Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CERTA-2010-AVI-627
Vulnerability from certfr_avis - Published: - Updated:
De nombreuses vulnérabilités, liées à l'utilisation de versions anciennes du code OpenSSL, affectent Blue Coat Reporter. Les plus dommageables permettent à un utilisateur malveillant d'exécuter du code arbitraire à distance.
Description
De nombreuses vulnérabilités, liées à l'utilisation de versions anciennes du code OpenSSL, affectent Blue Coat Reporter. Les plus dommageables permettent à un utilisateur malveillant d'exécuter du code arbitraire à distance.
Solution
Pour la version 9, la révision 9.2.4.1 remédie à ces vulnérabilités. Le correctif de la version 8 n'est pas encore disponible.
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
Blue Coat Reporter, versions 8.x et 9.x.
| Vendor | Product | Description |
|---|
| Title | Publication Time | Tags | |||
|---|---|---|---|---|---|
|
|||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [],
"affected_systems_content": "\u003cp\u003eBlue Coat Reporter, versions 8.x et 9.x.\u003c/p\u003e",
"content": "## Description\n\nDe nombreuses vuln\u00e9rabilit\u00e9s, li\u00e9es \u00e0 l\u0027utilisation de versions\nanciennes du code OpenSSL, affectent Blue Coat Reporter. Les plus\ndommageables permettent \u00e0 un utilisateur malveillant d\u0027ex\u00e9cuter du code\narbitraire \u00e0 distance.\n\n## Solution\n\nPour la version 9, la r\u00e9vision 9.2.4.1 rem\u00e9die \u00e0 ces vuln\u00e9rabilit\u00e9s. Le\ncorrectif de la version 8 n\u0027est pas encore disponible.\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des\ncorrectifs (cf. section Documentation).\n",
"cves": [
{
"name": "CVE-2008-1678",
"url": "https://www.cve.org/CVERecord?id=CVE-2008-1678"
},
{
"name": "CVE-2010-0433",
"url": "https://www.cve.org/CVERecord?id=CVE-2010-0433"
},
{
"name": "CVE-2010-0742",
"url": "https://www.cve.org/CVERecord?id=CVE-2010-0742"
},
{
"name": "CVE-2009-0789",
"url": "https://www.cve.org/CVERecord?id=CVE-2009-0789"
},
{
"name": "CVE-2009-1379",
"url": "https://www.cve.org/CVERecord?id=CVE-2009-1379"
},
{
"name": "CVE-2009-3555",
"url": "https://www.cve.org/CVERecord?id=CVE-2009-3555"
},
{
"name": "CVE-2009-0591",
"url": "https://www.cve.org/CVERecord?id=CVE-2009-0591"
},
{
"name": "CVE-2009-1378",
"url": "https://www.cve.org/CVERecord?id=CVE-2009-1378"
},
{
"name": "CVE-2009-1377",
"url": "https://www.cve.org/CVERecord?id=CVE-2009-1377"
},
{
"name": "CVE-2009-3245",
"url": "https://www.cve.org/CVERecord?id=CVE-2009-3245"
},
{
"name": "CVE-2010-0740",
"url": "https://www.cve.org/CVERecord?id=CVE-2010-0740"
},
{
"name": "CVE-2009-0590",
"url": "https://www.cve.org/CVERecord?id=CVE-2009-0590"
},
{
"name": "CVE-2009-4355",
"url": "https://www.cve.org/CVERecord?id=CVE-2009-4355"
}
],
"links": [],
"reference": "CERTA-2010-AVI-627",
"revisions": [
{
"description": "version initiale.",
"revision_date": "2010-12-23T00:00:00.000000"
}
],
"risks": [
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
}
],
"summary": "De nombreuses vuln\u00e9rabilit\u00e9s, li\u00e9es \u00e0 l\u0027utilisation de versions\nanciennes du code OpenSSL, affectent Blue Coat Reporter. Les plus\ndommageables permettent \u00e0 un utilisateur malveillant d\u0027ex\u00e9cuter du code\narbitraire \u00e0 distance.\n",
"title": "Vuln\u00e9rabilit\u00e9s dans Blue Coat Reporter",
"vendor_advisories": [
{
"published_at": null,
"title": "Bulletin de s\u00e9curit\u00e9 Blue Coat SA50 du 19 novembre 2010",
"url": "http://kb.bluecoat.com/index?page=content\u0026id=SA50"
}
]
}
CVE-2009-1379 (GCVE-0-2009-1379)
Vulnerability from cvelistv5 – Published: 2009-05-19 19:00 – Updated: 2024-08-07 05:13- n/a
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T05:13:25.560Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "https://launchpad.net/bugs/cve/2009-1379"
},
{
"name": "SSA:2010-060-02",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE",
"x_transferred"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "38794",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38794"
},
{
"name": "[security-announce] 20100303 VMSA-2010-0004 ESX Service Console and vMA third party updates",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://lists.vmware.com/pipermail/security-announce/2010/000082.html"
},
{
"name": "ADV-2009-1377",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1377"
},
{
"name": "35729",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35729"
},
{
"name": "GLSA-200912-01",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO",
"x_transferred"
],
"url": "http://security.gentoo.org/glsa/glsa-200912-01.xml"
},
{
"name": "RHSA-2009:1335",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2009-1335.html"
},
{
"name": "HPSBMA02492",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02029444"
},
{
"name": "38761",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38761"
},
{
"name": "37003",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37003"
},
{
"name": "36533",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/36533"
},
{
"name": "1022241",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1022241"
},
{
"name": "USN-792-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU",
"x_transferred"
],
"url": "http://www.ubuntu.com/usn/USN-792-1"
},
{
"name": "SUSE-SR:2009:011",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-06/msg00003.html"
},
{
"name": "oval:org.mitre.oval:def:9744",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A9744"
},
{
"name": "openssl-dtls1retrievebufferedfragment-dos(50661)",
"tags": [
"vdb-entry",
"x_refsource_XF",
"x_transferred"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/50661"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://voodoo-circle.sourceforge.net/sa/sa-20091012-01.html"
},
{
"name": "35138",
"tags": [
"vdb-entry",
"x_refsource_BID",
"x_transferred"
],
"url": "http://www.securityfocus.com/bid/35138"
},
{
"name": "[oss-security] 20090518 Re: Two OpenSSL DTLS remote DoS",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.openwall.com/lists/oss-security/2009/05/18/4"
},
{
"name": "NetBSD-SA2009-009",
"tags": [
"vendor-advisory",
"x_refsource_NETBSD",
"x_transferred"
],
"url": "ftp://ftp.netbsd.org/pub/NetBSD/security/advisories/NetBSD-SA2009-009.txt.asc"
},
{
"name": "38834",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38834"
},
{
"name": "35461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35461"
},
{
"name": "35571",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35571"
},
{
"name": "oval:org.mitre.oval:def:6848",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6848"
},
{
"name": "35416",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35416"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://sourceforge.net/mailarchive/message.php?msg_name=4AD43807.7080105%40users.sourceforge.net"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://rt.openssl.org/Ticket/Display.html?id=1923\u0026user=guest\u0026pass=guest"
},
{
"name": "SSRT100079",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02029444"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "ADV-2010-0528",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0528"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2009-05-18T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "Use-after-free vulnerability in the dtls1_retrieve_buffered_fragment function in ssl/d1_both.c in OpenSSL 1.0.0 Beta 2 allows remote attackers to cause a denial of service (openssl s_client crash) and possibly have unspecified other impact via a DTLS packet, as demonstrated by a packet from a server that uses a crafted server certificate."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2017-09-28T12:57:01",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "https://launchpad.net/bugs/cve/2009-1379"
},
{
"name": "SSA:2010-060-02",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "38794",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38794"
},
{
"name": "[security-announce] 20100303 VMSA-2010-0004 ESX Service Console and vMA third party updates",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://lists.vmware.com/pipermail/security-announce/2010/000082.html"
},
{
"name": "ADV-2009-1377",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1377"
},
{
"name": "35729",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35729"
},
{
"name": "GLSA-200912-01",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO"
],
"url": "http://security.gentoo.org/glsa/glsa-200912-01.xml"
},
{
"name": "RHSA-2009:1335",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2009-1335.html"
},
{
"name": "HPSBMA02492",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02029444"
},
{
"name": "38761",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38761"
},
{
"name": "37003",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37003"
},
{
"name": "36533",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/36533"
},
{
"name": "1022241",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1022241"
},
{
"name": "USN-792-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU"
],
"url": "http://www.ubuntu.com/usn/USN-792-1"
},
{
"name": "SUSE-SR:2009:011",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-06/msg00003.html"
},
{
"name": "oval:org.mitre.oval:def:9744",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A9744"
},
{
"name": "openssl-dtls1retrievebufferedfragment-dos(50661)",
"tags": [
"vdb-entry",
"x_refsource_XF"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/50661"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://voodoo-circle.sourceforge.net/sa/sa-20091012-01.html"
},
{
"name": "35138",
"tags": [
"vdb-entry",
"x_refsource_BID"
],
"url": "http://www.securityfocus.com/bid/35138"
},
{
"name": "[oss-security] 20090518 Re: Two OpenSSL DTLS remote DoS",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.openwall.com/lists/oss-security/2009/05/18/4"
},
{
"name": "NetBSD-SA2009-009",
"tags": [
"vendor-advisory",
"x_refsource_NETBSD"
],
"url": "ftp://ftp.netbsd.org/pub/NetBSD/security/advisories/NetBSD-SA2009-009.txt.asc"
},
{
"name": "38834",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38834"
},
{
"name": "35461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35461"
},
{
"name": "35571",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35571"
},
{
"name": "oval:org.mitre.oval:def:6848",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6848"
},
{
"name": "35416",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35416"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://sourceforge.net/mailarchive/message.php?msg_name=4AD43807.7080105%40users.sourceforge.net"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://rt.openssl.org/Ticket/Display.html?id=1923\u0026user=guest\u0026pass=guest"
},
{
"name": "SSRT100079",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02029444"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "ADV-2010-0528",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0528"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2009-1379",
"datePublished": "2009-05-19T19:00:00",
"dateReserved": "2009-04-23T00:00:00",
"dateUpdated": "2024-08-07T05:13:25.560Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
CVE-2009-0591 (GCVE-0-2009-0591)
Vulnerability from cvelistv5 – Published: 2009-03-27 16:00 – Updated: 2024-08-07 04:40- n/a
| URL | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T04:40:05.194Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"name": "SSRT090059",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=124464882609472\u0026w=2"
},
{
"name": "ADV-2009-0850",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/0850"
},
{
"name": "ADV-2009-1175",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1175"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "openssl-cmsverify-security-bypass(49432)",
"tags": [
"vdb-entry",
"x_refsource_XF",
"x_transferred"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/49432"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://sourceforge.net/project/shownotes.php?release_id=671059\u0026group_id=116847"
},
{
"name": "34666",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34666"
},
{
"name": "HPSBUX02435",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=124464882609472\u0026w=2"
},
{
"name": "ADV-2009-1020",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1020"
},
{
"name": "35729",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35729"
},
{
"name": "35380",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35380"
},
{
"name": "HPSBOV02540",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127678688104458\u0026w=2"
},
{
"name": "APPLE-SA-2009-09-10-2",
"tags": [
"vendor-advisory",
"x_refsource_APPLE",
"x_transferred"
],
"url": "http://lists.apple.com/archives/security-announce/2009/Sep/msg00004.html"
},
{
"name": "35065",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35065"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.php.net/archive/2009.php#id2009-04-08-1"
},
{
"name": "34411",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34411"
},
{
"name": "NetBSD-SA2009-008",
"tags": [
"vendor-advisory",
"x_refsource_NETBSD",
"x_transferred"
],
"url": "ftp://ftp.netbsd.org/pub/NetBSD/security/advisories/NetBSD-SA2009-008.txt.asc"
},
{
"name": "52865",
"tags": [
"vdb-entry",
"x_refsource_OSVDB",
"x_transferred"
],
"url": "http://www.osvdb.org/52865"
},
{
"name": "SUSE-SR:2009:010",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-05/msg00000.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://voodoo-circle.sourceforge.net/sa/sa-20090326-01.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.apple.com/kb/HT3865"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.openssl.org/news/secadv_20090325.txt"
},
{
"name": "ADV-2009-1548",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1548"
},
{
"name": "36701",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/36701"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "34460",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34460"
},
{
"name": "34256",
"tags": [
"vdb-entry",
"x_refsource_BID",
"x_transferred"
],
"url": "http://www.securityfocus.com/bid/34256"
},
{
"name": "1021907",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://securitytracker.com/id?1021907"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2009-03-25T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "The CMS_verify function in OpenSSL 0.9.8h through 0.9.8j, when CMS is enabled, does not properly handle errors associated with malformed signed attributes, which allows remote attackers to repudiate a signature that originally appeared to be valid but was actually invalid."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2017-08-16T14:57:01",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"name": "SSRT090059",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=124464882609472\u0026w=2"
},
{
"name": "ADV-2009-0850",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/0850"
},
{
"name": "ADV-2009-1175",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1175"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "openssl-cmsverify-security-bypass(49432)",
"tags": [
"vdb-entry",
"x_refsource_XF"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/49432"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://sourceforge.net/project/shownotes.php?release_id=671059\u0026group_id=116847"
},
{
"name": "34666",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34666"
},
{
"name": "HPSBUX02435",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=124464882609472\u0026w=2"
},
{
"name": "ADV-2009-1020",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1020"
},
{
"name": "35729",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35729"
},
{
"name": "35380",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35380"
},
{
"name": "HPSBOV02540",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127678688104458\u0026w=2"
},
{
"name": "APPLE-SA-2009-09-10-2",
"tags": [
"vendor-advisory",
"x_refsource_APPLE"
],
"url": "http://lists.apple.com/archives/security-announce/2009/Sep/msg00004.html"
},
{
"name": "35065",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35065"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.php.net/archive/2009.php#id2009-04-08-1"
},
{
"name": "34411",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34411"
},
{
"name": "NetBSD-SA2009-008",
"tags": [
"vendor-advisory",
"x_refsource_NETBSD"
],
"url": "ftp://ftp.netbsd.org/pub/NetBSD/security/advisories/NetBSD-SA2009-008.txt.asc"
},
{
"name": "52865",
"tags": [
"vdb-entry",
"x_refsource_OSVDB"
],
"url": "http://www.osvdb.org/52865"
},
{
"name": "SUSE-SR:2009:010",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-05/msg00000.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://voodoo-circle.sourceforge.net/sa/sa-20090326-01.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.apple.com/kb/HT3865"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.openssl.org/news/secadv_20090325.txt"
},
{
"name": "ADV-2009-1548",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1548"
},
{
"name": "36701",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/36701"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "34460",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34460"
},
{
"name": "34256",
"tags": [
"vdb-entry",
"x_refsource_BID"
],
"url": "http://www.securityfocus.com/bid/34256"
},
{
"name": "1021907",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://securitytracker.com/id?1021907"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2009-0591",
"datePublished": "2009-03-27T16:00:00",
"dateReserved": "2009-02-13T00:00:00",
"dateUpdated": "2024-08-07T04:40:05.194Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
CVE-2009-0590 (GCVE-0-2009-0590)
Vulnerability from cvelistv5 – Published: 2009-03-27 16:00 – Updated: 2024-08-07 04:40- n/a
| URL | Tags | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T04:40:04.972Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"name": "SSRT090059",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=124464882609472\u0026w=2"
},
{
"name": "ADV-2009-0850",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/0850"
},
{
"name": "1021905",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://securitytracker.com/id?1021905"
},
{
"name": "34896",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34896"
},
{
"name": "MDVSA-2009:087",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA",
"x_transferred"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2009:087"
},
{
"name": "ADV-2009-1175",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1175"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "20090403 rPSA-2009-0057-1 m2crypto openssl openssl-scripts",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ",
"x_transferred"
],
"url": "http://www.securityfocus.com/archive/1/502429/100/0/threaded"
},
{
"name": "SUSE-SU-2011:0847",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2011-07/msg00014.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://wiki.rpath.com/Advisories:rPSA-2009-0057"
},
{
"name": "DSA-1763",
"tags": [
"vendor-advisory",
"x_refsource_DEBIAN",
"x_transferred"
],
"url": "http://www.debian.org/security/2009/dsa-1763"
},
{
"name": "38794",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38794"
},
{
"name": "[security-announce] 20100303 VMSA-2010-0004 ESX Service Console and vMA third party updates",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://lists.vmware.com/pipermail/security-announce/2010/000082.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://sourceforge.net/project/shownotes.php?release_id=671059\u0026group_id=116847"
