Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2026-45914 (GCVE-0-2026-45914)
Vulnerability from cvelistv5 – Published: 2026-05-27 12:17 – Updated: 2026-05-27 12:17| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
3ce9b7ae9d4d148672b35147aaf7987a4f82bb94 , < 05112ba67c824ab416cd54307c0b50aba9f0047a
(git)
Affected: 533ead425f8109b02fecc7e72d612b8898ec347a , < efd68429f23fb4015b0ebc2392334059e06fad18 (git) Affected: fa37adcf1d564ef58b9dfb01b6c36d35c5294bad , < f448acd86835a650f9ea83460b9ca347d3aafba5 (git) Affected: 68d62e5bebbd118b763e8bb210d5cf2198ef450c , < 914b47c9b824d3d74f31c764163edf93302100b1 (git) Affected: 5aa2139201667c1f644601e4529c4acd6bf8db5a , < 14a38784e09aebc21207dc32fffa05247fc3dd64 (git) Affected: 6946c726c3f4c36f0f049e6f97e88c510b15f65d , < 894d9c7aab68fd0c70c78b1d03c8fa589fb0f67d (git) Affected: 6946c726c3f4c36f0f049e6f97e88c510b15f65d , < 8bde3e395a85017f12af2b0ba5c3684f5af9c006 (git) Affected: 5.10.248 , < 5.10.252 (semver) Affected: 6.1.160 , < 6.1.165 (semver) Affected: 6.6.120 , < 6.6.128 (semver) Affected: 6.12.64 , < 6.12.75 (semver) Affected: 6.18.3 , < 6.18.14 (semver) |
guessed | |
| Linux | Linux |
Affected:
6.19
Unaffected: 0 , < 6.19 (semver) Unaffected: 5.10.252 , ≤ 5.10.* (semver) Unaffected: 6.1.165 , ≤ 6.1.* (semver) Unaffected: 6.6.128 , ≤ 6.6.* (semver) Unaffected: 6.12.75 , ≤ 6.12.* (semver) Unaffected: 6.18.14 , ≤ 6.18.* (semver) Unaffected: 6.19.4 , ≤ 6.19.* (semver) Unaffected: 7.0 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/hwmon/ibmpex.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "05112ba67c824ab416cd54307c0b50aba9f0047a",
"status": "affected",
"version": "3ce9b7ae9d4d148672b35147aaf7987a4f82bb94",
"versionType": "git"
},
{
"lessThan": "efd68429f23fb4015b0ebc2392334059e06fad18",
"status": "affected",
"version": "533ead425f8109b02fecc7e72d612b8898ec347a",
"versionType": "git"
},
{
"lessThan": "f448acd86835a650f9ea83460b9ca347d3aafba5",
"status": "affected",
"version": "fa37adcf1d564ef58b9dfb01b6c36d35c5294bad",
"versionType": "git"
},
{
"lessThan": "914b47c9b824d3d74f31c764163edf93302100b1",
"status": "affected",
"version": "68d62e5bebbd118b763e8bb210d5cf2198ef450c",
"versionType": "git"
},
{
"lessThan": "14a38784e09aebc21207dc32fffa05247fc3dd64",
"status": "affected",
"version": "5aa2139201667c1f644601e4529c4acd6bf8db5a",
"versionType": "git"
},
{
"lessThan": "894d9c7aab68fd0c70c78b1d03c8fa589fb0f67d",
"status": "affected",
"version": "6946c726c3f4c36f0f049e6f97e88c510b15f65d",
"versionType": "git"
},
{
"lessThan": "8bde3e395a85017f12af2b0ba5c3684f5af9c006",
"status": "affected",
"version": "6946c726c3f4c36f0f049e6f97e88c510b15f65d",
"versionType": "git"
},
{
"lessThan": "5.10.252",
"status": "affected",
"version": "5.10.248",
"versionType": "semver"
},
{
"lessThan": "6.1.165",
"status": "affected",
"version": "6.1.160",
"versionType": "semver"
},
{
"lessThan": "6.6.128",
"status": "affected",
"version": "6.6.120",
"versionType": "semver"
},
{
"lessThan": "6.12.75",
"status": "affected",
"version": "6.12.64",
"versionType": "semver"
},
{
"lessThan": "6.18.14",
"status": "affected",
"version": "6.18.3",
"versionType": "semver"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/hwmon/ibmpex.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "6.19"
},
{
"lessThan": "6.19",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.252",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.165",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.128",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.75",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.14",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.19.*",
"status": "unaffected",
"version": "6.19.4",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.0",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.252",
"versionStartIncluding": "5.10.248",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.165",
"versionStartIncluding": "6.1.160",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.128",
"versionStartIncluding": "6.6.120",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.12.75",
"versionStartIncluding": "6.12.64",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.18.14",
"versionStartIncluding": "6.18.3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.19.4",
"versionStartIncluding": "6.19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "7.0",
"versionStartIncluding": "6.19",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nRevert \"hwmon: (ibmpex) fix use-after-free in high/low store\"\n\nThis reverts commit 6946c726c3f4c36f0f049e6f97e88c510b15f65d.\n\nJean Delvare points out that the patch does not completely\nfix the reported problem, that it in fact introduces a\n(new) race condition, and that it may actually not be needed in\nthe first place.\n\nVarious AI reviews agree. Specific and relevant AI feedback:\n\n\"\nThis reordering sets the driver data to NULL before removing the sensor\nattributes in the loop below.\n\nibmpex_show_sensor() retrieves this driver data via dev_get_drvdata() but\ndoes not check if it is NULL before dereferencing it to access\ndata-\u003esensors[].\n\nIf a userspace process reads a sensor file (like temp1_input) while this\ndelete function is running, could it race with the dev_set_drvdata(...,\nNULL) call here and crash in ibmpex_show_sensor()?\n\nWould it be safer to keep the original order where device_remove_file() is\ncalled before clearing the driver data? device_remove_file() should wait\nfor any active sysfs callbacks to complete, which might already prevent the\nuse-after-free this patch intends to fix.\n\"\n\nRevert the offending patch. If it can be shown that the originally reported\nalleged race condition does indeed exist, it can always be re-introduced\nwith a complete fix."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-27T12:17:29.426Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/05112ba67c824ab416cd54307c0b50aba9f0047a"
},
{
"url": "https://git.kernel.org/stable/c/efd68429f23fb4015b0ebc2392334059e06fad18"
},
{
"url": "https://git.kernel.org/stable/c/f448acd86835a650f9ea83460b9ca347d3aafba5"
},
{
"url": "https://git.kernel.org/stable/c/914b47c9b824d3d74f31c764163edf93302100b1"
},
{
"url": "https://git.kernel.org/stable/c/14a38784e09aebc21207dc32fffa05247fc3dd64"
},
{
"url": "https://git.kernel.org/stable/c/894d9c7aab68fd0c70c78b1d03c8fa589fb0f67d"
},
{
"url": "https://git.kernel.org/stable/c/8bde3e395a85017f12af2b0ba5c3684f5af9c006"
}
],
"title": "Revert \"hwmon: (ibmpex) fix use-after-free in high/low store\"",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2026-45914",
"datePublished": "2026-05-27T12:17:29.426Z",
"dateReserved": "2026-05-13T15:03:33.085Z",
"dateUpdated": "2026-05-27T12:17:29.426Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2026-45914",
"date": "2026-10-02",
"epss": "0.00171",
"percentile": "0.05842"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/hwmon/ibmpex.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "05112ba67c824ab416cd54307c0b50aba9f0047a",
"status": "affected",
"version": "3ce9b7ae9d4d148672b35147aaf7987a4f82bb94",
"versionType": "git"
},
{
"lessThan": "efd68429f23fb4015b0ebc2392334059e06fad18",
"status": "affected",
"version": "533ead425f8109b02fecc7e72d612b8898ec347a",
"versionType": "git"
},
{
"lessThan": "f448acd86835a650f9ea83460b9ca347d3aafba5",
"status": "affected",
"version": "fa37adcf1d564ef58b9dfb01b6c36d35c5294bad",
"versionType": "git"
},
{
"lessThan": "914b47c9b824d3d74f31c764163edf93302100b1",
"status": "affected",
"version": "68d62e5bebbd118b763e8bb210d5cf2198ef450c",
"versionType": "git"
},
{
"lessThan": "14a38784e09aebc21207dc32fffa05247fc3dd64",
"status": "affected",
"version": "5aa2139201667c1f644601e4529c4acd6bf8db5a",
"versionType": "git"
},
{
"lessThan": "894d9c7aab68fd0c70c78b1d03c8fa589fb0f67d",
"status": "affected",
"version": "6946c726c3f4c36f0f049e6f97e88c510b15f65d",
"versionType": "git"
},
{
"lessThan": "8bde3e395a85017f12af2b0ba5c3684f5af9c006",
"status": "affected",
"version": "6946c726c3f4c36f0f049e6f97e88c510b15f65d",
"versionType": "git"
},
{
"lessThan": "5.10.252",
"status": "affected",
"version": "5.10.248",
"versionType": "semver"
},
{
"lessThan": "6.1.165",
"status": "affected",
"version": "6.1.160",
"versionType": "semver"
},
{
"lessThan": "6.6.128",
"status": "affected",
"version": "6.6.120",
"versionType": "semver"
},
{
"lessThan": "6.12.75",
"status": "affected",
"version": "6.12.64",
"versionType": "semver"
},
{
"lessThan": "6.18.14",
"status": "affected",
"version": "6.18.3",
"versionType": "semver"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/hwmon/ibmpex.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "6.19"
},
{
"lessThan": "6.19",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.252",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.165",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.128",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.75",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.14",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.19.*",
"status": "unaffected",
"version": "6.19.4",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.0",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "0FF383F2-E238-49E9-870A-004DCE6EC4EE",
"versionEndExcluding": "5.10.252",
"versionStartIncluding": "5.10.248",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "29CE5815-AC25-4B86-8093-9B7C33747C6A",
"versionEndExcluding": "6.1.165",
"versionStartIncluding": "6.1.160",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F93EE437-1C07-464F-9047-8987F00BA711",
"versionEndExcluding": "6.6.128",
"versionStartIncluding": "6.6.120",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E27D5D92-2E0F-4CED-BEFE-15984B8B010D",
"versionEndExcluding": "6.12.75",
"versionStartIncluding": "6.12.64",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "1F86B087-7282-4A5E-92B3-E7448F7492B3",
"versionEndExcluding": "6.18.14",
"versionStartIncluding": "6.18.3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "411B9362-5B74-4569-8450-50CAD50DE99C",
"versionEndExcluding": "6.19.4",
"versionStartIncluding": "6.19.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:-:*:*:*:*:*:*",
"matchCriteriaId": "35C8A871-4971-433E-A046-FC9F7B7D190A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc2:*:*:*:*:*:*",
"matchCriteriaId": "C47E4CC9-C826-4FA9-B014-7FE3D9B318B2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc3:*:*:*:*:*:*",
"matchCriteriaId": "F71D92C0-C023-48BD-B3B6-70B638EEE298",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc4:*:*:*:*:*:*",
"matchCriteriaId": "13580667-0A98-40CC-B29F-D12790B91BDB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc5:*:*:*:*:*:*",
"matchCriteriaId": "CAD1FED7-CF48-47BF-AC7D-7B6FA3C065FC",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc6:*:*:*:*:*:*",
"matchCriteriaId": "3EF854A1-ABB1-4E93-BE9A-44569EC76C0D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc7:*:*:*:*:*:*",
"matchCriteriaId": "F5DC0CA6-F0AF-4DDF-A882-3DADB9A886A7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc8:*:*:*:*:*:*",
"matchCriteriaId": "EB5B7DFC-C36B-45D8-922C-877569FDDF43",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nRevert \"hwmon: (ibmpex) fix use-after-free in high/low store\"\n\nThis reverts commit 6946c726c3f4c36f0f049e6f97e88c510b15f65d.\n\nJean Delvare points out that the patch does not completely\nfix the reported problem, that it in fact introduces a\n(new) race condition, and that it may actually not be needed in\nthe first place.\n\nVarious AI reviews agree. Specific and relevant AI feedback:\n\n\"\nThis reordering sets the driver data to NULL before removing the sensor\nattributes in the loop below.\n\nibmpex_show_sensor() retrieves this driver data via dev_get_drvdata() but\ndoes not check if it is NULL before dereferencing it to access\ndata-\u003esensors[].\n\nIf a userspace process reads a sensor file (like temp1_input) while this\ndelete function is running, could it race with the dev_set_drvdata(...,\nNULL) call here and crash in ibmpex_show_sensor()?\n\nWould it be safer to keep the original order where device_remove_file() is\ncalled before clearing the driver data? device_remove_file() should wait\nfor any active sysfs callbacks to complete, which might already prevent the\nuse-after-free this patch intends to fix.\n\"\n\nRevert the offending patch. If it can be shown that the originally reported\nalleged race condition does indeed exist, it can always be re-introduced\nwith a complete fix."
