Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2024-40997 (GCVE-0-2024-40997)
Vulnerability from cvelistv5 – Published: 2024-07-12 12:37 – Updated: 2026-05-11 20:24| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
ffa5096a7c338641f70fb06d4778e8cf400181a8 , < 448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd
(git)
Affected: ffa5096a7c338641f70fb06d4778e8cf400181a8 , < 8015c17fe11a8608cc3eb83d0ab831e1845a9582 (git) Affected: ffa5096a7c338641f70fb06d4778e8cf400181a8 , < cea04f3d9aeebda9d9c063c0dfa71e739c322c81 (git) |
guessed | |
| Linux | Linux |
Affected:
6.3
Unaffected: 0 , < 6.3 (semver) Unaffected: 6.6.36 , ≤ 6.6.* (semver) Unaffected: 6.9.7 , ≤ 6.9.* (semver) Unaffected: 6.10 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T04:39:56.139Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/8015c17fe11a8608cc3eb83d0ab831e1845a9582"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/cea04f3d9aeebda9d9c063c0dfa71e739c322c81"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2024-40997",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T17:01:28.872143Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-09-11T17:34:19.570Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/amd-pstate.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd",
"status": "affected",
"version": "ffa5096a7c338641f70fb06d4778e8cf400181a8",
"versionType": "git"
},
{
"lessThan": "8015c17fe11a8608cc3eb83d0ab831e1845a9582",
"status": "affected",
"version": "ffa5096a7c338641f70fb06d4778e8cf400181a8",
"versionType": "git"
},
{
"lessThan": "cea04f3d9aeebda9d9c063c0dfa71e739c322c81",
"status": "affected",
"version": "ffa5096a7c338641f70fb06d4778e8cf400181a8",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/amd-pstate.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "6.3"
},
{
"lessThan": "6.3",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.36",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.7",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.36",
"versionStartIncluding": "6.3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.9.7",
"versionStartIncluding": "6.3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.10",
"versionStartIncluding": "6.3",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncpufreq: amd-pstate: fix memory leak on CPU EPP exit\n\nThe cpudata memory from kzalloc() in amd_pstate_epp_cpu_init() is\nnot freed in the analogous exit function, so fix that.\n\n[ rjw: Subject and changelog edits ]"
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T20:24:00.419Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd"
},
{
"url": "https://git.kernel.org/stable/c/8015c17fe11a8608cc3eb83d0ab831e1845a9582"
},
{
"url": "https://git.kernel.org/stable/c/cea04f3d9aeebda9d9c063c0dfa71e739c322c81"
}
],
"title": "cpufreq: amd-pstate: fix memory leak on CPU EPP exit",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-40997",
"datePublished": "2024-07-12T12:37:39.128Z",
"dateReserved": "2024-07-12T12:17:45.607Z",
"dateUpdated": "2026-05-11T20:24:00.419Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2024-40997",
"date": "2026-09-19",
"epss": "0.00267",
"percentile": "0.19149"
},
"fkie_nvd": {
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "97F8F699-7041-44A4-9087-0E1FFC0543C8",
"versionEndExcluding": "6.6.36",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "0A047AF2-94AC-4A3A-B32D-6AB930D8EF1C",
"versionEndExcluding": "6.9.7",
"versionStartIncluding": "6.7",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncpufreq: amd-pstate: fix memory leak on CPU EPP exit\n\nThe cpudata memory from kzalloc() in amd_pstate_epp_cpu_init() is\nnot freed in the analogous exit function, so fix that.\n\n[ rjw: Subject and changelog edits ]"
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: cpufreq: amd-pstate: corrige la p\u00e9rdida de memoria en la salida del EPP de la CPU La memoria cpudata de kzalloc() en amd_pstate_epp_cpu_init() no se libera en la funci\u00f3n de salida an\u00e1loga, as\u00ed que solucione eso. [rjw: ediciones de asunto y registro de cambios]"
}
],
"id": "CVE-2024-40997",
"lastModified": "2024-11-21T09:32:01.920",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2024-07-12T13:15:20.800",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/8015c17fe11a8608cc3eb83d0ab831e1845a9582"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/cea04f3d9aeebda9d9c063c0dfa71e739c322c81"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/8015c17fe11a8608cc3eb83d0ab831e1845a9582"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/cea04f3d9aeebda9d9c063c0dfa71e739c322c81"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-401"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"microsoft_vex": {
"current_release_date": "2026-03-31T14:50:30.000Z",
"cve": "CVE-2024-40997",
"id": "msrc_CVE-2024-40997",
"initial_release_date": "2024-07-01T07:00:00.000Z",
"product_status:fixed": "2",
"product_status:known_affected": "2",
"product_status:under_investigation": "3",
"source": "Microsoft CSAF VEX",
"status": "final",
"title": "cpufreq: amd-pstate: fix memory leak on CPU EPP exit",
"url": "https://msrc.microsoft.com/csaf/vex/2024/msrc_cve-2024-40997.json",
"version": "4"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/amd-pstate.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd",
"status": "affected",
"version": "ffa5096a7c338641f70fb06d4778e8cf400181a8",
"versionType": "git"
},
{
"lessThan": "8015c17fe11a8608cc3eb83d0ab831e1845a9582",
"status": "affected",
"version": "ffa5096a7c338641f70fb06d4778e8cf400181a8",
"versionType": "git"
},
{
"lessThan": "cea04f3d9aeebda9d9c063c0dfa71e739c322c81",
"status": "affected",
"version": "ffa5096a7c338641f70fb06d4778e8cf400181a8",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/amd-pstate.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "6.3"
},
{
"lessThan": "6.3",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.36",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.7",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "97F8F699-7041-44A4-9087-0E1FFC0543C8",
"versionEndExcluding": "6.6.36",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "0A047AF2-94AC-4A3A-B32D-6AB930D8EF1C",
"versionEndExcluding": "6.9.7",
"versionStartIncluding": "6.7",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncpufreq: amd-pstate: fix memory leak on CPU EPP exit\n\nThe cpudata memory from kzalloc() in amd_pstate_epp_cpu_init() is\nnot freed in the analogous exit function, so fix that.\n\n[ rjw: Subject and changelog edits ]"
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: cpufreq: amd-pstate: corrige la p\u00e9rdida de memoria en la salida del EPP de la CPU La memoria cpudata de kzalloc() en amd_pstate_epp_cpu_init() no se libera en la funci\u00f3n de salida an\u00e1loga, as\u00ed que solucione eso. [rjw: ediciones de asunto y registro de cambios]"
}
],
"id": "CVE-2024-40997",
"lastModified": "2026-06-17T07:47:02.927",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-40997",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T17:01:28.872143Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-07-12T13:15:20.800",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/8015c17fe11a8608cc3eb83d0ab831e1845a9582"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/cea04f3d9aeebda9d9c063c0dfa71e739c322c81"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/8015c17fe11a8608cc3eb83d0ab831e1845a9582"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/cea04f3d9aeebda9d9c063c0dfa71e739c322c81"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-401"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Low",
"current_release_date": "2026-06-28T07:05:24+00:00",
"cve": "CVE-2024-40997",
"id": "CVE-2024-40997",
"initial_release_date": "2024-07-12T00:00:00+00:00",
"product_status:fixed": "709",
"product_status:known_affected": "22",
"product_status:known_not_affected": "50",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: cpufreq: amd-pstate: fix memory leak on CPU EPP exit",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2024/cve-2024-40997.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-08-30T02:31:00Z",
"cve": "CVE-2024-40997",
"id": "CVE-2024-40997",
"initial_release_date": "2024-07-16T02:33:54Z",
"product_status:known_affected": "354",
"product_status:known_not_affected": "300",
"product_status:recommended": "644",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2024-40997",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2024-40997.json",
"version": "76"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T04:39:56.139Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/8015c17fe11a8608cc3eb83d0ab831e1845a9582"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/cea04f3d9aeebda9d9c063c0dfa71e739c322c81"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2024-40997",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T17:01:28.872143Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-09-11T12:42:22.011Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/amd-pstate.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd",
"status": "affected",
"version": "ffa5096a7c338641f70fb06d4778e8cf400181a8",
"versionType": "git"
},
{
"lessThan": "8015c17fe11a8608cc3eb83d0ab831e1845a9582",
"status": "affected",
"version": "ffa5096a7c338641f70fb06d4778e8cf400181a8",
"versionType": "git"
},
{
"lessThan": "cea04f3d9aeebda9d9c063c0dfa71e739c322c81",
"status": "affected",
"version": "ffa5096a7c338641f70fb06d4778e8cf400181a8",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/amd-pstate.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "6.3"
},
{
"lessThan": "6.3",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.36",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.7",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncpufreq: amd-pstate: fix memory leak on CPU EPP exit\n\nThe cpudata memory from kzalloc() in amd_pstate_epp_cpu_init() is\nnot freed in the analogous exit function, so fix that.\n\n[ rjw: Subject and changelog edits ]"
}
],
"providerMetadata": {
"dateUpdated": "2025-03-10T07:40:59.548Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd"
},
{
"url": "https://git.kernel.org/stable/c/8015c17fe11a8608cc3eb83d0ab831e1845a9582"
},
{
"url": "https://git.kernel.org/stable/c/cea04f3d9aeebda9d9c063c0dfa71e739c322c81"
}
],
"title": "cpufreq: amd-pstate: fix memory leak on CPU EPP exit",
"x_generator": {
"engine": "bippy-5f407fcff5a0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-40997",
"datePublished": "2024-07-12T12:37:39.128Z",
"dateReserved": "2024-07-12T12:17:45.607Z",
"dateUpdated": "2025-03-10T07:40:59.548Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
}
}
CERTFR-2024-AVI-1102
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | Public Cloud Module 15-SP5 | ||
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | Basesystem Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS | ||
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | N/A | Development Tools Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | Legacy Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | Confidential Computing Module 15-SP6 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Confidential Computing Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-3435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3435"
},
{
"name": "CVE-2022-45934",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45934"
},
{
"name": "CVE-2023-28327",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28327"
},
{
"name": "CVE-2023-2166",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2166"
},
{
"name": "CVE-2023-6270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6270"
},
{
"name": "CVE-2023-52524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52524"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26741"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26782"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27043"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2024-36031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36031"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35888"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-26864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26864"
},
{
"name": "CVE-2024-26886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26886"
},
{
"name": "CVE-2024-26953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26953"
},
{
"name": "CVE-2024-27026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27026"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-26703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26703"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2024-35980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35980"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2024-40914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40914"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2022-48674",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48674"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-36968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36968"
},
{
"name": "CVE-2024-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38576"
},
{
"name": "CVE-2024-38577",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38577"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-36484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36484"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-42102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42102"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-36244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36244"
},
{
"name": "CVE-2024-40965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40965"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-42098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42098"
},
{
"name": "CVE-2024-42226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42226"
},
{
"name": "CVE-2024-42253",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42253"
},
{
"name": "CVE-2024-43817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43817"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-43897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43897"
},
{
"name": "CVE-2024-44931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44931"
},
{
"name": "CVE-2024-44947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44947"
},
{
"name": "CVE-2024-41023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41023"
},
{
"name": "CVE-2024-41031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41031"
},
{
"name": "CVE-2024-44995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44995"
},
{
"name": "CVE-2024-45016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45016"
},
{
"name": "CVE-2024-45025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45025"
},
{
"name": "CVE-2024-46716",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46716"
},
{
"name": "CVE-2024-46719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46719"
},
{
"name": "CVE-2024-46721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46721"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2024-46771",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46771"
},
{
"name": "CVE-2024-46777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46777"
},
{
"name": "CVE-2024-46800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46800"
},
{
"name": "CVE-2024-46802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46802"
},
{
"name": "CVE-2024-46804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46804"
},
{
"name": "CVE-2024-46805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46805"
},
{
"name": "CVE-2024-46807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46807"
},
{
"name": "CVE-2024-46810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46810"
},
{
"name": "CVE-2024-46812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46812"
},
{
"name": "CVE-2024-46814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46814"
},
{
"name": "CVE-2024-46815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46815"
},
{
"name": "CVE-2024-46817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46817"
},
{
"name": "CVE-2024-46818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46818"
},
{
"name": "CVE-2024-46819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46819"
},
{
"name": "CVE-2024-46821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46821"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-46828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46828"
},
{
"name": "CVE-2024-46830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46830"
},
{
"name": "CVE-2024-46835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46835"
},
{
"name": "CVE-2024-46836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46836"
},
{
"name": "CVE-2024-46840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46840"
},
{
"name": "CVE-2024-46846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46846"
},
{
"name": "CVE-2024-46848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46848"
},
{
"name": "CVE-2024-46849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46849"
},
{
"name": "CVE-2024-46852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46852"
},
{
"name": "CVE-2024-46853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46853"
},
{
"name": "CVE-2024-46854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46854"
},
{
"name": "CVE-2024-46855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46855"
},
{
"name": "CVE-2024-46857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46857"
},
{
"name": "CVE-2024-46859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46859"
},
{
"name": "CVE-2023-52915",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52915"
},
{
"name": "CVE-2024-41082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41082"
},
{
"name": "CVE-2024-46678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46678"
},
{
"name": "CVE-2024-46775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46775"
},
{
"name": "CVE-2024-46797",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46797"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2023-52918",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52918"
},
{
"name": "CVE-2024-47663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47663"
},
{
"name": "CVE-2024-47667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47667"
},
{
"name": "CVE-2024-47669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47669"
},
{
"name": "CVE-2022-48664",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48664"
},
{
"name": "CVE-2022-48879",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48879"
},
{
"name": "CVE-2022-48946",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48946"
},
{
"name": "CVE-2022-48947",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48947"
},
{
"name": "CVE-2022-48948",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48948"
},
{
"name": "CVE-2022-48949",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48949"
},
{
"name": "CVE-2022-48951",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48951"
},
{
"name": "CVE-2022-48953",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48953"
},
{
"name": "CVE-2022-48954",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48954"
},
{
"name": "CVE-2022-48955",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48955"
},
{
"name": "CVE-2022-48956",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48956"
},
{
"name": "CVE-2022-48957",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48957"
},
{
"name": "CVE-2022-48958",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48958"
},
{
"name": "CVE-2022-48959",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48959"
},
{
"name": "CVE-2022-48960",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48960"
},
{
"name": "CVE-2022-48961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48961"
},
{
"name": "CVE-2022-48962",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48962"
},
{
"name": "CVE-2022-48966",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48966"
},
{
"name": "CVE-2022-48967",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48967"
},
{
"name": "CVE-2022-48968",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48968"
},
{
"name": "CVE-2022-48969",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48969"
},
{
"name": "CVE-2022-48970",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48970"
},
{
"name": "CVE-2022-48971",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48971"
},
{
"name": "CVE-2022-48972",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48972"
},
{
"name": "CVE-2022-48973",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48973"
},
{
"name": "CVE-2022-48975",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48975"
},
{
"name": "CVE-2022-48977",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48977"
},
{
"name": "CVE-2022-48978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48978"
},
{
"name": "CVE-2022-48980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48980"
},
{
"name": "CVE-2022-48981",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48981"
},
{
"name": "CVE-2022-48985",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48985"
},
{
"name": "CVE-2022-48987",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48987"
},
{
"name": "CVE-2022-48988",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48988"
},
{
"name": "CVE-2022-48991",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48991"
},
{
"name": "CVE-2022-48992",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48992"
},
{
"name": "CVE-2022-48994",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48994"
},
{
"name": "CVE-2022-48995",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48995"
},
{
"name": "CVE-2022-48997",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48997"
},
{
"name": "CVE-2022-48999",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48999"
},
{
"name": "CVE-2022-49000",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49000"
},
{
"name": "CVE-2022-49002",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49002"
},
{
"name": "CVE-2022-49003",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49003"
},
{
"name": "CVE-2022-49005",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49005"
},
{
"name": "CVE-2022-49006",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49006"
},
{
"name": "CVE-2022-49007",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49007"
},
{
"name": "CVE-2022-49010",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49010"
},
{
"name": "CVE-2022-49011",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49011"
},
{
"name": "CVE-2022-49012",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49012"
},
{
"name": "CVE-2022-49014",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49014"
},
{
"name": "CVE-2022-49015",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49015"
},
{
"name": "CVE-2022-49016",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49016"
},
{
"name": "CVE-2022-49017",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49017"
},
{
"name": "CVE-2022-49019",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49019"
},
{
"name": "CVE-2022-49020",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49020"
},
{
"name": "CVE-2022-49021",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49021"
},
{
"name": "CVE-2022-49022",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49022"
},
{
"name": "CVE-2022-49023",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49023"
},
{
"name": "CVE-2022-49024",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49024"
},
{
"name": "CVE-2022-49025",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49025"
},
{
"name": "CVE-2022-49026",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49026"
},
{
"name": "CVE-2022-49027",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49027"
},
{
"name": "CVE-2022-49028",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49028"
},
{
"name": "CVE-2022-49029",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49029"
},
{
"name": "CVE-2022-49031",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49031"
},
{
"name": "CVE-2022-49032",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49032"
},
{
"name": "CVE-2023-52917",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52917"
},
{
"name": "CVE-2023-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52919"
},
{
"name": "CVE-2024-44932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44932"
},
{
"name": "CVE-2024-44964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44964"
},
{
"name": "CVE-2024-46754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46754"
},
{
"name": "CVE-2024-46766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46766"
},
{
"name": "CVE-2024-46803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46803"
},
{
"name": "CVE-2024-46806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46806"
},
{
"name": "CVE-2024-46809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46809"
},
{
"name": "CVE-2024-46811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46811"
},
{
"name": "CVE-2024-46813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46813"
},
{
"name": "CVE-2024-46816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46816"
},
{
"name": "CVE-2024-46825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46825"
},
{
"name": "CVE-2024-46827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46827"
},
{
"name": "CVE-2024-46831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46831"
},
{
"name": "CVE-2024-46834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46834"
},
{
"name": "CVE-2024-46841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46841"
},
{
"name": "CVE-2024-46842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46842"
},
{
"name": "CVE-2024-46843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46843"
},
{
"name": "CVE-2024-46851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46851"
},
{
"name": "CVE-2024-46860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46860"
},
{
"name": "CVE-2024-46861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46861"
},
{
"name": "CVE-2024-46864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46864"
},
{
"name": "CVE-2024-46870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46870"
},
{
"name": "CVE-2024-46871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46871"
},
{
"name": "CVE-2024-47658",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47658"
},
{
"name": "CVE-2024-47661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47661"
},
{
"name": "CVE-2024-44958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44958"
},
{
"name": "CVE-2024-47660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47660"
},
{
"name": "CVE-2024-47665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47665"
},
{
"name": "CVE-2024-47662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47662"
},
{
"name": "CVE-2024-47664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47664"
},
{
"name": "CVE-2024-47670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47670"
},
{
"name": "CVE-2024-47671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47671"
},
{
"name": "CVE-2024-47672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47672"
},
{
"name": "CVE-2024-47673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47673"
},
{
"name": "CVE-2024-47674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47674"
},
{
"name": "CVE-2024-47675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47675"
},
{
"name": "CVE-2024-47681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47681"
},
{
"name": "CVE-2024-47682",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47682"
},
{
"name": "CVE-2024-47684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47684"
},
{
"name": "CVE-2024-47685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47685"
},
{
"name": "CVE-2024-47686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47686"
},
{
"name": "CVE-2024-47687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47687"
},
{
"name": "CVE-2024-47688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47688"
},
{
"name": "CVE-2024-47692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47692"
},
{
"name": "CVE-2024-47693",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47693"
},
{
"name": "CVE-2024-47695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47695"
},
{
"name": "CVE-2024-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47696"
},
{
"name": "CVE-2024-47697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47697"
},
{
"name": "CVE-2024-47698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47698"
},
{
"name": "CVE-2024-47699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47699"
},
{
"name": "CVE-2024-47702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47702"
},
{
"name": "CVE-2024-47704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47704"
},
{
"name": "CVE-2024-47705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47705"
},
{
"name": "CVE-2024-47706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47706"
},
{
"name": "CVE-2024-47707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47707"
},
{
"name": "CVE-2024-47709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47709"
},
{
"name": "CVE-2024-47710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47710"
},
{
"name": "CVE-2024-47712",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47712"
},
{
"name": "CVE-2024-47713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47713"
},
{
"name": "CVE-2024-47714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47714"
},
{
"name": "CVE-2024-47715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47715"
},
{
"name": "CVE-2024-47718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47718"
},
{
"name": "CVE-2024-47719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47719"
},
{
"name": "CVE-2024-47720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47720"
},
{
"name": "CVE-2024-47723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47723"
},
{
"name": "CVE-2024-47727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47727"
},
{
"name": "CVE-2024-47728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47728"
},
{
"name": "CVE-2024-47730",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47730"
},
{
"name": "CVE-2024-47731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47731"
},
{
"name": "CVE-2024-47732",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47732"
},
{
"name": "CVE-2024-47735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47735"
},
{
"name": "CVE-2024-47737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47737"
},
{
"name": "CVE-2024-47738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47738"
},
{
"name": "CVE-2024-47739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47739"
},
{
"name": "CVE-2024-47741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47741"
},
{
"name": "CVE-2024-47742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47742"
},
{
"name": "CVE-2024-47743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47743"
},
{
"name": "CVE-2024-47744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47744"
},
{
"name": "CVE-2024-47745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47745"
},
{
"name": "CVE-2024-47747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47747"
},
{
"name": "CVE-2024-47748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47748"
},
{
"name": "CVE-2024-47749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47749"
},
{
"name": "CVE-2024-47750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47750"
},
{
"name": "CVE-2024-47751",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47751"
},
{
"name": "CVE-2024-47752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47752"
},
{
"name": "CVE-2024-47753",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47753"
},
{
"name": "CVE-2024-47754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47754"
},
{
"name": "CVE-2024-47756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47756"
},
{
"name": "CVE-2024-47757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47757"
},
{
"name": "CVE-2024-49850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49850"
},
{
"name": "CVE-2024-49851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49851"
},
{
"name": "CVE-2024-49852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49852"
},
{
"name": "CVE-2024-49853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49853"
},
{
"name": "CVE-2024-49855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49855"
},
{
"name": "CVE-2024-49858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49858"
},
{
"name": "CVE-2024-49860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49860"
},
{
"name": "CVE-2024-49861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49861"
},
{
"name": "CVE-2024-49862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49862"
},
{
"name": "CVE-2024-49863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49863"
},
{
"name": "CVE-2024-49864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49864"
},
{
"name": "CVE-2024-49866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49866"
},
{
"name": "CVE-2024-49867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49867"
},
{
"name": "CVE-2024-49870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49870"
},
{
"name": "CVE-2024-49871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49871"
},
{
"name": "CVE-2024-49874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49874"
},
{
"name": "CVE-2024-49875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49875"
},
{
"name": "CVE-2024-49877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49877"
},
{
"name": "CVE-2024-49878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49878"
},
{
"name": "CVE-2024-49879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49879"
},
{
"name": "CVE-2024-49881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49881"
},
{
"name": "CVE-2024-49882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49882"
},
{
"name": "CVE-2024-49883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49883"
},
{
"name": "CVE-2024-49886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49886"
},
{
"name": "CVE-2024-49888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49888"
},
{
"name": "CVE-2024-49890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49890"
},
{
"name": "CVE-2024-49891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49891"
},
{
"name": "CVE-2024-49892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49892"
},
{
"name": "CVE-2024-49894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49894"
},
{
"name": "CVE-2024-49895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49895"
},
{
"name": "CVE-2024-49896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49896"
},
{
"name": "CVE-2024-49897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49897"
},
{
"name": "CVE-2024-49898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49898"
},
{
"name": "CVE-2024-49899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49899"
},
{
"name": "CVE-2024-49900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49900"
},
{
"name": "CVE-2024-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49901"
},
{
"name": "CVE-2024-49902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49902"
},
{
"name": "CVE-2024-49903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49903"
},
{
"name": "CVE-2024-49906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49906"
},
{
"name": "CVE-2024-49907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49907"
},
{
"name": "CVE-2024-49908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49908"
},
{
"name": "CVE-2024-49909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49909"
},
{
"name": "CVE-2024-49911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49911"
},
{
"name": "CVE-2024-49912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49912"
},
{
"name": "CVE-2024-49913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49913"
},
{
"name": "CVE-2024-49914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49914"
},
{
"name": "CVE-2024-49917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49917"
},
{
"name": "CVE-2024-49918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49918"
},
{
"name": "CVE-2024-49919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49919"
},
{
"name": "CVE-2024-49920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49920"
},
{
"name": "CVE-2024-49922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49922"
},
{
"name": "CVE-2024-49923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49923"
},
{
"name": "CVE-2024-49928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49928"
},
{