},
{
"name": "34960",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34960"
},
{
"name": "openSUSE-SU-2011:0845",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2011-07/msg00013.html"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://wiki.rpath.com/wiki/Advisories:rPSA-2009-0057"
},
{
"name": "34666",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34666"
},
{
"name": "USN-750-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU",
"x_transferred"
],
"url": "http://www.ubuntu.com/usn/usn-750-1"
},
{
"name": "FreeBSD-SA-09:08",
"tags": [
"vendor-advisory",
"x_refsource_FREEBSD",
"x_transferred"
],
"url": "http://security.FreeBSD.org/advisories/FreeBSD-SA-09:08.openssl.asc"
},
{
"name": "HPSBUX02435",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=124464882609472\u0026w=2"
},
{
"name": "ADV-2009-1020",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1020"
},
{
"name": "35729",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35729"
},
{
"name": "RHSA-2009:1335",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2009-1335.html"
},
{
"name": "52864",
"tags": [
"vdb-entry",
"x_refsource_OSVDB",
"x_transferred"
],
"url": "http://www.osvdb.org/52864"
},
{
"name": "34561",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34561"
},
{
"name": "35380",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35380"
},
{
"name": "HPSBOV02540",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127678688104458\u0026w=2"
},
{
"name": "42467",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42467"
},
{
"name": "APPLE-SA-2009-09-10-2",
"tags": [
"vendor-advisory",
"x_refsource_APPLE",
"x_transferred"
],
"url": "http://lists.apple.com/archives/security-announce/2009/Sep/msg00004.html"
},
{
"name": "35065",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35065"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.0.6a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000101.html"
},
{
"name": "oval:org.mitre.oval:def:10198",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A10198"
},
{
"name": "36533",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/36533"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.php.net/archive/2009.php#id2009-04-08-1"
},
{
"name": "34411",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34411"
},
{
"name": "NetBSD-SA2009-008",
"tags": [
"vendor-advisory",
"x_refsource_NETBSD",
"x_transferred"
],
"url": "ftp://ftp.netbsd.org/pub/NetBSD/security/advisories/NetBSD-SA2009-008.txt.asc"
},
{
"name": "20101207 VMSA-2010-0019 VMware ESX third party updates for Service Console",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ",
"x_transferred"
],
"url": "http://www.securityfocus.com/archive/1/515055/100/0/threaded"
},
{
"name": "34509",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34509"
},
{
"name": "openssl-asn1-stringprintex-dos(49431)",
"tags": [
"vdb-entry",
"x_refsource_XF",
"x_transferred"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/49431"
},
{
"name": "35181",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35181"
},
{
"name": "258048",
"tags": [
"vendor-advisory",
"x_refsource_SUNALERT",
"x_transferred"
],
"url": "http://sunsolve.sun.com/search/document.do?assetkey=1-26-258048-1"
},
{
"name": "38834",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38834"
},
{
"name": "SUSE-SR:2009:010",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-05/msg00000.html"
},
{
"name": "oval:org.mitre.oval:def:6996",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6996"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.2.1a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000102.html"
},
{
"name": "ADV-2010-3126",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/3126"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://voodoo-circle.sourceforge.net/sa/sa-20090326-01.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.apple.com/kb/HT3865"
},
{
"name": "ADV-2009-1220",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1220"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.openssl.org/news/secadv_20090325.txt"
},
{
"name": "ADV-2009-1548",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1548"
},
{
"name": "36701",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/36701"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.avaya.com/elmodocs2/security/ASA-2009-172.htm"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.vmware.com/security/advisories/VMSA-2010-0019.html"
},
{
"name": "HPSBMA02447",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=125017764422557\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "34460",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34460"
},
{
"name": "SSRT090062",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=125017764422557\u0026w=2"
},
{
"name": "34256",
"tags": [
"vdb-entry",
"x_refsource_BID",
"x_transferred"
],
"url": "http://www.securityfocus.com/bid/34256"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "ADV-2010-0528",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0528"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2009-03-25T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "The ASN1_STRING_print_ex function in OpenSSL before 0.9.8k allows remote attackers to cause a denial of service (invalid memory access and application crash) via vectors that trigger printing of a (1) BMPString or (2) UniversalString with an invalid encoded length."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2018-10-10T18:57:01",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"name": "SSRT090059",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=124464882609472\u0026w=2"
},
{
"name": "ADV-2009-0850",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/0850"
},
{
"name": "1021905",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://securitytracker.com/id?1021905"
},
{
"name": "34896",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34896"
},
{
"name": "MDVSA-2009:087",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2009:087"
},
{
"name": "ADV-2009-1175",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1175"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "20090403 rPSA-2009-0057-1 m2crypto openssl openssl-scripts",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ"
],
"url": "http://www.securityfocus.com/archive/1/502429/100/0/threaded"
},
{
"name": "SUSE-SU-2011:0847",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2011-07/msg00014.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://wiki.rpath.com/Advisories:rPSA-2009-0057"
},
{
"name": "DSA-1763",
"tags": [
"vendor-advisory",
"x_refsource_DEBIAN"
],
"url": "http://www.debian.org/security/2009/dsa-1763"
},
{
"name": "38794",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38794"
},
{
"name": "[security-announce] 20100303 VMSA-2010-0004 ESX Service Console and vMA third party updates",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://lists.vmware.com/pipermail/security-announce/2010/000082.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://sourceforge.net/project/shownotes.php?release_id=671059\u0026group_id=116847"
},
{
"name": "34960",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34960"
},
{
"name": "openSUSE-SU-2011:0845",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2011-07/msg00013.html"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://wiki.rpath.com/wiki/Advisories:rPSA-2009-0057"
},
{
"name": "34666",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34666"
},
{
"name": "USN-750-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU"
],
"url": "http://www.ubuntu.com/usn/usn-750-1"
},
{
"name": "FreeBSD-SA-09:08",
"tags": [
"vendor-advisory",
"x_refsource_FREEBSD"
],
"url": "http://security.FreeBSD.org/advisories/FreeBSD-SA-09:08.openssl.asc"
},
{
"name": "HPSBUX02435",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=124464882609472\u0026w=2"
},
{
"name": "ADV-2009-1020",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1020"
},
{
"name": "35729",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35729"
},
{
"name": "RHSA-2009:1335",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2009-1335.html"
},
{
"name": "52864",
"tags": [
"vdb-entry",
"x_refsource_OSVDB"
],
"url": "http://www.osvdb.org/52864"
},
{
"name": "34561",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34561"
},
{
"name": "35380",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35380"
},
{
"name": "HPSBOV02540",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127678688104458\u0026w=2"
},
{
"name": "42467",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42467"
},
{
"name": "APPLE-SA-2009-09-10-2",
"tags": [
"vendor-advisory",
"x_refsource_APPLE"
],
"url": "http://lists.apple.com/archives/security-announce/2009/Sep/msg00004.html"
},
{
"name": "35065",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35065"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.0.6a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000101.html"
},
{
"name": "oval:org.mitre.oval:def:10198",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A10198"
},
{
"name": "36533",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/36533"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.php.net/archive/2009.php#id2009-04-08-1"
},
{
"name": "34411",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34411"
},
{
"name": "NetBSD-SA2009-008",
"tags": [
"vendor-advisory",
"x_refsource_NETBSD"
],
"url": "ftp://ftp.netbsd.org/pub/NetBSD/security/advisories/NetBSD-SA2009-008.txt.asc"
},
{
"name": "20101207 VMSA-2010-0019 VMware ESX third party updates for Service Console",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ"
],
"url": "http://www.securityfocus.com/archive/1/515055/100/0/threaded"
},
{
"name": "34509",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34509"
},
{
"name": "openssl-asn1-stringprintex-dos(49431)",
"tags": [
"vdb-entry",
"x_refsource_XF"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/49431"
},
{
"name": "35181",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35181"
},
{
"name": "258048",
"tags": [
"vendor-advisory",
"x_refsource_SUNALERT"
],
"url": "http://sunsolve.sun.com/search/document.do?assetkey=1-26-258048-1"
},
{
"name": "38834",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38834"
},
{
"name": "SUSE-SR:2009:010",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-05/msg00000.html"
},
{
"name": "oval:org.mitre.oval:def:6996",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6996"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.2.1a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000102.html"
},
{
"name": "ADV-2010-3126",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/3126"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://voodoo-circle.sourceforge.net/sa/sa-20090326-01.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.apple.com/kb/HT3865"
},
{
"name": "ADV-2009-1220",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1220"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.openssl.org/news/secadv_20090325.txt"
},
{
"name": "ADV-2009-1548",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1548"
},
{
"name": "36701",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/36701"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.avaya.com/elmodocs2/security/ASA-2009-172.htm"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.vmware.com/security/advisories/VMSA-2010-0019.html"
},
{
"name": "HPSBMA02447",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=125017764422557\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "34460",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34460"
},
{
"name": "SSRT090062",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=125017764422557\u0026w=2"
},
{
"name": "34256",
"tags": [
"vdb-entry",
"x_refsource_BID"
],
"url": "http://www.securityfocus.com/bid/34256"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "ADV-2010-0528",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0528"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2009-0590",
"datePublished": "2009-03-27T16:00:00",
"dateReserved": "2009-02-13T00:00:00",
"dateUpdated": "2024-08-07T04:40:04.972Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
CVE-2009-4355 (GCVE-0-2009-4355)
Vulnerability from cvelistv5 – Published: 2010-01-14 19:00 – Updated: 2024-08-07 07:01- n/a
| URL | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T07:01:19.955Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"name": "DSA-1970",
"tags": [
"vendor-advisory",
"x_refsource_DEBIAN",
"x_transferred"
],
"url": "http://www.debian.org/security/2010/dsa-1970"
},
{
"name": "ADV-2010-0916",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0916"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://cvs.openssl.org/chngview?cn=19167"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "39461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39461"
},
{
"name": "oval:org.mitre.oval:def:11260",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11260"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=546707"
},
{
"name": "FEDORA-2010-5357",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/039561.html"
},
{
"name": "SSA:2010-060-02",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE",
"x_transferred"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "38761",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38761"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://wiki.rpath.com/wiki/Advisories:rPSA-2010-0004"
},
{
"name": "38181",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38181"
},
{
"name": "38200",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38200"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://issues.rpath.com/browse/RPL-3157"
},
{
"name": "ADV-2010-0839",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0839"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://cvs.openssl.org/chngview?cn=19069"
},
{
"name": "HPSBUX02517",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://cvs.openssl.org/chngview?cn=19068"
},
{
"name": "MDVSA-2010:022",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA",
"x_transferred"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:022"
},
{
"name": "RHSA-2010:0095",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "https://rhn.redhat.com/errata/RHSA-2010-0095.html"
},
{
"name": "USN-884-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU",
"x_transferred"
],
"url": "http://www.ubuntu.com/usn/USN-884-1"
},
{
"name": "SSRT100058",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "SUSE-SA:2010:008",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-01/msg00009.html"
},
{
"name": "[oss-security] 20100113 [PATCH] memory consumption (DoS) in openssl CVE-2009-4355",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.openwall.com/lists/oss-security/2010/01/13/3"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "oval:org.mitre.oval:def:6678",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6678"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "ADV-2010-0124",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0124"
},
{
"name": "FEDORA-2010-5744",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/038587.html"
},
{
"name": "38175",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38175"
},
{
"name": "oval:org.mitre.oval:def:12168",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A12168"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2010-01-13T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "Memory leak in the zlib_stateful_finish function in crypto/comp/c_zlib.c in OpenSSL 0.9.8l and earlier and 1.0.0 Beta through Beta 4 allows remote attackers to cause a denial of service (memory consumption) via vectors that trigger incorrect calls to the CRYPTO_cleanup_all_ex_data function, as demonstrated by use of SSLv3 and PHP with the Apache HTTP Server, a related issue to CVE-2008-1678."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2017-09-18T12:57:01",
"orgId": "8254265b-2729-46b6-b9e3-3dfca2d5bfca",
"shortName": "mitre"
},
"references": [
{
"name": "DSA-1970",
"tags": [
"vendor-advisory",
"x_refsource_DEBIAN"
],
"url": "http://www.debian.org/security/2010/dsa-1970"
},
{
"name": "ADV-2010-0916",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0916"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://cvs.openssl.org/chngview?cn=19167"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "39461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39461"
},
{
"name": "oval:org.mitre.oval:def:11260",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11260"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=546707"
},
{
"name": "FEDORA-2010-5357",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/039561.html"
},
{
"name": "SSA:2010-060-02",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "38761",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38761"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://wiki.rpath.com/wiki/Advisories:rPSA-2010-0004"
},
{
"name": "38181",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38181"
},
{
"name": "38200",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38200"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://issues.rpath.com/browse/RPL-3157"
},
{
"name": "ADV-2010-0839",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0839"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://cvs.openssl.org/chngview?cn=19069"
},
{
"name": "HPSBUX02517",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://cvs.openssl.org/chngview?cn=19068"
},
{
"name": "MDVSA-2010:022",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:022"
},
{
"name": "RHSA-2010:0095",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "https://rhn.redhat.com/errata/RHSA-2010-0095.html"
},
{
"name": "USN-884-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU"
],
"url": "http://www.ubuntu.com/usn/USN-884-1"
},
{
"name": "SSRT100058",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "SUSE-SA:2010:008",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-01/msg00009.html"
},
{
"name": "[oss-security] 20100113 [PATCH] memory consumption (DoS) in openssl CVE-2009-4355",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.openwall.com/lists/oss-security/2010/01/13/3"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "oval:org.mitre.oval:def:6678",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6678"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "ADV-2010-0124",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0124"
},
{
"name": "FEDORA-2010-5744",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/038587.html"
},
{
"name": "38175",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38175"
},
{
"name": "oval:org.mitre.oval:def:12168",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A12168"
}
],
"x_legacyV4Record": {
"CVE_data_meta": {
"ASSIGNER": "cve@mitre.org",
"ID": "CVE-2009-4355",
"STATE": "PUBLIC"
},
"affects": {
"vendor": {
"vendor_data": [
{
"product": {
"product_data": [
{
"product_name": "n/a",
"version": {
"version_data": [
{
"version_value": "n/a"
}
]
}
}
]
},
"vendor_name": "n/a"
}
]
}
},
"data_format": "MITRE",
"data_type": "CVE",
"data_version": "4.0",
"description": {
"description_data": [
{
"lang": "eng",
"value": "Memory leak in the zlib_stateful_finish function in crypto/comp/c_zlib.c in OpenSSL 0.9.8l and earlier and 1.0.0 Beta through Beta 4 allows remote attackers to cause a denial of service (memory consumption) via vectors that trigger incorrect calls to the CRYPTO_cleanup_all_ex_data function, as demonstrated by use of SSLv3 and PHP with the Apache HTTP Server, a related issue to CVE-2008-1678."