}
],
"id": "CVE-2026-45914",
"lastModified": "2026-06-24T14:55:01.837",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2026-05-27T14:17:06.180",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/05112ba67c824ab416cd54307c0b50aba9f0047a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/14a38784e09aebc21207dc32fffa05247fc3dd64"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/894d9c7aab68fd0c70c78b1d03c8fa589fb0f67d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8bde3e395a85017f12af2b0ba5c3684f5af9c006"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/914b47c9b824d3d74f31c764163edf93302100b1"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/efd68429f23fb4015b0ebc2392334059e06fad18"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f448acd86835a650f9ea83460b9ca347d3aafba5"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Undergoing Analysis",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-416"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2026-06-27T06:51:06+00:00",
"cve": "CVE-2026-45914",
"id": "CVE-2026-45914",
"initial_release_date": "2026-05-27T00:00:00+00:00",
"product_status:known_affected": "14",
"product_status:known_not_affected": "260",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: Revert \"hwmon: (ibmpex) fix use-after-free in high/low store\"",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2026/cve-2026-45914.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-08-31T16:59:15Z",
"cve": "CVE-2026-45914",
"id": "CVE-2026-45914",
"initial_release_date": "2026-05-28T03:56:18Z",
"product_status:known_affected": "394",
"product_status:known_not_affected": "326",
"product_status:recommended": "105",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2026-45914",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2026-45914.json",
"version": "11"
}
}
}
BDU:2026-11775 (CVE-2026-45914)
Vulnerability from fstec – Published: 2026-08-17 – Updated: 2026-09-17 – View on bdu.fstec.ru Fixed- CWE-364 - Состояние гонки в обработчике сигнала
{
"CVSS 2.0": "AV:L/AC:L/Au:S/C:N/I:N/A:C",
"CVSS 3.0": "AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"CVSS 4.0": null,
"remediation_\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": null,
"remediation_\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435": null,
"\u0412\u0435\u043d\u0434\u043e\u0440 \u041f\u041e": "\u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f, \u041e\u041e\u041e \u00ab\u0420\u0443\u0441\u0411\u0418\u0422\u0435\u0445-\u0410\u0441\u0442\u0440\u0430\u00bb, Canonical Ltd.",
"\u0412\u0435\u0440\u0441\u0438\u044f \u041f\u041e": "11 (Debian GNU/Linux), 12 (Debian GNU/Linux), 1.7 (Astra Linux Special Edition), 22.04 LTS (Ubuntu), 4.7 (Astra Linux Special Edition), 24.04 LTS (Ubuntu), 1.8 (Astra Linux Special Edition), 13 (Debian GNU/Linux), 3.8 (Astra Linux Special Edition), \u043e\u0442 6.19 \u0434\u043e 6.19.4 (Linux), 4.8 (Astra Linux Special Edition), \u043e\u0442 5.10.248 \u0434\u043e 5.10.252 (Linux), \u043e\u0442 6.1.160 \u0434\u043e 6.1.165 (Linux), \u043e\u0442 6.6.120 \u0434\u043e 6.6.128 (Linux), \u043e\u0442 6.12.64 \u0434\u043e 6.12.75 (Linux), \u043e\u0442 6.18.3 \u0434\u043e 6.18.14 (Linux)",
"\u0412\u043e\u0437\u043c\u043e\u0436\u043d\u044b\u0435 \u043c\u0435\u0440\u044b \u043f\u043e \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044e": "\u0412 \u0443\u0441\u043b\u043e\u0432\u0438\u044f\u0445 \u043e\u0442\u0441\u0443\u0442\u0441\u0442\u0432\u0438\u044f \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0439 \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u043e\u0442 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0443\u0435\u0442\u0441\u044f \u043f\u0440\u0438\u0434\u0435\u0440\u0436\u0438\u0432\u0430\u0442\u044c\u0441\u044f \"\u0420\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439 \u043f\u043e \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0439 \u043d\u0430\u0441\u0442\u0440\u043e\u0439\u043a\u0435 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u044b\u0445 \u0441\u0438\u0441\u0442\u0435\u043c LINUX\", \u0438\u0437\u043b\u043e\u0436\u0435\u043d\u043d\u044b\u0445 \u0432 \u043c\u0435\u0442\u043e\u0434\u0438\u0447\u0435\u0441\u043a\u043e\u043c \u0434\u043e\u043a\u0443\u043c\u0435\u043d\u0442\u0435 \u0424\u0421\u0422\u042d\u041a \u0420\u043e\u0441\u0441\u0438\u0438, \u0443\u0442\u0432\u0435\u0440\u0436\u0434\u0451\u043d\u043d\u043e\u043c 25 \u0434\u0435\u043a\u0430\u0431\u0440\u044f 2022 \u0433\u043e\u0434\u0430.\n\n\u0418\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0435 \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439:\n\u0414\u043b\u044f Linux:\nhttps://github.com/torvalds/linux/commit/894d9c7aab68fd0c70c78b1d03c8fa589fb0f67d\n\n\u0414\u043b\u044f \u041e\u0421 Astra Linux:\n\u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.1 \u0434\u043e 6.1.166-1.astra1+ci24 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se38-bulletin-2026-0729SE38\n\n\u0414\u043b\u044f Debian GNU/Linux:\nhttps://security-tracker.debian.org/tracker/CVE-2026-45914\n\n\u0414\u043b\u044f Ubuntu:\nhttps://ubuntu.com/security/CVE-2026-45914\n\n\u0414\u043b\u044f \u041e\u0421 Astra Linux:\n- \u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.12 \u0434\u043e 6.12.77-1.astra1+ci36 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se18-bulletin-2026-0806SE48\n- \u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.1 \u0434\u043e 6.1.166-1.astra1+ci24 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se18-bulletin-2026-0806SE48\n\n\u0414\u043b\u044f \u041e\u0421 Astra Linux:\n\u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.1 \u0434\u043e 6.1.170-1.astra1+ci5r25 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se17-bulletin-2026-0820SE17\n\n\u0414\u043b\u044f \u041e\u0421 Astra Linux:\n- \u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.1 \u0434\u043e 6.1.166-1.astra1+ci24 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se18-bulletin-2026-0626SE18\n- \u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.12 \u0434\u043e 6.12.77-1.astra1+ci36 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se18-bulletin-2026-0626SE18\n\n\u0414\u043b\u044f \u041e\u0421 Astra Linux:\n- \u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.1 \u0434\u043e 6.1.166-1.astra1+ci24 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se18-bulletin-2026-0626SE18\n- \u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.12 \u0434\u043e 6.12.77-1.astra1+ci36 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se18-bulletin-2026-0626SE18\n\n\u0414\u043b\u044f \u041e\u0421 Astra Linux:\n- \u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-5.10 \u0434\u043e 5.10.254-1.astra1+ci158 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se47-bulletin-2026-0907SE47\n- \u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.1 \u0434\u043e 6.1.170-1.astra1+ci5r25 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se47-bulletin-2026-0907SE47",
"\u0414\u0430\u0442\u0430 \u0432\u044b\u044f\u0432\u043b\u0435\u043d\u0438\u044f": "07.02.2026",
"\u0414\u0430\u0442\u0430 \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0433\u043e \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f": "17.09.2026",
"\u0414\u0430\u0442\u0430 \u043f\u0443\u0431\u043b\u0438\u043a\u0430\u0446\u0438\u0438": "17.08.2026",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": "BDU:2026-11775",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440\u044b \u0434\u0440\u0443\u0433\u0438\u0445 \u0441\u0438\u0441\u0442\u0435\u043c \u043e\u043f\u0438\u0441\u0430\u043d\u0438\u0439 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "CVE-2026-45914",
"\u0418\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f \u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0430",
"\u041a\u043b\u0430\u0441\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u0434\u0430",
"\u041d\u0430\u0437\u0432\u0430\u043d\u0438\u0435 \u041f\u041e": "Debian GNU/Linux, Astra Linux Special Edition (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u2116369), Ubuntu, Linux",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u041e\u0421 \u0438 \u0442\u0438\u043f \u0430\u043f\u043f\u0430\u0440\u0430\u0442\u043d\u043e\u0439 \u043f\u043b\u0430\u0442\u0444\u043e\u0440\u043c\u044b": "\u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 11 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 12 , \u041e\u041e\u041e \u00ab\u0420\u0443\u0441\u0411\u0418\u0422\u0435\u0445-\u0410\u0441\u0442\u0440\u0430\u00bb Astra Linux Special Edition 1.7 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u2116369), Canonical Ltd. Ubuntu 22.04 LTS , \u041e\u041e\u041e \u00ab\u0420\u0443\u0441\u0411\u0418\u0422\u0435\u0445-\u0410\u0441\u0442\u0440\u0430\u00bb Astra Linux Special Edition 4.7 ARM (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u2116369), Canonical Ltd. Ubuntu 24.04 LTS , \u041e\u041e\u041e \u00ab\u0420\u0443\u0441\u0411\u0418\u0422\u0435\u0445-\u0410\u0441\u0442\u0440\u0430\u00bb Astra Linux Special Edition 1.8 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u2116369), \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 13 , \u041e\u041e\u041e \u00ab\u0420\u0443\u0441\u0411\u0418\u0422\u0435\u0445-\u0410\u0441\u0442\u0440\u0430\u00bb Astra Linux Special Edition 3.8 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u2116369), \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.19 \u0434\u043e 6.19.4 , \u041e\u041e\u041e \u00ab\u0420\u0443\u0441\u0411\u0418\u0422\u0435\u0445-\u0410\u0441\u0442\u0440\u0430\u00bb Astra Linux Special Edition 4.8 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u2116369), \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.10.248 \u0434\u043e 5.10.252 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.1.160 \u0434\u043e 6.1.165 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.6.120 \u0434\u043e 6.6.128 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.12.64 \u0434\u043e 6.12.75 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.18.3 \u0434\u043e 6.18.14 ",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u043c\u043f\u043e\u043d\u0435\u043d\u0442\u0430 drivers/hwmon/ibmpex.c \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux, \u043f\u043e\u0437\u0432\u043e\u043b\u044f\u044e\u0449\u0430\u044f \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041d\u0430\u043b\u0438\u0447\u0438\u0435 \u044d\u043a\u0441\u043f\u043b\u043e\u0439\u0442\u0430": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0433\u043e\u043d\u043a\u0438 \u0432 \u043e\u0431\u0440\u0430\u0431\u043e\u0442\u0447\u0438\u043a\u0435 \u0441\u0438\u0433\u043d\u0430\u043b\u0430 (CWE-364)",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u043c\u043f\u043e\u043d\u0435\u043d\u0442\u0430 drivers/hwmon/ibmpex.c \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux \u0441\u0432\u044f\u0437\u0430\u043d\u0430 \u0441 \u0441\u0438\u0442\u0443\u0430\u0446\u0438\u0435\u0439 \u0433\u043e\u043d\u043a\u0438 \u0432 \u043e\u0431\u0440\u0430\u0431\u043e\u0442\u0447\u0438\u043a\u0435 \u0441\u0438\u0433\u043d\u0430\u043b\u0430. \u042d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u044f \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438 \u043c\u043e\u0436\u0435\u0442 \u043f\u043e\u0437\u0432\u043e\u043b\u0438\u0442\u044c \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041f\u043e\u0441\u043b\u0435\u0434\u0441\u0442\u0432\u0438\u044f \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": null,
"\u041f\u0440\u043e\u0447\u0430\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f": null,
"\u0421\u0432\u044f\u0437\u044c \u0441 \u0438\u043d\u0446\u0438\u0434\u0435\u043d\u0442\u0430\u043c\u0438 \u0418\u0411": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041e\u043f\u0443\u0431\u043b\u0438\u043a\u043e\u0432\u0430\u043d\u0430",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044f": "\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438": "\u041c\u0430\u043d\u0438\u043f\u0443\u043b\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u0435 \u0441\u0440\u043e\u043a\u0430\u043c\u0438 \u0438 \u0441\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435\u043c",
"\u0421\u0441\u044b\u043b\u043a\u0438 \u043d\u0430 \u0438\u0441\u0442\u043e\u0447\u043d\u0438\u043a\u0438": "https://nvd.nist.gov/vuln/detail/CVE-2026-45914\nhttps://security-tracker.debian.org/tracker/CVE-2026-45914\nhttps://git.kernel.org/linus/8bde3e395a85017f12af2b0ba5c3684f5af9c006\nhttps://git.kernel.org/stable/c/05112ba67c824ab416cd54307c0b50aba9f0047a\nhttps://git.kernel.org/stable/c/14a38784e09aebc21207dc32fffa05247fc3dd64\nhttps://git.kernel.org/stable/c/894d9c7aab68fd0c70c78b1d03c8fa589fb0f67d\nhttps://git.kernel.org/stable/c/8bde3e395a85017f12af2b0ba5c3684f5af9c006\nhttps://git.kernel.org/stable/c/914b47c9b824d3d74f31c764163edf93302100b1\nhttps://git.kernel.org/stable/c/efd68429f23fb4015b0ebc2392334059e06fad18\nhttps://git.kernel.org/stable/c/f448acd86835a650f9ea83460b9ca347d3aafba5\nhttps://github.com/torvalds/linux/commit/894d9c7aab68fd0c70c78b1d03c8fa589fb0f67d\nhttps://wiki.astralinux.ru/astra-linux-se38-bulletin-2026-0729SE38\nhttps://ubuntu.com/security/CVE-2026-45914\nhttps://wiki.astralinux.ru/astra-linux-se18-bulletin-2026-0806SE48\nhttps://wiki.astralinux.ru/astra-linux-se17-bulletin-2026-0820SE17\nhttps://wiki.astralinux.ru/astra-linux-se18-bulletin-2026-0626SE18\nhttps://wiki.astralinux.ru/astra-linux-se18-bulletin-2026-0626SE18\nhttps://wiki.astralinux.ru/astra-linux-se47-bulletin-2026-0907SE47",
"\u0421\u0442\u0430\u0442\u0443\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041f\u043e\u0434\u0442\u0432\u0435\u0440\u0436\u0434\u0435\u043d\u0430 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u0435\u043c",
"\u0422\u0438\u043f \u041f\u041e": "\u041e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u0430\u044f \u0441\u0438\u0441\u0442\u0435\u043c\u0430",
"\u0422\u0438\u043f \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "CWE-364",
"\u0423\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 2.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 4,6)\n\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 3.1 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 5,5)"
}
BELL-CVE-2026-45914 (CVE-2026-45914)
Vulnerability from osv_bellsoft – Published: 2026-05-28 06:10 – Updated: 2026-06-24 20:15 – Source website| URL | Type | |
|---|---|---|
{
"affected": [
{
"package": {
"ecosystem": "Alpaquita:23",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=23"
},
"ranges": [
{
"events": [
{
"introduced": "6.1.164-r0"
},
{
"fixed": "6.1.167-r0"
}
],
"type": "ECOSYSTEM"
}
]
},
{
"package": {
"ecosystem": "Alpaquita:25",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=25"
},
"ranges": [
{
"events": [
{
"introduced": "6.12.74-r0"
},
{
"fixed": "6.12.80-r0"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"id": "BELL-CVE-2026-45914",
"modified": "2026-06-24T20:15:12.490296Z",
"published": "2026-05-28T06:10:11.733414Z",
"references": [
{
"type": "ADVISORY",
"url": "https://docs.bell-sw.com/security/cves/CVE-2026-45914"
}
],
"schema_version": "1.7.4",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"upstream": [
"CVE-2026-45914"
]
}
CERTFR-2026-AVI-0696
Vulnerability from certfr_avis - Published: 2026-06-05 - Updated: 2026-06-05
De multiples vulnérabilités ont été découvertes dans le noyau Linux de Debian LTS. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et un déni de service.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||
|---|---|---|---|---|---|---|---|---|
|
||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Debian bullseye versions ant\u00e9rieures 6.1.174-1~deb11u1",
"product": {
"name": "Debian",
"vendor": {
"name": "Debian",
"scada": false
}
}
},
{
"description": "Debian bullseye versions ant\u00e9rieures 5.10.257-1",
"product": {
"name": "Debian",
"vendor": {
"name": "Debian",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-43078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43078"
},
{
"name": "CVE-2026-43068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43068"
},
{
"name": "CVE-2026-31770",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31770"
},
{
"name": "CVE-2026-31658",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31658"
},
{
"name": "CVE-2026-23318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23318"
},
{
"name": "CVE-2026-23368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23368"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-31485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31485"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-43373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43373"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-31402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31402"
},
{
"name": "CVE-2025-40219",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40219"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-31758",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31758"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2026-23281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23281"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2026-43060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43060"
},
{
"name": "CVE-2026-31416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31416"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2026-43062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43062"
},
{
"name": "CVE-2026-23293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23293"
},
{
"name": "CVE-2026-23463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23463"
},
{
"name": "CVE-2026-23227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23227"
},
{
"name": "CVE-2026-45923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45923"
},
{
"name": "CVE-2026-31405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31405"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-43339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43339"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2026-31473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31473"
},
{
"name": "CVE-2026-31550",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31550"
},
{
"name": "CVE-2026-23290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23290"
},
{
"name": "CVE-2026-31752",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31752"
},
{
"name": "CVE-2026-31787",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31787"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-23303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23303"
},
{
"name": "CVE-2026-43011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43011"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-31396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31396"
},
{
"name": "CVE-2026-31680",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31680"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-31738",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31738"
},
{
"name": "CVE-2026-43411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43411"
},
{
"name": "CVE-2026-31751",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31751"
},
{
"name": "CVE-2026-43429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43429"
},
{
"name": "CVE-2026-43382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43382"
},
{
"name": "CVE-2026-23439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23439"
},
{
"name": "CVE-2026-23253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23253"
},
{
"name": "CVE-2026-31721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31721"
},
{
"name": "CVE-2026-23434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23434"
},
{
"name": "CVE-2026-43014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43014"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-31447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31447"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-43445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43445"
},
{
"name": "CVE-2026-43387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43387"
},
{
"name": "CVE-2026-43028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43028"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-43475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43475"
},
{
"name": "CVE-2026-23304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23304"
},
{
"name": "CVE-2026-31683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31683"
},
{
"name": "CVE-2026-23357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23357"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-31524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31524"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-31546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31546"
},
{
"name": "CVE-2026-45956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45956"
},
{
"name": "CVE-2026-43047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43047"
},
{
"name": "CVE-2026-43432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43432"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-31786",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31786"
},
{
"name": "CVE-2026-31545",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31545"
},
{
"name": "CVE-2026-23456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23456"
},
{
"name": "CVE-2026-43458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43458"
},
{
"name": "CVE-2026-43450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43450"
},
{
"name": "CVE-2026-31510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31510"
},
{
"name": "CVE-2026-23457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23457"
},
{
"name": "CVE-2026-43503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43503"
},
{
"name": "CVE-2026-43069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43069"
},
{
"name": "CVE-2026-43425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43425"
},
{
"name": "CVE-2026-31659",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31659"
},
{
"name": "CVE-2026-43480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43480"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2026-43426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43426"
},
{
"name": "CVE-2026-43030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43030"
},
{
"name": "CVE-2026-45914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45914"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-43383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43383"
},
{
"name": "CVE-2026-43334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43334"
},
{
"name": "CVE-2026-23391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23391"
},
{
"name": "CVE-2026-31415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31415"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-23462",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23462"
},
{
"name": "CVE-2026-23273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23273"
},
{
"name": "CVE-2026-23372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23372"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-46174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46174"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-43327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43327"
},
{
"name": "CVE-2026-31494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31494"
},
{
"name": "CVE-2026-43381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43381"
},
{
"name": "CVE-2026-31763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31763"
},
{
"name": "CVE-2026-23279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23279"
},
{
"name": "CVE-2026-31670",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31670"
},
{
"name": "CVE-2026-31422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31422"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-23286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23286"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-23298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23298"
},
{
"name": "CVE-2026-31469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31469"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-31498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31498"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-43336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43336"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-31418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31418"
},
{
"name": "CVE-2026-45981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45981"
},
{
"name": "CVE-2026-43466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43466"
},
{
"name": "CVE-2026-31427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31427"
},
{
"name": "CVE-2026-31555",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31555"
},
{
"name": "CVE-2026-43439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43439"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-31515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31515"
},
{
"name": "CVE-2026-31661",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31661"
},
{
"name": "CVE-2026-43452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43452"
},
{
"name": "CVE-2026-31737",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31737"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2026-43043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43043"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-23396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23396"
},
{
"name": "CVE-2026-31423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31423"
},
{
"name": "CVE-2026-43051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43051"
},
{
"name": "CVE-2026-31759",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31759"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-31781",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31781"
},
{
"name": "CVE-2026-43449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43449"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-31523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31523"
},
{
"name": "CVE-2026-43459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43459"
},
{
"name": "CVE-2026-31450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31450"
},
{
"name": "CVE-2026-31671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31671"
},
{
"name": "CVE-2026-31749",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31749"
},
{
"name": "CVE-2026-43328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43328"
},
{
"name": "CVE-2026-43024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43024"
},
{
"name": "CVE-2026-45985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45985"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-23352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23352"
},
{
"name": "CVE-2026-31720",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31720"
},
{
"name": "CVE-2026-31748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31748"
},
{
"name": "CVE-2026-43077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43077"
},
{
"name": "CVE-2026-43472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43472"
},
{
"name": "CVE-2026-23367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23367"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-45899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45899"
},
{
"name": "CVE-2026-31662",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31662"
},
{
"name": "CVE-2026-43026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43026"
},
{
"name": "CVE-2026-43430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43430"
},
{
"name": "CVE-2026-43437",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43437"
},
{
"name": "CVE-2026-45920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45920"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-23446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23446"