"name": "CVE-2024-49929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49929"
},
{
"name": "CVE-2024-49930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49930"
},
{
"name": "CVE-2024-49931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49931"
},
{
"name": "CVE-2024-49933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49933"
},
{
"name": "CVE-2024-49935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49935"
},
{
"name": "CVE-2024-49936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49936"
},
{
"name": "CVE-2024-49937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49937"
},
{
"name": "CVE-2024-49938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49938"
},
{
"name": "CVE-2024-49939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49939"
},
{
"name": "CVE-2024-49946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49946"
},
{
"name": "CVE-2024-49947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49947"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2024-49950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49950"
},
{
"name": "CVE-2024-49953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49953"
},
{
"name": "CVE-2024-49954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49954"
},
{
"name": "CVE-2024-49955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49955"
},
{
"name": "CVE-2024-49957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49957"
},
{
"name": "CVE-2024-49958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49958"
},
{
"name": "CVE-2024-49959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49959"
},
{
"name": "CVE-2024-49960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49960"
},
{
"name": "CVE-2024-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49961"
},
{
"name": "CVE-2024-49962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49962"
},
{
"name": "CVE-2024-49963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49963"
},
{
"name": "CVE-2024-49965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49965"
},
{
"name": "CVE-2024-49966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49966"
},
{
"name": "CVE-2024-49967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49967"
},
{
"name": "CVE-2024-49969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49969"
},
{
"name": "CVE-2024-49972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49972"
},
{
"name": "CVE-2024-49973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49973"
},
{
"name": "CVE-2024-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49974"
},
{
"name": "CVE-2024-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49975"
},
{
"name": "CVE-2024-49981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49981"
},
{
"name": "CVE-2024-49982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49982"
},
{
"name": "CVE-2024-49985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49985"
},
{
"name": "CVE-2024-49986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49986"
},
{
"name": "CVE-2024-49991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49991"
},
{
"name": "CVE-2024-49993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49993"
},
{
"name": "CVE-2024-49995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49995"
},
{
"name": "CVE-2024-49996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49996"
},
{
"name": "CVE-2024-50000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50000"
},
{
"name": "CVE-2024-50001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50001"
},
{
"name": "CVE-2024-50002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50002"
},
{
"name": "CVE-2024-50006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50006"
},
{
"name": "CVE-2024-50007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50007"
},
{
"name": "CVE-2024-50008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50008"
},
{
"name": "CVE-2024-50013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50013"
},
{
"name": "CVE-2024-50014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50014"
},
{
"name": "CVE-2024-50015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50015"
},
{
"name": "CVE-2024-50017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50017"
},
{
"name": "CVE-2024-50019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50019"
},
{
"name": "CVE-2024-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50020"
},
{
"name": "CVE-2024-50021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50021"
},
{
"name": "CVE-2024-50022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50022"
},
{
"name": "CVE-2024-50023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50023"
},
{
"name": "CVE-2024-50024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50024"
},
{
"name": "CVE-2024-50025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50025"
},
{
"name": "CVE-2024-50027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50027"
},
{
"name": "CVE-2024-50028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50028"
},
{
"name": "CVE-2024-50031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50031"
},
{
"name": "CVE-2024-50033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50033"
},
{
"name": "CVE-2024-50035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50035"
},
{
"name": "CVE-2024-50040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50040"
},
{
"name": "CVE-2024-50041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50041"
},
{
"name": "CVE-2024-50042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50042"
},
{
"name": "CVE-2024-50044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50044"
},
{
"name": "CVE-2024-50045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50045"
},
{
"name": "CVE-2024-50046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50046"
},
{
"name": "CVE-2024-50047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50047"
},
{
"name": "CVE-2024-50048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50048"
},
{
"name": "CVE-2024-50049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50049"
},
{
"name": "CVE-2024-50055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50055"
},
{
"name": "CVE-2024-50058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50058"
},
{
"name": "CVE-2024-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50059"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2024-50061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50061"
},
{
"name": "CVE-2024-50062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50062"
},
{
"name": "CVE-2024-50063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50063"
},
{
"name": "CVE-2024-50064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50064"
},
{
"name": "CVE-2024-50069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50069"
},
{
"name": "CVE-2024-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50073"
},
{
"name": "CVE-2024-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50074"
},
{
"name": "CVE-2024-50075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50075"
},
{
"name": "CVE-2024-50076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50076"
},
{
"name": "CVE-2024-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50077"
},
{
"name": "CVE-2024-50078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50078"
},
{
"name": "CVE-2024-50080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50080"
},
{
"name": "CVE-2024-50081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50081"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2024-50067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50067"
},
{
"name": "CVE-2024-50215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50215"
},
{
"name": "CVE-2024-50218",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50218"
},
{
"name": "CVE-2024-50228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50228"
},
{
"name": "CVE-2024-50229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50229"
},
{
"name": "CVE-2024-50230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50230"
},
{
"name": "CVE-2024-50232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50232"
},
{
"name": "CVE-2024-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50233"
},
{
"name": "CVE-2024-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50234"
},
{
"name": "CVE-2024-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50235"
},
{
"name": "CVE-2024-50236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50236"
},
{
"name": "CVE-2024-50237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50237"
},
{
"name": "CVE-2024-50245",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50245"
},
{
"name": "CVE-2024-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50249"
},
{
"name": "CVE-2024-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50250"
},
{
"name": "CVE-2024-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50252"
},
{
"name": "CVE-2024-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50255"
},
{
"name": "CVE-2024-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50257"
},
{
"name": "CVE-2024-50259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50259"
},
{
"name": "CVE-2024-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50261"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50265"
},
{
"name": "CVE-2024-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50267"
},
{
"name": "CVE-2024-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50268"
},
{
"name": "CVE-2024-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50269"
},
{
"name": "CVE-2024-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50271"
},
{
"name": "CVE-2024-50273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50273"
},
{
"name": "CVE-2024-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50276"
},
{
"name": "CVE-2024-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50278"
},
{
"name": "CVE-2024-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50279"
},
{
"name": "CVE-2024-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50282"
},
{
"name": "CVE-2024-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50287"
},
{
"name": "CVE-2024-50290",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50290"
},
{
"name": "CVE-2024-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50292"
},
{
"name": "CVE-2024-50295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50295"
},
{
"name": "CVE-2024-50296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50296"
},
{
"name": "CVE-2024-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50301"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2024-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53042"
},
{
"name": "CVE-2024-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53043"
},
{
"name": "CVE-2024-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53052"
},
{
"name": "CVE-2024-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53055"
},
{
"name": "CVE-2024-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53058"
},
{
"name": "CVE-2024-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53059"
},
{
"name": "CVE-2024-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53060"
},
{
"name": "CVE-2024-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53061"
},
{
"name": "CVE-2024-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53063"
},
{
"name": "CVE-2024-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53066"
},
{
"name": "CVE-2024-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53072"
},
{
"name": "CVE-2024-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53081"
},
{
"name": "CVE-2024-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53082"
},
{
"name": "CVE-2024-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53088"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2024-49925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49925"
},
{
"name": "CVE-2024-49945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49945"
},
{
"name": "CVE-2024-50208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50208"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2024-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50192"
},
{
"name": "CVE-2024-46680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46680"
},
{
"name": "CVE-2024-46681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46681"
},
{
"name": "CVE-2024-46765",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46765"
},
{
"name": "CVE-2024-46788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46788"
},
{
"name": "CVE-2024-46845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46845"
},
{
"name": "CVE-2024-47666",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47666"
},
{
"name": "CVE-2024-47679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47679"
},
{
"name": "CVE-2024-47701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47701"
},
{
"name": "CVE-2024-49868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49868"
},
{
"name": "CVE-2024-49884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49884"
},
{
"name": "CVE-2024-49905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49905"
},
{
"name": "CVE-2024-49921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49921"
},
{
"name": "CVE-2024-49924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49924"
},
{
"name": "CVE-2024-49944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49944"
},
{
"name": "CVE-2024-49952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49952"
},
{
"name": "CVE-2024-49983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49983"
},
{
"name": "CVE-2024-50003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50003"
},
{
"name": "CVE-2024-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50093"
},
{
"name": "CVE-2024-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50095"
},
{
"name": "CVE-2024-50096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50096"
},
{
"name": "CVE-2024-50179",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50179"
},
{
"name": "CVE-2024-50180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50180"
},
{
"name": "CVE-2024-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50181"
},
{
"name": "CVE-2024-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50184"
},
{
"name": "CVE-2024-50186",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50186"
},
{
"name": "CVE-2024-50188",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50188"
},
{
"name": "CVE-2024-50189",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50189"
},
{
"name": "CVE-2021-47594",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47594"
},
{
"name": "CVE-2022-48979",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48979"
},
{
"name": "CVE-2022-48982",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48982"
},
{
"name": "CVE-2022-48983",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48983"
},
{
"name": "CVE-2022-48989",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48989"
},
{
"name": "CVE-2022-48990",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48990"
},
{
"name": "CVE-2023-52778",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52778"
},
{
"name": "CVE-2023-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52920"
},
{
"name": "CVE-2023-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52921"
},
{
"name": "CVE-2023-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52922"
},
{
"name": "CVE-2024-26596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26596"
},
{
"name": "CVE-2024-27407",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27407"
},
{
"name": "CVE-2024-47703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47703"
},
{
"name": "CVE-2024-49934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49934"
},
{
"name": "CVE-2024-49968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49968"
},
{
"name": "CVE-2024-49976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49976"
},
{
"name": "CVE-2024-49987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49987"
},
{
"name": "CVE-2024-49989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49989"
},
{
"name": "CVE-2024-50004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50004"
},
{
"name": "CVE-2024-50009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50009"
},
{
"name": "CVE-2024-50026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50026"
},
{
"name": "CVE-2024-50084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50084"
},
{
"name": "CVE-2024-50087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50087"
},
{
"name": "CVE-2024-50088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50088"
},
{
"name": "CVE-2024-50089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50089"
},
{
"name": "CVE-2024-50098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50098"
},
{
"name": "CVE-2024-50100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50100"
},
{
"name": "CVE-2024-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50101"
},
{
"name": "CVE-2024-50102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50102"
},
{
"name": "CVE-2024-50103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50103"
},
{
"name": "CVE-2024-50108",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50108"
},
{
"name": "CVE-2024-50115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50115"
},
{
"name": "CVE-2024-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50116"
},
{
"name": "CVE-2024-50117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50117"
},
{
"name": "CVE-2024-50121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50121"
},
{
"name": "CVE-2024-50124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50124"
},
{
"name": "CVE-2024-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50125"
},
{
"name": "CVE-2024-50127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50127"
},
{
"name": "CVE-2024-50128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50128"
},
{
"name": "CVE-2024-50130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50130"
},
{
"name": "CVE-2024-50131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50131"
},
{
"name": "CVE-2024-50134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50134"
},
{
"name": "CVE-2024-50135",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50135"
},
{
"name": "CVE-2024-50136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50136"
},
{
"name": "CVE-2024-50138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50138"
},
{
"name": "CVE-2024-50139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50139"
},
{
"name": "CVE-2024-50141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50141"
},
{
"name": "CVE-2024-50145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50145"
},
{
"name": "CVE-2024-50146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50146"
},
{
"name": "CVE-2024-50147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50147"
},
{
"name": "CVE-2024-50148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50148"
},
{
"name": "CVE-2024-50150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50150"
},
{
"name": "CVE-2024-50153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50153"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2024-50155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50155"
},
{
"name": "CVE-2024-50156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50156"
},
{
"name": "CVE-2024-50157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50157"
},
{
"name": "CVE-2024-50158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50158"
},
{
"name": "CVE-2024-50159",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50159"
},
{
"name": "CVE-2024-50160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50160"
},
{
"name": "CVE-2024-50166",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50166"
},
{
"name": "CVE-2024-50167",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50167"
},
{
"name": "CVE-2024-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50169"
},
{
"name": "CVE-2024-50171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50171"
},
{
"name": "CVE-2024-50172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50172"
},
{
"name": "CVE-2024-50175",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50175"
},
{
"name": "CVE-2024-50176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50176"
},
{
"name": "CVE-2024-50177",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50177"
},
{
"name": "CVE-2024-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50182"
},
{
"name": "CVE-2024-50183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50183"
},
{
"name": "CVE-2024-50187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50187"
},
{
"name": "CVE-2024-50194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50194"
},
{
"name": "CVE-2024-50195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50195"
},
{
"name": "CVE-2024-50196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50196"
},
{
"name": "CVE-2024-50198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50198"
},
{
"name": "CVE-2024-50200",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50200"
},
{
"name": "CVE-2024-50201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50201"
},
{
"name": "CVE-2024-50205",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50205"
},
{
"name": "CVE-2024-50209",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50209"
},
{
"name": "CVE-2024-50210",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50210"
},
{
"name": "CVE-2024-50216",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50216"
},
{
"name": "CVE-2024-50221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50221"
},
{
"name": "CVE-2024-50224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50224"
},
{
"name": "CVE-2024-50225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50225"
},
{
"name": "CVE-2024-50231",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50231"
},
{
"name": "CVE-2024-50240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50240"
},
{
"name": "CVE-2024-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50246"
},
{
"name": "CVE-2024-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50248"
},
{
"name": "CVE-2024-50274",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50274"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2024-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50289"
},
{
"name": "CVE-2024-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50298"
},
{
"name": "CVE-2024-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53045"
},
{
"name": "CVE-2024-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53048"
},
{
"name": "CVE-2024-53051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53051"
},
{
"name": "CVE-2024-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53056"
},
{
"name": "CVE-2024-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53068"
},
{
"name": "CVE-2024-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53074"
},
{
"name": "CVE-2024-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53076"
},
{
"name": "CVE-2024-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53079"
},
{
"name": "CVE-2024-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53085"
},
{
"name": "CVE-2024-53094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53094"
},
{
"name": "CVE-2024-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53095"
},
{
"name": "CVE-2024-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53096"
},
{
"name": "CVE-2024-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53100"
},
{
"name": "CVE-2024-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53101"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2024-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53106"
},
{
"name": "CVE-2024-53108",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53108"
},
{
"name": "CVE-2024-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53110"
},
{
"name": "CVE-2024-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53112"
},
{
"name": "CVE-2024-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53114"
},
{
"name": "CVE-2024-53121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53121"
},
{
"name": "CVE-2024-53138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53138"
},
{
"name": "CVE-2024-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53142"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-1102",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-12-20T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4314-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244314-1"
},
{
"published_at": "2024-12-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4367-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244367-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4317-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244317-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4313-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244313-1"
},
{
"published_at": "2024-12-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4388-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244388-1"
},
{
"published_at": "2024-12-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4346-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244346-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4316-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244316-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4315-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244315-1"
},
{
"published_at": "2024-12-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4364-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244364-1"
},
{
"published_at": "2024-12-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4387-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244387-1"
},
{
"published_at": "2024-12-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4345-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244345-1"
},
{
"published_at": "2024-12-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4376-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244376-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4318-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244318-1"
}
]
}
CERTFR-2025-AVI-0021
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans les produits IBM. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| IBM | Security QRadar EDR | Security QRadar EDR versions antérieures à 3.12.14 | ||
| IBM | Spectrum | Spectrum Control versions 5.4.x antérieures à 5.4.13 | ||
| IBM | Spectrum | Spectrum Protect Plus versions 10.1.x antérieures à 10.1.6.4 pour Linux | ||
| IBM | QRadar SIEM | QRadar SIEM versions 7.5.x sans les derniers correctifs de sécurité | ||
| IBM | QRadar | QRadar Analyst Workflow versions antérieures à 2.34.0 | ||
| IBM | Db2 | Db2 Big SQL versions antérieures à 7.4.2 pour Cloud Pak for Data |
| Title | Publication Time | Tags | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Security QRadar EDR versions ant\u00e9rieures \u00e0 3.12.14",
"product": {
"name": "Security QRadar EDR",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Spectrum Control versions 5.4.x ant\u00e9rieures \u00e0 5.4.13 ",
"product": {
"name": "Spectrum",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Spectrum Protect Plus versions 10.1.x ant\u00e9rieures \u00e0 10.1.6.4 pour Linux",
"product": {
"name": "Spectrum",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar SIEM versions 7.5.x sans les derniers correctifs de s\u00e9curit\u00e9 ",
"product": {
"name": "QRadar SIEM",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar Analyst Workflow versions ant\u00e9rieures \u00e0 2.34.0",
"product": {
"name": "QRadar",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Big SQL versions ant\u00e9rieures \u00e0 7.4.2 pour Cloud Pak for Data",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-24790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24790"
},
{
"name": "CVE-2023-52471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52471"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2015-2156",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2156"
},
{
"name": "CVE-2023-43642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-43642"
},
{
"name": "CVE-2024-42246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42246"
},
{
"name": "CVE-2024-22020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22020"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2022-25869",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25869"
},
{
"name": "CVE-2024-9355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9355"
},
{
"name": "CVE-2023-26116",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26116"
},
{
"name": "CVE-2024-26595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26595"
},
{
"name": "CVE-2024-55565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55565"
},
{
"name": "CVE-2024-26586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26586"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2024-47831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47831"
},
{
"name": "CVE-2020-7238",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-7238"
},
{
"name": "CVE-2021-46939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46939"
},
{
"name": "CVE-2024-43799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43799"
},
{
"name": "CVE-2024-49766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49766"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2021-32036",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-32036"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2023-44270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44270"
},
{
"name": "CVE-2019-20444",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20444"
},
{
"name": "CVE-2023-34454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34454"
},
{
"name": "CVE-2024-26645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26645"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-29025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29025"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2023-34453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34453"
},
{
"name": "CVE-2023-5072",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5072"
},
{
"name": "CVE-2024-45590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45590"
},
{
"name": "CVE-2019-10202",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-10202"
},
{
"name": "CVE-2024-43796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43796"
},
{
"name": "CVE-2021-32040",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-32040"
},
{
"name": "CVE-2024-34158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34158"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2024-4067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4067"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2023-26117",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26117"
},
{
"name": "CVE-2022-3786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3786"
},
{
"name": "CVE-2023-52486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52486"
},
{
"name": "CVE-2014-0193",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-0193"
},
{
"name": "CVE-2022-21680",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21680"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2019-14863",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-14863"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-21538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21538"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-47764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47764"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52451"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2023-34455",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34455"
},
{
"name": "CVE-2024-45296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45296"
},
{
"name": "CVE-2021-21295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21295"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-7254",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7254"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2022-46751",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-46751"
},
{
"name": "CVE-2023-52470",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52470"
},
{
"name": "CVE-2021-43797",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43797"
},
{
"name": "CVE-2020-7676",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-7676"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2023-26118",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26118"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2024-34156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34156"
},
{
"name": "CVE-2024-43830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43830"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2024-26640",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26640"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-49767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49767"
},
{
"name": "CVE-2024-22018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22018"
},
{
"name": "CVE-2019-10172",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-10172"
},
{
"name": "CVE-2024-6119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6119"
},
{
"name": "CVE-2024-37890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37890"
},
{
"name": "CVE-2024-47874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47874"
},
{
"name": "CVE-2024-42322",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42322"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-43800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43800"
},
{
"name": "CVE-2024-28863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28863"
},
{
"name": "CVE-2024-39338",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39338"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2021-21290",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21290"
},
{
"name": "CVE-2019-10768",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-10768"
},
{
"name": "CVE-2022-3602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3602"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-26717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26717"
},
{
"name": "CVE-2023-26136",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26136"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2023-52476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52476"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-34155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34155"
},
{
"name": "CVE-2023-52530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52530"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2019-16869",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-16869"
},
{
"name": "CVE-2022-21681",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-21681"
},
{
"name": "CVE-2024-42237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42237"
},
{
"name": "CVE-2024-24789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24789"
},
{
"name": "CVE-2024-27011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27011"
},
{
"name": "CVE-2019-20445",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20445"
}
],
"links": [],
"reference": "CERTFR-2025-AVI-0021",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-01-10T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Injection de code indirecte \u00e0 distance (XSS)"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits IBM. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits IBM",
"vendor_advisories": [
{
"published_at": "2025-01-08",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7180462",
"url": "https://www.ibm.com/support/pages/node/7180462"
},
{
"published_at": "2025-01-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7180361",
"url": "https://www.ibm.com/support/pages/node/7180361"
},
{
"published_at": "2025-01-04",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7180282",
"url": "https://www.ibm.com/support/pages/node/7180282"
},
{
"published_at": "2025-01-06",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7180314",
"url": "https://www.ibm.com/support/pages/node/7180314"
},
{
"published_at": "2025-01-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7180450",
"url": "https://www.ibm.com/support/pages/node/7180450"
},
{
"published_at": "2025-01-08",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7180545",
"url": "https://www.ibm.com/support/pages/node/7180545"
}
]
}
CERTFR-2026-AVI-1165
Vulnerability from certfr_avis - Published: 2026-09-11 - Updated: 2026-09-11
De multiples vulnérabilités ont été découvertes dans les produits IBM. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| IBM | Db2 | Db2 Common Container sans le correctif de sécurité 1159cn3 | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 15.0.x antérieures à 15.0.1.14 | ||
| IBM | QRadar Hub | QRadar Hub versions antérieures à 3.9.1 | ||