}
]
},
"problemtype": {
"problemtype_data": [
{
"description": [
{
"lang": "eng",
"value": "n/a"
}
]
}
]
},
"references": {
"reference_data": [
{
"name": "DSA-1970",
"refsource": "DEBIAN",
"url": "http://www.debian.org/security/2010/dsa-1970"
},
{
"name": "ADV-2010-0916",
"refsource": "VUPEN",
"url": "http://www.vupen.com/english/advisories/2010/0916"
},
{
"name": "http://cvs.openssl.org/chngview?cn=19167",
"refsource": "CONFIRM",
"url": "http://cvs.openssl.org/chngview?cn=19167"
},
{
"name": "42724",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/42724"
},
{
"name": "39461",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/39461"
},
{
"name": "oval:org.mitre.oval:def:11260",
"refsource": "OVAL",
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11260"
},
{
"name": "https://bugzilla.redhat.com/show_bug.cgi?id=546707",
"refsource": "CONFIRM",
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=546707"
},
{
"name": "FEDORA-2010-5357",
"refsource": "FEDORA",
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/039561.html"
},
{
"name": "SSA:2010-060-02",
"refsource": "SLACKWARE",
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "38761",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/38761"
},
{
"name": "http://wiki.rpath.com/wiki/Advisories:rPSA-2010-0004",
"refsource": "CONFIRM",
"url": "http://wiki.rpath.com/wiki/Advisories:rPSA-2010-0004"
},
{
"name": "38181",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/38181"
},
{
"name": "38200",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/38200"
},
{
"name": "https://issues.rpath.com/browse/RPL-3157",
"refsource": "CONFIRM",
"url": "https://issues.rpath.com/browse/RPL-3157"
},
{
"name": "ADV-2010-0839",
"refsource": "VUPEN",
"url": "http://www.vupen.com/english/advisories/2010/0839"
},
{
"name": "http://cvs.openssl.org/chngview?cn=19069",
"refsource": "CONFIRM",
"url": "http://cvs.openssl.org/chngview?cn=19069"
},
{
"name": "HPSBUX02517",
"refsource": "HP",
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "http://cvs.openssl.org/chngview?cn=19068",
"refsource": "CONFIRM",
"url": "http://cvs.openssl.org/chngview?cn=19068"
},
{
"name": "MDVSA-2010:022",
"refsource": "MANDRIVA",
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:022"
},
{
"name": "RHSA-2010:0095",
"refsource": "REDHAT",
"url": "https://rhn.redhat.com/errata/RHSA-2010-0095.html"
},
{
"name": "USN-884-1",
"refsource": "UBUNTU",
"url": "http://www.ubuntu.com/usn/USN-884-1"
},
{
"name": "SSRT100058",
"refsource": "HP",
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "SUSE-SA:2010:008",
"refsource": "SUSE",
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-01/msg00009.html"
},
{
"name": "[oss-security] 20100113 [PATCH] memory consumption (DoS) in openssl CVE-2009-4355",
"refsource": "MLIST",
"url": "http://www.openwall.com/lists/oss-security/2010/01/13/3"
},
{
"name": "https://kb.bluecoat.com/index?page=content\u0026id=SA50",
"refsource": "CONFIRM",
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "oval:org.mitre.oval:def:6678",
"refsource": "OVAL",
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6678"
},
{
"name": "42733",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/42733"
},
{
"name": "ADV-2010-0124",
"refsource": "VUPEN",
"url": "http://www.vupen.com/english/advisories/2010/0124"
},
{
"name": "FEDORA-2010-5744",
"refsource": "FEDORA",
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/038587.html"
},
{
"name": "38175",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/38175"
},
{
"name": "oval:org.mitre.oval:def:12168",
"refsource": "OVAL",
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A12168"
}
]
}
}
}
},
"cveMetadata": {
"assignerOrgId": "8254265b-2729-46b6-b9e3-3dfca2d5bfca",
"assignerShortName": "mitre",
"cveId": "CVE-2009-4355",
"datePublished": "2010-01-14T19:00:00",
"dateReserved": "2009-12-18T00:00:00",
"dateUpdated": "2024-08-07T07:01:19.955Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
CVE-2010-0740 (GCVE-0-2010-0740)
Vulnerability from cvelistv5 – Published: 2010-03-26 18:00 – Updated: 2024-08-07 00:59- n/a
| URL | Tags | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T00:59:39.011Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.apple.com/kb/HT4723"
},
{
"name": "HPSBUX02531",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127557640302499\u0026w=2"
},
{
"name": "APPLE-SA-2011-06-23-1",
"tags": [
"vendor-advisory",
"x_refsource_APPLE",
"x_transferred"
],
"url": "http://lists.apple.com/archives/security-announce/2011//Jun/msg00000.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.openssl.org/news/secadv_20100324.txt"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.0.6a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000101.html"
},
{
"name": "ADV-2010-0710",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0710"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.vmware.com/support/vsphere4/doc/vsp_vc41_u1_rel_notes.html"
},
{
"name": "ADV-2010-0839",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0839"
},
{
"name": "SSRT100108",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127557640302499\u0026w=2"
},
{
"name": "MDVSA-2010:076",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA",
"x_transferred"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:076"
},
{
"name": "HPSBUX02517",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.2.1a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000102.html"
},
{
"name": "1023748",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023748"
},
{
"name": "39932",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39932"
},
{
"name": "ADV-2010-0933",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0933"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.vmware.com/security/advisories/VMSA-2011-0003.html"
},
{
"name": "SSRT100058",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "oval:org.mitre.oval:def:11731",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11731"
},
{
"name": "20110211 VMSA-2011-0003 Third party component updates for VMware vCenter Server, vCenter Update Manager, ESXi and ESX",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ",
"x_transferred"
],
"url": "http://www.securityfocus.com/archive/1/516397/100/0/threaded"
},
{
"name": "43311",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/43311"
},
{
"name": "ADV-2010-1216",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/1216"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "FEDORA-2010-5744",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/038587.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://aix.software.ibm.com/aix/efixes/security/openssl_advisory.asc"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2010-03-24T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "The ssl3_get_record function in ssl/s3_pkt.c in OpenSSL 0.9.8f through 0.9.8m allows remote attackers to cause a denial of service (crash) via a malformed record in a TLS connection that triggers a NULL pointer dereference, related to the minor version number. NOTE: some of these details are obtained from third party information."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2018-10-10T18:57:01",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.apple.com/kb/HT4723"
},
{
"name": "HPSBUX02531",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127557640302499\u0026w=2"
},
{
"name": "APPLE-SA-2011-06-23-1",
"tags": [
"vendor-advisory",
"x_refsource_APPLE"
],
"url": "http://lists.apple.com/archives/security-announce/2011//Jun/msg00000.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.openssl.org/news/secadv_20100324.txt"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.0.6a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000101.html"
},
{
"name": "ADV-2010-0710",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0710"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.vmware.com/support/vsphere4/doc/vsp_vc41_u1_rel_notes.html"
},
{
"name": "ADV-2010-0839",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0839"
},
{
"name": "SSRT100108",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127557640302499\u0026w=2"
},
{
"name": "MDVSA-2010:076",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:076"
},
{
"name": "HPSBUX02517",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.2.1a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000102.html"
},
{
"name": "1023748",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023748"
},
{
"name": "39932",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39932"
},
{
"name": "ADV-2010-0933",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0933"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.vmware.com/security/advisories/VMSA-2011-0003.html"
},
{
"name": "SSRT100058",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "oval:org.mitre.oval:def:11731",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11731"
},
{
"name": "20110211 VMSA-2011-0003 Third party component updates for VMware vCenter Server, vCenter Update Manager, ESXi and ESX",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ"
],
"url": "http://www.securityfocus.com/archive/1/516397/100/0/threaded"
},
{
"name": "43311",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/43311"
},
{
"name": "ADV-2010-1216",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/1216"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "FEDORA-2010-5744",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/038587.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://aix.software.ibm.com/aix/efixes/security/openssl_advisory.asc"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2010-0740",
"datePublished": "2010-03-26T18:00:00",
"dateReserved": "2010-02-26T00:00:00",
"dateUpdated": "2024-08-07T00:59:39.011Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
CVE-2010-0742 (GCVE-0-2010-0742)
Vulnerability from cvelistv5 – Published: 2010-06-03 14:00 – Updated: 2024-08-07 00:59- n/a
| URL | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T00:59:38.997Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://rt.openssl.org/Ticket/Display.html?id=2211\u0026user=guest\u0026pass=guest"
},
{
"name": "ADV-2010-1313",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/1313"
},
{
"name": "40024",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/40024"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "oval:org.mitre.oval:def:12395",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A12395"
},
{
"name": "40502",
"tags": [
"vdb-entry",
"x_refsource_BID",
"x_transferred"
],
"url": "http://www.securityfocus.com/bid/40502"
},
{
"name": "HPSBUX02610",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=129138643405740\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=ssg1S1004564"
},
{
"name": "ADV-2010-3105",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/3105"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.0.6a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000101.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://cvs.openssl.org/filediff?f=openssl/crypto/cms/cms_asn1.c\u0026v1=1.8\u0026v2=1.8.6.1"
},
{
"name": "57353",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/57353"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.2.1a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000102.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=598738"
},
{
"name": "SSRT100341",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=129138643405740\u0026w=2"
},
{
"name": "40000",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/40000"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "42457",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42457"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://cvs.openssl.org/chngview?cn=19693"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.openssl.org/news/secadv_20100601.txt"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2010-06-01T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "The Cryptographic Message Syntax (CMS) implementation in crypto/cms/cms_asn1.c in OpenSSL before 0.9.8o and 1.x before 1.0.0a does not properly handle structures that contain OriginatorInfo, which allows context-dependent attackers to modify invalid memory locations or conduct double-free attacks, and possibly execute arbitrary code, via unspecified vectors."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2017-09-18T12:57:01",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://rt.openssl.org/Ticket/Display.html?id=2211\u0026user=guest\u0026pass=guest"
},
{
"name": "ADV-2010-1313",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/1313"
},
{
"name": "40024",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/40024"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "oval:org.mitre.oval:def:12395",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A12395"
},
{
"name": "40502",
"tags": [
"vdb-entry",
"x_refsource_BID"
],
"url": "http://www.securityfocus.com/bid/40502"
},
{
"name": "HPSBUX02610",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=129138643405740\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=ssg1S1004564"
},
{
"name": "ADV-2010-3105",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/3105"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.0.6a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000101.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://cvs.openssl.org/filediff?f=openssl/crypto/cms/cms_asn1.c\u0026v1=1.8\u0026v2=1.8.6.1"
},
{
"name": "57353",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/57353"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.2.1a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000102.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=598738"
},
{
"name": "SSRT100341",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=129138643405740\u0026w=2"
},
{
"name": "40000",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/40000"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "42457",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42457"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://cvs.openssl.org/chngview?cn=19693"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.openssl.org/news/secadv_20100601.txt"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2010-0742",
"datePublished": "2010-06-03T14:00:00",
"dateReserved": "2010-02-26T00:00:00",
"dateUpdated": "2024-08-07T00:59:38.997Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
CVE-2009-3245 (GCVE-0-2009-3245)
Vulnerability from cvelistv5 – Published: 2010-03-05 19:00 – Updated: 2024-08-07 06:22- n/a
| URL | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T06:22:24.020Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"name": "ADV-2010-0916",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0916"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "oval:org.mitre.oval:def:11738",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11738"
},
{
"name": "39461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39461"
},
{
"name": "[openssl-cvs] 20100223 OpenSSL: OpenSSL_1_0_0-stable: openssl/crypto/bn/ bn_div.c bn_gf...",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://marc.info/?l=openssl-cvs\u0026m=126692159706582\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.apple.com/kb/HT4723"
},
{
"name": "FEDORA-2010-5357",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/039561.html"
},
{
"name": "SSA:2010-060-02",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE",
"x_transferred"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "APPLE-SA-2011-06-23-1",
"tags": [
"vendor-advisory",
"x_refsource_APPLE",
"x_transferred"
],
"url": "http://lists.apple.com/archives/security-announce/2011//Jun/msg00000.html"
},
{
"name": "oval:org.mitre.oval:def:6640",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6640"
},
{
"name": "HPSBOV02540",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127678688104458\u0026w=2"
},
{
"name": "[openssl-cvs] 20100223 OpenSSL: openssl/crypto/bn/ bn_div.c bn_gf2m.c openssl/crypto/ec...",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://marc.info/?l=openssl-cvs\u0026m=126692170906712\u0026w=2"
},
{
"name": "38761",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38761"
},
{
"name": "SUSE-SR:2010:013",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-06/msg00001.html"
},
{
"name": "38562",
"tags": [
"vdb-entry",
"x_refsource_BID",
"x_transferred"
],
"url": "http://www.securityfocus.com/bid/38562"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.0.6a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000101.html"
},
{
"name": "oval:org.mitre.oval:def:9790",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A9790"
},
{
"name": "[openssl-cvs] 20100223 OpenSSL: OpenSSL_0_9_8-stable: openssl/ CHANGES openssl/crypto/b...",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://marc.info/?l=openssl-cvs\u0026m=126692180606861\u0026w=2"
},
{
"name": "RHSA-2010:0977",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0977.html"
},
{
"name": "ADV-2010-0839",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0839"
},
{
"name": "MDVSA-2010:076",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA",
"x_transferred"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:076"
},
{
"name": "HPSBUX02517",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.2.1a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000102.html"
},
{
"name": "USN-1003-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU",
"x_transferred"
],
"url": "http://www.ubuntu.com/usn/USN-1003-1"
},
{
"name": "39932",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39932"
},
{
"name": "ADV-2010-0933",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0933"
},
{
"name": "RHSA-2011:0896",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2011-0896.html"
},
{
"name": "SSRT100058",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "ADV-2010-1216",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/1216"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "37291",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37291"
},
{
"name": "FEDORA-2010-5744",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/038587.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://aix.software.ibm.com/aix/efixes/security/openssl_advisory.asc"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://packetstormsecurity.com/files/153392/ABB-HMI-Outdated-Software-Components.html"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2010-02-23T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "OpenSSL before 0.9.8m does not check for a NULL return value from bn_wexpand function calls in (1) crypto/bn/bn_div.c, (2) crypto/bn/bn_gf2m.c, (3) crypto/ec/ec2_smpl.c, and (4) engines/e_ubsec.c, which has unspecified impact and context-dependent attack vectors."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2019-06-25T00:06:09",
"orgId": "8254265b-2729-46b6-b9e3-3dfca2d5bfca",
"shortName": "mitre"
},
"references": [
{
"name": "ADV-2010-0916",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0916"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "oval:org.mitre.oval:def:11738",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11738"
},
{
"name": "39461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39461"
},
{
"name": "[openssl-cvs] 20100223 OpenSSL: OpenSSL_1_0_0-stable: openssl/crypto/bn/ bn_div.c bn_gf...",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://marc.info/?l=openssl-cvs\u0026m=126692159706582\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.apple.com/kb/HT4723"
},
{
"name": "FEDORA-2010-5357",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/039561.html"
},
{
"name": "SSA:2010-060-02",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "APPLE-SA-2011-06-23-1",
"tags": [
"vendor-advisory",
"x_refsource_APPLE"
],
"url": "http://lists.apple.com/archives/security-announce/2011//Jun/msg00000.html"
},
{
"name": "oval:org.mitre.oval:def:6640",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6640"
},
{
"name": "HPSBOV02540",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127678688104458\u0026w=2"
},
{
"name": "[openssl-cvs] 20100223 OpenSSL: openssl/crypto/bn/ bn_div.c bn_gf2m.c openssl/crypto/ec...",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://marc.info/?l=openssl-cvs\u0026m=126692170906712\u0026w=2"
},
{
"name": "38761",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38761"
},
{
"name": "SUSE-SR:2010:013",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-06/msg00001.html"
},
{
"name": "38562",
"tags": [
"vdb-entry",
"x_refsource_BID"
],
"url": "http://www.securityfocus.com/bid/38562"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.0.6a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000101.html"
},
{
"name": "oval:org.mitre.oval:def:9790",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A9790"
},
{
"name": "[openssl-cvs] 20100223 OpenSSL: OpenSSL_0_9_8-stable: openssl/ CHANGES openssl/crypto/b...",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://marc.info/?l=openssl-cvs\u0026m=126692180606861\u0026w=2"
},
{
"name": "RHSA-2010:0977",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0977.html"
},
{
"name": "ADV-2010-0839",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0839"
},
{
"name": "MDVSA-2010:076",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:076"
},
{
"name": "HPSBUX02517",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.2.1a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000102.html"
},
{
"name": "USN-1003-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU"
],
"url": "http://www.ubuntu.com/usn/USN-1003-1"
},
{
"name": "39932",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39932"
},
{
"name": "ADV-2010-0933",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0933"
},
{
"name": "RHSA-2011:0896",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2011-0896.html"
},
{
"name": "SSRT100058",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "ADV-2010-1216",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/1216"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "37291",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37291"
},
{
"name": "FEDORA-2010-5744",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/038587.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://aix.software.ibm.com/aix/efixes/security/openssl_advisory.asc"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://packetstormsecurity.com/files/153392/ABB-HMI-Outdated-Software-Components.html"
}
],
"x_legacyV4Record": {
"CVE_data_meta": {
"ASSIGNER": "cve@mitre.org",
"ID": "CVE-2009-3245",
"STATE": "PUBLIC"
},
"affects": {
"vendor": {
"vendor_data": [
{
"product": {
"product_data": [
{
"product_name": "n/a",
"version": {
"version_data": [
{
"version_value": "n/a"
}
]
}
}
]
},
"vendor_name": "n/a"
}
]
}
},
"data_format": "MITRE",
"data_type": "CVE",
"data_version": "4.0",
"description": {
"description_data": [
{
"lang": "eng",
"value": "OpenSSL before 0.9.8m does not check for a NULL return value from bn_wexpand function calls in (1) crypto/bn/bn_div.c, (2) crypto/bn/bn_gf2m.c, (3) crypto/ec/ec2_smpl.c, and (4) engines/e_ubsec.c, which has unspecified impact and context-dependent attack vectors."
