"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2026-72129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72129"
},
{
"name": "CVE-2026-72299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72299"
},
{
"name": "CVE-2026-64445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64445"
},
{
"name": "CVE-2026-52935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52935"
},
{
"name": "CVE-2026-64328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64328"
},
{
"name": "CVE-2026-72417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72417"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-53013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53013"
},
{
"name": "CVE-2026-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53317"
},
{
"name": "CVE-2026-53200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53200"
},
{
"name": "CVE-2026-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53183"
},
{
"name": "CVE-2026-64433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64433"
},
{
"name": "CVE-2026-53054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53054"
},
{
"name": "CVE-2026-64165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64165"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-53064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53064"
},
{
"name": "CVE-2026-64272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64272"
},
{
"name": "CVE-2026-23469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23469"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-72278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72278"
},
{
"name": "CVE-2026-23324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23324"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-52995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52995"
},
{
"name": "CVE-2026-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53257"
},
{
"name": "CVE-2026-46209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46209"
},
{
"name": "CVE-2026-52931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52931"
},
{
"name": "CVE-2026-53113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53113"
},
{
"name": "CVE-2026-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53338"
},
{
"name": "CVE-2026-64003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64003"
},
{
"name": "CVE-2026-64253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64253"
},
{
"name": "CVE-2026-64213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64213"
},
{
"name": "CVE-2026-46153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46153"
},
{
"name": "CVE-2026-68476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68476"
},
{
"name": "CVE-2026-64076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64076"
},
{
"name": "CVE-2026-68477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68477"
},
{
"name": "CVE-2026-52951",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52951"
},
{
"name": "CVE-2026-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53058"
},
{
"name": "CVE-2026-64500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64500"
},
{
"name": "CVE-2026-53094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53094"
},
{
"name": "CVE-2026-43047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43047"
},
{
"name": "CVE-2026-63806",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63806"
},
{
"name": "CVE-2026-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53047"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2026-52961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52961"
},
{
"name": "CVE-2026-43432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43432"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53368"
},
{
"name": "CVE-2026-53296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53296"
},
{
"name": "CVE-2026-64239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64239"
},
{
"name": "CVE-2026-64097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64097"
},
{
"name": "CVE-2024-46715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46715"
},
{
"name": "CVE-2026-72351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72351"
},
{
"name": "CVE-2026-63816",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63816"
},
{
"name": "CVE-2026-64330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64330"
},
{
"name": "CVE-2026-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53330"
},
{
"name": "CVE-2026-31545",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31545"
},
{
"name": "CVE-2026-31681",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31681"
},
{
"name": "CVE-2026-72277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72277"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-23456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23456"
},
{
"name": "CVE-2026-46186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46186"
},
{
"name": "CVE-2026-64348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64348"
},
{
"name": "CVE-2026-53383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53383"
},
{
"name": "CVE-2026-64469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64469"
},
{
"name": "CVE-2026-53348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53348"
},
{
"name": "CVE-2026-43458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43458"
},
{
"name": "CVE-2026-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53101"
},
{
"name": "CVE-2026-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52919"
},
{
"name": "CVE-2026-46169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46169"
},
{
"name": "CVE-2026-74361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74361"
},
{
"name": "CVE-2026-64310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64310"
},
{
"name": "CVE-2026-53006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53006"
},
{
"name": "CVE-2026-43450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43450"
},
{
"name": "CVE-2026-64280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64280"
},
{
"name": "CVE-2026-63880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63880"
},
{
"name": "CVE-2026-64362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64362"
},
{
"name": "CVE-2026-64327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64327"
},
{
"name": "CVE-2026-64415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64415"
},
{
"name": "CVE-2026-31510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31510"
},
{
"name": "CVE-2026-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53324"
},
{
"name": "CVE-2026-63989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63989"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-64289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64289"
},
{
"name": "CVE-2026-43079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43079"
},
{
"name": "CVE-2026-23457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23457"
},
{
"name": "CVE-2026-64523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64523"
},
{
"name": "CVE-2026-63800",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63800"
},
{
"name": "CVE-2026-63964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63964"
},
{
"name": "CVE-2026-64102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64102"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-64255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64255"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-43103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43103"
},
{
"name": "CVE-2026-43069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43069"
},
{
"name": "CVE-2026-64041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64041"
},
{
"name": "CVE-2026-43425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43425"
},
{
"name": "CVE-2026-64071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64071"
},
{
"name": "CVE-2026-64314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64314"
},
{
"name": "CVE-2026-63863",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63863"
},
{
"name": "CVE-2026-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53377"
},
{
"name": "CVE-2026-64486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64486"
},
{
"name": "CVE-2026-31642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31642"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-64129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64129"
},
{
"name": "CVE-2026-64267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64267"
},
{
"name": "CVE-2026-23399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23399"
},
{
"name": "CVE-2026-72220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72220"
},
{
"name": "CVE-2026-53028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53028"
},
{
"name": "CVE-2026-90386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-90386"
},
{
"name": "CVE-2026-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53312"
},
{
"name": "CVE-2026-64517",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64517"
},
{
"name": "CVE-2026-64341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64341"
},
{
"name": "CVE-2026-46106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46106"
},
{
"name": "CVE-2026-31420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31420"
},
{
"name": "CVE-2026-72194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72194"
},
{
"name": "CVE-2026-63817",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63817"
},
{
"name": "CVE-2026-64446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64446"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2026-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53339"
},
{
"name": "CVE-2026-64534",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64534"
},
{
"name": "CVE-2026-53266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53266"
},
{
"name": "CVE-2026-64338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64338"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2026-43480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43480"
},
{
"name": "CVE-2026-64083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64083"
},
{
"name": "CVE-2026-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53234"
},
{
"name": "CVE-2026-64169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64169"
},
{
"name": "CVE-2026-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53149"
},
{
"name": "CVE-2026-23401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23401"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2026-63795",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63795"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-46116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46116"
},
{
"name": "CVE-2026-64106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64106"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2026-64418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64418"
},
{
"name": "CVE-2026-64249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64249"
},
{
"name": "CVE-2026-72222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72222"
},
{
"name": "CVE-2026-64536",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64536"
},
{
"name": "CVE-2026-46203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46203"
},
{
"name": "CVE-2026-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53048"
},
{
"name": "CVE-2026-63873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63873"
},
{
"name": "CVE-2026-63932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63932"
},
{
"name": "CVE-2026-43426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43426"
},
{
"name": "CVE-2026-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53176"
},
{
"name": "CVE-2026-63892",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63892"
},
{
"name": "CVE-2026-63850",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63850"
},
{
"name": "CVE-2026-43030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43030"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2026-53172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53172"
},
{
"name": "CVE-2026-43074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43074"
},
{
"name": "CVE-2026-46151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46151"
},
{
"name": "CVE-2026-64010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64010"
},
{
"name": "CVE-2026-64364",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64364"
},
{
"name": "CVE-2026-63947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63947"
},
{
"name": "CVE-2026-63950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63950"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-64243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64243"
},
{
"name": "CVE-2026-45911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45911"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2026-46220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46220"
},
{
"name": "CVE-2026-52975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52975"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-64008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64008"
},
{
"name": "CVE-2026-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53315"
},
{
"name": "CVE-2026-64163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64163"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-43334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43334"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-23391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23391"
},
{
"name": "CVE-2026-64050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64050"
},
{
"name": "CVE-2026-31415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31415"
},
{
"name": "CVE-2026-46127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46127"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-63975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63975"
},
{
"name": "CVE-2026-53233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53233"
},
{
"name": "CVE-2026-63859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63859"
},
{
"name": "CVE-2026-63952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63952"
},
{
"name": "CVE-2026-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53114"
},
{
"name": "CVE-2026-53402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53402"
},
{
"name": "CVE-2024-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47809"
},
{
"name": "CVE-2026-63965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63965"
},
{
"name": "CVE-2026-64351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64351"
},
{
"name": "CVE-2026-23204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23204"
},
{
"name": "CVE-2026-64051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64051"
},
{
"name": "CVE-2026-23462",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23462"
},
{
"name": "CVE-2026-53046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53046"
},
{
"name": "CVE-2026-63835",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63835"
},
{
"name": "CVE-2026-53050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53050"
},
{
"name": "CVE-2026-64432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64432"
},
{
"name": "CVE-2026-46176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46176"
},
{
"name": "CVE-2026-23372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23372"
},
{
"name": "CVE-2026-43080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43080"
},
{
"name": "CVE-2026-46146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46146"
},
{
"name": "CVE-2026-45836",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45836"
},
{
"name": "CVE-2026-46318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46318"
},
{
"name": "CVE-2026-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53386"
},
{
"name": "CVE-2026-64181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64181"
},
{
"name": "CVE-2026-64293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64293"
},
{
"name": "CVE-2026-64039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64039"
},
{
"name": "CVE-2026-63855",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63855"
},
{
"name": "CVE-2026-68087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68087"
},
{
"name": "CVE-2026-63833",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63833"
},
{
"name": "CVE-2026-46178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46178"
},
{
"name": "CVE-2026-45846",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45846"
},
{
"name": "CVE-2026-63796",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63796"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-53332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53332"
},
{
"name": "CVE-2026-64363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64363"
},
{
"name": "CVE-2026-46174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46174"
},
{
"name": "CVE-2026-43495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43495"
},
{
"name": "CVE-2026-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53401"
},
{
"name": "CVE-2026-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53334"
},
{
"name": "CVE-2026-53021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53021"
},
{
"name": "CVE-2026-46171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46171"
},
{
"name": "CVE-2026-64263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64263"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-43327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43327"
},
{
"name": "CVE-2026-64061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64061"
},
{
"name": "CVE-2024-56719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56719"
},
{
"name": "CVE-2026-53353",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53353"
},
{
"name": "CVE-2026-64375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64375"
},
{
"name": "CVE-2026-46133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46133"
},
{
"name": "CVE-2026-31494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31494"
},
{
"name": "CVE-2026-64296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64296"
},
{
"name": "CVE-2026-64040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64040"
},
{
"name": "CVE-2026-63917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63917"
},
{
"name": "CVE-2026-31565",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31565"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-43381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43381"
},
{
"name": "CVE-2026-46308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46308"
},
{
"name": "CVE-2026-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53335"
},
{
"name": "CVE-2026-23270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23270"
},
{
"name": "CVE-2026-31763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31763"
},
{
"name": "CVE-2026-63926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63926"
},
{
"name": "CVE-2026-64370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64370"
},
{
"name": "CVE-2026-23279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23279"
},
{
"name": "CVE-2026-64150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64150"
},
{
"name": "CVE-2026-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53178"
},
{
"name": "CVE-2026-53389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53389"
},
{
"name": "CVE-2026-64439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64439"
},
{
"name": "CVE-2026-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53110"
},
{
"name": "CVE-2026-52937",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52937"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2026-72322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72322"
},
{
"name": "CVE-2026-31670",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31670"
},
{
"name": "CVE-2026-64593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64593"
},
{
"name": "CVE-2026-64254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64254"
},
{
"name": "CVE-2026-64231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64231"
},
{
"name": "CVE-2026-46122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46122"
},
{
"name": "CVE-2026-64022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64022"
},
{
"name": "CVE-2026-53158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53158"
},
{
"name": "CVE-2026-53131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53131"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2026-64210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64210"
},
{
"name": "CVE-2026-64091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64091"
},
{
"name": "CVE-2026-46241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46241"
},
{
"name": "CVE-2026-64299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64299"
},
{
"name": "CVE-2026-63865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63865"
},
{
"name": "CVE-2026-64052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64052"
},
{
"name": "CVE-2026-72422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72422"
},
{
"name": "CVE-2026-31422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31422"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-23286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23286"
},
{
"name": "CVE-2026-23359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23359"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-23298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23298"
},
{
"name": "CVE-2026-64374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64374"
},
{
"name": "CVE-2026-46181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46181"
},
{
"name": "CVE-2026-64357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64357"
},
{
"name": "CVE-2026-31469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31469"
},
{
"name": "CVE-2026-64488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64488"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-46213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46213"
},
{
"name": "CVE-2026-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53288"
},
{
"name": "CVE-2026-31498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31498"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-64603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64603"
},
{
"name": "CVE-2026-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53219"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-64109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64109"
},
{
"name": "CVE-2026-53190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53190"
},
{
"name": "CVE-2026-64345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64345"
},
{
"name": "CVE-2026-64085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64085"
},
{
"name": "CVE-2026-46226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46226"
},
{
"name": "CVE-2026-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46120"
},
{
"name": "CVE-2026-46198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46198"
},
{
"name": "CVE-2026-43336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43336"
},
{
"name": "CVE-2026-64368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64368"
},
{
"name": "CVE-2026-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53251"
},
{
"name": "CVE-2026-64518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64518"
},
{
"name": "CVE-2026-43104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43104"
},
{
"name": "CVE-2026-52954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52954"
},
{
"name": "CVE-2026-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53249"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-64166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64166"
},
{
"name": "CVE-2026-53329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53329"
},
{
"name": "CVE-2026-46189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46189"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-52997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52997"
},
{
"name": "CVE-2026-53139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53139"
},
{
"name": "CVE-2026-53382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53382"
},
{
"name": "CVE-2026-43466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43466"
},
{
"name": "CVE-2026-64504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64504"
},
{
"name": "CVE-2026-46315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46315"
},
{
"name": "CVE-2026-64020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64020"
},
{
"name": "CVE-2026-63875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63875"
},
{
"name": "CVE-2026-63898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63898"
},
{
"name": "CVE-2026-52987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52987"
},
{
"name": "CVE-2026-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53217"
},
{
"name": "CVE-2026-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53276"
},
{
"name": "CVE-2026-23296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23296"
},
{
"name": "CVE-2026-46296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46296"
},
{
"name": "CVE-2026-64148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64148"
},
{
"name": "CVE-2026-53262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53262"
},
{
"name": "CVE-2026-53346",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53346"
},
{
"name": "CVE-2026-64090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64090"
},
{
"name": "CVE-2026-53130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53130"
},
{
"name": "CVE-2026-46128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46128"
},
{
"name": "CVE-2026-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53070"
},
{
"name": "CVE-2026-52984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52984"
},
{
"name": "CVE-2026-72495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72495"
},
{
"name": "CVE-2026-64004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64004"
},
{
"name": "CVE-2026-31427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31427"
},
{
"name": "CVE-2026-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53088"
},
{
"name": "CVE-2026-31555",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31555"
},
{
"name": "CVE-2026-63813",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63813"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2026-64320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64320"
},
{
"name": "CVE-2026-63992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63992"
},
{
"name": "CVE-2026-72287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72287"
},
{
"name": "CVE-2026-46317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46317"
},
{
"name": "CVE-2026-64155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64155"
},
{
"name": "CVE-2026-43439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43439"
},
{
"name": "CVE-2022-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50073"
},
{
"name": "CVE-2026-64398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64398"
},
{
"name": "CVE-2026-64147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64147"
},
{
"name": "CVE-2026-72084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72084"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-64464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64464"
},
{
"name": "CVE-2026-64297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64297"
},
{
"name": "CVE-2026-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53243"
},
{
"name": "CVE-2026-72317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72317"
},
{
"name": "CVE-2026-72137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72137"
},
{
"name": "CVE-2026-63909",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63909"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-43099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43099"
},
{
"name": "CVE-2026-46242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46242"
},
{
"name": "CVE-2026-53065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53065"
},
{
"name": "CVE-2026-63976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63976"
},
{
"name": "CVE-2026-52960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52960"
},
{
"name": "CVE-2026-63996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63996"
},
{
"name": "CVE-2026-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53079"
},
{
"name": "CVE-2026-68092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68092"
},
{
"name": "CVE-2026-31515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31515"
},
{
"name": "CVE-2026-64343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64343"
},
{
"name": "CVE-2026-31661",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31661"
},
{
"name": "CVE-2026-46293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46293"
},
{
"name": "CVE-2026-43380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43380"
},
{
"name": "CVE-2026-43452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43452"
},
{
"name": "CVE-2026-64473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64473"
},
{
"name": "CVE-2026-64021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64021"
},
{
"name": "CVE-2026-64397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64397"
},
{
"name": "CVE-2026-31737",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31737"
},
{
"name": "CVE-2025-68358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68358"
},
{
"name": "CVE-2026-64152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64152"
},
{
"name": "CVE-2026-46197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46197"
},
{
"name": "CVE-2026-52952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52952"
},
{
"name": "CVE-2026-63984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63984"
},
{
"name": "CVE-2026-53361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53361"
},
{
"name": "CVE-2026-64371",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64371"
},
{
"name": "CVE-2026-52973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52973"
},
{
"name": "CVE-2026-46301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46301"
},
{
"name": "CVE-2026-46223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46223"
},
{
"name": "CVE-2026-64057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64057"
},
{
"name": "CVE-2026-46224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46224"
},
{
"name": "CVE-2026-64520",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64520"
},
{
"name": "CVE-2026-52914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52914"
},
{
"name": "CVE-2026-52916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52916"
},
{
"name": "CVE-2026-53009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53009"
},
{
"name": "CVE-2026-64167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64167"
},
{
"name": "CVE-2026-53236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53236"
},
{
"name": "CVE-2026-64471",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64471"
},
{
"name": "CVE-2026-53225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53225"
},
{
"name": "CVE-2026-64180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64180"
},
{
"name": "CVE-2026-64468",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64468"
},
{
"name": "CVE-2026-53034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53034"
},
{
"name": "CVE-2026-53294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53294"
},
{
"name": "CVE-2026-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53222"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2026-53084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53084"
},
{
"name": "CVE-2026-72033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72033"
},
{
"name": "CVE-2026-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53105"
},
{
"name": "CVE-2026-64449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64449"
},
{
"name": "CVE-2026-63866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63866"
},
{
"name": "CVE-2026-64105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64105"
},
{
"name": "CVE-2026-64602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64602"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2026-64125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64125"
},
{
"name": "CVE-2026-53283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53283"
},
{
"name": "CVE-2026-43043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43043"
},
{
"name": "CVE-2026-63884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63884"
},
{
"name": "CVE-2026-64551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64551"
},
{
"name": "CVE-2026-31705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31705"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-72472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72472"
},
{
"name": "CVE-2026-53111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53111"
},
{
"name": "CVE-2026-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53362"
},
{
"name": "CVE-2026-64410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64410"
},
{
"name": "CVE-2026-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31684"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53168"
},
{
"name": "CVE-2026-23396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23396"
},
{
"name": "CVE-2026-64212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64212"
},
{
"name": "CVE-2026-31423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31423"
},
{
"name": "CVE-2026-53173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53173"
},
{
"name": "CVE-2026-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52922"
},
{
"name": "CVE-2026-46180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46180"
},
{
"name": "CVE-2026-64528",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64528"
},
{
"name": "CVE-2026-53053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53053"
},
{
"name": "CVE-2026-64089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64089"
},
{
"name": "CVE-2026-46295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46295"
},
{
"name": "CVE-2026-53403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53403"
},
{
"name": "CVE-2026-63871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63871"
},
{
"name": "CVE-2026-64131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64131"
},
{
"name": "CVE-2026-64048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64048"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-43051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43051"
},
{
"name": "CVE-2026-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53209"
},
{
"name": "CVE-2026-31759",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31759"
},
{
"name": "CVE-2026-52992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52992"
},
{
"name": "CVE-2026-63797",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63797"
},
{
"name": "CVE-2026-63987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63987"
},
{
"name": "CVE-2023-45896",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45896"
},
{
"name": "CVE-2026-64080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64080"
},
{
"name": "CVE-2026-23370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23370"
},
{
"name": "CVE-2026-64456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64456"
},
{
"name": "CVE-2026-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53112"
},
{
"name": "CVE-2026-72491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72491"
},
{
"name": "CVE-2026-63858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63858"
},
{
"name": "CVE-2026-64170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64170"
},
{
"name": "CVE-2026-46206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46206"
},
{
"name": "CVE-2026-72393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72393"
},
{
"name": "CVE-2026-53124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53124"
},
{
"name": "CVE-2026-52979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52979"
},
{
"name": "CVE-2026-64100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64100"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-53086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53086"
},
{
"name": "CVE-2026-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53371"
},
{
"name": "CVE-2026-64306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64306"
},
{
"name": "CVE-2026-31781",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31781"
},
{
"name": "CVE-2026-43449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43449"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-64465",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64465"
},
{
"name": "CVE-2026-64313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64313"
},
{
"name": "CVE-2026-52965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52965"
},
{
"name": "CVE-2026-63978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63978"
},
{
"name": "CVE-2026-31523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31523"
},
{
"name": "CVE-2026-53067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53067"
},
{
"name": "CVE-2026-52994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52994"
},
{
"name": "CVE-2026-52988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52988"
},
{
"name": "CVE-2026-46297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46297"
},
{
"name": "CVE-2026-53157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53157"
},
{
"name": "CVE-2026-64112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64112"
},
{
"name": "CVE-2026-43459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43459"
},
{
"name": "CVE-2026-46154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46154"
},
{
"name": "CVE-2025-10263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10263"
},
{
"name": "CVE-2026-31450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31450"
},
{
"name": "CVE-2026-53135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53135"
},
{
"name": "CVE-2026-74434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74434"
},
{
"name": "CVE-2026-63853",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63853"
},
{
"name": "CVE-2026-64442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64442"
},
{
"name": "CVE-2026-46302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46302"
},
{
"name": "CVE-2026-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53333"
},
{
"name": "CVE-2026-64477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64477"
},
{
"name": "CVE-2026-64463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64463"
},
{
"name": "CVE-2026-64401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64401"
},
{
"name": "CVE-2026-31671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31671"
},
{
"name": "CVE-2026-31749",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31749"
},
{
"name": "CVE-2026-52971",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52971"
},
{
"name": "CVE-2026-46234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46234"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-43328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43328"
},
{
"name": "CVE-2026-72064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72064"
},
{
"name": "CVE-2026-53188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53188"
},
{
"name": "CVE-2026-53392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53392"
},
{
"name": "CVE-2026-64259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64259"
},
{
"name": "CVE-2026-64018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64018"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2026-43024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43024"
},
{
"name": "CVE-2026-53099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53099"
},
{
"name": "CVE-2026-46109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46109"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-53279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53279"
},
{
"name": "CVE-2026-45985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45985"
},
{
"name": "CVE-2026-64541",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64541"
},
{
"name": "CVE-2026-64069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64069"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-63916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63916"
},
{
"name": "CVE-2026-64332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64332"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2026-63920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63920"
},
{
"name": "CVE-2026-52981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52981"
},
{
"name": "CVE-2026-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53170"
},
{
"name": "CVE-2026-46108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46108"
},
{
"name": "CVE-2026-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53167"
},
{
"name": "CVE-2026-52927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52927"
},
{
"name": "CVE-2026-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53060"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-23352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23352"
},
{
"name": "CVE-2026-64191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64191"
},
{
"name": "CVE-2026-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53096"
},
{
"name": "CVE-2026-31720",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31720"
},
{
"name": "CVE-2026-46321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46321"
},
{
"name": "CVE-2026-31748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31748"
},
{
"name": "CVE-2026-63930",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63930"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-64458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64458"
},
{
"name": "CVE-2026-64171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64171"
},
{
"name": "CVE-2026-64127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64127"
},
{
"name": "CVE-2026-64476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64476"
},
{
"name": "CVE-2026-64027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64027"
},
{
"name": "CVE-2026-64378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64378"
},
{
"name": "CVE-2026-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53076"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-72323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72323"
},
{
"name": "CVE-2026-72065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72065"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-64318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64318"
},
{
"name": "CVE-2026-43472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43472"
},
{
"name": "CVE-2026-23367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23367"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-64521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64521"
},
{
"name": "CVE-2026-64300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64300"
},
{
"name": "CVE-2026-72398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72398"
},
{
"name": "CVE-2026-52908",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52908"
},
{
"name": "CVE-2026-63861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63861"
},
{
"name": "CVE-2026-45899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45899"
},
{
"name": "CVE-2026-63794",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63794"
},
{
"name": "CVE-2026-31662",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31662"
},
{
"name": "CVE-2026-53018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53018"
},
{
"name": "CVE-2026-64394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64394"
},
{
"name": "CVE-2026-74398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74398"
},
{
"name": "CVE-2026-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53237"
},
{
"name": "CVE-2026-80591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80591"
},
{
"name": "CVE-2026-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53302"
},
{
"name": "CVE-2026-53035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53035"
},
{
"name": "CVE-2026-53186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53186"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2026-53340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53340"
},
{
"name": "CVE-2026-43026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43026"
},
{
"name": "CVE-2026-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53182"
},
{
"name": "CVE-2026-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53177"
},
{
"name": "CVE-2026-31480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31480"
},
{
"name": "CVE-2026-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53208"
},
{
"name": "CVE-2026-64055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64055"
},
{
"name": "CVE-2026-43405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43405"
},
{
"name": "CVE-2026-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53255"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53207"
},
{
"name": "CVE-2026-43430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43430"
},
{
"name": "CVE-2026-64244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64244"
},
{
"name": "CVE-2026-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53375"
},
{
"name": "CVE-2026-45920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45920"
},
{
"name": "CVE-2026-46150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46150"
},
{
"name": "CVE-2026-63938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63938"
},
{
"name": "CVE-2026-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53314"
},
{
"name": "CVE-2026-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53123"
},
{
"name": "CVE-2026-53347",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53347"
},
{
"name": "CVE-2026-53126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53126"
},
{
"name": "CVE-2026-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53187"
},
{
"name": "CVE-2026-64060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64060"
},
{
"name": "CVE-2026-64026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64026"
},
{
"name": "CVE-2026-46228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46228"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53311"
},
{
"name": "CVE-2026-45840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45840"
},
{
"name": "CVE-2026-64228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64228"
},
{
"name": "CVE-2026-52950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52950"
},
{
"name": "CVE-2026-72355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72355"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-53160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53160"
},
{
"name": "CVE-2026-74384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74384"
},
{
"name": "CVE-2026-63970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63970"
},
{
"name": "CVE-2026-23446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23446"
},
{
"name": "CVE-2026-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53245"
},
{
"name": "CVE-2026-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53195"
},
{
"name": "CVE-2026-64309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64309"
},
{
"name": "CVE-2026-46219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46219"
},
{
"name": "CVE-2026-64173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64173"
},
{
"name": "CVE-2026-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53043"
},
{
"name": "CVE-2026-63824",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63824"
},
{
"name": "CVE-2026-72139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72139"
},
{
"name": "CVE-2026-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53171"
},
{
"name": "CVE-2026-43075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43075"
},
{
"name": "CVE-2026-43035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43035"
},
{
"name": "CVE-2026-63914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63914"
},
{
"name": "CVE-2026-46172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46172"
},
{
"name": "CVE-2026-63935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63935"
},
{
"name": "CVE-2026-64556",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64556"
},
{
"name": "CVE-2026-63825",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63825"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2026-46311",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46311"
},
{
"name": "CVE-2026-74433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74433"
},
{
"name": "CVE-2026-53164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53164"
},
{
"name": "CVE-2024-56657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56657"
},
{
"name": "CVE-2026-31665",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31665"
},
{
"name": "CVE-2026-46161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46161"
},
{
"name": "CVE-2026-72463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72463"
},
{
"name": "CVE-2026-63874",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63874"
},
{
"name": "CVE-2026-53285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53285"
},
{
"name": "CVE-2026-64224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64224"
},
{
"name": "CVE-2026-63901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63901"
},
{
"name": "CVE-2026-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53232"
},
{
"name": "CVE-2026-23300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23300"
},
{
"name": "CVE-2026-64435",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64435"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-64184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64184"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-23444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23444"
},
{
"name": "CVE-2026-64336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64336"
},
{
"name": "CVE-2026-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53148"
},
{
"name": "CVE-2026-63951",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63951"
},
{
"name": "CVE-2026-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53189"
},
{
"name": "CVE-2026-64352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64352"
},
{
"name": "CVE-2026-72318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72318"
},
{
"name": "CVE-2026-43378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43378"
},
{
"name": "CVE-2026-64474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64474"
},
{
"name": "CVE-2026-52949",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52949"
},
{
"name": "CVE-2026-64115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64115"
},
{
"name": "CVE-2026-45844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45844"
},
{
"name": "CVE-2026-52985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52985"
},
{
"name": "CVE-2026-46110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46110"
},
{
"name": "CVE-2026-64356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64356"
},
{
"name": "CVE-2026-63867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63867"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-31672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31672"
},
{
"name": "CVE-2026-64031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64031"
},
{
"name": "CVE-2026-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53059"
},
{
"name": "CVE-2026-53133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53133"
},
{
"name": "CVE-2026-64377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64377"
},
{
"name": "CVE-2026-43093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43093"
},
{
"name": "CVE-2026-31780",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31780"
},
{
"name": "CVE-2026-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53204"
},
{
"name": "CVE-2026-43342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43342"
},
{
"name": "CVE-2026-64164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64164"
},
{
"name": "CVE-2026-63918",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63918"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-64346",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64346"
},
{
"name": "CVE-2026-53351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53351"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-53024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53024"
},
{
"name": "CVE-2026-31521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31521"
},
{
"name": "CVE-2026-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53307"
},
{
"name": "CVE-2026-64522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64522"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2026-53087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53087"
},
{
"name": "CVE-2026-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53344"
},
{
"name": "CVE-2026-43357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43357"
},
{
"name": "CVE-2026-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53263"
},
{
"name": "CVE-2026-64160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64160"
},
{
"name": "CVE-2026-63891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63891"
},
{
"name": "CVE-2026-46111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46111"
},
{
"name": "CVE-2026-31634",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31634"
},
{
"name": "CVE-2026-43061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43061"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2026-63945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63945"
},
{
"name": "CVE-2026-52932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52932"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-63822",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63822"
},
{
"name": "CVE-2026-72329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72329"
},
{
"name": "CVE-2026-46240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46240"
},
{
"name": "CVE-2026-74310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74310"
},
{
"name": "CVE-2026-72041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72041"
},
{
"name": "CVE-2026-64187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64187"
},
{
"name": "CVE-2026-64342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64342"
},
{
"name": "CVE-2026-46104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46104"
},
{
"name": "CVE-2026-64392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64392"
},
{
"name": "CVE-2026-64360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64360"
},
{
"name": "CVE-2026-53012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53012"
},
{
"name": "CVE-2026-46179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46179"
},
{
"name": "CVE-2026-43453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43453"
},
{
"name": "CVE-2026-64096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64096"
},
{
"name": "CVE-2026-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53118"
},
{
"name": "CVE-2026-43032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43032"
},
{
"name": "CVE-2026-43484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43484"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-63985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63985"
},
{
"name": "CVE-2026-63848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63848"
},
{
"name": "CVE-2026-64478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64478"
},
{
"name": "CVE-2026-64140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64140"
},
{
"name": "CVE-2026-23362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23362"
},
{
"name": "CVE-2026-23379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23379"
},
{
"name": "CVE-2026-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53152"
},
{
"name": "CVE-2026-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53356"
},
{
"name": "CVE-2026-43076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43076"
},
{
"name": "CVE-2026-63799",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63799"
},
{
"name": "CVE-2026-64472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64472"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-63968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63968"
},
{
"name": "CVE-2026-64035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64035"
},
{
"name": "CVE-2026-43427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43427"
},
{
"name": "CVE-2026-43498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43498"
},
{
"name": "CVE-2026-46291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46291"
},
{
"name": "CVE-2022-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50116"
},
{
"name": "CVE-2026-31421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31421"
},
{
"name": "CVE-2026-53069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53069"
},
{
"name": "CVE-2026-64335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64335"
},
{