| IBM | WebSphere Application Server | WebSphere Application Server Liberty versions antérieures à 26.0.0.10 (disponibilité prévue pour le quatrième trimestre 2026) | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 12.10 antérieures à InformixHQ 3.3.1 | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 14.10.x antérieures à 14.10.xC14 | ||
| IBM | Db2 | Db2 versions V11.5.x sans le correctif de sécurité DT495924, DT474170, DT495462, DT470425 et DT501356 | ||
| IBM | Sterling Partner Engagement Manager Essentials Edition | Sterling Partner Engagement Manager Essentials Edition versions 6.2.4.x antérieures à 6.2.4.5 | ||
| IBM | Db2 | Db2 Bridge versions antérieures à 1.1.5.2 | ||
| IBM | Db2 | Db2 Warehouse on Cloud Pak for Data versions antérieures à v5.4 patch 6 | ||
| IBM | Sterling Partner Engagement Manager Standard Edition | Sterling Partner Engagement Manager Standard Edition versions 6.2.4.x antérieures à 6.2.4.5 | ||
| IBM | Db2 | Db2 Developer Extension versions 1.1.x antérieures à 1.1.2 | ||
| IBM | Sterling Partner Engagement Manager Essentials Edition | Sterling Partner Engagement Manager Essentials Edition versions 6.3.0.x antérieures à 6.3.0.3 | ||
| IBM | Db2 | Db2 on Cloud Pak for Data versions antérieures à v5.4 patch 6 | ||
| IBM | Db2 | Db2 versions V12.1 sans le correctif de sécurité DT495924, DT495462 et DT474170 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Db2 Common Container sans le correctif de s\u00e9curit\u00e9 1159cn3",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 15.0.x ant\u00e9rieures \u00e0 15.0.1.14",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar Hub versions ant\u00e9rieures \u00e0 3.9.1",
"product": {
"name": "QRadar Hub",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "WebSphere Application Server Liberty versions ant\u00e9rieures \u00e0 26.0.0.10 (disponibilit\u00e9 pr\u00e9vue pour le quatri\u00e8me trimestre 2026)",
"product": {
"name": "WebSphere Application Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 12.10 ant\u00e9rieures \u00e0 InformixHQ 3.3.1",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 14.10.x ant\u00e9rieures \u00e0 14.10.xC14",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 versions V11.5.x sans le correctif de s\u00e9curit\u00e9 DT495924, DT474170, DT495462, DT470425 et DT501356",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Essentials Edition versions 6.2.4.x ant\u00e9rieures \u00e0 6.2.4.5",
"product": {
"name": "Sterling Partner Engagement Manager Essentials Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Bridge versions ant\u00e9rieures \u00e0 1.1.5.2",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Warehouse on Cloud Pak for Data versions ant\u00e9rieures \u00e0 v5.4 patch 6",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Standard Edition versions 6.2.4.x ant\u00e9rieures \u00e0 6.2.4.5",
"product": {
"name": "Sterling Partner Engagement Manager Standard Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Developer Extension versions 1.1.x ant\u00e9rieures \u00e0 1.1.2",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Essentials Edition versions 6.3.0.x ant\u00e9rieures \u00e0 6.3.0.3",
"product": {
"name": "Sterling Partner Engagement Manager Essentials Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 on Cloud Pak for Data versions ant\u00e9rieures \u00e0 v5.4 patch 6",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 versions V12.1 sans le correctif de s\u00e9curit\u00e9 DT495924, DT495462 et DT474170",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-75595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75595"
},
{
"name": "CVE-2026-49978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49978"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2023-52471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52471"
},
{
"name": "CVE-2026-5588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5588"
},
{
"name": "CVE-2021-33036",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33036"
},
{
"name": "CVE-2021-44906",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44906"
},
{
"name": "CVE-2026-54264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54264"
},
{
"name": "CVE-2024-50142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50142"
},
{
"name": "CVE-2026-59651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59651"
},
{
"name": "CVE-2026-45819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45819"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2026-50557",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50557"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2026-59295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59295"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2023-43642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-43642"
},
{
"name": "CVE-2021-21409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21409"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2018-14042",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14042"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2025-2534",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2534"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2026-41254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41254"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2024-42246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42246"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2026-16480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16480"
},
{
"name": "CVE-2018-1334",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1334"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2026-32990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-32990"
},
{
"name": "CVE-2024-26595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26595"
},
{
"name": "CVE-2026-50645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50645"
},
{
"name": "CVE-2026-22610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22610"
},
{
"name": "CVE-2024-42292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42292"
},
{
"name": "CVE-2026-42041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42041"
},
{
"name": "CVE-2014-125087",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-125087"
},
{
"name": "CVE-2026-14686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14686"
},
{
"name": "CVE-2026-68763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68763"
},
{
"name": "CVE-2023-1370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1370"
},
{
"name": "CVE-2026-45416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45416"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-33201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-33201"
},
{
"name": "CVE-2026-10050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10050"
},
{
"name": "CVE-2024-27010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27010"
},
{
"name": "CVE-2024-42284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42284"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2026-53666",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53666"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2026-59648",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59648"
},
{
"name": "CVE-2026-69153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69153"
},
{
"name": "CVE-2026-3621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3621"
},
{
"name": "CVE-2026-43515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43515"
},
{
"name": "CVE-2026-42402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42402"
},
{
"name": "CVE-2021-47304",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47304"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2026-43868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43868"
},
{
"name": "CVE-2026-50560",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50560"
},
{
"name": "CVE-2024-26586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26586"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2015-5237",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-5237"
},
{
"name": "CVE-2026-71290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-71290"
},
{
"name": "CVE-2019-10099",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-10099"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2026-41716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41716"
},
{
"name": "CVE-2018-11760",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11760"
},
{
"name": "CVE-2026-15328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15328"
},
{
"name": "CVE-2026-59645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59645"
},
{
"name": "CVE-2022-45688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45688"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-23944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23944"
},
{
"name": "CVE-2022-33891",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-33891"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2026-13006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13006"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2018-8024",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8024"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2024-27397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27397"
},
{
"name": "CVE-2024-49350",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49350"
},
{
"name": "CVE-2022-48619",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48619"
},
{
"name": "CVE-2024-46679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46679"
},
{
"name": "CVE-2025-66412",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66412"
},
{
"name": "CVE-2025-36131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36131"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2026-54514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54514"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2018-14040",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14040"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-28757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28757"
},
{
"name": "CVE-2026-77414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77414"
},
{
"name": "CVE-2020-11988",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11988"
},
{
"name": "CVE-2021-46939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46939"
},
{
"name": "CVE-2025-56200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-56200"
},
{
"name": "CVE-2024-37071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37071"
},
{
"name": "CVE-2026-77413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77413"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2026-54399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54399"
},
{
"name": "CVE-2026-53668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53668"
},
{
"name": "CVE-2024-41038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41038"
},
{
"name": "CVE-2025-30065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30065"
},
{
"name": "CVE-2026-16243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16243"
},
{
"name": "CVE-2016-4055",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-4055"
},
{
"name": "CVE-2026-9171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9171"
},
{
"name": "CVE-2026-67214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67214"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2024-25638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25638"
},
{
"name": "CVE-2026-12185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12185"
},
{
"name": "CVE-2026-59921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59921"
},
{
"name": "CVE-2024-47118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47118"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2026-47010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47010"
},
{
"name": "CVE-2023-45853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45853"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2023-45288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45288"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2026-14685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14685"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-45178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45178"
},
{
"name": "CVE-2026-54171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54171"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2022-31160",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31160"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2020-10683",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10683"
},
{
"name": "CVE-2018-1273",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1273"
},
{
"name": "CVE-2026-41239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41239"
},
{
"name": "CVE-2024-26600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26600"
},
{
"name": "CVE-2026-33814",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33814"
},
{
"name": "CVE-2023-28746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28746"
},
{
"name": "CVE-2026-47891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47891"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2024-42114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42114"
},
{
"name": "CVE-2020-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26945"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2026-68569",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68569"
},
{
"name": "CVE-2026-59084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59084"
},
{
"name": "CVE-2026-65183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65183"
},
{
"name": "CVE-2024-35897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35897"
},
{
"name": "CVE-2026-14257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14257"
},
{
"name": "CVE-2026-41901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41901"
},
{
"name": "CVE-2026-73088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73088"
},
{
"name": "CVE-2023-52478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52478"
},
{
"name": "CVE-2024-23945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23945"
},
{
"name": "CVE-2021-41182",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41182"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2022-25647",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25647"
},
{
"name": "CVE-2026-9072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9072"
},
{
"name": "CVE-2022-26612",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26612"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2026-18097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18097"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2023-52492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52492"
},
{
"name": "CVE-2022-36364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36364"
},
{
"name": "CVE-2026-73089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73089"
},
{
"name": "CVE-2023-34610",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34610"
},
{
"name": "CVE-2026-47057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47057"
},
{
"name": "CVE-2024-47561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47561"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-31881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31881"
},
{
"name": "CVE-2019-11358",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-11358"
},
{
"name": "CVE-2026-69152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69152"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2026-68525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68525"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2026-59901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59901"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-35839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35839"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2026-14525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14525"
},
{
"name": "CVE-2026-67313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67313"
},
{
"name": "CVE-2020-13955",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-13955"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2026-8858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8858"
},
{
"name": "CVE-2026-42580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42580"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2026-41691",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41691"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-43889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43889"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2026-65637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65637"
},
{
"name": "CVE-2018-8009",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8009"
},
{
"name": "CVE-2026-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50163"
},
{
"name": "CVE-2026-67315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67315"
},
{
"name": "CVE-2026-54516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54516"
},
{
"name": "CVE-2026-55223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55223"
},
{
"name": "CVE-2025-7962",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7962"
},
{
"name": "CVE-2026-18499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18499"
},
{
"name": "CVE-2019-20444",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20444"
},
{
"name": "CVE-2026-54515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54515"
},
{
"name": "CVE-2026-5516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5516"
},
{
"name": "CVE-2023-34462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34462"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2026-41721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41721"
},
{
"name": "CVE-2018-1313",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1313"
},
{
"name": "CVE-2026-16221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16221"
},
{
"name": "CVE-2023-34454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34454"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2022-46337",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-46337"
},
{
"name": "CVE-2026-6790",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6790"
},
{
"name": "CVE-2026-65911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65911"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2026-18401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18401"
},
{
"name": "CVE-2021-35516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35516"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26686"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2023-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44487"
},
{
"name": "CVE-2024-29857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29857"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-26645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26645"
},
{
"name": "CVE-2026-66143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66143"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2026-66144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66144"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2026-44494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44494"
},
{
"name": "CVE-2023-26049",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26049"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2026-42585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42585"
},
{
"name": "CVE-2024-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50192"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-45018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45018"
},
{
"name": "CVE-2026-12860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12860"
},
{
"name": "CVE-2026-10571",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10571"
},
{
"name": "CVE-2024-34447",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34447"
},
{
"name": "CVE-2026-65901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65901"
},
{
"name": "CVE-2026-11541",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11541"
},
{
"name": "CVE-2014-3578",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-3578"
},
{
"name": "CVE-2026-41635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41635"
},
{
"name": "CVE-2024-43871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43871"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2024-31880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31880"
},
{
"name": "CVE-2024-29025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29025"
},
{
"name": "CVE-2024-43880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43880"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2026-11546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11546"
},
{
"name": "CVE-2026-42036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42036"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2026-64607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64607"
},
{
"name": "CVE-2026-59652",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59652"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2023-34453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34453"
},
{
"name": "CVE-2024-26669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26669"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27043"
},
{
"name": "CVE-2024-41761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41761"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2026-65903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65903"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2026-65900",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65900"
},
{
"name": "CVE-2026-66010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66010"
},
{
"name": "CVE-2026-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52746"
},
{
"name": "CVE-2024-28762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28762"
},
{
"name": "CVE-2023-3635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3635"
},
{
"name": "CVE-2026-43827",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43827"
},
{
"name": "CVE-2026-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50184"
},
{
"name": "CVE-2026-47885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47885"
},
{
"name": "CVE-2026-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50169"
},
{
"name": "CVE-2021-47287",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47287"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2026-47065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47065"
},
{
"name": "CVE-2026-55831",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55831"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2023-5072",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5072"
},
{
"name": "CVE-2026-47841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47841"
},
{
"name": "CVE-2021-23337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-23337"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2026-41707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41707"
},
{
"name": "CVE-2021-23369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-23369"
},
{
"name": "CVE-2026-77415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77415"
},
{
"name": "CVE-2026-42403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42403"
},
{
"name": "CVE-2024-41056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41056"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2022-31777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31777"
},
{
"name": "CVE-2019-14893",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-14893"
},
{
"name": "CVE-2026-10534",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10534"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2026-59880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59880"
},
{
"name": "CVE-2026-65432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65432"
},
{
"name": "CVE-2026-59894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59894"
},
{
"name": "CVE-2019-0231",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-0231"
},
{
"name": "CVE-2023-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50298"
},
{
"name": "CVE-2026-15057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15057"
},
{
"name": "CVE-2026-41607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41607"
},
{
"name": "CVE-2024-26308",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26308"
},
{
"name": "CVE-2025-1992",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1992"
},
{
"name": "CVE-2026-44248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44248"
},
{
"name": "CVE-2018-20676",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-20676"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-31141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31141"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2025-13755",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13755"
},
{
"name": "CVE-2025-62718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62718"
},
{
"name": "CVE-2025-36136",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36136"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2026-49458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49458"
},
{
"name": "CVE-2026-4800",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-4800"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2026-42584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42584"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2026-4410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-4410"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2026-44249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44249"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2026-41284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41284"
},
{
"name": "CVE-2025-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36008"
},
{
"name": "CVE-2026-59647",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59647"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2021-35517",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35517"
},
{
"name": "CVE-2024-30172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30172"
},
{
"name": "CVE-2026-42577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42577"
},
{
"name": "CVE-2026-58059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58059"
},
{
"name": "CVE-2026-48978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48978"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2026-75596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75596"
},
{
"name": "CVE-2026-8484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8484"
},
{
"name": "CVE-2026-8763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8763"
},
{
"name": "CVE-2026-6051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6051"
},
{
"name": "CVE-2026-44598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44598"
},
{
"name": "CVE-2023-52486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52486"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2025-14917",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14917"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2026-15325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15325"
},
{
"name": "CVE-2021-47073",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47073"
},
{
"name": "CVE-2026-69247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69247"
},
{
"name": "CVE-2026-49268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49268"
},
{
"name": "CVE-2024-36124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36124"
},
{
"name": "CVE-2021-47579",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47579"
},
{
"name": "CVE-2026-33671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33671"
},
{
"name": "CVE-2026-14976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14976"
},
{
"name": "CVE-2026-5598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5598"
},
{
"name": "CVE-2025-68470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68470"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2026-65182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65182"
},
{
"name": "CVE-2018-11087",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11087"
},
{
"name": "CVE-2026-42033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42033"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2026-42035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42035"
},
{
"name": "CVE-2024-26804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26804"
},
{
"name": "CVE-2026-18446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18446"
},
{
"name": "CVE-2026-44495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44495"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2026-41695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41695"
},
{
"name": "CVE-2024-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23454"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2026-22740",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22740"
},
{
"name": "CVE-2026-47890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47890"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2022-3510",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3510"
},
{
"name": "CVE-2026-59903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59903"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2022-3509",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3509"
},
{
"name": "CVE-2026-14684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14684"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2026-56746",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56746"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2021-37137",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37137"
},
{
"name": "CVE-2026-10842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10842"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2023-51074",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51074"
},
{
"name": "CVE-2024-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53122"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2026-9496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9496"
},
{
"name": "CVE-2026-34478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34478"
},
{
"name": "CVE-2026-42586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42586"
},
{
"name": "CVE-2026-35091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-35091"
},
{
"name": "CVE-2024-57807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57807"
},
{
"name": "CVE-2025-30474",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30474"
},
{
"name": "CVE-2024-41008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41008"
},
{
"name": "CVE-2026-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40984"
},
{
"name": "CVE-2021-41973",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41973"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2024-8184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8184"
},
{
"name": "CVE-2026-54428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54428"
},
{
"name": "CVE-2026-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50162"
},
{
"name": "CVE-2026-42043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42043"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2025-11143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11143"
},
{
"name": "CVE-2026-15055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15055"
},
{
"name": "CVE-2026-8646",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8646"
},
{
"name": "CVE-2026-45822",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45822"
},
{
"name": "CVE-2025-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36006"
},
{
"name": "CVE-2026-40477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40477"
},
{
"name": "CVE-2023-35701",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-35701"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2026-47834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47834"
},
{
"name": "CVE-2026-34480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34480"
},
{
"name": "CVE-2026-14682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14682"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2018-20677",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-20677"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2026-84305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-84305"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2026-73180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73180"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2026-59869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59869"
},
{
"name": "CVE-2026-47887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47887"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2025-36186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36186"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2026-62243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-62243"
},
{
"name": "CVE-2023-22946",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22946"
},
{
"name": "CVE-2026-65904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65904"
},
{
"name": "CVE-2026-58061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58061"
},
{
"name": "CVE-2025-12758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12758"
},
{
"name": "CVE-2026-40175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40175"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2026-69151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69151"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-44935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44935"
},
{
"name": "CVE-2026-27970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27970"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2026-9320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9320"
},
{
"name": "CVE-2026-49459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49459"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2021-36090",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36090"
},
{
"name": "CVE-2021-27568",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-27568"
},
{
"name": "CVE-2026-6053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6053"
},
{
"name": "CVE-2024-41039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41039"
},
{
"name": "CVE-2024-23953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23953"
},
{
"name": "CVE-2026-54265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54265"
},
{
"name": "CVE-2025-68161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68161"
},
{
"name": "CVE-2023-52451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52451"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2021-38296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-38296"
},
{
"name": "CVE-2025-21785",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21785"
},
{
"name": "CVE-2022-24823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24823"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-26649",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26649"
},
{
"name": "CVE-2026-56624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56624"
},
{
"name": "CVE-2023-34455",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34455"
},
{
"name": "CVE-2021-41184",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41184"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-29131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29131"
},
{
"name": "CVE-2021-41183",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41183"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-29869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29869"
},
{
"name": "CVE-2026-41240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41240"
},
{
"name": "CVE-2026-67317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67317"
},
{
"name": "CVE-2026-40478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40478"
},
{
"name": "CVE-2026-22748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22748"
},
{
"name": "CVE-2025-33012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-33012"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2026-34479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34479"
},
{
"name": "CVE-2024-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52804"
},
{
"name": "CVE-2026-43828",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43828"
},
{
"name": "CVE-2026-42040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42040"
},
{
"name": "CVE-2023-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36478"
},
{
"name": "CVE-2021-37136",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37136"
},
{