}
]
},
"problemtype": {
"problemtype_data": [
{
"description": [
{
"lang": "eng",
"value": "n/a"
}
]
}
]
},
"references": {
"reference_data": [
{
"name": "ADV-2010-0916",
"refsource": "VUPEN",
"url": "http://www.vupen.com/english/advisories/2010/0916"
},
{
"name": "42724",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/42724"
},
{
"name": "oval:org.mitre.oval:def:11738",
"refsource": "OVAL",
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11738"
},
{
"name": "39461",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/39461"
},
{
"name": "[openssl-cvs] 20100223 OpenSSL: OpenSSL_1_0_0-stable: openssl/crypto/bn/ bn_div.c bn_gf...",
"refsource": "MLIST",
"url": "http://marc.info/?l=openssl-cvs\u0026m=126692159706582\u0026w=2"
},
{
"name": "http://support.apple.com/kb/HT4723",
"refsource": "CONFIRM",
"url": "http://support.apple.com/kb/HT4723"
},
{
"name": "FEDORA-2010-5357",
"refsource": "FEDORA",
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/039561.html"
},
{
"name": "SSA:2010-060-02",
"refsource": "SLACKWARE",
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "APPLE-SA-2011-06-23-1",
"refsource": "APPLE",
"url": "http://lists.apple.com/archives/security-announce/2011//Jun/msg00000.html"
},
{
"name": "oval:org.mitre.oval:def:6640",
"refsource": "OVAL",
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6640"
},
{
"name": "HPSBOV02540",
"refsource": "HP",
"url": "http://marc.info/?l=bugtraq\u0026m=127678688104458\u0026w=2"
},
{
"name": "[openssl-cvs] 20100223 OpenSSL: openssl/crypto/bn/ bn_div.c bn_gf2m.c openssl/crypto/ec...",
"refsource": "MLIST",
"url": "http://marc.info/?l=openssl-cvs\u0026m=126692170906712\u0026w=2"
},
{
"name": "38761",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/38761"
},
{
"name": "SUSE-SR:2010:013",
"refsource": "SUSE",
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-06/msg00001.html"
},
{
"name": "38562",
"refsource": "BID",
"url": "http://www.securityfocus.com/bid/38562"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.0.6a has been released",
"refsource": "MLIST",
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000101.html"
},
{
"name": "oval:org.mitre.oval:def:9790",
"refsource": "OVAL",
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A9790"
},
{
"name": "[openssl-cvs] 20100223 OpenSSL: OpenSSL_0_9_8-stable: openssl/ CHANGES openssl/crypto/b...",
"refsource": "MLIST",
"url": "http://marc.info/?l=openssl-cvs\u0026m=126692180606861\u0026w=2"
},
{
"name": "RHSA-2010:0977",
"refsource": "REDHAT",
"url": "http://www.redhat.com/support/errata/RHSA-2010-0977.html"
},
{
"name": "ADV-2010-0839",
"refsource": "VUPEN",
"url": "http://www.vupen.com/english/advisories/2010/0839"
},
{
"name": "MDVSA-2010:076",
"refsource": "MANDRIVA",
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:076"
},
{
"name": "HPSBUX02517",
"refsource": "HP",
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.2.1a has been released",
"refsource": "MLIST",
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000102.html"
},
{
"name": "USN-1003-1",
"refsource": "UBUNTU",
"url": "http://www.ubuntu.com/usn/USN-1003-1"
},
{
"name": "39932",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/39932"
},
{
"name": "ADV-2010-0933",
"refsource": "VUPEN",
"url": "http://www.vupen.com/english/advisories/2010/0933"
},
{
"name": "RHSA-2011:0896",
"refsource": "REDHAT",
"url": "http://www.redhat.com/support/errata/RHSA-2011-0896.html"
},
{
"name": "SSRT100058",
"refsource": "HP",
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "https://kb.bluecoat.com/index?page=content\u0026id=SA50",
"refsource": "CONFIRM",
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "ADV-2010-1216",
"refsource": "VUPEN",
"url": "http://www.vupen.com/english/advisories/2010/1216"
},
{
"name": "42733",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/42733"
},
{
"name": "37291",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/37291"
},
{
"name": "FEDORA-2010-5744",
"refsource": "FEDORA",
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/038587.html"
},
{
"name": "http://aix.software.ibm.com/aix/efixes/security/openssl_advisory.asc",
"refsource": "CONFIRM",
"url": "http://aix.software.ibm.com/aix/efixes/security/openssl_advisory.asc"
},
{
"name": "http://packetstormsecurity.com/files/153392/ABB-HMI-Outdated-Software-Components.html",
"refsource": "MISC",
"url": "http://packetstormsecurity.com/files/153392/ABB-HMI-Outdated-Software-Components.html"
}
]
}
}
}
},
"cveMetadata": {
"assignerOrgId": "8254265b-2729-46b6-b9e3-3dfca2d5bfca",
"assignerShortName": "mitre",
"cveId": "CVE-2009-3245",
"datePublished": "2010-03-05T19:00:00",
"dateReserved": "2009-09-18T00:00:00",
"dateUpdated": "2024-08-07T06:22:24.020Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
CVE-2009-1377 (GCVE-0-2009-1377)
Vulnerability from cvelistv5 – Published: 2009-05-19 19:00 – Updated: 2024-08-07 05:13- n/a
| URL | Tags | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T05:13:25.060Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://rt.openssl.org/Ticket/Display.html?id=1930\u0026user=guest\u0026pass=guest"
},
{
"name": "SSA:2010-060-02",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE",
"x_transferred"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "38794",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38794"
},
{
"name": "[security-announce] 20100303 VMSA-2010-0004 ESX Service Console and vMA third party updates",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://lists.vmware.com/pipermail/security-announce/2010/000082.html"
},
{
"name": "ADV-2009-1377",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1377"
},
{
"name": "35729",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35729"
},
{
"name": "GLSA-200912-01",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO",
"x_transferred"
],
"url": "http://security.gentoo.org/glsa/glsa-200912-01.xml"
},
{
"name": "RHSA-2009:1335",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2009-1335.html"
},
{
"name": "HPSBMA02492",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02029444"
},
{
"name": "38761",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38761"
},
{
"name": "37003",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37003"
},
{
"name": "oval:org.mitre.oval:def:9663",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A9663"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "https://launchpad.net/bugs/cve/2009-1377"
},
{
"name": "36533",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/36533"
},
{
"name": "1022241",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1022241"
},
{
"name": "USN-792-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU",
"x_transferred"
],
"url": "http://www.ubuntu.com/usn/USN-792-1"
},
{
"name": "SUSE-SR:2009:011",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-06/msg00003.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://voodoo-circle.sourceforge.net/sa/sa-20091012-01.html"
},
{
"name": "[oss-security] 20090518 Two OpenSSL DTLS remote DoS",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.openwall.com/lists/oss-security/2009/05/18/1"
},
{
"name": "[openssl-dev] 20090516 [openssl.org #1930] [PATCH] DTLS record buffer limitation bug",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://marc.info/?l=openssl-dev\u0026m=124247675613888\u0026w=2"
},
{
"name": "NetBSD-SA2009-009",
"tags": [
"vendor-advisory",
"x_refsource_NETBSD",
"x_transferred"
],
"url": "ftp://ftp.netbsd.org/pub/NetBSD/security/advisories/NetBSD-SA2009-009.txt.asc"
},
{
"name": "35001",
"tags": [
"vdb-entry",
"x_refsource_BID",
"x_transferred"
],
"url": "http://www.securityfocus.com/bid/35001"
},
{
"name": "oval:org.mitre.oval:def:6683",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6683"
},
{
"name": "38834",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38834"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://cvs.openssl.org/chngview?cn=18187"
},
{
"name": "MDVSA-2009:120",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA",
"x_transferred"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2009:120"
},
{
"name": "35461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35461"
},
{
"name": "35128",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35128"
},
{
"name": "35571",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35571"
},
{
"name": "35416",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35416"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://sourceforge.net/mailarchive/message.php?msg_name=4AD43807.7080105%40users.sourceforge.net"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "SSRT100079",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02029444"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "ADV-2010-0528",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0528"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2009-05-18T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "The dtls1_buffer_record function in ssl/d1_pkt.c in OpenSSL 0.9.8k and earlier 0.9.8 versions allows remote attackers to cause a denial of service (memory consumption) via a large series of \"future epoch\" DTLS records that are buffered in a queue, aka \"DTLS record buffer limitation bug.\""
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2017-09-28T12:57:01",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://rt.openssl.org/Ticket/Display.html?id=1930\u0026user=guest\u0026pass=guest"
},
{
"name": "SSA:2010-060-02",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "38794",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38794"
},
{
"name": "[security-announce] 20100303 VMSA-2010-0004 ESX Service Console and vMA third party updates",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://lists.vmware.com/pipermail/security-announce/2010/000082.html"
},
{
"name": "ADV-2009-1377",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1377"
},
{
"name": "35729",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35729"
},
{
"name": "GLSA-200912-01",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO"
],
"url": "http://security.gentoo.org/glsa/glsa-200912-01.xml"
},
{
"name": "RHSA-2009:1335",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2009-1335.html"
},
{
"name": "HPSBMA02492",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02029444"
},
{
"name": "38761",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38761"
},
{
"name": "37003",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37003"
},
{
"name": "oval:org.mitre.oval:def:9663",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A9663"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "https://launchpad.net/bugs/cve/2009-1377"
},
{
"name": "36533",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/36533"
},
{
"name": "1022241",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1022241"
},
{
"name": "USN-792-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU"
],
"url": "http://www.ubuntu.com/usn/USN-792-1"
},
{
"name": "SUSE-SR:2009:011",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-06/msg00003.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://voodoo-circle.sourceforge.net/sa/sa-20091012-01.html"
},
{
"name": "[oss-security] 20090518 Two OpenSSL DTLS remote DoS",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.openwall.com/lists/oss-security/2009/05/18/1"
},
{
"name": "[openssl-dev] 20090516 [openssl.org #1930] [PATCH] DTLS record buffer limitation bug",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://marc.info/?l=openssl-dev\u0026m=124247675613888\u0026w=2"
},
{
"name": "NetBSD-SA2009-009",
"tags": [
"vendor-advisory",
"x_refsource_NETBSD"
],
"url": "ftp://ftp.netbsd.org/pub/NetBSD/security/advisories/NetBSD-SA2009-009.txt.asc"
},
{
"name": "35001",
"tags": [
"vdb-entry",
"x_refsource_BID"
],
"url": "http://www.securityfocus.com/bid/35001"
},
{
"name": "oval:org.mitre.oval:def:6683",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6683"
},
{
"name": "38834",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38834"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://cvs.openssl.org/chngview?cn=18187"
},
{
"name": "MDVSA-2009:120",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2009:120"
},
{
"name": "35461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35461"
},
{
"name": "35128",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35128"
},
{
"name": "35571",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35571"
},
{
"name": "35416",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35416"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://sourceforge.net/mailarchive/message.php?msg_name=4AD43807.7080105%40users.sourceforge.net"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "SSRT100079",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02029444"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "ADV-2010-0528",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0528"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2009-1377",
"datePublished": "2009-05-19T19:00:00",
"dateReserved": "2009-04-23T00:00:00",
"dateUpdated": "2024-08-07T05:13:25.060Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
CVE-2009-1378 (GCVE-0-2009-1378)
Vulnerability from cvelistv5 – Published: 2009-05-19 19:00 – Updated: 2024-08-07 05:13- n/a
| URL | Tags | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T05:13:25.511Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://rt.openssl.org/Ticket/Display.html?id=1931\u0026user=guest\u0026pass=guest"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "oval:org.mitre.oval:def:7229",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A7229"
},
{
"name": "SSA:2010-060-02",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE",
"x_transferred"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "38794",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38794"
},
{
"name": "[security-announce] 20100303 VMSA-2010-0004 ESX Service Console and vMA third party updates",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://lists.vmware.com/pipermail/security-announce/2010/000082.html"
},
{
"name": "8720",
"tags": [
"exploit",
"x_refsource_EXPLOIT-DB",
"x_transferred"
],
"url": "https://www.exploit-db.com/exploits/8720"
},
{
"name": "ADV-2009-1377",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1377"
},
{
"name": "oval:org.mitre.oval:def:11309",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11309"
},
{
"name": "35729",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35729"
},
{
"name": "GLSA-200912-01",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO",
"x_transferred"
],
"url": "http://security.gentoo.org/glsa/glsa-200912-01.xml"
},
{
"name": "RHSA-2009:1335",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2009-1335.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://cvs.openssl.org/chngview?cn=18188"
},
{
"name": "HPSBMA02492",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02029444"
},
{
"name": "38761",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38761"
},
{
"name": "37003",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37003"
},
{
"name": "[openssl-dev] 20090518 Re: [openssl.org #1931] [PATCH] DTLS fragment handling memory leak",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://marc.info/?l=openssl-dev\u0026m=124263491424212\u0026w=2"
},
{
"name": "36533",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/36533"
},
{
"name": "1022241",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1022241"
},
{
"name": "USN-792-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU",
"x_transferred"
],
"url": "http://www.ubuntu.com/usn/USN-792-1"
},
{
"name": "SUSE-SR:2009:011",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-06/msg00003.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://voodoo-circle.sourceforge.net/sa/sa-20091012-01.html"
},
{
"name": "[oss-security] 20090518 Two OpenSSL DTLS remote DoS",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.openwall.com/lists/oss-security/2009/05/18/1"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "https://launchpad.net/bugs/cve/2009-1378"
},
{
"name": "NetBSD-SA2009-009",
"tags": [
"vendor-advisory",
"x_refsource_NETBSD",
"x_transferred"
],
"url": "ftp://ftp.netbsd.org/pub/NetBSD/security/advisories/NetBSD-SA2009-009.txt.asc"
},
{
"name": "35001",
"tags": [
"vdb-entry",
"x_refsource_BID",
"x_transferred"
],
"url": "http://www.securityfocus.com/bid/35001"
},
{
"name": "38834",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38834"
},
{
"name": "MDVSA-2009:120",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA",
"x_transferred"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2009:120"
},
{
"name": "35461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35461"
},
{
"name": "35128",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35128"
},
{
"name": "35571",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35571"
},
{
"name": "35416",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35416"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://sourceforge.net/mailarchive/message.php?msg_name=4AD43807.7080105%40users.sourceforge.net"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "SSRT100079",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02029444"
},
{
"name": "[openssl-dev] 20090516 [openssl.org #1931] [PATCH] DTLS fragment handling memory leak",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://marc.info/?l=openssl-dev\u0026m=124247679213944\u0026w=2"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "ADV-2010-0528",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0528"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2009-05-18T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "Multiple memory leaks in the dtls1_process_out_of_seq_message function in ssl/d1_both.c in OpenSSL 0.9.8k and earlier 0.9.8 versions allow remote attackers to cause a denial of service (memory consumption) via DTLS records that (1) are duplicates or (2) have sequence numbers much greater than current sequence numbers, aka \"DTLS fragment handling memory leak.\""
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2017-09-28T12:57:01",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://rt.openssl.org/Ticket/Display.html?id=1931\u0026user=guest\u0026pass=guest"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "oval:org.mitre.oval:def:7229",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A7229"
},
{
"name": "SSA:2010-060-02",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "38794",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38794"
},
{
"name": "[security-announce] 20100303 VMSA-2010-0004 ESX Service Console and vMA third party updates",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://lists.vmware.com/pipermail/security-announce/2010/000082.html"
},
{
"name": "8720",
"tags": [
"exploit",
"x_refsource_EXPLOIT-DB"
],
"url": "https://www.exploit-db.com/exploits/8720"
},
{
"name": "ADV-2009-1377",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1377"
},
{
"name": "oval:org.mitre.oval:def:11309",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11309"
},
{
"name": "35729",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35729"
},
{
"name": "GLSA-200912-01",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO"
],
"url": "http://security.gentoo.org/glsa/glsa-200912-01.xml"
},
{
"name": "RHSA-2009:1335",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2009-1335.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://cvs.openssl.org/chngview?cn=18188"
},
{
"name": "HPSBMA02492",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02029444"
},
{
"name": "38761",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38761"
},
{
"name": "37003",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37003"
},
{
"name": "[openssl-dev] 20090518 Re: [openssl.org #1931] [PATCH] DTLS fragment handling memory leak",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://marc.info/?l=openssl-dev\u0026m=124263491424212\u0026w=2"
},
{
"name": "36533",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/36533"
},
{
"name": "1022241",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1022241"
},
{
"name": "USN-792-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU"
],
"url": "http://www.ubuntu.com/usn/USN-792-1"
},
{
"name": "SUSE-SR:2009:011",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-06/msg00003.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://voodoo-circle.sourceforge.net/sa/sa-20091012-01.html"
},
{
"name": "[oss-security] 20090518 Two OpenSSL DTLS remote DoS",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.openwall.com/lists/oss-security/2009/05/18/1"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "https://launchpad.net/bugs/cve/2009-1378"
},
{
"name": "NetBSD-SA2009-009",
"tags": [
"vendor-advisory",
"x_refsource_NETBSD"
],
"url": "ftp://ftp.netbsd.org/pub/NetBSD/security/advisories/NetBSD-SA2009-009.txt.asc"
},
{
"name": "35001",
"tags": [
"vdb-entry",
"x_refsource_BID"
],
"url": "http://www.securityfocus.com/bid/35001"
},
{
"name": "38834",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38834"
},
{
"name": "MDVSA-2009:120",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2009:120"
},
{
"name": "35461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35461"
},
{
"name": "35128",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35128"
},
{
"name": "35571",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35571"
},
{
"name": "35416",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35416"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://sourceforge.net/mailarchive/message.php?msg_name=4AD43807.7080105%40users.sourceforge.net"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "SSRT100079",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02029444"
},
{
"name": "[openssl-dev] 20090516 [openssl.org #1931] [PATCH] DTLS fragment handling memory leak",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://marc.info/?l=openssl-dev\u0026m=124247679213944\u0026w=2"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "ADV-2010-0528",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0528"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2009-1378",
"datePublished": "2009-05-19T19:00:00",
"dateReserved": "2009-04-23T00:00:00",
"dateUpdated": "2024-08-07T05:13:25.511Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
CVE-2009-3555 (GCVE-0-2009-3555)
Vulnerability from cvelistv5 – Published: 2009-11-09 17:00 – Updated: 2024-08-07 06:31- n/a
| URL | Tags | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T06:31:10.430Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"name": "APPLE-SA-2010-05-18-1",
"tags": [
"vendor-advisory",
"x_refsource_APPLE",
"x_transferred"
],
"url": "http://lists.apple.com/archives/security-announce/2010//May/msg00001.html"
},
{
"name": "1023427",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023427"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.avaya.com/css/P8/documents/100081611"