"name": "CVE-2026-46215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46215"
},
{
"name": "CVE-2026-53228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53228"
},
{
"name": "CVE-2026-63906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63906"
},
{
"name": "CVE-2026-72399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72399"
},
{
"name": "CVE-2026-63877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63877"
},
{
"name": "CVE-2026-64301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64301"
},
{
"name": "CVE-2026-64315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64315"
},
{
"name": "CVE-2026-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53073"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2026-46312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46312"
},
{
"name": "CVE-2026-43365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43365"
},
{
"name": "CVE-2022-50552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50552"
},
{
"name": "CVE-2026-64395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64395"
},
{
"name": "CVE-2026-23381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23381"
},
{
"name": "CVE-2026-31518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31518"
},
{
"name": "CVE-2026-64273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64273"
},
{
"name": "CVE-2026-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53259"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-63828",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63828"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-52944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52944"
},
{
"name": "CVE-2025-68256",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68256"
},
{
"name": "CVE-2026-63904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63904"
},
{
"name": "CVE-2026-46145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46145"
},
{
"name": "CVE-2026-53031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53031"
},
{
"name": "CVE-2026-72226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72226"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-63820",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63820"
},
{
"name": "CVE-2026-31660",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31660"
},
{
"name": "CVE-2026-64262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64262"
},
{
"name": "CVE-2026-46156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46156"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-64142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64142"
},
{
"name": "CVE-2026-64211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64211"
},
{
"name": "CVE-2026-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53336"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-64139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64139"
},
{
"name": "CVE-2026-46294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46294"
},
{
"name": "CVE-2026-31728",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31728"
},
{
"name": "CVE-2026-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53125"
},
{
"name": "CVE-2026-53107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53107"
},
{
"name": "CVE-2026-46125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46125"
},
{
"name": "CVE-2026-72348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72348"
},
{
"name": "CVE-2026-46152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46152"
},
{
"name": "CVE-2026-46290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46290"
},
{
"name": "CVE-2026-64509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64509"
},
{
"name": "CVE-2026-52980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52980"
},
{
"name": "CVE-2026-64117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64117"
},
{
"name": "CVE-2026-64079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64079"
},
{
"name": "CVE-2026-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53194"
},
{
"name": "CVE-2026-64084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64084"
},
{
"name": "CVE-2026-64014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64014"
},
{
"name": "CVE-2026-31400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31400"
},
{
"name": "CVE-2026-31512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31512"
},
{
"name": "CVE-2026-64307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64307"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-64001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64001"
},
{
"name": "CVE-2026-64036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64036"
},
{
"name": "CVE-2026-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53242"
},
{
"name": "CVE-2026-53293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53293"
},
{
"name": "CVE-2026-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53248"
},
{
"name": "CVE-2026-46135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46135"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-31726",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31726"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2026-43370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43370"
},
{
"name": "CVE-2026-31773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31773"
},
{
"name": "CVE-2026-53341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53341"
},
{
"name": "CVE-2026-64238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64238"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-52910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52910"
},
{
"name": "CVE-2026-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53206"
},
{
"name": "CVE-2026-64339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64339"
},
{
"name": "CVE-2026-64108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64108"
},
{
"name": "CVE-2026-64529",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64529"
},
{
"name": "CVE-2026-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53388"
},
{
"name": "CVE-2026-63937",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63937"
},
{
"name": "CVE-2023-52682",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52682"
},
{
"name": "CVE-2025-71150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71150"
},
{
"name": "CVE-2026-46167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46167"
},
{
"name": "CVE-2026-63804",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63804"
},
{
"name": "CVE-2026-64305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64305"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-64119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64119"
},
{
"name": "CVE-2026-53212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53212"
},
{
"name": "CVE-2026-43015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43015"
},
{
"name": "CVE-2026-53137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53137"
},
{
"name": "CVE-2026-31509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31509"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2026-43066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43066"
},
{
"name": "CVE-2026-46139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46139"
},
{
"name": "CVE-2026-64175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64175"
},
{
"name": "CVE-2026-72429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72429"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-64400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64400"
},
{
"name": "CVE-2026-72248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72248"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-31679",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31679"
},
{
"name": "CVE-2026-64381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64381"
},
{
"name": "CVE-2026-64066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64066"
},
{
"name": "CVE-2026-46191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46191"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2026-64604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64604"
},
{
"name": "CVE-2026-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53393"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2026-52978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52978"
},
{
"name": "CVE-2026-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53337"
},
{
"name": "CVE-2026-64597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64597"
},
{
"name": "CVE-2026-53310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53310"
},
{
"name": "CVE-2026-64095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64095"
},
{
"name": "CVE-2026-63812",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63812"
},
{
"name": "CVE-2026-63887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63887"
},
{
"name": "CVE-2026-43469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43469"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53199"
},
{
"name": "CVE-2026-43085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43085"
},
{
"name": "CVE-2026-64496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64496"
},
{
"name": "CVE-2026-64062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64062"
},
{
"name": "CVE-2026-64251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64251"
},
{
"name": "CVE-2026-53025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53025"
},
{
"name": "CVE-2026-64113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64113"
},
{
"name": "CVE-2026-64387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64387"
},
{
"name": "CVE-2026-53008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53008"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-46192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46192"
},
{
"name": "CVE-2026-52938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52938"
},
{
"name": "CVE-2026-63972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63972"
},
{
"name": "CVE-2026-64103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64103"
},
{
"name": "CVE-2026-64078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64078"
},
{
"name": "CVE-2026-46105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46105"
},
{
"name": "CVE-2026-46274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46274"
},
{
"name": "CVE-2026-63849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63849"
},
{
"name": "CVE-2026-64408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64408"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2026-43020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43020"
},
{
"name": "CVE-2026-31417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31417"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2026-43041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43041"
},
{
"name": "CVE-2026-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53247"
},
{
"name": "CVE-2026-31761",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31761"
},
{
"name": "CVE-2026-31466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31466"
},
{
"name": "CVE-2026-63900",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63900"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-64136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64136"
},
{
"name": "CVE-2026-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53165"
},
{
"name": "CVE-2026-63953",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63953"
},
{
"name": "CVE-2026-64227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64227"
},
{
"name": "CVE-2026-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53197"
},
{
"name": "CVE-2026-64481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64481"
},
{
"name": "CVE-2026-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53042"
},
{
"name": "CVE-2026-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53258"
},
{
"name": "CVE-2026-64316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64316"
},
{
"name": "CVE-2026-53289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53289"
},
{
"name": "CVE-2026-64208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64208"
},
{
"name": "CVE-2026-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53304"
},
{
"name": "CVE-2026-64174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64174"
},
{
"name": "CVE-2026-64000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64000"
},
{
"name": "CVE-2025-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54518"
},
{
"name": "CVE-2026-43111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43111"
},
{
"name": "CVE-2024-56584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56584"
},
{
"name": "CVE-2026-63967",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63967"
},
{
"name": "CVE-2026-63897",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63897"
},
{
"name": "CVE-2026-52936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52936"
},
{
"name": "CVE-2026-64417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64417"
},
{
"name": "CVE-2026-53376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53376"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2026-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53268"
},
{
"name": "CVE-2026-64457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64457"
},
{
"name": "CVE-2026-46313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46313"
},
{
"name": "CVE-2026-63819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63819"
},
{
"name": "CVE-2026-80952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80952"
},
{
"name": "CVE-2026-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53241"
},
{
"name": "CVE-2026-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53223"
},
{
"name": "CVE-2026-64423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64423"
},
{
"name": "CVE-2026-31414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31414"
},
{
"name": "CVE-2026-53005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53005"
},
{
"name": "CVE-2026-46309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46309"
},
{
"name": "CVE-2026-64034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64034"
},
{
"name": "CVE-2026-64443",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64443"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-53159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53159"
},
{
"name": "CVE-2026-64588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64588"
},
{
"name": "CVE-2026-45958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45958"
},
{
"name": "CVE-2026-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53298"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-64229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64229"
},
{
"name": "CVE-2026-31778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31778"
},
{
"name": "CVE-2026-53372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53372"
},
{
"name": "CVE-2026-64093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64093"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2026-53039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53039"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-63868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63868"
},
{
"name": "CVE-2026-53290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53290"
},
{
"name": "CVE-2026-64269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64269"
},
{
"name": "CVE-2026-53080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53080"
},
{
"name": "CVE-2026-43490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43490"
},
{
"name": "CVE-2026-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53316"
},
{
"name": "CVE-2026-53267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53267"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-53004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53004"
},
{
"name": "CVE-2022-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49961"
},
{
"name": "CVE-2026-43040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43040"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-72296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72296"
},
{
"name": "CVE-2026-52912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52912"
},
{
"name": "CVE-2026-63955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63955"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-46129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46129"
},
{
"name": "CVE-2026-31552",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31552"
},
{
"name": "CVE-2026-64101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64101"
},
{
"name": "CVE-2026-64482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64482"
},
{
"name": "CVE-2026-64218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64218"
},
{
"name": "CVE-2026-52976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52976"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-46292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46292"
},
{
"name": "CVE-2026-64495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64495"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53221"
},
{
"name": "CVE-2026-43428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43428"
},
{
"name": "CVE-2026-52998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52998"
},
{
"name": "CVE-2026-63811",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63811"
},
{
"name": "CVE-2026-53011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53011"
},
{
"name": "CVE-2026-63991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63991"
},
{
"name": "CVE-2026-64282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64282"
},
{
"name": "CVE-2026-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53275"
},
{
"name": "CVE-2026-63982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63982"
},
{
"name": "CVE-2026-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52920"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-64366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64366"
},
{
"name": "CVE-2026-53001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53001"
},
{
"name": "CVE-2026-23397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23397"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-23452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23452"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-64594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64594"
},
{
"name": "CVE-2026-64278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64278"
},
{
"name": "CVE-2026-63960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63960"
},
{
"name": "CVE-2026-23474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23474"
},
{
"name": "CVE-2026-64396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64396"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2026-53203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53203"
},
{
"name": "CVE-2026-52911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52911"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-43065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43065"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53295"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-53269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53269"
},
{
"name": "CVE-2026-64235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64235"
},
{
"name": "CVE-2026-64479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64479"
},
{
"name": "CVE-2026-63963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63963"
},
{
"name": "CVE-2026-23336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23336"
},
{
"name": "CVE-2026-63890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63890"
},
{
"name": "CVE-2026-64324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64324"
},
{
"name": "CVE-2026-64329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64329"
},
{
"name": "CVE-2026-45843",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45843"
},
{
"name": "CVE-2026-64434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64434"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-64373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64373"
},
{
"name": "CVE-2026-63997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63997"
},
{
"name": "CVE-2026-46148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46148"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-46136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46136"
},
{
"name": "CVE-2026-64219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64219"
},
{
"name": "CVE-2026-64277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64277"
},
{
"name": "CVE-2026-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53357"
},
{
"name": "CVE-2026-46324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46324"
},
{
"name": "CVE-2026-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53052"
},
{
"name": "CVE-2026-31497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31497"
},
{
"name": "CVE-2026-43451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43451"
},
{
"name": "CVE-2026-53318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53318"
},
{
"name": "CVE-2026-64070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64070"
},
{
"name": "CVE-2026-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46316"
},
{
"name": "CVE-2026-64126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64126"
},
{
"name": "CVE-2026-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53280"
},
{
"name": "CVE-2026-53136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53136"
},
{
"name": "CVE-2026-64503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64503"
},
{
"name": "CVE-2026-63977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63977"
},
{
"name": "CVE-2026-31570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31570"
},
{
"name": "CVE-2026-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53215"
},
{
"name": "CVE-2026-23289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23289"
},
{
"name": "CVE-2026-31755",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31755"
},
{
"name": "CVE-2026-64168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64168"
},
{
"name": "CVE-2026-53108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53108"
},
{
"name": "CVE-2026-46230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46230"
},
{
"name": "CVE-2026-72381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72381"
},
{
"name": "CVE-2026-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23141"
},
{
"name": "CVE-2026-64161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64161"
},
{
"name": "CVE-2026-63881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63881"
},
{
"name": "CVE-2026-52964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52964"
},
{
"name": "CVE-2026-46138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46138"
},
{
"name": "CVE-2026-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53216"
},
{
"name": "CVE-2025-21739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21739"
},
{
"name": "CVE-2026-23277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23277"
},
{
"name": "CVE-2026-74350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74350"
},
{
"name": "CVE-2026-31399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31399"
},
{
"name": "CVE-2026-72496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72496"
},
{
"name": "CVE-2026-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53153"
},
{
"name": "CVE-2026-63969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63969"
},
{
"name": "CVE-2026-64291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64291"
},
{
"name": "CVE-2026-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53226"
},
{
"name": "CVE-2026-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53089"
},
{
"name": "CVE-2026-63809",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63809"
},
{
"name": "CVE-2026-53253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53253"
},
{
"name": "CVE-2026-31489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31489"
},
{
"name": "CVE-2026-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53250"
},
{
"name": "CVE-2026-64453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64453"
},
{
"name": "CVE-2026-53003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53003"
},
{
"name": "CVE-2026-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53394"
},
{
"name": "CVE-2026-46225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46225"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-64436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64436"
},
{
"name": "CVE-2026-64403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64403"
},
{
"name": "CVE-2026-52948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52948"
},
{
"name": "CVE-2026-64222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64222"
},
{
"name": "CVE-2026-64121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64121"
},
{
"name": "CVE-2026-63939",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63939"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-63962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63962"
},
{
"name": "CVE-2026-63836",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63836"
},
{
"name": "CVE-2026-63814",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63814"
},
{
"name": "CVE-2026-64053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64053"
},
{
"name": "CVE-2026-63936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63936"
},
{
"name": "CVE-2026-43343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43343"
},
{
"name": "CVE-2026-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53252"
},
{
"name": "CVE-2026-64216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64216"
},
{
"name": "CVE-2026-63927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63927"
},
{
"name": "CVE-2026-64412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64412"
},
{
"name": "CVE-2026-64284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64284"
},
{
"name": "CVE-2026-53355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53355"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-46314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46314"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-64188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64188"
},
{
"name": "CVE-2026-46149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46149"
},
{
"name": "CVE-2026-64491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64491"
},
{
"name": "CVE-2026-74287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74287"
},
{
"name": "CVE-2026-53017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53017"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2026-64144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64144"
},
{
"name": "CVE-2026-64487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64487"
},
{
"name": "CVE-2026-64391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64391"
},
{
"name": "CVE-2026-64303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64303"
},
{
"name": "CVE-2026-46208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46208"
},
{
"name": "CVE-2026-63971",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63971"
},
{
"name": "CVE-2026-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53174"
},
{
"name": "CVE-2026-64086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64086"
},
{
"name": "CVE-2026-64429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64429"
},
{
"name": "CVE-2026-64344",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64344"
},
{
"name": "CVE-2026-53134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53134"
},
{
"name": "CVE-2026-63831",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63831"
},
{
"name": "CVE-2026-63983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63983"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-46205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46205"
},
{
"name": "CVE-2026-64286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64286"
},
{
"name": "CVE-2026-72412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72412"
},
{
"name": "CVE-2026-64292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64292"
},
{
"name": "CVE-2026-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53359"
},
{
"name": "CVE-2026-64029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64029"
},
{
"name": "CVE-2026-53016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53016"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46218"
},
{
"name": "CVE-2026-63834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63834"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-23335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23335"
},
{
"name": "CVE-2026-52986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52986"
},
{
"name": "CVE-2026-31551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31551"
},
{
"name": "CVE-2026-63919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63919"
},
{
"name": "CVE-2026-53077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53077"
},
{
"name": "CVE-2026-31495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31495"
},
{
"name": "CVE-2026-64350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64350"
},
{
"name": "CVE-2026-64321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64321"
},
{
"name": "CVE-2026-46132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46132"
},
{
"name": "CVE-2026-72473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72473"
},
{
"name": "CVE-2026-64111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64111"
},
{
"name": "CVE-2026-64447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64447"
},
{
"name": "CVE-2026-46160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46160"
},
{
"name": "CVE-2026-46177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46177"
},
{
"name": "CVE-2026-46131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46131"
},
{
"name": "CVE-2026-43110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43110"
},
{
"name": "CVE-2026-64149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64149"
},
{
"name": "CVE-2026-53256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53256"
},
{
"name": "CVE-2026-64075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64075"
},
{
"name": "CVE-2026-31507",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31507"
},
{
"name": "CVE-2026-72014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72014"
},
{
"name": "CVE-2026-64411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64411"
},
{
"name": "CVE-2026-63876",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63876"
},
{
"name": "CVE-2026-53306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53306"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53235"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-53129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53129"
},
{
"name": "CVE-2026-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53396"
},
{
"name": "CVE-2026-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53277"
},
{
"name": "CVE-2026-64587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64587"
},
{
"name": "CVE-2026-63998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63998"
},
{
"name": "CVE-2026-31762",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31762"
},
{
"name": "CVE-2026-64137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64137"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-31788",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31788"
},
{
"name": "CVE-2026-63959",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63959"
},
{
"name": "CVE-2026-53115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53115"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-31428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31428"
},
{
"name": "CVE-2026-64043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64043"
},
{
"name": "CVE-2026-53308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53308"
},
{
"name": "CVE-2026-23420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23420"
},
{
"name": "CVE-2026-23388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23388"
},
{
"name": "CVE-2026-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53045"
},
{
"name": "CVE-2026-72098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72098"
},
{
"name": "CVE-2026-72249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72249"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2026-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43098"
},
{
"name": "CVE-2026-63862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63862"
},
{
"name": "CVE-2026-63954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63954"
},
{
"name": "CVE-2026-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53282"
},
{
"name": "CVE-2026-63840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63840"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-46306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46306"
},
{
"name": "CVE-2026-64242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64242"
},
{
"name": "CVE-2026-43386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43386"
},
{
"name": "CVE-2026-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53085"
},
{
"name": "CVE-2026-64334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64334"
},
{
"name": "CVE-2026-64049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64049"
},
{
"name": "CVE-2026-46210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46210"
},
{
"name": "CVE-2026-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53384"
},
{
"name": "CVE-2026-53155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53155"
},
{
"name": "CVE-2026-72442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72442"
},
{
"name": "CVE-2026-64183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64183"
},
{
"name": "CVE-2026-64448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64448"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2026-64120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64120"
},
{
"name": "CVE-2026-43089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43089"
},
{
"name": "CVE-2026-72493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72493"
},
{
"name": "CVE-2026-53033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53033"
},
{
"name": "CVE-2026-72221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72221"
},
{
"name": "CVE-2026-72289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72289"
},
{
"name": "CVE-2026-72251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72251"
},
{
"name": "CVE-2026-46162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46162"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53319"
},
{
"name": "CVE-2026-64347",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64347"
},
{
"name": "CVE-2026-63826",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63826"
},
{
"name": "CVE-2026-31676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31676"
},
{
"name": "CVE-2026-52959",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52959"
},
{
"name": "CVE-2026-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53120"
},
{
"name": "CVE-2026-64393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64393"
},
{
"name": "CVE-2026-64134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64134"
},
{
"name": "CVE-2026-53026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53026"
},
{
"name": "CVE-2026-43112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43112"
},
{
"name": "CVE-2026-64005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64005"
},
{
"name": "CVE-2026-23442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23442"
},
{
"name": "CVE-2026-64466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64466"
},
{
"name": "CVE-2026-31476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31476"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-64419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64419"
},
{
"name": "CVE-2026-46107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46107"
},
{
"name": "CVE-2026-64524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64524"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-46273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46273"
},
{
"name": "CVE-2026-23458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23458"
},
{
"name": "CVE-2026-53145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53145"
},
{
"name": "CVE-2026-63981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63981"
},
{
"name": "CVE-2026-43502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43502"
},
{
"name": "CVE-2026-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53270"
},
{
"name": "CVE-2026-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53379"
},
{
"name": "CVE-2026-31674",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31674"
},
{
"name": "CVE-2026-31393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31393"
},
{
"name": "CVE-2026-43420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43420"
},
{
"name": "CVE-2026-53198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53198"
},
{
"name": "CVE-2026-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53056"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2026-64382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64382"
},
{
"name": "CVE-2026-64589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64589"
},
{
"name": "CVE-2026-63946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63946"
},
{
"name": "CVE-2026-63903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63903"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-53240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53240"
},
{
"name": "CVE-2026-64372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64372"
},
{
"name": "CVE-2026-64490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64490"
},
{
"name": "CVE-2026-43027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43027"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-52909",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52909"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-64236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64236"
},
{
"name": "CVE-2026-63922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63922"
},
{
"name": "CVE-2026-64283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64283"
},
{
"name": "CVE-2026-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53395"
},
{
"name": "CVE-2026-63949",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63949"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2025-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68206"
},
{
"name": "CVE-2026-46163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46163"
},
{
"name": "CVE-2026-64444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64444"
},
{
"name": "CVE-2026-46202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46202"
},
{
"name": "CVE-2022-49803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49803"
},
{
"name": "CVE-2026-64233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64233"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-46164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46164"
},
{
"name": "CVE-2026-46235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46235"
},
{
"name": "CVE-2026-64225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64225"
},
{
"name": "CVE-2026-64331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64331"
},
{
"name": "CVE-2026-64511",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64511"
},
{
"name": "CVE-2026-63907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63907"
},
{
"name": "CVE-2026-64032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64032"
},
{
"name": "CVE-2026-45838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45838"
},
{
"name": "CVE-2026-64361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64361"
},
{
"name": "CVE-2026-64209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64209"
},
{
"name": "CVE-2026-31506",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31506"
},
{
"name": "CVE-2026-64182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64182"
},
{
"name": "CVE-2026-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53264"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-23339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23339"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-63999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63999"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-53023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53023"
},
{
"name": "CVE-2026-31433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31433"
},
{
"name": "CVE-2026-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53142"
},
{
"name": "CVE-2026-53098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53098"
},
{
"name": "CVE-2026-43497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43497"
},
{
"name": "CVE-2026-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53063"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-64369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64369"
},
{
"name": "CVE-2026-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53175"
},
{
"name": "CVE-2026-64024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64024"
},
{
"name": "CVE-2026-64215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64215"
},
{
"name": "CVE-2026-45924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45924"
},
{
"name": "CVE-2026-63944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63944"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53273"
},
{
"name": "CVE-2026-64054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64054"
},
{
"name": "CVE-2026-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53184"
},
{
"name": "CVE-2026-64019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64019"
},
{
"name": "CVE-2026-31560",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31560"
},
{
"name": "CVE-2026-64056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64056"
},
{
"name": "CVE-2026-52962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52962"
},
{
"name": "CVE-2026-63860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63860"
},
{
"name": "CVE-2026-64265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64265"
},
{
"name": "CVE-2026-52953",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52953"
},
{
"name": "CVE-2026-64494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64494"
},
{
"name": "CVE-2026-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53093"
},
{
"name": "CVE-2026-63899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63899"
},
{
"name": "CVE-2026-74268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74268"
},
{
"name": "CVE-2026-46200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46200"
},
{
"name": "CVE-2026-72451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72451"
},
{
"name": "CVE-2026-53144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53144"
},
{
"name": "CVE-2026-64033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64033"
},
{
"name": "CVE-2026-63893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63893"
},
{
"name": "CVE-2026-64124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64124"
},
{
"name": "CVE-2026-23460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23460"
},
{
"name": "CVE-2026-46222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46222"
},
{
"name": "CVE-2026-46187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46187"
},
{
"name": "CVE-2026-43281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43281"
},
{
"name": "CVE-2026-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53385"
},
{
"name": "CVE-2026-64030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64030"
},
{
"name": "CVE-2025-71161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71161"
},
{
"name": "CVE-2026-46168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46168"
},
{
"name": "CVE-2026-53075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53075"
},
{
"name": "CVE-2026-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53246"
},
{
"name": "CVE-2026-64245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64245"
},
{
"name": "CVE-2026-72279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72279"
},
{
"name": "CVE-2026-31540",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31540"
},
{
"name": "CVE-2026-64072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64072"
},
{
"name": "CVE-2026-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53326"
},
{
"name": "CVE-2026-64240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64240"
},
{
"name": "CVE-2026-63823",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63823"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-46175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46175"
},
{
"name": "CVE-2026-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53325"
},
{
"name": "CVE-2026-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53323"
},
{
"name": "CVE-2026-72501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72501"
},
{
"name": "CVE-2026-64354",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64354"
},
{
"name": "CVE-2026-53030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53030"
},
{
"name": "CVE-2026-23395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23395"
},
{
"name": "CVE-2026-64206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64206"
},
{
"name": "CVE-2026-45837",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45837"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-31651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31651"
},
{
"name": "CVE-2026-64530",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64530"
},
{
"name": "CVE-2026-64015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64015"
},
{
"name": "CVE-2026-64110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64110"
},
{
"name": "CVE-2026-46299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46299"
},
{
"name": "CVE-2026-64294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64294"
},
{
"name": "CVE-2026-63851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63851"
},
{
"name": "CVE-2026-63934",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63934"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2026-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53303"
},
{
"name": "CVE-2026-46239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46239"
},
{
"name": "CVE-2026-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53299"
},
{
"name": "CVE-2026-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53055"
},
{
"name": "CVE-2026-64288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64288"
},
{
"name": "CVE-2025-21863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21863"
},
{
"name": "CVE-2026-64285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64285"
},
{
"name": "CVE-2026-64123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64123"
},
{
"name": "CVE-2026-53019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53019"
},
{
"name": "CVE-2026-46201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46201"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-31747",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31747"
},
{
"name": "CVE-2026-31455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31455"
},
{
"name": "CVE-2026-64156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64156"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-53363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53363"
},
{
"name": "CVE-2026-74436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74436"
},
{
"name": "CVE-2026-52991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52991"
},
{
"name": "CVE-2026-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53322"
},
{
"name": "CVE-2026-64122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64122"
},
{
"name": "CVE-2026-63808",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63808"
},
{
"name": "CVE-2026-53191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53191"
},
{
"name": "CVE-2026-72217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72217"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-64493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64493"
},
{
"name": "CVE-2026-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53100"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-46221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46221"
},
{
"name": "CVE-2026-52940",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52940"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2026-43340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43340"
},
{
"name": "CVE-2026-53358",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53358"
},
{
"name": "CVE-2026-63905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63905"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-64535",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64535"
},
{
"name": "CVE-2026-63973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63973"
},
{
"name": "CVE-2026-63857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63857"
},
{
"name": "CVE-2026-46144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46144"
},
{
"name": "CVE-2026-63837",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63837"
},
{
"name": "CVE-2026-63895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63895"
},
{
"name": "CVE-2026-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53352"
},
{
"name": "CVE-2026-64234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64234"
},
{
"name": "CVE-2026-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53151"
},
{
"name": "CVE-2026-64416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64416"
},
{
"name": "CVE-2026-72234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72234"
},
{
"name": "CVE-2026-64157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64157"
},
{
"name": "CVE-2026-23031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23031"
},
{
"name": "CVE-2026-64247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64247"
},
{
"name": "CVE-2026-64379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64379"
},
{
"name": "CVE-2026-53254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53254"
},
{
"name": "CVE-2026-53078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53078"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2026-52928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52928"
},
{
"name": "CVE-2026-64420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64420"
},
{
"name": "CVE-2026-64138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64138"
},
{
"name": "CVE-2026-64153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64153"
},
{
"name": "CVE-2026-23291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23291"
},
{
"name": "CVE-2026-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53180"
},
{
"name": "CVE-2026-53037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53037"
},
{
"name": "CVE-2026-63986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63986"
},
{
"name": "CVE-2026-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53238"
},
{
"name": "CVE-2026-64205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64205"
},
{
"name": "CVE-2026-46305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46305"
},
{
"name": "CVE-2026-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53072"
},
{
"name": "CVE-2026-53284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53284"
},
{
"name": "CVE-2026-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52921"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53281"
},
{
"name": "CVE-2026-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53068"
},
{
"name": "CVE-2026-64012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64012"
},
{
"name": "CVE-2026-52967",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52967"
},
{
"name": "CVE-2026-46304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46304"
},
{
"name": "CVE-2026-64118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64118"
},
{
"name": "CVE-2026-46166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46166"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-64058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64058"
},
{
"name": "CVE-2026-64325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64325"
},
{
"name": "CVE-2026-74427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74427"
},
{
"name": "CVE-2026-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53213"
},
{
"name": "CVE-2026-64525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64525"
},
{
"name": "CVE-2025-68239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68239"
},
{
"name": "CVE-2026-64596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64596"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-53387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53387"
},
{
"name": "CVE-2026-23382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23382"
},
{
"name": "CVE-2026-64384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64384"
},
{
"name": "CVE-2026-64037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64037"
},
{
"name": "CVE-2026-68084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68084"
},
{
"name": "CVE-2026-64406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64406"
},
{
"name": "CVE-2026-63912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63912"
},
{
"name": "CVE-2026-64425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64425"
},
{
"name": "CVE-2026-64600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64600"
},
{
"name": "CVE-2026-43473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43473"
},
{
"name": "CVE-2026-52983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52983"
},
{
"name": "CVE-2026-46216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46216"
},
{
"name": "CVE-2026-74406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74406"
},
{
"name": "CVE-2026-52930",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52930"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-63942",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63942"
},
{
"name": "CVE-2026-64064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64064"
},
{
"name": "CVE-2026-64116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64116"
},
{
"name": "CVE-2026-64312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64312"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2026-31446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31446"
},
{
"name": "CVE-2026-46275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46275"
},
{
"name": "CVE-2026-68460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68460"
},
{
"name": "CVE-2026-23113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23113"
},
{
"name": "CVE-2026-63889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63889"
},
{
"name": "CVE-2026-46126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46126"
},
{
"name": "CVE-2026-46193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46193"
},
{
"name": "CVE-2026-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53265"
},
{
"name": "CVE-2026-64526",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64526"
},
{
"name": "CVE-2026-64428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64428"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-64505",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64505"
},
{
"name": "CVE-2026-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53057"
},
{
"name": "CVE-2026-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23157"
},
{
"name": "CVE-2026-64426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64426"
},
{
"name": "CVE-2026-52974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52974"
},
{
"name": "CVE-2026-64507",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64507"
},
{
"name": "CVE-2026-53127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53127"
},
{
"name": "CVE-2026-31464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31464"
},
{
"name": "CVE-2026-63941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63941"
},
{
"name": "CVE-2026-53366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53366"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-46143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46143"
},
{
"name": "CVE-2026-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52923"
},
{
"name": "CVE-2026-64087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64087"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2026-63958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63958"
},
{
"name": "CVE-2026-46212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46212"
},
{
"name": "CVE-2026-64499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64499"
},
{
"name": "CVE-2026-45834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45834"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-31695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31695"
},
{
"name": "CVE-2026-63856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63856"
},
{
"name": "CVE-2026-31630",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31630"
},
{