"name": "CVE-2018-1330",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1330"
},
{
"name": "CVE-2026-47027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47027"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2026-47058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47058"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2026-16441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16441"
},
{
"name": "CVE-2024-6763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6763"
},
{
"name": "CVE-2026-6052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6052"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53088"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2026-14981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14981"
},
{
"name": "CVE-2026-58060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58060"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2021-21295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21295"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2026-42778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42778"
},
{
"name": "CVE-2026-14683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14683"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2026-14529",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14529"
},
{
"name": "CVE-2019-0204",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-0204"
},
{
"name": "CVE-2024-26851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26851"
},
{
"name": "CVE-2022-2047",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2047"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2018-11793",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11793"
},
{
"name": "CVE-2026-22741",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22741"
},
{
"name": "CVE-2023-39410",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39410"
},
{
"name": "CVE-2024-35888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35888"
},
{
"name": "CVE-2024-25710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25710"
},
{
"name": "CVE-2026-12802",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12802"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2024-7254",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7254"
},
{
"name": "CVE-2024-46695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46695"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2020-9492",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-9492"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2026-40181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40181"
},
{
"name": "CVE-2023-52700",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52700"
},
{
"name": "CVE-2025-14923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14923"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2026-10649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10649"
},
{
"name": "CVE-2026-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50020"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-29133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29133"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2026-54512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54512"
},
{
"name": "CVE-2026-58063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58063"
},
{
"name": "CVE-2026-57819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-57819"
},
{
"name": "CVE-2026-42578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42578"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2024-35910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35910"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2022-48757",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48757"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2026-65899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65899"
},
{
"name": "CVE-2026-43514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43514"
},
{
"name": "CVE-2026-45773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45773"
},
{
"name": "CVE-2026-67319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67319"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2026-10532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10532"
},
{
"name": "CVE-2023-52470",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52470"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2022-24785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24785"
},
{
"name": "CVE-2025-2518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2518"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46120"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-57979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57979"
},
{
"name": "CVE-2024-52046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52046"
},
{
"name": "CVE-2021-43797",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43797"
},
{
"name": "CVE-2026-70907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-70907"
},
{
"name": "CVE-2026-48589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48589"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2021-37404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37404"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2026-42404",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42404"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2022-45787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45787"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2018-1199",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1199"
},
{
"name": "CVE-2024-14041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-14041"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2022-48754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48754"
},
{
"name": "CVE-2026-41586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41586"
},
{
"name": "CVE-2026-16192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16192"
},
{
"name": "CVE-2024-5569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5569"
},
{
"name": "CVE-2026-2950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2950"
},
{
"name": "CVE-2016-6811",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-6811"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2026-68945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68945"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2023-44981",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44981"
},
{
"name": "CVE-2026-40895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40895"
},
{
"name": "CVE-2026-47063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47063"
},
{
"name": "CVE-2025-1493",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1493"
},
{
"name": "CVE-2026-12816",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12816"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-43830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43830"
},
{
"name": "CVE-2026-59083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59083"
},
{
"name": "CVE-2025-27553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27553"
},
{
"name": "CVE-2024-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47535"
},
{
"name": "CVE-2026-45772",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45772"
},
{
"name": "CVE-2023-52428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52428"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2026-41606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41606"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2026-59888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59888"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2026-10543",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10543"
},
{
"name": "CVE-2023-6040",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6040"
},
{
"name": "CVE-2026-13149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13149"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2026-47021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47021"
},
{
"name": "CVE-2024-41042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41042"
},
{
"name": "CVE-2024-6485",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6485"
},
{
"name": "CVE-2026-47842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47842"
},
{
"name": "CVE-2025-3050",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-3050"
},
{
"name": "CVE-2023-40167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40167"
},
{
"name": "CVE-2018-1274",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1274"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2026-59898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59898"
},
{
"name": "CVE-2026-16440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16440"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2026-64958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64958"
},
{
"name": "CVE-2024-9823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9823"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2026-66422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66422"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2021-22569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22569"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-41762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41762"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2023-6378",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6378"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2026-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41006"
},
{
"name": "CVE-2026-41711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41711"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2026-45205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45205"
},
{
"name": "CVE-2026-27830",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27830"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47018",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47018"
},
{
"name": "CVE-2026-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44487"
},
{
"name": "CVE-2026-13506",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13506"
},
{
"name": "CVE-2024-26640",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26640"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2026-2482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2482"
},
{
"name": "CVE-2026-11897",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11897"
},
{
"name": "CVE-2026-35092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-35092"
},
{
"name": "CVE-2026-42038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42038"
},
{
"name": "CVE-2026-49844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49844"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2021-46972",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46972"
},
{
"name": "CVE-2026-18096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18096"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2022-34169",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-34169"
},
{
"name": "CVE-2026-2332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2332"
},
{
"name": "CVE-2026-1561",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1561"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2026-42039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42039"
},
{
"name": "CVE-2026-59879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59879"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2026-46968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46968"
},
{
"name": "CVE-2026-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40972"
},
{
"name": "CVE-2024-43892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43892"
},
{
"name": "CVE-2026-50010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50010"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2023-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36479"
},
{
"name": "CVE-2024-50256",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50256"
},
{
"name": "CVE-2026-59296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59296"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2026-33672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33672"
},
{
"name": "CVE-2026-75838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75838"
},
{
"name": "CVE-2018-14041",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14041"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2026-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40983"
},
{
"name": "CVE-2024-24549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24549"
},
{
"name": "CVE-2026-42581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42581"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2025-0915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0915"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2023-29267",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29267"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2026-42779",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42779"
},
{
"name": "CVE-2021-47097",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47097"
},
{
"name": "CVE-2024-42322",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42322"
},
{
"name": "CVE-2026-43513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43513"
},
{
"name": "CVE-2023-28370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28370"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2026-54517",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54517"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26843"
},
{
"name": "CVE-2022-48747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48747"
},
{
"name": "CVE-2026-25639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25639"
},
{
"name": "CVE-2026-40973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40973"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2020-11022",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11022"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2026-15064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15064"
},
{
"name": "CVE-2026-42044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42044"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2021-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-31684"
},
{
"name": "CVE-2025-25193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25193"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2026-8620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8620"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2026-65905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65905"
},
{
"name": "CVE-2026-16439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16439"
},
{
"name": "CVE-2025-14915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14915"
},
{
"name": "CVE-2026-56745",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56745"
},
{
"name": "CVE-2018-16487",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-16487"
},
{
"name": "CVE-2026-8633",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8633"
},
{
"name": "CVE-2022-31159",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31159"
},
{
"name": "CVE-2026-11714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11714"
},
{
"name": "CVE-2016-10735",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-10735"
},
{
"name": "CVE-2024-52903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52903"
},
{
"name": "CVE-2026-47838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47838"
},
{
"name": "CVE-2021-42550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42550"
},
{
"name": "CVE-2017-18214",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-18214"
},
{
"name": "CVE-2025-22870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22870"
},
{
"name": "CVE-2026-59642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59642"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2024-40679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40679"
},
{
"name": "CVE-2026-42034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42034"
},
{
"name": "CVE-2026-47884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47884"
},
{
"name": "CVE-2026-41417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41417"
},
{
"name": "CVE-2026-61308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-61308"
},
{
"name": "CVE-2025-23215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23215"
},
{
"name": "CVE-2026-48043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48043"
},
{
"name": "CVE-2026-9322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9322"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2026-87958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-87958"
},
{
"name": "CVE-2026-22745",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22745"
},
{
"name": "CVE-2024-30171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30171"
},
{
"name": "CVE-2026-42587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42587"
},
{
"name": "CVE-2026-54513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54513"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2025-14914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14914"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2023-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52922"
},
{
"name": "CVE-2026-65927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65927"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2026-9563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9563"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2026-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54518"
},
{
"name": "CVE-2020-9480",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-9480"
},
{
"name": "CVE-2024-36114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36114"
},
{
"name": "CVE-2026-47244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47244"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2026-13676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13676"
},
{
"name": "CVE-2024-26759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26759"
},
{
"name": "CVE-2026-54297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54297"
},
{
"name": "CVE-2026-53434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53434"
},
{
"name": "CVE-2011-4969",
"url": "https://www.cve.org/CVERecord?id=CVE-2011-4969"
},
{
"name": "CVE-2026-60589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-60589"
},
{
"name": "CVE-2026-67312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67312"
},
{
"name": "CVE-2026-6938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6938"
},
{
"name": "CVE-2025-8916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8916"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2026-66142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66142"
},
{
"name": "CVE-2025-8885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8885"
},
{
"name": "CVE-2023-52464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52464"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2026-10051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10051"
},
{
"name": "CVE-2026-53669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53669"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2026-41409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41409"
},
{
"name": "CVE-2018-1259",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1259"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2026-6322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6322"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2026-8400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8400"
},
{
"name": "CVE-2026-45623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45623"
},
{
"name": "CVE-2026-14980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14980"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2023-24998",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24998"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2026-58062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58062"
},
{
"name": "CVE-2024-41023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41023"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2026-12143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12143"
},
{
"name": "CVE-2026-67318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67318"
},
{
"name": "CVE-2026-59893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59893"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-26660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26660"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2021-21290",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21290"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2023-52560",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52560"
},
{
"name": "CVE-2026-50151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50151"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-41065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41065"
},
{
"name": "CVE-2026-44486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44486"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2026-42264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42264"
},
{
"name": "CVE-2026-12803",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12803"
},
{
"name": "CVE-2021-47069",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47069"
},
{
"name": "CVE-2026-8384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8384"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2023-2976",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2976"
},
{
"name": "CVE-2026-59650",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59650"
},
{
"name": "CVE-2025-1000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1000"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2026-44496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44496"
},
{
"name": "CVE-2018-8023",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8023"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2026-44492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44492"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2026-54225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54225"
},
{
"name": "CVE-2026-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-39865"
},
{
"name": "CVE-2026-41238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41238"
},
{
"name": "CVE-2026-47877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47877"
},
{
"name": "CVE-2023-52522",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52522"
},
{
"name": "CVE-2026-43512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43512"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2020-26555",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26555"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2024-26717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26717"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2021-22570",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22570"
},
{
"name": "CVE-2026-47883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47883"
},
{
"name": "CVE-2021-35515",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35515"
},
{
"name": "CVE-2024-44990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44990"
},
{
"name": "CVE-2026-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41007"
},
{
"name": "CVE-2026-42037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42037"
},
{
"name": "CVE-2022-40898",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40898"
},
{
"name": "CVE-2024-42265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42265"
},
{
"name": "CVE-2021-46984",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46984"
},
{
"name": "CVE-2026-55760",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55760"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-26048",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26048"
},
{
"name": "CVE-2026-42498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42498"
},
{
"name": "CVE-2026-42042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42042"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2026-9071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9071"
},
{
"name": "CVE-2017-7669",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7669"
},
{
"name": "CVE-2026-67213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67213"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2026-55833",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55833"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2024-45663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45663"
},
{
"name": "CVE-2026-13586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13586"
},
{
"name": "CVE-2025-33134",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-33134"
},
{
"name": "CVE-2021-47101",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47101"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2023-26112",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26112"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2026-9370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9370"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2023-52626",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52626"
},
{
"name": "CVE-2024-36979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36979"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2026-11806",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11806"
},
{
"name": "CVE-2023-52476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52476"
},
{
"name": "CVE-2024-42301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42301"
},
{
"name": "CVE-2026-12590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12590"
},
{
"name": "CVE-2026-34477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34477"
},
{
"name": "CVE-2026-65902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65902"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2026-56819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56819"
},
{
"name": "CVE-2026-54284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54284"
},
{
"name": "CVE-2026-6321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6321"
},
{
"name": "CVE-2022-3171",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3171"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2026-44490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44490"
},
{
"name": "CVE-2016-7103",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-7103"
},
{
"name": "CVE-2015-9251",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-9251"
},
{
"name": "CVE-2026-59639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59639"
},
{
"name": "CVE-2026-86093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-86093"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2026-10852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10852"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2026-28338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28338"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2010-5312",
"url": "https://www.cve.org/CVERecord?id=CVE-2010-5312"
},
{
"name": "CVE-2026-68494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68494"
},
{
"name": "CVE-2024-26810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26810"
},
{
"name": "CVE-2023-52530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52530"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2012-6708",
"url": "https://www.cve.org/CVERecord?id=CVE-2012-6708"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2020-7656",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-7656"
},
{
"name": "CVE-2018-8013",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8013"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2026-29063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-29063"
},
{
"name": "CVE-2026-60147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-60147"
},
{
"name": "CVE-2026-47889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47889"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2019-16869",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-16869"
},
{
"name": "CVE-2023-52648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52648"
},
{
"name": "CVE-2026-15280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15280"
},
{
"name": "CVE-2026-67316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67316"
},
{
"name": "CVE-2025-14813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14813"
},
{
"name": "CVE-2022-41881",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-41881"
},
{
"name": "CVE-2025-13465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13465"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2026-44488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44488"
},
{
"name": "CVE-2024-42237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42237"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2026-59899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59899"
},
{
"name": "CVE-2026-1718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1718"
},
{
"name": "CVE-2026-71491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-71491"
},
{
"name": "CVE-2026-34481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34481"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-27011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27011"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2021-47257",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47257"
},
{
"name": "CVE-2026-38969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-38969"
},
{
"name": "CVE-2026-19880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-19880"
},
{
"name": "CVE-2024-46858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46858"
},
{
"name": "CVE-2026-47059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47059"
},
{
"name": "CVE-2022-25168",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25168"
},
{
"name": "CVE-2026-41293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41293"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-44989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44989"
},
{
"name": "CVE-2024-6345",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6345"
},
{
"name": "CVE-2026-77310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77310"
},
{
"name": "CVE-2024-57699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57699"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2026-65898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65898"
},
{
"name": "CVE-2020-11023",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11023"
},
{
"name": "CVE-2023-5090",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5090"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2021-46909",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46909"
},
{
"name": "CVE-2019-8331",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-8331"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2018-1000632",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1000632"
},
{
"name": "CVE-2019-20445",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20445"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2026-59889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59889"
},
{
"name": "CVE-2025-36185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36185"
},
{
"name": "CVE-2025-11226",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11226"
}
],
"initial_release_date": "2026-09-11T00:00:00",
"last_revision_date": "2026-09-11T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-1165",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-09-11T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Injection de code indirecte \u00e0 distance (XSS)"
},
{
"description": "Injection de requ\u00eates ill\u00e9gitimes par rebond (CSRF)"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Falsification de requ\u00eates c\u00f4t\u00e9 serveur (SSRF)"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits IBM. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits IBM",
"vendor_advisories": [
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286777",
"url": "https://www.ibm.com/support/pages/node/7286777"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286776",
"url": "https://www.ibm.com/support/pages/node/7286776"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286990",
"url": "https://www.ibm.com/support/pages/node/7286990"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286976",
"url": "https://www.ibm.com/support/pages/node/7286976"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286993",
"url": "https://www.ibm.com/support/pages/node/7286993"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286782",
"url": "https://www.ibm.com/support/pages/node/7286782"
},
{
"published_at": "2026-09-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286515",
"url": "https://www.ibm.com/support/pages/node/7286515"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286646",
"url": "https://www.ibm.com/support/pages/node/7286646"
},
{
"published_at": "2026-09-11",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7287136",
"url": "https://www.ibm.com/support/pages/node/7287136"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286986",
"url": "https://www.ibm.com/support/pages/node/7286986"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286982",
"url": "https://www.ibm.com/support/pages/node/7286982"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286775",
"url": "https://www.ibm.com/support/pages/node/7286775"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286987",
"url": "https://www.ibm.com/support/pages/node/7286987"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286910",
"url": "https://www.ibm.com/support/pages/node/7286910"
},
{
"published_at": "2026-09-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286516",
"url": "https://www.ibm.com/support/pages/node/7286516"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286909",
"url": "https://www.ibm.com/support/pages/node/7286909"
}
]
}
FKIE_CVE-2024-40997
Vulnerability from fkie_nvd - Published: 2024-07-12 13:15 - Updated: 2026-06-17 07:47| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/amd-pstate.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd",
"status": "affected",
"version": "ffa5096a7c338641f70fb06d4778e8cf400181a8",
"versionType": "git"
},
{
"lessThan": "8015c17fe11a8608cc3eb83d0ab831e1845a9582",
"status": "affected",
"version": "ffa5096a7c338641f70fb06d4778e8cf400181a8",
"versionType": "git"
},
{
"lessThan": "cea04f3d9aeebda9d9c063c0dfa71e739c322c81",
"status": "affected",
"version": "ffa5096a7c338641f70fb06d4778e8cf400181a8",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/amd-pstate.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "6.3"
},
{
"lessThan": "6.3",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.36",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.7",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "97F8F699-7041-44A4-9087-0E1FFC0543C8",
"versionEndExcluding": "6.6.36",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "0A047AF2-94AC-4A3A-B32D-6AB930D8EF1C",
"versionEndExcluding": "6.9.7",
"versionStartIncluding": "6.7",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncpufreq: amd-pstate: fix memory leak on CPU EPP exit\n\nThe cpudata memory from kzalloc() in amd_pstate_epp_cpu_init() is\nnot freed in the analogous exit function, so fix that.\n\n[ rjw: Subject and changelog edits ]"
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: cpufreq: amd-pstate: corrige la p\u00e9rdida de memoria en la salida del EPP de la CPU La memoria cpudata de kzalloc() en amd_pstate_epp_cpu_init() no se libera en la funci\u00f3n de salida an\u00e1loga, as\u00ed que solucione eso. [rjw: ediciones de asunto y registro de cambios]"
}
],
"id": "CVE-2024-40997",
"lastModified": "2026-06-17T07:47:02.927",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-40997",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T17:01:28.872143Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-07-12T13:15:20.800",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/8015c17fe11a8608cc3eb83d0ab831e1845a9582"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/cea04f3d9aeebda9d9c063c0dfa71e739c322c81"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/8015c17fe11a8608cc3eb83d0ab831e1845a9582"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Patch"
],
"url": "https://git.kernel.org/stable/c/cea04f3d9aeebda9d9c063c0dfa71e739c322c81"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-401"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-4P9W-PPGQ-RM99
Vulnerability from github – Published: 2024-07-12 15:31 – Updated: 2024-08-21 18:31In the Linux kernel, the following vulnerability has been resolved:
cpufreq: amd-pstate: fix memory leak on CPU EPP exit
The cpudata memory from kzalloc() in amd_pstate_epp_cpu_init() is not freed in the analogous exit function, so fix that.