},
{
"name": "CVE-2026-46300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46300"
},
{
"name": "CVE-2026-43035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43035"
},
{
"name": "CVE-2026-31665",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31665"
},
{
"name": "CVE-2026-23300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23300"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-31391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31391"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-31672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31672"
},
{
"name": "CVE-2026-31780",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31780"
},
{
"name": "CVE-2026-43342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43342"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-43357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43357"
},
{
"name": "CVE-2026-43061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43061"
},
{
"name": "CVE-2026-43453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43453"
},
{
"name": "CVE-2026-43032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43032"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-23362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23362"
},
{
"name": "CVE-2026-23379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23379"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-43427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43427"
},
{
"name": "CVE-2026-31421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31421"
},
{
"name": "CVE-2026-23381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23381"
},
{
"name": "CVE-2026-31518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31518"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-31660",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31660"
},
{
"name": "CVE-2026-23245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23245"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-31728",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31728"
},
{
"name": "CVE-2026-31403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31403"
},
{
"name": "CVE-2026-31400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31400"
},
{
"name": "CVE-2026-31512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31512"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-31726",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31726"
},
{
"name": "CVE-2026-31504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31504"
},
{
"name": "CVE-2026-43370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43370"
},
{
"name": "CVE-2026-31773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31773"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-43015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43015"
},
{
"name": "CVE-2026-31509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31509"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2026-43066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43066"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-31679",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31679"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2026-23274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23274"
},
{
"name": "CVE-2026-43020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43020"
},
{
"name": "CVE-2026-31417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31417"
},
{
"name": "CVE-2026-43041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43041"
},
{
"name": "CVE-2026-31761",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31761"
},
{
"name": "CVE-2026-31466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31466"
},
{
"name": "CVE-2024-56584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56584"
},
{
"name": "CVE-2026-45958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45958"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-31778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31778"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-43040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43040"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-31552",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31552"
},
{
"name": "CVE-2026-43428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43428"
},
{
"name": "CVE-2026-23397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23397"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-23452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23452"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-23474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23474"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-23336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23336"
},
{
"name": "CVE-2026-43355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43355"
},
{
"name": "CVE-2026-31497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31497"
},
{
"name": "CVE-2026-43451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43451"
},
{
"name": "CVE-2026-31682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31682"
},
{
"name": "CVE-2026-31570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31570"
},
{
"name": "CVE-2026-23289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23289"
},
{
"name": "CVE-2026-23277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23277"
},
{
"name": "CVE-2026-31399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31399"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-43343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43343"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-23455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23455"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-31495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31495"
},
{
"name": "CVE-2026-31507",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31507"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-31762",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31762"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-31788",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31788"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-31428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31428"
},
{
"name": "CVE-2026-23420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23420"
},
{
"name": "CVE-2026-23388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23388"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-43386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43386"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-23458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23458"
},
{
"name": "CVE-2026-31649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31649"
},
{
"name": "CVE-2026-31674",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31674"
},
{
"name": "CVE-2026-31393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31393"
},
{
"name": "CVE-2026-43420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43420"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43027"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2025-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68206"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-23339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23339"
},
{
"name": "CVE-2026-23112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23112"
},
{
"name": "CVE-2026-23460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23460"
},
{
"name": "CVE-2026-23395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23395"
},
{
"name": "CVE-2026-31651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31651"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2026-31747",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31747"
},
{
"name": "CVE-2026-31455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31455"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-43340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43340"
},
{
"name": "CVE-2026-23291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23291"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-23382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23382"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-43424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43424"
},
{
"name": "CVE-2025-40261",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40261"
},
{
"name": "CVE-2026-23312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23312"
},
{
"name": "CVE-2026-31508",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31508"
},
{
"name": "CVE-2026-23365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23365"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-31424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31424"
},
{
"name": "CVE-2026-46028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46028"
},
{
"name": "CVE-2026-23356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23356"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23307"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-43363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43363"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2026-31454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31454"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-31452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31452"
},
{
"name": "CVE-2026-23398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23398"
},
{
"name": "CVE-2026-31425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31425"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-23351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23351"
},
{
"name": "CVE-2026-43050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43050"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
},
{
"name": "CVE-2026-31667",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31667"
}
],
"initial_release_date": "2026-06-05T00:00:00",
"last_revision_date": "2026-06-05T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0696",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-06-05T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de Debian LTS. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et un d\u00e9ni de service.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de Debian LTS",
"vendor_advisories": [
{
"published_at": "2026-05-29",
"title": "Bulletin de s\u00e9curit\u00e9 Debian LTS msg00051",
"url": "https://lists.debian.org/debian-lts-announce/2026/05/msg00051.html"
},
{
"published_at": "2026-05-29",
"title": "Bulletin de s\u00e9curit\u00e9 Debian LTS msg00052",
"url": "https://lists.debian.org/debian-lts-announce/2026/05/msg00052.html"
}
]
}
CERTFR-2026-AVI-0831
Vulnerability from certfr_avis - Published: 2026-07-03 - Updated: 2026-07-03
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 25.10",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-46325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46325"
},
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-23198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23198"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-43078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43078"
},
{
"name": "CVE-2026-31713",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31713"
},
{
"name": "CVE-2026-23202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23202"
},
{
"name": "CVE-2026-23260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23260"
},
{
"name": "CVE-2026-23167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23167"
},
{
"name": "CVE-2026-45905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45905"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-43414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43414"
},
{
"name": "CVE-2026-46010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46010"
},
{
"name": "CVE-2026-23129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23129"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2026-31582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31582"
},
{
"name": "CVE-2026-46045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46045"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2026-23098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23098"
},
{
"name": "CVE-2026-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47329"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2025-68749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68749"
},
{
"name": "CVE-2026-46081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46081"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-45884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45884"
},
{
"name": "CVE-2026-46087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46087"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-23126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23126"
},
{
"name": "CVE-2026-46255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46255"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2026-23054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23054"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-31402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31402"
},
{
"name": "CVE-2026-46042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46042"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-43317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43317"
},
{
"name": "CVE-2026-23159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23159"
},
{
"name": "CVE-2025-68725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68725"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2026-46076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46076"
},
{
"name": "CVE-2026-23450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23450"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2026-31704",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31704"
},
{
"name": "CVE-2026-31685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31685"
},
{
"name": "CVE-2026-43073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43073"
},
{
"name": "CVE-2026-43143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43143"
},
{
"name": "CVE-2026-46013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46013"
},
{
"name": "CVE-2026-23069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23069"
},
{
"name": "CVE-2026-22992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22992"
},
{
"name": "CVE-2026-46065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46065"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2025-71191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71191"
},
{
"name": "CVE-2026-31593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31593"
},
{
"name": "CVE-2026-46007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46007"
},
{
"name": "CVE-2026-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47330"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-45923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45923"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-45910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45910"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-31600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31600"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-45928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45928"
},
{
"name": "CVE-2026-45988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45988"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2025-40039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40039"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-23020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23020"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-46063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46063"
},
{
"name": "CVE-2026-23187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23187"
},
{
"name": "CVE-2026-46280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46280"
},
{
"name": "CVE-2026-43011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43011"
},
{
"name": "CVE-2026-43167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43167"
},
{
"name": "CVE-2026-45976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45976"
},
{
"name": "CVE-2026-43248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43248"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-23136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23136"
},
{
"name": "CVE-2026-23139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23139"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-46287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46287"
},
{
"name": "CVE-2025-71189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71189"
},
{
"name": "CVE-2026-23179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23179"
},
{
"name": "CVE-2026-31613",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31613"
},
{
"name": "CVE-2026-23090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23090"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-46032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46032"
},
{
"name": "CVE-2026-23035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23035"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2026-31574",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31574"
},
{
"name": "CVE-2026-46057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46057"
},
{
"name": "CVE-2026-23258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23258"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2026-23064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23064"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2026-43284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43284"
},
{
"name": "CVE-2026-45995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45995"
},
{
"name": "CVE-2026-46034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46034"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-23061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23061"
},
{
"name": "CVE-2026-23059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23059"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-45996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45996"
},
{
"name": "CVE-2026-46286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46286"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-23135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23135"
},
{
"name": "CVE-2026-23047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23047"
},
{
"name": "CVE-2025-68365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68365"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-43244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43244"
},
{
"name": "CVE-2026-23119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23119"
},
{
"name": "CVE-2026-23173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23173"
},
{
"name": "CVE-2026-31711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31711"
},
{
"name": "CVE-2026-31611",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31611"
},
{
"name": "CVE-2026-23123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23123"
},
{
"name": "CVE-2026-43201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43201"
},
{
"name": "CVE-2026-31714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31714"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-46260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46260"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-31431",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31431"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-43319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43319"
},
{
"name": "CVE-2026-23094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23094"
},
{
"name": "CVE-2026-23049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23049"
},
{
"name": "CVE-2026-46092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46092"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2026-31614",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31614"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2026-23101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23101"
},
{
"name": "CVE-2026-46001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46001"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-46071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46071"
},
{
"name": "CVE-2026-23099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23099"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-45851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45851"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-31478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31478"
},
{
"name": "CVE-2026-45859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45859"
},
{
"name": "CVE-2026-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23085"
},
{
"name": "CVE-2026-46066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46066"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-43153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43153"
},
{
"name": "CVE-2026-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23150"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-45917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45917"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-46031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46031"
},
{
"name": "CVE-2026-46277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46277"
},
{
"name": "CVE-2026-23163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23163"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-23057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23057"
},
{
"name": "CVE-2025-37926",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37926"
},
{
"name": "CVE-2026-45865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45865"
},
{
"name": "CVE-2026-31635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31635"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-43033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43033"
},
{
"name": "CVE-2026-46265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46265"
},
{
"name": "CVE-2026-45972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45972"
},
{
"name": "CVE-2026-23166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23166"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-22991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22991"
},
{
"name": "CVE-2026-23264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23264"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-46074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46074"
},
{
"name": "CVE-2026-47331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47331"
},
{
"name": "CVE-2026-31595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31595"
},
{
"name": "CVE-2026-46332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46332"
},
{
"name": "CVE-2026-43503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43503"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-45989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45989"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-45881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45881"
},
{
"name": "CVE-2026-43350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43350"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2026-43376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43376"
},
{
"name": "CVE-2026-23256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23256"
},
{
"name": "CVE-2026-23116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23116"
},
{
"name": "CVE-2026-46261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46261"
},
{
"name": "CVE-2026-31659",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31659"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2026-45861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45861"
},
{
"name": "CVE-2026-31591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31591"
},
{
"name": "CVE-2026-46041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46041"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2025-71200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71200"
},
{
"name": "CVE-2026-43117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43117"
},
{
"name": "CVE-2026-46083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46083"
},
{
"name": "CVE-2026-22980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22980"
},
{
"name": "CVE-2026-45914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45914"
},
{
"name": "CVE-2026-23172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23172"
},
{
"name": "CVE-2026-43493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43493"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-43383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43383"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-43500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43500"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-23133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23133"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-31703",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31703"
},
{
"name": "CVE-2026-23131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23131"
},
{
"name": "CVE-2026-23212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23212"
},
{
"name": "CVE-2026-23032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23032"
},
{
"name": "CVE-2026-23170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23170"
},
{
"name": "CVE-2026-46097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46097"
},
{
"name": "CVE-2026-23204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23204"
},
{
"name": "CVE-2026-23019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23019"
},
{
"name": "CVE-2026-23230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23230"
},
{
"name": "CVE-2025-71188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71188"
},
{
"name": "CVE-2026-46030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46030"
},
{
"name": "CVE-2026-43170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43170"
},
{
"name": "CVE-2026-31693",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31693"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-23125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23125"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-43150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43150"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45913"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-23005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23005"
},
{
"name": "CVE-2026-47328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47328"
},
{
"name": "CVE-2026-23214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23214"
},
{
"name": "CVE-2026-46005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46005"
},
{
"name": "CVE-2026-45962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45962"
},
{
"name": "CVE-2026-31718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31718"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-23030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23030"
},
{
"name": "CVE-2026-46247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46247"
},
{
"name": "CVE-2026-46069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46069"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2026-23178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23178"
},
{
"name": "CVE-2026-46288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46288"
},
{
"name": "CVE-2026-43288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43288"
},
{
"name": "CVE-2026-22997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22997"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2025-71294",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71294"