"name": "CVE-2026-74584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74584"
},
{
"name": "CVE-2026-43333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43333"
},
{
"name": "CVE-2026-53154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53154"
},
{
"name": "CVE-2026-64358",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64358"
},
{
"name": "CVE-2026-64355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64355"
},
{
"name": "CVE-2026-46199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46199"
},
{
"name": "CVE-2026-64515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64515"
},
{
"name": "CVE-2026-43105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43105"
},
{
"name": "CVE-2026-23312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23312"
},
{
"name": "CVE-2026-64130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64130"
},
{
"name": "CVE-2026-72069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72069"
},
{
"name": "CVE-2026-31508",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31508"
},
{
"name": "CVE-2026-64044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64044"
},
{
"name": "CVE-2026-64290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64290"
},
{
"name": "CVE-2026-64185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64185"
},
{
"name": "CVE-2026-64422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64422"
},
{
"name": "CVE-2026-64519",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64519"
},
{
"name": "CVE-2026-72020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72020"
},
{
"name": "CVE-2026-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53122"
},
{
"name": "CVE-2026-23365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23365"
},
{
"name": "CVE-2025-40323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40323"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53196"
},
{
"name": "CVE-2026-63878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63878"
},
{
"name": "CVE-2026-46310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46310"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-46123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46123"
},
{
"name": "CVE-2026-64340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64340"
},
{
"name": "CVE-2026-64092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64092"
},
{
"name": "CVE-2026-43329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43329"
},
{
"name": "CVE-2026-31424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31424"
},
{
"name": "CVE-2026-53000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53000"
},
{
"name": "CVE-2026-64007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64007"
},
{
"name": "CVE-2026-64450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64450"
},
{
"name": "CVE-2026-23356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23356"
},
{
"name": "CVE-2026-46207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46207"
},
{
"name": "CVE-2026-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53156"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-64484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64484"
},
{
"name": "CVE-2026-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23307"
},
{
"name": "CVE-2026-53300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53300"
},
{
"name": "CVE-2026-64298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64298"
},
{
"name": "CVE-2026-52969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52969"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2026-46157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46157"
},
{
"name": "CVE-2026-64207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64207"
},
{
"name": "CVE-2026-63994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63994"
},
{
"name": "CVE-2026-53062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53062"
},
{
"name": "CVE-2026-52990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52990"
},
{
"name": "CVE-2026-64114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64114"
},
{
"name": "CVE-2026-64390",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64390"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53390"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-74255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74255"
},
{
"name": "CVE-2026-72191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72191"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-64266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64266"
},
{
"name": "CVE-2026-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53380"
},
{
"name": "CVE-2026-53032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53032"
},
{
"name": "CVE-2026-46232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46232"
},
{
"name": "CVE-2026-53211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53211"
},
{
"name": "CVE-2026-43363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43363"
},
{
"name": "CVE-2026-64159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64159"
},
{
"name": "CVE-2026-64088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64088"
},
{
"name": "CVE-2026-46165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46165"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2026-64073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64073"
},
{
"name": "CVE-2026-31454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31454"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2026-64441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64441"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-31452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31452"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2026-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53369"
},
{
"name": "CVE-2026-31407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31407"
},
{
"name": "CVE-2026-53162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53162"
},
{
"name": "CVE-2026-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53343"
},
{
"name": "CVE-2026-23398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23398"
},
{
"name": "CVE-2026-74269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74269"
},
{
"name": "CVE-2026-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53082"
},
{
"name": "CVE-2026-52926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52926"
},
{
"name": "CVE-2026-63908",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63908"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-64145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64145"
},
{
"name": "CVE-2026-63829",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63829"
},
{
"name": "CVE-2026-72192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72192"
},
{
"name": "CVE-2026-31425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31425"
},
{
"name": "CVE-2026-64002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64002"
},
{
"name": "CVE-2026-63894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63894"
},
{
"name": "CVE-2026-46238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46238"
},
{
"name": "CVE-2026-72288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72288"
},
{
"name": "CVE-2026-64081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64081"
},
{
"name": "CVE-2026-64135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64135"
},
{
"name": "CVE-2026-63844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63844"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-64440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64440"
},
{
"name": "CVE-2026-64063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64063"
},
{
"name": "CVE-2026-52977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52977"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-63803",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63803"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-46155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46155"
},
{
"name": "CVE-2026-52917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52917"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-64601",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64601"
},
{
"name": "CVE-2026-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53074"
},
{
"name": "CVE-2026-63961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63961"
},
{
"name": "CVE-2026-64154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64154"
},
{
"name": "CVE-2026-46322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46322"
},
{
"name": "CVE-2026-53036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53036"
},
{
"name": "CVE-2026-45839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45839"
},
{
"name": "CVE-2026-72477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72477"
},
{
"name": "CVE-2026-72046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72046"
},
{
"name": "CVE-2026-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53261"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-64065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64065"
},
{
"name": "CVE-2026-72085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72085"
},
{
"name": "CVE-2026-52982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52982"
},
{
"name": "CVE-2026-74428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74428"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-63902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63902"
},
{
"name": "CVE-2026-64011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64011"
},
{
"name": "CVE-2026-64359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64359"
},
{
"name": "CVE-2026-63846",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63846"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-64317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64317"
},
{
"name": "CVE-2026-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53328"
},
{
"name": "CVE-2026-64009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64009"
},
{
"name": "CVE-2026-43050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43050"
},
{
"name": "CVE-2026-53022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53022"
},
{
"name": "CVE-2026-63883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63883"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
},
{
"name": "CVE-2026-63802",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63802"
},
{
"name": "CVE-2026-31673",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31673"
},
{
"name": "CVE-2026-63869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63869"
},
{
"name": "CVE-2026-31667",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31667"
},
{
"name": "CVE-2026-53083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53083"
}
],
"initial_release_date": "2026-09-25T00:00:00",
"last_revision_date": "2026-09-25T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-1229",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-09-25T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8800-1",
"url": "https://ubuntu.com/security/notices/USN-8800-1"
},
{
"published_at": "2026-09-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8668-2",
"url": "https://ubuntu.com/security/notices/USN-8668-2"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8801-1",
"url": "https://ubuntu.com/security/notices/USN-8801-1"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8760-2",
"url": "https://ubuntu.com/security/notices/USN-8760-2"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8728-2",
"url": "https://ubuntu.com/security/notices/USN-8728-2"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8802-1",
"url": "https://ubuntu.com/security/notices/USN-8802-1"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8729-4",
"url": "https://ubuntu.com/security/notices/USN-8729-4"
},
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8816-1",
"url": "https://ubuntu.com/security/notices/USN-8816-1"
},
{
"published_at": "2026-09-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8729-3",
"url": "https://ubuntu.com/security/notices/USN-8729-3"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8793-2",
"url": "https://ubuntu.com/security/notices/USN-8793-2"
},
{
"published_at": "2026-09-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8761-3",
"url": "https://ubuntu.com/security/notices/USN-8761-3"
},
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8818-1",
"url": "https://ubuntu.com/security/notices/USN-8818-1"
},
{
"published_at": "2026-09-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8726-3",
"url": "https://ubuntu.com/security/notices/USN-8726-3"
},
{
"published_at": "2026-09-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8730-4",
"url": "https://ubuntu.com/security/notices/USN-8730-4"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8730-5",
"url": "https://ubuntu.com/security/notices/USN-8730-5"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8661-5",
"url": "https://ubuntu.com/security/notices/USN-8661-5"
},
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8817-1",
"url": "https://ubuntu.com/security/notices/USN-8817-1"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8726-4",
"url": "https://ubuntu.com/security/notices/USN-8726-4"
},
{
"published_at": "2026-09-21",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8793-1",
"url": "https://ubuntu.com/security/notices/USN-8793-1"
}
]
}
CERTFR-2026-AVI-1231
Vulnerability from certfr_avis - Published: 2026-09-25 - Updated: 2026-09-25
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Linux Micro 6.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 LTSS | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP applications 16.0 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Micro 6.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 16.0 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP applications 16.0",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 16.0",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-31483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31483"
},
{
"name": "CVE-2026-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53091"
},
{
"name": "CVE-2026-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53381"
},
{
"name": "CVE-2026-74394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74394"
},
{
"name": "CVE-2026-68450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68450"
},
{
"name": "CVE-2026-68480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68480"
},
{
"name": "CVE-2026-74297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74297"
},
{
"name": "CVE-2026-80716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80716"
},
{
"name": "CVE-2026-64561",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64561"
},
{
"name": "CVE-2026-64047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64047"
},
{
"name": "CVE-2026-68138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68138"
},
{
"name": "CVE-2026-52925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52925"
},
{
"name": "CVE-2026-74669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74669"
},
{
"name": "CVE-2026-68141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68141"
},
{
"name": "CVE-2026-52929",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52929"
},
{
"name": "CVE-2026-74482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74482"
},
{
"name": "CVE-2026-64322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64322"
},
{
"name": "CVE-2026-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53061"
},
{
"name": "CVE-2026-64470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64470"
},
{
"name": "CVE-2026-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53374"
},
{
"name": "CVE-2026-64513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64513"
},
{
"name": "CVE-2026-64512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64512"
},
{
"name": "CVE-2026-68129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68129"
},
{
"name": "CVE-2026-64380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64380"
},
{
"name": "CVE-2026-64268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64268"
},
{
"name": "CVE-2026-68428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68428"
},
{
"name": "CVE-2026-74378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74378"
},
{
"name": "CVE-2026-74417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74417"
},
{
"name": "CVE-2026-74581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74581"
},
{
"name": "CVE-2026-68313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68313"
},
{
"name": "CVE-2026-74537",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74537"
},
{
"name": "CVE-2026-68417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68417"
},
{
"name": "CVE-2026-68338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68338"
},
{
"name": "CVE-2026-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53260"
},
{
"name": "CVE-2026-68277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68277"
},
{
"name": "CVE-2026-74557",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74557"
},
{
"name": "CVE-2026-68410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68410"
},
{
"name": "CVE-2026-74345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74345"
},
{
"name": "CVE-2026-80909",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80909"
},
{
"name": "CVE-2026-72083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72083"
},
{
"name": "CVE-2026-64333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64333"
},
{
"name": "CVE-2026-68155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68155"
},
{
"name": "CVE-2026-63928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63928"
},
{
"name": "CVE-2026-80765",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80765"
},
{
"name": "CVE-2026-74488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74488"
},
{
"name": "CVE-2026-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53220"
},
{
"name": "CVE-2026-72297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72297"
},
{
"name": "CVE-2026-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53360"
},
{
"name": "CVE-2026-68425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68425"
},
{
"name": "CVE-2026-63888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63888"
},
{
"name": "CVE-2026-80534",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80534"
},
{
"name": "CVE-2026-72466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72466"
},
{
"name": "CVE-2026-64178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64178"
},
{
"name": "CVE-2026-53163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53163"
},
{
"name": "CVE-2026-72450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72450"
},
{
"name": "CVE-2026-80609",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80609"
},
{
"name": "CVE-2026-72339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72339"
},
{
"name": "CVE-2026-68320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68320"
},
{
"name": "CVE-2026-31502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31502"
},
{
"name": "CVE-2026-63810",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63810"
},
{
"name": "CVE-2026-64098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64098"
},
{
"name": "CVE-2026-63801",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63801"
},
{
"name": "CVE-2026-63827",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63827"
},
{
"name": "CVE-2026-64304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64304"
},
{
"name": "CVE-2026-23443",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23443"
},
{
"name": "CVE-2026-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53309"
},
{
"name": "CVE-2026-64190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64190"
},
{
"name": "CVE-2026-64323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64323"
},
{
"name": "CVE-2026-52939",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52939"
},
{
"name": "CVE-2026-72135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72135"
},
{
"name": "CVE-2026-80714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80714"
},
{
"name": "CVE-2026-68093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68093"
},
{
"name": "CVE-2026-72262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72262"
},
{
"name": "CVE-2026-63990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63990"
},
{
"name": "CVE-2026-80574",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80574"
},
{
"name": "CVE-2026-74388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74388"
},
{
"name": "CVE-2026-74271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74271"
},
{
"name": "CVE-2026-64563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64563"
},
{
"name": "CVE-2026-68405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68405"
},
{
"name": "CVE-2026-68328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68328"
},
{
"name": "CVE-2026-72164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72164"
},
{
"name": "CVE-2026-72017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72017"
},
{
"name": "CVE-2026-74390",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74390"
},
{
"name": "CVE-2026-68363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68363"
},
{
"name": "CVE-2026-68278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68278"
},
{
"name": "CVE-2026-74454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74454"
},
{
"name": "CVE-2026-64341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64341"
},
{
"name": "CVE-2026-72086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72086"
},
{
"name": "CVE-2026-80580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80580"
},
{
"name": "CVE-2026-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53149"
},
{
"name": "CVE-2026-63892",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63892"
},
{
"name": "CVE-2026-64010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64010"
},
{
"name": "CVE-2025-40277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40277"
},
{
"name": "CVE-2026-68160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68160"
},
{
"name": "CVE-2026-72421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72421"
},
{
"name": "CVE-2026-64553",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64553"
},
{
"name": "CVE-2026-80819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80819"
},
{
"name": "CVE-2026-68426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68426"
},
{
"name": "CVE-2026-68329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68329"
},
{
"name": "CVE-2026-64593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64593"
},
{
"name": "CVE-2026-72108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72108"
},
{
"name": "CVE-2026-80722",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80722"
},
{
"name": "CVE-2026-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53219"
},
{
"name": "CVE-2026-64109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64109"
},
{
"name": "CVE-2026-74278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74278"
},
{
"name": "CVE-2026-72284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72284"
},
{
"name": "CVE-2026-63898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63898"
},
{
"name": "CVE-2026-74341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74341"
},
{
"name": "CVE-2026-46128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46128"
},
{
"name": "CVE-2026-63992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63992"
},
{
"name": "CVE-2026-72084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72084"
},
{
"name": "CVE-2026-68197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68197"
},
{
"name": "CVE-2026-64343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64343"
},
{
"name": "CVE-2026-68315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68315"
},
{
"name": "CVE-2026-64471",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64471"
},
{
"name": "CVE-2026-68357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68357"
},
{
"name": "CVE-2024-57841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57841"
},
{
"name": "CVE-2026-72487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72487"
},
{
"name": "CVE-2026-64551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64551"
},
{
"name": "CVE-2026-53403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53403"
},
{
"name": "CVE-2026-64048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64048"
},
{
"name": "CVE-2026-74479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74479"
},
{
"name": "CVE-2026-64306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64306"
},
{
"name": "CVE-2026-64313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64313"
},
{
"name": "CVE-2026-72142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72142"
},
{
"name": "CVE-2026-68159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68159"
},
{
"name": "CVE-2026-74302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74302"
},
{
"name": "CVE-2026-64541",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64541"
},
{
"name": "CVE-2026-64332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64332"
},
{
"name": "CVE-2026-63920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63920"
},
{
"name": "CVE-2026-46108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46108"
},
{
"name": "CVE-2026-68202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68202"
},
{
"name": "CVE-2026-72389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72389"
},
{
"name": "CVE-2026-72323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72323"
},
{
"name": "CVE-2026-68143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68143"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-68349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68349"
},
{
"name": "CVE-2026-74496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74496"
},
{
"name": "CVE-2026-46150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46150"
},
{
"name": "CVE-2026-72282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72282"
},
{
"name": "CVE-2026-72502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72502"
},
{
"name": "CVE-2026-68351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68351"
},
{
"name": "CVE-2026-68289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68289"
},
{
"name": "CVE-2026-64556",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64556"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-68117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68117"
},
{
"name": "CVE-2026-64544",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64544"
},
{
"name": "CVE-2026-68111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68111"
},
{
"name": "CVE-2026-64577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64577"
},
{
"name": "CVE-2026-64115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64115"
},
{
"name": "CVE-2026-52946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52946"
},
{
"name": "CVE-2026-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53059"
},
{
"name": "CVE-2026-74334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74334"
},
{
"name": "CVE-2026-64164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64164"
},
{
"name": "CVE-2026-63891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63891"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2026-74615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74615"
},
{
"name": "CVE-2026-80603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80603"
},
{
"name": "CVE-2026-64581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64581"
},
{
"name": "CVE-2026-74261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74261"
},
{
"name": "CVE-2026-53228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53228"
},
{
"name": "CVE-2026-64315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64315"
},
{
"name": "CVE-2026-68238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68238"
},
{
"name": "CVE-2026-74582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74582"
},
{
"name": "CVE-2026-68432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68432"
},
{
"name": "CVE-2026-74519",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74519"
},
{
"name": "CVE-2026-74548",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74548"
},
{
"name": "CVE-2026-64001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64001"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-52910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52910"
},
{
"name": "CVE-2026-74518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74518"
},
{
"name": "CVE-2026-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53388"
},
{
"name": "CVE-2026-80590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80590"
},
{
"name": "CVE-2026-68398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68398"
},
{
"name": "CVE-2026-64381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64381"
},
{
"name": "CVE-2026-63887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63887"
},
{
"name": "CVE-2026-68136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68136"
},
{
"name": "CVE-2025-39964",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39964"
},
{
"name": "CVE-2026-74416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74416"
},
{
"name": "CVE-2026-64113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64113"
},
{
"name": "CVE-2026-68299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68299"
},
{
"name": "CVE-2026-64103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64103"
},
{
"name": "CVE-2026-68082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68082"
},
{
"name": "CVE-2026-74508",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74508"
},
{
"name": "CVE-2026-64408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64408"
},
{
"name": "CVE-2026-68156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68156"
},
{
"name": "CVE-2026-74695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74695"
},
{
"name": "CVE-2026-68121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68121"
},
{
"name": "CVE-2026-64481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64481"
},
{
"name": "CVE-2026-72036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72036"
},
{
"name": "CVE-2026-64582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64582"
},
{
"name": "CVE-2026-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53223"
},
{
"name": "CVE-2026-64423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64423"
},
{
"name": "CVE-2026-68433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68433"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-63868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63868"
},
{
"name": "CVE-2026-72123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72123"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-72296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72296"
},
{
"name": "CVE-2026-52912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52912"
},
{
"name": "CVE-2026-72072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72072"
},
{
"name": "CVE-2026-68279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68279"
},
{
"name": "CVE-2026-68234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68234"
},
{
"name": "CVE-2026-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52920"
},
{
"name": "CVE-2026-53001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53001"
},
{
"name": "CVE-2026-74510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74510"
},
{
"name": "CVE-2023-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53109"
},
{
"name": "CVE-2026-63890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63890"
},
{
"name": "CVE-2026-74382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74382"
},
{
"name": "CVE-2026-64562",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64562"
},
{
"name": "CVE-2026-43456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43456"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2026-68153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68153"
},
{
"name": "CVE-2026-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53089"
},
{
"name": "CVE-2026-68188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68188"
},
{
"name": "CVE-2026-64436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64436"
},
{
"name": "CVE-2026-63962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63962"
},
{
"name": "CVE-2026-64412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64412"
},
{
"name": "CVE-2026-74556",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74556"
},
{
"name": "CVE-2026-74377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74377"
},
{
"name": "CVE-2026-74296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74296"
},
{
"name": "CVE-2026-64344",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64344"
},
{
"name": "CVE-2026-53077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53077"
},
{
"name": "CVE-2026-68397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68397"
},
{
"name": "CVE-2026-64572",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64572"
},
{
"name": "CVE-2026-64411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64411"
},
{
"name": "CVE-2026-74279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74279"
},
{
"name": "CVE-2026-74705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74705"
},
{
"name": "CVE-2026-64137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64137"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-64334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64334"
},
{
"name": "CVE-2026-74495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74495"
},
{
"name": "CVE-2026-72289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72289"
},
{
"name": "CVE-2026-72251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72251"
},
{
"name": "CVE-2026-64005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64005"
},
{
"name": "CVE-2026-46107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46107"
},
{
"name": "CVE-2026-23003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23003"
},
{
"name": "CVE-2026-43502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43502"
},
{
"name": "CVE-2026-74265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74265"
},
{
"name": "CVE-2026-68300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68300"
},
{
"name": "CVE-2026-68284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68284"
},
{
"name": "CVE-2026-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53264"
},
{
"name": "CVE-2026-74743",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74743"
},
{
"name": "CVE-2026-64547",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64547"
},
{
"name": "CVE-2026-63860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63860"
},
{
"name": "CVE-2026-68158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68158"
},
{
"name": "CVE-2026-64543",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64543"
},
{
"name": "CVE-2026-63823",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63823"
},
{
"name": "CVE-2026-68325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68325"
},
{
"name": "CVE-2026-64015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64015"
},
{
"name": "CVE-2026-43125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43125"
},
{
"name": "CVE-2026-72138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72138"
},
{
"name": "CVE-2026-74673",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74673"
},
{
"name": "CVE-2026-68198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68198"
},
{
"name": "CVE-2026-23451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23451"
},
{
"name": "CVE-2026-68123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68123"
},
{
"name": "CVE-2026-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53238"
},
{
"name": "CVE-2026-43416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43416"
},
{
"name": "CVE-2026-64118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64118"
},
{
"name": "CVE-2026-74406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74406"
},
{
"name": "CVE-2026-64312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64312"
},
{
"name": "CVE-2026-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53265"
},
{
"name": "CVE-2026-74584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74584"
},
{
"name": "CVE-2026-64355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64355"
},
{
"name": "CVE-2026-72069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72069"
},
{
"name": "CVE-2026-80737",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-80737"
},
{
"name": "CVE-2026-72020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72020"
},
{
"name": "CVE-2026-43116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43116"
},
{
"name": "CVE-2026-64340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64340"
},
{
"name": "CVE-2026-64007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64007"
},
{
"name": "CVE-2026-64567",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64567"
},
{
"name": "CVE-2026-64450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64450"
},
{
"name": "CVE-2026-64114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64114"
},
{
"name": "CVE-2026-74255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74255"
},
{
"name": "CVE-2026-64266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64266"
},
{
"name": "CVE-2025-40022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40022"
},
{
"name": "CVE-2026-43363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43363"
},
{
"name": "CVE-2026-64088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64088"
},
{
"name": "CVE-2026-74616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74616"
},
{
"name": "CVE-2026-74550",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-74550"
},
{
"name": "CVE-2026-64002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64002"
},
{
"name": "CVE-2026-72288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-72288"
},
{
"name": "CVE-2026-52977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52977"
},
{
"name": "CVE-2026-64564",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64564"
},
{
"name": "CVE-2026-64011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64011"
},
{
"name": "CVE-2026-64317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64317"
},
{
"name": "CVE-2026-68154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68154"
}
],
"initial_release_date": "2026-09-25T00:00:00",
"last_revision_date": "2026-09-25T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-1231",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-09-25T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20264320-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264320-1"
},
{
"published_at": "2026-09-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23763-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623763-1"
},
{
"published_at": "2026-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20264310-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264310-1"
},
{
"published_at": "2026-09-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23801-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623801-1"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4284-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264284-1"
},
{
"published_at": "2026-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20264312-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264312-1"
},
{
"published_at": "2026-09-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23797-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623797-1"
},
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4342-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264342-1"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4279-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264279-1"
},
{
"published_at": "2026-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4315-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264315-1"
},
{
"published_at": "2026-09-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4259-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264259-1"
},
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4328-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264328-1"
},
{
"published_at": "2026-09-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23790-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623790-1"
},
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4340-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264340-1"
},
{
"published_at": "2026-09-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23791-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623791-1"
},
{
"published_at": "2026-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20264299-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264299-1"
},
{
"published_at": "2026-09-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23764-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623764-1"
},
{
"published_at": "2026-09-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23789-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623789-1"
},
{
"published_at": "2026-09-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4282-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264282-1"
},
{
"published_at": "2026-09-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23798-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623798-1"
},
{
"published_at": "2026-09-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23799-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623799-1"
},
{
"published_at": "2026-09-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4258-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264258-1"
},
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4347-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264347-1"
},
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4344-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264344-1"
},
{
"published_at": "2026-09-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:4336-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20264336-1"
},
{
"published_at": "2026-09-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:23781-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202623781-1"
}
]
}
FKIE_CVE-2026-74394
Vulnerability from fkie_nvd - Published: 2026-08-15 06:22 - Updated: 2026-08-17 06:19| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/067b9556eeb007f28b7c2033b4dcde5b6d88418f | ||
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/07dec3f6dcb6c6cc891162d252b800eb0e6d5e8e | ||
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/3efa5301137140a3ca3677a9098c0a93a0acfd49 | ||
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/65572fbd86033ae2370125593d59b8be34253aaf | ||
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/72497172a4799119a0282a5eb5e2b8ddcc821921 | ||
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/c82c860f8c8e4f4f454c9f14d0ad0c0466965f7d | ||
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/dcf7a986f377cce0749ed53f1d64195fbd5fdf91 | ||
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/eb4ecdf631fe00e8020bf461503cb9b7017ed796 |
| Vendor | Product | Version |
|---|
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/infiniband/ulp/srpt/ib_srpt.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "c82c860f8c8e4f4f454c9f14d0ad0c0466965f7d",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "3efa5301137140a3ca3677a9098c0a93a0acfd49",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "067b9556eeb007f28b7c2033b4dcde5b6d88418f",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "dcf7a986f377cce0749ed53f1d64195fbd5fdf91",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "07dec3f6dcb6c6cc891162d252b800eb0e6d5e8e",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "65572fbd86033ae2370125593d59b8be34253aaf",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "72497172a4799119a0282a5eb5e2b8ddcc821921",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
},
{
"lessThan": "eb4ecdf631fe00e8020bf461503cb9b7017ed796",
"status": "affected",
"version": "5dabcd0456d7ee17c2c7a17d7c2305444d2b9639",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/infiniband/ulp/srpt/ib_srpt.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.0"
},
{
"lessThan": "5.0",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.261",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.212",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.178",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.145",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.97",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.40",
"versionType": "semver"
},
{
"lessThanOrEqual": "7.1.*",
"status": "unaffected",
"version": "7.1.5",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.2",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/srpt: fix integer overflow in immediate data length check\n\nimm_buf-\u003elen is a user-controlled uint32_t received from the network.\nAdding it to imm_data_offset without overflow checking allows a\nmalicious initiator to send len=0xFFFFFFFF, causing req_size to wrap\naround to a small value, bypassing the bounds check, and subsequently\npassing a ~4GB length to sg_init_one().\n\nUse check_add_overflow() to detect wrapping before the comparison."
}
],
"id": "CVE-2026-74394",
"lastModified": "2026-08-17T06:19:34.430",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"availabilityImpact": "HIGH",
"baseScore": 9.8,
"baseSeverity": "CRITICAL",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 3.9,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
}
]
},
"published": "2026-08-15T06:22:41.363",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/067b9556eeb007f28b7c2033b4dcde5b6d88418f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/07dec3f6dcb6c6cc891162d252b800eb0e6d5e8e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/3efa5301137140a3ca3677a9098c0a93a0acfd49"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/65572fbd86033ae2370125593d59b8be34253aaf"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/72497172a4799119a0282a5eb5e2b8ddcc821921"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/c82c860f8c8e4f4f454c9f14d0ad0c0466965f7d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/dcf7a986f377cce0749ed53f1d64195fbd5fdf91"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/eb4ecdf631fe00e8020bf461503cb9b7017ed796"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Received"
}
GHSA-F87M-VG23-G294
Vulnerability from github – Published: 2026-08-15 06:32 – Updated: 2026-08-17 06:33In the Linux kernel, the following vulnerability has been resolved:
RDMA/srpt: fix integer overflow in immediate data length check
imm_buf->len is a user-controlled uint32_t received from the network. Adding it to imm_data_offset without overflow checking allows a malicious initiator to send len=0xFFFFFFFF, causing req_size to wrap around to a small value, bypassing the bounds check, and subsequently passing a ~4GB length to sg_init_one().
Use check_add_overflow() to detect wrapping before the comparison.
{
"affected": [],
"aliases": [
"CVE-2026-74394"
],
"database_specific": {
"cwe_ids": [],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2026-08-15T06:22:41Z",
"severity": "CRITICAL"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/srpt: fix integer overflow in immediate data length check\n\nimm_buf-\u003elen is a user-controlled uint32_t received from the network.\nAdding it to imm_data_offset without overflow checking allows a\nmalicious initiator to send len=0xFFFFFFFF, causing req_size to wrap\naround to a small value, bypassing the bounds check, and subsequently\npassing a ~4GB length to sg_init_one().\n\nUse check_add_overflow() to detect wrapping before the comparison.",
"id": "GHSA-f87m-vg23-g294",
"modified": "2026-08-17T06:33:42Z",
"published": "2026-08-15T06:32:32Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74394"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/067b9556eeb007f28b7c2033b4dcde5b6d88418f"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/07dec3f6dcb6c6cc891162d252b800eb0e6d5e8e"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/3efa5301137140a3ca3677a9098c0a93a0acfd49"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/65572fbd86033ae2370125593d59b8be34253aaf"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/72497172a4799119a0282a5eb5e2b8ddcc821921"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/c82c860f8c8e4f4f454c9f14d0ad0c0466965f7d"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/dcf7a986f377cce0749ed53f1d64195fbd5fdf91"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/eb4ecdf631fe00e8020bf461503cb9b7017ed796"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2026-3702 (CVE-2025-40027)
Vulnerability from osv_openeuler – Published: 2026-09-05 15:04 – Updated: 2026-09-05 15:04 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
net/9p: fix double req put in p9_fd_cancelled
Syzkaller reports a KASAN issue as below:
general protection fault, probably for non-canonical address 0xfbd59c0000000021: 0000 [#1] PREEMPT SMP KASAN NOPTI KASAN: maybe wild-memory-access in range [0xdead000000000108-0xdead00000000010f] CPU: 0 PID: 5083 Comm: syz-executor.2 Not tainted 6.1.134-syzkaller-00037-g855bd1d7d838 #0 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.12.0-1 04/01/2014 RIP: 0010:__list_del include/linux/list.h:114 [inline] RIP: 0010:__list_del_entry include/linux/list.h:137 [inline] RIP: 0010:list_del include/linux/list.h:148 [inline] RIP: 0010:p9_fd_cancelled+0xe9/0x200 net/9p/trans_fd.c:734
Call Trace: <TASK> p9_client_flush+0x351/0x440 net/9p/client.c:614 p9_client_rpc+0xb6b/0xc70 net/9p/client.c:734 p9_client_version net/9p/client.c:920 [inline] p9_client_create+0xb51/0x1240 net/9p/client.c:1027 v9fs_session_init+0x1f0/0x18f0 fs/9p/v9fs.c:408 v9fs_mount+0xba/0xcb0 fs/9p/vfs_super.c:126 legacy_get_tree+0x108/0x220 fs/fs_context.c:632 vfs_get_tree+0x8e/0x300 fs/super.c:1573 do_new_mount fs/namespace.c:3056 [inline] path_mount+0x6a6/0x1e90 fs/namespace.c:3386 do_mount fs/namespace.c:3399 [inline] __do_sys_mount fs/namespace.c:3607 [inline] __se_sys_mount fs/namespace.c:3584 [inline] __x64_sys_mount+0x283/0x300 fs/namespace.c:3584 do_syscall_x64 arch/x86/entry/common.c:51 [inline] do_syscall_64+0x35/0x80 arch/x86/entry/common.c:81 entry_SYSCALL_64_after_hwframe+0x6e/0xd8
This happens because of a race condition between:
- The 9p client sending an invalid flush request and later cleaning it up;
-
The 9p client in p9_read_work() canceled all pending requests.
Thread 1 Thread 2 ... p9_client_create() ... p9_fd_create() ... p9_conn_create() ... // start Thread 2 INIT_WORK(&m->rq, p9_read_work); p9_read_work() ... p9_client_rpc() ... ... p9_conn_cancel() ... spin_lock(&m->req_lock); ... p9_fd_cancelled() ... ... spin_unlock(&m->req_lock); // status rewrite p9_client_cb(m->client, req, REQ_STATUS_ERROR) // first remove list_del(&req->req_list); ...
spin_lock(&m->req_lock) ... // second remove list_del(&req->req_list); spin_unlock(&m->req_lock) ...
Commit 74d6a5d56629 ("9p/trans_fd: Fix concurrency del of req_list in p9_fd_cancelled/p9_read_work") fixes a concurrency issue in the 9p filesystem client where the req_list could be deleted simultaneously by both p9_read_work and p9_fd_cancelled functions, but for the case where req->status equals REQ_STATUS_RCVD.
Update the check for req->status in p9_fd_cancelled to skip processing not just received requests, but anything that is not SENT, as whatever changed the state from SENT also removed the request from its list.
Found by Linux Verification Center (linuxtesting.org) with Syzkaller.
updated the check from status == RECV || status == ERROR to status != SENT
In the Linux kernel, the following vulnerability has been resolved:
exfat: validate cluster allocation bits of the allocation bitmap
syzbot created an exfat image with cluster bits not set for the allocation bitmap. exfat-fs reads and uses the allocation bitmap without checking this. The problem is that if the start cluster of the allocation bitmap is 6, cluster 6 can be allocated when creating a directory with mkdir. exfat zeros out this cluster in exfat_mkdir, which can delete existing entries. This can reallocate the allocated entries. In addition, the allocation bitmap is also zeroed out, so cluster 6 can be reallocated. This patch adds exfat_test_bitmap_range to validate that clusters used for the allocation bitmap are correctly marked as in-use.(CVE-2025-40307)
In the Linux kernel, the following vulnerability has been resolved:
batman-adv: stop tp_meter sessions during mesh teardown
TP meter sessions remain linked on bat_priv->tp_list after the netlink request has already finished. When the mesh interface is removed, batadv_mesh_free() currently tears down the mesh without first draining these sessions.
A running sender thread or a late incoming tp_meter packet can then keep processing against a mesh instance which is already shutting down. Synchronize tp_meter with the mesh lifetime by stopping all active sessions from batadv_mesh_free() and waiting for sender threads to exit before teardown continues.(CVE-2026-46208)
In the Linux kernel, the following vulnerability has been resolved:
sctp: diag: reject stale associations in dump_one path
The SCTP exact sock_diag lookup can hold a transport reference, block on lock_sock(sk), and then resume after sctp_association_free() has marked the association dead and freed its bind address list.
When that happens, inet_assoc_attr_size() and inet_diag_msg_sctpasoc_fill() can still dereference association state that is no longer valid for reporting. In particular, inet_diag_msg_sctpasoc_fill() may read an empty bind-address list as a real sctp_sockaddr_entry and trigger an out-of-bounds read from unrelated association memory.
Reject the association after taking the socket lock if it has been reaped or detached from the endpoint, and report the lookup as stale. This keeps the exact dump-one path from formatting torn association state.(CVE-2026-52917)
In the Linux kernel, the following vulnerability has been resolved:
libceph: Fix potential out-of-bounds access in crush_decode()
A message of type CEPH_MSG_OSD_MAP containing a crush map with at least one bucket has two fields holding the bucket algorithm. If the values in these two fields differ, an out-of-bounds access can occur. This is the case because the first algorithm field (alg) is used to allocate the correct amount of memory for a bucket of this type, while the second algorithm field inside the bucket (b->alg) is used in the subsequent processing.
This patch fixes the issue by adding a check that compares alg and b->alg and aborts the processing in case they differ. Furthermore, b->alg is set to 0 in this case, because the destruction of the crush map also uses this field to determine the bucket type, which can again result in an out-of-bounds access when trying to free the memory pointed to by the fields of the bucket. To correctly free the memory allocated for the bucket in such a case, the corresponding call to kfree is moved from the algorithm-specific crush_destroy_bucket functions to the generic crush_destroy_bucket().(CVE-2026-52955)
In the Linux kernel, the following vulnerability has been resolved:
hv_netvsc: use kmap_local_page in netvsc_copy_to_send_buf
netvsc_copy_to_send_buf() copies page buffer entries into the VMBus send buffer using phys_to_virt() on the entry PFN. Entries for the RNDIS header and the skb linear data come from kmalloc'd memory and are always in the kernel direct map, but entries for skb fragments reference page cache or user pages, which on 32-bit x86 with CONFIG_HIGHMEM=y can live above the LOWMEM boundary. For such a page phys_to_virt() returns an address outside the direct map and the subsequent memcpy() faults on the transmit softirq path, which is fatal.
Map the pages with kmap_local_page() instead, handling two properties of the page buffer entries:
-
pb[i].pfn is a Hyper-V PFN at HV_HYP_PAGE_SIZE (4K) granularity, not a native PFN. Reconstruct the physical address first and derive the native page from it, so the mapping stays correct where PAGE_SIZE > HV_HYP_PAGE_SIZE (e.g. arm64 with 64K pages).
-
Since commit 41a6328b2c55 ("hv_netvsc: Preserve contiguous PFN grouping in the page buffer array"), an entry describes a full physically contiguous fragment and pb[i].len can exceed PAGE_SIZE, while kmap_local_page() maps a single page. Copy page by page, splitting at native page boundaries.
The copy path only handles packets smaller than the send section size (6144 bytes by default); larger packets take the cp_partial path where only the RNDIS header is copied. So entries here are bounded by the section size and a copy is split at most once on 4K-page systems. On !CONFIG_HIGHMEM configs kmap_local_page() folds to page_address() and no mapping work is added.(CVE-2026-53199)
In the Linux kernel, the following vulnerability has been resolved:
sctp: fix uninit-value in __sctp_rcv_asconf_lookup()
__sctp_rcv_asconf_lookup() in net/sctp/input.c only checks that the ASCONF chunk can hold the ADDIP header and a parameter header, then calls af->from_addr_param(), which reads the full address (16 bytes for IPv6) trusting the parameter's declared length.