},
{
"name": "62210",
"tags": [
"vdb-entry",
"x_refsource_OSVDB",
"x_transferred"
],
"url": "http://osvdb.org/62210"
},
{
"name": "37640",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37640"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.arubanetworks.com/support/alerts/aid-020810.txt"
},
{
"name": "ADV-2010-0916",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0916"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.avaya.com/css/P8/documents/100114327"
},
{
"name": "RHSA-2010:0167",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0167.html"
},
{
"name": "ADV-2010-2010",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/2010"
},
{
"name": "FEDORA-2009-12750",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg00428.html"
},
{
"name": "ADV-2010-0086",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0086"
},
{
"name": "ADV-2010-1673",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/1673"
},
{
"name": "[tls] 20091104 TLS renegotiation issue",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.ietf.org/mail-archive/web/tls/current/msg03948.html"
},
{
"name": "37656",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37656"
},
{
"name": "RHSA-2010:0865",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0865.html"
},
{
"name": "39628",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39628"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.oracle.com/technetwork/topics/security/cpuapr2011-301950.html"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "ADV-2009-3310",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/3310"
},
{
"name": "ADV-2009-3205",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/3205"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://blogs.sun.com/security/entry/vulnerability_in_tls_protocol_during"
},
{
"name": "39461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39461"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.avaya.com/css/P8/documents/100114315"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.proftpd.org/docs/RELEASE_NOTES-1.3.2c"
},
{
"name": "GLSA-201406-32",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO",
"x_transferred"
],
"url": "http://security.gentoo.org/glsa/glsa-201406-32.xml"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.ingate.com/Relnote.php?ver=481"
},
{
"name": "1023204",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023204"
},
{
"name": "40866",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/40866"
},
{
"name": "HPSBMU02799",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=134254866602253\u0026w=2"
},
{
"name": "TA10-222A",
"tags": [
"third-party-advisory",
"x_refsource_CERT",
"x_transferred"
],
"url": "http://www.us-cert.gov/cas/techalerts/TA10-222A.html"
},
{
"name": "1023211",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023211"
},
{
"name": "SSRT090249",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c01945686"
},
{
"name": "39317",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39317"
},
{
"name": "1023212",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023212"
},
{
"name": "SUSE-SA:2010:061",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-12/msg00005.html"
},
{
"name": "39127",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39127"
},
{
"name": "40545",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/40545"
},
{
"name": "ADV-2010-3069",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/3069"
},
{
"name": "[4.5] 010: SECURITY FIX: November 26, 2009",
"tags": [
"vendor-advisory",
"x_refsource_OPENBSD",
"x_transferred"
],
"url": "http://openbsd.org/errata45.html#010_openssl"
},
{
"name": "1023210",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023210"
},
{
"name": "1023270",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023270"
},
{
"name": "40070",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/40070"
},
{
"name": "1023273",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023273"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://kbase.redhat.com/faq/docs/DOC-20491"
},
{
"name": "USN-927-5",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU",
"x_transferred"
],
"url": "http://www.ubuntu.com/usn/USN-927-5"
},
{
"name": "PM12247",
"tags": [
"vendor-advisory",
"x_refsource_AIXAPAR",
"x_transferred"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg1PM12247"
},
{
"name": "SUSE-SU-2011:0847",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2011-07/msg00014.html"
},
{
"name": "MDVSA-2010:089",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA",
"x_transferred"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:089"
},
{
"name": "RHSA-2010:0770",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0770.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.openssl.org/news/secadv_20091111.txt"
},
{
"name": "1023275",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023275"
},
{
"name": "DSA-3253",
"tags": [
"vendor-advisory",
"x_refsource_DEBIAN",
"x_transferred"
],
"url": "http://www.debian.org/security/2015/dsa-3253"
},
{
"name": "ADV-2009-3484",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/3484"
},
{
"name": "1023207",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023207"
},
{
"name": "37859",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37859"
},
{
"name": "SSRT101846",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=142660345230545\u0026w=2"
},
{
"name": "1021752",
"tags": [
"vendor-advisory",
"x_refsource_SUNALERT",
"x_transferred"
],
"url": "http://sunsolve.sun.com/search/document.do?assetkey=1-77-1021752.1-1"
},
{
"name": "FEDORA-2010-6131",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-May/040652.html"
},
{
"name": "ADV-2010-0848",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0848"
},
{
"name": "[oss-security] 20091107 Re: [TLS] CVE-2009-3555 for TLS renegotiation MITM attacks",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.openwall.com/lists/oss-security/2009/11/07/3"
},
{
"name": "39819",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39819"
},
{
"name": "IC68055",
"tags": [
"vendor-advisory",
"x_refsource_AIXAPAR",
"x_transferred"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg1IC68055"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://www.links.org/?p=786"
},
{
"name": "60521",
"tags": [
"vdb-entry",
"x_refsource_OSVDB",
"x_transferred"
],
"url": "http://osvdb.org/60521"
},
{
"name": "[oss-security] 20091123 Re: CVEs for nginx",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.openwall.com/lists/oss-security/2009/11/23/10"
},
{
"name": "VU#120541",
"tags": [
"third-party-advisory",
"x_refsource_CERT-VN",
"x_transferred"
],
"url": "http://www.kb.cert.org/vuls/id/120541"
},
{
"name": "1023217",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023217"
},
{
"name": "RHSA-2010:0768",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0768.html"
},
{
"name": "ADV-2009-3353",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/3353"
},
{
"name": "FEDORA-2010-5357",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/039561.html"
},
{
"name": "39136",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39136"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.openoffice.org/security/cves/CVE-2009-3555.html"
},
{
"name": "ADV-2011-0032",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2011/0032"
},
{
"name": "1023148",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://securitytracker.com/id?1023148"
},
{
"name": "openSUSE-SU-2011:0845",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2011-07/msg00013.html"
},
{
"name": "36935",
"tags": [
"vdb-entry",
"x_refsource_BID",
"x_transferred"
],
"url": "http://www.securityfocus.com/bid/36935"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://www.tombom.co.uk/blog/?p=85"
},
{
"name": "SSRT090208",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=130497311408250\u0026w=2"
},
{
"name": "ADV-2010-1107",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/1107"
},
{
"name": "1023218",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023218"
},
{
"name": "ADV-2010-1350",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/1350"
},
{
"name": "RHSA-2010:0338",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0338.html"
},
{
"name": "42379",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42379"
},
{
"name": "FEDORA-2009-12775",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg00442.html"
},
{
"name": "20091109 Transport Layer Security Renegotiation Vulnerability",
"tags": [
"vendor-advisory",
"x_refsource_CISCO",
"x_transferred"
],
"url": "http://www.cisco.com/en/US/products/products_security_advisory09186a0080b01d1d.shtml"
},
{
"name": "IC67848",
"tags": [
"vendor-advisory",
"x_refsource_AIXAPAR",
"x_transferred"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg1IC67848"
},
{
"name": "1023213",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023213"
},
{
"name": "FEDORA-2010-16240",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-October/049702.html"
},
{
"name": "ADV-2010-1793",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/1793"
},
{
"name": "oval:org.mitre.oval:def:11617",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11617"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://extendedsubset.com/?p=8"
},
{
"name": "37292",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37292"
},
{
"name": "SSRT100817",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://www.securityfocus.com/archive/1/522176"
},
{
"name": "tls-renegotiation-weak-security(54158)",
"tags": [
"vdb-entry",
"x_refsource_XF",
"x_transferred"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/54158"
},
{
"name": "APPLE-SA-2010-05-18-2",
"tags": [
"vendor-advisory",
"x_refsource_APPLE",
"x_transferred"
],
"url": "http://lists.apple.com/archives/security-announce/2010//May/msg00002.html"
},
{
"name": "39278",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39278"
},
{
"name": "1023205",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023205"
},
{
"name": "RHSA-2010:0130",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0130.html"
},
{
"name": "HPSBUX02482",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c01945686"
},
{
"name": "HPSBHF03293",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=142660345230545\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://tomcat.apache.org/native-doc/miscellaneous/changelog-1.1.x.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.apple.com/kb/HT4004"
},
{
"name": "1023215",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023215"
},
{
"name": "USN-1010-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU",
"x_transferred"
],
"url": "http://www.ubuntu.com/usn/USN-1010-1"
},
{
"name": "1023206",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023206"
},
{
"name": "SUSE-SR:2010:011",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-05/msg00001.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://h20566.www2.hpe.com/portal/site/hpsc/public/kb/docDisplay?docId=emr_na-c05150888"
},
{
"name": "GLSA-200912-01",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO",
"x_transferred"
],
"url": "http://security.gentoo.org/glsa/glsa-200912-01.xml"
},
{
"name": "SSRT090180",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127419602507642\u0026w=2"
},
{
"name": "ADV-2009-3313",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/3313"
},
{
"name": "274990",
"tags": [
"vendor-advisory",
"x_refsource_SUNALERT",
"x_transferred"
],
"url": "http://sunsolve.sun.com/search/document.do?assetkey=1-66-274990-1"
},
{
"name": "1023208",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023208"
},
{
"name": "43308",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/43308"
},
{
"name": "1023214",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023214"
},
{
"name": "SUSE-SA:2009:057",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-11/msg00009.html"
},
{
"name": "38781",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38781"
},
{
"name": "HPSBOV02762",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=133469267822771\u0026w=2"
},
{
"name": "HPSBMA02534",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127419602507642\u0026w=2"
},
{
"name": "DSA-1934",
"tags": [
"vendor-advisory",
"x_refsource_DEBIAN",
"x_transferred"
],
"url": "http://www.debian.org/security/2009/dsa-1934"
},
{
"name": "FEDORA-2009-12782",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg00449.html"
},
{
"name": "oval:org.mitre.oval:def:7478",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A7478"
},
{
"name": "1023271",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023271"
},
{
"name": "APPLE-SA-2010-01-19-1",
"tags": [
"vendor-advisory",
"x_refsource_APPLE",
"x_transferred"
],
"url": "http://lists.apple.com/archives/security-announce/2010/Jan/msg00000.html"
},
{
"name": "[cryptography] 20091105 OpenSSL 0.9.8l released",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://marc.info/?l=cryptography\u0026m=125752275331877\u0026w=2"
},
{
"name": "42467",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42467"
},
{
"name": "20091130 TLS / SSLv3 vulnerability explained (New ways to leverage the vulnerability)",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ",
"x_transferred"
],
"url": "http://www.securityfocus.com/archive/1/508130/100/0/threaded"
},
{
"name": "oval:org.mitre.oval:def:7315",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A7315"
},
{
"name": "1023224",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023224"
},
{
"name": "SUSE-SR:2010:013",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-06/msg00001.html"
},
{
"name": "USN-927-4",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU",
"x_transferred"
],
"url": "http://www.ubuntu.com/usn/USN-927-4"
},
{
"name": "41490",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/41490"
},
{
"name": "20091124 rPSA-2009-0155-1 httpd mod_ssl",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ",
"x_transferred"
],
"url": "http://www.securityfocus.com/archive/1/508075/100/0/threaded"
},
{
"name": "1023243",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023243"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://blog.g-sec.lu/2009/11/tls-sslv3-renegotiation-vulnerability.html"
},
{
"name": "37504",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37504"
},
{
"name": "1023219",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023219"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://sysoev.ru/nginx/patch.cve-2009-3555.txt"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://xss.cx/examples/plesk-reports/plesk-parallels-controlpanel-psa.v.10.3.1_build1013110726.09%20os_redhat.el6-billing-system-plugin-javascript-injection-example-poc-report.html"
},
{
"name": "1023163",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023163"
},
{
"name": "HPSBHF02706",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=132077688910227\u0026w=2"
},
{
"name": "ADV-2009-3521",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/3521"
},
{
"name": "oval:org.mitre.oval:def:7973",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A7973"
},
{
"name": "HPSBMA02568",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://www.itrc.hp.com/service/cki/docDisplay.do?docId=emr_na-c02512995"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.zeus.com/zws/news/2010/01/13/zws_4_3r5_released"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=533125"
},
{
"name": "oval:org.mitre.oval:def:10088",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A10088"
},
{
"name": "44183",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/44183"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.zeus.com/zws/media/docs/4.3/RELEASE_NOTES"
},
{
"name": "42808",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42808"
},
{
"name": "39500",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39500"
},
{
"name": "oval:org.mitre.oval:def:11578",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11578"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.oracle.com/technetwork/topics/security/cpuoct2010-175626.html"
},
{
"name": "ADV-2009-3220",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/3220"
},
{
"name": "SSRT100179",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://itrc.hp.com/service/cki/docDisplay.do?docId=emr_na-c02273751"
},
{
"name": "SSRT100089",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127557596201693\u0026w=2"
},
{
"name": "RHSA-2010:0165",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0165.html"
},
{
"name": "20101207 VMSA-2010-0019 VMware ESX third party updates for Service Console",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ",
"x_transferred"
],
"url": "http://www.securityfocus.com/archive/1/515055/100/0/threaded"
},
{
"name": "RHSA-2010:0987",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0987.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://bugzilla.mozilla.org/show_bug.cgi?id=545755"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg21426108"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://blogs.iss.net/archive/sslmitmiscsrf.html"
},
{
"name": "1023411",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023411"
},
{
"name": "RHSA-2010:0339",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0339.html"
},
{
"name": "RHSA-2010:0986",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0986.html"
},
{
"name": "ADV-2009-3164",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/3164"
},
{
"name": "37383",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37383"
},
{
"name": "FEDORA-2009-12229",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg01029.html"
},
{
"name": "44954",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/44954"
},
{
"name": "[tls] 20091104 MITM attack on delayed TLS-client auth through renegotiation",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.ietf.org/mail-archive/web/tls/current/msg03928.html"
},
{
"name": "HPSBUX02524",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127557596201693\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.avaya.com/css/P8/documents/100070150"
},
{
"name": "40747",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/40747"
},
{
"name": "HPSBUX02498",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=126150535619567\u0026w=2"
},
{
"name": "HPSBMU02759",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://www.securityfocus.com/archive/1/522176"
},
{
"name": "39292",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39292"
},
{
"name": "42816",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42816"
},
{
"name": "IC68054",
"tags": [
"vendor-advisory",
"x_refsource_AIXAPAR",
"x_transferred"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg1IC68054"
},
{
"name": "273029",
"tags": [
"vendor-advisory",
"x_refsource_SUNALERT",
"x_transferred"
],
"url": "http://sunsolve.sun.com/search/document.do?assetkey=1-66-273029-1"
},
{
"name": "FEDORA-2009-12604",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg00645.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg21432298"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://extendedsubset.com/Renegotiating_TLS.pdf"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg24025312"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg24006386"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.apple.com/kb/HT4170"
},
{
"name": "20091118 TLS / SSLv3 vulnerability explained (DRAFT)",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ",
"x_transferred"
],
"url": "http://www.securityfocus.com/archive/1/507952/100/0/threaded"
},
{
"name": "1023209",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023209"
},
{
"name": "PM00675",
"tags": [
"vendor-advisory",
"x_refsource_AIXAPAR",
"x_transferred"
],
"url": "http://www-1.ibm.com/support/search.wss?rs=0\u0026q=PM00675\u0026apar=only"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.vmware.com/support/vsphere4/doc/vsp_vc41_u1_rel_notes.html"
},
{
"name": "HPSBOV02683",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=130497311408250\u0026w=2"
},
{
"name": "48577",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/48577"
},
{
"name": "SSA:2009-320-01",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE",
"x_transferred"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2009\u0026m=slackware-security.597446"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://www.links.org/?p=789"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.opera.com/docs/changelogs/unix/1060/"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://www.securegoose.org/2009/11/tls-renegotiation-vulnerability-cve.html"
},
{
"name": "RHSA-2011:0880",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2011-0880.html"
},
{
"name": "SUSE-SR:2010:008",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-04/msg00001.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.oracle.com/technetwork/topics/security/javacpuoct2010-176258.html"
},
{
"name": "[oss-security] 20091107 Re: CVE-2009-3555 for TLS renegotiation MITM attacks",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.openwall.com/lists/oss-security/2009/11/06/3"
},
{
"name": "FEDORA-2009-12305",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg01020.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://wiki.rpath.com/Advisories:rPSA-2009-0155"
},
{
"name": "SUSE-SR:2010:012",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-05/msg00002.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.citrix.com/article/CTX123359"
},
{
"name": "37501",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37501"
},
{
"name": "MDVSA-2010:076",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA",
"x_transferred"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:076"
},
{
"name": "HPSBUX02517",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "ADV-2009-3587",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/3587"
},
{
"name": "39632",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39632"
},
{
"name": "SSRT090264",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=126150535619567\u0026w=2"
},
{
"name": "38687",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38687"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "https://bugzilla.mozilla.org/show_bug.cgi?id=526689"
},
{
"name": "MS10-049",
"tags": [
"vendor-advisory",
"x_refsource_MS",
"x_transferred"
],
"url": "https://docs.microsoft.com/en-us/security-updates/securitybulletins/2010/ms10-049"
},
{
"name": "ADV-2010-0982",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0982"
},
{
"name": "SSRT100825",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=133469267822771\u0026w=2"
},
{
"name": "37399",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37399"
},
{
"name": "USN-927-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU",
"x_transferred"
],
"url": "http://www.ubuntu.com/usn/USN-927-1"