},
{
"name": "CVE-2026-31609",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31609"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2025-71196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71196"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-31533",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31533"
},
{
"name": "CVE-2026-46059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46059"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-46323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46323"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-46103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46103"
},
{
"name": "CVE-2026-43348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43348"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-46043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46043"
},
{
"name": "CVE-2026-23191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23191"
},
{
"name": "CVE-2026-31601",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31601"
},
{
"name": "CVE-2026-23078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23078"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-31418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31418"
},
{
"name": "CVE-2026-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47332"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-45981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45981"
},
{
"name": "CVE-2026-31620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31620"
},
{
"name": "CVE-2026-43197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43197"
},
{
"name": "CVE-2026-46278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46278"
},
{
"name": "CVE-2026-46011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46011"
},
{
"name": "CVE-2026-46095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46095"
},
{
"name": "CVE-2026-43253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43253"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2025-71220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71220"
},
{
"name": "CVE-2025-71295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71295"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-23103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23103"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-43491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43491"
},
{
"name": "CVE-2026-46100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46100"
},
{
"name": "CVE-2025-71199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71199"
},
{
"name": "CVE-2026-46012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46012"
},
{
"name": "CVE-2026-31606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31606"
},
{
"name": "CVE-2025-68358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68358"
},
{
"name": "CVE-2026-23180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23180"
},
{
"name": "CVE-2026-45999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45999"
},
{
"name": "CVE-2026-45973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45973"
},
{
"name": "CVE-2026-23006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23006"
},
{
"name": "CVE-2026-43249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43249"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2025-71195",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71195"
},
{
"name": "CVE-2026-22994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22994"
},
{
"name": "CVE-2026-31705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31705"
},
{
"name": "CVE-2026-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52905"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-23083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23083"
},
{
"name": "CVE-2026-23262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23262"
},
{
"name": "CVE-2026-23088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23088"
},
{
"name": "CVE-2026-46038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46038"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-45878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45878"
},
{
"name": "CVE-2026-23108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23108"
},
{
"name": "CVE-2026-23267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23267"
},
{
"name": "CVE-2025-71180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71180"
},
{
"name": "CVE-2026-46000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46000"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47334"
},
{
"name": "CVE-2025-71194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71194"
},
{
"name": "CVE-2026-45982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45982"
},
{
"name": "CVE-2026-31669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31669"
},
{
"name": "CVE-2026-23200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23200"
},
{
"name": "CVE-2026-22999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22999"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-23068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23068"
},
{
"name": "CVE-2026-23089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23089"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-23216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23216"
},
{
"name": "CVE-2025-71225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71225"
},
{
"name": "CVE-2026-46276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46276"
},
{
"name": "CVE-2026-23071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23071"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-23056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23056"
},
{
"name": "CVE-2026-31608",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31608"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-43173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43173"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-43077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43077"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-46283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46283"
},
{
"name": "CVE-2026-45957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45957"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-23063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23063"
},
{
"name": "CVE-2026-23427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23427"
},
{
"name": "CVE-2026-47335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47335"
},
{
"name": "CVE-2026-23073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23073"
},
{
"name": "CVE-2026-46020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46020"
},
{
"name": "CVE-2026-23058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23058"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2025-71182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71182"
},
{
"name": "CVE-2026-45997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45997"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-23038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23038"
},
{
"name": "CVE-2026-43402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43402"
},
{
"name": "CVE-2025-71286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71286"
},
{
"name": "CVE-2026-46090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46090"
},
{
"name": "CVE-2026-22990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22990"
},
{
"name": "CVE-2026-23000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23000"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2025-71186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71186"
},
{
"name": "CVE-2026-47336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47336"
},
{
"name": "CVE-2026-23176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23176"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-23026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23026"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-23128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23128"
},
{
"name": "CVE-2026-46300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46300"
},
{
"name": "CVE-2026-43271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43271"
},
{
"name": "CVE-2025-71190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71190"
},
{
"name": "CVE-2026-23140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23140"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2026-46026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46026"
},
{
"name": "CVE-2026-43258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43258"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-23107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23107"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-43304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43304"
},
{
"name": "CVE-2026-45886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45886"
},
{
"name": "CVE-2026-22978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22978"
},
{
"name": "CVE-2026-43378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43378"
},
{
"name": "CVE-2026-43384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43384"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23146"
},
{
"name": "CVE-2026-43501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43501"
},
{
"name": "CVE-2026-45998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45998"
},
{
"name": "CVE-2026-23037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23037"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2026-23001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23001"
},
{
"name": "CVE-2025-71224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71224"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2026-23193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23193"
},
{
"name": "CVE-2026-31610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31610"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-46008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46008"
},
{
"name": "CVE-2026-23215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23215"
},
{
"name": "CVE-2026-43238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43238"
},
{
"name": "CVE-2026-31592",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31592"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-45991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45991"
},
{
"name": "CVE-2026-23025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23025"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-31712",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31712"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-31707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31707"
},
{
"name": "CVE-2026-23151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23151"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-45880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45880"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-46067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46067"
},
{
"name": "CVE-2026-43349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43349"
},
{
"name": "CVE-2026-22982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22982"
},
{
"name": "CVE-2026-46290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46290"
},
{
"name": "CVE-2026-23205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23205"
},
{
"name": "CVE-2026-46036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46036"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-46279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46279"
},
{
"name": "CVE-2026-46135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46135"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-45990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45990"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2025-71222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71222"
},
{
"name": "CVE-2026-31504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31504"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-45895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45895"
},
{
"name": "CVE-2026-46075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46075"
},
{
"name": "CVE-2026-23142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23142"
},
{
"name": "CVE-2025-71229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71229"
},
{
"name": "CVE-2026-23213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23213"
},
{
"name": "CVE-2026-31607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31607"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-23091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23091"
},
{
"name": "CVE-2026-46054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46054"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-45877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45877"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-46282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46282"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2025-71192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71192"
},
{
"name": "CVE-2026-47327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47327"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-23121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23121"
},
{
"name": "CVE-2026-31637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31637"
},
{
"name": "CVE-2026-31612",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31612"
},
{
"name": "CVE-2026-23428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23428"
},
{
"name": "CVE-2026-23274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23274"
},
{
"name": "CVE-2026-43199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43199"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-46073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46073"
},
{
"name": "CVE-2026-31621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31621"
},
{
"name": "CVE-2025-71297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71297"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2026-47326",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47326"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-31604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31604"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2026-23144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23144"
},
{
"name": "CVE-2026-23087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23087"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-31584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31584"
},
{
"name": "CVE-2026-31419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31419"
},
{
"name": "CVE-2025-71185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71185"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-43221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43221"
},
{
"name": "CVE-2025-71268",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71268"
},
{
"name": "CVE-2026-46281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46281"
},
{
"name": "CVE-2026-23096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23096"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2025-68351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68351"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-31717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31717"
},
{
"name": "CVE-2026-43300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43300"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-43189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43189"
},
{
"name": "CVE-2025-40149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40149"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-23164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23164"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-46035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46035"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-31715",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31715"
},
{
"name": "CVE-2026-23278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23278"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-23124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23124"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-23257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23257"
},
{
"name": "CVE-2025-71160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71160"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2024-58096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58096"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2025-71162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71162"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-23075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23075"
},
{
"name": "CVE-2026-23120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23120"
},
{
"name": "CVE-2026-43222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43222"
},
{
"name": "CVE-2025-68803",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68803"
},
{
"name": "CVE-2026-22996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22996"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-46016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46016"
},
{
"name": "CVE-2026-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47337"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-23168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23168"
},
{
"name": "CVE-2024-50004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50004"
},
{
"name": "CVE-2026-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46316"
},
{
"name": "CVE-2026-23105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23105"
},
{
"name": "CVE-2026-31682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31682"
},
{
"name": "CVE-2026-22976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22976"
},
{
"name": "CVE-2026-46068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46068"
},
{
"name": "CVE-2026-43406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43406"
},
{
"name": "CVE-2026-45893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45893"
},
{
"name": "CVE-2026-46056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46056"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2026-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23141"
},
{
"name": "CVE-2026-23065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23065"
},
{
"name": "CVE-2026-23182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23182"
},
{
"name": "CVE-2026-31709",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31709"
},
{
"name": "CVE-2026-43215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43215"
},
{
"name": "CVE-2026-23086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23086"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-52904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52904"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-46086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46086"
},
{
"name": "CVE-2025-71273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71273"
},
{
"name": "CVE-2025-71291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71291"
},
{
"name": "CVE-2026-46094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46094"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-23455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23455"
},
{
"name": "CVE-2026-23233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23233"
},
{
"name": "CVE-2026-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53174"
},
{
"name": "CVE-2026-23261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23261"
},
{
"name": "CVE-2026-43341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43341"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-43239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43239"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-23156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23156"
},
{
"name": "CVE-2026-46060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46060"
},
{
"name": "CVE-2025-71193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71193"
},
{
"name": "CVE-2026-23095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23095"
},
{
"name": "CVE-2026-45882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45882"
},
{
"name": "CVE-2026-46084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46084"
},
{
"name": "CVE-2026-46079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46079"
},
{
"name": "CVE-2025-71163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71163"
},
{
"name": "CVE-2026-23062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23062"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23160"
},
{
"name": "CVE-2026-46333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46333"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-43071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43071"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-46085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46085"
},
{
"name": "CVE-2026-22984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22984"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47333"
},
{
"name": "CVE-2026-46029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46029"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2026-45898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45898"
},
{
"name": "CVE-2026-23206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23206"
},
{
"name": "CVE-2024-58097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58097"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-46021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46021"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-23033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23033"
},
{
"name": "CVE-2026-31676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31676"
},
{
"name": "CVE-2026-43318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43318"
},
{
"name": "CVE-2026-22977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22977"
},
{
"name": "CVE-2026-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23145"
},
{
"name": "CVE-2026-43186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43186"
},
{
"name": "CVE-2026-43083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43083"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-23003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23003"
},
{
"name": "CVE-2026-31649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31649"
},
{
"name": "CVE-2026-31719",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31719"
},
{
"name": "CVE-2026-23076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23076"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2025-68823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68823"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43256"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-23394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23394"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-23010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23010"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-23272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23272"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-45872",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45872"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-31575",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31575"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-31589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31589"
},
{
"name": "CVE-2026-23084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23084"
},
{
"name": "CVE-2026-23190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23190"
},
{
"name": "CVE-2026-22979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22979"
},
{
"name": "CVE-2026-43114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43114"
},
{
"name": "CVE-2026-31702",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31702"
},
{
"name": "CVE-2026-23011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23011"
},
{
"name": "CVE-2026-31587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31587"
},
{
"name": "CVE-2026-43278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43278"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52906"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-31708",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31708"
},
{
"name": "CVE-2026-23110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23110"
},
{
"name": "CVE-2026-46093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46093"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2026-31657",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31657"
},
{
"name": "CVE-2026-43125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43125"
},
{
"name": "CVE-2026-46025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46025"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-46246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46246"
},
{
"name": "CVE-2026-46003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46003"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2026-45921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45921"
},
{
"name": "CVE-2026-23148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23148"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-43169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43169"
},
{
"name": "CVE-2025-71197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71197"
},
{
"name": "CVE-2026-43175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43175"
},
{
"name": "CVE-2026-43320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43320"
},
{
"name": "CVE-2026-23031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23031"
},
{
"name": "CVE-2026-52907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52907"
},
{
"name": "CVE-2026-23102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23102"
},
{
"name": "CVE-2026-22998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22998"
},
{
"name": "CVE-2026-23050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23050"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-46096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46096"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-45849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45849"
},
{
"name": "CVE-2026-31706",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31706"
},
{
"name": "CVE-2026-31436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31436"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-43214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43214"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2025-71272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71272"
},
{
"name": "CVE-2026-23113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23113"
},
{
"name": "CVE-2025-71231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71231"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-46251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46251"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-23097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23097"
},
{
"name": "CVE-2026-31700",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31700"
},
{
"name": "CVE-2026-43212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43212"
},
{
"name": "CVE-2026-46089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46089"
},
{
"name": "CVE-2025-71198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71198"
},
{
"name": "CVE-2026-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52933"
},
{