An unauthenticated peer can send a truncated trailing ASCONF chunk that declares an IPv6 address parameter but stops after the 4-byte parameter header; reached from the no-association lookup path, from_addr_param() then reads uninitialized bytes past the parameter.
Impact: an unauthenticated SCTP peer makes the receive path read up to 16 bytes of uninitialized memory past a truncated ASCONF address parameter.
The sibling __sctp_rcv_init_lookup() bounds parameters with sctp_walk_params(); this path open-codes the fetch and omits the bound. Verify the whole address parameter lies within the chunk before from_addr_param() reads it, the same class of fix as commit 51e5ad549c43 ("net: sctp: fix KMSAN uninit-value in sctp_inq_pop").(CVE-2026-53225)
In the Linux kernel, the following vulnerability has been resolved:
tipc: fix slab-use-after-free Read in tipc_aead_decrypt_done
tipc_aead_decrypt() goes straight from tipc_bearer_hold(b) to crypto_aead_decrypt(req) without taking a reference on the netns, unlike the encrypt path. When crypto_aead_decrypt() is offloaded asynchronously (e.g. the SIMD aead wrapper queuing to cryptd), the cryptd worker runs tipc_aead_decrypt_done() later. If the bearer's netns is torn down in the meantime, cleanup_net() -> tipc_exit_net() -> tipc_crypto_stop() frees the per-netns tipc_crypto, and the completion then reads it: tipc_aead_decrypt_done() dereferences aead->crypto->stats and aead->crypto->net, and tipc_crypto_rcv_complete() dereferences aead->crypto->aead[] and the node table -- reading freed memory.
Decoded KASAN splat (v7.1-rc7, CONFIG_KASAN_INLINE + TIPC + TIPC_CRYPTO):
BUG: KASAN: slab-use-after-free in tipc_aead_decrypt_done (net/tipc/crypto.c:999) Read of size 8 at addr ffff8881056258a8 by task kworker/u16:2/51 Workqueue: events_unbound Call Trace: tipc_aead_decrypt_done (net/tipc/crypto.c:999) process_one_work (kernel/workqueue.c:3314) worker_thread (kernel/workqueue.c:3397 kernel/workqueue.c:3478) kthread (kernel/kthread.c:436) ret_from_fork (arch/x86/kernel/process.c:158) ret_from_fork_asm (arch/x86/entry/entry_64.S:245)
Allocated by task 169: __kasan_kmalloc (mm/kasan/common.c:398 mm/kasan/common.c:415) tipc_crypto_start (net/tipc/crypto.c:1502) tipc_init_net (net/tipc/core.c:72) ops_init (net/core/net_namespace.c:137) setup_net (net/core/net_namespace.c:446) copy_net_ns (net/core/net_namespace.c:579) create_new_namespaces (kernel/nsproxy.c:132) __x64_sys_unshare (kernel/fork.c:3316) do_syscall_64 (arch/x86/entry/syscall_64.c:63) entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:121)
Freed by task 8: kfree (mm/slub.c:6566) tipc_exit_net (net/tipc/core.c:119) cleanup_net (net/core/net_namespace.c:704) process_one_work (kernel/workqueue.c:3314) kthread (kernel/kthread.c:436)
This is the same class of bug that commit e279024617134 ("net/tipc: fix slab-use-after-free Read in tipc_aead_encrypt_done") fixed for the encrypt side. The encrypt path takes maybe_get_net(aead->crypto->net) before crypto_aead_encrypt() and drops it with put_net() on the synchronous return paths and in tipc_aead_encrypt_done(); the -EINPROGRESS/-EBUSY return keeps the reference for the async callback to release. The decrypt path was left without the equivalent guard.
Mirror the encrypt-side fix on the decrypt path: take a net reference before crypto_aead_decrypt() (failing with -ENODEV and the matching bearer put if it cannot be acquired), keep it across the -EINPROGRESS/-EBUSY async return, and drop it with put_net() on the synchronous success/error return and at the end of tipc_aead_decrypt_done().
Reproduced under KASAN on v7.1-rc7: a UDP bearer with a cluster key is flooded with crafted encrypted frames from an unknown peer (driving the cluster-key decrypt path) while the bearer's netns is repeatedly torn down. The completion must run asynchronously to outlive tipc_crypto_stop(); on x86 the stock aesni gcm(aes) now decrypts synchronously, so the async path was exercised via cryptd offload. The unguarded aead->crypto dereference in tipc_aead_decrypt_done() is the unpatched upstream path; tipc_aead_decrypt() still lacks maybe_get_net(aead->crypto->net), so the completion can outlive the free on any config where crypto_aead_decrypt() goes async.
Found by 0sec automated security-research tooling (https://0sec.ai).(CVE-2026-63801)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: conntrack: tcp: do not force CLOSE on invalid-seq RST without direction check
An unintended behavior in the TCP conntrack state machine allows a connection to be forced into the CLOSE state using an RST packet with an invalid sequence number.
Specifically, after a SYN packet is observed, an RST with an invalid SEQ can transition the conntrack entry to TCP_CONNTRACK_CLOSE, regardless of whether the RST corresponds to the expected reply direction. The relevant code path assumes the RST is a response to an outgoing SYN, but does not validate packet direction or ensure that a matching SYN was actually sent in the opposite direction.
As a result, a crafted packet sequence consisting of a SYN followed by an invalid-sequence RST can prematurely terminate an active NAT entry. This makes connection teardown easier than intended.
So, tighten the state transition logic to ensure that RST-triggered CLOSE transitions only occur when the RST is a valid response to a previously observed SYN in the correct direction.(CVE-2026-63913)
In the Linux kernel, the following vulnerability has been resolved:
xfrm: route MIGRATE notifications to caller's netns
xfrm_send_migrate() in net/xfrm/xfrm_user.c and pfkey_send_migrate() in net/key/af_key.c both hardcode &init_net for the multicast that announces a successful XFRM_MSG_MIGRATE / SADB_X_MIGRATE.
XFRM_MSG_MIGRATE arrives on a per-netns NETLINK_XFRM socket, and the rest of the xfrm/af_key netlink path was made netns-aware in 2008. The other 14 multicast paths in xfrm_user.c route their event using xs_net(x), xp_net(xp) or sock_net(skb->sk); only the migrate path was missed.
Two consequences of the init_net hardcoding:
-
The notification (selector, old/new endpoint addresses, and the km_address) is delivered to listeners on init_net's XFRMNLGRP_MIGRATE / pfkey BROADCAST_ALL groups rather than on the issuing netns. An IKE daemon running in init_net therefore receives migration notifications originating from any other netns on the host.
-
An IKE daemon running inside a non-init netns and subscribed to its own XFRMNLGRP_MIGRATE / pfkey groups never receives the notification of its own migration. IKEv2 MOBIKE / address-update handling inside a netns is silently broken.
Thread struct net through km_migrate() and the xfrm_mgr.migrate function pointer, drop the &init_net override in xfrm_send_migrate() and pfkey_send_migrate(), and pass the caller's net (already in scope in xfrm_migrate() via sock_net(skb->sk)) all the way down. struct xfrm_mgr is in-tree only and not exported as a stable API, so the function-pointer signature change is internal.
pfkey_broadcast() is already netns-aware via net_generic(net, pfkey_net_id) since the pernet conversion. The five other pfkey_broadcast() callers in af_key.c already pass xs_net(x), sock_net(sk) or a per-netns net, so this only removes the &init_net outlier.(CVE-2026-63914)
In the Linux kernel, the following vulnerability has been resolved:
sctp: fix race between sctp_wait_for_connect and peeloff
sctp_wait_for_connect() drops and re-acquires the socket lock while waiting for the association to reach ESTABLISHED state. During this window, another thread can peeloff the association to a new socket via getsockopt(SCTP_SOCKOPT_PEELOFF), changing asoc->base.sk. After re-acquiring the old socket lock, sctp_wait_for_connect() returns success without noticing the migration — the caller then accesses the association under the wrong lock in sctp_datamsg_from_user().
Add the same sk != asoc->base.sk check that sctp_wait_for_sndbuf() already has, returning an error if the association was migrated while we slept.(CVE-2026-63971)
In the Linux kernel, the following vulnerability has been resolved:
batman-adv: tt: fix negative last_changeset_len
batadv_piv_tt::last_changeset_len len was declared as s16, but the field is never intended to hold a negative value. When a value greater than 32767 is assigned, it wraps to a negative signed integer.
In batadv_send_my_tt_response(), last_changeset_len is temporarily widened to s32. The incorrectly negative s16 value propagates into the s32, causing batadv_tt_prepare_tvlv_local_data() to allocate a full sized buffer but populates only a small portion of it with the collected changeset. All remaining bits are kept uninitialized.
Using an u16 avoids this type confusion and ensures that no (negative) sign extension is performed in batadv_send_my_tt_response().(CVE-2026-64089)
In the Linux kernel, the following vulnerability has been resolved:
batman-adv: bla: avoid double decrement of bla.num_requests
The bla.num_requests is increased when no request_sent was in progress. And it is decremented in various places (announcement was received, backbone is purged, periodic work). But the check if the request_sent is actually set to a specific state and the atomic_dec/_inc are not safe because they are not atomic (TOCTOU) and multiple such code portions can run concurrently.
At the same time, it is necessary to modify request_sent (state) and bla.num_requests atomically. Otherwise batadv_bla_send_request() might set request_sent to 1 and is interrupted. batadv_handle_announce() can then set request_sent back to 0 and decrement num_requests before batadv_bla_send_request() incremented it.
The two operations must therefore be locked. And since state (request_sent) and wait_periods are only accessed inside this lock, they can be converted to simpler datatypes. And to avoid that the bla.num_requests is touched by a parallel running context with a valid backbone_gw reference after batadv_bla_purge_backbone_gw() ran, a third state "stopped" is required to correctly signal that a backbone_gw is in the state of being cleaned up.(CVE-2026-64095)
In the Linux kernel, the following vulnerability has been resolved:
net: qualcomm: rmnet: fix endpoint use-after-free in rmnet_dellink()
rmnet_dellink() removes the endpoint from the hash table with hlist_del_init_rcu() and then immediately frees it with kfree(). However, RCU readers on the receive path (rmnet_rx_handler -> __rmnet_map_ingress_handler) may still hold a reference to the endpoint and dereference ep->egress_dev after the memory has been freed. The endpoint is a kmalloc-32 object, and the stale read at offset 8 corresponds to the egress_dev pointer.
BUG: unable to handle page fault for address: ffffffffde942eef Oops: 0002 [#1] SMP NOPTI CPU: 1 UID: 0 PID: 137 Comm: poc_write Not tainted 7.0.0+ #4 PREEMPTLAZY RIP: 0010:rmnet_vnd_rx_fixup (rmnet_vnd.c:27) Call Trace: <TASK> __rmnet_map_ingress_handler (rmnet_handlers.c:48 rmnet_handlers.c:101) rmnet_rx_handler (rmnet_handlers.c:129 rmnet_handlers.c:235) __netif_receive_skb_core.constprop.0 (net/core/dev.c:6096) __netif_receive_skb_one_core (net/core/dev.c:6208) netif_receive_skb (net/core/dev.c:6467) tun_get_user (drivers/net/tun.c:1955) tun_chr_write_iter (drivers/net/tun.c:2003) vfs_write (fs/read_write.c:688) ksys_write (fs/read_write.c:740) </TASK>
Add an rcu_head field to struct rmnet_endpoint and replace kfree() with kfree_rcu() so the endpoint memory remains valid through the RCU grace period. Also remove the rmnet_vnd_dellink() call and inline only the nr_rmnet_devs decrement, since rmnet_vnd_dellink() would set ep->egress_dev to NULL during the grace period, creating a data race with lockless readers.(CVE-2026-64188)
In the Linux kernel, the following vulnerability has been resolved: tipc: fix out-of-bounds read in broadcast Gap ACK blocks. A broadcast PROTOCOL/STATE_MSG can carry a Gap ACK blocks record in its data area. tipc_get_gap_ack_blks() only verifies that the record's len field is self-consistent with its ugack_cnt/bgack_cnt counts (sz == struct_size(p, gacks, ugack_cnt + bgack_cnt)); it does not check that the record actually fits in the message data area, msg_data_sz(). The unicast caller tipc_link_proto_rcv() bounds it, but the broadcast caller tipc_bcast_sync_rcv() discards the returned size, so tipc_link_advance_transmq() copies the record off the receive skb with an attacker-controlled count, leading to an out-of-bounds read. This could allow an attacker to read beyond the allocated buffer, potentially causing information disclosure or system crash.(CVE-2026-64450)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: btusb: fix use-after-free on registration failure
Make sure to release the sibling interfaces in case controller registration fails to avoid use-after-free and double-free when they are eventually disconnected.
This issue was reported by Sashiko while reviewing a fix for a wakeup source leak in the btusb probe errors paths.(CVE-2026-64471)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: firewire: isight: bound the sample count to the packet payload
isight_packet() takes the frame count from the device iso packet and checks it only against the device claimed iso length.
count = be32_to_cpu(payload->sample_count);
if (likely(count <= (length - 16) / 4))
isight_samples(isight, payload->samples, count);
length is the iso header data_length. It can be up to 0xffff. So the gate allows a count up to about 16379. isight_samples() then copies count frames out of payload->samples into the PCM DMA buffer.
payload->samples holds only 2 * MAX_FRAMES_PER_PACKET values. The device multiplexes two samples per frame. A count past MAX_FRAMES_PER_PACKET reads past the payload. A count past the buffer size writes past runtime->dma_area. The smallest PCM buffer is larger than MAX_FRAMES_PER_PACKET. Bounding the count to MAX_FRAMES_PER_PACKET keeps both the read and the write in range.
A malicious or faulty Apple iSight on the FireWire bus reaches this during a normal capture.
Add the MAX_FRAMES_PER_PACKET bound to the gate.(CVE-2026-64483)
In the Linux kernel, the following vulnerability has been resolved:
libceph: Reject monmaps advertising zero monitors
A message of type CEPH_MSG_MON_MAP contains a monmap that is sent from a monitor to the client. This monmap contains information about the existing monitors in the cluster. Currently, a monmap indicating that there are zero monitors in the cluster is treated as valid. However, it is impossible to have zero monitors in the cluster and still receive a valid monmap from a monitor. Therefore, such a monmap must be corrupted and should be treated as invalid. Furthermore, a monmap with a monitor count of zero can subsequently crash the client when attempting to open a session with a monitor in __open_session(). This happens because the "BUG_ON(monc->monmap->num_mon < 1)" assertion in pick_new_mon() is triggered.
This patch extends a check in ceph_monmap_decode() to also reject arriving mon_maps with num_mon == 0 rather than only with num_mon > CEPH_MAX_MON.
idryomov: drop "log output for unusual values of num_mon" part
In the Linux kernel, the following vulnerability has been resolved:
libceph: refresh auth->authorizer_buf{,_len} after authorizer update
ceph_x_create_authorizer() caches au->buf->vec.iov_base and au->buf->vec.iov_len in struct ceph_auth_handshake. These cached values are then used by the messenger connect code when sending the authorizer.
ceph_x_update_authorizer() can rebuild the authorizer when a newer service ticket is available. If the rebuilt authorizer no longer fits in the existing buffer, ceph_x_build_authorizer() drops its reference to au->buf and allocates a new one. If this is the final reference, ceph_buffer_put() frees the old ceph_buffer and its vec.iov_base, but auth->authorizer_buf still points at that freed memory.
A subsequent msgr1 reconnect can therefore queue the stale pointer and trigger a KASAN slab-use-after-free in _copy_from_iter() while tcp_sendmsg() copies the authorizer.
Refresh auth->authorizer_buf and auth->authorizer_buf_len after a successful authorizer rebuild so the messenger sends the current buffer.(CVE-2026-68156)
In the Linux kernel, the following vulnerability has been resolved:
media: cx231xx: fix devres lifetime
USB drivers bind to USB interfaces and any device managed resources should have their lifetime tied to the interface rather than parent USB device. This avoids issues like memory leaks when drivers are unbound without their devices being physically disconnected (e.g. on probe deferral or configuration changes).
Fix the driver state lifetime so that it is released on driver unbind.(CVE-2026-68227)
In the Linux kernel, the following vulnerability has been resolved:
IB/mad: Drop unmatched RMPP responses before reassembly
Kernel-handled RMPP receive processing starts reassembly for active DATA responses before the response is matched to an outstanding send. The normal match happens later, after ib_process_rmpp_recv_wc() has either assembled a complete message or consumed the segment.
That ordering lets an unsolicited response that routes to a kernel RMPP agent by the high TID bits allocate or extend RMPP receive state before the full TID and source address are checked against a real request. A reordered burst can therefore reach the receive-side insertion path even though the response would not match any send.
For kernel-handled RMPP DATA responses, require the existing ib_find_send_mad() match before entering RMPP reassembly. The matcher already checks the full TID, management class and source address/GID against the agent wait, backlog and in-flight send lists. If there is no match, drop the response without creating RMPP state.
This leaves the RMPP window behavior unchanged and only rejects responses that have no corresponding request.(CVE-2026-68425)
In the Linux kernel, the following vulnerability has been resolved:
ntfs: sanitize MFT references returned from ntfs_lookup_inode_by_name()
ntfs_lookup_inode_by_name() returns MFT references read from directory index entries on disk. These values are untrusted, but the function can currently return an error-marked MFT reference to its callers without validating it.
Callers later decode lookup failures with MREF_ERR(). A crafted NTFS image can set the MREF error bit while leaving the low bits as an arbitrary value, causing callers to consume a bogus pseudo-errno instead of treating the lookup result as corrupted on-disk metadata.
Fix this at the source by normalizing every error-marked MFT reference returned from ntfs_lookup_inode_by_name() to ERR_MREF(-EIO). Apply this to all four directory lookup return paths so every caller gets a validated result without needing additional checks or an API change.
This keeps the sanitization in the common lookup helper, which is cleaner than duplicating validation in each caller.(CVE-2026-72188)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/mlx5: Fix undefined shift of user RQ WQE size
set_rq_size() computes the RQ WQE size as "1 << rq_wqe_shift" based on the user-provided rq_wqe_shift, which is only checked to be greater than 32, so shifts of 32 are still accepted. A shift of 31 also overflows a signed integer, leading to undefined behavior.
Use check_shl_overflow() to compute the RQ WQE size and reject any invalid values.(CVE-2026-74297)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: hci_core: Fix UAF in hci_unregister_dev()
hci_unregister_dev() does not disable cmd_timer and ncmd_timer before the hci_dev structure is freed. If a timeout fires during device teardown, the callback dereferences freed memory (including the hdev->reset function pointer), leading to a use-after-free.
Add disable_delayed_work_sync() calls alongside the existing disable_work_sync() calls to ensure both timers are fully quiesced before teardown proceeds.(CVE-2026-74302)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/rxe: Copy WQE to local buffer in non-SRQ receive path
For non-SRQ QPs, the responder reads WQE fields directly from the shared queue buffer mapped into userspace. This allows a malicious user to modify fields like num_sge or sge entries while the kernel is processing the WQE, leading to out-of-bounds reads in rxe_resp_check_length() and copy_data().
Introduce get_recv_wqe() that validates num_sge and copies the WQE to a kernel-local buffer before processing, matching the approach already used for SRQ WQEs in get_srq_wqe(). The srq_wqe buffer is reused since SRQ and non-SRQ paths are mutually exclusive per QP.(CVE-2026-74377)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/srpt: fix integer overflow in immediate data length check
imm_buf->len is a user-controlled uint32_t received from the network. Adding it to imm_data_offset without overflow checking allows a malicious initiator to send len=0xFFFFFFFF, causing req_size to wrap around to a small value, bypassing the bounds check, and subsequently passing a ~4GB length to sg_init_one().
Use check_add_overflow() to detect wrapping before the comparison.(CVE-2026-74394)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/mlx5: Fix devx subscribe-event unwind NULL dereference
MLX5_IB_METHOD_DEVX_SUBSCRIBE_EVENT() links event_sub into sub_list before initializing the fields used by the shared error path.
If eventfd_ctx_fdget() then fails, the unwind path dereferences event_sub->ev_file in uverbs_uobject_put() and calls subscribe_event_xa_dealloc() with an unset xa_key_level1.
subscribe_event_xa_alloc() creates the XA entry exactly once for a given key_level1, on the first occurrence of that key. The unwind path must therefore call subscribe_event_xa_dealloc() exactly once for it as well.
Enforce that by adding devx_key_in_sub_list() and calling subscribe_event_xa_dealloc() only when the last matching pending entry is being cleaned up.(CVE-2026-74395)
In the Linux kernel, the following vulnerability has been resolved:
IB/mlx5: Fix transport-domain rollback and initialize lb mutex earlier
mlx5_ib_alloc_transport_domain() allocates a transport domain and then may fail in mlx5_ib_enable_lb(). In that case, the allocated TD is leaked.
Fix this by deallocating the TD when mlx5_ib_enable_lb() returns an error. Also return 0 explicitly in the no-loopback-capability success branch, and move dev->lb.mutex initialization to mlx5_ib_stage_init_init().(CVE-2026-74397)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: usb-audio: fix OOB write in snd_usbmidi_akai_output()
snd_usbmidi_akai_output() computes its fill-loop bound
buf_end = ep->max_transfer - MAX_AKAI_SYSEX_LEN - 1;
as a signed int, so a small device-advertised bulk-OUT max_transfer makes buf_end negative. The loop guard then compares the u32 urb->transfer_buffer_length against that negative int: the usual arithmetic conversion turns buf_end into a large unsigned value, so the guard stays true and each iteration keeps appending SysEx framing and payload bytes past the end of the URB transfer buffer, which is only max_transfer bytes long.
A USB device that advertises a tiny bulk-OUT endpoint can therefore trigger an attacker-length- and content-controlled heap out-of-bounds write when a process writes to the created /dev/snd/midiCD node.
Return early when there is no room for even one SysEx, so the loop is never entered with a bound that would wrap. The loop is the last statement of the function, so bailing out is equivalent to it not running.
Discovered by XBOW, triaged by Baul Lee <(CVE-2026-74499)
In the Linux kernel, the following vulnerability has been resolved: sctp: keep chunk->transport in step with the list it is queued on. __sctp_outq_flush_rtx() moves a gap-acked chunk onto another transport's transmitted list without updating chunk->transport. The chunk then sits on a live transport's list while chunk->transport still names a different one. If that transport is removed - sctp_assoc_rm_peer() from an ASCONF Delete-IP - sctp_transport_free() RCU-frees it and the chunk is left with a dangling pointer. A SACK that reneges on the TSN clears the flag, and the next SACK reaches inside the freed transport. KASAN reports a slab-use-after-free read in sctp_check_transmitted(), freed from sctp_assoc_rm_peer().(CVE-2026-74588)
In the Linux kernel, a deadlock vulnerability has been found in the ceph filesystem. A reader can hang forever in __ceph_get_caps() when the client no longer holds FILE_RD, but local cap state still says that the capability is already wanted (via mds_wanted). One way to trigger this is through MDS cap revocation. If another client performs a conflicting operation, the MDS can revoke FILE_RD from the reader; the next read then has to reacquire FILE_RD. If the cap update that should request FILE_RD never reaches the MDS after cap->mds_wanted was raised, the reader is left holding only non-file caps while local mds_wanted still includes the file read caps, causing the reader to wait indefinitely.(CVE-2026-80527)
In the Linux kernel, the following vulnerability has been resolved:
libceph: fix OOB read in decode_watchers() via missing bounds check
ceph_start_decoding() validates that struct_len bytes remain in the buffer after the encoding header, but accepts struct_len=0 as valid: ceph_decode_need(p, end, 0, bad) always passes. When a malicious or compromised OSD sends an obj_list_watch_response_t reply with struct_len=0, ceph_start_decoding() returns success with p == end, leaving zero bytes guaranteed for subsequent reads.
The immediately following ceph_decode_32(p) in decode_watchers() has no preceding bounds check. With p == end this is a 4-byte read past the validated buffer boundary. The garbage value is then passed directly to kzalloc_objs() as the watcher count.
The sibling function decode_watcher() already uses the safe variants (ceph_decode_copy_safe, ceph_decode_64_safe, ceph_decode_skip_32) after its own ceph_start_decoding() call. decode_watchers() is the only site that uses the bare variant, confirming an oversight.
Fix by replacing ceph_decode_32(p) with ceph_decode_32_safe(p, end, *num_watchers, bad), consistent with the established pattern.
Attacker model: a malicious or compromised OSD in a multi-tenant Ceph deployment (e.g. cloud) can trigger this against any kernel client that calls CEPH_OSD_OP_LIST_WATCHERS, without any further privileges beyond OSD session establishment.