},
{
"name": "1023272",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023272"
},
{
"name": "FEDORA-2009-12606",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg00944.html"
},
{
"name": "ADV-2010-3126",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/3126"
},
{
"name": "37320",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37320"
},
{
"name": "ADV-2009-3165",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/3165"
},
{
"name": "ADV-2010-1639",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/1639"
},
{
"name": "38020",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38020"
},
{
"name": "USN-923-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU",
"x_transferred"
],
"url": "http://ubuntu.com/usn/usn-923-1"
},
{
"name": "39243",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39243"
},
{
"name": "oval:org.mitre.oval:def:8366",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A8366"
},
{
"name": "37453",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37453"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.hitachi.co.jp/Prod/comp/soft1/security/info/vuls/HS10-030/index.html"
},
{
"name": "ADV-2010-0933",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0933"
},
{
"name": "SSRT100219",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://www.itrc.hp.com/service/cki/docDisplay.do?docId=emr_na-c02512995"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.vmware.com/security/advisories/VMSA-2011-0003.html"
},
{
"name": "41972",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/41972"
},
{
"name": "ADV-2010-3086",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/3086"
},
{
"name": "DSA-2141",
"tags": [
"vendor-advisory",
"x_refsource_DEBIAN",
"x_transferred"
],
"url": "http://www.debian.org/security/2011/dsa-2141"
},
{
"name": "1024789",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1024789"
},
{
"name": "RHSA-2010:0155",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0155.html"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://www.educatedguesswork.org/2009/11/understanding_the_tls_renegoti.html"
},
{
"name": "ADV-2011-0033",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2011/0033"
},
{
"name": "RHSA-2010:0337",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0337.html"
},
{
"name": "1023216",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023216"
},
{
"name": "41480",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/41480"
},
{
"name": "ADV-2011-0086",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2011/0086"
},
{
"name": "41818",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/41818"
},
{
"name": "37604",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37604"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.opera.com/support/search/view/944/"
},
{
"name": "[announce] 20091107 CVE-2009-3555 - apache/mod_ssl vulnerability and mitigation",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://marc.info/?l=apache-httpd-announce\u0026m=125755783724966\u0026w=2"
},
{
"name": "SUSE-SR:2010:024",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-12/msg00006.html"
},
{
"name": "TA10-287A",
"tags": [
"third-party-advisory",
"x_refsource_CERT",
"x_transferred"
],
"url": "http://www.us-cert.gov/cas/techalerts/TA10-287A.html"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://www.links.org/?p=780"
},
{
"name": "RHSA-2010:0119",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0119.html"
},
{
"name": "38056",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38056"
},
{
"name": "ADV-2010-0748",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0748"
},
{
"name": "37675",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37675"
},
{
"name": "oval:org.mitre.oval:def:8535",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A8535"
},
{
"name": "HPSBMA02547",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://itrc.hp.com/service/cki/docDisplay.do?docId=emr_na-c02273751"
},
{
"name": "SSRT100058",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.vmware.com/security/advisories/VMSA-2010-0019.html"
},
{
"name": "RHSA-2010:0786",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0786.html"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "https://svn.resiprocate.org/rep/ietf-drafts/ekr/draft-rescorla-tls-renegotiate.txt"
},
{
"name": "38003",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38003"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.apple.com/kb/HT4171"
},
{
"name": "1023428",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023428"
},
{
"name": "SSRT100613",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=132077688910227\u0026w=2"
},
{
"name": "[oss-security] 20091120 CVEs for nginx",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.openwall.com/lists/oss-security/2009/11/20/1"
},
{
"name": "ADV-2009-3354",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/3354"
},
{
"name": "1023274",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023274"
},
{
"name": "FEDORA-2009-12968",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg00634.html"
},
{
"name": "39242",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39242"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "38241",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38241"
},
{
"name": "42377",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42377"
},
{
"name": "GLSA-201203-22",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO",
"x_transferred"
],
"url": "http://security.gentoo.org/glsa/glsa-201203-22.xml"
},
{
"name": "[oss-security] 20091105 CVE-2009-3555 for TLS renegotiation MITM attacks",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.openwall.com/lists/oss-security/2009/11/05/3"
},
{
"name": "SUSE-SR:2010:019",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-10/msg00006.html"
},
{
"name": "60972",
"tags": [
"vdb-entry",
"x_refsource_OSVDB",
"x_transferred"
],
"url": "http://osvdb.org/60972"
},
{
"name": "1023426",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1023426"
},
{
"name": "38484",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38484"
},
{
"name": "MDVSA-2010:084",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA",
"x_transferred"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:084"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://www.betanews.com/article/1257452450"
},
{
"name": "1021653",
"tags": [
"vendor-advisory",
"x_refsource_SUNALERT",
"x_transferred"
],
"url": "http://sunsolve.sun.com/search/document.do?assetkey=1-77-1021653.1-1"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.mozilla.org/security/announce/2010/mfsa2010-22.html"
},
{
"name": "20110211 VMSA-2011-0003 Third party component updates for VMware vCenter Server, vCenter Update Manager, ESXi and ESX",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ",
"x_transferred"
],
"url": "http://www.securityfocus.com/archive/1/516397/100/0/threaded"
},
{
"name": "[4.6] 004: SECURITY FIX: November 26, 2009",
"tags": [
"vendor-advisory",
"x_refsource_OPENBSD",
"x_transferred"
],
"url": "http://openbsd.org/errata46.html#004_openssl"
},
{
"name": "41967",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/41967"
},
{
"name": "RHSA-2010:0807",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0807.html"
},
{
"name": "ADV-2010-1191",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/1191"
},
{
"name": "20091111 Re: SSL/TLS MiTM PoC",
"tags": [
"mailing-list",
"x_refsource_FULLDISC",
"x_transferred"
],
"url": "http://seclists.org/fulldisclosure/2009/Nov/139"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "https://support.f5.com/kb/en-us/solutions/public/10000/700/sol10737.html"
},
{
"name": "[oss-security] 20091105 Re: CVE-2009-3555 for TLS renegotiation MITM attacks",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.openwall.com/lists/oss-security/2009/11/05/5"
},
{
"name": "39713",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39713"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "37291",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/37291"
},
{
"name": "FEDORA-2010-16312",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-October/049455.html"
},
{
"name": "FEDORA-2010-5942",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/039957.html"
},
{
"name": "ADV-2010-2745",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/2745"
},
{
"name": "273350",
"tags": [
"vendor-advisory",
"x_refsource_SUNALERT",
"x_transferred"
],
"url": "http://sunsolve.sun.com/search/document.do?assetkey=1-26-273350-1"
},
{
"name": "ADV-2010-0994",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0994"
},
{
"name": "ADV-2010-0173",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0173"
},
{
"name": "ADV-2010-1054",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/1054"
},
{
"name": "65202",
"tags": [
"vdb-entry",
"x_refsource_OSVDB",
"x_transferred"
],
"url": "http://osvdb.org/65202"
},
{
"name": "HPSBGN02562",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02436041"
},
{
"name": "FEDORA-2010-16294",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-October/049528.html"
},
{
"name": "[gnutls-devel] 20091105 Re: TLS renegotiation MITM",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://lists.gnu.org/archive/html/gnutls-devel/2009-11/msg00029.html"
},
{
"name": "20131121 ESA-2013-077: RSA Data Protection Manager Appliance Multiple Vulnerabilities",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ",
"x_transferred"
],
"url": "http://archives.neohapsis.com/archives/bugtraq/2013-11/0120.html"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://clicky.me/tlsvuln"
},
{
"name": "42811",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42811"
},
{
"name": "[tomcat-dev] 20190319 svn commit: r1855831 [26/30] - in /tomcat/site/trunk: ./ docs/ xdocs/",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.apache.org/thread.html/ba661b0edd913b39ff129a32d855620dd861883ade05fd88a8ce517d%40%3Cdev.tomcat.apache.org%3E"
},
{
"name": "[tomcat-dev] 20190325 svn commit: r1856174 [26/29] - in /tomcat/site/trunk: docs/ xdocs/ xdocs/stylesheets/",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.apache.org/thread.html/f8e0814e11c7f21f42224b6de111cb3f5e5ab5c15b78924c516d4ec2%40%3Cdev.tomcat.apache.org%3E"
},
{
"name": "[tomcat-dev] 20200203 svn commit: r1873527 [26/30] - /tomcat/site/trunk/docs/",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.apache.org/thread.html/rf8e8c091182b45daa50d3557cad9b10bb4198e3f08cf8f1c66a1b08d%40%3Cdev.tomcat.apache.org%3E"
},
{
"name": "[tomcat-dev] 20200213 svn commit: r1873980 [31/34] - /tomcat/site/trunk/docs/",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.apache.org/thread.html/re3b72cbb13e1dfe85c4a06959a3b6ca6d939b407ecca80db12b54220%40%3Cdev.tomcat.apache.org%3E"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2009-11-04T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "The TLS protocol, and the SSL protocol 3.0 and possibly earlier, as used in Microsoft Internet Information Services (IIS) 7.0, mod_ssl in the Apache HTTP Server 2.2.14 and earlier, OpenSSL before 0.9.8l, GnuTLS 2.8.5 and earlier, Mozilla Network Security Services (NSS) 3.12.4 and earlier, multiple Cisco products, and other products, does not properly associate renegotiation handshakes with an existing connection, which allows man-in-the-middle attackers to insert data into HTTPS sessions, and possibly other types of sessions protected by TLS or SSL, by sending an unauthenticated request that is processed retroactively by a server in a post-renegotiation context, related to a \"plaintext injection\" attack, aka the \"Project Mogul\" issue."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2020-02-13T16:08:08",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"name": "APPLE-SA-2010-05-18-1",
"tags": [
"vendor-advisory",
"x_refsource_APPLE"
],
"url": "http://lists.apple.com/archives/security-announce/2010//May/msg00001.html"
},
{
"name": "1023427",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023427"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.avaya.com/css/P8/documents/100081611"
},
{
"name": "62210",
"tags": [
"vdb-entry",
"x_refsource_OSVDB"
],
"url": "http://osvdb.org/62210"
},
{
"name": "37640",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37640"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.arubanetworks.com/support/alerts/aid-020810.txt"
},
{
"name": "ADV-2010-0916",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0916"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.avaya.com/css/P8/documents/100114327"
},
{
"name": "RHSA-2010:0167",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0167.html"
},
{
"name": "ADV-2010-2010",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/2010"
},
{
"name": "FEDORA-2009-12750",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg00428.html"
},
{
"name": "ADV-2010-0086",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0086"
},
{
"name": "ADV-2010-1673",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/1673"
},
{
"name": "[tls] 20091104 TLS renegotiation issue",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.ietf.org/mail-archive/web/tls/current/msg03948.html"
},
{
"name": "37656",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37656"
},
{
"name": "RHSA-2010:0865",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0865.html"
},
{
"name": "39628",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39628"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.oracle.com/technetwork/topics/security/cpuapr2011-301950.html"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "ADV-2009-3310",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/3310"
},
{
"name": "ADV-2009-3205",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/3205"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://blogs.sun.com/security/entry/vulnerability_in_tls_protocol_during"
},
{
"name": "39461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39461"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.avaya.com/css/P8/documents/100114315"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.proftpd.org/docs/RELEASE_NOTES-1.3.2c"
},
{
"name": "GLSA-201406-32",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO"
],
"url": "http://security.gentoo.org/glsa/glsa-201406-32.xml"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.ingate.com/Relnote.php?ver=481"
},
{
"name": "1023204",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023204"
},
{
"name": "40866",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/40866"
},
{
"name": "HPSBMU02799",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=134254866602253\u0026w=2"
},
{
"name": "TA10-222A",
"tags": [
"third-party-advisory",
"x_refsource_CERT"
],
"url": "http://www.us-cert.gov/cas/techalerts/TA10-222A.html"
},
{
"name": "1023211",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023211"
},
{
"name": "SSRT090249",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c01945686"
},
{
"name": "39317",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39317"
},
{
"name": "1023212",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023212"
},
{
"name": "SUSE-SA:2010:061",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-12/msg00005.html"
},
{
"name": "39127",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39127"
},
{
"name": "40545",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/40545"
},
{
"name": "ADV-2010-3069",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/3069"
},
{
"name": "[4.5] 010: SECURITY FIX: November 26, 2009",
"tags": [
"vendor-advisory",
"x_refsource_OPENBSD"
],
"url": "http://openbsd.org/errata45.html#010_openssl"
},
{
"name": "1023210",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023210"
},
{
"name": "1023270",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023270"
},
{
"name": "40070",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/40070"
},
{
"name": "1023273",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023273"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://kbase.redhat.com/faq/docs/DOC-20491"
},
{
"name": "USN-927-5",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU"
],
"url": "http://www.ubuntu.com/usn/USN-927-5"
},
{
"name": "PM12247",
"tags": [
"vendor-advisory",
"x_refsource_AIXAPAR"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg1PM12247"
},
{
"name": "SUSE-SU-2011:0847",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2011-07/msg00014.html"
},
{
"name": "MDVSA-2010:089",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:089"
},
{
"name": "RHSA-2010:0770",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0770.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.openssl.org/news/secadv_20091111.txt"
},
{
"name": "1023275",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023275"
},
{
"name": "DSA-3253",
"tags": [
"vendor-advisory",
"x_refsource_DEBIAN"
],
"url": "http://www.debian.org/security/2015/dsa-3253"
},
{
"name": "ADV-2009-3484",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/3484"
},
{
"name": "1023207",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023207"
},
{
"name": "37859",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37859"
},
{
"name": "SSRT101846",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=142660345230545\u0026w=2"
},
{
"name": "1021752",
"tags": [
"vendor-advisory",
"x_refsource_SUNALERT"
],
"url": "http://sunsolve.sun.com/search/document.do?assetkey=1-77-1021752.1-1"
},
{
"name": "FEDORA-2010-6131",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-May/040652.html"
},
{
"name": "ADV-2010-0848",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0848"
},
{
"name": "[oss-security] 20091107 Re: [TLS] CVE-2009-3555 for TLS renegotiation MITM attacks",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.openwall.com/lists/oss-security/2009/11/07/3"
},
{
"name": "39819",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39819"
},
{
"name": "IC68055",
"tags": [
"vendor-advisory",
"x_refsource_AIXAPAR"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg1IC68055"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://www.links.org/?p=786"
},
{
"name": "60521",
"tags": [
"vdb-entry",
"x_refsource_OSVDB"
],
"url": "http://osvdb.org/60521"
},
{
"name": "[oss-security] 20091123 Re: CVEs for nginx",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.openwall.com/lists/oss-security/2009/11/23/10"
},
{
"name": "VU#120541",
"tags": [
"third-party-advisory",
"x_refsource_CERT-VN"
],
"url": "http://www.kb.cert.org/vuls/id/120541"
},
{
"name": "1023217",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023217"
},
{
"name": "RHSA-2010:0768",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0768.html"
},
{
"name": "ADV-2009-3353",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/3353"
},
{
"name": "FEDORA-2010-5357",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/039561.html"
},
{
"name": "39136",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39136"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.openoffice.org/security/cves/CVE-2009-3555.html"
},
{
"name": "ADV-2011-0032",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2011/0032"
},
{
"name": "1023148",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://securitytracker.com/id?1023148"
},
{
"name": "openSUSE-SU-2011:0845",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2011-07/msg00013.html"
},
{
"name": "36935",
"tags": [
"vdb-entry",
"x_refsource_BID"
],
"url": "http://www.securityfocus.com/bid/36935"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://www.tombom.co.uk/blog/?p=85"
},
{
"name": "SSRT090208",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=130497311408250\u0026w=2"
},
{
"name": "ADV-2010-1107",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/1107"
},
{
"name": "1023218",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023218"
},
{
"name": "ADV-2010-1350",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/1350"
},
{
"name": "RHSA-2010:0338",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0338.html"
},
{
"name": "42379",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42379"
},
{
"name": "FEDORA-2009-12775",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg00442.html"
},
{
"name": "20091109 Transport Layer Security Renegotiation Vulnerability",
"tags": [
"vendor-advisory",
"x_refsource_CISCO"
],
"url": "http://www.cisco.com/en/US/products/products_security_advisory09186a0080b01d1d.shtml"
},
{
"name": "IC67848",
"tags": [
"vendor-advisory",
"x_refsource_AIXAPAR"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg1IC67848"
},
{
"name": "1023213",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023213"
},
{
"name": "FEDORA-2010-16240",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-October/049702.html"
},
{
"name": "ADV-2010-1793",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/1793"
},
{
"name": "oval:org.mitre.oval:def:11617",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11617"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://extendedsubset.com/?p=8"
},
{
"name": "37292",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37292"
},
{
"name": "SSRT100817",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://www.securityfocus.com/archive/1/522176"
},
{
"name": "tls-renegotiation-weak-security(54158)",
"tags": [
"vdb-entry",
"x_refsource_XF"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/54158"
},
{
"name": "APPLE-SA-2010-05-18-2",
"tags": [
"vendor-advisory",
"x_refsource_APPLE"
],
"url": "http://lists.apple.com/archives/security-announce/2010//May/msg00002.html"
},
{
"name": "39278",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39278"
},
{
"name": "1023205",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023205"
},
{
"name": "RHSA-2010:0130",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0130.html"
},
{
"name": "HPSBUX02482",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c01945686"
},
{
"name": "HPSBHF03293",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=142660345230545\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://tomcat.apache.org/native-doc/miscellaneous/changelog-1.1.x.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.apple.com/kb/HT4004"
},
{
"name": "1023215",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023215"
},
{
"name": "USN-1010-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU"
],
"url": "http://www.ubuntu.com/usn/USN-1010-1"
},
{
"name": "1023206",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023206"
},
{
"name": "SUSE-SR:2010:011",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-05/msg00001.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://h20566.www2.hpe.com/portal/site/hpsc/public/kb/docDisplay?docId=emr_na-c05150888"
},
{
"name": "GLSA-200912-01",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO"
],
"url": "http://security.gentoo.org/glsa/glsa-200912-01.xml"
},
{