"name": "CVE-2026-43128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43128"
},
{
"name": "CVE-2026-23021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23021"
},
{
"name": "CVE-2026-43250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43250"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-23093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23093"
},
{
"name": "CVE-2026-46028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46028"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2025-71183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71183"
},
{
"name": "CVE-2026-23249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23249"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-31710",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31710"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-43072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43072"
},
{
"name": "CVE-2026-23053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23053"
},
{
"name": "CVE-2026-46014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46014"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2025-71184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71184"
},
{
"name": "CVE-2026-46052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46052"
},
{
"name": "CVE-2026-46061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46061"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2025-71305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71305"
},
{
"name": "CVE-2026-43297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43297"
},
{
"name": "CVE-2025-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68263"
},
{
"name": "CVE-2026-45938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45938"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-43157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43157"
},
{
"name": "CVE-2026-45947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45947"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-46284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46284"
},
{
"name": "CVE-2026-46039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46039"
},
{
"name": "CVE-2026-46155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46155"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-31579",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31579"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-46048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46048"
},
{
"name": "CVE-2026-43137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43137"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-46254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46254"
},
{
"name": "CVE-2026-23080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23080"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-23351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23351"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-23254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23254"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-46058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46058"
},
{
"name": "CVE-2026-43494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43494"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
}
],
"initial_release_date": "2026-07-03T00:00:00",
"last_revision_date": "2026-07-03T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0831",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-07-03T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8491-1",
"url": "https://ubuntu.com/security/notices/USN-8491-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8497-1",
"url": "https://ubuntu.com/security/notices/USN-8497-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8499-1",
"url": "https://ubuntu.com/security/notices/USN-8499-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8493-2",
"url": "https://ubuntu.com/security/notices/USN-8493-2"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8488-1",
"url": "https://ubuntu.com/security/notices/USN-8488-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-2",
"url": "https://ubuntu.com/security/notices/USN-8492-2"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8498-1",
"url": "https://ubuntu.com/security/notices/USN-8498-1"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8489-1",
"url": "https://ubuntu.com/security/notices/USN-8489-1"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-1",
"url": "https://ubuntu.com/security/notices/USN-8492-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8488-2",
"url": "https://ubuntu.com/security/notices/USN-8488-2"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8493-1",
"url": "https://ubuntu.com/security/notices/USN-8493-1"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8490-1",
"url": "https://ubuntu.com/security/notices/USN-8490-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8501-1",
"url": "https://ubuntu.com/security/notices/USN-8501-1"
}
]
}
CERTFR-2026-AVI-0861
Vulnerability from certfr_avis - Published: 2026-07-10 - Updated: 2026-07-10
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 25.10",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-46325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46325"
},
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-23198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23198"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-43078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43078"
},
{
"name": "CVE-2026-31713",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31713"
},
{
"name": "CVE-2026-23202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23202"
},
{
"name": "CVE-2026-45905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45905"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-43414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43414"
},
{
"name": "CVE-2026-46010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46010"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2026-31582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31582"
},
{
"name": "CVE-2026-46045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46045"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2025-71134",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71134"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2026-46081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46081"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-45884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45884"
},
{
"name": "CVE-2026-46087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46087"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-46255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46255"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2021-47202",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47202"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-31402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31402"
},
{
"name": "CVE-2026-46042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46042"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-43317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43317"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2026-46076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46076"
},
{
"name": "CVE-2026-23450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23450"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2026-31704",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31704"
},
{
"name": "CVE-2026-31685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31685"
},
{
"name": "CVE-2026-43073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43073"
},
{
"name": "CVE-2026-43143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43143"
},
{
"name": "CVE-2026-46013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46013"
},
{
"name": "CVE-2026-46065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46065"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2026-31593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31593"
},
{
"name": "CVE-2026-46007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46007"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-45923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45923"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-45910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45910"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-31600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31600"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-45928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45928"
},
{
"name": "CVE-2026-45988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45988"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-46063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46063"
},
{
"name": "CVE-2026-46280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46280"
},
{
"name": "CVE-2026-43011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43011"
},
{
"name": "CVE-2026-43167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43167"
},
{
"name": "CVE-2026-45976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45976"
},
{
"name": "CVE-2026-43248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43248"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-46287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46287"
},
{
"name": "CVE-2025-71088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71088"
},
{
"name": "CVE-2026-31613",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31613"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-46032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46032"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2026-31574",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31574"
},
{
"name": "CVE-2026-46057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46057"
},
{
"name": "CVE-2026-23258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23258"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2026-43284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43284"
},
{
"name": "CVE-2026-45995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45995"
},
{
"name": "CVE-2026-46034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46034"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-45996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45996"
},
{
"name": "CVE-2026-46286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46286"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-43244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43244"
},
{
"name": "CVE-2026-31711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31711"
},
{
"name": "CVE-2026-31611",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31611"
},
{
"name": "CVE-2026-43201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43201"
},
{
"name": "CVE-2024-56643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56643"
},
{
"name": "CVE-2026-31714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31714"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-46260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46260"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-31431",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31431"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-43319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43319"
},
{
"name": "CVE-2026-46092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46092"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2026-31614",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31614"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2025-71090",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71090"
},
{
"name": "CVE-2026-46001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46001"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-46071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46071"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-45851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45851"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-31478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31478"
},
{
"name": "CVE-2025-71142",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71142"
},
{
"name": "CVE-2026-45859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45859"
},
{
"name": "CVE-2026-46066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46066"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-43153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43153"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-45917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45917"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-46031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46031"
},
{
"name": "CVE-2026-46277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46277"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-45865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45865"
},
{
"name": "CVE-2026-31635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31635"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-43033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43033"
},
{
"name": "CVE-2026-46265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46265"
},
{
"name": "CVE-2026-45972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45972"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-46074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46074"
},
{
"name": "CVE-2026-31595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31595"
},
{
"name": "CVE-2026-46332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46332"
},
{
"name": "CVE-2026-43503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43503"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-45989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45989"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2025-71144",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71144"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-45881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45881"
},
{
"name": "CVE-2026-43350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43350"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2026-43376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43376"
},
{
"name": "CVE-2026-23256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23256"
},
{
"name": "CVE-2026-46261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46261"
},
{
"name": "CVE-2026-31659",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31659"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2026-45861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45861"
},
{
"name": "CVE-2026-31591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31591"
},
{
"name": "CVE-2026-46041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46041"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2026-43117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43117"
},
{
"name": "CVE-2026-46083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46083"
},
{
"name": "CVE-2026-45914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45914"
},
{
"name": "CVE-2026-43493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43493"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-43383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43383"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-43500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43500"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-31703",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31703"
},
{
"name": "CVE-2026-46097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46097"
},
{
"name": "CVE-2026-23273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23273"
},
{
"name": "CVE-2026-23230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23230"
},
{
"name": "CVE-2026-46030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46030"
},
{
"name": "CVE-2026-43170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43170"
},
{
"name": "CVE-2026-31693",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31693"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-43150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43150"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45913"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-46005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46005"
},
{
"name": "CVE-2026-45962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45962"
},
{
"name": "CVE-2026-31718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31718"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-46247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46247"
},
{
"name": "CVE-2026-46069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46069"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2026-46288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46288"
},
{
"name": "CVE-2026-43288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43288"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2025-71294",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71294"
},
{
"name": "CVE-2026-31609",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31609"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-31533",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31533"
},
{
"name": "CVE-2026-46059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46059"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-46103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46103"
},
{
"name": "CVE-2026-43348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43348"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-46043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46043"
},
{
"name": "CVE-2026-31601",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31601"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-31418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31418"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-45981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45981"
},
{
"name": "CVE-2026-31620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31620"
},
{
"name": "CVE-2026-43197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43197"
},
{
"name": "CVE-2026-46278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46278"
},
{
"name": "CVE-2026-46011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46011"
},
{
"name": "CVE-2026-46095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46095"
},
{
"name": "CVE-2026-43253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43253"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2025-71220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71220"
},
{
"name": "CVE-2025-71295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71295"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-43491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43491"
},
{
"name": "CVE-2026-46100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46100"
},
{
"name": "CVE-2026-46012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46012"
},
{
"name": "CVE-2026-31606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31606"
},
{
"name": "CVE-2026-23180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23180"
},
{
"name": "CVE-2026-45999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45999"
},
{
"name": "CVE-2026-45973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45973"
},
{
"name": "CVE-2026-43249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43249"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2026-31705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31705"
},
{
"name": "CVE-2026-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52905"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-45966",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45966"
},
{
"name": "CVE-2026-23262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23262"
},
{
"name": "CVE-2026-46038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46038"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-45878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45878"
},
{
"name": "CVE-2026-23267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23267"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-45982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45982"
},
{
"name": "CVE-2026-31669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31669"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-23216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23216"
},
{
"name": "CVE-2026-46276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46276"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-31608",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31608"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-43173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43173"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-43077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43077"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-46283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46283"
},
{
"name": "CVE-2026-45957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45957"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-23427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23427"
},
{
"name": "CVE-2026-46020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46020"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2026-45997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45997"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-43402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43402"
},
{
"name": "CVE-2025-71286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71286"
},
{
"name": "CVE-2026-46090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46090"
},
{
"name": "CVE-2026-23176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23176"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-46300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46300"
},
{
"name": "CVE-2026-43271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43271"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2026-46026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46026"
},
{
"name": "CVE-2026-43258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43258"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-43304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43304"
},
{
"name": "CVE-2026-45886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45886"
},
{
"name": "CVE-2026-43378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43378"
},
{
"name": "CVE-2026-43384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43384"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2025-71141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71141"
},
{
"name": "CVE-2026-43501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43501"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2025-71224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71224"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2026-23193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23193"
},
{
"name": "CVE-2026-31610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31610"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-46008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46008"
},
{
"name": "CVE-2026-43238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43238"
},
{
"name": "CVE-2026-31592",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31592"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-45991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45991"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-31712",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31712"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-31707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31707"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-45880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45880"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-46067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46067"
},
{
"name": "CVE-2026-43349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43349"
},
{
"name": "CVE-2026-46036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46036"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-46279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46279"
},
{
"name": "CVE-2026-46135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46135"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-45990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45990"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2025-71222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71222"
},
{
"name": "CVE-2026-31504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31504"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-45895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45895"
},
{
"name": "CVE-2026-46075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46075"
},
{
"name": "CVE-2025-71229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71229"
},
{
"name": "CVE-2026-31607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31607"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-46054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46054"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-45877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45877"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-46282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46282"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-31637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31637"
},
{
"name": "CVE-2026-31612",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31612"
},
{
"name": "CVE-2026-23428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23428"
},
{
"name": "CVE-2026-23274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23274"
},
{
"name": "CVE-2026-43199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43199"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-46073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46073"
},
{
"name": "CVE-2026-31621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31621"
},
{
"name": "CVE-2025-71297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71297"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-31604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31604"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2025-71152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71152"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-31584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31584"
},
{
"name": "CVE-2026-31419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31419"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-43221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43221"
},
{
"name": "CVE-2026-46281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46281"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-31717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31717"
},
{
"name": "CVE-2026-43300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43300"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-43189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43189"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-46035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46035"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-31715",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31715"
},
{
"name": "CVE-2026-23278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23278"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-23257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23257"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-43222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43222"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-46016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46016"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46316"