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"bpftool-debuginfo-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"kernel-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"kernel-debuginfo-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"kernel-debugsource-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"kernel-devel-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"kernel-headers-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"kernel-source-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"kernel-tools-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"kernel-tools-devel-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"perf-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"perf-debuginfo-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"python3-perf-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-331.0.0.232.oe2203sp4.aarch64.rpm"
],
"src": [
"kernel-5.10.0-331.0.0.232.oe2203sp4.src.rpm"
],
"x86_64": [
"bpftool-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"bpftool-debuginfo-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"kernel-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"kernel-debuginfo-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"kernel-debugsource-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"kernel-devel-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"kernel-headers-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"kernel-source-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"kernel-tools-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"kernel-tools-devel-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"perf-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"perf-debuginfo-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"python3-perf-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-331.0.0.232.oe2203sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-331.0.0.232.oe2203sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/9p: fix double req put in p9_fd_cancelled\n\nSyzkaller reports a KASAN issue as below:\n\ngeneral protection fault, probably for non-canonical address 0xfbd59c0000000021: 0000 [#1] PREEMPT SMP KASAN NOPTI\nKASAN: maybe wild-memory-access in range [0xdead000000000108-0xdead00000000010f]\nCPU: 0 PID: 5083 Comm: syz-executor.2 Not tainted 6.1.134-syzkaller-00037-g855bd1d7d838 #0\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.12.0-1 04/01/2014\nRIP: 0010:__list_del include/linux/list.h:114 [inline]\nRIP: 0010:__list_del_entry include/linux/list.h:137 [inline]\nRIP: 0010:list_del include/linux/list.h:148 [inline]\nRIP: 0010:p9_fd_cancelled+0xe9/0x200 net/9p/trans_fd.c:734\n\nCall Trace:\n \u0026lt;TASK\u0026gt;\n p9_client_flush+0x351/0x440 net/9p/client.c:614\n p9_client_rpc+0xb6b/0xc70 net/9p/client.c:734\n p9_client_version net/9p/client.c:920 [inline]\n p9_client_create+0xb51/0x1240 net/9p/client.c:1027\n v9fs_session_init+0x1f0/0x18f0 fs/9p/v9fs.c:408\n v9fs_mount+0xba/0xcb0 fs/9p/vfs_super.c:126\n legacy_get_tree+0x108/0x220 fs/fs_context.c:632\n vfs_get_tree+0x8e/0x300 fs/super.c:1573\n do_new_mount fs/namespace.c:3056 [inline]\n path_mount+0x6a6/0x1e90 fs/namespace.c:3386\n do_mount fs/namespace.c:3399 [inline]\n __do_sys_mount fs/namespace.c:3607 [inline]\n __se_sys_mount fs/namespace.c:3584 [inline]\n __x64_sys_mount+0x283/0x300 fs/namespace.c:3584\n do_syscall_x64 arch/x86/entry/common.c:51 [inline]\n do_syscall_64+0x35/0x80 arch/x86/entry/common.c:81\n entry_SYSCALL_64_after_hwframe+0x6e/0xd8\n\nThis happens because of a race condition between:\n\n- The 9p client sending an invalid flush request and later cleaning it up;\n- The 9p client in p9_read_work() canceled all pending requests.\n\n Thread 1 Thread 2\n ...\n p9_client_create()\n ...\n p9_fd_create()\n ...\n p9_conn_create()\n ...\n // start Thread 2\n INIT_WORK(\u0026amp;m-\u0026gt;rq, p9_read_work);\n p9_read_work()\n ...\n p9_client_rpc()\n ...\n ...\n p9_conn_cancel()\n ...\n spin_lock(\u0026amp;m-\u0026gt;req_lock);\n ...\n p9_fd_cancelled()\n ...\n ...\n spin_unlock(\u0026amp;m-\u0026gt;req_lock);\n // status rewrite\n p9_client_cb(m-\u0026gt;client, req, REQ_STATUS_ERROR)\n // first remove\n list_del(\u0026amp;req-\u0026gt;req_list);\n ...\n\n spin_lock(\u0026amp;m-\u0026gt;req_lock)\n ...\n // second remove\n list_del(\u0026amp;req-\u0026gt;req_list);\n spin_unlock(\u0026amp;m-\u0026gt;req_lock)\n ...\n\nCommit 74d6a5d56629 (\u0026quot;9p/trans_fd: Fix concurrency del of req_list in\np9_fd_cancelled/p9_read_work\u0026quot;) fixes a concurrency issue in the 9p filesystem\nclient where the req_list could be deleted simultaneously by both\np9_read_work and p9_fd_cancelled functions, but for the case where req-\u0026gt;status\nequals REQ_STATUS_RCVD.\n\nUpdate the check for req-\u0026gt;status in p9_fd_cancelled to skip processing not\njust received requests, but anything that is not SENT, as whatever\nchanged the state from SENT also removed the request from its list.\n\nFound by Linux Verification Center (linuxtesting.org) with Syzkaller.\n\n[updated the check from status == RECV || status == ERROR to status != SENT](CVE-2025-40027)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nexfat: validate cluster allocation bits of the allocation bitmap\n\nsyzbot created an exfat image with cluster bits not set for the allocation\nbitmap. exfat-fs reads and uses the allocation bitmap without checking\nthis. The problem is that if the start cluster of the allocation bitmap\nis 6, cluster 6 can be allocated when creating a directory with mkdir.\nexfat zeros out this cluster in exfat_mkdir, which can delete existing\nentries. This can reallocate the allocated entries. In addition,\nthe allocation bitmap is also zeroed out, so cluster 6 can be reallocated.\nThis patch adds exfat_test_bitmap_range to validate that clusters used for\nthe allocation bitmap are correctly marked as in-use.(CVE-2025-40307)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbatman-adv: stop tp_meter sessions during mesh teardown\n\nTP meter sessions remain linked on bat_priv-\u0026gt;tp_list after the netlink\nrequest has already finished. When the mesh interface is removed,\nbatadv_mesh_free() currently tears down the mesh without first draining\nthese sessions.\n\nA running sender thread or a late incoming tp_meter packet can then keep\nprocessing against a mesh instance which is already shutting down.\nSynchronize tp_meter with the mesh lifetime by stopping all active\nsessions from batadv_mesh_free() and waiting for sender threads to exit\nbefore teardown continues.(CVE-2026-46208)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: diag: reject stale associations in dump_one path\n\nThe SCTP exact sock_diag lookup can hold a transport reference, block on\nlock_sock(sk), and then resume after sctp_association_free() has marked\nthe association dead and freed its bind address list.\n\nWhen that happens, inet_assoc_attr_size() and\ninet_diag_msg_sctpasoc_fill() can still dereference association state\nthat is no longer valid for reporting. In particular,\ninet_diag_msg_sctpasoc_fill() may read an empty bind-address list as a\nreal sctp_sockaddr_entry and trigger an out-of-bounds read from\nunrelated association memory.\n\nReject the association after taking the socket lock if it has been\nreaped or detached from the endpoint, and report the lookup as stale.\nThis keeps the exact dump-one path from formatting torn association\nstate.(CVE-2026-52917)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nlibceph: Fix potential out-of-bounds access in crush_decode()\n\nA message of type CEPH_MSG_OSD_MAP containing a crush map with at least\none bucket has two fields holding the bucket algorithm. If the values\nin these two fields differ, an out-of-bounds access can occur. This is\nthe case because the first algorithm field (alg) is used to allocate\nthe correct amount of memory for a bucket of this type, while the second\nalgorithm field inside the bucket (b-\u0026gt;alg) is used in the subsequent\nprocessing.\n\nThis patch fixes the issue by adding a check that compares alg and\nb-\u0026gt;alg and aborts the processing in case they differ. Furthermore,\nb-\u0026gt;alg is set to 0 in this case, because the destruction of the crush\nmap also uses this field to determine the bucket type, which can again\nresult in an out-of-bounds access when trying to free the memory pointed\nto by the fields of the bucket. To correctly free the memory allocated\nfor the bucket in such a case, the corresponding call to kfree is moved\nfrom the algorithm-specific crush_destroy_bucket functions to the\ngeneric crush_destroy_bucket().(CVE-2026-52955)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nhv_netvsc: use kmap_local_page in netvsc_copy_to_send_buf\n\nnetvsc_copy_to_send_buf() copies page buffer entries into the VMBus\nsend buffer using phys_to_virt() on the entry PFN. Entries for the\nRNDIS header and the skb linear data come from kmalloc\u0026apos;d memory and\nare always in the kernel direct map, but entries for skb fragments\nreference page cache or user pages, which on 32-bit x86 with\nCONFIG_HIGHMEM=y can live above the LOWMEM boundary. For such a page\nphys_to_virt() returns an address outside the direct map and the\nsubsequent memcpy() faults on the transmit softirq path, which is\nfatal.\n\nMap the pages with kmap_local_page() instead, handling two properties\nof the page buffer entries:\n\n - pb[i].pfn is a Hyper-V PFN at HV_HYP_PAGE_SIZE (4K) granularity,\n not a native PFN. Reconstruct the physical address first and derive\n the native page from it, so the mapping stays correct where\n PAGE_SIZE \u0026gt; HV_HYP_PAGE_SIZE (e.g. arm64 with 64K pages).\n\n - Since commit 41a6328b2c55 (\u0026quot;hv_netvsc: Preserve contiguous PFN\n grouping in the page buffer array\u0026quot;), an entry describes a full\n physically contiguous fragment and pb[i].len can exceed PAGE_SIZE,\n while kmap_local_page() maps a single page. Copy page by page,\n splitting at native page boundaries.\n\nThe copy path only handles packets smaller than the send section size\n(6144 bytes by default); larger packets take the cp_partial path where\nonly the RNDIS header is copied. So entries here are bounded by the\nsection size and a copy is split at most once on 4K-page systems. On\n!CONFIG_HIGHMEM configs kmap_local_page() folds to page_address() and\nno mapping work is added.(CVE-2026-53199)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: fix uninit-value in __sctp_rcv_asconf_lookup()\n\n__sctp_rcv_asconf_lookup() in net/sctp/input.c only checks that the ASCONF\nchunk can hold the ADDIP header and a parameter header, then calls\naf-\u0026gt;from_addr_param(), which reads the full address (16 bytes for IPv6)\ntrusting the parameter\u0026apos;s declared length.\n\nAn unauthenticated peer can send a truncated trailing ASCONF chunk that\ndeclares an IPv6 address parameter but stops after the 4-byte parameter\nheader; reached from the no-association lookup path, from_addr_param() then\nreads uninitialized bytes past the parameter.\n\nImpact: an unauthenticated SCTP peer makes the receive path read up to 16\nbytes of uninitialized memory past a truncated ASCONF address parameter.\n\nThe sibling __sctp_rcv_init_lookup() bounds parameters with\nsctp_walk_params(); this path open-codes the fetch and omits the bound.\nVerify the whole address parameter lies within the chunk before\nfrom_addr_param() reads it, the same class of fix as commit 51e5ad549c43\n(\u0026quot;net: sctp: fix KMSAN uninit-value in sctp_inq_pop\u0026quot;).(CVE-2026-53225)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntipc: fix slab-use-after-free Read in tipc_aead_decrypt_done\n\ntipc_aead_decrypt() goes straight from tipc_bearer_hold(b) to\ncrypto_aead_decrypt(req) without taking a reference on the netns, unlike\nthe encrypt path. When crypto_aead_decrypt() is offloaded asynchronously\n(e.g. the SIMD aead wrapper queuing to cryptd), the cryptd worker runs\ntipc_aead_decrypt_done() later. If the bearer\u0026apos;s netns is torn down in the\nmeantime, cleanup_net() -\u0026gt; tipc_exit_net() -\u0026gt; tipc_crypto_stop() frees the\nper-netns tipc_crypto, and the completion then reads it:\ntipc_aead_decrypt_done() dereferences aead-\u0026gt;crypto-\u0026gt;stats and\naead-\u0026gt;crypto-\u0026gt;net, and tipc_crypto_rcv_complete() dereferences\naead-\u0026gt;crypto-\u0026gt;aead[] and the node table -- reading freed memory.\n\nDecoded KASAN splat (v7.1-rc7, CONFIG_KASAN_INLINE + TIPC + TIPC_CRYPTO):\n\n BUG: KASAN: slab-use-after-free in tipc_aead_decrypt_done (net/tipc/crypto.c:999)\n Read of size 8 at addr ffff8881056258a8 by task kworker/u16:2/51\n Workqueue: events_unbound\n Call Trace:\n tipc_aead_decrypt_done (net/tipc/crypto.c:999)\n process_one_work (kernel/workqueue.c:3314)\n worker_thread (kernel/workqueue.c:3397 kernel/workqueue.c:3478)\n kthread (kernel/kthread.c:436)\n ret_from_fork (arch/x86/kernel/process.c:158)\n ret_from_fork_asm (arch/x86/entry/entry_64.S:245)\n\n Allocated by task 169:\n __kasan_kmalloc (mm/kasan/common.c:398 mm/kasan/common.c:415)\n tipc_crypto_start (net/tipc/crypto.c:1502)\n tipc_init_net (net/tipc/core.c:72)\n ops_init (net/core/net_namespace.c:137)\n setup_net (net/core/net_namespace.c:446)\n copy_net_ns (net/core/net_namespace.c:579)\n create_new_namespaces (kernel/nsproxy.c:132)\n __x64_sys_unshare (kernel/fork.c:3316)\n do_syscall_64 (arch/x86/entry/syscall_64.c:63)\n entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:121)\n\n Freed by task 8:\n kfree (mm/slub.c:6566)\n tipc_exit_net (net/tipc/core.c:119)\n cleanup_net (net/core/net_namespace.c:704)\n process_one_work (kernel/workqueue.c:3314)\n kthread (kernel/kthread.c:436)\n\nThis is the same class of bug that commit e279024617134 (\u0026quot;net/tipc: fix\nslab-use-after-free Read in tipc_aead_encrypt_done\u0026quot;) fixed for the encrypt\nside. The encrypt path takes maybe_get_net(aead-\u0026gt;crypto-\u0026gt;net) before\ncrypto_aead_encrypt() and drops it with put_net() on the synchronous\nreturn paths and in tipc_aead_encrypt_done(); the -EINPROGRESS/-EBUSY\nreturn keeps the reference for the async callback to release. The decrypt\npath was left without the equivalent guard.\n\nMirror the encrypt-side fix on the decrypt path: take a net reference\nbefore crypto_aead_decrypt() (failing with -ENODEV and the matching\nbearer put if it cannot be acquired), keep it across the\n-EINPROGRESS/-EBUSY async return, and drop it with put_net() on the\nsynchronous success/error return and at the end of\ntipc_aead_decrypt_done().\n\nReproduced under KASAN on v7.1-rc7: a UDP bearer with a cluster key is\nflooded with crafted encrypted frames from an unknown peer (driving the\ncluster-key decrypt path) while the bearer\u0026apos;s netns is repeatedly torn\ndown. The completion must run asynchronously to outlive\ntipc_crypto_stop(); on x86 the stock aesni gcm(aes) now decrypts\nsynchronously, so the async path was exercised via cryptd offload. The\nunguarded aead-\u0026gt;crypto dereference in tipc_aead_decrypt_done() is the\nunpatched upstream path; tipc_aead_decrypt() still lacks\nmaybe_get_net(aead-\u0026gt;crypto-\u0026gt;net), so the completion can outlive the free\non any config where crypto_aead_decrypt() goes async.\n\nFound by 0sec automated security-research tooling (https://0sec.ai).(CVE-2026-63801)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: conntrack: tcp: do not force CLOSE on invalid-seq RST without direction check\n\nAn unintended behavior in the TCP conntrack state machine allows a\nconnection to be forced into the CLOSE state using an RST packet with an\ninvalid sequence number.\n\nSpecifically, after a SYN packet is observed, an RST with an invalid SEQ\ncan transition the conntrack entry to TCP_CONNTRACK_CLOSE, regardless of\nwhether the RST corresponds to the expected reply direction. The relevant\ncode path assumes the RST is a response to an outgoing SYN, but does not\nvalidate packet direction or ensure that a matching SYN was actually sent\nin the opposite direction.\n\nAs a result, a crafted packet sequence consisting of a SYN followed by an\ninvalid-sequence RST can prematurely terminate an active NAT entry. This\nmakes connection teardown easier than intended.\n\nSo, tighten the state transition logic to ensure that RST-triggered\nCLOSE transitions only occur when the RST is a valid response to a\npreviously observed SYN in the correct direction.(CVE-2026-63913)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm: route MIGRATE notifications to caller\u0026apos;s netns\n\nxfrm_send_migrate() in net/xfrm/xfrm_user.c and pfkey_send_migrate()\nin net/key/af_key.c both hardcode \u0026amp;init_net for the multicast that\nannounces a successful XFRM_MSG_MIGRATE / SADB_X_MIGRATE.\n\nXFRM_MSG_MIGRATE arrives on a per-netns NETLINK_XFRM socket, and the\nrest of the xfrm/af_key netlink path was made netns-aware in 2008.\nThe other 14 multicast paths in xfrm_user.c route their event using\nxs_net(x), xp_net(xp) or sock_net(skb-\u0026gt;sk); only the migrate path\nwas missed.\n\nTwo consequences of the init_net hardcoding:\n\n 1. The notification (selector, old/new endpoint addresses, and the\n km_address) is delivered to listeners on init_net\u0026apos;s\n XFRMNLGRP_MIGRATE / pfkey BROADCAST_ALL groups rather than on\n the issuing netns. An IKE daemon running in init_net therefore\n receives migration notifications originating from any other\n netns on the host.\n\n 2. An IKE daemon running inside a non-init netns and subscribed\n to its own XFRMNLGRP_MIGRATE / pfkey groups never receives the\n notification of its own migration. IKEv2 MOBIKE / address-update\n handling inside a netns is silently broken.\n\nThread struct net through km_migrate() and the xfrm_mgr.migrate\nfunction pointer, drop the \u0026amp;init_net override in xfrm_send_migrate()\nand pfkey_send_migrate(), and pass the caller\u0026apos;s net (already in\nscope in xfrm_migrate() via sock_net(skb-\u0026gt;sk)) all the way down.\nstruct xfrm_mgr is in-tree only and not exported as a stable API,\nso the function-pointer signature change is internal.\n\npfkey_broadcast() is already netns-aware via net_generic(net,\npfkey_net_id) since the pernet conversion. The five other\npfkey_broadcast() callers in af_key.c already pass xs_net(x),\nsock_net(sk) or a per-netns net, so this only removes the\n\u0026amp;init_net outlier.(CVE-2026-63914)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: fix race between sctp_wait_for_connect and peeloff\n\nsctp_wait_for_connect() drops and re-acquires the socket lock while\nwaiting for the association to reach ESTABLISHED state. During this\nwindow, another thread can peeloff the association to a new socket via\ngetsockopt(SCTP_SOCKOPT_PEELOFF), changing asoc-\u0026gt;base.sk. After\nre-acquiring the old socket lock, sctp_wait_for_connect() returns\nsuccess without noticing the migration \u2014 the caller then accesses\nthe association under the wrong lock in sctp_datamsg_from_user().\n\nAdd the same sk != asoc-\u0026gt;base.sk check that sctp_wait_for_sndbuf()\nalready has, returning an error if the association was migrated while\nwe slept.(CVE-2026-63971)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbatman-adv: tt: fix negative last_changeset_len\n\nbatadv_piv_tt::last_changeset_len len was declared as s16, but the field is\nnever intended to hold a negative value. When a value greater than 32767 is\nassigned, it wraps to a negative signed integer.\n\nIn batadv_send_my_tt_response(), last_changeset_len is temporarily widened\nto s32. The incorrectly negative s16 value propagates into the s32, causing\nbatadv_tt_prepare_tvlv_local_data() to allocate a full sized buffer but\npopulates only a small portion of it with the collected changeset. All\nremaining bits are kept uninitialized.\n\nUsing an u16 avoids this type confusion and ensures that no (negative) sign\nextension is performed in batadv_send_my_tt_response().(CVE-2026-64089)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbatman-adv: bla: avoid double decrement of bla.num_requests\n\nThe bla.num_requests is increased when no request_sent was in progress. And\nit is decremented in various places (announcement was received, backbone is\npurged, periodic work). But the check if the request_sent is actually set\nto a specific state and the atomic_dec/_inc are not safe because they are\nnot atomic (TOCTOU) and multiple such code portions can run concurrently.\n\nAt the same time, it is necessary to modify request_sent (state) and\nbla.num_requests atomically. Otherwise batadv_bla_send_request() might set\nrequest_sent to 1 and is interrupted. batadv_handle_announce() can then\nset request_sent back to 0 and decrement num_requests before\nbatadv_bla_send_request() incremented it.\n\nThe two operations must therefore be locked. And since state (request_sent)\nand wait_periods are only accessed inside this lock, they can be converted\nto simpler datatypes. And to avoid that the bla.num_requests is touched by\na parallel running context with a valid backbone_gw reference after\nbatadv_bla_purge_backbone_gw() ran, a third state \u0026quot;stopped\u0026quot; is required to\ncorrectly signal that a backbone_gw is in the state of being cleaned up.(CVE-2026-64095)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: qualcomm: rmnet: fix endpoint use-after-free in rmnet_dellink()\n\nrmnet_dellink() removes the endpoint from the hash table with\nhlist_del_init_rcu() and then immediately frees it with kfree(). However,\nRCU readers on the receive path (rmnet_rx_handler -\u0026gt;\n__rmnet_map_ingress_handler) may still hold a reference to the endpoint and\ndereference ep-\u0026gt;egress_dev after the memory has been freed. The endpoint is\na kmalloc-32 object, and the stale read at offset 8 corresponds to the\negress_dev pointer.\n\n BUG: unable to handle page fault for address: ffffffffde942eef\n Oops: 0002 [#1] SMP NOPTI\n CPU: 1 UID: 0 PID: 137 Comm: poc_write Not tainted 7.0.0+ #4 PREEMPTLAZY\n RIP: 0010:rmnet_vnd_rx_fixup (rmnet_vnd.c:27)\n Call Trace:\n \u0026lt;TASK\u0026gt;\n __rmnet_map_ingress_handler (rmnet_handlers.c:48 rmnet_handlers.c:101)\n rmnet_rx_handler (rmnet_handlers.c:129 rmnet_handlers.c:235)\n __netif_receive_skb_core.constprop.0 (net/core/dev.c:6096)\n __netif_receive_skb_one_core (net/core/dev.c:6208)\n netif_receive_skb (net/core/dev.c:6467)\n tun_get_user (drivers/net/tun.c:1955)\n tun_chr_write_iter (drivers/net/tun.c:2003)\n vfs_write (fs/read_write.c:688)\n ksys_write (fs/read_write.c:740)\n \u0026lt;/TASK\u0026gt;\n\nAdd an rcu_head field to struct rmnet_endpoint and replace kfree() with\nkfree_rcu() so the endpoint memory remains valid through the RCU grace\nperiod. Also remove the rmnet_vnd_dellink() call and inline only the\nnr_rmnet_devs decrement, since rmnet_vnd_dellink() would set\nep-\u0026gt;egress_dev to NULL during the grace period, creating a data race\nwith lockless readers.(CVE-2026-64188)\n\nIn the Linux kernel, the following vulnerability has been resolved: tipc: fix out-of-bounds read in broadcast Gap ACK blocks. A broadcast PROTOCOL/STATE_MSG can carry a Gap ACK blocks record in its data area. tipc_get_gap_ack_blks() only verifies that the record\u0026apos;s len field is self-consistent with its ugack_cnt/bgack_cnt counts (sz == struct_size(p, gacks, ugack_cnt + bgack_cnt)); it does not check that the record actually fits in the message data area, msg_data_sz(). The unicast caller tipc_link_proto_rcv() bounds it, but the broadcast caller tipc_bcast_sync_rcv() discards the returned size, so tipc_link_advance_transmq() copies the record off the receive skb with an attacker-controlled count, leading to an out-of-bounds read. This could allow an attacker to read beyond the allocated buffer, potentially causing information disclosure or system crash.(CVE-2026-64450)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBluetooth: btusb: fix use-after-free on registration failure\n\nMake sure to release the sibling interfaces in case controller\nregistration fails to avoid use-after-free and double-free when they are\neventually disconnected.\n\nThis issue was reported by Sashiko while reviewing a fix for a wakeup\nsource leak in the btusb probe errors paths.(CVE-2026-64471)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nALSA: firewire: isight: bound the sample count to the packet payload\n\nisight_packet() takes the frame count from the device iso packet and\nchecks it only against the device claimed iso length.\n\n\tcount = be32_to_cpu(payload-\u0026gt;sample_count);\n\tif (likely(count \u0026lt;= (length - 16) / 4))\n\t\tisight_samples(isight, payload-\u0026gt;samples, count);\n\nlength is the iso header data_length. It can be up to 0xffff. So the\ngate allows a count up to about 16379. isight_samples() then copies\ncount frames out of payload-\u0026gt;samples into the PCM DMA buffer.\n\npayload-\u0026gt;samples holds only 2 * MAX_FRAMES_PER_PACKET values. The\ndevice multiplexes two samples per frame. A count past\nMAX_FRAMES_PER_PACKET reads past the payload. A count past the buffer\nsize writes past runtime-\u0026gt;dma_area. The smallest PCM buffer is larger\nthan MAX_FRAMES_PER_PACKET. Bounding the count to MAX_FRAMES_PER_PACKET\nkeeps both the read and the write in range.\n\nA malicious or faulty Apple iSight on the FireWire bus reaches this\nduring a normal capture.\n\nAdd the MAX_FRAMES_PER_PACKET bound to the gate.(CVE-2026-64483)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nlibceph: Reject monmaps advertising zero monitors\n\nA message of type CEPH_MSG_MON_MAP contains a monmap that is sent from a\nmonitor to the client. This monmap contains information about the\nexisting monitors in the cluster. Currently, a monmap indicating that\nthere are zero monitors in the cluster is treated as valid. However, it\nis impossible to have zero monitors in the cluster and still receive a\nvalid monmap from a monitor. Therefore, such a monmap must be corrupted\nand should be treated as invalid. Furthermore, a monmap with a monitor\ncount of zero can subsequently crash the client when attempting to open\na session with a monitor in __open_session(). This happens because the\n\u0026quot;BUG_ON(monc-\u0026gt;monmap-\u0026gt;num_mon \u0026lt; 1)\u0026quot; assertion in pick_new_mon() is\ntriggered.\n\nThis patch extends a check in ceph_monmap_decode() to also reject\narriving mon_maps with num_mon == 0 rather than only with\nnum_mon \u0026gt; CEPH_MAX_MON.\n\n[ idryomov: drop \u0026quot;log output for unusual values of num_mon\u0026quot; part ](CVE-2026-68155)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nlibceph: refresh auth-\u0026gt;authorizer_buf{,_len} after authorizer update\n\nceph_x_create_authorizer() caches au-\u0026gt;buf-\u0026gt;vec.iov_base and\nau-\u0026gt;buf-\u0026gt;vec.iov_len in struct ceph_auth_handshake. These\ncached values are then used by the messenger connect code when\nsending the authorizer.\n\nceph_x_update_authorizer() can rebuild the authorizer when a newer\nservice ticket is available. If the rebuilt authorizer no longer\nfits in the existing buffer, ceph_x_build_authorizer() drops its\nreference to au-\u0026gt;buf and allocates a new one. If this is the final\nreference, ceph_buffer_put() frees the old ceph_buffer and its\nvec.iov_base, but auth-\u0026gt;authorizer_buf still points at that freed\nmemory.\n\nA subsequent msgr1 reconnect can therefore queue the stale pointer\nand trigger a KASAN slab-use-after-free in _copy_from_iter() while\ntcp_sendmsg() copies the authorizer.\n\nRefresh auth-\u0026gt;authorizer_buf and auth-\u0026gt;authorizer_buf_len after a\nsuccessful authorizer rebuild so the messenger sends the current\nbuffer.(CVE-2026-68156)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmedia: cx231xx: fix devres lifetime\n\nUSB drivers bind to USB interfaces and any device managed resources\nshould have their lifetime tied to the interface rather than parent USB\ndevice. This avoids issues like memory leaks when drivers are unbound\nwithout their devices being physically disconnected (e.g. on probe\ndeferral or configuration changes).\n\nFix the driver state lifetime so that it is released on driver unbind.(CVE-2026-68227)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nIB/mad: Drop unmatched RMPP responses before reassembly\n\nKernel-handled RMPP receive processing starts reassembly for active\nDATA responses before the response is matched to an outstanding send.\nThe normal match happens later, after ib_process_rmpp_recv_wc() has\neither assembled a complete message or consumed the segment.\n\nThat ordering lets an unsolicited response that routes to a kernel\nRMPP agent by the high TID bits allocate or extend RMPP receive state\nbefore the full TID and source address are checked against a real\nrequest. A reordered burst can therefore reach the receive-side\ninsertion path even though the response would not match any send.\n\nFor kernel-handled RMPP DATA responses, require the existing\nib_find_send_mad() match before entering RMPP reassembly. The matcher\nalready checks the full TID, management class and source address/GID\nagainst the agent wait, backlog and in-flight send lists. If there is\nno match, drop the response without creating RMPP state.\n\nThis leaves the RMPP window behavior unchanged and only rejects\nresponses that have no corresponding request.(CVE-2026-68425)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nntfs: sanitize MFT references returned from ntfs_lookup_inode_by_name()\n\nntfs_lookup_inode_by_name() returns MFT references read from directory\nindex entries on disk. These values are untrusted, but the function can\ncurrently return an error-marked MFT reference to its callers without\nvalidating it.\n\nCallers later decode lookup failures with MREF_ERR(). A crafted NTFS image\ncan set the MREF error bit while leaving the low bits as an arbitrary\nvalue, causing callers to consume a bogus pseudo-errno instead of treating\nthe lookup result as corrupted on-disk metadata.\n\nFix this at the source by normalizing every error-marked MFT reference\nreturned from ntfs_lookup_inode_by_name() to ERR_MREF(-EIO). Apply this to\nall four directory lookup return paths so every caller gets a validated\nresult without needing additional checks or an API change.\n\nThis keeps the sanitization in the common lookup helper, which is cleaner\nthan duplicating validation in each caller.(CVE-2026-72188)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/mlx5: Fix undefined shift of user RQ WQE size\n\nset_rq_size() computes the RQ WQE size as \u0026quot;1 \u0026lt;\u0026lt; rq_wqe_shift\u0026quot; based on\nthe user-provided rq_wqe_shift, which is only checked to be greater than\n32, so shifts of 32 are still accepted. A shift of 31 also overflows a\nsigned integer, leading to undefined behavior.\n\nUse check_shl_overflow() to compute the RQ WQE size and reject any\ninvalid values.(CVE-2026-74297)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBluetooth: hci_core: Fix UAF in hci_unregister_dev()\n\nhci_unregister_dev() does not disable cmd_timer and ncmd_timer\nbefore the hci_dev structure is freed. If a timeout fires\nduring device teardown, the callback dereferences freed memory\n(including the hdev-\u0026gt;reset function pointer), leading to a\nuse-after-free.\n\nAdd disable_delayed_work_sync() calls alongside the existing\ndisable_work_sync() calls to ensure both timers are fully\nquiesced before teardown proceeds.(CVE-2026-74302)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/rxe: Copy WQE to local buffer in non-SRQ receive path\n\nFor non-SRQ QPs, the responder reads WQE fields directly from the\nshared queue buffer mapped into userspace. This allows a malicious\nuser to modify fields like num_sge or sge entries while the kernel\nis processing the WQE, leading to out-of-bounds reads in\nrxe_resp_check_length() and copy_data().\n\nIntroduce get_recv_wqe() that validates num_sge and copies the WQE\nto a kernel-local buffer before processing, matching the approach\nalready used for SRQ WQEs in get_srq_wqe(). The srq_wqe buffer is\nreused since SRQ and non-SRQ paths are mutually exclusive per QP.(CVE-2026-74377)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/srpt: fix integer overflow in immediate data length check\n\nimm_buf-\u0026gt;len is a user-controlled uint32_t received from the network.\nAdding it to imm_data_offset without overflow checking allows a\nmalicious initiator to send len=0xFFFFFFFF, causing req_size to wrap\naround to a small value, bypassing the bounds check, and subsequently\npassing a ~4GB length to sg_init_one().\n\nUse check_add_overflow() to detect wrapping before the comparison.(CVE-2026-74394)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/mlx5: Fix devx subscribe-event unwind NULL dereference\n\nMLX5_IB_METHOD_DEVX_SUBSCRIBE_EVENT() links event_sub into sub_list\nbefore initializing the fields used by the shared error path.\n\nIf eventfd_ctx_fdget() then fails, the unwind path dereferences\nevent_sub-\u0026gt;ev_file in uverbs_uobject_put() and calls\nsubscribe_event_xa_dealloc() with an unset xa_key_level1.\n\nsubscribe_event_xa_alloc() creates the XA entry exactly once for a given\nkey_level1, on the first occurrence of that key. The unwind path must\ntherefore call subscribe_event_xa_dealloc() exactly once for it as well.\n\nEnforce that by adding devx_key_in_sub_list() and calling\nsubscribe_event_xa_dealloc() only when the last matching pending entry is\nbeing cleaned up.(CVE-2026-74395)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nIB/mlx5: Fix transport-domain rollback and initialize lb mutex earlier\n\nmlx5_ib_alloc_transport_domain() allocates a transport domain and then\nmay fail in mlx5_ib_enable_lb(). In that case, the allocated TD is leaked.\n\nFix this by deallocating the TD when mlx5_ib_enable_lb() returns an\nerror. Also return 0 explicitly in the no-loopback-capability success\nbranch, and move dev-\u0026gt;lb.mutex initialization to mlx5_ib_stage_init_init().(CVE-2026-74397)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nALSA: usb-audio: fix OOB write in snd_usbmidi_akai_output()\n\nsnd_usbmidi_akai_output() computes its fill-loop bound\n\n\tbuf_end = ep-\u0026gt;max_transfer - MAX_AKAI_SYSEX_LEN - 1;\n\nas a signed int, so a small device-advertised bulk-OUT max_transfer\nmakes buf_end negative. The loop guard then compares the u32\nurb-\u0026gt;transfer_buffer_length against that negative int: the usual\narithmetic conversion turns buf_end into a large unsigned value, so the\nguard stays true and each iteration keeps appending SysEx framing and\npayload bytes past the end of the URB transfer buffer, which is only\nmax_transfer bytes long.\n\nA USB device that advertises a tiny bulk-OUT endpoint can therefore\ntrigger an attacker-length- and content-controlled heap out-of-bounds\nwrite when a process writes to the created /dev/snd/midiC*D* node.\n\nReturn early when there is no room for even one SysEx, so the loop is\nnever entered with a bound that would wrap. The loop is the last\nstatement of the function, so bailing out is equivalent to it not\nrunning.\n\nDiscovered by XBOW, triaged by Baul Lee \u0026lt;(CVE-2026-74499)\n\nIn the Linux kernel, the following vulnerability has been resolved: sctp: keep chunk-\u0026gt;transport in step with the list it is queued on. __sctp_outq_flush_rtx() moves a gap-acked chunk onto another transport\u0026apos;s transmitted list without updating chunk-\u0026gt;transport. The chunk then sits on a live transport\u0026apos;s list while chunk-\u0026gt;transport still names a different one. If that transport is removed - sctp_assoc_rm_peer() from an ASCONF Delete-IP - sctp_transport_free() RCU-frees it and the chunk is left with a dangling pointer. A SACK that reneges on the TSN clears the flag, and the next SACK reaches inside the freed transport. KASAN reports a slab-use-after-free read in sctp_check_transmitted(), freed from sctp_assoc_rm_peer().(CVE-2026-74588)\n\nIn the Linux kernel, a deadlock vulnerability has been found in the ceph filesystem. A reader can hang forever in __ceph_get_caps() when the client no longer holds FILE_RD, but local cap state still says that the capability is already wanted (via mds_wanted). One way to trigger this is through MDS cap revocation. If another client performs a conflicting operation, the MDS can revoke FILE_RD from the reader; the next read then has to reacquire FILE_RD. If the cap update that should request FILE_RD never reaches the MDS after cap-\u0026gt;mds_wanted was raised, the reader is left holding only non-file caps while local mds_wanted still includes the file read caps, causing the reader to wait indefinitely.(CVE-2026-80527)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nlibceph: fix OOB read in decode_watchers() via missing bounds check\n\nceph_start_decoding() validates that struct_len bytes remain in the\nbuffer after the encoding header, but accepts struct_len=0 as valid:\nceph_decode_need(p, end, 0, bad) always passes. When a malicious or\ncompromised OSD sends an obj_list_watch_response_t reply with\nstruct_len=0, ceph_start_decoding() returns success with p == end,\nleaving zero bytes guaranteed for subsequent reads.\n\nThe immediately following ceph_decode_32(p) in decode_watchers() has\nno preceding bounds check. With p == end this is a 4-byte read past\nthe validated buffer boundary. The garbage value is then passed\ndirectly to kzalloc_objs() as the watcher count.\n\nThe sibling function decode_watcher() already uses the safe variants\n(ceph_decode_copy_safe, ceph_decode_64_safe, ceph_decode_skip_32)\nafter its own ceph_start_decoding() call. decode_watchers() is the\nonly site that uses the bare variant, confirming an oversight.\n\nFix by replacing ceph_decode_32(p) with ceph_decode_32_safe(p, end,\n*num_watchers, bad), consistent with the established pattern.\n\nAttacker model: a malicious or compromised OSD in a multi-tenant Ceph\ndeployment (e.g. cloud) can trigger this against any kernel client\nthat calls CEPH_OSD_OP_LIST_WATCHERS, without any further privileges\nbeyond OSD session establishment.\n\n[ idryomov: trim changelog ](CVE-2026-80557)",
"id": "OESA-2026-3702",
"modified": "2026-09-05T15:04:06Z",
"published": "2026-09-05T15:04:06Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-3702"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-40027"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-40307"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46208"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-52917"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-52955"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53199"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53225"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63801"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63913"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63914"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63971"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64089"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64095"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64188"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64450"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64471"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64483"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-68155"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-68156"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-68227"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-68425"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72188"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74297"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74302"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74377"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74394"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74395"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74397"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74499"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74588"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-80527"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-80557"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2025-40027",
"CVE-2025-40307",
"CVE-2026-46208",
"CVE-2026-52917",
"CVE-2026-52955",
"CVE-2026-53199",
"CVE-2026-53225",
"CVE-2026-63801",
"CVE-2026-63913",
"CVE-2026-63914",
"CVE-2026-63971",
"CVE-2026-64089",
"CVE-2026-64095",
"CVE-2026-64188",
"CVE-2026-64450",
"CVE-2026-64471",
"CVE-2026-64483",
"CVE-2026-68155",
"CVE-2026-68156",
"CVE-2026-68227",
"CVE-2026-68425",
"CVE-2026-72188",
"CVE-2026-74297",
"CVE-2026-74302",
"CVE-2026-74377",
"CVE-2026-74394",
"CVE-2026-74395",
"CVE-2026-74397",
"CVE-2026-74499",
"CVE-2026-74588",
"CVE-2026-80527",
"CVE-2026-80557"
]
}
OESA-2026-3703 (CVE-2025-37979)
Vulnerability from osv_openeuler – Published: 2026-09-05 15:04 – Updated: 2026-09-05 15:04 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
ASoC: qcom: Fix sc7280 lpass potential buffer overflow
Case values introduced in commit 5f78e1fb7a3e ("ASoC: qcom: Add driver support for audioreach solution") cause out of bounds access in arrays of sc7280 driver data (e.g. in case of RX_CODEC_DMA_RX_0 in sc7280_snd_hw_params()).
Redefine LPASS_MAX_PORTS to consider the maximum possible port id for q6dsp as sc7280 driver utilizes some of those values.
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2025-37979)
In the Linux kernel, the following vulnerability has been resolved:
net: usb: asix_devices: Fix PHY address mask in MDIO bus initialization
Syzbot reported shift-out-of-bounds exception on MDIO bus initialization.
The PHY address should be masked to 5 bits (0-31). Without this mask, invalid PHY addresses could be used, potentially causing issues with MDIO bus operations.
Fix this by masking the PHY address with 0x1f (31 decimal) to ensure it stays within the valid range.(CVE-2025-38736)
In the Linux kernel, the following vulnerability has been resolved:
crypto: af_alg - Fix page reassignment overflow in af_alg_pull_tsgl
When page reassignment was added to af_alg_pull_tsgl the original loop wasn't updated so it may try to reassign one more page than necessary.
Add the check to the reassignment so that this does not happen.
Also update the comment which still refers to the obsolete offset argument.(CVE-2026-43078)
In the Linux kernel, the following vulnerability has been resolved:
crypto: algif_aead - snapshot IV for async AEAD requests
AF_ALG AEAD AIO requests currently use the socket-wide IV buffer during request processing. For async requests, later socket activity can update that shared state before the original request has fully completed, which can lead to inconsistent IV handling.
Snapshot the IV into per-request storage when preparing the AEAD request, so in-flight operations no longer depend on mutable socket state.(CVE-2026-46028)
In the Linux kernel, the following vulnerability has been resolved:
xfrm: esp: restore combined single-frag length gate
The ESP out-of-place fast path appends the trailer in esp_output_head() before esp_output_tail() allocates the destination page frag. The head-side gate currently checks skb->data_len and tailen separately, but the tail code allocates a single destination frag from the combined post-trailer skb->data_len.