[ rjw: Subject and changelog edits ]
{
"affected": [],
"aliases": [
"CVE-2024-40997"
],
"database_specific": {
"cwe_ids": [
"CWE-401"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-07-12T13:15:20Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\ncpufreq: amd-pstate: fix memory leak on CPU EPP exit\n\nThe cpudata memory from kzalloc() in amd_pstate_epp_cpu_init() is\nnot freed in the analogous exit function, so fix that.\n\n[ rjw: Subject and changelog edits ]",
"id": "GHSA-4p9w-ppgq-rm99",
"modified": "2024-08-21T18:31:26Z",
"published": "2024-07-12T15:31:29Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40997"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/448efb7ea0bfa2c4e27c5a2eb5684fd225cd12cd"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/8015c17fe11a8608cc3eb83d0ab831e1845a9582"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/cea04f3d9aeebda9d9c063c0dfa71e739c322c81"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
MSRC_CVE-2024-40997
Vulnerability from csaf_microsoft - Published: 2024-07-01 07:00 - Updated: 2026-03-31 14:50OESA-2024-1863 (CVE-2024-36017)
Vulnerability from osv_openeuler – Published: 2024-07-19 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
rtnetlink: Correct nested IFLA_VF_VLAN_LIST attribute validation
Each attribute inside a nested IFLA_VF_VLAN_LIST is assumed to be a struct ifla_vf_vlan_info so the size of such attribute needs to be at least of sizeof(struct ifla_vf_vlan_info) which is 14 bytes. The current size validation in do_setvfinfo is against NLA_HDRLEN (4 bytes) which is less than sizeof(struct ifla_vf_vlan_info) so this validation is not enough and a too small attribute might be cast to a struct ifla_vf_vlan_info, this might result in an out of bands read access when accessing the saved (casted) entry in ivvl.(CVE-2024-36017)
In the Linux kernel, the following vulnerability has been resolved:
null_blk: fix null-ptr-dereference while configuring 'power' and 'submit_queues'
Writing 'power' and 'submit_queues' concurrently will trigger kernel panic:
Test script:
modprobe null_blk nr_devices=0 mkdir -p /sys/kernel/config/nullb/nullb0 while true; do echo 1 > submit_queues; echo 4 > submit_queues; done & while true; do echo 1 > power; echo 0 > power; done
Test result:
BUG: kernel NULL pointer dereference, address: 0000000000000148 Oops: 0000 [#1] PREEMPT SMP RIP: 0010:__lock_acquire+0x41d/0x28f0 Call Trace: <TASK> lock_acquire+0x121/0x450 down_write+0x5f/0x1d0 simple_recursive_removal+0x12f/0x5c0 blk_mq_debugfs_unregister_hctxs+0x7c/0x100 blk_mq_update_nr_hw_queues+0x4a3/0x720 nullb_update_nr_hw_queues+0x71/0xf0 [null_blk] nullb_device_submit_queues_store+0x79/0xf0 [null_blk] configfs_write_iter+0x119/0x1e0 vfs_write+0x326/0x730 ksys_write+0x74/0x150
This is because del_gendisk() can concurrent with blk_mq_update_nr_hw_queues():
nullb_device_power_store nullb_apply_submit_queues null_del_dev del_gendisk nullb_update_nr_hw_queues if (!dev->nullb) // still set while gendisk is deleted return 0 blk_mq_update_nr_hw_queues dev->nullb = NULL
Fix this problem by resuing the global mutex to protect nullb_device_power_store() and nullb_update_nr_hw_queues() from configfs.(CVE-2024-36478)
In the Linux kernel, the following vulnerability has been resolved:
tracing/probes: fix error check in parse_btf_field()
btf_find_struct_member() might return NULL or an error via the ERR_PTR() macro. However, its caller in parse_btf_field() only checks for the NULL condition. Fix this by using IS_ERR() and returning the error up the stack.(CVE-2024-36481)
In the Linux kernel, the following vulnerability has been resolved:
scsi: lpfc: Release hbalock before calling lpfc_worker_wake_up()
lpfc_worker_wake_up() calls the lpfc_work_done() routine, which takes the hbalock. Thus, lpfc_worker_wake_up() should not be called while holding the hbalock to avoid potential deadlock.(CVE-2024-36924)
In the Linux kernel, the following vulnerability has been resolved:
net: core: reject skb_copy(_expand) for fraglist GSO skbs
SKB_GSO_FRAGLIST skbs must not be linearized, otherwise they become invalid. Return NULL if such an skb is passed to skb_copy or skb_copy_expand, in order to prevent a crash on a potential later call to skb_gso_segment.(CVE-2024-36929)
In the Linux kernel, the following vulnerability has been resolved:
s390/cio: Ensure the copied buf is NUL terminated
Currently, we allocate a lbuf-sized kernel buffer and copy lbuf from userspace to that buffer. Later, we use scanf on this buffer but we don't ensure that the string is terminated inside the buffer, this can lead to OOB read when using scanf. Fix this issue by using memdup_user_nul instead.(CVE-2024-36931)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdkfd: range check cp bad op exception interrupts
Due to a CP interrupt bug, bad packet garbage exception codes are raised. Do a range check so that the debugger and runtime do not receive garbage codes. Update the user api to guard exception code type checking as well.(CVE-2024-36951)
In the Linux kernel, the following vulnerability has been resolved:
blk-cgroup: fix list corruption from reorder of WRITE ->lqueued
__blkcg_rstat_flush() can be run anytime, especially when blk_cgroup_bio_start is being executed.
If WRITE of ->lqueued is re-ordered with READ of 'bisc->lnode.next' in
the loop of __blkcg_rstat_flush(), next_bisc can be assigned with one
stat instance being added in blk_cgroup_bio_start(), then the local
list in __blkcg_rstat_flush() could be corrupted.
Fix the issue by adding one barrier.(CVE-2024-38384)
In the Linux kernel, the following vulnerability has been resolved:
net: openvswitch: fix overwriting ct original tuple for ICMPv6
OVS_PACKET_CMD_EXECUTE has 3 main attributes: - OVS_PACKET_ATTR_KEY - Packet metadata in a netlink format. - OVS_PACKET_ATTR_PACKET - Binary packet content. - OVS_PACKET_ATTR_ACTIONS - Actions to execute on the packet.
OVS_PACKET_ATTR_KEY is parsed first to populate sw_flow_key structure with the metadata like conntrack state, input port, recirculation id, etc. Then the packet itself gets parsed to populate the rest of the keys from the packet headers.
Whenever the packet parsing code starts parsing the ICMPv6 header, it first zeroes out fields in the key corresponding to Neighbor Discovery information even if it is not an ND packet.
It is an 'ipv6.nd' field. However, the 'ipv6' is a union that shares the space between 'nd' and 'ct_orig' that holds the original tuple conntrack metadata parsed from the OVS_PACKET_ATTR_KEY.
ND packets should not normally have conntrack state, so it's fine to share the space, but normal ICMPv6 Echo packets or maybe other types of ICMPv6 can have the state attached and it should not be overwritten.
The issue results in all but the last 4 bytes of the destination address being wiped from the original conntrack tuple leading to incorrect packet matching and potentially executing wrong actions in case this packet recirculates within the datapath or goes back to userspace.
ND fields should not be accessed in non-ND packets, so not clearing them should be fine. Executing memset() only for actual ND packets to avoid the issue.
Initializing the whole thing before parsing is needed because ND packet may not contain all the options.
The issue only affects the OVS_PACKET_CMD_EXECUTE path and doesn't affect packets entering OVS datapath from network interfaces, because in this case CT metadata is populated from skb after the packet is already parsed.(CVE-2024-38558)
In the Linux kernel, the following vulnerability has been resolved:
gfs2: Fix potential glock use-after-free on unmount
When a DLM lockspace is released and there ares still locks in that lockspace, DLM will unlock those locks automatically. Commit fb6791d100d1b started exploiting this behavior to speed up filesystem unmount: gfs2 would simply free glocks it didn't want to unlock and then release the lockspace. This didn't take the bast callbacks for asynchronous lock contention notifications into account, which remain active until until a lock is unlocked or its lockspace is released.
To prevent those callbacks from accessing deallocated objects, put the glocks that should not be unlocked on the sd_dead_glocks list, release the lockspace, and only then free those glocks.
As an additional measure, ignore unexpected ast and bast callbacks if the receiving glock is dead.(CVE-2024-38570)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu/mes: fix use-after-free issue
Delete fence fallback timer to fix the ramdom use-after-free issue.
v2: move to amdgpu_mes.c(CVE-2024-38581)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: fix use-after-free of timer for log writer thread
Patch series "nilfs2: fix log writer related issues".
This bug fix series covers three nilfs2 log writer-related issues, including a timer use-after-free issue and potential deadlock issue on unmount, and a potential freeze issue in event synchronization found during their analysis. Details are described in each commit log.
This patch (of 3):
A use-after-free issue has been reported regarding the timer sc_timer on the nilfs_sc_info structure.
The problem is that even though it is used to wake up a sleeping log writer thread, sc_timer is not shut down until the nilfs_sc_info structure is about to be freed, and is used regardless of the thread's lifetime.
Fix this issue by limiting the use of sc_timer only while the log writer thread is alive.(CVE-2024-38583)
In the Linux kernel, the following vulnerability has been resolved:
r8169: Fix possible ring buffer corruption on fragmented Tx packets.
An issue was found on the RTL8125b when transmitting small fragmented packets, whereby invalid entries were inserted into the transmit ring buffer, subsequently leading to calls to dma_unmap_single() with a null address.
This was caused by rtl8169_start_xmit() not noticing changes to nr_frags which may occur when small packets are padded (to work around hardware quirks) in rtl8169_tso_csum_v2().
To fix this, postpone inspecting nr_frags until after any padding has been applied.(CVE-2024-38586)
In the Linux kernel, the following vulnerability has been resolved:
openrisc: traps: Don't send signals to kernel mode threads
OpenRISC exception handling sends signals to user processes on floating point exceptions and trap instructions (for debugging) among others. There is a bug where the trap handling logic may send signals to kernel threads, we should not send these signals to kernel threads, if that happens we treat it as an error.
This patch adds conditions to die if the kernel receives these exceptions in kernel mode code.(CVE-2024-38614)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: HCI: Remove HCI_AMP support
Since BT_HS has been remove HCI_AMP controllers no longer has any use so remove it along with the capability of creating AMP controllers.
Since we no longer need to differentiate between AMP and Primary controllers, as only HCI_PRIMARY is left, this also remove hdev->dev_type altogether.(CVE-2024-38620)
In the Linux kernel, the following vulnerability has been resolved:
vfio/pci: fix potential memory leak in vfio_intx_enable()
If vfio_irq_ctx_alloc() failed will lead to 'name' memory leak.(CVE-2024-38632)
In the Linux kernel, the following vulnerability has been resolved:
s390/ap: Fix crash in AP internal function modify_bitmap()
A system crash like this
Failing address: 200000cb7df6f000 TEID: 200000cb7df6f403 Fault in home space mode while using kernel ASCE. AS:00000002d71bc007 R3:00000003fe5b8007 S:000000011a446000 P:000000015660c13d Oops: 0038 ilc:3 [#1] PREEMPT SMP Modules linked in: mlx5_ib ... CPU: 8 PID: 7556 Comm: bash Not tainted 6.9.0-rc7 #8 Hardware name: IBM 3931 A01 704 (LPAR) Krnl PSW : 0704e00180000000 0000014b75e7b606 (ap_parse_bitmap_str+0x10e/0x1f8) R:0 T:1 IO:1 EX:1 Key:0 M:1 W:0 P:0 AS:3 CC:2 PM:0 RI:0 EA:3 Krnl GPRS: 0000000000000001 ffffffffffffffc0 0000000000000001 00000048f96b75d3 000000cb00000100 ffffffffffffffff ffffffffffffffff 000000cb7df6fce0 000000cb7df6fce0 00000000ffffffff 000000000000002b 00000048ffffffff 000003ff9b2dbc80 200000cb7df6fcd8 0000014bffffffc0 000000cb7df6fbc8 Krnl Code: 0000014b75e7b5fc: a7840047 brc 8,0000014b75e7b68a 0000014b75e7b600: 18b2 lr %r11,%r2 #0000014b75e7b602: a7f4000a brc 15,0000014b75e7b616 >0000014b75e7b606: eb22d00000e6 laog %r2,%r2,0(%r13) 0000014b75e7b60c: a7680001 lhi %r6,1 0000014b75e7b610: 187b lr %r7,%r11 0000014b75e7b612: 84960021 brxh %r9,%r6,0000014b75e7b654 0000014b75e7b616: 18e9 lr %r14,%r9 Call Trace: [<0000014b75e7b606>] ap_parse_bitmap_str+0x10e/0x1f8 ([<0000014b75e7b5dc>] ap_parse_bitmap_str+0xe4/0x1f8) [<0000014b75e7b758>] apmask_store+0x68/0x140 [<0000014b75679196>] kernfs_fop_write_iter+0x14e/0x1e8 [<0000014b75598524>] vfs_write+0x1b4/0x448 [<0000014b7559894c>] ksys_write+0x74/0x100 [<0000014b7618a440>] __do_syscall+0x268/0x328 [<0000014b761a3558>] system_call+0x70/0x98 INFO: lockdep is turned off. Last Breaking-Event-Address: [<0000014b75e7b636>] ap_parse_bitmap_str+0x13e/0x1f8 Kernel panic - not syncing: Fatal exception: panic_on_oops
occured when /sys/bus/ap/a[pq]mask was updated with a relative mask value (like +0x10-0x12,+60,-90) with one of the numeric values exceeding INT_MAX.
The fix is simple: use unsigned long values for the internal variables. The correct checks are already in place in the function but a simple int for the internal variables was used with the possibility to overflow.(CVE-2024-38661)
In the Linux kernel, the following vulnerability has been resolved:
clk: bcm: dvp: Assign ->num before accessing ->hws
Commit f316cdff8d67 ("clk: Annotate struct clk_hw_onecell_data with __counted_by") annotated the hws member of 'struct clk_hw_onecell_data' with __counted_by, which informs the bounds sanitizer about the number of elements in hws, so that it can warn when hws is accessed out of bounds. As noted in that change, the __counted_by member must be initialized with the number of elements before the first array access happens, otherwise there will be a warning from each access prior to the initialization because the number of elements is zero. This occurs in clk_dvp_probe() due to ->num being assigned after ->hws has been accessed:
UBSAN: array-index-out-of-bounds in drivers/clk/bcm/clk-bcm2711-dvp.c:59:2 index 0 is out of range for type 'struct clk_hw [] __counted_by(num)' (aka 'struct clk_hw []')
Move the ->num initialization to before the first access of ->hws, which clears up the warning.(CVE-2024-39462)
In the Linux kernel, the following vulnerability has been resolved:
media: v4l: async: Fix notifier list entry init
struct v4l2_async_notifier has several list_head members, but only waiting_list and done_list are initialized. notifier_entry was kept 'zeroed' leading to an uninitialized list_head. This results in a NULL-pointer dereference if csi2_async_register() fails, e.g. node for remote endpoint is disabled, and returns -ENOTCONN. The following calls to v4l2_async_nf_unregister() results in a NULL pointer dereference. Add the missing list head initializer.(CVE-2024-39464)
In the Linux kernel, the following vulnerability has been resolved:
crypto: starfive - Do not free stack buffer
RSA text data uses variable length buffer allocated in software stack. Calling kfree on it causes undefined behaviour in subsequent operations.(CVE-2024-39478)
In the Linux kernel, the following vulnerability has been resolved:
drm/i915/hwmon: Get rid of devm
When both hwmon and hwmon drvdata (on which hwmon depends) are device managed resources, the expectation, on device unbind, is that hwmon will be released before drvdata. However, in i915 there are two separate code paths, which both release either drvdata or hwmon and either can be released before the other. These code paths (for device unbind) are as follows (see also the bug referenced below):
Call Trace: release_nodes+0x11/0x70 devres_release_group+0xb2/0x110 component_unbind_all+0x8d/0xa0 component_del+0xa5/0x140 intel_pxp_tee_component_fini+0x29/0x40 [i915] intel_pxp_fini+0x33/0x80 [i915] i915_driver_remove+0x4c/0x120 [i915] i915_pci_remove+0x19/0x30 [i915] pci_device_remove+0x32/0xa0 device_release_driver_internal+0x19c/0x200 unbind_store+0x9c/0xb0
and
Call Trace: release_nodes+0x11/0x70 devres_release_all+0x8a/0xc0 device_unbind_cleanup+0x9/0x70 device_release_driver_internal+0x1c1/0x200 unbind_store+0x9c/0xb0
This means that in i915, if use devm, we cannot gurantee that hwmon will always be released before drvdata. Which means that we have a uaf if hwmon sysfs is accessed when drvdata has been released but hwmon hasn't.
The only way out of this seems to be do get rid of devm_ and release/free everything explicitly during device unbind.
v2: Change commit message and other minor code changes v3: Cleanup from i915_hwmon_register on error (Armin Wolf) v4: Eliminate potential static analyzer warning (Rodrigo) Eliminate fetch_and_zero (Jani) v5: Restore previous logic for ddat_gt->hwmon_dev error return (Andi)(CVE-2024-39479)
In the Linux kernel, the following vulnerability has been resolved:
kdb: Fix buffer overflow during tab-complete
Currently, when the user attempts symbol completion with the Tab key, kdb will use strncpy() to insert the completed symbol into the command buffer. Unfortunately it passes the size of the source buffer rather than the destination to strncpy() with predictably horrible results. Most obviously if the command buffer is already full but cp, the cursor position, is in the middle of the buffer, then we will write past the end of the supplied buffer.
Fix this by replacing the dubious strncpy() calls with memmove()/memcpy() calls plus explicit boundary checks to make sure we have enough space before we start moving characters around.(CVE-2024-39480)
In the Linux kernel, the following vulnerability has been resolved:
bonding: Fix out-of-bounds read in bond_option_arp_ip_targets_set()
In function bond_option_arp_ip_targets_set(), if newval->string is an empty string, newval->string+1 will point to the byte after the string, causing an out-of-bound read.
BUG: KASAN: slab-out-of-bounds in strlen+0x7d/0xa0 lib/string.c:418 Read of size 1 at addr ffff8881119c4781 by task syz-executor665/8107 CPU: 1 PID: 8107 Comm: syz-executor665 Not tainted 6.7.0-rc7 #1 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014 Call Trace: <TASK> __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0xd9/0x150 lib/dump_stack.c:106 print_address_description mm/kasan/report.c:364 [inline] print_report+0xc1/0x5e0 mm/kasan/report.c:475 kasan_report+0xbe/0xf0 mm/kasan/report.c:588 strlen+0x7d/0xa0 lib/string.c:418 __fortify_strlen include/linux/fortify-string.h:210 [inline] in4_pton+0xa3/0x3f0 net/core/utils.c:130 bond_option_arp_ip_targets_set+0xc2/0x910 drivers/net/bonding/bond_options.c:1201 __bond_opt_set+0x2a4/0x1030 drivers/net/bonding/bond_options.c:767 __bond_opt_set_notify+0x48/0x150 drivers/net/bonding/bond_options.c:792 bond_opt_tryset_rtnl+0xda/0x160 drivers/net/bonding/bond_options.c:817 bonding_sysfs_store_option+0xa1/0x120 drivers/net/bonding/bond_sysfs.c:156 dev_attr_store+0x54/0x80 drivers/base/core.c:2366 sysfs_kf_write+0x114/0x170 fs/sysfs/file.c:136 kernfs_fop_write_iter+0x337/0x500 fs/kernfs/file.c:334 call_write_iter include/linux/fs.h:2020 [inline] new_sync_write fs/read_write.c:491 [inline] vfs_write+0x96a/0xd80 fs/read_write.c:584 ksys_write+0x122/0x250 fs/read_write.c:637 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0x40/0x110 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x63/0x6b ---[ end trace ]---
Fix it by adding a check of string length before using it.(CVE-2024-39487)
In the Linux kernel, the following vulnerability has been resolved:
arm64: asm-bug: Add .align 2 to the end of __BUG_ENTRY
When CONFIG_DEBUG_BUGVERBOSE=n, we fail to add necessary padding bytes to bug_table entries, and as a result the last entry in a bug table will be ignored, potentially leading to an unexpected panic(). All prior entries in the table will be handled correctly.
The arm64 ABI requires that struct fields of up to 8 bytes are naturally-aligned, with padding added within a struct such that struct are suitably aligned within arrays.
When CONFIG_DEBUG_BUGVERPOSE=y, the layout of a bug_entry is:
struct bug_entry {
signed int bug_addr_disp; // 4 bytes
signed int file_disp; // 4 bytes
unsigned short line; // 2 bytes
unsigned short flags; // 2 bytes
}
... with 12 bytes total, requiring 4-byte alignment.
When CONFIG_DEBUG_BUGVERBOSE=n, the layout of a bug_entry is:
struct bug_entry {
signed int bug_addr_disp; // 4 bytes
unsigned short flags; // 2 bytes
< implicit padding > // 2 bytes
}
... with 8 bytes total, with 6 bytes of data and 2 bytes of trailing padding, requiring 4-byte alginment.
When we create a bug_entry in assembly, we align the start of the entry to 4 bytes, which implicitly handles padding for any prior entries. However, we do not align the end of the entry, and so when CONFIG_DEBUG_BUGVERBOSE=n, the final entry lacks the trailing padding bytes.
For the main kernel image this is not a problem as find_bug() doesn't depend on the trailing padding bytes when searching for entries:
for (bug = __start___bug_table; bug < __stop___bug_table; ++bug)
if (bugaddr == bug_addr(bug))
return bug;
However for modules, module_bug_finalize() depends on the trailing bytes when calculating the number of entries:
mod->num_bugs = sechdrs[i].sh_size / sizeof(struct bug_entry);
... and as the last bug_entry lacks the necessary padding bytes, this entry will not be counted, e.g. in the case of a single entry:
sechdrs[i].sh_size == 6
sizeof(struct bug_entry) == 8;
sechdrs[i].sh_size / sizeof(struct bug_entry) == 0;
Consequently module_find_bug() will miss the last bug_entry when it does:
for (i = 0; i < mod->num_bugs; ++i, ++bug)
if (bugaddr == bug_addr(bug))
goto out;
... which can lead to a kenrel panic due to an unhandled bug.