},
{
"name": "CVE-2026-31682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31682"
},
{
"name": "CVE-2026-46068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46068"
},
{
"name": "CVE-2026-43406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43406"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2026-45893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45893"
},
{
"name": "CVE-2026-46056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46056"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2026-23182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23182"
},
{
"name": "CVE-2026-31709",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31709"
},
{
"name": "CVE-2026-43215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43215"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-52904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52904"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-46086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46086"
},
{
"name": "CVE-2025-71273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71273"
},
{
"name": "CVE-2025-71291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71291"
},
{
"name": "CVE-2026-46094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46094"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-23455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23455"
},
{
"name": "CVE-2026-23233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23233"
},
{
"name": "CVE-2026-43341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43341"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-43239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43239"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-46060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46060"
},
{
"name": "CVE-2026-45882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45882"
},
{
"name": "CVE-2026-46084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46084"
},
{
"name": "CVE-2026-46079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46079"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-46333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46333"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-43071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43071"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-46085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46085"
},
{
"name": "CVE-2025-71155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71155"
},
{
"name": "CVE-2026-22984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22984"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-46029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46029"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2026-45898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45898"
},
{
"name": "CVE-2026-23206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23206"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-46021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46021"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-43318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43318"
},
{
"name": "CVE-2026-43186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43186"
},
{
"name": "CVE-2026-43083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43083"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-31649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31649"
},
{
"name": "CVE-2026-31719",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31719"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43256"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-23394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23394"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-23272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23272"
},
{
"name": "CVE-2026-23112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23112"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-45872",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45872"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-31575",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31575"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-31589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31589"
},
{
"name": "CVE-2026-23190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23190"
},
{
"name": "CVE-2026-43114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43114"
},
{
"name": "CVE-2026-31702",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31702"
},
{
"name": "CVE-2026-31587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31587"
},
{
"name": "CVE-2026-43278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43278"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52906"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-31708",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31708"
},
{
"name": "CVE-2026-46093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46093"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2026-31657",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31657"
},
{
"name": "CVE-2026-43125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43125"
},
{
"name": "CVE-2026-46025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46025"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-46246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46246"
},
{
"name": "CVE-2026-46003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46003"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2026-45921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45921"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-43169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43169"
},
{
"name": "CVE-2026-43175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43175"
},
{
"name": "CVE-2026-43320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43320"
},
{
"name": "CVE-2025-71127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71127"
},
{
"name": "CVE-2026-52907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52907"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-46096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46096"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-45849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45849"
},
{
"name": "CVE-2026-31706",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31706"
},
{
"name": "CVE-2026-31436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31436"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-43214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43214"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2025-71272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71272"
},
{
"name": "CVE-2025-71231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71231"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-46251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46251"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-31700",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31700"
},
{
"name": "CVE-2026-43212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43212"
},
{
"name": "CVE-2026-46089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46089"
},
{
"name": "CVE-2026-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52933"
},
{
"name": "CVE-2026-43128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43128"
},
{
"name": "CVE-2026-23231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23231"
},
{
"name": "CVE-2026-43250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43250"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-46028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46028"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2026-23249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23249"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-31710",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31710"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-43072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43072"
},
{
"name": "CVE-2026-46014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46014"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2026-46052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46052"
},
{
"name": "CVE-2026-46061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46061"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2025-71305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71305"
},
{
"name": "CVE-2026-43297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43297"
},
{
"name": "CVE-2025-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68263"
},
{
"name": "CVE-2026-45938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45938"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-43157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43157"
},
{
"name": "CVE-2026-45947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45947"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-46284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46284"
},
{
"name": "CVE-2026-46039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46039"
},
{
"name": "CVE-2026-46155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46155"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-31579",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31579"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-43137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43137"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-46254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46254"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-23351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23351"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-46058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46058"
},
{
"name": "CVE-2026-43494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43494"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
}
],
"initial_release_date": "2026-07-10T00:00:00",
"last_revision_date": "2026-07-10T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0861",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-07-10T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8527-1",
"url": "https://ubuntu.com/security/notices/USN-8527-1"
},
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8528-1",
"url": "https://ubuntu.com/security/notices/USN-8528-1"
},
{
"published_at": "2026-07-06",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8507-1",
"url": "https://ubuntu.com/security/notices/USN-8507-1"
},
{
"published_at": "2026-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8490-2",
"url": "https://ubuntu.com/security/notices/USN-8490-2"
},
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8530-1",
"url": "https://ubuntu.com/security/notices/USN-8530-1"
},
{
"published_at": "2026-07-06",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8508-1",
"url": "https://ubuntu.com/security/notices/USN-8508-1"
},
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8529-1",
"url": "https://ubuntu.com/security/notices/USN-8529-1"
},
{
"published_at": "2026-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-4",
"url": "https://ubuntu.com/security/notices/USN-8492-4"
},
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-5",
"url": "https://ubuntu.com/security/notices/USN-8492-5"
},
{
"published_at": "2026-07-06",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-3",
"url": "https://ubuntu.com/security/notices/USN-8492-3"
}
]
}
CERTFR-2026-AVI-0927
Vulnerability from certfr_avis - Published: 2026-07-24 - Updated: 2026-07-24
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une atteinte à la confidentialité des données, une atteinte à l'intégrité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | N/A | SUSE Linux Micro 6.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP7 | ||
| SUSE | N/A | SUSE Linux Micro 6.0 | ||
| SUSE | N/A | Legacy Module 15-SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Micro 6.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 LTSS | ||
| SUSE | N/A | SUSE Linux Micro Extras 6.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP7 | ||
| SUSE | N/A | Basesystem Module 15-SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro Extras 6.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-43198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43198"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53192"
},
{
"name": "CVE-2026-43113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43113"
},
{
"name": "CVE-2026-31522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31522"
},
{
"name": "CVE-2026-43366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43366"
},
{
"name": "CVE-2026-31770",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31770"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-46211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46211"
},
{
"name": "CVE-2026-43298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43298"
},
{
"name": "CVE-2026-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53272"
},
{
"name": "CVE-2026-46184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46184"
},
{
"name": "CVE-2026-53049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53049"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2026-31756",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31756"
},
{
"name": "CVE-2026-52955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52955"
},
{
"name": "CVE-2026-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53350"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2026-52957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52957"
},
{
"name": "CVE-2026-46307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46307"
},
{
"name": "CVE-2026-43468",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43468"
},
{
"name": "CVE-2026-45884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45884"
},
{
"name": "CVE-2026-43374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43374"
},
{
"name": "CVE-2026-31485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31485"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-43373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43373"
},
{
"name": "CVE-2026-53090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53090"
},
{
"name": "CVE-2026-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53287"
},
{
"name": "CVE-2026-46124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46124"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53274"
},
{
"name": "CVE-2026-53202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53202"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2026-31754",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31754"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-53218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53218"
},
{
"name": "CVE-2026-31758",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31758"
},
{
"name": "CVE-2026-46076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46076"
},
{
"name": "CVE-2026-53041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53041"
},
{
"name": "CVE-2026-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53066"
},
{
"name": "CVE-2026-43161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43161"
},
{
"name": "CVE-2026-43457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43457"
},
{
"name": "CVE-2026-45922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45922"
},
{
"name": "CVE-2026-43119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43119"
},
{
"name": "CVE-2026-53143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53143"
},
{
"name": "CVE-2026-31685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31685"
},
{
"name": "CVE-2026-53161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53161"
},
{
"name": "CVE-2026-43240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43240"
},
{
"name": "CVE-2026-52958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52958"
},
{
"name": "CVE-2026-53140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53140"
},
{
"name": "CVE-2026-43143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43143"
},
{
"name": "CVE-2026-46319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46319"
},
{
"name": "CVE-2026-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53229"
},
{
"name": "CVE-2026-43470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43470"
},
{
"name": "CVE-2026-43492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43492"
},
{
"name": "CVE-2026-46065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46065"
},
{
"name": "CVE-2026-46227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46227"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2026-53040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53040"
},
{
"name": "CVE-2026-43062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43062"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-45923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45923"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-43294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43294"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-43339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43339"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-45928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45928"
},
{
"name": "CVE-2026-31664",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31664"
},
{
"name": "CVE-2023-20585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-20585"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2026-43118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43118"
},
{
"name": "CVE-2026-46112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46112"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-45853",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45853"
},
{
"name": "CVE-2026-31549",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31549"
},
{
"name": "CVE-2026-31752",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31752"
},
{
"name": "CVE-2026-31513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31513"
},
{
"name": "CVE-2026-43476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43476"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-52989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52989"
},
{
"name": "CVE-2026-46063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46063"
},
{
"name": "CVE-2026-43064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43064"
},
{
"name": "CVE-2026-52924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52924"
},
{
"name": "CVE-2026-53227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53227"
},
{
"name": "CVE-2026-43011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43011"
},
{
"name": "CVE-2026-45901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45901"
},
{
"name": "CVE-2026-43167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43167"
},
{
"name": "CVE-2026-45976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45976"
},
{
"name": "CVE-2026-43248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43248"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53239"
},
{
"name": "CVE-2026-43092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43092"
},
{
"name": "CVE-2026-31680",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31680"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53181"
},
{
"name": "CVE-2026-43465",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43465"
},
{
"name": "CVE-2026-46233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46233"
},
{
"name": "CVE-2026-52918",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52918"
},
{
"name": "CVE-2026-45888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45888"
},
{
"name": "CVE-2026-52963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52963"
},
{
"name": "CVE-2026-46140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46140"
},
{
"name": "CVE-2026-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53286"
},
{
"name": "CVE-2026-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53081"
},
{
"name": "CVE-2026-31751",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31751"
},
{
"name": "CVE-2026-43429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43429"
},
{
"name": "CVE-2026-53224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53224"
},
{
"name": "CVE-2026-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53360"
},
{
"name": "CVE-2026-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52993"
},
{
"name": "CVE-2026-43284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43284"
},
{
"name": "CVE-2026-46231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46231"
},
{
"name": "CVE-2026-43010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43010"
},
{
"name": "CVE-2026-45835",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45835"
},
{
"name": "CVE-2026-43382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43382"
},
{
"name": "CVE-2026-52956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52956"
},
{
"name": "CVE-2026-52943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52943"
},
{
"name": "CVE-2026-43025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43025"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-45996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45996"
},
{
"name": "CVE-2026-46229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46229"
},
{
"name": "CVE-2026-46286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46286"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-43496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43496"
},
{
"name": "CVE-2026-43324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43324"
},
{
"name": "CVE-2026-52915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52915"
},
{
"name": "CVE-2026-46173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46173"
},
{
"name": "CVE-2026-43244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43244"
},
{
"name": "CVE-2026-46204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46204"
},
{
"name": "CVE-2026-46214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46214"
},
{
"name": "CVE-2026-53146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53146"
},
{
"name": "CVE-2026-43053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43053"
},
{
"name": "CVE-2026-53103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53103"
},
{
"name": "CVE-2026-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53313"
},
{
"name": "CVE-2026-31502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31502"
},
{
"name": "CVE-2026-43018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43018"
},
{
"name": "CVE-2026-43014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43014"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-31447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31447"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-43319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43319"
},
{
"name": "CVE-2026-43445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43445"
},
{
"name": "CVE-2026-46320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46320"
},
{
"name": "CVE-2026-46092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46092"
},
{
"name": "CVE-2026-43488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43488"
},
{
"name": "CVE-2026-43387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43387"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2026-43028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43028"
},
{
"name": "CVE-2026-31511",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31511"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-46236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46236"
},
{
"name": "CVE-2026-43220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43220"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-31548",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31548"
},
{
"name": "CVE-2026-43415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43415"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-46071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46071"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-53071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53071"
},
{
"name": "CVE-2026-45841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45841"
},
{
"name": "CVE-2026-43022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43022"
},
{
"name": "CVE-2026-31524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31524"
},
{
"name": "CVE-2026-31568",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31568"
},
{
"name": "CVE-2026-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53150"
},
{
"name": "CVE-2026-45851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45851"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-31505",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31505"
},
{
"name": "CVE-2026-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53147"
},
{
"name": "CVE-2026-46190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46190"
},
{
"name": "CVE-2026-46331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46331"
},
{
"name": "CVE-2026-46252",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46252"
},
{
"name": "CVE-2026-53015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53015"
},
{
"name": "CVE-2026-43436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43436"
},
{
"name": "CVE-2026-53013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53013"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-52995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52995"
},
{
"name": "CVE-2026-52931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52931"
},
{
"name": "CVE-2026-52951",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52951"
},
{
"name": "CVE-2026-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53058"
},
{
"name": "CVE-2026-43047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43047"
},
{
"name": "CVE-2026-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53047"
},
{
"name": "CVE-2026-52961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52961"
},
{
"name": "CVE-2026-43432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43432"
},
{
"name": "CVE-2026-31545",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31545"
},
{
"name": "CVE-2026-46186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46186"
},
{
"name": "CVE-2026-43458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43458"
},
{
"name": "CVE-2026-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52919"
},
{
"name": "CVE-2026-43450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43450"
},
{
"name": "CVE-2026-43345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43345"
},
{
"name": "CVE-2026-31510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31510"
},
{
"name": "CVE-2026-43243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43243"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2026-43069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43069"
},
{
"name": "CVE-2026-43425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43425"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-45881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45881"
},
{
"name": "CVE-2026-46261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46261"
},
{
"name": "CVE-2026-31659",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31659"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53339"
},
{
"name": "CVE-2026-53266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53266"
},
{
"name": "CVE-2026-45861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45861"
},
{
"name": "CVE-2026-43480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43480"
},
{