Reject the page-frag fast path when the combined aligned length exceeds a page. Otherwise skb_page_frag_refill() may fall back to a single page while the destination sg still spans the combined skb->data_len.
Restore this combined-length page gate for both IPv4 and IPv6.(CVE-2026-63912)
In the Linux kernel, the following vulnerability has been resolved: ipvs: reload ip header after head reallocation. __ip_vs_get_out_rt() calls skb_ensure_writable() which may reallocate skb->head, causing the previously obtained IP header pointer to become a dangling pointer, leading to a use-after-free vulnerability.(CVE-2026-68476)
In the Linux kernel, the following vulnerability has been resolved:
ipvs: fix more places with wrong ipv6 transport offsets
Sashiko reports for more incorrect IPv6 transport offsets.
The app code for TCP was assuming IPv4 network header even after the ipvsh argument was provided. This can cause problems with apps over IPv6. As for the only official app in the kernel tree (FTP) this problem is harmless because we use Netfilter to mangle the FTP ports and we do not adjust the TCP seq numbers.
Also, provide correct offset of the ICMPV6 header in ip_vs_out_icmp_v6() for correct checksum checks when the IPv6 packet has extension headers.(CVE-2026-68477)
In the Linux kernel, the following vulnerability has been resolved:
ipvs: use parsed transport offset in SCTP state lookup
set_sctp_state() reads the SCTP chunk header again in order to drive the IPVS SCTP state table. For IPv6 it computes the offset with sizeof(struct ipv6hdr), while the surrounding IPVS code uses iph.len from ip_vs_fill_iph_skb(), where ipv6_find_hdr() has already skipped extension headers and found the real transport header.
This makes the state machine read from the wrong offset for IPv6 SCTP packets that carry extension headers. For example, an INIT packet with an 8-byte destination options header can be scheduled correctly by sctp_conn_schedule(), but set_sctp_state() reads the first byte of the SCTP verification tag as a DATA chunk type. The connection then moves from NONE to ESTABLISHED instead of INIT1, gets the longer established timeout, and updates the active/inactive destination counters incorrectly. This happens even though the SCTP handshake has not completed.
Use the parsed transport offset passed down from ip_vs_set_state() for the SCTP chunk-header lookup. For IPv4 and IPv6 packets without extension headers this preserves the existing offset.(CVE-2026-72021)
In the Linux kernel, the following vulnerability has been resolved:
ieee802154: admin-gate legacy LLSEC dump operations
In net/ieee802154/netlink.c, the legacy IEEE802154_NL family ops table builds the LLSEC dump entries (LLSEC_LIST_KEY, LLSEC_LIST_DEV, LLSEC_LIST_DEVKEY, LLSEC_LIST_SECLEVEL) with IEEE802154_DUMP() which sets no .flags, so generic netlink runs them ungated. The modern nl802154 family admin-gates the equivalent reads via NL802154_CMD_GET_SEC_KEY and friends with .flags = GENL_ADMIN_PERM.
Any local uid that can open AF_NETLINK / NETLINK_GENERIC can resolve the "802.15.4 MAC" family and dump LLSEC_LIST_KEY on any wpan netdev that has an LLSEC key installed; the dump handler writes the raw 16-byte AES-128 key bytes (IEEE802154_ATTR_LLSEC_KEY_BYTES, copied verbatim from struct ieee802154_llsec_key.key) into the reply. Recovering the AES key compromises 802.15.4 LLSEC link confidentiality and authenticity, since LLSEC uses CCM* and the same key authenticates and encrypts frames.
Impact: any local uid with no capabilities can read the raw 16-byte AES-128 LLSEC key from the kernel keytable on any wpan netdev that has an administrator-installed LLSEC key, by issuing an LLSEC_LIST_KEY dump on the legacy IEEE802154_NL generic-netlink family.
Introduce IEEE802154_DUMP_PRIV() mirroring IEEE802154_DUMP() but setting .flags = GENL_ADMIN_PERM, and use it for the four LLSEC dump entries. LIST_PHY and LIST_IFACE retain IEEE802154_DUMP() because the modern nl802154 family exposes their equivalents to unprivileged readers by design (NL802154_CMD_GET_WPAN_PHY and NL802154_CMD_GET_INTERFACE carry "can be retrieved by unprivileged users" annotations).(CVE-2026-72049)
In the Linux kernel, the following vulnerability has been resolved:
net: ip6_gre: require CAP_NET_ADMIN in the device netns for changelink
ip6gre_changelink() and ip6erspan_changelink() operate on at most two netns, dev_net(dev) and the tunnel link netns t->net. They differ once the device is created in or moved to a netns other than the one the request runs in. The rtnl changelink path checks CAP_NET_ADMIN only against dev_net(dev), so a caller privileged there but not in t->net can rewrite a tunnel that lives in t->net.
Gate both ops on rtnl_dev_link_net_capable() at their top, before any attribute is parsed.(CVE-2026-72052)
In the Linux kernel, the following vulnerability has been resolved:
net: ipip: require CAP_NET_ADMIN in the device netns for changelink
ipip_changelink() operates on at most two netns, dev_net(dev) and the tunnel link netns t->net. They differ once the device is created in or moved to a netns other than the one the request runs in. The rtnl changelink path checks CAP_NET_ADMIN only against dev_net(dev), so a caller privileged there but not in t->net can rewrite a tunnel that lives in t->net.
Gate ipip_changelink() on rtnl_dev_link_net_capable() at its top, before any attribute is parsed.(CVE-2026-72053)
In the Linux kernel, the following vulnerability has been resolved:
net: ip_vti: require CAP_NET_ADMIN in the device netns for changelink
vti_changelink() operates on at most two netns, dev_net(dev) and the tunnel link netns t->net. They differ once the device is created in or moved to a netns other than the one the request runs in. The rtnl changelink path checks CAP_NET_ADMIN only against dev_net(dev), so a caller privileged there but not in t->net can rewrite a tunnel that lives in t->net.
Gate vti_changelink() on rtnl_dev_link_net_capable() at its top, before any attribute is parsed.(CVE-2026-72054)
In the Linux kernel, the following vulnerability has been resolved:
net: sit: require CAP_NET_ADMIN in the device netns for changelink
ipip6_changelink() operates on at most two netns, dev_net(dev) and the tunnel link netns t->net. They differ once the device is created in or moved to a netns other than the one the request runs in. The rtnl changelink path checks CAP_NET_ADMIN only against dev_net(dev), so a caller privileged there but not in t->net can rewrite a tunnel that lives in t->net.
Gate ipip6_changelink() on rtnl_dev_link_net_capable() at its top, before any attribute is parsed. sit was the one tunnel type not covered by the recent series that added this check to the other changelink() handlers.(CVE-2026-72061)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5e: macsec: fix use-after-free of metadata_dst on RX SC delete
When an offloaded MACsec RX SC is deleted, macsec_del_rxsc_ctx() freed the per-SC metadata_dst with metadata_dst_free(), which kfree()s the object unconditionally and ignores the dst reference count. The RX datapath in mlx5e_macsec_offload_handle_rx_skb() looks up the SC under rcu_read_lock() via xa_load(), takes a reference with dst_hold() and attaches the dst to the skb with skb_dst_set(). A reader that already obtained the rx_sc pointer can race with the delete path and operate on freed memory.
Fix the owner side by dropping the reference with dst_release() instead of freeing unconditionally, and convert the RX datapath to dst_hold_safe() so a reader racing the SC delete cannot attach a dst whose last reference was just dropped; only attach it when a reference was actually taken.
mlx5e_macsec_add_rxsc() also published sc_xarray_element via xa_alloc() before rx_sc->md_dst was allocated and initialised, so a datapath reader that looked the SC up by fs_id could observe rx_sc with md_dst still NULL or, on weakly-ordered architectures, a non-NULL md_dst pointer whose contents were not yet visible. NULL-check the xa_load() result and md_dst on the datapath, and reorder add_rxsc() so the xa_alloc() publish happens only after md_dst is fully initialised; the xarray RCU publish then pairs with the rcu_read_lock()/xa_load() in the datapath.
Note: macsec_del_rxsc_ctx() also kfree()s rx_sc->sc_xarray_element without an RCU grace period while the same datapath reads it under rcu_read_lock(); that is a separate pre-existing issue left to a follow-up patch.
Found by 0sec automated security-research tooling (https://0sec.ai).(CVE-2026-72072)
In the Linux kernel, the following vulnerability has been resolved:
nvmet-rdma: handle inline data with a nonzero offset
nvmet_rdma_use_inline_sg() maps the host-controlled inline data offset into the per-command inline scatterlist. The bounds check admits any offset with off + len <= inline_data_size, but the mapping still assumes the data begins in the first inline page:
sg->offset = off;
sg->length = min_t(int, len, PAGE_SIZE - off);
When a port is configured with inline_data_size > PAGE_SIZE (settable up to max(SZ_16K, PAGE_SIZE)), an offset in (PAGE_SIZE, inline_data_size] makes "PAGE_SIZE - off" underflow, so sg->length is set to ~4 GiB and the block backend reads far past the first inline page. num_pages(len) also ignores the offset, so an in-bounds offset whose [off, off+len) span crosses a page boundary under-counts the scatterlist.
Map the offset properly: split it into a page index and an in-page offset, start the scatterlist at that page, and size the page count from page_off + len. Because the request scatterlist may now start at inline_sg[page_idx] rather than inline_sg[0], generalize the inline-SGL identity test in nvmet_rdma_release_rsp() to a range test; otherwise the persistent inline scatterlist is mistaken for an allocated one and nvmet_req_free_sgls() frees an inline page (and warns in free_large_kmalloc()).(CVE-2026-72129)
In the Linux kernel, the following vulnerability has been resolved:
tpm: Make the TPM character devices non-seekable
The TPM character devices expose a sequential command/response interface, but their open handlers leave FMODE_PREAD and FMODE_PWRITE enabled.
After a command leaves a response pending, pread(fd, buf, 16, 0x1400) passes 0x1400 as off to tpm_common_read(). The transfer length is bounded by response_length, but the offset is used unchecked when forming data_buffer + off. A sufficiently large offset therefore causes an out-of-bounds heap read through copy_to_user() and, if the copy succeeds, an out-of-bounds zero-write through the following memset().
Positional I/O does not provide coherent semantics for this interface. An arbitrary pread offset cannot represent how much of a response has been consumed sequentially. The write callback always stores a command at the start of data_buffer, while pwrite() does not update file->f_pos and can leave the sequential read cursor stale.
Call nonseekable_open() from both open handlers. This removes FMODE_PREAD and FMODE_PWRITE, causing positional reads and writes to fail with -ESPIPE before reaching the TPM callbacks, and explicitly marks the files non-seekable. Normal read() and write() continue to use the existing sequential f_pos cursor, leaving the response state machine unchanged.
Tested on Linux 6.12 with KASAN and a swtpm TPM2 device:
- sequential partial reads returned the complete response
- pread() and preadv() with offset 0x1400 returned -ESPIPE
- pwrite() and pwritev() with offset zero returned -ESPIPE
- the pending response remained intact after the rejected operations
- a subsequent normal command/response cycle completed normally
- no KASAN report was produced.(CVE-2026-72135)
In the Linux kernel, the following vulnerability has been resolved:
xfrm: xfrm_interface: require CAP_NET_ADMIN in the device netns for changelink
xfrmi_changelink() operates on at most two netns, dev_net(dev) and the interface link netns xi->net. They differ once the device is created in or moved to a netns other than the one the request runs in. The rtnl changelink path checks CAP_NET_ADMIN only against dev_net(dev), so a caller privileged there but not in xi->net can rewrite an interface that lives in xi->net.
Gate xfrmi_changelink() on rtnl_dev_link_net_capable() at its top, before any attribute is parsed.(CVE-2026-72136)
In the Linux kernel, the following vulnerability has been resolved: net: thunderbolt: Fix frags[] overflow by bounding frame_count. tbnet_poll() assembles a multi-frame ThunderboltIP packet into one skb. The first frame goes into the skb linear area and every further frame is added as a page fragment. A packet of frame_count frames therefore ends up with frame_count - 1 fragments. tbnet_check_frame() only bounds the peer supplied frame_count to TBNET_RING_SIZE / 4 (64), which is far above MAX_SKB_FRAGS (17 by default). A peer that sends a packet of 19 or more small frames pushes nr_frags past MAX_SKB_FRAGS, so skb_add_rx_frag() writes past skb_shinfo()->frags[] and corrupts memory after the shared info.(CVE-2026-72157)
In the Linux kernel, the following vulnerability has been resolved: mm/mm_init: fix uninitialized struct pages for ZONE_DEVICE. If DAX memory is hotplugged into an unoccupied subsection of an early section, section_activate() reuses the unoptimized boot memmap. However, compound_nr_pages() still assumes that vmemmap optimization is in effect and initializes only the reduced number of struct pages. As a result, the remaining tail struct pages are left uninitialized, which can later lead to unexpected behavior or crashes. Fix this by treating early sections as unoptimized when calculating how many struct pages to initialize.(CVE-2026-72172)
In the Linux kernel, the following vulnerability has been resolved:
SUNRPC: Bound-check xdr_buf_to_bvec() stores before writing
xdr_buf_to_bvec() writes a bio_vec into the caller's array before testing whether that slot is in range, and the head branch performs the store with no check at all. When the caller's budget is exactly used up, the next store lands one element past the end of the array. The overflow label returns count - 1, which masks the surplus store but cannot undo it.
rq_bvec, the array passed by nfsd_vfs_write(), is allocated to exactly rq_maxpages entries with no slack. The OOB store can land in adjacent slab memory; the bv_len and bv_offset fields written there are derived from client-supplied RPC payload sizes.
Move the in-range check ahead of the store in the head, page-loop, and tail branches. With the check at the top of each sequence, count is incremented only after a successful store, so the overflow label can return count directly.(CVE-2026-72217)
In the Linux kernel, the following vulnerability has been resolved:
sunrpc: wait for in-flight TLS handshake callback when cancel loses race
When wait_for_completion_interruptible_timeout() in svc_tcp_handshake() returns 0 (timeout) or -ERESTARTSYS (signal) and tls_handshake_cancel() then returns false, handshake_complete() has won the cancellation race: it has set HANDSHAKE_F_REQ_COMPLETED and is about to invoke svc_tcp_handshake_done(), but the callback's side effects on xpt_flags and on svsk->sk_handshake_done have not yet committed.
The current code reads xpt_flags immediately to decide whether the session succeeded. Two races result.
If the callback has executed set_bit(XPT_TLS_SESSION) but not yet clear_bit(XPT_HANDSHAKE), svc_tcp_handshake() sees a session, enqueues the transport, and returns. svc_xprt_received() then clears XPT_BUSY, a worker thread picks the transport up, the dispatcher in svc_handle_xprt() observes XPT_HANDSHAKE still set, and xpo_handshake is invoked a second time. That svc_tcp_handshake() calls init_completion(&svsk->sk_handshake_done) while the original callback concurrently calls complete_all() on it, corrupting the embedded swait_queue.
If the callback has set HANDSHAKE_F_REQ_COMPLETED but not yet entered svc_tcp_handshake_done(), svc_tcp_handshake() reads XPT_TLS_SESSION as clear and tears the connection down even though the handshake is about to succeed.
Wait for the callback to commit before inspecting xpt_flags. The completion is guaranteed to fire because handshake_complete() invokes svc_tcp_handshake_done() unconditionally once it has set HANDSHAKE_F_REQ_COMPLETED.(CVE-2026-72221)
In the Linux kernel, the following vulnerability has been resolved:
sunrpc: pin svc_xprt across the asynchronous TLS handshake callback
svc_tcp_handshake() stores the raw svc_xprt pointer in tls_handshake_args.ta_data and submits the request through tls_server_hello_x509(). The handshake core takes only sock_hold(req->hr_sk); nothing references the embedding struct svc_sock that svc_tcp_handshake_done() reaches via container_of().
Two close races leave the in-flight callback writing through a freed svc_sock. svc_sock_free() calls tls_handshake_cancel() and discards its return value: a false return means handshake_complete() has already set HANDSHAKE_F_REQ_COMPLETED but hp_done() may not have finished, yet svc_sock_free() proceeds to kfree(svsk). The cancel-loser fall-through inside svc_tcp_handshake() itself produces the same window: when wait_for_completion_interruptible_timeout() returns <= 0 (timeout or signal) and tls_handshake_cancel() returns false, the function does not drain, returns, and svc_handle_xprt() calls svc_xprt_received(), which clears XPT_BUSY and can drop the last reference. A concurrent close then runs svc_sock_free() while svc_tcp_handshake_done() is still updating xpt_flags and walking svsk->sk_handshake_done.
The corruption surfaces as set_bit/clear_bit RMW into the freed xpt_flags slab slot and as complete_all() walking and writing the freed wait_queue_head_t list embedded in sk_handshake_done -- a slab-corruption primitive, not a benign read. The path is reachable on any TLS-enabled NFS server whenever a connection close overlaps the tlshd downcall delivery window; the interruptible wait means signal delivery suffices, not just SVC_HANDSHAKE_TO expiry.
Take svc_xprt_get(xprt) immediately before tls_server_hello_x509() so the in-flight callback owns its own reference. Release it on the two edges where the callback is guaranteed not to fire -- submission failure from tls_server_hello_x509() and a successful tls_handshake_cancel() -- and at the tail of svc_tcp_handshake_done() after complete_all().
cel: rewrote commit message to describe the actual change
In the Linux kernel, the following vulnerability has been resolved:
batman-adv: retrieve ethhdr after potential skb realloc on RX
pskb_may_pull() in batadv_interface_rx() could reallocate the buffer behind the skb. Variables which were pointing to the old buffer need to be reassigned to avoid an use-after-free.
This was done correctly for the VLAN header but missed for the ethernet header which is later used for the TT and AP isolation handling.(CVE-2026-72235)
In the Linux kernel, the following vulnerability has been resolved:
KVM: Move kvm_io_bus_get_dev() locking responsibilities to callers
kvm_io_bus_get_dev() returns a device that is only matched by the address, and nothing else. This can cause a lifetime issue if the matched device is not the expected type, as by the time the caller can introspect the object, it might be gone (the srcu lock having been dropped).
Given that there is only a single user of this helper, the simplest option is to move the locking responsibility to the caller, which can keep the srcu lock held for as long as it wants.
Note that this aligns with other kvm_io_bus*() helpers, which already require the srcu lock to be held by the callers.(CVE-2026-72282)
In the Linux kernel, the following vulnerability has been resolved: smb: client: fix overflow in passthrough ioctl bounds check. smb2_ioctl_query_info() validates the PASSTHRU_FSCTL response payload before copying it to userspace. The payload offset and length both come from 32-bit fields. The bounds check currently adds OutputOffset and qi.input_buffer_length directly, so the addition can wrap in 32-bit arithmetic before the result is compared against the response buffer length. A malicious server can use a large OutputOffset and a small OutputCount to make the wrapped sum pass the bounds check. The later copy_to_user() then reads from io_rsp + OutputOffset, outside the response buffer, leading to an out-of-bounds read.(CVE-2026-72310)
In the Linux kernel, the following vulnerability has been resolved:
dm era: fix NULL pointer dereference in metadata_open()
metadata_open() returns NULL when kzalloc_obj() fails, but the caller era_ctr() only checks IS_ERR(md). Since IS_ERR(NULL) returns false, the NULL pointer is treated as a valid result and later assigned to era->md, leading to a NULL pointer dereference when the metadata is accessed.
Fix this by returning ERR_PTR(-ENOMEM) on allocation failure, consistent with dm-cache-metadata.c, dm-thin-metadata.c, and dm-clone-metadata.c which all use ERR_PTR(-ENOMEM) for the same pattern.(CVE-2026-72316)
In the Linux kernel, the following vulnerability has been resolved:
SUNRPC: pin upper rpc_clnt across the TLS connect_worker
The TLS connect path has a use-after-free: nothing pins the upper rpc_clnt across the delayed connect_worker. xs_connect() stores task->tk_client in sock_xprt::clnt as a raw pointer and queues the worker; for TLS-secured transports that worker is xs_tcp_tls_setup_socket(), which reads several fields out of the saved pointer (cl_timeout, cl_program, cl_prog, cl_vers, cl_cred, cl_stats) to construct the args for the inner handshake rpc_clnt.
The xprt does not reference the rpc_clnt; the rpc_clnt references the xprt. xs_destroy() does cancel the connect_worker, but it runs only when the xprt's refcount drops to zero, which cannot happen until the rpc_clnt releases its cl_xprt reference in rpc_free_client_work(). When a TLS handshake fails fatally (for example, an mTLS mount whose client cert does not match the server), the connecting task is woken with -EACCES and exits, the mount caller invokes rpc_shutdown_client(), and the upper rpc_clnt is freed before the queued connect_worker fires. xs_tcp_tls_setup_socket() then dereferences the freed clnt, producing the refcount_t underflow Michael Nemanov reported.
Take a reference on the upper rpc_clnt in xs_connect() for TLS transports via a new rpc_hold_client() helper, and drop it in the connect_worker's exit path with rpc_release_client(). The xprt_lock_connect() / xprt_unlock_connect() pairing already serialises xs_connect() with xs_tcp_tls_setup_socket(), so the take and release are balanced one-for-one.
The non-TLS connect worker (xs_tcp_setup_socket) never reads sock_xprt::clnt, so leave that path alone and avoid the clnt-holds-xprt-holds-clnt cycle that would otherwise prevent xprt destruction.(CVE-2026-72317)
In the Linux kernel, the following vulnerability has been resolved:
cifs: validate DFS referral string offsets
parse_dfs_referrals() validates that the response header and referral array fit in the received buffer, but each referral also contains string offsets supplied by the server.
Those offsets are used to compute the DfsPath and NetworkAddress string pointers without checking whether they still point inside the response buffer. A malformed referral can therefore make the computed pointer exceed the end of the buffer. The resulting negative max_len is then passed to cifs_strndup_from_utf16(), and the non-Unicode path forwards it to kstrndup() as a size_t, allowing strnlen() to read out of bounds.
Validate each string offset before deriving the string pointer.(CVE-2026-72318)
In the Linux kernel, the following vulnerability has been resolved:
ipvs: ensure inner headers in ICMP errors are in headroom
Sashiko points out that after stripping the outer headers with pskb_pull() we should ensure the inner IP headers in ICMP errors from tunnels are present in the skb headroom for functions like ipv4_update_pmtu(), icmp_send() and IP_VS_DBG().
Also, add more checks for the length of the inner headers.(CVE-2026-72319)
In the Linux kernel, the following vulnerability has been resolved:
net/tls: Consume empty data records in tls_sw_read_sock()
A peer may send a zero-length TLS application_data record; TLS 1.3 explicitly permits these as a traffic-analysis countermeasure (RFC 8446, Section 5.1). After decryption such a record has full_len == 0. tls_sw_read_sock() hands it to the read_actor, which has no payload to consume and returns zero. The loop treats a zero return as backpressure (used <= 0), requeues the skb at the head of rx_list, and stops. rx_list is serviced head-first on the next call, so the empty record is dequeued, fails the same way, and is requeued again; every later record on the connection is blocked behind it.
tls_sw_recvmsg() does not stall on this: a zero-length data record copies nothing and falls through to consume_skb(). Mirror that in the read_sock() path by recognizing an empty data record before the actor runs, consuming it, and continuing.(CVE-2026-72330)
In the Linux kernel, the following vulnerability has been resolved:
qede: fix off-by-one in BD ring consumption on build_skb failure
qede_rx_build_skb() and qede_tpa_rx_build_skb() do not check for a NULL return from qede_build_skb(). When it returns NULL under memory pressure, the functions still consume a BD from the ring before returning NULL. The callers then recycle additional BDs, resulting in one extra BD being consumed (off-by-one). This desynchronizes the BD ring, which can corrupt DMA page reference counts and lead to SLUB freelist corruption.
Commit 4e910dbe3650 ("qede: confirm skb is allocated before using") added a NULL check inside qede_build_skb() to prevent a NULL pointer dereference, but did not address the missing NULL checks in the callers, making this off-by-one reachable.
Fix this by adding NULL checks for the return value of qede_build_skb() in both qede_rx_build_skb() and qede_tpa_rx_build_skb(), returning NULL immediately before any BD ring manipulation.(CVE-2026-72339)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5e: Fix HV VHCA stats agent registration race
mlx5e_hv_vhca_stats_create() registers the stats agent through mlx5_hv_vhca_agent_create(). The helper publishes the agent in hv_vhca->agents[type] under agents_lock and immediately schedules an asynchronous control invalidation on the HV VHCA workqueue before returning to mlx5e.
The asynchronous invalidation invokes the control agent's invalidate callback, which reads the hypervisor control block and forwards the command to mlx5e_hv_vhca_stats_control(). That callback may either:
- call cancel_delayed_work_sync(&priv->stats_agent.work), or
- call queue_delayed_work(priv->wq, &sagent->work, sagent->delay).
However, the delayed_work and priv->stats_agent.agent are only initialized after mlx5_hv_vhca_agent_create() returns to mlx5e:
agent = mlx5_hv_vhca_agent_create(...); /* publish + invalidate */
...
priv->stats_agent.agent = agent; /* too late */
INIT_DELAYED_WORK(&priv->stats_agent.work, ...); /* too late */
If the asynchronous control path runs before the two assignments above, it can:
- Operate on an uninitialized delayed_work whose timer.function is NULL. queue_delayed_work() calls add_timer() unconditionally, so when the timer expires the timer softirq invokes a NULL function pointer.
- Re-initialize the timer later through INIT_DELAYED_WORK() while the timer is already enqueued in the timer wheel, corrupting the hlist (entry.pprev cleared while the previous bucket node still points at this entry).
- When the worker eventually runs, mlx5e_hv_vhca_stats_work() reads sagent->agent (NULL) and dereferences it inside mlx5_hv_vhca_agent_write().
Fix this by:
- Initializing priv->stats_agent.work before invoking mlx5_hv_vhca_agent_create(), so the work is always in a valid state when the control callback observes it.
- Adding a struct mlx5_hv_vhca_agent *ctx_update out-parameter to mlx5_hv_vhca_agent_create(). The helper writes the agent pointer to ctx_update before publishing into hv_vhca->agents[] and triggering the agents_update flow, so any callback subsequently invoked from that flow already sees a valid priv->stats_agent.agent. This avoids having the control callback participate in agent initialization.
While at it, access priv->stats_agent.agent with READ_ONCE()/WRITE_ONCE() for the cross-CPU access with the worker, and clear priv->stats_agent.buf on the agent_create() failure path.(CVE-2026-72342)
In the Linux kernel, the following vulnerability has been resolved:
bridge: stp: Fix a potential use-after-free when deleting a bridge
The three STP timers are not supposed to be armed while the bridge is administratively down. They are synchronously deactivated when the bridge is put administratively down and the various call sites check for 'IFF_UP' before arming them.
This check is missing from br_topology_change_detection() and it is possible to engineer a situation in which the topology change timer is armed while the bridge is administratively down, resulting in a use-after-free [1] when the bridge is deleted.
Fix by adding the missing check and for good measures synchronously shutdown the three timers when the bridge is deleted.
[1] ODEBUG: free active (active state 0) object: ffff88811662b9b0 object type: timer_list hint: br_topology_change_timer_expired (net/bridge/br_stp_timer.c:120) WARNING: lib/debugobjects.c:629 at debug_print_object+0x1bc/0x450, CPU#9: ip/359(CVE-2026-72389)
In the Linux kernel, the following vulnerability has been resolved:
seg6: validate SRH length before reading fixed fields
seg6_validate_srh() reads fixed SRH fields such as srh->type and srh->hdrlen before checking that the supplied length covers the fixed struct ipv6_sr_hdr fields.
The BPF SEG6 encap path reaches this with a BPF program-supplied pointer and length: bpf_lwt_push_encap() and the SEG6 local BPF END_B6 and END_B6_ENCAP actions call bpf_push_seg6_encap(), which forwards the length to seg6_validate_srh() with no minimum-size guard. A 2-byte SEG6 encap header can therefore make the validator read srh->type at offset 2 beyond the caller-supplied buffer.
Reject lengths shorter than the fixed SRH at the top of seg6_validate_srh(), before any field is read. This fixes the BPF helper path and keeps the common validator robust.(CVE-2026-72400)
In the Linux kernel, the following vulnerability has been resolved:
ice: fix FDIR CTRL VSI resource leak in ice_reset_all_vfs()
Resetting all VFs causes resource leak on VFs with FDIR filters enabled as CTRL VSIs are only invalidated and not freed. Fix by using ice_vf_ctrl_vsi_release() instead of ice_vf_ctrl_invalidate_vsi() which aligns behavior with the ice_reset_vf() function.
Reproduction: echo 1 > /sys/class/net/$pf/device/sriov_numvfs ethtool -N $vf flow-type ether proto 0x9000 action 0 echo 1 > /sys/class/net/$pf/device/reset(CVE-2026-72425)
In the Linux kernel, the following vulnerability has been resolved:
xfrm: validate selector family and prefixlen during match
syzbot reported a shift-out-of-bounds in xfrm_selector_match() due to AF_UNSPEC selector with large prefixlen (e.g. 128) matched against IPv4 flow (when XFRM_STATE_AF_UNSPEC is set).
Fix this by:
- Rejecting mismatched families in xfrm_selector_match.
- Returning false in addr4_match if prefixlen > 32.
- Returning false in addr_match if prefixlen > 128 (prevents overflow).(CVE-2026-72450)
In the Linux kernel, the following vulnerability has been resolved:
apparmor: aa_label_alloc use aa_label_free on alloc failure
aa_label_alloc() allocates a secid before allocating or taking the label proxy. If the later proxy step fails, the error path only freed the label memory, leaking any resources initialized by aa_label_init().
Use aa_label_free() on the failure path so partially initialized labels release their secid and other label resources before the backing memory is freed.(CVE-2026-72459)
In the Linux kernel, the following vulnerability has been resolved:
apparmor: check label build before no_new_privs test
aa_change_profile() builds a replacement label with fn_label_build_in_scope() before the no_new_privs subset check. The build helper can fail and return NULL or an ERR_PTR, but the result was passed to aa_label_is_unconfined_subset() before the existing IS_ERR_OR_NULL() check.
Reuse the existing target-label build failure handling immediately after the build. This preserves the current audit handling while preventing the subset helper from dereferencing an invalid label.(CVE-2026-72460)
In the Linux kernel, the following vulnerability has been resolved:
xprtrdma: Repost Receive buffers for malformed replies
rpcrdma_wc_receive() decrements the transport's Receive count for every completion before it dispatches a successful Receive to rpcrdma_reply_handler(). The handler must post a replacement Receive WR before returning unless ownership of the rep has moved elsewhere, as on the backchannel path.
Commit 2ae50ad68cd7 ("xprtrdma: Close window between waking RPC senders and posting Receives") moved the Receive refill out of rpcrdma_wc_receive(), where it had run ahead of every reply, into rpcrdma_reply_handler() so that the responder's credit grant could be parsed before reposting. The bad-version and short-reply exits never reach that refill: they recycle the rep and return without calling rpcrdma_post_recvs().
A remote peer can therefore drain the client's posted Receive queue by sending a sustained stream of replies that are shorter than the fixed transport header or that carry an unrecognized RPC/RDMA version. Each such reply consumes one posted Receive without replacing it. Once the queue empties, the peer's next Send finds no posted Receive and the transport stalls until reconnect.
Route both malformed-reply exits through the shared repost tail after recycling the rep, refilling against buf->rb_credits, the most recent accepted credit grant. Neither exit updates the congestion window, so RPCs admitted under the previous grant remain in flight awaiting replies. A smaller refill target would let a stream of malformed replies ratchet the posted Receive count down to the batch floor while the congestion window still admits rb_credits RPCs; a burst of valid replies to those RPCs could then overrun the posted Receives, and because the client connects with rnr_retry_count of zero, a single RNR NAK terminates the connection. Refilling against rb_credits also restores the target that applied to malformed replies before commit 2ae50ad68cd7 ("xprtrdma: Close window between waking RPC senders and posting Receives") when rpcrdma_post_recvs() computed it from rb_credits internally. rb_credits is at least one from connection establishment onward, so the repost path always keeps Receives posted.(CVE-2026-72464)
In the Linux kernel, the following vulnerability has been resolved:
xprtrdma: Fix bcall rep leak and unbounded peek
rpcrdma_is_bcall() decodes a reply's first words to decide whether the frame is a backchannel call. Two issues in that decode path let a short or malformed reply leak the receive buffer and drain the Receive queue.
First, the speculative peek
p = xdr_inline_decode(xdr, 0);
/* five p++ reads follow */
asks xdr_inline_decode() for zero bytes, which returns xdr->p without consulting xdr->end. The five subsequent __be32 reads can then walk up to 20 bytes past the wire payload into stale regbuf contents and misclassify the reply as a backchannel call.