This can be demonstrated with the following module:
static int __init buginit(void)
{
WARN(1, "hello\n");
return 0;
}
static void __exit bugexit(void)
{
}
module_init(buginit);
module_exit(bugexit);
MODULE_LICENSE("GPL");
... which will trigger a kernel panic when loaded:
------------[ cut here ]------------
hello
Unexpected kernel BRK exception at EL1
Internal error: BRK handler: 00000000f2000800 [#1] PREEMPT SMP
Modules linked in: hello(O+)
CPU: 0 PID: 50 Comm: insmod Tainted: G O 6.9.1 #8
Hardware name: linux,dummy-virt (DT)
pstate: 60400005 (nZCv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--)
pc : buginit+0x18/0x1000 [hello]
lr : buginit+0x18/0x1000 [hello]
sp : ffff800080533ae0
x29: ffff800080533ae0 x28: 0000000000000000 x27: 0000000000000000
x26: ffffaba8c4e70510 x25: ffff800080533c30 x24: ffffaba8c4a28a58
x23: 0000000000000000 x22: 0000000000000000 x21: ffff3947c0eab3c0
x20: ffffaba8c4e3f000 x19: ffffaba846464000 x18: 0000000000000006
x17: 0000000000000000 x16: ffffaba8c2492834 x15: 0720072007200720
x14: 0720072007200720 x13: ffffaba8c49b27c8 x12: 0000000000000312
x11: 0000000000000106 x10: ffffaba8c4a0a7c8 x9 : ffffaba8c49b27c8
x8 : 00000000ffffefff x7 : ffffaba8c4a0a7c8 x6 : 80000000fffff000
x5 : 0000000000000107 x4 : 0000000000000000 x3 : 0000000000000000
x2 : 0000000000000000 x1 : 0000000000000000 x0 : ffff3947c0eab3c0
Call trace:
buginit+0x18/0x1000 [hello]
do_one_initcall+0x80/0x1c8
do_init_module+0x60/0x218
load_module+0x1ba4/0x1d70
__do_sys_init_module+0x198/0x1d0
__arm64_sys_init_module+0x1c/0x28
invoke_syscall+0x48/0x114
el0_svc
---truncated---(CVE-2024-39488)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: sr: fix memleak in seg6_hmac_init_algo
seg6_hmac_init_algo returns without cleaning up the previous allocations if one fails, so it's going to leak all that memory and the crypto tfms.
Update seg6_hmac_exit to only free the memory when allocated, so we can reuse the code directly.(CVE-2024-39489)
In the Linux kernel, the following vulnerability has been resolved:
sock_map: avoid race between sock_map_close and sk_psock_put
sk_psock_get will return NULL if the refcount of psock has gone to 0, which will happen when the last call of sk_psock_put is done. However, sk_psock_drop may not have finished yet, so the close callback will still point to sock_map_close despite psock being NULL.
This can be reproduced with a thread deleting an element from the sock map, while the second one creates a socket, adds it to the map and closes it.
That will trigger the WARN_ON_ONCE:
------------[ cut here ]------------ WARNING: CPU: 1 PID: 7220 at net/core/sock_map.c:1701 sock_map_close+0x2a2/0x2d0 net/core/sock_map.c:1701 Modules linked in: CPU: 1 PID: 7220 Comm: syz-executor380 Not tainted 6.9.0-syzkaller-07726-g3c999d1ae3c7 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024 RIP: 0010:sock_map_close+0x2a2/0x2d0 net/core/sock_map.c:1701 Code: df e8 92 29 88 f8 48 8b 1b 48 89 d8 48 c1 e8 03 42 80 3c 20 00 74 08 48 89 df e8 79 29 88 f8 4c 8b 23 eb 89 e8 4f 15 23 f8 90 <0f> 0b 90 48 83 c4 08 5b 41 5c 41 5d 41 5e 41 5f 5d e9 13 26 3d 02 RSP: 0018:ffffc9000441fda8 EFLAGS: 00010293 RAX: ffffffff89731ae1 RBX: ffffffff94b87540 RCX: ffff888029470000 RDX: 0000000000000000 RSI: ffffffff8bcab5c0 RDI: ffffffff8c1faba0 RBP: 0000000000000000 R08: ffffffff92f9b61f R09: 1ffffffff25f36c3 R10: dffffc0000000000 R11: fffffbfff25f36c4 R12: ffffffff89731840 R13: ffff88804b587000 R14: ffff88804b587000 R15: ffffffff89731870 FS: 000055555e080380(0000) GS:ffff8880b9500000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000000000000000 CR3: 00000000207d4000 CR4: 0000000000350ef0 Call Trace: <TASK> unix_release+0x87/0xc0 net/unix/af_unix.c:1048 __sock_release net/socket.c:659 [inline] sock_close+0xbe/0x240 net/socket.c:1421 __fput+0x42b/0x8a0 fs/file_table.c:422 __do_sys_close fs/open.c:1556 [inline] __se_sys_close fs/open.c:1541 [inline] __x64_sys_close+0x7f/0x110 fs/open.c:1541 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xf5/0x240 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f RIP: 0033:0x7fb37d618070 Code: 00 00 48 c7 c2 b8 ff ff ff f7 d8 64 89 02 b8 ff ff ff ff eb d4 e8 10 2c 00 00 80 3d 31 f0 07 00 00 74 17 b8 03 00 00 00 0f 05 <48> 3d 00 f0 ff ff 77 48 c3 0f 1f 80 00 00 00 00 48 83 ec 18 89 7c RSP: 002b:00007ffcd4a525d8 EFLAGS: 00000202 ORIG_RAX: 0000000000000003 RAX: ffffffffffffffda RBX: 0000000000000005 RCX: 00007fb37d618070 RDX: 0000000000000010 RSI: 00000000200001c0 RDI: 0000000000000004 RBP: 0000000000000000 R08: 0000000100000000 R09: 0000000100000000 R10: 0000000000000000 R11: 0000000000000202 R12: 0000000000000000 R13: 0000000000000000 R14: 0000000000000000 R15: 0000000000000000 </TASK>
Use sk_psock, which will only check that the pointer is not been set to NULL yet, which should only happen after the callbacks are restored. If, then, a reference can still be gotten, we may call sk_psock_stop and cancel psock->work.
As suggested by Paolo Abeni, reorder the condition so the control flow is less convoluted.
After that change, the reproducer does not trigger the WARN_ON_ONCE anymore.(CVE-2024-39500)
In the Linux kernel, the following vulnerability has been resolved:
ionic: fix use after netif_napi_del()
When queues are started, netif_napi_add() and napi_enable() are called. If there are 4 queues and only 3 queues are used for the current configuration, only 3 queues' napi should be registered and enabled. The ionic_qcq_enable() checks whether the .poll pointer is not NULL for enabling only the using queue' napi. Unused queues' napi will not be registered by netif_napi_add(), so the .poll pointer indicates NULL. But it couldn't distinguish whether the napi was unregistered or not because netif_napi_del() doesn't reset the .poll pointer to NULL. So, ionic_qcq_enable() calls napi_enable() for the queue, which was unregistered by netif_napi_del().
Reproducer: ethtool -L <interface name> rx 1 tx 1 combined 0 ethtool -L <interface name> rx 0 tx 0 combined 1 ethtool -L <interface name> rx 0 tx 0 combined 4
Splat looks like: kernel BUG at net/core/dev.c:6666! Oops: invalid opcode: 0000 [#1] PREEMPT SMP NOPTI CPU: 3 PID: 1057 Comm: kworker/3:3 Not tainted 6.10.0-rc2+ #16 Workqueue: events ionic_lif_deferred_work [ionic] RIP: 0010:napi_enable+0x3b/0x40 Code: 48 89 c2 48 83 e2 f6 80 b9 61 09 00 00 00 74 0d 48 83 bf 60 01 00 00 00 74 03 80 ce 01 f0 4f RSP: 0018:ffffb6ed83227d48 EFLAGS: 00010246 RAX: 0000000000000000 RBX: ffff97560cda0828 RCX: 0000000000000029 RDX: 0000000000000001 RSI: 0000000000000000 RDI: ffff97560cda0a28 RBP: ffffb6ed83227d50 R08: 0000000000000400 R09: 0000000000000001 R10: 0000000000000001 R11: 0000000000000001 R12: 0000000000000000 R13: ffff97560ce3c1a0 R14: 0000000000000000 R15: ffff975613ba0a20 FS: 0000000000000000(0000) GS:ffff975d5f780000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007f8f734ee200 CR3: 0000000103e50000 CR4: 00000000007506f0 PKRU: 55555554 Call Trace: <TASK> ? die+0x33/0x90 ? do_trap+0xd9/0x100 ? napi_enable+0x3b/0x40 ? do_error_trap+0x83/0xb0 ? napi_enable+0x3b/0x40 ? napi_enable+0x3b/0x40 ? exc_invalid_op+0x4e/0x70 ? napi_enable+0x3b/0x40 ? asm_exc_invalid_op+0x16/0x20 ? napi_enable+0x3b/0x40 ionic_qcq_enable+0xb7/0x180 [ionic 59bdfc8a035436e1c4224ff7d10789e3f14643f8] ionic_start_queues+0xc4/0x290 [ionic 59bdfc8a035436e1c4224ff7d10789e3f14643f8] ionic_link_status_check+0x11c/0x170 [ionic 59bdfc8a035436e1c4224ff7d10789e3f14643f8] ionic_lif_deferred_work+0x129/0x280 [ionic 59bdfc8a035436e1c4224ff7d10789e3f14643f8] process_one_work+0x145/0x360 worker_thread+0x2bb/0x3d0 ? __pfx_worker_thread+0x10/0x10 kthread+0xcc/0x100 ? __pfx_kthread+0x10/0x10 ret_from_fork+0x2d/0x50 ? __pfx_kthread+0x10/0x10 ret_from_fork_asm+0x1a/0x30(CVE-2024-39502)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: fix possible race in __fib6_drop_pcpu_from()
syzbot found a race in __fib6_drop_pcpu_from() [1]
If compiler reads more than once (*ppcpu_rt), second read could read NULL, if another cpu clears the value in rt6_get_pcpu_route().
Add a READ_ONCE() to prevent this race.
Also add rcu_read_lock()/rcu_read_unlock() because we rely on RCU protection while dereferencing pcpu_rt.
[1]
Oops: general protection fault, probably for non-canonical address 0xdffffc0000000012: 0000 [#1] PREEMPT SMP KASAN PTI KASAN: null-ptr-deref in range [0x0000000000000090-0x0000000000000097] CPU: 0 PID: 7543 Comm: kworker/u8:17 Not tainted 6.10.0-rc1-syzkaller-00013-g2bfcfd584ff5 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024 Workqueue: netns cleanup_net RIP: 0010:__fib6_drop_pcpu_from.part.0+0x10a/0x370 net/ipv6/ip6_fib.c:984 Code: f8 48 c1 e8 03 80 3c 28 00 0f 85 16 02 00 00 4d 8b 3f 4d 85 ff 74 31 e8 74 a7 fa f7 49 8d bf 90 00 00 00 48 89 f8 48 c1 e8 03 <80> 3c 28 00 0f 85 1e 02 00 00 49 8b 87 90 00 00 00 48 8b 0c 24 48 RSP: 0018:ffffc900040df070 EFLAGS: 00010206 RAX: 0000000000000012 RBX: 0000000000000001 RCX: ffffffff89932e16 RDX: ffff888049dd1e00 RSI: ffffffff89932d7c RDI: 0000000000000091 RBP: dffffc0000000000 R08: 0000000000000005 R09: 0000000000000007 R10: 0000000000000001 R11: 0000000000000006 R12: ffff88807fa080b8 R13: fffffbfff1a9a07d R14: ffffed100ff41022 R15: 0000000000000001 FS: 0000000000000000(0000) GS:ffff8880b9200000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000001b32c26000 CR3: 000000005d56e000 CR4: 00000000003526f0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> __fib6_drop_pcpu_from net/ipv6/ip6_fib.c:966 [inline] fib6_drop_pcpu_from net/ipv6/ip6_fib.c:1027 [inline] fib6_purge_rt+0x7f2/0x9f0 net/ipv6/ip6_fib.c:1038 fib6_del_route net/ipv6/ip6_fib.c:1998 [inline] fib6_del+0xa70/0x17b0 net/ipv6/ip6_fib.c:2043 fib6_clean_node+0x426/0x5b0 net/ipv6/ip6_fib.c:2205 fib6_walk_continue+0x44f/0x8d0 net/ipv6/ip6_fib.c:2127 fib6_walk+0x182/0x370 net/ipv6/ip6_fib.c:2175 fib6_clean_tree+0xd7/0x120 net/ipv6/ip6_fib.c:2255 __fib6_clean_all+0x100/0x2d0 net/ipv6/ip6_fib.c:2271 rt6_sync_down_dev net/ipv6/route.c:4906 [inline] rt6_disable_ip+0x7ed/0xa00 net/ipv6/route.c:4911 addrconf_ifdown.isra.0+0x117/0x1b40 net/ipv6/addrconf.c:3855 addrconf_notify+0x223/0x19e0 net/ipv6/addrconf.c:3778 notifier_call_chain+0xb9/0x410 kernel/notifier.c:93 call_netdevice_notifiers_info+0xbe/0x140 net/core/dev.c:1992 call_netdevice_notifiers_extack net/core/dev.c:2030 [inline] call_netdevice_notifiers net/core/dev.c:2044 [inline] dev_close_many+0x333/0x6a0 net/core/dev.c:1585 unregister_netdevice_many_notify+0x46d/0x19f0 net/core/dev.c:11193 unregister_netdevice_many net/core/dev.c:11276 [inline] default_device_exit_batch+0x85b/0xae0 net/core/dev.c:11759 ops_exit_list+0x128/0x180 net/core/net_namespace.c:178 cleanup_net+0x5b7/0xbf0 net/core/net_namespace.c:640 process_one_work+0x9fb/0x1b60 kernel/workqueue.c:3231 process_scheduled_works kernel/workqueue.c:3312 [inline] worker_thread+0x6c8/0xf70 kernel/workqueue.c:3393 kthread+0x2c1/0x3a0 kernel/kthread.c:389 ret_from_fork+0x45/0x80 arch/x86/kernel/process.c:147 ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:244(CVE-2024-40905)
In the Linux kernel, the following vulnerability has been resolved:
mptcp: ensure snd_una is properly initialized on connect
This is strictly related to commit fb7a0d334894 ("mptcp: ensure snd_nxt is properly initialized on connect"). It turns out that syzkaller can trigger the retransmit after fallback and before processing any other incoming packet - so that snd_una is still left uninitialized.
Address the issue explicitly initializing snd_una together with snd_nxt and write_seq.(CVE-2024-40931)
In the Linux kernel, the following vulnerability has been resolved:
HID: logitech-dj: Fix memory leak in logi_dj_recv_switch_to_dj_mode()
Fix a memory leak on logi_dj_recv_send_report() error path.(CVE-2024-40934)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: hda: cs35l41: Possible null pointer dereference in cs35l41_hda_unbind()
The cs35l41_hda_unbind() function clears the hda_component entry matching it's index and then dereferences the codec pointer held in the first element of the hda_component array, this is an issue when the device index was 0.
Instead use the codec pointer stashed in the cs35l41_hda structure as it will still be valid.(CVE-2024-40964)
In the Linux kernel, the following vulnerability has been resolved:
f2fs: remove clear SB_INLINECRYPT flag in default_options
In f2fs_remount, SB_INLINECRYPT flag will be clear and re-set. If create new file or open file during this gap, these files will not use inlinecrypt. Worse case, it may lead to data corruption if wrappedkey_v0 is enable.
Thread A: Thread B:
-f2fs_remount -f2fs_file_open or f2fs_new_inode -default_options <- clear SB_INLINECRYPT flag
-fscrypt_select_encryption_impl
-parse_options <- set SB_INLINECRYPT again(CVE-2024-40971)
In the Linux kernel, the following vulnerability has been resolved:
cpufreq: amd-pstate: fix memory leak on CPU EPP exit
The cpudata memory from kzalloc() in amd_pstate_epp_cpu_init() is not freed in the analogous exit function, so fix that.