"name": "CVE-2026-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53149"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-46116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46116"
},
{
"name": "CVE-2026-43213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43213"
},
{
"name": "CVE-2026-43057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43057"
},
{
"name": "CVE-2026-43426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43426"
},
{
"name": "CVE-2026-43443",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43443"
},
{
"name": "CVE-2026-43117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43117"
},
{
"name": "CVE-2026-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53176"
},
{
"name": "CVE-2026-31663",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31663"
},
{
"name": "CVE-2026-43074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43074"
},
{
"name": "CVE-2026-46151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46151"
},
{
"name": "CVE-2026-45914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45914"
},
{
"name": "CVE-2026-43493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43493"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-45911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45911"
},
{
"name": "CVE-2026-43383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43383"
},
{
"name": "CVE-2026-46220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46220"
},
{
"name": "CVE-2026-52975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52975"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-31647",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31647"
},
{
"name": "CVE-2026-53050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53050"
},
{
"name": "CVE-2026-43080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43080"
},
{
"name": "CVE-2026-46146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46146"
},
{
"name": "CVE-2026-31693",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31693"
},
{
"name": "CVE-2026-46178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46178"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-43036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43036"
},
{
"name": "CVE-2026-53021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53021"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-43327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43327"
},
{
"name": "CVE-2025-39894",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39894"
},
{
"name": "CVE-2026-31566",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31566"
},
{
"name": "CVE-2026-46005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46005"
},
{
"name": "CVE-2026-43381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43381"
},
{
"name": "CVE-2026-31763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31763"
},
{
"name": "CVE-2026-45894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45894"
},
{
"name": "CVE-2026-46247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46247"
},
{
"name": "CVE-2026-46069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46069"
},
{
"name": "CVE-2026-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53178"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2026-31670",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31670"
},
{
"name": "CVE-2026-31765",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31765"
},
{
"name": "CVE-2026-46122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46122"
},
{
"name": "CVE-2026-53158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53158"
},
{
"name": "CVE-2026-31533",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31533"
},
{
"name": "CVE-2026-46059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46059"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-31469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31469"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-31498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31498"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-46103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46103"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-31520",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31520"
},
{
"name": "CVE-2026-53190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53190"
},
{
"name": "CVE-2026-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46120"
},
{
"name": "CVE-2026-46198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46198"
},
{
"name": "CVE-2026-43336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43336"
},
{
"name": "CVE-2026-43104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43104"
},
{
"name": "CVE-2026-52954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52954"
},
{
"name": "CVE-2026-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53249"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-53329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53329"
},
{
"name": "CVE-2026-45981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45981"
},
{
"name": "CVE-2026-53139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53139"
},
{
"name": "CVE-2026-43466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43466"
},
{
"name": "CVE-2026-46011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46011"
},
{
"name": "CVE-2026-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53217"
},
{
"name": "CVE-2026-53262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53262"
},
{
"name": "CVE-2026-46128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46128"
},
{
"name": "CVE-2026-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53070"
},
{
"name": "CVE-2026-31555",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31555"
},
{
"name": "CVE-2026-43253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43253"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-43491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43491"
},
{
"name": "CVE-2026-46242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46242"
},
{
"name": "CVE-2026-43403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43403"
},
{
"name": "CVE-2026-53065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53065"
},
{
"name": "CVE-2026-45963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45963"
},
{
"name": "CVE-2026-31661",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31661"
},
{
"name": "CVE-2026-43380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43380"
},
{
"name": "CVE-2026-43452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43452"
},
{
"name": "CVE-2026-46197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46197"
},
{
"name": "CVE-2026-43017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43017"
},
{
"name": "CVE-2026-52914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52914"
},
{
"name": "CVE-2026-43467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43467"
},
{
"name": "CVE-2026-52916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52916"
},
{
"name": "CVE-2026-46330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46330"
},
{
"name": "CVE-2026-53009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53009"
},
{
"name": "CVE-2026-45999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45999"
},
{
"name": "CVE-2026-53225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53225"
},
{
"name": "CVE-2026-43019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43019"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2026-43043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43043"
},
{
"name": "CVE-2026-43260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43260"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53362"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53168"
},
{
"name": "CVE-2026-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52922"
},
{
"name": "CVE-2026-53053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53053"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-43051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43051"
},
{
"name": "CVE-2026-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53209"
},
{
"name": "CVE-2026-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53112"
},
{
"name": "CVE-2026-46206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46206"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-53086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53086"
},
{
"name": "CVE-2026-31781",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31781"
},
{
"name": "CVE-2026-43449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43449"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-31523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31523"
},
{
"name": "CVE-2026-45982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45982"
},
{
"name": "CVE-2026-43459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43459"
},
{
"name": "CVE-2026-45940",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45940"
},
{
"name": "CVE-2025-10263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10263"
},
{
"name": "CVE-2026-31450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31450"
},
{
"name": "CVE-2026-53135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53135"
},
{
"name": "CVE-2026-31749",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31749"
},
{
"name": "CVE-2026-43024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43024"
},
{
"name": "CVE-2026-53279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53279"
},
{
"name": "CVE-2026-45985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45985"
},
{
"name": "CVE-2026-46276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46276"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-52981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52981"
},
{
"name": "CVE-2026-46108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46108"
},
{
"name": "CVE-2026-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53167"
},
{
"name": "CVE-2026-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53060"
},
{
"name": "CVE-2026-31720",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31720"
},
{
"name": "CVE-2026-46321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46321"
},
{
"name": "CVE-2026-31748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31748"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-52908",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52908"
},
{
"name": "CVE-2026-45899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45899"
},
{
"name": "CVE-2026-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53237"
},
{
"name": "CVE-2026-53035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53035"
},
{
"name": "CVE-2026-53186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53186"
},
{
"name": "CVE-2026-31768",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31768"
},
{
"name": "CVE-2026-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53182"
},
{
"name": "CVE-2026-45997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45997"
},
{
"name": "CVE-2026-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53208"
},
{
"name": "CVE-2026-43405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43405"
},
{
"name": "CVE-2026-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53255"
},
{
"name": "CVE-2025-40341",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40341"
},
{
"name": "CVE-2026-43430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43430"
},
{
"name": "CVE-2026-43437",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43437"
},
{
"name": "CVE-2026-45920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45920"
},
{
"name": "CVE-2026-46150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46150"
},
{
"name": "CVE-2025-71286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71286"
},
{
"name": "CVE-2026-46090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46090"
},
{
"name": "CVE-2026-53347",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53347"
},
{
"name": "CVE-2026-43007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43007"
},
{
"name": "CVE-2026-45840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45840"
},
{
"name": "CVE-2026-53160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53160"
},
{
"name": "CVE-2026-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53245"
},
{
"name": "CVE-2026-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53195"
},
{
"name": "CVE-2026-46219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46219"
},
{
"name": "CVE-2026-43035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43035"
},
{
"name": "CVE-2026-31561",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31561"
},
{
"name": "CVE-2026-46172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46172"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2026-31429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31429"
},
{
"name": "CVE-2026-31665",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31665"
},
{
"name": "CVE-2026-46161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46161"
},
{
"name": "CVE-2026-53285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53285"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-31743",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31743"
},
{
"name": "CVE-2026-43304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43304"
},
{
"name": "CVE-2026-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53148"
},
{
"name": "CVE-2026-45961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45961"
},
{
"name": "CVE-2026-43384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43384"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-31672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31672"
},
{
"name": "CVE-2026-43501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43501"
},
{
"name": "CVE-2026-53133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53133"
},
{
"name": "CVE-2026-43093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43093"
},
{
"name": "CVE-2026-31780",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31780"
},
{
"name": "CVE-2026-43342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43342"
},
{
"name": "CVE-2026-31479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31479"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2026-43337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43337"
},
{
"name": "CVE-2026-43357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43357"
},
{
"name": "CVE-2026-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53263"
},
{
"name": "CVE-2026-46111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46111"
},
{
"name": "CVE-2026-43061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43061"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2026-43238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43238"
},
{
"name": "CVE-2026-46179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46179"
},
{
"name": "CVE-2026-43032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43032"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53356"
},
{
"name": "CVE-2026-43427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43427"
},
{
"name": "CVE-2026-46291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46291"
},
{
"name": "CVE-2026-43444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43444"
},
{
"name": "CVE-2026-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53073"
},
{
"name": "CVE-2026-46312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46312"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-43086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43086"
},
{
"name": "CVE-2026-31730",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31730"
},
{
"name": "CVE-2026-31660",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31660"
},
{
"name": "CVE-2026-31771",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31771"
},
{
"name": "CVE-2026-45880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45880"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-46294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46294"
},
{
"name": "CVE-2026-31728",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31728"
},
{
"name": "CVE-2026-46125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46125"
},
{
"name": "CVE-2026-46152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46152"
},
{
"name": "CVE-2026-52980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52980"
},
{
"name": "CVE-2026-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53194"
},
{
"name": "CVE-2026-43034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43034"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-43094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43094"
},
{
"name": "CVE-2026-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53242"
},
{
"name": "CVE-2026-43395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43395"
},
{
"name": "CVE-2026-53293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53293"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-31726",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31726"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2026-43370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43370"
},
{
"name": "CVE-2026-31773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31773"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-43204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43204"
},
{
"name": "CVE-2026-46075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46075"
},
{
"name": "CVE-2026-46167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46167"
},
{
"name": "CVE-2026-43162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43162"
},
{
"name": "CVE-2026-43015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43015"
},
{
"name": "CVE-2026-53137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53137"
},
{
"name": "CVE-2026-31509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31509"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-45877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45877"
},
{
"name": "CVE-2026-43346",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43346"
},
{
"name": "CVE-2026-46191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46191"
},
{
"name": "CVE-2026-43120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43120"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2026-43469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43469"
},
{
"name": "CVE-2026-43085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43085"
},
{
"name": "CVE-2026-31779",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31779"
},
{
"name": "CVE-2026-43199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43199"
},
{
"name": "CVE-2025-71297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71297"
},
{
"name": "CVE-2026-46274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46274"
},
{
"name": "CVE-2026-43020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43020"
},
{
"name": "CVE-2026-31761",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31761"
},
{
"name": "CVE-2026-31466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31466"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53258"
},
{
"name": "CVE-2026-31604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31604"
},
{
"name": "CVE-2026-43111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43111"
},
{
"name": "CVE-2026-52936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52936"
},
{
"name": "CVE-2026-46263",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46263"
},
{
"name": "CVE-2026-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53268"
},
{
"name": "CVE-2026-46313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46313"
},
{
"name": "CVE-2026-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53241"
},
{
"name": "CVE-2026-31414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31414"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-53159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53159"
},
{
"name": "CVE-2026-45958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45958"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-43221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43221"
},
{
"name": "CVE-2026-31778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31778"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2026-53039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53039"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-43300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43300"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-53080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53080"
},
{
"name": "CVE-2026-53004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53004"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-43189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43189"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-31552",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31552"
},
{
"name": "CVE-2026-52976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52976"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-43191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43191"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-43428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43428"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-53203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53203"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-31430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31430"
},
{
"name": "CVE-2026-43222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43222"
},
{
"name": "CVE-2026-46016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46016"
},
{
"name": "CVE-2025-71314",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71314"
},
{
"name": "CVE-2026-46136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46136"
},
{
"name": "CVE-2026-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53357"
},
{
"name": "CVE-2026-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53052"
},
{
"name": "CVE-2026-31497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31497"
},
{
"name": "CVE-2026-53136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53136"
},
{
"name": "CVE-2026-46068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46068"
},
{
"name": "CVE-2026-43456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43456"
},
{
"name": "CVE-2026-43406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43406"
},
{
"name": "CVE-2026-31570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31570"
},
{
"name": "CVE-2026-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53215"
},
{
"name": "CVE-2026-31755",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31755"
},
{
"name": "CVE-2026-46056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46056"
},
{
"name": "CVE-2026-46230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46230"
},
{
"name": "CVE-2026-52964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52964"
},
{
"name": "CVE-2026-46138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46138"
},
{
"name": "CVE-2026-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53216"
},
{
"name": "CVE-2026-43215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43215"
},
{
"name": "CVE-2026-53253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53253"
},
{
"name": "CVE-2026-31441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31441"
},
{
"name": "CVE-2026-53003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53003"
},
{
"name": "CVE-2026-46225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46225"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-52904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52904"
},
{
"name": "CVE-2026-52948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52948"
},
{
"name": "CVE-2026-46086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46086"
},
{
"name": "CVE-2026-43343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43343"
},
{
"name": "CVE-2025-71291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71291"
},
{
"name": "CVE-2026-53355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53355"
},
{
"name": "CVE-2026-46314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46314"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-43081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43081"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-46205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46205"
},
{
"name": "CVE-2026-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53359"
},
{
"name": "CVE-2026-53016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53016"
},
{
"name": "CVE-2026-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46218"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-31551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31551"
},
{
"name": "CVE-2026-31495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31495"
},
{
"name": "CVE-2026-46132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46132"
},
{
"name": "CVE-2026-46160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46160"
},
{
"name": "CVE-2026-46177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46177"
},
{
"name": "CVE-2026-46131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46131"
},
{
"name": "CVE-2026-46079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46079"
},
{
"name": "CVE-2026-53256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53256"
},
{
"name": "CVE-2026-53306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53306"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2025-71302",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71302"
},
{
"name": "CVE-2026-31762",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31762"
},
{
"name": "CVE-2026-43353",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43353"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-43303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43303"
},
{
"name": "CVE-2026-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53045"
},
{
"name": "CVE-2026-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43098"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-43386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43386"
},
{
"name": "CVE-2026-31492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31492"
},
{
"name": "CVE-2026-43089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43089"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-46162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46162"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-43318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43318"
},
{
"name": "CVE-2026-43083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43083"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-23393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23393"
},
{
"name": "CVE-2026-43502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43502"
},
{
"name": "CVE-2026-31674",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31674"
},
{
"name": "CVE-2026-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53056"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43027"
},
{
"name": "CVE-2026-43256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43256"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-52909",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52909"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-46163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46163"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-45858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45858"
},
{
"name": "CVE-2026-23394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23394"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-46235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46235"
},
{
"name": "CVE-2026-45838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45838"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-43109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43109"