Second, after the post-peek
p = xdr_inline_decode(xdr, 3 * sizeof(*p));
if (unlikely(!p))
return true;
the short-header arm returns true without calling rpcrdma_bc_receive_call(). The contract with the caller is that a true return transfers ownership of rep to the backchannel path:
rpcrdma_reply_handler()
if (rpcrdma_is_bcall(r_xprt, rep))
return; /* bare return, skips out_post */
...
out_post:
rpcrdma_post_recvs(r_xprt, credits + ...);
Because rpcrdma_bc_receive_call() never ran, no one took rep, but rpcrdma_reply_handler still bare-returns past rpcrdma_rep_put() and rpcrdma_post_recvs(). The rep, with its persistently DMA-mapped receive buffer, is orphaned on rb_all_reps and freed only at transport teardown. This completion reposts nothing, so its slot is reclaimed only when a later forward-channel reply reaches out_post and rpcrdma_post_recvs() allocates a fresh rep to backfill; absent that traffic the Receive queue drains and the peer's Sends draw RNR NAKs.
Fix by consulting xdr->end after the zero-length peek so the five __be32 reads cannot run unless 20 bytes of wire payload remain. A byte-precise comparison against xdr->end is required because a non-4-aligned receive rounds the stream's word count up past the true payload. Also return false from the short-header arm so the reply falls through the normal out_norqst cleanup chain (rpcrdma_rep_put() plus rpcrdma_post_recvs()).(CVE-2026-72466)
In the Linux kernel, the following vulnerability has been resolved:
xprtrdma: Decouple req recycling from RPC completion
rl_kref formerly served two distinct lifetimes through a single refcount: it gated when a Reply could wake its RPC task, and it gated when an rpcrdma_req could return to its free pool. The marshal path took the Send-side reference only when SGEs needed DMA-unmap (sc_unmap_count > 0), which made a Send carrying only pre-registered buffers an exception: the Reply handler dropped rl_kref from 1 to 0 and freed the req while the HCA might still be DMA-reading from its send buffer.
Give rl_kref a narrower job. The RPC layer takes one reference when slot allocation hands a req out. rpcrdma_prepare_send_sges() takes a Send-side reference unconditionally after WR preparation succeeds. xprt_rdma_free_slot() and xprt_rdma_bc_free_rqst() drop the RPC-layer reference; rpcrdma_sendctx_unmap() drops the Send-side reference. The req returns to its free pool only after both owners have signed off.
The existing kref_init(&req->rl_kref) call in rpcrdma_prepare_send_sges() is removed. Initialization moves to the slot-allocation paths (xprt_rdma_alloc_slot and rpcrdma_bc_rqst_get), and the release callback re-arms rl_kref before the req returns to a free pool. A re-init in the marshal path would discard the RPC-layer reference that already exists on entry.
Three invariants follow:
-
Any rpcrdma_req held by an rpc_rqst has rl_kref >= 1. xprt_rdma_alloc_slot(), rpcrdma_bc_rqst_get(), and the backlog-wake branch in xprt_rdma_alloc_slot() each kref_init rl_kref before publishing the req. Without this invariant, an RPC task that aborts between slot allocation and marshal (gss_refresh failure or signal during call_connect, for example) would drive xprt_release() -> xprt_rdma_free_slot() -> kref_put against a refcount of zero, saturating refcount_t and stranding the slot.
-
The Send-side reference is taken only after WR prep succeeds. A mapping failure in rpcrdma_prepare_send_sges() runs rpcrdma_sendctx_cancel(), which DMA-unmaps the sendctx and clears sc_req without touching rl_kref. The sendctx ring walks in rpcrdma_sendctx_put_locked() and rpcrdma_sendctxs_destroy() skip entries with sc_req == NULL, so a burst of -EIO marshal failures cannot hold reqs off rb_send_bufs.
-
The release callback re-arms rl_kref so the next consumer enters with the invariant satisfied.
Replies now complete the RPC directly. rpcrdma_reply_handler() calls rpcrdma_complete_rqst() in place of kref_put on the non-LocalInv branch. The LocalInv branch already completes the RPC from frwr_unmap_async() and is unaffected.
Because Send-side references can now outlive RPC completion, connection teardown drains sendctx entries whose unsignaled Sends never had a later signaled completion to walk the ring. rpcrdma_sendctxs_destroy() walks the active range and runs rpcrdma_sendctx_unmap() on each entry with a non-NULL sc_req before the request buffers are reset, and is moved ahead of rpcrdma_reqs_reset() in rpcrdma_xprt_disconnect() so the reqs are still in their pre-reset state when the Send-side refs are released.
The drain creates a teardown-ordering hazard on the backchannel path. With the new lifetime, releasing a bc_prealloc req from rpcrdma_req_release() re-adds it to bc_pa_list. The disconnect in xprt_rdma_destroy() runs after xprt_destroy_backchannel() has already emptied bc_pa_list, so the drained reqs would otherwise leak. xprt_rdma_destroy() now runs xprt_rdma_bc_destroy(xprt, 0) a second time after the disconnect to reclaim them.(CVE-2026-72473)
In the Linux kernel, the following vulnerability has been resolved:
power: supply: core: fix supplied_from allocations
If dts property power-supplies has multiple values, then accessing to psy->supplied_from[i-1] in __power_supply_populate_supplied_from will overrun supplied_from array.(CVE-2026-74271)
In the Linux kernel, the following vulnerability has been resolved:
tipc: require net admin for TIPCv2 netlink mutators
TIPCv2 registers mutating generic-netlink operations without admin permission flags. Generic netlink only checks CAP_NET_ADMIN when an operation sets GENL_ADMIN_PERM or GENL_UNS_ADMIN_PERM, so a local unprivileged process can currently change TIPC state through commands such as TIPC_NL_NET_SET, TIPC_NL_KEY_SET, TIPC_NL_KEY_FLUSH, and bearer enable/disable.
The legacy TIPC netlink API already checks netlink_net_capable(..., CAP_NET_ADMIN) for administrative commands. Give the TIPCv2 mutators the equivalent generic-netlink gate. Use GENL_UNS_ADMIN_PERM, which maps to the same namespace-aware CAP_NET_ADMIN check that netlink_net_capable() performs, so the behaviour matches the legacy path and keeps working for CAP_NET_ADMIN holders in a non-initial user namespace (containers).
A QEMU/KASAN repro run as uid/gid 65534 with zero effective capabilities previously succeeded in changing the network id and node identity, setting and flushing key material, and enabling/disabling a UDP bearer. With this patch applied the same operations fail with -EPERM.(CVE-2026-74283)
In the Linux kernel, the following vulnerability has been resolved:
sctp: validate embedded address parameter length
sctp_verify_asconf() and sctp_verify_param() only validate ADD_IP, DEL_IP, and SET_PRIMARY parameters against a fixed minimum size of sizeof(struct sctp_addip_param) + sizeof(struct sctp_paramhdr). This ensures the outer parameter is large enough to contain an embedded address parameter header, but does not verify that the embedded address parameter's declared length fits within the bounds of the outer parameter.
Later, sctp_process_param() and sctp_process_asconf_param() extract the embedded address parameter and pass it to af->from_addr_param(), which uses the address parameter length to parse the variable-length address payload. A malformed peer can therefore advertise an embedded address parameter length that exceeds the remaining bytes in the enclosing parameter.
Validate that addr_param->p.length does not exceed the space available after the sctp_addip_param header before processing the embedded address parameter. Reject malformed parameters when the embedded address length extends beyond the enclosing parameter bounds.
This prevents out-of-bounds reads when parsing malformed parameters carried in INIT or ASCONF processing paths.(CVE-2026-74287)
In the Linux kernel, the following vulnerability has been resolved:
bpf: Tighten cgroup storage cookie checks for prog arrays
The fix in commit abad3d0bad72 ("bpf: Fix oob access in cgroup local storage") is still incomplete. The prog-array compatibility check treats a program with no cgroup storage as compatible with any stored storage cookie. This allows a storage-less program to bridge a tail call chain between an entry program and a storage-using callee even though cgroup local storage at runtime still follows the caller's context, that is, A -> B(no storage) -> C(storage) path.
Requiring exact cookie equality would break the legitimate case of a storage-less leaf program being tail called from a storage-using one. Instead, only accept a zero storage cookie if the program cannot perform tail calls itself. This keeps A -> B(no storage) working while rejecting the A -> B(no storage) -> C(storage) bridge.(CVE-2026-74305)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/rxe: Copy WQE to local buffer in non-SRQ receive path
For non-SRQ QPs, the responder reads WQE fields directly from the shared queue buffer mapped into userspace. This allows a malicious user to modify fields like num_sge or sge entries while the kernel is processing the WQE, leading to out-of-bounds reads in rxe_resp_check_length() and copy_data().
Introduce get_recv_wqe() that validates num_sge and copies the WQE to a kernel-local buffer before processing, matching the approach already used for SRQ WQEs in get_srq_wqe(). The srq_wqe buffer is reused since SRQ and non-SRQ paths are mutually exclusive per QP.(CVE-2026-74377)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/rxe: Fix TOCTOU heap overflow in get_srq_wqe
get_srq_wqe() reads wqe->dma.num_sge from the shared receive queue buffer, which is mapped into userspace. It validates num_sge against max_sge, but then re-reads the same field to calculate the memcpy size. A concurrent userspace thread can modify num_sge between validation and use, causing a heap buffer overflow when copying the WQE into qp->resp.srq_wqe.
Read num_sge into a local variable and use it for both the bounds check and the size calculation.(CVE-2026-74378)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/srpt: fix integer overflow in immediate data length check
imm_buf->len is a user-controlled uint32_t received from the network. Adding it to imm_data_offset without overflow checking allows a malicious initiator to send len=0xFFFFFFFF, causing req_size to wrap around to a small value, bypassing the bounds check, and subsequently passing a ~4GB length to sg_init_one().
Use check_add_overflow() to detect wrapping before the comparison.(CVE-2026-74394)
In the Linux kernel, the following vulnerability has been resolved:
IB/mlx5: Fix transport-domain rollback and initialize lb mutex earlier
mlx5_ib_alloc_transport_domain() allocates a transport domain and then may fail in mlx5_ib_enable_lb(). In that case, the allocated TD is leaked.
Fix this by deallocating the TD when mlx5_ib_enable_lb() returns an error. Also return 0 explicitly in the no-loopback-capability success branch, and move dev->lb.mutex initialization to mlx5_ib_stage_init_init().(CVE-2026-74397)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: addrconf: bail out of dad_failure when state is no longer POSTDAD
addrconf_dad_failure() transitions ifp->state from DAD to POSTDAD via addrconf_dad_end(), which drops ifp->lock on return. The lock is re-acquired after net_info_ratelimited(). A concurrent ipv6_del_addr() can take the lock in that window, set ifp->state to DEAD and run list_del_rcu(&ifp->if_list).
addrconf_dad_failure() then overwrites DEAD with ERRDAD at errdad: and schedules a new dad_work. The work calls ipv6_del_addr() again, hitting the already-poisoned list entry:
general protection fault: 0000 [#1] SMP NOPTI CPU: 4 PID: 217 Comm: kworker/4:1 Workqueue: ipv6_addrconf addrconf_dad_work RIP: 0010:ipv6_del_addr+0xe9/0x280 RAX: dead000000000122 Call Trace: addrconf_dad_stop+0x113/0x140 addrconf_dad_work+0x28c/0x430 process_one_work+0x1eb/0x3b0 worker_thread+0x4d/0x400 kthread+0x104/0x140 ret_from_fork+0x35/0x40
Fold the addrconf_dad_end() logic into addrconf_dad_failure() under a single ifp->lock critical section. The STABLE_PRIVACY branch temporarily drops ifp->lock around address regeneration, so at lock_errdad: verify the state is still POSTDAD before transitioning to ERRDAD; bail out otherwise to avoid overwriting a state set by another path while the lock was released.(CVE-2026-74398)
In the Linux kernel, the following vulnerability has been resolved:
vxlan: Fix potential null-ptr-deref in vxlan_gro_prepare_receive().
udp_tunnel_sock_release() could set sk->sk_user_data to NULL while vxlan_gro_prepare_receive() is running.
Let's check if rcu_dereference_sk_user_data() is NULL after skb_gro_remcsum_init().(CVE-2026-74406)
| URL | Type | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"bpftool-debuginfo-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"kernel-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"kernel-debuginfo-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"kernel-debugsource-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"kernel-devel-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"kernel-headers-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"kernel-source-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"kernel-tools-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"kernel-tools-debuginfo-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"kernel-tools-devel-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"perf-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"perf-debuginfo-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"python3-perf-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm",
"python3-perf-debuginfo-6.6.0-145.1.24.161.oe2403sp1.aarch64.rpm"
],
"src": [
"kernel-6.6.0-145.1.24.161.oe2403sp1.src.rpm"
],
"x86_64": [
"bpftool-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"bpftool-debuginfo-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"kernel-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"kernel-debuginfo-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"kernel-debugsource-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"kernel-devel-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"kernel-headers-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"kernel-source-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"kernel-tools-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"kernel-tools-debuginfo-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"kernel-tools-devel-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"perf-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"perf-debuginfo-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"python3-perf-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm",
"python3-perf-debuginfo-6.6.0-145.1.24.161.oe2403sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:24.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-24.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "6.6.0-145.1.24.161.oe2403sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nASoC: qcom: Fix sc7280 lpass potential buffer overflow\n\nCase values introduced in commit\n5f78e1fb7a3e (\u0026quot;ASoC: qcom: Add driver support for audioreach solution\u0026quot;)\ncause out of bounds access in arrays of sc7280 driver data (e.g. in case\nof RX_CODEC_DMA_RX_0 in sc7280_snd_hw_params()).\n\nRedefine LPASS_MAX_PORTS to consider the maximum possible port id for\nq6dsp as sc7280 driver utilizes some of those values.\n\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2025-37979)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: usb: asix_devices: Fix PHY address mask in MDIO bus initialization\n\nSyzbot reported shift-out-of-bounds exception on MDIO bus initialization.\n\nThe PHY address should be masked to 5 bits (0-31). Without this\nmask, invalid PHY addresses could be used, potentially causing issues\nwith MDIO bus operations.\n\nFix this by masking the PHY address with 0x1f (31 decimal) to ensure\nit stays within the valid range.(CVE-2025-38736)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: af_alg - Fix page reassignment overflow in af_alg_pull_tsgl\n\nWhen page reassignment was added to af_alg_pull_tsgl the original\nloop wasn\u0026apos;t updated so it may try to reassign one more page than\nnecessary.\n\nAdd the check to the reassignment so that this does not happen.\n\nAlso update the comment which still refers to the obsolete offset\nargument.(CVE-2026-43078)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: algif_aead - snapshot IV for async AEAD requests\n\nAF_ALG AEAD AIO requests currently use the socket-wide IV buffer during\nrequest processing. For async requests, later socket activity can\nupdate that shared state before the original request has fully\ncompleted, which can lead to inconsistent IV handling.\n\nSnapshot the IV into per-request storage when preparing the AEAD\nrequest, so in-flight operations no longer depend on mutable socket\nstate.(CVE-2026-46028)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm: esp: restore combined single-frag length gate\n\nThe ESP out-of-place fast path appends the trailer in esp_output_head()\nbefore esp_output_tail() allocates the destination page frag. The\nhead-side gate currently checks skb-\u0026gt;data_len and tailen separately, but\nthe tail code allocates a single destination frag from the combined\npost-trailer skb-\u0026gt;data_len.\n\nReject the page-frag fast path when the combined aligned length exceeds a\npage. Otherwise skb_page_frag_refill() may fall back to a single page while\nthe destination sg still spans the combined skb-\u0026gt;data_len.\n\nRestore this combined-length page gate for both IPv4 and IPv6.(CVE-2026-63912)\n\nIn the Linux kernel, the following vulnerability has been resolved: ipvs: reload ip header after head reallocation. __ip_vs_get_out_rt() calls skb_ensure_writable() which may reallocate skb-\u0026gt;head, causing the previously obtained IP header pointer to become a dangling pointer, leading to a use-after-free vulnerability.(CVE-2026-68476)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipvs: fix more places with wrong ipv6 transport offsets\n\nSashiko reports for more incorrect IPv6 transport offsets.\n\nThe app code for TCP was assuming IPv4 network header\neven after the ipvsh argument was provided. This can\ncause problems with apps over IPv6. As for the only\nofficial app in the kernel tree (FTP) this problem is\nharmless because we use Netfilter to mangle the FTP\nports and we do not adjust the TCP seq numbers.\n\nAlso, provide correct offset of the ICMPV6 header in\nip_vs_out_icmp_v6() for correct checksum checks when\nthe IPv6 packet has extension headers.(CVE-2026-68477)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipvs: use parsed transport offset in SCTP state lookup\n\nset_sctp_state() reads the SCTP chunk header again in order to drive the\nIPVS SCTP state table. For IPv6 it computes the offset with\nsizeof(struct ipv6hdr), while the surrounding IPVS code uses iph.len from\nip_vs_fill_iph_skb(), where ipv6_find_hdr() has already skipped\nextension headers and found the real transport header.\n\nThis makes the state machine read from the wrong offset for IPv6 SCTP\npackets that carry extension headers. For example, an INIT packet with an\n8-byte destination options header can be scheduled correctly by\nsctp_conn_schedule(), but set_sctp_state() reads the first byte of the\nSCTP verification tag as a DATA chunk type. The connection then moves\nfrom NONE to ESTABLISHED instead of INIT1, gets the longer established\ntimeout, and updates the active/inactive destination counters\nincorrectly. This happens even though the SCTP handshake has not\ncompleted.\n\nUse the parsed transport offset passed down from ip_vs_set_state() for\nthe SCTP chunk-header lookup. For IPv4 and IPv6 packets without\nextension headers this preserves the existing offset.(CVE-2026-72021)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nieee802154: admin-gate legacy LLSEC dump operations\n\nIn net/ieee802154/netlink.c, the legacy IEEE802154_NL family ops table\nbuilds the LLSEC dump entries (LLSEC_LIST_KEY, LLSEC_LIST_DEV,\nLLSEC_LIST_DEVKEY, LLSEC_LIST_SECLEVEL) with IEEE802154_DUMP() which\nsets no .flags, so generic netlink runs them ungated. The modern\nnl802154 family admin-gates the equivalent reads via\nNL802154_CMD_GET_SEC_KEY and friends with .flags = GENL_ADMIN_PERM.\n\nAny local uid that can open AF_NETLINK / NETLINK_GENERIC can resolve\nthe \u0026quot;802.15.4 MAC\u0026quot; family and dump LLSEC_LIST_KEY on any wpan netdev\nthat has an LLSEC key installed; the dump handler writes the raw\n16-byte AES-128 key bytes (IEEE802154_ATTR_LLSEC_KEY_BYTES, copied\nverbatim from struct ieee802154_llsec_key.key) into the reply.\nRecovering the AES key compromises 802.15.4 LLSEC link confidentiality\nand authenticity, since LLSEC uses CCM* and the same key authenticates\nand encrypts frames.\n\nImpact: any local uid with no capabilities can read the raw 16-byte\nAES-128 LLSEC key from the kernel keytable on any wpan netdev that has\nan administrator-installed LLSEC key, by issuing an LLSEC_LIST_KEY\ndump on the legacy IEEE802154_NL generic-netlink family.\n\nIntroduce IEEE802154_DUMP_PRIV() mirroring IEEE802154_DUMP() but\nsetting .flags = GENL_ADMIN_PERM, and use it for the four LLSEC dump\nentries. LIST_PHY and LIST_IFACE retain IEEE802154_DUMP() because the\nmodern nl802154 family exposes their equivalents to unprivileged\nreaders by design (NL802154_CMD_GET_WPAN_PHY and\nNL802154_CMD_GET_INTERFACE carry \u0026quot;can be retrieved by unprivileged\nusers\u0026quot; annotations).(CVE-2026-72049)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: ip6_gre: require CAP_NET_ADMIN in the device netns for changelink\n\nip6gre_changelink() and ip6erspan_changelink() operate on at most two\nnetns, dev_net(dev) and the tunnel link netns t-\u0026gt;net. They differ once\nthe device is created in or moved to a netns other than the one the\nrequest runs in. The rtnl changelink path checks CAP_NET_ADMIN only\nagainst dev_net(dev), so a caller privileged there but not in t-\u0026gt;net can\nrewrite a tunnel that lives in t-\u0026gt;net.\n\nGate both ops on rtnl_dev_link_net_capable() at their top, before any\nattribute is parsed.(CVE-2026-72052)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: ipip: require CAP_NET_ADMIN in the device netns for changelink\n\nipip_changelink() operates on at most two netns, dev_net(dev) and the\ntunnel link netns t-\u0026gt;net. They differ once the device is created in or\nmoved to a netns other than the one the request runs in. The rtnl\nchangelink path checks CAP_NET_ADMIN only against dev_net(dev), so a\ncaller privileged there but not in t-\u0026gt;net can rewrite a tunnel that\nlives in t-\u0026gt;net.\n\nGate ipip_changelink() on rtnl_dev_link_net_capable() at its top,\nbefore any attribute is parsed.(CVE-2026-72053)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: ip_vti: require CAP_NET_ADMIN in the device netns for changelink\n\nvti_changelink() operates on at most two netns, dev_net(dev) and the\ntunnel link netns t-\u0026gt;net. They differ once the device is created in or\nmoved to a netns other than the one the request runs in. The rtnl\nchangelink path checks CAP_NET_ADMIN only against dev_net(dev), so a\ncaller privileged there but not in t-\u0026gt;net can rewrite a tunnel that\nlives in t-\u0026gt;net.\n\nGate vti_changelink() on rtnl_dev_link_net_capable() at its top,\nbefore any attribute is parsed.(CVE-2026-72054)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: sit: require CAP_NET_ADMIN in the device netns for changelink\n\nipip6_changelink() operates on at most two netns, dev_net(dev) and the\ntunnel link netns t-\u0026gt;net. They differ once the device is created in or\nmoved to a netns other than the one the request runs in. The rtnl\nchangelink path checks CAP_NET_ADMIN only against dev_net(dev), so a\ncaller privileged there but not in t-\u0026gt;net can rewrite a tunnel that\nlives in t-\u0026gt;net.\n\nGate ipip6_changelink() on rtnl_dev_link_net_capable() at its top,\nbefore any attribute is parsed. sit was the one tunnel type not covered\nby the recent series that added this check to the other changelink()\nhandlers.(CVE-2026-72061)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/mlx5e: macsec: fix use-after-free of metadata_dst on RX SC delete\n\nWhen an offloaded MACsec RX SC is deleted, macsec_del_rxsc_ctx() freed\nthe per-SC metadata_dst with metadata_dst_free(), which kfree()s the\nobject unconditionally and ignores the dst reference count. The RX\ndatapath in mlx5e_macsec_offload_handle_rx_skb() looks up the SC under\nrcu_read_lock() via xa_load(), takes a reference with dst_hold() and\nattaches the dst to the skb with skb_dst_set(). A reader that already\nobtained the rx_sc pointer can race with the delete path and operate on\nfreed memory.\n\nFix the owner side by dropping the reference with dst_release() instead\nof freeing unconditionally, and convert the RX datapath to\ndst_hold_safe() so a reader racing the SC delete cannot attach a dst\nwhose last reference was just dropped; only attach it when a reference\nwas actually taken.\n\nmlx5e_macsec_add_rxsc() also published sc_xarray_element via xa_alloc()\nbefore rx_sc-\u0026gt;md_dst was allocated and initialised, so a datapath reader\nthat looked the SC up by fs_id could observe rx_sc with md_dst still\nNULL or, on weakly-ordered architectures, a non-NULL md_dst pointer\nwhose contents were not yet visible. NULL-check the xa_load() result and\nmd_dst on the datapath, and reorder add_rxsc() so the xa_alloc() publish\nhappens only after md_dst is fully initialised; the xarray RCU publish\nthen pairs with the rcu_read_lock()/xa_load() in the datapath.\n\nNote: macsec_del_rxsc_ctx() also kfree()s rx_sc-\u0026gt;sc_xarray_element\nwithout an RCU grace period while the same datapath reads it under\nrcu_read_lock(); that is a separate pre-existing issue left to a\nfollow-up patch.\n\nFound by 0sec automated security-research tooling (https://0sec.ai).(CVE-2026-72072)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnvmet-rdma: handle inline data with a nonzero offset\n\nnvmet_rdma_use_inline_sg() maps the host-controlled inline data offset\ninto the per-command inline scatterlist. The bounds check admits any\noffset with off + len \u0026lt;= inline_data_size, but the mapping still assumes\nthe data begins in the first inline page:\n\n\tsg-\u0026gt;offset = off;\n\tsg-\u0026gt;length = min_t(int, len, PAGE_SIZE - off);\n\nWhen a port is configured with inline_data_size \u0026gt; PAGE_SIZE (settable up\nto max(SZ_16K, PAGE_SIZE)), an offset in (PAGE_SIZE, inline_data_size]\nmakes \u0026quot;PAGE_SIZE - off\u0026quot; underflow, so sg-\u0026gt;length is set to ~4 GiB and\nthe block backend reads far past the first inline page. num_pages(len)\nalso ignores the offset, so an in-bounds offset whose [off, off+len)\nspan crosses a page boundary under-counts the scatterlist.\n\nMap the offset properly: split it into a page index and an in-page\noffset, start the scatterlist at that page, and size the page count from\npage_off + len. Because the request scatterlist may now start at\ninline_sg[page_idx] rather than inline_sg[0], generalize the inline-SGL\nidentity test in nvmet_rdma_release_rsp() to a range test; otherwise the\npersistent inline scatterlist is mistaken for an allocated one and\nnvmet_req_free_sgls() frees an inline page (and warns in\nfree_large_kmalloc()).(CVE-2026-72129)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntpm: Make the TPM character devices non-seekable\n\nThe TPM character devices expose a sequential command/response\ninterface, but their open handlers leave FMODE_PREAD and FMODE_PWRITE\nenabled.\n\nAfter a command leaves a response pending, pread(fd, buf, 16, 0x1400)\npasses 0x1400 as *off to tpm_common_read(). The transfer length is\nbounded by response_length, but the offset is used unchecked when\nforming data_buffer + *off. A sufficiently large offset therefore causes\nan out-of-bounds heap read through copy_to_user() and, if the copy\nsucceeds, an out-of-bounds zero-write through the following memset().\n\nPositional I/O does not provide coherent semantics for this interface.\nAn arbitrary pread offset cannot represent how much of a response has\nbeen consumed sequentially. The write callback always stores a command\nat the start of data_buffer, while pwrite() does not update file-\u0026gt;f_pos\nand can leave the sequential read cursor stale.\n\nCall nonseekable_open() from both open handlers. This removes\nFMODE_PREAD and FMODE_PWRITE, causing positional reads and writes to\nfail with -ESPIPE before reaching the TPM callbacks, and explicitly\nmarks the files non-seekable. Normal read() and write() continue to use\nthe existing sequential f_pos cursor, leaving the response state machine\nunchanged.\n\nTested on Linux 6.12 with KASAN and a swtpm TPM2 device:\n\n - sequential partial reads returned the complete response\n - pread() and preadv() with offset 0x1400 returned -ESPIPE\n - pwrite() and pwritev() with offset zero returned -ESPIPE\n - the pending response remained intact after the rejected operations\n - a subsequent normal command/response cycle completed normally\n - no KASAN report was produced.(CVE-2026-72135)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm: xfrm_interface: require CAP_NET_ADMIN in the device netns for changelink\n\nxfrmi_changelink() operates on at most two netns, dev_net(dev) and the\ninterface link netns xi-\u0026gt;net. They differ once the device is created in\nor moved to a netns other than the one the request runs in. The rtnl\nchangelink path checks CAP_NET_ADMIN only against dev_net(dev), so a\ncaller privileged there but not in xi-\u0026gt;net can rewrite an interface that\nlives in xi-\u0026gt;net.\n\nGate xfrmi_changelink() on rtnl_dev_link_net_capable() at its top,\nbefore any attribute is parsed.(CVE-2026-72136)\n\nIn the Linux kernel, the following vulnerability has been resolved: net: thunderbolt: Fix frags[] overflow by bounding frame_count. tbnet_poll() assembles a multi-frame ThunderboltIP packet into one skb. The first frame goes into the skb linear area and every further frame is added as a page fragment. A packet of frame_count frames therefore ends up with frame_count - 1 fragments. tbnet_check_frame() only bounds the peer supplied frame_count to TBNET_RING_SIZE / 4 (64), which is far above MAX_SKB_FRAGS (17 by default). A peer that sends a packet of 19 or more small frames pushes nr_frags past MAX_SKB_FRAGS, so skb_add_rx_frag() writes past skb_shinfo()-\u0026gt;frags[] and corrupts memory after the shared info.(CVE-2026-72157)\n\nIn the Linux kernel, the following vulnerability has been resolved: mm/mm_init: fix uninitialized struct pages for ZONE_DEVICE. If DAX memory is hotplugged into an unoccupied subsection of an early section, section_activate() reuses the unoptimized boot memmap. However, compound_nr_pages() still assumes that vmemmap optimization is in effect and initializes only the reduced number of struct pages. As a result, the remaining tail struct pages are left uninitialized, which can later lead to unexpected behavior or crashes. Fix this by treating early sections as unoptimized when calculating how many struct pages to initialize.(CVE-2026-72172)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nSUNRPC: Bound-check xdr_buf_to_bvec() stores before writing\n\nxdr_buf_to_bvec() writes a bio_vec into the caller\u0026apos;s array before\ntesting whether that slot is in range, and the head branch performs\nthe store with no check at all. When the caller\u0026apos;s budget is exactly\nused up, the next store lands one element past the end of the array.\nThe overflow label returns count - 1, which masks the surplus store\nbut cannot undo it.\n\nrq_bvec, the array passed by nfsd_vfs_write(), is allocated to\nexactly rq_maxpages entries with no slack. The OOB store can land in\nadjacent slab memory; the bv_len and bv_offset fields written there\nare derived from client-supplied RPC payload sizes.\n\nMove the in-range check ahead of the store in the head, page-loop,\nand tail branches. With the check at the top of each sequence, count\nis incremented only after a successful store, so the overflow label\ncan return count directly.(CVE-2026-72217)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsunrpc: wait for in-flight TLS handshake callback when cancel loses race\n\nWhen wait_for_completion_interruptible_timeout() in\nsvc_tcp_handshake() returns 0 (timeout) or -ERESTARTSYS (signal) and\ntls_handshake_cancel() then returns false, handshake_complete() has\nwon the cancellation race: it has set HANDSHAKE_F_REQ_COMPLETED and\nis about to invoke svc_tcp_handshake_done(), but the callback\u0026apos;s\nside effects on xpt_flags and on svsk-\u0026gt;sk_handshake_done have not\nyet committed.\n\nThe current code reads xpt_flags immediately to decide whether the\nsession succeeded. Two races result.\n\nIf the callback has executed set_bit(XPT_TLS_SESSION) but not yet\nclear_bit(XPT_HANDSHAKE), svc_tcp_handshake() sees a session,\nenqueues the transport, and returns. svc_xprt_received() then\nclears XPT_BUSY, a worker thread picks the transport up, the\ndispatcher in svc_handle_xprt() observes XPT_HANDSHAKE still set,\nand xpo_handshake is invoked a second time. That svc_tcp_handshake()\ncalls init_completion(\u0026amp;svsk-\u0026gt;sk_handshake_done) while the original\ncallback concurrently calls complete_all() on it, corrupting the\nembedded swait_queue.\n\nIf the callback has set HANDSHAKE_F_REQ_COMPLETED but not yet\nentered svc_tcp_handshake_done(), svc_tcp_handshake() reads\nXPT_TLS_SESSION as clear and tears the connection down even though\nthe handshake is about to succeed.\n\nWait for the callback to commit before inspecting xpt_flags. The\ncompletion is guaranteed to fire because handshake_complete()\ninvokes svc_tcp_handshake_done() unconditionally once it has set\nHANDSHAKE_F_REQ_COMPLETED.(CVE-2026-72221)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsunrpc: pin svc_xprt across the asynchronous TLS handshake callback\n\nsvc_tcp_handshake() stores the raw svc_xprt pointer in\ntls_handshake_args.ta_data and submits the request through\ntls_server_hello_x509(). The handshake core takes only\nsock_hold(req-\u0026gt;hr_sk); nothing references the embedding struct\nsvc_sock that svc_tcp_handshake_done() reaches via container_of().\n\nTwo close races leave the in-flight callback writing through a freed\nsvc_sock. svc_sock_free() calls tls_handshake_cancel() and discards\nits return value: a false return means handshake_complete() has\nalready set HANDSHAKE_F_REQ_COMPLETED but hp_done() may not have\nfinished, yet svc_sock_free() proceeds to kfree(svsk). The\ncancel-loser fall-through inside svc_tcp_handshake() itself produces\nthe same window: when wait_for_completion_interruptible_timeout()\nreturns \u0026lt;= 0 (timeout or signal) and tls_handshake_cancel() returns\nfalse, the function does not drain, returns, and svc_handle_xprt()\ncalls svc_xprt_received(), which clears XPT_BUSY and can drop the\nlast reference. A concurrent close then runs svc_sock_free() while\nsvc_tcp_handshake_done() is still updating xpt_flags and walking\nsvsk-\u0026gt;sk_handshake_done.