"name": "SSRT090180",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127419602507642\u0026w=2"
},
{
"name": "ADV-2009-3313",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/3313"
},
{
"name": "274990",
"tags": [
"vendor-advisory",
"x_refsource_SUNALERT"
],
"url": "http://sunsolve.sun.com/search/document.do?assetkey=1-66-274990-1"
},
{
"name": "1023208",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023208"
},
{
"name": "43308",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/43308"
},
{
"name": "1023214",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023214"
},
{
"name": "SUSE-SA:2009:057",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-11/msg00009.html"
},
{
"name": "38781",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38781"
},
{
"name": "HPSBOV02762",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=133469267822771\u0026w=2"
},
{
"name": "HPSBMA02534",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127419602507642\u0026w=2"
},
{
"name": "DSA-1934",
"tags": [
"vendor-advisory",
"x_refsource_DEBIAN"
],
"url": "http://www.debian.org/security/2009/dsa-1934"
},
{
"name": "FEDORA-2009-12782",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg00449.html"
},
{
"name": "oval:org.mitre.oval:def:7478",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A7478"
},
{
"name": "1023271",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023271"
},
{
"name": "APPLE-SA-2010-01-19-1",
"tags": [
"vendor-advisory",
"x_refsource_APPLE"
],
"url": "http://lists.apple.com/archives/security-announce/2010/Jan/msg00000.html"
},
{
"name": "[cryptography] 20091105 OpenSSL 0.9.8l released",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://marc.info/?l=cryptography\u0026m=125752275331877\u0026w=2"
},
{
"name": "42467",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42467"
},
{
"name": "20091130 TLS / SSLv3 vulnerability explained (New ways to leverage the vulnerability)",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ"
],
"url": "http://www.securityfocus.com/archive/1/508130/100/0/threaded"
},
{
"name": "oval:org.mitre.oval:def:7315",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A7315"
},
{
"name": "1023224",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023224"
},
{
"name": "SUSE-SR:2010:013",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-06/msg00001.html"
},
{
"name": "USN-927-4",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU"
],
"url": "http://www.ubuntu.com/usn/USN-927-4"
},
{
"name": "41490",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/41490"
},
{
"name": "20091124 rPSA-2009-0155-1 httpd mod_ssl",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ"
],
"url": "http://www.securityfocus.com/archive/1/508075/100/0/threaded"
},
{
"name": "1023243",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023243"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://blog.g-sec.lu/2009/11/tls-sslv3-renegotiation-vulnerability.html"
},
{
"name": "37504",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37504"
},
{
"name": "1023219",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023219"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://sysoev.ru/nginx/patch.cve-2009-3555.txt"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://xss.cx/examples/plesk-reports/plesk-parallels-controlpanel-psa.v.10.3.1_build1013110726.09%20os_redhat.el6-billing-system-plugin-javascript-injection-example-poc-report.html"
},
{
"name": "1023163",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023163"
},
{
"name": "HPSBHF02706",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=132077688910227\u0026w=2"
},
{
"name": "ADV-2009-3521",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/3521"
},
{
"name": "oval:org.mitre.oval:def:7973",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A7973"
},
{
"name": "HPSBMA02568",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://www.itrc.hp.com/service/cki/docDisplay.do?docId=emr_na-c02512995"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.zeus.com/zws/news/2010/01/13/zws_4_3r5_released"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=533125"
},
{
"name": "oval:org.mitre.oval:def:10088",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A10088"
},
{
"name": "44183",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/44183"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.zeus.com/zws/media/docs/4.3/RELEASE_NOTES"
},
{
"name": "42808",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42808"
},
{
"name": "39500",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39500"
},
{
"name": "oval:org.mitre.oval:def:11578",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A11578"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.oracle.com/technetwork/topics/security/cpuoct2010-175626.html"
},
{
"name": "ADV-2009-3220",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/3220"
},
{
"name": "SSRT100179",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://itrc.hp.com/service/cki/docDisplay.do?docId=emr_na-c02273751"
},
{
"name": "SSRT100089",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127557596201693\u0026w=2"
},
{
"name": "RHSA-2010:0165",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0165.html"
},
{
"name": "20101207 VMSA-2010-0019 VMware ESX third party updates for Service Console",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ"
],
"url": "http://www.securityfocus.com/archive/1/515055/100/0/threaded"
},
{
"name": "RHSA-2010:0987",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0987.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://bugzilla.mozilla.org/show_bug.cgi?id=545755"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg21426108"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://blogs.iss.net/archive/sslmitmiscsrf.html"
},
{
"name": "1023411",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023411"
},
{
"name": "RHSA-2010:0339",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0339.html"
},
{
"name": "RHSA-2010:0986",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0986.html"
},
{
"name": "ADV-2009-3164",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/3164"
},
{
"name": "37383",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37383"
},
{
"name": "FEDORA-2009-12229",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg01029.html"
},
{
"name": "44954",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/44954"
},
{
"name": "[tls] 20091104 MITM attack on delayed TLS-client auth through renegotiation",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.ietf.org/mail-archive/web/tls/current/msg03928.html"
},
{
"name": "HPSBUX02524",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127557596201693\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.avaya.com/css/P8/documents/100070150"
},
{
"name": "40747",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/40747"
},
{
"name": "HPSBUX02498",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=126150535619567\u0026w=2"
},
{
"name": "HPSBMU02759",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://www.securityfocus.com/archive/1/522176"
},
{
"name": "39292",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39292"
},
{
"name": "42816",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42816"
},
{
"name": "IC68054",
"tags": [
"vendor-advisory",
"x_refsource_AIXAPAR"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg1IC68054"
},
{
"name": "273029",
"tags": [
"vendor-advisory",
"x_refsource_SUNALERT"
],
"url": "http://sunsolve.sun.com/search/document.do?assetkey=1-66-273029-1"
},
{
"name": "FEDORA-2009-12604",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg00645.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg21432298"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://extendedsubset.com/Renegotiating_TLS.pdf"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg24025312"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www-01.ibm.com/support/docview.wss?uid=swg24006386"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.apple.com/kb/HT4170"
},
{
"name": "20091118 TLS / SSLv3 vulnerability explained (DRAFT)",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ"
],
"url": "http://www.securityfocus.com/archive/1/507952/100/0/threaded"
},
{
"name": "1023209",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023209"
},
{
"name": "PM00675",
"tags": [
"vendor-advisory",
"x_refsource_AIXAPAR"
],
"url": "http://www-1.ibm.com/support/search.wss?rs=0\u0026q=PM00675\u0026apar=only"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.vmware.com/support/vsphere4/doc/vsp_vc41_u1_rel_notes.html"
},
{
"name": "HPSBOV02683",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=130497311408250\u0026w=2"
},
{
"name": "48577",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/48577"
},
{
"name": "SSA:2009-320-01",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2009\u0026m=slackware-security.597446"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://www.links.org/?p=789"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.opera.com/docs/changelogs/unix/1060/"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://www.securegoose.org/2009/11/tls-renegotiation-vulnerability-cve.html"
},
{
"name": "RHSA-2011:0880",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2011-0880.html"
},
{
"name": "SUSE-SR:2010:008",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-04/msg00001.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.oracle.com/technetwork/topics/security/javacpuoct2010-176258.html"
},
{
"name": "[oss-security] 20091107 Re: CVE-2009-3555 for TLS renegotiation MITM attacks",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.openwall.com/lists/oss-security/2009/11/06/3"
},
{
"name": "FEDORA-2009-12305",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg01020.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://wiki.rpath.com/Advisories:rPSA-2009-0155"
},
{
"name": "SUSE-SR:2010:012",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-05/msg00002.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.citrix.com/article/CTX123359"
},
{
"name": "37501",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37501"
},
{
"name": "MDVSA-2010:076",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:076"
},
{
"name": "HPSBUX02517",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "ADV-2009-3587",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/3587"
},
{
"name": "39632",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39632"
},
{
"name": "SSRT090264",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=126150535619567\u0026w=2"
},
{
"name": "38687",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38687"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "https://bugzilla.mozilla.org/show_bug.cgi?id=526689"
},
{
"name": "MS10-049",
"tags": [
"vendor-advisory",
"x_refsource_MS"
],
"url": "https://docs.microsoft.com/en-us/security-updates/securitybulletins/2010/ms10-049"
},
{
"name": "ADV-2010-0982",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0982"
},
{
"name": "SSRT100825",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=133469267822771\u0026w=2"
},
{
"name": "37399",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37399"
},
{
"name": "USN-927-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU"
],
"url": "http://www.ubuntu.com/usn/USN-927-1"
},
{
"name": "1023272",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023272"
},
{
"name": "FEDORA-2009-12606",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg00944.html"
},
{
"name": "ADV-2010-3126",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/3126"
},
{
"name": "37320",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37320"
},
{
"name": "ADV-2009-3165",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/3165"
},
{
"name": "ADV-2010-1639",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/1639"
},
{
"name": "38020",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38020"
},
{
"name": "USN-923-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU"
],
"url": "http://ubuntu.com/usn/usn-923-1"
},
{
"name": "39243",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39243"
},
{
"name": "oval:org.mitre.oval:def:8366",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A8366"
},
{
"name": "37453",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37453"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.hitachi.co.jp/Prod/comp/soft1/security/info/vuls/HS10-030/index.html"
},
{
"name": "ADV-2010-0933",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0933"
},
{
"name": "SSRT100219",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://www.itrc.hp.com/service/cki/docDisplay.do?docId=emr_na-c02512995"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.vmware.com/security/advisories/VMSA-2011-0003.html"
},
{
"name": "41972",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/41972"
},
{
"name": "ADV-2010-3086",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/3086"
},
{
"name": "DSA-2141",
"tags": [
"vendor-advisory",
"x_refsource_DEBIAN"
],
"url": "http://www.debian.org/security/2011/dsa-2141"
},
{
"name": "1024789",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1024789"
},
{
"name": "RHSA-2010:0155",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0155.html"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://www.educatedguesswork.org/2009/11/understanding_the_tls_renegoti.html"
},
{
"name": "ADV-2011-0033",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2011/0033"
},
{
"name": "RHSA-2010:0337",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0337.html"
},
{
"name": "1023216",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023216"
},
{
"name": "41480",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/41480"
},
{
"name": "ADV-2011-0086",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2011/0086"
},
{
"name": "41818",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/41818"
},
{
"name": "37604",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37604"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.opera.com/support/search/view/944/"
},
{
"name": "[announce] 20091107 CVE-2009-3555 - apache/mod_ssl vulnerability and mitigation",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://marc.info/?l=apache-httpd-announce\u0026m=125755783724966\u0026w=2"
},
{
"name": "SUSE-SR:2010:024",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-12/msg00006.html"
},
{
"name": "TA10-287A",
"tags": [
"third-party-advisory",
"x_refsource_CERT"
],
"url": "http://www.us-cert.gov/cas/techalerts/TA10-287A.html"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://www.links.org/?p=780"
},
{
"name": "RHSA-2010:0119",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0119.html"
},
{
"name": "38056",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38056"
},
{
"name": "ADV-2010-0748",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0748"
},
{
"name": "37675",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37675"
},
{
"name": "oval:org.mitre.oval:def:8535",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A8535"
},
{
"name": "HPSBMA02547",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://itrc.hp.com/service/cki/docDisplay.do?docId=emr_na-c02273751"
},
{
"name": "SSRT100058",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.vmware.com/security/advisories/VMSA-2010-0019.html"
},
{
"name": "RHSA-2010:0786",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0786.html"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "https://svn.resiprocate.org/rep/ietf-drafts/ekr/draft-rescorla-tls-renegotiate.txt"
},
{
"name": "38003",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38003"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.apple.com/kb/HT4171"
},
{
"name": "1023428",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023428"
},
{
"name": "SSRT100613",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=132077688910227\u0026w=2"
},
{
"name": "[oss-security] 20091120 CVEs for nginx",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.openwall.com/lists/oss-security/2009/11/20/1"
},
{
"name": "ADV-2009-3354",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/3354"
},
{
"name": "1023274",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023274"
},
{
"name": "FEDORA-2009-12968",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2009-December/msg00634.html"
},
{
"name": "39242",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39242"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "38241",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38241"
},
{
"name": "42377",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42377"
},
{
"name": "GLSA-201203-22",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO"
],
"url": "http://security.gentoo.org/glsa/glsa-201203-22.xml"
},
{
"name": "[oss-security] 20091105 CVE-2009-3555 for TLS renegotiation MITM attacks",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.openwall.com/lists/oss-security/2009/11/05/3"
},
{
"name": "SUSE-SR:2010:019",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2010-10/msg00006.html"
},
{
"name": "60972",
"tags": [
"vdb-entry",
"x_refsource_OSVDB"
],
"url": "http://osvdb.org/60972"
},
{
"name": "1023426",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1023426"
},
{
"name": "38484",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38484"
},
{
"name": "MDVSA-2010:084",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:084"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://www.betanews.com/article/1257452450"
},
{
"name": "1021653",
"tags": [
"vendor-advisory",
"x_refsource_SUNALERT"
],
"url": "http://sunsolve.sun.com/search/document.do?assetkey=1-77-1021653.1-1"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.mozilla.org/security/announce/2010/mfsa2010-22.html"
},
{
"name": "20110211 VMSA-2011-0003 Third party component updates for VMware vCenter Server, vCenter Update Manager, ESXi and ESX",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ"
],
"url": "http://www.securityfocus.com/archive/1/516397/100/0/threaded"
},
{
"name": "[4.6] 004: SECURITY FIX: November 26, 2009",
"tags": [
"vendor-advisory",
"x_refsource_OPENBSD"
],
"url": "http://openbsd.org/errata46.html#004_openssl"
},
{
"name": "41967",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/41967"
},
{
"name": "RHSA-2010:0807",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2010-0807.html"
},
{
"name": "ADV-2010-1191",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/1191"
},
{
"name": "20091111 Re: SSL/TLS MiTM PoC",
"tags": [
"mailing-list",
"x_refsource_FULLDISC"
],
"url": "http://seclists.org/fulldisclosure/2009/Nov/139"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "https://support.f5.com/kb/en-us/solutions/public/10000/700/sol10737.html"
},
{
"name": "[oss-security] 20091105 Re: CVE-2009-3555 for TLS renegotiation MITM attacks",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.openwall.com/lists/oss-security/2009/11/05/5"
},
{
"name": "39713",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39713"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "37291",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/37291"
},
{
"name": "FEDORA-2010-16312",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-October/049455.html"
},
{
"name": "FEDORA-2010-5942",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/039957.html"
},
{
"name": "ADV-2010-2745",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/2745"
},
{
"name": "273350",
"tags": [
"vendor-advisory",
"x_refsource_SUNALERT"
],
"url": "http://sunsolve.sun.com/search/document.do?assetkey=1-26-273350-1"
},
{
"name": "ADV-2010-0994",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0994"
},
{
"name": "ADV-2010-0173",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0173"
},
{
"name": "ADV-2010-1054",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/1054"
},
{
"name": "65202",
"tags": [
"vdb-entry",
"x_refsource_OSVDB"
],
"url": "http://osvdb.org/65202"
},
{
"name": "HPSBGN02562",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://h20000.www2.hp.com/bizsupport/TechSupport/Document.jsp?objectID=c02436041"
},
{
"name": "FEDORA-2010-16294",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-October/049528.html"
},
{
"name": "[gnutls-devel] 20091105 Re: TLS renegotiation MITM",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://lists.gnu.org/archive/html/gnutls-devel/2009-11/msg00029.html"
},
{
"name": "20131121 ESA-2013-077: RSA Data Protection Manager Appliance Multiple Vulnerabilities",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ"
],
"url": "http://archives.neohapsis.com/archives/bugtraq/2013-11/0120.html"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://clicky.me/tlsvuln"
},
{
"name": "42811",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42811"
},
{
"name": "[tomcat-dev] 20190319 svn commit: r1855831 [26/30] - in /tomcat/site/trunk: ./ docs/ xdocs/",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.apache.org/thread.html/ba661b0edd913b39ff129a32d855620dd861883ade05fd88a8ce517d%40%3Cdev.tomcat.apache.org%3E"
},
{
"name": "[tomcat-dev] 20190325 svn commit: r1856174 [26/29] - in /tomcat/site/trunk: docs/ xdocs/ xdocs/stylesheets/",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.apache.org/thread.html/f8e0814e11c7f21f42224b6de111cb3f5e5ab5c15b78924c516d4ec2%40%3Cdev.tomcat.apache.org%3E"
},
{
"name": "[tomcat-dev] 20200203 svn commit: r1873527 [26/30] - /tomcat/site/trunk/docs/",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.apache.org/thread.html/rf8e8c091182b45daa50d3557cad9b10bb4198e3f08cf8f1c66a1b08d%40%3Cdev.tomcat.apache.org%3E"
},
{
"name": "[tomcat-dev] 20200213 svn commit: r1873980 [31/34] - /tomcat/site/trunk/docs/",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.apache.org/thread.html/re3b72cbb13e1dfe85c4a06959a3b6ca6d939b407ecca80db12b54220%40%3Cdev.tomcat.apache.org%3E"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2009-3555",
"datePublished": "2009-11-09T17:00:00",
"dateReserved": "2009-10-05T00:00:00",
"dateUpdated": "2024-08-07T06:31:10.430Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
CVE-2010-0433 (GCVE-0-2010-0433)
Vulnerability from cvelistv5 – Published: 2010-03-05 19:00 – Updated: 2024-08-07 00:52- n/a
| URL | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T00:52:17.351Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"name": "ADV-2010-0916",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0916"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "39461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39461"
},
{
"name": "oval:org.mitre.oval:def:9856",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A9856"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=569774"
},
{
"name": "FEDORA-2010-5357",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/039561.html"
},
{
"name": "HPSBUX02531",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127557640302499\u0026w=2"