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"bpftool-debuginfo-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"kernel-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"kernel-debuginfo-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"kernel-debugsource-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"kernel-devel-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"kernel-headers-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"kernel-source-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"kernel-tools-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"kernel-tools-debuginfo-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"kernel-tools-devel-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"perf-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"perf-debuginfo-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"python3-perf-6.6.0-34.0.0.41.oe2403.aarch64.rpm",
"python3-perf-debuginfo-6.6.0-34.0.0.41.oe2403.aarch64.rpm"
],
"src": [
"kernel-6.6.0-34.0.0.41.oe2403.src.rpm"
],
"x86_64": [
"bpftool-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"bpftool-debuginfo-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"kernel-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"kernel-debuginfo-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"kernel-debugsource-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"kernel-devel-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"kernel-headers-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"kernel-source-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"kernel-tools-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"kernel-tools-debuginfo-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"kernel-tools-devel-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"perf-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"perf-debuginfo-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"python3-perf-6.6.0-34.0.0.41.oe2403.x86_64.rpm",
"python3-perf-debuginfo-6.6.0-34.0.0.41.oe2403.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:24.03-LTS",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-24.03-LTS"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "6.6.0-34.0.0.41.oe2403"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nrtnetlink: Correct nested IFLA_VF_VLAN_LIST attribute validation\r\n\r\nEach attribute inside a nested IFLA_VF_VLAN_LIST is assumed to be a\nstruct ifla_vf_vlan_info so the size of such attribute needs to be at least\nof sizeof(struct ifla_vf_vlan_info) which is 14 bytes.\nThe current size validation in do_setvfinfo is against NLA_HDRLEN (4 bytes)\nwhich is less than sizeof(struct ifla_vf_vlan_info) so this validation\nis not enough and a too small attribute might be cast to a\nstruct ifla_vf_vlan_info, this might result in an out of bands\nread access when accessing the saved (casted) entry in ivvl.(CVE-2024-36017)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnull_blk: fix null-ptr-dereference while configuring \u0026apos;power\u0026apos; and \u0026apos;submit_queues\u0026apos;\r\n\r\nWriting \u0026apos;power\u0026apos; and \u0026apos;submit_queues\u0026apos; concurrently will trigger kernel\npanic:\r\n\r\nTest script:\r\n\r\nmodprobe null_blk nr_devices=0\nmkdir -p /sys/kernel/config/nullb/nullb0\nwhile true; do echo 1 \u0026gt; submit_queues; echo 4 \u0026gt; submit_queues; done \u0026amp;\nwhile true; do echo 1 \u0026gt; power; echo 0 \u0026gt; power; done\r\n\r\nTest result:\r\n\r\nBUG: kernel NULL pointer dereference, address: 0000000000000148\nOops: 0000 [#1] PREEMPT SMP\nRIP: 0010:__lock_acquire+0x41d/0x28f0\nCall Trace:\n \u0026lt;TASK\u0026gt;\n lock_acquire+0x121/0x450\n down_write+0x5f/0x1d0\n simple_recursive_removal+0x12f/0x5c0\n blk_mq_debugfs_unregister_hctxs+0x7c/0x100\n blk_mq_update_nr_hw_queues+0x4a3/0x720\n nullb_update_nr_hw_queues+0x71/0xf0 [null_blk]\n nullb_device_submit_queues_store+0x79/0xf0 [null_blk]\n configfs_write_iter+0x119/0x1e0\n vfs_write+0x326/0x730\n ksys_write+0x74/0x150\r\n\r\nThis is because del_gendisk() can concurrent with\nblk_mq_update_nr_hw_queues():\r\n\r\nnullb_device_power_store\tnullb_apply_submit_queues\n null_del_dev\n del_gendisk\n\t\t\t\t nullb_update_nr_hw_queues\n\t\t\t\t if (!dev-\u0026gt;nullb)\n\t\t\t\t // still set while gendisk is deleted\n\t\t\t\t return 0\n\t\t\t\t blk_mq_update_nr_hw_queues\n dev-\u0026gt;nullb = NULL\r\n\r\nFix this problem by resuing the global mutex to protect\nnullb_device_power_store() and nullb_update_nr_hw_queues() from configfs.(CVE-2024-36478)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntracing/probes: fix error check in parse_btf_field()\r\n\r\nbtf_find_struct_member() might return NULL or an error via the\nERR_PTR() macro. However, its caller in parse_btf_field() only checks\nfor the NULL condition. Fix this by using IS_ERR() and returning the\nerror up the stack.(CVE-2024-36481)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: lpfc: Release hbalock before calling lpfc_worker_wake_up()\r\n\r\nlpfc_worker_wake_up() calls the lpfc_work_done() routine, which takes the\nhbalock. Thus, lpfc_worker_wake_up() should not be called while holding the\nhbalock to avoid potential deadlock.(CVE-2024-36924)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: core: reject skb_copy(_expand) for fraglist GSO skbs\r\n\r\nSKB_GSO_FRAGLIST skbs must not be linearized, otherwise they become\ninvalid. Return NULL if such an skb is passed to skb_copy or\nskb_copy_expand, in order to prevent a crash on a potential later\ncall to skb_gso_segment.(CVE-2024-36929)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ns390/cio: Ensure the copied buf is NUL terminated\r\n\r\nCurrently, we allocate a lbuf-sized kernel buffer and copy lbuf from\nuserspace to that buffer. Later, we use scanf on this buffer but we don\u0026apos;t\nensure that the string is terminated inside the buffer, this can lead to\nOOB read when using scanf. Fix this issue by using memdup_user_nul instead.(CVE-2024-36931)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdkfd: range check cp bad op exception interrupts\r\n\r\nDue to a CP interrupt bug, bad packet garbage exception codes are raised.\nDo a range check so that the debugger and runtime do not receive garbage\ncodes.\nUpdate the user api to guard exception code type checking as well.(CVE-2024-36951)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nblk-cgroup: fix list corruption from reorder of WRITE -\u0026gt;lqueued\r\n\r\n__blkcg_rstat_flush() can be run anytime, especially when blk_cgroup_bio_start\nis being executed.\r\n\r\nIf WRITE of `-\u0026gt;lqueued` is re-ordered with READ of \u0026apos;bisc-\u0026gt;lnode.next\u0026apos; in\nthe loop of __blkcg_rstat_flush(), `next_bisc` can be assigned with one\nstat instance being added in blk_cgroup_bio_start(), then the local\nlist in __blkcg_rstat_flush() could be corrupted.\r\n\r\nFix the issue by adding one barrier.(CVE-2024-38384)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: openvswitch: fix overwriting ct original tuple for ICMPv6\r\n\r\nOVS_PACKET_CMD_EXECUTE has 3 main attributes:\n - OVS_PACKET_ATTR_KEY - Packet metadata in a netlink format.\n - OVS_PACKET_ATTR_PACKET - Binary packet content.\n - OVS_PACKET_ATTR_ACTIONS - Actions to execute on the packet.\r\n\r\nOVS_PACKET_ATTR_KEY is parsed first to populate sw_flow_key structure\nwith the metadata like conntrack state, input port, recirculation id,\netc. Then the packet itself gets parsed to populate the rest of the\nkeys from the packet headers.\r\n\r\nWhenever the packet parsing code starts parsing the ICMPv6 header, it\nfirst zeroes out fields in the key corresponding to Neighbor Discovery\ninformation even if it is not an ND packet.\r\n\r\nIt is an \u0026apos;ipv6.nd\u0026apos; field. However, the \u0026apos;ipv6\u0026apos; is a union that shares\nthe space between \u0026apos;nd\u0026apos; and \u0026apos;ct_orig\u0026apos; that holds the original tuple\nconntrack metadata parsed from the OVS_PACKET_ATTR_KEY.\r\n\r\nND packets should not normally have conntrack state, so it\u0026apos;s fine to\nshare the space, but normal ICMPv6 Echo packets or maybe other types of\nICMPv6 can have the state attached and it should not be overwritten.\r\n\r\nThe issue results in all but the last 4 bytes of the destination\naddress being wiped from the original conntrack tuple leading to\nincorrect packet matching and potentially executing wrong actions\nin case this packet recirculates within the datapath or goes back\nto userspace.\r\n\r\nND fields should not be accessed in non-ND packets, so not clearing\nthem should be fine. Executing memset() only for actual ND packets to\navoid the issue.\r\n\r\nInitializing the whole thing before parsing is needed because ND packet\nmay not contain all the options.\r\n\r\nThe issue only affects the OVS_PACKET_CMD_EXECUTE path and doesn\u0026apos;t\naffect packets entering OVS datapath from network interfaces, because\nin this case CT metadata is populated from skb after the packet is\nalready parsed.(CVE-2024-38558)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ngfs2: Fix potential glock use-after-free on unmount\r\n\r\nWhen a DLM lockspace is released and there ares still locks in that\nlockspace, DLM will unlock those locks automatically. Commit\nfb6791d100d1b started exploiting this behavior to speed up filesystem\nunmount: gfs2 would simply free glocks it didn\u0026apos;t want to unlock and then\nrelease the lockspace. This didn\u0026apos;t take the bast callbacks for\nasynchronous lock contention notifications into account, which remain\nactive until until a lock is unlocked or its lockspace is released.\r\n\r\nTo prevent those callbacks from accessing deallocated objects, put the\nglocks that should not be unlocked on the sd_dead_glocks list, release\nthe lockspace, and only then free those glocks.\r\n\r\nAs an additional measure, ignore unexpected ast and bast callbacks if\nthe receiving glock is dead.(CVE-2024-38570)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu/mes: fix use-after-free issue\r\n\r\nDelete fence fallback timer to fix the ramdom\nuse-after-free issue.\r\n\r\nv2: move to amdgpu_mes.c(CVE-2024-38581)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: fix use-after-free of timer for log writer thread\r\n\r\nPatch series \u0026quot;nilfs2: fix log writer related issues\u0026quot;.\r\n\r\nThis bug fix series covers three nilfs2 log writer-related issues,\nincluding a timer use-after-free issue and potential deadlock issue on\nunmount, and a potential freeze issue in event synchronization found\nduring their analysis. Details are described in each commit log.\r\n\r\n\nThis patch (of 3):\r\n\r\nA use-after-free issue has been reported regarding the timer sc_timer on\nthe nilfs_sc_info structure.\r\n\r\nThe problem is that even though it is used to wake up a sleeping log\nwriter thread, sc_timer is not shut down until the nilfs_sc_info structure\nis about to be freed, and is used regardless of the thread\u0026apos;s lifetime.\r\n\r\nFix this issue by limiting the use of sc_timer only while the log writer\nthread is alive.(CVE-2024-38583)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nr8169: Fix possible ring buffer corruption on fragmented Tx packets.\r\n\r\nAn issue was found on the RTL8125b when transmitting small fragmented\npackets, whereby invalid entries were inserted into the transmit ring\nbuffer, subsequently leading to calls to dma_unmap_single() with a null\naddress.\r\n\r\nThis was caused by rtl8169_start_xmit() not noticing changes to nr_frags\nwhich may occur when small packets are padded (to work around hardware\nquirks) in rtl8169_tso_csum_v2().\r\n\r\nTo fix this, postpone inspecting nr_frags until after any padding has been\napplied.(CVE-2024-38586)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nopenrisc: traps: Don\u0026apos;t send signals to kernel mode threads\r\n\r\nOpenRISC exception handling sends signals to user processes on floating\npoint exceptions and trap instructions (for debugging) among others.\nThere is a bug where the trap handling logic may send signals to kernel\nthreads, we should not send these signals to kernel threads, if that\nhappens we treat it as an error.\r\n\r\nThis patch adds conditions to die if the kernel receives these\nexceptions in kernel mode code.(CVE-2024-38614)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: HCI: Remove HCI_AMP support\r\n\r\nSince BT_HS has been remove HCI_AMP controllers no longer has any use so\nremove it along with the capability of creating AMP controllers.\r\n\r\nSince we no longer need to differentiate between AMP and Primary\ncontrollers, as only HCI_PRIMARY is left, this also remove\nhdev-\u0026gt;dev_type altogether.(CVE-2024-38620)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nvfio/pci: fix potential memory leak in vfio_intx_enable()\r\n\r\nIf vfio_irq_ctx_alloc() failed will lead to \u0026apos;name\u0026apos; memory leak.(CVE-2024-38632)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ns390/ap: Fix crash in AP internal function modify_bitmap()\r\n\r\nA system crash like this\r\n\r\n Failing address: 200000cb7df6f000 TEID: 200000cb7df6f403\n Fault in home space mode while using kernel ASCE.\n AS:00000002d71bc007 R3:00000003fe5b8007 S:000000011a446000 P:000000015660c13d\n Oops: 0038 ilc:3 [#1] PREEMPT SMP\n Modules linked in: mlx5_ib ...\n CPU: 8 PID: 7556 Comm: bash Not tainted 6.9.0-rc7 #8\n Hardware name: IBM 3931 A01 704 (LPAR)\n Krnl PSW : 0704e00180000000 0000014b75e7b606 (ap_parse_bitmap_str+0x10e/0x1f8)\n R:0 T:1 IO:1 EX:1 Key:0 M:1 W:0 P:0 AS:3 CC:2 PM:0 RI:0 EA:3\n Krnl GPRS: 0000000000000001 ffffffffffffffc0 0000000000000001 00000048f96b75d3\n 000000cb00000100 ffffffffffffffff ffffffffffffffff 000000cb7df6fce0\n 000000cb7df6fce0 00000000ffffffff 000000000000002b 00000048ffffffff\n 000003ff9b2dbc80 200000cb7df6fcd8 0000014bffffffc0 000000cb7df6fbc8\n Krnl Code: 0000014b75e7b5fc: a7840047 brc 8,0000014b75e7b68a\n 0000014b75e7b600: 18b2 lr %r11,%r2\n #0000014b75e7b602: a7f4000a brc 15,0000014b75e7b616\n \u0026gt;0000014b75e7b606: eb22d00000e6 laog %r2,%r2,0(%r13)\n 0000014b75e7b60c: a7680001 lhi %r6,1\n 0000014b75e7b610: 187b lr %r7,%r11\n 0000014b75e7b612: 84960021 brxh %r9,%r6,0000014b75e7b654\n 0000014b75e7b616: 18e9 lr %r14,%r9\n Call Trace:\n [\u0026lt;0000014b75e7b606\u0026gt;] ap_parse_bitmap_str+0x10e/0x1f8\n ([\u0026lt;0000014b75e7b5dc\u0026gt;] ap_parse_bitmap_str+0xe4/0x1f8)\n [\u0026lt;0000014b75e7b758\u0026gt;] apmask_store+0x68/0x140\n [\u0026lt;0000014b75679196\u0026gt;] kernfs_fop_write_iter+0x14e/0x1e8\n [\u0026lt;0000014b75598524\u0026gt;] vfs_write+0x1b4/0x448\n [\u0026lt;0000014b7559894c\u0026gt;] ksys_write+0x74/0x100\n [\u0026lt;0000014b7618a440\u0026gt;] __do_syscall+0x268/0x328\n [\u0026lt;0000014b761a3558\u0026gt;] system_call+0x70/0x98\n INFO: lockdep is turned off.\n Last Breaking-Event-Address:\n [\u0026lt;0000014b75e7b636\u0026gt;] ap_parse_bitmap_str+0x13e/0x1f8\n Kernel panic - not syncing: Fatal exception: panic_on_oops\r\n\r\noccured when /sys/bus/ap/a[pq]mask was updated with a relative mask value\n(like +0x10-0x12,+60,-90) with one of the numeric values exceeding INT_MAX.\r\n\r\nThe fix is simple: use unsigned long values for the internal variables. The\ncorrect checks are already in place in the function but a simple int for\nthe internal variables was used with the possibility to overflow.(CVE-2024-38661)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: bcm: dvp: Assign -\u0026gt;num before accessing -\u0026gt;hws\r\n\r\nCommit f316cdff8d67 (\u0026quot;clk: Annotate struct clk_hw_onecell_data with\n__counted_by\u0026quot;) annotated the hws member of \u0026apos;struct clk_hw_onecell_data\u0026apos;\nwith __counted_by, which informs the bounds sanitizer about the number\nof elements in hws, so that it can warn when hws is accessed out of\nbounds. As noted in that change, the __counted_by member must be\ninitialized with the number of elements before the first array access\nhappens, otherwise there will be a warning from each access prior to the\ninitialization because the number of elements is zero. This occurs in\nclk_dvp_probe() due to -\u0026gt;num being assigned after -\u0026gt;hws has been\naccessed:\r\n\r\n UBSAN: array-index-out-of-bounds in drivers/clk/bcm/clk-bcm2711-dvp.c:59:2\n index 0 is out of range for type \u0026apos;struct clk_hw *[] __counted_by(num)\u0026apos; (aka \u0026apos;struct clk_hw *[]\u0026apos;)\r\n\r\nMove the -\u0026gt;num initialization to before the first access of -\u0026gt;hws, which\nclears up the warning.(CVE-2024-39462)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: v4l: async: Fix notifier list entry init\r\n\r\nstruct v4l2_async_notifier has several list_head members, but only\nwaiting_list and done_list are initialized. notifier_entry was kept\n\u0026apos;zeroed\u0026apos; leading to an uninitialized list_head.\nThis results in a NULL-pointer dereference if csi2_async_register() fails,\ne.g. node for remote endpoint is disabled, and returns -ENOTCONN.\nThe following calls to v4l2_async_nf_unregister() results in a NULL\npointer dereference.\nAdd the missing list head initializer.(CVE-2024-39464)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncrypto: starfive - Do not free stack buffer\r\n\r\nRSA text data uses variable length buffer allocated in software stack.\nCalling kfree on it causes undefined behaviour in subsequent operations.(CVE-2024-39478)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/i915/hwmon: Get rid of devm\r\n\r\nWhen both hwmon and hwmon drvdata (on which hwmon depends) are device\nmanaged resources, the expectation, on device unbind, is that hwmon will be\nreleased before drvdata. However, in i915 there are two separate code\npaths, which both release either drvdata or hwmon and either can be\nreleased before the other. These code paths (for device unbind) are as\nfollows (see also the bug referenced below):\r\n\r\nCall Trace:\nrelease_nodes+0x11/0x70\ndevres_release_group+0xb2/0x110\ncomponent_unbind_all+0x8d/0xa0\ncomponent_del+0xa5/0x140\nintel_pxp_tee_component_fini+0x29/0x40 [i915]\nintel_pxp_fini+0x33/0x80 [i915]\ni915_driver_remove+0x4c/0x120 [i915]\ni915_pci_remove+0x19/0x30 [i915]\npci_device_remove+0x32/0xa0\ndevice_release_driver_internal+0x19c/0x200\nunbind_store+0x9c/0xb0\r\n\r\nand\r\n\r\nCall Trace:\nrelease_nodes+0x11/0x70\ndevres_release_all+0x8a/0xc0\ndevice_unbind_cleanup+0x9/0x70\ndevice_release_driver_internal+0x1c1/0x200\nunbind_store+0x9c/0xb0\r\n\r\nThis means that in i915, if use devm, we cannot gurantee that hwmon will\nalways be released before drvdata. Which means that we have a uaf if hwmon\nsysfs is accessed when drvdata has been released but hwmon hasn\u0026apos;t.\r\n\r\nThe only way out of this seems to be do get rid of devm_ and release/free\neverything explicitly during device unbind.\r\n\r\nv2: Change commit message and other minor code changes\nv3: Cleanup from i915_hwmon_register on error (Armin Wolf)\nv4: Eliminate potential static analyzer warning (Rodrigo)\n Eliminate fetch_and_zero (Jani)\nv5: Restore previous logic for ddat_gt-\u0026gt;hwmon_dev error return (Andi)(CVE-2024-39479)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nkdb: Fix buffer overflow during tab-complete\r\n\r\nCurrently, when the user attempts symbol completion with the Tab key, kdb\nwill use strncpy() to insert the completed symbol into the command buffer.\nUnfortunately it passes the size of the source buffer rather than the\ndestination to strncpy() with predictably horrible results. Most obviously\nif the command buffer is already full but cp, the cursor position, is in\nthe middle of the buffer, then we will write past the end of the supplied\nbuffer.\r\n\r\nFix this by replacing the dubious strncpy() calls with memmove()/memcpy()\ncalls plus explicit boundary checks to make sure we have enough space\nbefore we start moving characters around.(CVE-2024-39480)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbonding: Fix out-of-bounds read in bond_option_arp_ip_targets_set()\r\n\r\nIn function bond_option_arp_ip_targets_set(), if newval-\u0026gt;string is an\nempty string, newval-\u0026gt;string+1 will point to the byte after the\nstring, causing an out-of-bound read.\r\n\r\nBUG: KASAN: slab-out-of-bounds in strlen+0x7d/0xa0 lib/string.c:418\nRead of size 1 at addr ffff8881119c4781 by task syz-executor665/8107\nCPU: 1 PID: 8107 Comm: syz-executor665 Not tainted 6.7.0-rc7 #1\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0xd9/0x150 lib/dump_stack.c:106\n print_address_description mm/kasan/report.c:364 [inline]\n print_report+0xc1/0x5e0 mm/kasan/report.c:475\n kasan_report+0xbe/0xf0 mm/kasan/report.c:588\n strlen+0x7d/0xa0 lib/string.c:418\n __fortify_strlen include/linux/fortify-string.h:210 [inline]\n in4_pton+0xa3/0x3f0 net/core/utils.c:130\n bond_option_arp_ip_targets_set+0xc2/0x910\ndrivers/net/bonding/bond_options.c:1201\n __bond_opt_set+0x2a4/0x1030 drivers/net/bonding/bond_options.c:767\n __bond_opt_set_notify+0x48/0x150 drivers/net/bonding/bond_options.c:792\n bond_opt_tryset_rtnl+0xda/0x160 drivers/net/bonding/bond_options.c:817\n bonding_sysfs_store_option+0xa1/0x120 drivers/net/bonding/bond_sysfs.c:156\n dev_attr_store+0x54/0x80 drivers/base/core.c:2366\n sysfs_kf_write+0x114/0x170 fs/sysfs/file.c:136\n kernfs_fop_write_iter+0x337/0x500 fs/kernfs/file.c:334\n call_write_iter include/linux/fs.h:2020 [inline]\n new_sync_write fs/read_write.c:491 [inline]\n vfs_write+0x96a/0xd80 fs/read_write.c:584\n ksys_write+0x122/0x250 fs/read_write.c:637\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0x40/0x110 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x63/0x6b\n---[ end trace ]---\r\n\r\nFix it by adding a check of string length before using it.