\n\nThe corruption surfaces as set_bit/clear_bit RMW into the freed\nxpt_flags slab slot and as complete_all() walking and writing the\nfreed wait_queue_head_t list embedded in sk_handshake_done -- a\nslab-corruption primitive, not a benign read. The path is reachable\non any TLS-enabled NFS server whenever a connection close overlaps\nthe tlshd downcall delivery window; the interruptible wait means\nsignal delivery suffices, not just SVC_HANDSHAKE_TO expiry.\n\nTake svc_xprt_get(xprt) immediately before tls_server_hello_x509()\nso the in-flight callback owns its own reference. Release it on the\ntwo edges where the callback is guaranteed not to fire -- submission\nfailure from tls_server_hello_x509() and a successful\ntls_handshake_cancel() -- and at the tail of\nsvc_tcp_handshake_done() after complete_all().\n\n[cel: rewrote commit message to describe the actual change](CVE-2026-72222)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbatman-adv: retrieve ethhdr after potential skb realloc on RX\n\npskb_may_pull() in batadv_interface_rx() could reallocate the buffer behind\nthe skb. Variables which were pointing to the old buffer need to be\nreassigned to avoid an use-after-free.\n\nThis was done correctly for the VLAN header but missed for the ethernet\nheader which is later used for the TT and AP isolation handling.(CVE-2026-72235)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nKVM: Move kvm_io_bus_get_dev() locking responsibilities to callers\n\nkvm_io_bus_get_dev() returns a device that is only matched by the\naddress, and nothing else. This can cause a lifetime issue if\nthe matched device is not the expected type, as by the time\nthe caller can introspect the object, it might be gone (the srcu\nlock having been dropped).\n\nGiven that there is only a single user of this helper, the simplest\noption is to move the locking responsibility to the caller, which\ncan keep the srcu lock held for as long as it wants.\n\nNote that this aligns with other kvm_io_bus*() helpers, which\nalready require the srcu lock to be held by the callers.(CVE-2026-72282)\n\nIn the Linux kernel, the following vulnerability has been resolved: smb: client: fix overflow in passthrough ioctl bounds check. smb2_ioctl_query_info() validates the PASSTHRU_FSCTL response payload before copying it to userspace. The payload offset and length both come from 32-bit fields. The bounds check currently adds OutputOffset and qi.input_buffer_length directly, so the addition can wrap in 32-bit arithmetic before the result is compared against the response buffer length. A malicious server can use a large OutputOffset and a small OutputCount to make the wrapped sum pass the bounds check. The later copy_to_user() then reads from io_rsp + OutputOffset, outside the response buffer, leading to an out-of-bounds read.(CVE-2026-72310)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndm era: fix NULL pointer dereference in metadata_open()\n\nmetadata_open() returns NULL when kzalloc_obj() fails, but the\ncaller era_ctr() only checks IS_ERR(md). Since IS_ERR(NULL)\nreturns false, the NULL pointer is treated as a valid result\nand later assigned to era-\u0026gt;md, leading to a NULL pointer\ndereference when the metadata is accessed.\n\nFix this by returning ERR_PTR(-ENOMEM) on allocation failure,\nconsistent with dm-cache-metadata.c, dm-thin-metadata.c, and\ndm-clone-metadata.c which all use ERR_PTR(-ENOMEM) for the\nsame pattern.(CVE-2026-72316)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nSUNRPC: pin upper rpc_clnt across the TLS connect_worker\n\nThe TLS connect path has a use-after-free: nothing pins the\nupper rpc_clnt across the delayed connect_worker. xs_connect()\nstores task-\u0026gt;tk_client in sock_xprt::clnt as a raw pointer\nand queues the worker; for TLS-secured transports that worker\nis xs_tcp_tls_setup_socket(), which reads several fields out\nof the saved pointer (cl_timeout, cl_program, cl_prog,\ncl_vers, cl_cred, cl_stats) to construct the args for the\ninner handshake rpc_clnt.\n\nThe xprt does not reference the rpc_clnt; the rpc_clnt\nreferences the xprt. xs_destroy() does cancel the\nconnect_worker, but it runs only when the xprt\u0026apos;s refcount\ndrops to zero, which cannot happen until the rpc_clnt\nreleases its cl_xprt reference in rpc_free_client_work().\nWhen a TLS handshake fails fatally (for example, an mTLS\nmount whose client cert does not match the server), the\nconnecting task is woken with -EACCES and exits, the mount\ncaller invokes rpc_shutdown_client(), and the upper rpc_clnt\nis freed before the queued connect_worker fires.\nxs_tcp_tls_setup_socket() then dereferences the freed clnt,\nproducing the refcount_t underflow Michael Nemanov reported.\n\nTake a reference on the upper rpc_clnt in xs_connect() for\nTLS transports via a new rpc_hold_client() helper, and drop\nit in the connect_worker\u0026apos;s exit path with rpc_release_client().\nThe xprt_lock_connect() / xprt_unlock_connect() pairing\nalready serialises xs_connect() with xs_tcp_tls_setup_socket(),\nso the take and release are balanced one-for-one.\n\nThe non-TLS connect worker (xs_tcp_setup_socket) never reads\nsock_xprt::clnt, so leave that path alone and avoid the\nclnt-holds-xprt-holds-clnt cycle that would otherwise prevent\nxprt destruction.(CVE-2026-72317)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncifs: validate DFS referral string offsets\n\nparse_dfs_referrals() validates that the response header and referral\narray fit in the received buffer, but each referral also contains string\noffsets supplied by the server.\n\nThose offsets are used to compute the DfsPath and NetworkAddress string\npointers without checking whether they still point inside the response\nbuffer. A malformed referral can therefore make the computed pointer\nexceed the end of the buffer. The resulting negative max_len is then\npassed to cifs_strndup_from_utf16(), and the non-Unicode path forwards it\nto kstrndup() as a size_t, allowing strnlen() to read out of bounds.\n\nValidate each string offset before deriving the string pointer.(CVE-2026-72318)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipvs: ensure inner headers in ICMP errors are in headroom\n\nSashiko points out that after stripping the outer headers\nwith pskb_pull() we should ensure the inner IP headers\nin ICMP errors from tunnels are present in the skb headroom\nfor functions like ipv4_update_pmtu(), icmp_send() and\nIP_VS_DBG().\n\nAlso, add more checks for the length of the inner headers.(CVE-2026-72319)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/tls: Consume empty data records in tls_sw_read_sock()\n\nA peer may send a zero-length TLS application_data record; TLS 1.3\nexplicitly permits these as a traffic-analysis countermeasure (RFC\n8446, Section 5.1). After decryption such a record has full_len ==\n0. tls_sw_read_sock() hands it to the read_actor, which has no\npayload to consume and returns zero. The loop treats a zero return\nas backpressure (used \u0026lt;= 0), requeues the skb at the head of\nrx_list, and stops. rx_list is serviced head-first on the next\ncall, so the empty record is dequeued, fails the same way, and is\nrequeued again; every later record on the connection is blocked\nbehind it.\n\ntls_sw_recvmsg() does not stall on this: a zero-length data record\ncopies nothing and falls through to consume_skb(). Mirror that in\nthe read_sock() path by recognizing an empty data record before\nthe actor runs, consuming it, and continuing.(CVE-2026-72330)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nqede: fix off-by-one in BD ring consumption on build_skb failure\n\nqede_rx_build_skb() and qede_tpa_rx_build_skb() do not check for a\nNULL return from qede_build_skb(). When it returns NULL under memory\npressure, the functions still consume a BD from the ring before\nreturning NULL. The callers then recycle additional BDs, resulting in\none extra BD being consumed (off-by-one). This desynchronizes the BD\nring, which can corrupt DMA page reference counts and lead to SLUB\nfreelist corruption.\n\nCommit 4e910dbe3650 (\u0026quot;qede: confirm skb is allocated before using\u0026quot;)\nadded a NULL check inside qede_build_skb() to prevent a NULL pointer\ndereference, but did not address the missing NULL checks in the\ncallers, making this off-by-one reachable.\n\nFix this by adding NULL checks for the return value of\nqede_build_skb() in both qede_rx_build_skb() and\nqede_tpa_rx_build_skb(), returning NULL immediately before any BD ring\nmanipulation.(CVE-2026-72339)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/mlx5e: Fix HV VHCA stats agent registration race\n\nmlx5e_hv_vhca_stats_create() registers the stats agent through\nmlx5_hv_vhca_agent_create(). The helper publishes the agent in\nhv_vhca-\u0026gt;agents[type] under agents_lock and immediately schedules an\nasynchronous control invalidation on the HV VHCA workqueue before\nreturning to mlx5e.\n\nThe asynchronous invalidation invokes the control agent\u0026apos;s invalidate\ncallback, which reads the hypervisor control block and forwards the\ncommand to mlx5e_hv_vhca_stats_control(). That callback may either:\n\n - call cancel_delayed_work_sync(\u0026amp;priv-\u0026gt;stats_agent.work), or\n - call queue_delayed_work(priv-\u0026gt;wq, \u0026amp;sagent-\u0026gt;work, sagent-\u0026gt;delay).\n\nHowever, the delayed_work and priv-\u0026gt;stats_agent.agent are only\ninitialized after mlx5_hv_vhca_agent_create() returns to mlx5e:\n\n agent = mlx5_hv_vhca_agent_create(...); /* publish + invalidate */\n ...\n priv-\u0026gt;stats_agent.agent = agent; /* too late */\n INIT_DELAYED_WORK(\u0026amp;priv-\u0026gt;stats_agent.work, ...); /* too late */\n\nIf the asynchronous control path runs before the two assignments\nabove, it can:\n\n - Operate on an uninitialized delayed_work whose timer.function is\n NULL. queue_delayed_work() calls add_timer() unconditionally, so\n when the timer expires the timer softirq invokes a NULL function\n pointer.\n - Re-initialize the timer later through INIT_DELAYED_WORK() while\n the timer is already enqueued in the timer wheel, corrupting the\n hlist (entry.pprev cleared while the previous bucket node still\n points at this entry).\n - When the worker eventually runs, mlx5e_hv_vhca_stats_work() reads\n sagent-\u0026gt;agent (NULL) and dereferences it inside\n mlx5_hv_vhca_agent_write().\n\nFix this by:\n\n - Initializing priv-\u0026gt;stats_agent.work before invoking\n mlx5_hv_vhca_agent_create(), so the work is always in a valid\n state when the control callback observes it.\n - Adding a struct mlx5_hv_vhca_agent **ctx_update out-parameter\n to mlx5_hv_vhca_agent_create(). The helper writes the agent\n pointer to *ctx_update before publishing into hv_vhca-\u0026gt;agents[]\n and triggering the agents_update flow, so any callback\n subsequently invoked from that flow already sees a valid\n priv-\u0026gt;stats_agent.agent. This avoids having the control\n callback participate in agent initialization.\n\nWhile at it, access priv-\u0026gt;stats_agent.agent with\nREAD_ONCE()/WRITE_ONCE() for the cross-CPU access with the worker, and\nclear priv-\u0026gt;stats_agent.buf on the agent_create() failure path.(CVE-2026-72342)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbridge: stp: Fix a potential use-after-free when deleting a bridge\n\nThe three STP timers are not supposed to be armed while the bridge is\nadministratively down. They are synchronously deactivated when the\nbridge is put administratively down and the various call sites check for\n\u0026apos;IFF_UP\u0026apos; before arming them.\n\nThis check is missing from br_topology_change_detection() and it is\npossible to engineer a situation in which the topology change timer is\narmed while the bridge is administratively down, resulting in a\nuse-after-free [1] when the bridge is deleted.\n\nFix by adding the missing check and for good measures synchronously\nshutdown the three timers when the bridge is deleted.\n\n[1]\nODEBUG: free active (active state 0) object: ffff88811662b9b0 object type: timer_list hint: br_topology_change_timer_expired (net/bridge/br_stp_timer.c:120)\nWARNING: lib/debugobjects.c:629 at debug_print_object+0x1bc/0x450, CPU#9: ip/359(CVE-2026-72389)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nseg6: validate SRH length before reading fixed fields\n\nseg6_validate_srh() reads fixed SRH fields such as srh-\u0026gt;type and\nsrh-\u0026gt;hdrlen before checking that the supplied length covers the fixed\nstruct ipv6_sr_hdr fields.\n\nThe BPF SEG6 encap path reaches this with a BPF program-supplied pointer\nand length: bpf_lwt_push_encap() and the SEG6 local BPF END_B6 and\nEND_B6_ENCAP actions call bpf_push_seg6_encap(), which forwards the\nlength to seg6_validate_srh() with no minimum-size guard. A 2-byte SEG6\nencap header can therefore make the validator read srh-\u0026gt;type at offset 2\nbeyond the caller-supplied buffer.\n\nReject lengths shorter than the fixed SRH at the top of\nseg6_validate_srh(), before any field is read. This fixes the BPF helper\npath and keeps the common validator robust.(CVE-2026-72400)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nice: fix FDIR CTRL VSI resource leak in ice_reset_all_vfs()\n\nResetting all VFs causes resource leak on VFs with FDIR filters\nenabled as CTRL VSIs are only invalidated and not freed. Fix by using\nice_vf_ctrl_vsi_release() instead of ice_vf_ctrl_invalidate_vsi() which\naligns behavior with the ice_reset_vf() function.\n\nReproduction:\n echo 1 \u0026gt; /sys/class/net/$pf/device/sriov_numvfs\n ethtool -N $vf flow-type ether proto 0x9000 action 0\n echo 1 \u0026gt; /sys/class/net/$pf/device/reset(CVE-2026-72425)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm: validate selector family and prefixlen during match\n\nsyzbot reported a shift-out-of-bounds in xfrm_selector_match()\ndue to AF_UNSPEC selector with large prefixlen (e.g. 128) matched\nagainst IPv4 flow (when XFRM_STATE_AF_UNSPEC is set).\n\nFix this by:\n\n- Rejecting mismatched families in xfrm_selector_match.\n- Returning false in addr4_match if prefixlen \u0026gt; 32.\n- Returning false in addr_match if prefixlen \u0026gt; 128 (prevents overflow).(CVE-2026-72450)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\napparmor: aa_label_alloc use aa_label_free on alloc failure\n\naa_label_alloc() allocates a secid before allocating or taking the label\nproxy. If the later proxy step fails, the error path only freed the label\nmemory, leaking any resources initialized by aa_label_init().\n\nUse aa_label_free() on the failure path so partially initialized labels\nrelease their secid and other label resources before the backing memory is\nfreed.(CVE-2026-72459)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\napparmor: check label build before no_new_privs test\n\naa_change_profile() builds a replacement label with\nfn_label_build_in_scope() before the no_new_privs subset check. The build\nhelper can fail and return NULL or an ERR_PTR, but the result was passed\nto aa_label_is_unconfined_subset() before the existing IS_ERR_OR_NULL()\ncheck.\n\nReuse the existing target-label build failure handling immediately after\nthe build. This preserves the current audit handling while preventing the\nsubset helper from dereferencing an invalid label.(CVE-2026-72460)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxprtrdma: Repost Receive buffers for malformed replies\n\nrpcrdma_wc_receive() decrements the transport\u0026apos;s Receive count for\nevery completion before it dispatches a successful Receive to\nrpcrdma_reply_handler(). The handler must post a replacement\nReceive WR before returning unless ownership of the rep has moved\nelsewhere, as on the backchannel path.\n\nCommit 2ae50ad68cd7 (\u0026quot;xprtrdma: Close window between waking RPC\nsenders and posting Receives\u0026quot;) moved the Receive refill out of\nrpcrdma_wc_receive(), where it had run ahead of every reply, into\nrpcrdma_reply_handler() so that the responder\u0026apos;s credit grant could\nbe parsed before reposting. The bad-version and short-reply exits\nnever reach that refill: they recycle the rep and return without\ncalling rpcrdma_post_recvs().\n\nA remote peer can therefore drain the client\u0026apos;s posted Receive\nqueue by sending a sustained stream of replies that are shorter\nthan the fixed transport header or that carry an unrecognized\nRPC/RDMA version. Each such reply consumes one posted Receive\nwithout replacing it. Once the queue empties, the peer\u0026apos;s next\nSend finds no posted Receive and the transport stalls until\nreconnect.\n\nRoute both malformed-reply exits through the shared repost tail\nafter recycling the rep, refilling against buf-\u0026gt;rb_credits, the\nmost recent accepted credit grant. Neither exit updates the\ncongestion window, so RPCs admitted under the previous grant\nremain in flight awaiting replies. A smaller refill target would\nlet a stream of malformed replies ratchet the posted Receive count\ndown to the batch floor while the congestion window still admits\nrb_credits RPCs; a burst of valid replies to those RPCs could then\noverrun the posted Receives, and because the client connects with\nrnr_retry_count of zero, a single RNR NAK terminates the\nconnection. Refilling against rb_credits also restores the target\nthat applied to malformed replies before commit 2ae50ad68cd7\n(\u0026quot;xprtrdma: Close window between waking RPC senders and posting\nReceives\u0026quot;) when rpcrdma_post_recvs() computed it from rb_credits\ninternally. rb_credits is at least one from connection\nestablishment onward, so the repost path always keeps Receives\nposted.(CVE-2026-72464)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxprtrdma: Fix bcall rep leak and unbounded peek\n\nrpcrdma_is_bcall() decodes a reply\u0026apos;s first words to decide whether\nthe frame is a backchannel call. Two issues in that decode path\nlet a short or malformed reply leak the receive buffer and drain\nthe Receive queue.\n\nFirst, the speculative peek\n\n p = xdr_inline_decode(xdr, 0);\n /* five p++ reads follow */\n\nasks xdr_inline_decode() for zero bytes, which returns xdr-\u0026gt;p\nwithout consulting xdr-\u0026gt;end. The five subsequent __be32 reads can\nthen walk up to 20 bytes past the wire payload into stale regbuf\ncontents and misclassify the reply as a backchannel call.\n\nSecond, after the post-peek\n\n p = xdr_inline_decode(xdr, 3 * sizeof(*p));\n if (unlikely(!p))\n return true;\n\nthe short-header arm returns true without calling\nrpcrdma_bc_receive_call(). The contract with the caller is that a\ntrue return transfers ownership of rep to the backchannel path:\n\n rpcrdma_reply_handler()\n if (rpcrdma_is_bcall(r_xprt, rep))\n return; /* bare return, skips out_post */\n ...\n out_post:\n rpcrdma_post_recvs(r_xprt, credits + ...);\n\nBecause rpcrdma_bc_receive_call() never ran, no one took rep, but\nrpcrdma_reply_handler still bare-returns past rpcrdma_rep_put()\nand rpcrdma_post_recvs(). The rep, with its persistently\nDMA-mapped receive buffer, is orphaned on rb_all_reps and freed\nonly at transport teardown. This completion reposts nothing, so\nits slot is reclaimed only when a later forward-channel reply\nreaches out_post and rpcrdma_post_recvs() allocates a fresh rep to\nbackfill; absent that traffic the Receive queue drains and the\npeer\u0026apos;s Sends draw RNR NAKs.\n\nFix by consulting xdr-\u0026gt;end after the zero-length peek so the five\n__be32 reads cannot run unless 20 bytes of wire payload remain. A\nbyte-precise comparison against xdr-\u0026gt;end is required because a\nnon-4-aligned receive rounds the stream\u0026apos;s word count up past the\ntrue payload. Also return false from the short-header arm so the\nreply falls through the normal out_norqst cleanup chain\n(rpcrdma_rep_put() plus rpcrdma_post_recvs()).(CVE-2026-72466)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxprtrdma: Decouple req recycling from RPC completion\n\nrl_kref formerly served two distinct lifetimes through a single\nrefcount: it gated when a Reply could wake its RPC task, and it\ngated when an rpcrdma_req could return to its free pool. The\nmarshal path took the Send-side reference only when SGEs needed\nDMA-unmap (sc_unmap_count \u0026gt; 0), which made a Send carrying only\npre-registered buffers an exception: the Reply handler dropped\nrl_kref from 1 to 0 and freed the req while the HCA might still\nbe DMA-reading from its send buffer.\n\nGive rl_kref a narrower job. The RPC layer takes one reference\nwhen slot allocation hands a req out. rpcrdma_prepare_send_sges()\ntakes a Send-side reference unconditionally after WR preparation\nsucceeds. xprt_rdma_free_slot() and xprt_rdma_bc_free_rqst() drop\nthe RPC-layer reference; rpcrdma_sendctx_unmap() drops the\nSend-side reference. The req returns to its free pool only after\nboth owners have signed off.\n\nThe existing kref_init(\u0026amp;req-\u0026gt;rl_kref) call in\nrpcrdma_prepare_send_sges() is removed. Initialization moves to\nthe slot-allocation paths (xprt_rdma_alloc_slot and\nrpcrdma_bc_rqst_get), and the release callback re-arms rl_kref\nbefore the req returns to a free pool. A re-init in the marshal\npath would discard the RPC-layer reference that already exists\non entry.\n\nThree invariants follow:\n\n - Any rpcrdma_req held by an rpc_rqst has rl_kref \u0026gt;= 1.\n xprt_rdma_alloc_slot(), rpcrdma_bc_rqst_get(), and the\n backlog-wake branch in xprt_rdma_alloc_slot() each kref_init\n rl_kref before publishing the req. Without this invariant,\n an RPC task that aborts between slot allocation and marshal\n (gss_refresh failure or signal during call_connect, for\n example) would drive xprt_release() -\u0026gt;\n xprt_rdma_free_slot() -\u0026gt; kref_put against a refcount of\n zero, saturating refcount_t and stranding the slot.\n\n - The Send-side reference is taken only after WR prep\n succeeds. A mapping failure in rpcrdma_prepare_send_sges()\n runs rpcrdma_sendctx_cancel(), which DMA-unmaps the sendctx\n and clears sc_req without touching rl_kref. The sendctx\n ring walks in rpcrdma_sendctx_put_locked() and\n rpcrdma_sendctxs_destroy() skip entries with sc_req == NULL,\n so a burst of -EIO marshal failures cannot hold reqs off\n rb_send_bufs.\n\n - The release callback re-arms rl_kref so the next consumer\n enters with the invariant satisfied.\n\nReplies now complete the RPC directly. rpcrdma_reply_handler()\ncalls rpcrdma_complete_rqst() in place of kref_put on the\nnon-LocalInv branch. The LocalInv branch already completes the\nRPC from frwr_unmap_async() and is unaffected.\n\nBecause Send-side references can now outlive RPC completion,\nconnection teardown drains sendctx entries whose unsignaled\nSends never had a later signaled completion to walk the ring.\nrpcrdma_sendctxs_destroy() walks the active range and runs\nrpcrdma_sendctx_unmap() on each entry with a non-NULL sc_req\nbefore the request buffers are reset, and is moved ahead of\nrpcrdma_reqs_reset() in rpcrdma_xprt_disconnect() so the reqs\nare still in their pre-reset state when the Send-side refs are\nreleased.\n\nThe drain creates a teardown-ordering hazard on the backchannel\npath. With the new lifetime, releasing a bc_prealloc req from\nrpcrdma_req_release() re-adds it to bc_pa_list. The disconnect\nin xprt_rdma_destroy() runs after xprt_destroy_backchannel() has\nalready emptied bc_pa_list, so the drained reqs would otherwise\nleak. xprt_rdma_destroy() now runs xprt_rdma_bc_destroy(xprt, 0)\na second time after the disconnect to reclaim them.(CVE-2026-72473)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\npower: supply: core: fix supplied_from allocations\n\nIf dts property power-supplies has multiple values, then accessing to\npsy-\u0026gt;supplied_from[i-1] in __power_supply_populate_supplied_from will\noverrun supplied_from array.(CVE-2026-74271)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntipc: require net admin for TIPCv2 netlink mutators\n\nTIPCv2 registers mutating generic-netlink operations without admin\npermission flags. Generic netlink only checks CAP_NET_ADMIN when an\noperation sets GENL_ADMIN_PERM or GENL_UNS_ADMIN_PERM, so a local\nunprivileged process can currently change TIPC state through commands\nsuch as TIPC_NL_NET_SET, TIPC_NL_KEY_SET, TIPC_NL_KEY_FLUSH, and\nbearer enable/disable.\n\nThe legacy TIPC netlink API already checks netlink_net_capable(...,\nCAP_NET_ADMIN) for administrative commands. Give the TIPCv2 mutators\nthe equivalent generic-netlink gate. Use GENL_UNS_ADMIN_PERM, which\nmaps to the same namespace-aware CAP_NET_ADMIN check that\nnetlink_net_capable() performs, so the behaviour matches the legacy\npath and keeps working for CAP_NET_ADMIN holders in a non-initial user\nnamespace (containers).\n\nA QEMU/KASAN repro run as uid/gid 65534 with zero effective\ncapabilities previously succeeded in changing the network id and node\nidentity, setting and flushing key material, and enabling/disabling a\nUDP bearer. With this patch applied the same operations fail with\n-EPERM.(CVE-2026-74283)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: validate embedded address parameter length\n\nsctp_verify_asconf() and sctp_verify_param() only validate ADD_IP, DEL_IP,\nand SET_PRIMARY parameters against a fixed minimum size of sizeof(struct\nsctp_addip_param) + sizeof(struct sctp_paramhdr). This ensures the outer\nparameter is large enough to contain an embedded address parameter header,\nbut does not verify that the embedded address parameter\u0026apos;s declared length\nfits within the bounds of the outer parameter.\n\nLater, sctp_process_param() and sctp_process_asconf_param() extract the\nembedded address parameter and pass it to af-\u0026gt;from_addr_param(), which uses\nthe address parameter length to parse the variable-length address payload.\nA malformed peer can therefore advertise an embedded address parameter\nlength that exceeds the remaining bytes in the enclosing parameter.\n\nValidate that addr_param-\u0026gt;p.length does not exceed the space available\nafter the sctp_addip_param header before processing the embedded address\nparameter. Reject malformed parameters when the embedded address length\nextends beyond the enclosing parameter bounds.\n\nThis prevents out-of-bounds reads when parsing malformed parameters carried\nin INIT or ASCONF processing paths.(CVE-2026-74287)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbpf: Tighten cgroup storage cookie checks for prog arrays\n\nThe fix in commit abad3d0bad72 (\u0026quot;bpf: Fix oob access in cgroup local\nstorage\u0026quot;) is still incomplete. The prog-array compatibility check\ntreats a program with no cgroup storage as compatible with any stored\nstorage cookie. This allows a storage-less program to bridge a tail\ncall chain between an entry program and a storage-using callee even\nthough cgroup local storage at runtime still follows the caller\u0026apos;s\ncontext, that is, A -\u0026gt; B(no storage) -\u0026gt; C(storage) path.\n\nRequiring exact cookie equality would break the legitimate case of a\nstorage-less leaf program being tail called from a storage-using one.\nInstead, only accept a zero storage cookie if the program cannot\nperform tail calls itself. This keeps A -\u0026gt; B(no storage) working\nwhile rejecting the A -\u0026gt; B(no storage) -\u0026gt; C(storage) bridge.(CVE-2026-74305)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/rxe: Copy WQE to local buffer in non-SRQ receive path\n\nFor non-SRQ QPs, the responder reads WQE fields directly from the\nshared queue buffer mapped into userspace. This allows a malicious\nuser to modify fields like num_sge or sge entries while the kernel\nis processing the WQE, leading to out-of-bounds reads in\nrxe_resp_check_length() and copy_data().\n\nIntroduce get_recv_wqe() that validates num_sge and copies the WQE\nto a kernel-local buffer before processing, matching the approach\nalready used for SRQ WQEs in get_srq_wqe(). The srq_wqe buffer is\nreused since SRQ and non-SRQ paths are mutually exclusive per QP.(CVE-2026-74377)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/rxe: Fix TOCTOU heap overflow in get_srq_wqe\n\nget_srq_wqe() reads wqe-\u0026gt;dma.num_sge from the shared receive queue\nbuffer, which is mapped into userspace. It validates num_sge against\nmax_sge, but then re-reads the same field to calculate the memcpy\nsize. A concurrent userspace thread can modify num_sge between\nvalidation and use, causing a heap buffer overflow when copying the\nWQE into qp-\u0026gt;resp.srq_wqe.\n\nRead num_sge into a local variable and use it for both the bounds\ncheck and the size calculation.(CVE-2026-74378)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/srpt: fix integer overflow in immediate data length check\n\nimm_buf-\u0026gt;len is a user-controlled uint32_t received from the network.\nAdding it to imm_data_offset without overflow checking allows a\nmalicious initiator to send len=0xFFFFFFFF, causing req_size to wrap\naround to a small value, bypassing the bounds check, and subsequently\npassing a ~4GB length to sg_init_one().\n\nUse check_add_overflow() to detect wrapping before the comparison.(CVE-2026-74394)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nIB/mlx5: Fix transport-domain rollback and initialize lb mutex earlier\n\nmlx5_ib_alloc_transport_domain() allocates a transport domain and then\nmay fail in mlx5_ib_enable_lb(). In that case, the allocated TD is leaked.\n\nFix this by deallocating the TD when mlx5_ib_enable_lb() returns an\nerror. Also return 0 explicitly in the no-loopback-capability success\nbranch, and move dev-\u0026gt;lb.mutex initialization to mlx5_ib_stage_init_init().(CVE-2026-74397)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipv6: addrconf: bail out of dad_failure when state is no longer POSTDAD\n\naddrconf_dad_failure() transitions ifp-\u0026gt;state from DAD to POSTDAD\nvia addrconf_dad_end(), which drops ifp-\u0026gt;lock on return. The lock\nis re-acquired after net_info_ratelimited(). A concurrent\nipv6_del_addr() can take the lock in that window, set ifp-\u0026gt;state\nto DEAD and run list_del_rcu(\u0026amp;ifp-\u0026gt;if_list).\n\naddrconf_dad_failure() then overwrites DEAD with ERRDAD at errdad:\nand schedules a new dad_work. The work calls ipv6_del_addr()\nagain, hitting the already-poisoned list entry:\n\n general protection fault: 0000 [#1] SMP NOPTI\n CPU: 4 PID: 217 Comm: kworker/4:1\n Workqueue: ipv6_addrconf addrconf_dad_work\n RIP: 0010:ipv6_del_addr+0xe9/0x280\n RAX: dead000000000122\n Call Trace:\n addrconf_dad_stop+0x113/0x140\n addrconf_dad_work+0x28c/0x430\n process_one_work+0x1eb/0x3b0\n worker_thread+0x4d/0x400\n kthread+0x104/0x140\n ret_from_fork+0x35/0x40\n\nFold the addrconf_dad_end() logic into addrconf_dad_failure() under\na single ifp-\u0026gt;lock critical section. The STABLE_PRIVACY branch\ntemporarily drops ifp-\u0026gt;lock around address regeneration, so at\nlock_errdad: verify the state is still POSTDAD before transitioning\nto ERRDAD; bail out otherwise to avoid overwriting a state set by\nanother path while the lock was released.(CVE-2026-74398)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nvxlan: Fix potential null-ptr-deref in vxlan_gro_prepare_receive().\n\nudp_tunnel_sock_release() could set sk-\u0026gt;sk_user_data to NULL\nwhile vxlan_gro_prepare_receive() is running.\n\nLet\u0026apos;s check if rcu_dereference_sk_user_data() is NULL after\nskb_gro_remcsum_init().(CVE-2026-74406)",
"id": "OESA-2026-3703",
"modified": "2026-09-05T15:04:07Z",
"published": "2026-09-05T15:04:07Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-3703"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37979"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38736"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43078"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46028"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63912"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-68476"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-68477"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72021"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72049"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72052"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72053"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72054"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72061"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72072"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72129"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72135"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72136"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72157"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72172"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72217"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72221"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72222"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72235"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72282"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72310"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72316"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72317"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72318"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72319"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72330"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72339"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72342"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72389"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72400"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72425"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72450"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72459"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72460"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72464"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72466"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-72473"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74271"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74283"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74287"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74305"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74377"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74378"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74394"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74397"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74398"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-74406"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2025-37979",
"CVE-2025-38736",
"CVE-2026-43078",
"CVE-2026-46028",
"CVE-2026-63912",
"CVE-2026-68476",
"CVE-2026-68477",
"CVE-2026-72021",
"CVE-2026-72049",
"CVE-2026-72052",
"CVE-2026-72053",
"CVE-2026-72054",
"CVE-2026-72061",
"CVE-2026-72072",
"CVE-2026-72129",
"CVE-2026-72135",
"CVE-2026-72136",
"CVE-2026-72157",
"CVE-2026-72172",
"CVE-2026-72217",
"CVE-2026-72221",
"CVE-2026-72222",
"CVE-2026-72235",
"CVE-2026-72282",
"CVE-2026-72310",
"CVE-2026-72316",
"CVE-2026-72317",
"CVE-2026-72318",
"CVE-2026-72319",
"CVE-2026-72330",
"CVE-2026-72339",
"CVE-2026-72342",
"CVE-2026-72389",
"CVE-2026-72400",
"CVE-2026-72425",
"CVE-2026-72450",
"CVE-2026-72459",
"CVE-2026-72460",
"CVE-2026-72464",
"CVE-2026-72466",
"CVE-2026-72473",
"CVE-2026-74271",
"CVE-2026-74283",
"CVE-2026-74287",
"CVE-2026-74305",
"CVE-2026-74377",
"CVE-2026-74378",
"CVE-2026-74394",
"CVE-2026-74397",
"CVE-2026-74398",
"CVE-2026-74406"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.