},
{
"name": "oval:org.mitre.oval:def:12260",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A12260"
},
{
"name": "[oss-security] 20100303 OpenSSL (with KRB5) remote crash - CVE-2010-0433",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.openwall.com/lists/oss-security/2010/03/03/5"
},
{
"name": "[dovecot] 20100219 segfault - (imap|pop3)-login during nessus scan",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://www.mail-archive.com/dovecot%40dovecot.org/msg26224.html"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.0.6a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000101.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=567711"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.vmware.com/support/vsphere4/doc/vsp_vc41_u1_rel_notes.html"
},
{
"name": "ADV-2010-0839",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0839"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://cvs.openssl.org/chngview?cn=19374"
},
{
"name": "SSRT100108",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127557640302499\u0026w=2"
},
{
"name": "MDVSA-2010:076",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA",
"x_transferred"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:076"
},
{
"name": "HPSBUX02517",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.2.1a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000102.html"
},
{
"name": "39932",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/39932"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.openssl.org/news/changelog.html"
},
{
"name": "ADV-2010-0933",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/0933"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.vmware.com/security/advisories/VMSA-2011-0003.html"
},
{
"name": "SSRT100058",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "20110211 VMSA-2011-0003 Third party component updates for VMware vCenter Server, vCenter Update Manager, ESXi and ESX",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ",
"x_transferred"
],
"url": "http://www.securityfocus.com/archive/1/516397/100/0/threaded"
},
{
"name": "43311",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/43311"
},
{
"name": "ADV-2010-1216",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2010/1216"
},
{
"name": "oval:org.mitre.oval:def:6718",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6718"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "FEDORA-2010-5744",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/038587.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://aix.software.ibm.com/aix/efixes/security/openssl_advisory.asc"
},
{
"tags": [
"x_refsource_MISC",
"x_transferred"
],
"url": "http://groups.google.com/group/mailing.openssl.users/browse_thread/thread/c3e1ab0034ca4b4c/66aa896c3a78b2f7"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2010-03-03T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "The kssl_keytab_is_available function in ssl/kssl.c in OpenSSL before 0.9.8n, when Kerberos is enabled but Kerberos configuration files cannot be opened, does not check a certain return value, which allows remote attackers to cause a denial of service (NULL pointer dereference and daemon crash) via SSL cipher negotiation, as demonstrated by a chroot installation of Dovecot or stunnel without Kerberos configuration files inside the chroot."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2018-10-10T18:57:01",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"name": "ADV-2010-0916",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0916"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "39461",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39461"
},
{
"name": "oval:org.mitre.oval:def:9856",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A9856"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=569774"
},
{
"name": "FEDORA-2010-5357",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/039561.html"
},
{
"name": "HPSBUX02531",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127557640302499\u0026w=2"
},
{
"name": "oval:org.mitre.oval:def:12260",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A12260"
},
{
"name": "[oss-security] 20100303 OpenSSL (with KRB5) remote crash - CVE-2010-0433",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.openwall.com/lists/oss-security/2010/03/03/5"
},
{
"name": "[dovecot] 20100219 segfault - (imap|pop3)-login during nessus scan",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://www.mail-archive.com/dovecot%40dovecot.org/msg26224.html"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.0.6a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000101.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=567711"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.vmware.com/support/vsphere4/doc/vsp_vc41_u1_rel_notes.html"
},
{
"name": "ADV-2010-0839",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0839"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://cvs.openssl.org/chngview?cn=19374"
},
{
"name": "SSRT100108",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127557640302499\u0026w=2"
},
{
"name": "MDVSA-2010:076",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2010:076"
},
{
"name": "HPSBUX02517",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"name": "[syslog-ng-announce] 20110110 syslog-ng Premium Edition 3.2.1a has been released",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "https://lists.balabit.com/pipermail/syslog-ng-announce/2011-January/000102.html"
},
{
"name": "39932",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/39932"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.openssl.org/news/changelog.html"
},
{
"name": "ADV-2010-0933",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/0933"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.vmware.com/security/advisories/VMSA-2011-0003.html"
},
{
"name": "SSRT100058",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127128920008563\u0026w=2"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "20110211 VMSA-2011-0003 Third party component updates for VMware vCenter Server, vCenter Update Manager, ESXi and ESX",
"tags": [
"mailing-list",
"x_refsource_BUGTRAQ"
],
"url": "http://www.securityfocus.com/archive/1/516397/100/0/threaded"
},
{
"name": "43311",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/43311"
},
{
"name": "ADV-2010-1216",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2010/1216"
},
{
"name": "oval:org.mitre.oval:def:6718",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A6718"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
},
{
"name": "FEDORA-2010-5744",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "http://lists.fedoraproject.org/pipermail/package-announce/2010-April/038587.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://aix.software.ibm.com/aix/efixes/security/openssl_advisory.asc"
},
{
"tags": [
"x_refsource_MISC"
],
"url": "http://groups.google.com/group/mailing.openssl.users/browse_thread/thread/c3e1ab0034ca4b4c/66aa896c3a78b2f7"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2010-0433",
"datePublished": "2010-03-05T19:00:00",
"dateReserved": "2010-01-27T00:00:00",
"dateUpdated": "2024-08-07T00:52:17.351Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
CVE-2009-0789 (GCVE-0-2009-0789)
Vulnerability from cvelistv5 – Published: 2009-03-27 16:00 – Updated: 2024-08-07 04:48- n/a
| URL | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T04:48:52.220Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"name": "SSRT090059",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=124464882609472\u0026w=2"
},
{
"name": "ADV-2009-0850",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/0850"
},
{
"name": "ADV-2009-1175",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1175"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "SUSE-SU-2011:0847",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2011-07/msg00014.html"
},
{
"name": "52866",
"tags": [
"vdb-entry",
"x_refsource_OSVDB",
"x_transferred"
],
"url": "http://www.osvdb.org/52866"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://sourceforge.net/project/shownotes.php?release_id=671059\u0026group_id=116847"
},
{
"name": "openSUSE-SU-2011:0845",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2011-07/msg00013.html"
},
{
"name": "34666",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34666"
},
{
"name": "HPSBUX02435",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=124464882609472\u0026w=2"
},
{
"name": "ADV-2009-1020",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1020"
},
{
"name": "35729",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35729"
},
{
"name": "35380",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35380"
},
{
"name": "HPSBOV02540",
"tags": [
"vendor-advisory",
"x_refsource_HP",
"x_transferred"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127678688104458\u0026w=2"
},
{
"name": "openssl-asn1-structure-dos(49433)",
"tags": [
"vdb-entry",
"x_refsource_XF",
"x_transferred"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/49433"
},
{
"name": "APPLE-SA-2009-09-10-2",
"tags": [
"vendor-advisory",
"x_refsource_APPLE",
"x_transferred"
],
"url": "http://lists.apple.com/archives/security-announce/2009/Sep/msg00004.html"
},
{
"name": "35065",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35065"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.php.net/archive/2009.php#id2009-04-08-1"
},
{
"name": "34411",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34411"
},
{
"name": "NetBSD-SA2009-008",
"tags": [
"vendor-advisory",
"x_refsource_NETBSD",
"x_transferred"
],
"url": "ftp://ftp.netbsd.org/pub/NetBSD/security/advisories/NetBSD-SA2009-008.txt.asc"
},
{
"name": "1021906",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://securitytracker.com/id?1021906"
},
{
"name": "SUSE-SR:2009:010",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-05/msg00000.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://voodoo-circle.sourceforge.net/sa/sa-20090326-01.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.apple.com/kb/HT3865"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://www.openssl.org/news/secadv_20090325.txt"
},
{
"name": "ADV-2009-1548",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2009/1548"
},
{
"name": "36701",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/36701"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "34460",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34460"
},
{
"name": "34256",
"tags": [
"vdb-entry",
"x_refsource_BID",
"x_transferred"
],
"url": "http://www.securityfocus.com/bid/34256"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2009-03-25T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "OpenSSL before 0.9.8k on WIN64 and certain other platforms does not properly handle a malformed ASN.1 structure, which allows remote attackers to cause a denial of service (invalid memory access and application crash) by placing this structure in the public key of a certificate, as demonstrated by an RSA public key."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2017-08-16T14:57:01",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"name": "SSRT090059",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=124464882609472\u0026w=2"
},
{
"name": "ADV-2009-0850",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/0850"
},
{
"name": "ADV-2009-1175",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1175"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "SUSE-SU-2011:0847",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2011-07/msg00014.html"
},
{
"name": "52866",
"tags": [
"vdb-entry",
"x_refsource_OSVDB"
],
"url": "http://www.osvdb.org/52866"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://sourceforge.net/project/shownotes.php?release_id=671059\u0026group_id=116847"
},
{
"name": "openSUSE-SU-2011:0845",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2011-07/msg00013.html"
},
{
"name": "34666",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34666"
},
{
"name": "HPSBUX02435",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=124464882609472\u0026w=2"
},
{
"name": "ADV-2009-1020",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1020"
},
{
"name": "35729",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35729"
},
{
"name": "35380",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35380"
},
{
"name": "HPSBOV02540",
"tags": [
"vendor-advisory",
"x_refsource_HP"
],
"url": "http://marc.info/?l=bugtraq\u0026m=127678688104458\u0026w=2"
},
{
"name": "openssl-asn1-structure-dos(49433)",
"tags": [
"vdb-entry",
"x_refsource_XF"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/49433"
},
{
"name": "APPLE-SA-2009-09-10-2",
"tags": [
"vendor-advisory",
"x_refsource_APPLE"
],
"url": "http://lists.apple.com/archives/security-announce/2009/Sep/msg00004.html"
},
{
"name": "35065",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35065"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.php.net/archive/2009.php#id2009-04-08-1"
},
{
"name": "34411",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34411"
},
{
"name": "NetBSD-SA2009-008",
"tags": [
"vendor-advisory",
"x_refsource_NETBSD"
],
"url": "ftp://ftp.netbsd.org/pub/NetBSD/security/advisories/NetBSD-SA2009-008.txt.asc"
},
{
"name": "1021906",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://securitytracker.com/id?1021906"
},
{
"name": "SUSE-SR:2009:010",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2009-05/msg00000.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://voodoo-circle.sourceforge.net/sa/sa-20090326-01.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.apple.com/kb/HT3865"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://www.openssl.org/news/secadv_20090325.txt"
},
{
"name": "ADV-2009-1548",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2009/1548"
},
{
"name": "36701",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/36701"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "34460",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34460"
},
{
"name": "34256",
"tags": [
"vdb-entry",
"x_refsource_BID"
],
"url": "http://www.securityfocus.com/bid/34256"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2009-0789",
"datePublished": "2009-03-27T16:00:00",
"dateReserved": "2009-03-04T00:00:00",
"dateUpdated": "2024-08-07T04:48:52.220Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
CVE-2008-1678 (GCVE-0-2008-1678)
Vulnerability from cvelistv5 – Published: 2008-07-10 17:00 – Updated: 2024-08-07 08:32- n/a
| URL | Tags | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T08:32:01.281Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"name": "RHSA-2009:1075",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT",
"x_transferred"
],
"url": "http://www.redhat.com/support/errata/RHSA-2009-1075.html"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "34219",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/34219"
},
{
"name": "openssl-libssl-dos(43948)",
"tags": [
"vdb-entry",
"x_refsource_XF",
"x_transferred"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/43948"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=447268"
},
{
"name": "31026",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/31026"
},
{
"name": "SSA:2010-060-02",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE",
"x_transferred"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "31692",
"tags": [
"vdb-entry",
"x_refsource_BID",
"x_transferred"
],
"url": "http://www.securityfocus.com/bid/31692"
},
{
"name": "SUSE-SR:2008:024",
"tags": [
"vendor-advisory",
"x_refsource_SUSE",
"x_transferred"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2008-11/msg00000.html"
},
{
"name": "oval:org.mitre.oval:def:9754",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A9754"
},
{
"name": "31681",
"tags": [
"vdb-entry",
"x_refsource_BID",
"x_transferred"
],
"url": "http://www.securityfocus.com/bid/31681"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://issues.apache.org/bugzilla/show_bug.cgi?id=44975"
},
{
"name": "38761",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/38761"
},
{
"name": "31416",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/31416"
},
{
"name": "44183",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/44183"
},
{
"name": "USN-731-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU",
"x_transferred"
],
"url": "http://www.ubuntu.com/usn/USN-731-1"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://bugs.gentoo.org/show_bug.cgi?id=222643"
},
{
"name": "32222",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/32222"
},
{
"name": "35264",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/35264"
},
{
"name": "MDVSA-2009:124",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA",
"x_transferred"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2009:124"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://svn.apache.org/viewvc?view=rev\u0026revision=654119"
},
{
"name": "FEDORA-2008-6393",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA",
"x_transferred"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2008-August/msg00055.html"
},
{
"name": "GLSA-200807-06",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO",
"x_transferred"
],
"url": "http://security.gentoo.org/glsa/glsa-200807-06.xml"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://bugs.edge.launchpad.net/bugs/224945"
},
{
"name": "ADV-2008-2780",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2008/2780"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://bugs.edge.launchpad.net/bugs/186339"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "3981",
"tags": [
"third-party-advisory",
"x_refsource_SREASON",
"x_transferred"
],
"url": "http://securityreason.com/securityalert/3981"
},
{
"name": "[openssl-dev] 20080512 possible memory leak in zlib compression",
"tags": [
"mailing-list",
"x_refsource_MLIST",
"x_transferred"
],
"url": "http://marc.info/?l=openssl-dev\u0026m=121060672602371\u0026w=2"
},
{
"name": "APPLE-SA-2008-10-09",
"tags": [
"vendor-advisory",
"x_refsource_APPLE",
"x_transferred"
],
"url": "http://lists.apple.com/archives/security-announce/2008/Oct/msg00001.html"
},
{
"tags": [
"x_refsource_CONFIRM",
"x_transferred"
],
"url": "http://support.apple.com/kb/HT3216"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/42733"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2008-07-09T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "Memory leak in the zlib_stateful_init function in crypto/comp/c_zlib.c in libssl in OpenSSL 0.9.8f through 0.9.8h allows remote attackers to cause a denial of service (memory consumption) via multiple calls, as demonstrated by initial SSL client handshakes to the Apache HTTP Server mod_ssl that specify a compression algorithm."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2017-09-28T12:57:01",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"name": "RHSA-2009:1075",
"tags": [
"vendor-advisory",
"x_refsource_REDHAT"
],
"url": "http://www.redhat.com/support/errata/RHSA-2009-1075.html"
},
{
"name": "42724",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42724"
},
{
"name": "34219",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/34219"
},
{
"name": "openssl-libssl-dos(43948)",
"tags": [
"vdb-entry",
"x_refsource_XF"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/43948"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=447268"
},
{
"name": "31026",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/31026"
},
{
"name": "SSA:2010-060-02",
"tags": [
"vendor-advisory",
"x_refsource_SLACKWARE"
],
"url": "http://slackware.com/security/viewer.php?l=slackware-security\u0026y=2010\u0026m=slackware-security.663049"
},
{
"name": "31692",
"tags": [
"vdb-entry",
"x_refsource_BID"
],
"url": "http://www.securityfocus.com/bid/31692"
},
{
"name": "SUSE-SR:2008:024",
"tags": [
"vendor-advisory",
"x_refsource_SUSE"
],
"url": "http://lists.opensuse.org/opensuse-security-announce/2008-11/msg00000.html"
},
{
"name": "oval:org.mitre.oval:def:9754",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A9754"
},
{
"name": "31681",
"tags": [
"vdb-entry",
"x_refsource_BID"
],
"url": "http://www.securityfocus.com/bid/31681"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://issues.apache.org/bugzilla/show_bug.cgi?id=44975"
},
{
"name": "38761",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/38761"
},
{
"name": "31416",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/31416"
},
{
"name": "44183",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/44183"
},
{
"name": "USN-731-1",
"tags": [
"vendor-advisory",
"x_refsource_UBUNTU"
],
"url": "http://www.ubuntu.com/usn/USN-731-1"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://bugs.gentoo.org/show_bug.cgi?id=222643"
},
{
"name": "32222",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/32222"
},
{
"name": "35264",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/35264"
},
{
"name": "MDVSA-2009:124",
"tags": [
"vendor-advisory",
"x_refsource_MANDRIVA"
],
"url": "http://www.mandriva.com/security/advisories?name=MDVSA-2009:124"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://svn.apache.org/viewvc?view=rev\u0026revision=654119"
},
{
"name": "FEDORA-2008-6393",
"tags": [
"vendor-advisory",
"x_refsource_FEDORA"
],
"url": "https://www.redhat.com/archives/fedora-package-announce/2008-August/msg00055.html"
},
{
"name": "GLSA-200807-06",
"tags": [
"vendor-advisory",
"x_refsource_GENTOO"
],
"url": "http://security.gentoo.org/glsa/glsa-200807-06.xml"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://bugs.edge.launchpad.net/bugs/224945"
},
{
"name": "ADV-2008-2780",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2008/2780"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://bugs.edge.launchpad.net/bugs/186339"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "https://kb.bluecoat.com/index?page=content\u0026id=SA50"
},
{
"name": "3981",
"tags": [
"third-party-advisory",
"x_refsource_SREASON"
],
"url": "http://securityreason.com/securityalert/3981"
},
{
"name": "[openssl-dev] 20080512 possible memory leak in zlib compression",
"tags": [
"mailing-list",
"x_refsource_MLIST"
],
"url": "http://marc.info/?l=openssl-dev\u0026m=121060672602371\u0026w=2"
},
{
"name": "APPLE-SA-2008-10-09",
"tags": [
"vendor-advisory",
"x_refsource_APPLE"
],
"url": "http://lists.apple.com/archives/security-announce/2008/Oct/msg00001.html"
},
{
"tags": [
"x_refsource_CONFIRM"
],
"url": "http://support.apple.com/kb/HT3216"
},
{
"name": "42733",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/42733"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2008-1678",
"datePublished": "2008-07-10T17:00:00",
"dateReserved": "2008-04-03T00:00:00",
"dateUpdated": "2024-08-07T08:32:01.281Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
Sightings
| Author | Source | Type | Date |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.