(CVE-2024-39487)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\narm64: asm-bug: Add .align 2 to the end of __BUG_ENTRY\r\n\r\nWhen CONFIG_DEBUG_BUGVERBOSE=n, we fail to add necessary padding bytes\nto bug_table entries, and as a result the last entry in a bug table will\nbe ignored, potentially leading to an unexpected panic(). All prior\nentries in the table will be handled correctly.\r\n\r\nThe arm64 ABI requires that struct fields of up to 8 bytes are\nnaturally-aligned, with padding added within a struct such that struct\nare suitably aligned within arrays.\r\n\r\nWhen CONFIG_DEBUG_BUGVERPOSE=y, the layout of a bug_entry is:\r\n\r\n\tstruct bug_entry {\n\t\tsigned int bug_addr_disp;\t// 4 bytes\n\t\tsigned int file_disp;\t// 4 bytes\n\t\tunsigned short line;\t\t// 2 bytes\n\t\tunsigned short flags;\t\t// 2 bytes\n\t}\r\n\r\n... with 12 bytes total, requiring 4-byte alignment.\r\n\r\nWhen CONFIG_DEBUG_BUGVERBOSE=n, the layout of a bug_entry is:\r\n\r\n\tstruct bug_entry {\n\t\tsigned int bug_addr_disp;\t// 4 bytes\n\t\tunsigned short flags;\t\t// 2 bytes\n\t\t\u0026lt; implicit padding \u0026gt;\t\t// 2 bytes\n\t}\r\n\r\n... with 8 bytes total, with 6 bytes of data and 2 bytes of trailing\npadding, requiring 4-byte alginment.\r\n\r\nWhen we create a bug_entry in assembly, we align the start of the entry\nto 4 bytes, which implicitly handles padding for any prior entries.\nHowever, we do not align the end of the entry, and so when\nCONFIG_DEBUG_BUGVERBOSE=n, the final entry lacks the trailing padding\nbytes.\r\n\r\nFor the main kernel image this is not a problem as find_bug() doesn\u0026apos;t\ndepend on the trailing padding bytes when searching for entries:\r\n\r\n\tfor (bug = __start___bug_table; bug \u0026lt; __stop___bug_table; ++bug)\n\t\tif (bugaddr == bug_addr(bug))\n\t\t\treturn bug;\r\n\r\nHowever for modules, module_bug_finalize() depends on the trailing\nbytes when calculating the number of entries:\r\n\r\n\tmod-\u0026gt;num_bugs = sechdrs[i].sh_size / sizeof(struct bug_entry);\r\n\r\n... and as the last bug_entry lacks the necessary padding bytes, this entry\nwill not be counted, e.g. in the case of a single entry:\r\n\r\n\tsechdrs[i].sh_size == 6\n\tsizeof(struct bug_entry) == 8;\r\n\r\n\tsechdrs[i].sh_size / sizeof(struct bug_entry) == 0;\r\n\r\nConsequently module_find_bug() will miss the last bug_entry when it does:\r\n\r\n\tfor (i = 0; i \u0026lt; mod-\u0026gt;num_bugs; ++i, ++bug)\n\t\tif (bugaddr == bug_addr(bug))\n\t\t\tgoto out;\r\n\r\n... which can lead to a kenrel panic due to an unhandled bug.\r\n\r\nThis can be demonstrated with the following module:\r\n\r\n\tstatic int __init buginit(void)\n\t{\n\t\tWARN(1, \u0026quot;hello\\n\u0026quot;);\n\t\treturn 0;\n\t}\r\n\r\n\tstatic void __exit bugexit(void)\n\t{\n\t}\r\n\r\n\tmodule_init(buginit);\n\tmodule_exit(bugexit);\n\tMODULE_LICENSE(\u0026quot;GPL\u0026quot;);\r\n\r\n... which will trigger a kernel panic when loaded:\r\n\r\n\t------------[ cut here ]------------\n\thello\n\tUnexpected kernel BRK exception at EL1\n\tInternal error: BRK handler: 00000000f2000800 [#1] PREEMPT SMP\n\tModules linked in: hello(O+)\n\tCPU: 0 PID: 50 Comm: insmod Tainted: G O 6.9.1 #8\n\tHardware name: linux,dummy-virt (DT)\n\tpstate: 60400005 (nZCv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n\tpc : buginit+0x18/0x1000 [hello]\n\tlr : buginit+0x18/0x1000 [hello]\n\tsp : ffff800080533ae0\n\tx29: ffff800080533ae0 x28: 0000000000000000 x27: 0000000000000000\n\tx26: ffffaba8c4e70510 x25: ffff800080533c30 x24: ffffaba8c4a28a58\n\tx23: 0000000000000000 x22: 0000000000000000 x21: ffff3947c0eab3c0\n\tx20: ffffaba8c4e3f000 x19: ffffaba846464000 x18: 0000000000000006\n\tx17: 0000000000000000 x16: ffffaba8c2492834 x15: 0720072007200720\n\tx14: 0720072007200720 x13: ffffaba8c49b27c8 x12: 0000000000000312\n\tx11: 0000000000000106 x10: ffffaba8c4a0a7c8 x9 : ffffaba8c49b27c8\n\tx8 : 00000000ffffefff x7 : ffffaba8c4a0a7c8 x6 : 80000000fffff000\n\tx5 : 0000000000000107 x4 : 0000000000000000 x3 : 0000000000000000\n\tx2 : 0000000000000000 x1 : 0000000000000000 x0 : ffff3947c0eab3c0\n\tCall trace:\n\t buginit+0x18/0x1000 [hello]\n\t do_one_initcall+0x80/0x1c8\n\t do_init_module+0x60/0x218\n\t load_module+0x1ba4/0x1d70\n\t __do_sys_init_module+0x198/0x1d0\n\t __arm64_sys_init_module+0x1c/0x28\n\t invoke_syscall+0x48/0x114\n\t el0_svc\n---truncated---(CVE-2024-39488)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: sr: fix memleak in seg6_hmac_init_algo\r\n\r\nseg6_hmac_init_algo returns without cleaning up the previous allocations\nif one fails, so it\u0026apos;s going to leak all that memory and the crypto tfms.\r\n\r\nUpdate seg6_hmac_exit to only free the memory when allocated, so we can\nreuse the code directly.(CVE-2024-39489)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nsock_map: avoid race between sock_map_close and sk_psock_put\r\n\r\nsk_psock_get will return NULL if the refcount of psock has gone to 0, which\nwill happen when the last call of sk_psock_put is done. However,\nsk_psock_drop may not have finished yet, so the close callback will still\npoint to sock_map_close despite psock being NULL.\r\n\r\nThis can be reproduced with a thread deleting an element from the sock map,\nwhile the second one creates a socket, adds it to the map and closes it.\r\n\r\nThat will trigger the WARN_ON_ONCE:\r\n\r\n------------[ cut here ]------------\nWARNING: CPU: 1 PID: 7220 at net/core/sock_map.c:1701 sock_map_close+0x2a2/0x2d0 net/core/sock_map.c:1701\nModules linked in:\nCPU: 1 PID: 7220 Comm: syz-executor380 Not tainted 6.9.0-syzkaller-07726-g3c999d1ae3c7 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024\nRIP: 0010:sock_map_close+0x2a2/0x2d0 net/core/sock_map.c:1701\nCode: df e8 92 29 88 f8 48 8b 1b 48 89 d8 48 c1 e8 03 42 80 3c 20 00 74 08 48 89 df e8 79 29 88 f8 4c 8b 23 eb 89 e8 4f 15 23 f8 90 \u0026lt;0f\u0026gt; 0b 90 48 83 c4 08 5b 41 5c 41 5d 41 5e 41 5f 5d e9 13 26 3d 02\nRSP: 0018:ffffc9000441fda8 EFLAGS: 00010293\nRAX: ffffffff89731ae1 RBX: ffffffff94b87540 RCX: ffff888029470000\nRDX: 0000000000000000 RSI: ffffffff8bcab5c0 RDI: ffffffff8c1faba0\nRBP: 0000000000000000 R08: ffffffff92f9b61f R09: 1ffffffff25f36c3\nR10: dffffc0000000000 R11: fffffbfff25f36c4 R12: ffffffff89731840\nR13: ffff88804b587000 R14: ffff88804b587000 R15: ffffffff89731870\nFS: 000055555e080380(0000) GS:ffff8880b9500000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000000000000000 CR3: 00000000207d4000 CR4: 0000000000350ef0\nCall Trace:\n \u0026lt;TASK\u0026gt;\n unix_release+0x87/0xc0 net/unix/af_unix.c:1048\n __sock_release net/socket.c:659 [inline]\n sock_close+0xbe/0x240 net/socket.c:1421\n __fput+0x42b/0x8a0 fs/file_table.c:422\n __do_sys_close fs/open.c:1556 [inline]\n __se_sys_close fs/open.c:1541 [inline]\n __x64_sys_close+0x7f/0x110 fs/open.c:1541\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xf5/0x240 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\nRIP: 0033:0x7fb37d618070\nCode: 00 00 48 c7 c2 b8 ff ff ff f7 d8 64 89 02 b8 ff ff ff ff eb d4 e8 10 2c 00 00 80 3d 31 f0 07 00 00 74 17 b8 03 00 00 00 0f 05 \u0026lt;48\u0026gt; 3d 00 f0 ff ff 77 48 c3 0f 1f 80 00 00 00 00 48 83 ec 18 89 7c\nRSP: 002b:00007ffcd4a525d8 EFLAGS: 00000202 ORIG_RAX: 0000000000000003\nRAX: ffffffffffffffda RBX: 0000000000000005 RCX: 00007fb37d618070\nRDX: 0000000000000010 RSI: 00000000200001c0 RDI: 0000000000000004\nRBP: 0000000000000000 R08: 0000000100000000 R09: 0000000100000000\nR10: 0000000000000000 R11: 0000000000000202 R12: 0000000000000000\nR13: 0000000000000000 R14: 0000000000000000 R15: 0000000000000000\n \u0026lt;/TASK\u0026gt;\r\n\r\nUse sk_psock, which will only check that the pointer is not been set to\nNULL yet, which should only happen after the callbacks are restored. If,\nthen, a reference can still be gotten, we may call sk_psock_stop and cancel\npsock-\u0026gt;work.\r\n\r\nAs suggested by Paolo Abeni, reorder the condition so the control flow is\nless convoluted.\r\n\r\nAfter that change, the reproducer does not trigger the WARN_ON_ONCE\nanymore.(CVE-2024-39500)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nionic: fix use after netif_napi_del()\r\n\r\nWhen queues are started, netif_napi_add() and napi_enable() are called.\nIf there are 4 queues and only 3 queues are used for the current\nconfiguration, only 3 queues\u0026apos; napi should be registered and enabled.\nThe ionic_qcq_enable() checks whether the .poll pointer is not NULL for\nenabling only the using queue\u0026apos; napi. Unused queues\u0026apos; napi will not be\nregistered by netif_napi_add(), so the .poll pointer indicates NULL.\nBut it couldn\u0026apos;t distinguish whether the napi was unregistered or not\nbecause netif_napi_del() doesn\u0026apos;t reset the .poll pointer to NULL.\nSo, ionic_qcq_enable() calls napi_enable() for the queue, which was\nunregistered by netif_napi_del().\r\n\r\nReproducer:\n ethtool -L \u0026lt;interface name\u0026gt; rx 1 tx 1 combined 0\n ethtool -L \u0026lt;interface name\u0026gt; rx 0 tx 0 combined 1\n ethtool -L \u0026lt;interface name\u0026gt; rx 0 tx 0 combined 4\r\n\r\nSplat looks like:\nkernel BUG at net/core/dev.c:6666!\nOops: invalid opcode: 0000 [#1] PREEMPT SMP NOPTI\nCPU: 3 PID: 1057 Comm: kworker/3:3 Not tainted 6.10.0-rc2+ #16\nWorkqueue: events ionic_lif_deferred_work [ionic]\nRIP: 0010:napi_enable+0x3b/0x40\nCode: 48 89 c2 48 83 e2 f6 80 b9 61 09 00 00 00 74 0d 48 83 bf 60 01 00 00 00 74 03 80 ce 01 f0 4f\nRSP: 0018:ffffb6ed83227d48 EFLAGS: 00010246\nRAX: 0000000000000000 RBX: ffff97560cda0828 RCX: 0000000000000029\nRDX: 0000000000000001 RSI: 0000000000000000 RDI: ffff97560cda0a28\nRBP: ffffb6ed83227d50 R08: 0000000000000400 R09: 0000000000000001\nR10: 0000000000000001 R11: 0000000000000001 R12: 0000000000000000\nR13: ffff97560ce3c1a0 R14: 0000000000000000 R15: ffff975613ba0a20\nFS: 0000000000000000(0000) GS:ffff975d5f780000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00007f8f734ee200 CR3: 0000000103e50000 CR4: 00000000007506f0\nPKRU: 55555554\nCall Trace:\n \u0026lt;TASK\u0026gt;\n ? die+0x33/0x90\n ? do_trap+0xd9/0x100\n ? napi_enable+0x3b/0x40\n ? do_error_trap+0x83/0xb0\n ? napi_enable+0x3b/0x40\n ? napi_enable+0x3b/0x40\n ? exc_invalid_op+0x4e/0x70\n ? napi_enable+0x3b/0x40\n ? asm_exc_invalid_op+0x16/0x20\n ? napi_enable+0x3b/0x40\n ionic_qcq_enable+0xb7/0x180 [ionic 59bdfc8a035436e1c4224ff7d10789e3f14643f8]\n ionic_start_queues+0xc4/0x290 [ionic 59bdfc8a035436e1c4224ff7d10789e3f14643f8]\n ionic_link_status_check+0x11c/0x170 [ionic 59bdfc8a035436e1c4224ff7d10789e3f14643f8]\n ionic_lif_deferred_work+0x129/0x280 [ionic 59bdfc8a035436e1c4224ff7d10789e3f14643f8]\n process_one_work+0x145/0x360\n worker_thread+0x2bb/0x3d0\n ? __pfx_worker_thread+0x10/0x10\n kthread+0xcc/0x100\n ? __pfx_kthread+0x10/0x10\n ret_from_fork+0x2d/0x50\n ? __pfx_kthread+0x10/0x10\n ret_from_fork_asm+0x1a/0x30(CVE-2024-39502)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: fix possible race in __fib6_drop_pcpu_from()\r\n\r\nsyzbot found a race in __fib6_drop_pcpu_from() [1]\r\n\r\nIf compiler reads more than once (*ppcpu_rt),\nsecond read could read NULL, if another cpu clears\nthe value in rt6_get_pcpu_route().\r\n\r\nAdd a READ_ONCE() to prevent this race.\r\n\r\nAlso add rcu_read_lock()/rcu_read_unlock() because\nwe rely on RCU protection while dereferencing pcpu_rt.\r\n\r\n[1]\r\n\r\nOops: general protection fault, probably for non-canonical address 0xdffffc0000000012: 0000 [#1] PREEMPT SMP KASAN PTI\nKASAN: null-ptr-deref in range [0x0000000000000090-0x0000000000000097]\nCPU: 0 PID: 7543 Comm: kworker/u8:17 Not tainted 6.10.0-rc1-syzkaller-00013-g2bfcfd584ff5 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024\nWorkqueue: netns cleanup_net\n RIP: 0010:__fib6_drop_pcpu_from.part.0+0x10a/0x370 net/ipv6/ip6_fib.c:984\nCode: f8 48 c1 e8 03 80 3c 28 00 0f 85 16 02 00 00 4d 8b 3f 4d 85 ff 74 31 e8 74 a7 fa f7 49 8d bf 90 00 00 00 48 89 f8 48 c1 e8 03 \u0026lt;80\u0026gt; 3c 28 00 0f 85 1e 02 00 00 49 8b 87 90 00 00 00 48 8b 0c 24 48\nRSP: 0018:ffffc900040df070 EFLAGS: 00010206\nRAX: 0000000000000012 RBX: 0000000000000001 RCX: ffffffff89932e16\nRDX: ffff888049dd1e00 RSI: ffffffff89932d7c RDI: 0000000000000091\nRBP: dffffc0000000000 R08: 0000000000000005 R09: 0000000000000007\nR10: 0000000000000001 R11: 0000000000000006 R12: ffff88807fa080b8\nR13: fffffbfff1a9a07d R14: ffffed100ff41022 R15: 0000000000000001\nFS: 0000000000000000(0000) GS:ffff8880b9200000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000001b32c26000 CR3: 000000005d56e000 CR4: 00000000003526f0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __fib6_drop_pcpu_from net/ipv6/ip6_fib.c:966 [inline]\n fib6_drop_pcpu_from net/ipv6/ip6_fib.c:1027 [inline]\n fib6_purge_rt+0x7f2/0x9f0 net/ipv6/ip6_fib.c:1038\n fib6_del_route net/ipv6/ip6_fib.c:1998 [inline]\n fib6_del+0xa70/0x17b0 net/ipv6/ip6_fib.c:2043\n fib6_clean_node+0x426/0x5b0 net/ipv6/ip6_fib.c:2205\n fib6_walk_continue+0x44f/0x8d0 net/ipv6/ip6_fib.c:2127\n fib6_walk+0x182/0x370 net/ipv6/ip6_fib.c:2175\n fib6_clean_tree+0xd7/0x120 net/ipv6/ip6_fib.c:2255\n __fib6_clean_all+0x100/0x2d0 net/ipv6/ip6_fib.c:2271\n rt6_sync_down_dev net/ipv6/route.c:4906 [inline]\n rt6_disable_ip+0x7ed/0xa00 net/ipv6/route.c:4911\n addrconf_ifdown.isra.0+0x117/0x1b40 net/ipv6/addrconf.c:3855\n addrconf_notify+0x223/0x19e0 net/ipv6/addrconf.c:3778\n notifier_call_chain+0xb9/0x410 kernel/notifier.c:93\n call_netdevice_notifiers_info+0xbe/0x140 net/core/dev.c:1992\n call_netdevice_notifiers_extack net/core/dev.c:2030 [inline]\n call_netdevice_notifiers net/core/dev.c:2044 [inline]\n dev_close_many+0x333/0x6a0 net/core/dev.c:1585\n unregister_netdevice_many_notify+0x46d/0x19f0 net/core/dev.c:11193\n unregister_netdevice_many net/core/dev.c:11276 [inline]\n default_device_exit_batch+0x85b/0xae0 net/core/dev.c:11759\n ops_exit_list+0x128/0x180 net/core/net_namespace.c:178\n cleanup_net+0x5b7/0xbf0 net/core/net_namespace.c:640\n process_one_work+0x9fb/0x1b60 kernel/workqueue.c:3231\n process_scheduled_works kernel/workqueue.c:3312 [inline]\n worker_thread+0x6c8/0xf70 kernel/workqueue.c:3393\n kthread+0x2c1/0x3a0 kernel/kthread.c:389\n ret_from_fork+0x45/0x80 arch/x86/kernel/process.c:147\n ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:244(CVE-2024-40905)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmptcp: ensure snd_una is properly initialized on connect\r\n\r\nThis is strictly related to commit fb7a0d334894 (\u0026quot;mptcp: ensure snd_nxt\nis properly initialized on connect\u0026quot;). It turns out that syzkaller can\ntrigger the retransmit after fallback and before processing any other\nincoming packet - so that snd_una is still left uninitialized.\r\n\r\nAddress the issue explicitly initializing snd_una together with snd_nxt\nand write_seq.(CVE-2024-40931)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nHID: logitech-dj: Fix memory leak in logi_dj_recv_switch_to_dj_mode()\r\n\r\nFix a memory leak on logi_dj_recv_send_report() error path.(CVE-2024-40934)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nALSA: hda: cs35l41: Possible null pointer dereference in cs35l41_hda_unbind()\r\n\r\nThe cs35l41_hda_unbind() function clears the hda_component entry\nmatching it\u0026apos;s index and then dereferences the codec pointer held in the\nfirst element of the hda_component array, this is an issue when the\ndevice index was 0.\r\n\r\nInstead use the codec pointer stashed in the cs35l41_hda structure as it\nwill still be valid.(CVE-2024-40964)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nf2fs: remove clear SB_INLINECRYPT flag in default_options\r\n\r\nIn f2fs_remount, SB_INLINECRYPT flag will be clear and re-set.\nIf create new file or open file during this gap, these files\nwill not use inlinecrypt. Worse case, it may lead to data\ncorruption if wrappedkey_v0 is enable.\r\n\r\nThread A: Thread B:\r\n\r\n-f2fs_remount\t\t\t\t-f2fs_file_open or f2fs_new_inode\n -default_options\n\t\u0026lt;- clear SB_INLINECRYPT flag\r\n\r\n -fscrypt_select_encryption_impl\r\n\r\n -parse_options\n\t\u0026lt;- set SB_INLINECRYPT again(CVE-2024-40971)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncpufreq: amd-pstate: fix memory leak on CPU EPP exit\r\n\r\nThe cpudata memory from kzalloc() in amd_pstate_epp_cpu_init() is\nnot freed in the analogous exit function, so fix that.\r\n\r\n[ rjw: Subject and changelog edits ](CVE-2024-40997)",
"id": "OESA-2024-1863",
"modified": "2026-08-06T11:07:19Z",
"published": "2024-07-19T11:07:19Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2024-1863"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36017"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36478"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36481"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36924"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36929"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36931"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36951"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38384"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38558"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38570"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38581"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38583"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38586"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38614"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38620"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38632"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38661"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39462"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39464"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39478"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39479"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39480"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39487"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39488"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39489"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39500"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39502"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40905"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40931"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40934"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40964"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40971"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40997"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2024-36017",
"CVE-2024-36478",
"CVE-2024-36481",
"CVE-2024-36924",
"CVE-2024-36929",
"CVE-2024-36931",
"CVE-2024-36951",
"CVE-2024-38384",
"CVE-2024-38558",
"CVE-2024-38570",
"CVE-2024-38581",
"CVE-2024-38583",
"CVE-2024-38586",
"CVE-2024-38614",
"CVE-2024-38620",
"CVE-2024-38632",
"CVE-2024-38661",
"CVE-2024-39462",
"CVE-2024-39464",
"CVE-2024-39478",
"CVE-2024-39479",
"CVE-2024-39480",
"CVE-2024-39487",
"CVE-2024-39488",
"CVE-2024-39489",
"CVE-2024-39500",
"CVE-2024-39502",
"CVE-2024-40905",
"CVE-2024-40931",
"CVE-2024-40934",
"CVE-2024-40964",
"CVE-2024-40971",
"CVE-2024-40997"
]
}
RHSA-2024:10771
Vulnerability from csaf_redhat - Published: 2024-12-04 00:56 - Updated: 2026-09-13 08:43In the Linux kernel, the following vulnerability has been resolved: cpufreq: amd-pstate: fix memory leak on CPU EPP exit The cpudata memory from kzalloc() in amd_pstate_epp_cpu_init() is not freed in the analogous exit function, so fix that. [ rjw: Subject and changelog edits ]
RHSA-2024:7000
Vulnerability from csaf_redhat - Published: 2024-09-24 02:39 - Updated: 2026-09-13 08:46In the Linux kernel, the following vulnerability has been resolved: cpufreq: amd-pstate: fix memory leak on CPU EPP exit The cpudata memory from kzalloc() in amd_pstate_epp_cpu_init() is not freed in the analogous exit function, so fix that. [ rjw: Subject and changelog edits ]
RHSA-2024:7001
Vulnerability from csaf_redhat - Published: 2024-09-24 00:40 - Updated: 2026-09-13 08:28In the Linux kernel, the following vulnerability has been resolved: cpufreq: amd-pstate: fix memory leak on CPU EPP exit The cpudata memory from kzalloc() in amd_pstate_epp_cpu_init() is not freed in the analogous exit function, so fix that. [ rjw: Subject and changelog edits ]
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.