},
{
"name": "CVE-2026-45933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45933"
},
{
"name": "CVE-2026-53098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53098"
},
{
"name": "CVE-2026-43497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43497"
},
{
"name": "CVE-2026-31776",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31776"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-31560",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31560"
},
{
"name": "CVE-2026-52962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52962"
},
{
"name": "CVE-2026-43101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43101"
},
{
"name": "CVE-2026-52953",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52953"
},
{
"name": "CVE-2026-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53093"
},
{
"name": "CVE-2026-53144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53144"
},
{
"name": "CVE-2026-43412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43412"
},
{
"name": "CVE-2026-46187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46187"
},
{
"name": "CVE-2026-31678",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31678"
},
{
"name": "CVE-2026-31587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31587"
},
{
"name": "CVE-2026-53075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53075"
},
{
"name": "CVE-2026-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53246"
},
{
"name": "CVE-2026-43278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43278"
},
{
"name": "CVE-2026-31540",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31540"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53325"
},
{
"name": "CVE-2026-45837",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45837"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-31651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31651"
},
{
"name": "CVE-2026-43471",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43471"
},
{
"name": "CVE-2026-46093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46093"
},
{
"name": "CVE-2026-31503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31503"
},
{
"name": "CVE-2026-31657",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31657"
},
{
"name": "CVE-2026-46201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46201"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-31747",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31747"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-43016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43016"
},
{
"name": "CVE-2026-43129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43129"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-43340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43340"
},
{
"name": "CVE-2026-45921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45921"
},
{
"name": "CVE-2026-53358",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53358"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-43169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43169"
},
{
"name": "CVE-2026-31474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31474"
},
{
"name": "CVE-2026-43175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43175"
},
{
"name": "CVE-2026-31646",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31646"
},
{
"name": "CVE-2026-43320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43320"
},
{
"name": "CVE-2026-23451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23451"
},
{
"name": "CVE-2026-53254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53254"
},
{
"name": "CVE-2026-53078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53078"
},
{
"name": "CVE-2026-31439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31439"
},
{
"name": "CVE-2026-53037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53037"
},
{
"name": "CVE-2026-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53072"
},
{
"name": "CVE-2026-31727",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31727"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53281"
},
{
"name": "CVE-2026-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53068"
},
{
"name": "CVE-2026-46166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46166"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-43397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43397"
},
{
"name": "CVE-2026-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53213"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-43473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43473"
},
{
"name": "CVE-2026-46216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46216"
},
{
"name": "CVE-2026-46275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46275"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-43107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43107"
},
{
"name": "CVE-2026-23248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23248"
},
{
"name": "CVE-2026-53366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53366"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-46143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46143"
},
{
"name": "CVE-2026-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52923"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2026-46212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46212"
},
{
"name": "CVE-2026-45834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45834"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-46089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46089"
},
{
"name": "CVE-2026-43351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43351"
},
{
"name": "CVE-2026-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52933"
},
{
"name": "CVE-2026-43128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43128"
},
{
"name": "CVE-2026-46199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46199"
},
{
"name": "CVE-2026-43105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43105"
},
{
"name": "CVE-2026-43090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43090"
},
{
"name": "CVE-2026-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53122"
},
{
"name": "CVE-2026-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53196"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-46207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46207"
},
{
"name": "CVE-2026-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53156"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-52969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52969"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-43072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43072"
},
{
"name": "CVE-2026-46232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46232"
},
{
"name": "CVE-2026-46165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46165"
},
{
"name": "CVE-2026-46052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46052"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-31452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31452"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2025-71305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71305"
},
{
"name": "CVE-2026-31499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31499"
},
{
"name": "CVE-2026-52926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52926"
},
{
"name": "CVE-2026-46238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46238"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-43157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43157"
},
{
"name": "CVE-2026-43177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43177"
},
{
"name": "CVE-2026-45947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45947"
},
{
"name": "CVE-2026-31440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31440"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-52972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52972"
},
{
"name": "CVE-2026-46322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46322"
},
{
"name": "CVE-2026-53036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53036"
},
{
"name": "CVE-2026-45839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45839"
},
{
"name": "CVE-2026-23276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23276"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-46048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46048"
},
{
"name": "CVE-2026-52982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52982"
},
{
"name": "CVE-2026-43137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43137"
},
{
"name": "CVE-2026-46254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46254"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-53022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53022"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-31438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31438"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-46058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46058"
},
{
"name": "CVE-2026-43494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43494"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
},
{
"name": "CVE-2026-31673",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31673"
},
{
"name": "CVE-2026-31667",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31667"
}
],
"initial_release_date": "2026-07-24T00:00:00",
"last_revision_date": "2026-07-24T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0927",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-07-24T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es, une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2026-07-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22762-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622762-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22735-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622735-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22693-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622693-1"
},
{
"published_at": "2026-07-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22769-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622769-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22696-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622696-1"
},
{
"published_at": "2026-07-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3166-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263166-1"
},
{
"published_at": "2026-07-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22742-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622742-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22732-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622732-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22698-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622698-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22682-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622682-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22751-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622751-1"
},
{
"published_at": "2026-07-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3130-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263130-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22748-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622748-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22691-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622691-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22677-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622677-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22685-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622685-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22734-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622734-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22749-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622749-1"
},
{
"published_at": "2026-07-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22761-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622761-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22680-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622680-1"
},
{
"published_at": "2026-07-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3089-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263089-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22690-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622690-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22733-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622733-1"
},
{
"published_at": "2026-07-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22755-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622755-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22687-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622687-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22686-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622686-1"
},
{
"published_at": "2026-07-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22758-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622758-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22694-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622694-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22692-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622692-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22684-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622684-1"
},
{
"published_at": "2026-07-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22759-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622759-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22695-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622695-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22681-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622681-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22676-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622676-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22678-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622678-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22683-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622683-1"
},
{
"published_at": "2026-07-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22766-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622766-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22679-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622679-1"
},
{
"published_at": "2026-07-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:3156-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-20263156-1"
},
{
"published_at": "2026-07-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22763-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622763-1"
},
{
"published_at": "2026-07-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2026:22697-1",
"url": "https://www.suse.com/support/update/announcement/2026/suse-su-202622697-1"
}
]
}
CERTFR-2026-AVI-0954
Vulnerability from certfr_avis - Published: 2026-07-31 - Updated: 2026-07-31
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2025-40103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40103"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2024-46715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46715"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2025-21709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21709"
},
{
"name": "CVE-2025-62626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62626"
},
{
"name": "CVE-2025-40323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40323"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2023-45896",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45896"
},
{
"name": "CVE-2024-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47809"
},
{
"name": "CVE-2024-56557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56557"
},
{
"name": "CVE-2024-56584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56584"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2024-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53221"
},
{
"name": "CVE-2024-56657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56657"
},
{
"name": "CVE-2024-56719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56719"
},
{
"name": "CVE-2025-21739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21739"
},
{
"name": "CVE-2025-21712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21712"
},
{
"name": "CVE-2025-21863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21863"
},
{
"name": "CVE-2025-22107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22107"
},
{
"name": "CVE-2025-22116",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22116"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2022-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50073"
},
{
"name": "CVE-2022-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50116"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2025-38105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38105"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2025-38426",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38426"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2025-40135",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40135"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2025-68307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68307"
},
{
"name": "CVE-2025-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68206"
},
{
"name": "CVE-2025-68239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68239"
},
{
"name": "CVE-2025-68256",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68256"
},
{
"name": "CVE-2025-68736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68736"
},
{
"name": "CVE-2025-40150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40150"
},
{
"name": "CVE-2025-68175",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68175"
},
{
"name": "CVE-2025-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68263"
},
{
"name": "CVE-2025-68358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68358"
},
{
"name": "CVE-2026-22985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22985"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2025-71150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71150"
},
{
"name": "CVE-2025-71160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71160"
},
{
"name": "CVE-2025-71162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71162"
},
{
"name": "CVE-2025-71163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71163"
},
{
"name": "CVE-2025-71180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71180"
},
{
"name": "CVE-2025-71182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71182"
},
{
"name": "CVE-2025-71183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71183"
},
{
"name": "CVE-2025-71184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71184"
},
{
"name": "CVE-2025-71185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71185"
},
{
"name": "CVE-2025-71186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71186"
},
{
"name": "CVE-2025-71189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71189"
},
{
"name": "CVE-2025-71190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71190"
},
{
"name": "CVE-2025-71191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71191"
},
{
"name": "CVE-2025-71192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71192"
},
{
"name": "CVE-2025-71193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71193"
},
{
"name": "CVE-2025-71194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71194"
},
{
"name": "CVE-2025-71195",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71195"
},
{
"name": "CVE-2025-71196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71196"
},
{
"name": "CVE-2025-71197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71197"
},
{
"name": "CVE-2025-71198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71198"
},
{
"name": "CVE-2025-71199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71199"
},
{
"name": "CVE-2026-22976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22976"
},
{
"name": "CVE-2026-22977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22977"
},
{
"name": "CVE-2026-22978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22978"
},
{
"name": "CVE-2026-22979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22979"
},
{
"name": "CVE-2026-22980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22980"
},
{
"name": "CVE-2026-22982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22982"
},
{
"name": "CVE-2026-22984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22984"
},
{
"name": "CVE-2026-22989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22989"
},
{
"name": "CVE-2026-22990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22990"
},
{
"name": "CVE-2026-22991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22991"
},
{
"name": "CVE-2026-22992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22992"
},
{
"name": "CVE-2026-22994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22994"
},
{
"name": "CVE-2026-22996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22996"
},
{
"name": "CVE-2026-22997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22997"
},
{
"name": "CVE-2026-22998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22998"
},
{
"name": "CVE-2026-22999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22999"
},
{
"name": "CVE-2026-23000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23000"
},
{
"name": "CVE-2026-23001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23001"
},
{
"name": "CVE-2026-23002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23002"
},
{
"name": "CVE-2026-23003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23003"
},
{
"name": "CVE-2026-23005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23005"
},
{
"name": "CVE-2026-23006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23006"
},
{
"name": "CVE-2026-23010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23010"
},
{
"name": "CVE-2026-23011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23011"
},
{
"name": "CVE-2026-23013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23013"
},
{
"name": "CVE-2026-23019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23019"
},
{
"name": "CVE-2026-23020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23020"
},
{
"name": "CVE-2026-23021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23021"
},
{
"name": "CVE-2026-23023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23023"
},
{
"name": "CVE-2026-23025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23025"
},
{
"name": "CVE-2026-23026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23026"
},
{
"name": "CVE-2026-23030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23030"
},
{
"name": "CVE-2026-23031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23031"
},
{
"name": "CVE-2026-23032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23032"
},
{
"name": "CVE-2026-23033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23033"
},
{
"name": "CVE-2026-23035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23035"
},
{
"name": "CVE-2026-23037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23037"
},
{
"name": "CVE-2026-23038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23038"
},
{
"name": "CVE-2026-23047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23047"
},
{
"name": "CVE-2026-23049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23049"
},
{
"name": "CVE-2026-23050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23050"
},
{
"name": "CVE-2026-23053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23053"
},
{
"name": "CVE-2026-23054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23054"
},
{
"name": "CVE-2026-23055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23055"
},
{
"name": "CVE-2026-23056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23056"
},
{
"name": "CVE-2026-23057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23057"
},
{
"name": "CVE-2026-23058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23058"
},
{
"name": "CVE-2026-23059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23059"
},
{
"name": "CVE-2026-23061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23061"
},
{
"name": "CVE-2026-23062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23062"
},
{
"name": "CVE-2026-23063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23063"
},
{
"name": "CVE-2026-23064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23064"
},
{
"name": "CVE-2026-23065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23065"
},
{
"name": "CVE-2026-23068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23068"
},
{
"name": "CVE-2026-23069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23069"
},
{
"name": "CVE-2026-23071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23071"
},
{
"name": "CVE-2026-23072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23072"
},
{
"name": "CVE-2026-23073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23073"
},
{
"name": "CVE-2026-23075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23075"
},
{
"name": "CVE-2026-23076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23076"
},
{
"name": "CVE-2026-23078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23078"
},
{
"name": "CVE-2026-23080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23080"
},
{
"name": "CVE-2026-23083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23083"
},
{
"name": "CVE-2026-23084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23084"
},
{
"name": "CVE-2026-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23085"
},
{
"name": "CVE-2026-23086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23086"
},
{
"name": "CVE-2026-23087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23087"
},
{
"name": "CVE-2026-23088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23088"
},
{
"name": "CVE-2026-23089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23089"
},
{
"name": "CVE-2026-23090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23090"
},
{
"name": "CVE-2026-23093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23093"
},
{
"name": "CVE-2026-23094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23094"
},
{
"name": "CVE-2026-23095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23095"
},
{
"name": "CVE-2026-23096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23096"
},
{
"name": "CVE-2026-23097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23097"
},
{
"name": "CVE-2026-23098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23098"
},
{
"name": "CVE-2026-23099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23099"
},
{
"name": "CVE-2026-23101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23101"
},
{
"name": "CVE-2026-23102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23102"
},
{
"name": "CVE-2026-23103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23103"
},
{
"name": "CVE-2026-23105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23105"
},
{
"name": "CVE-2026-23107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23107"
},
{
"name": "CVE-2026-23108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23108"
},
{
"name": "CVE-2026-23110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23110"
},
{
"name": "CVE-2026-22993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22993"
},
{
"name": "CVE-2025-71203",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71203"
},
{
"name": "CVE-2025-71220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71220"
},
{
"name": "CVE-2025-71222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71222"
},
{
"name": "CVE-2025-71224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71224"
},
{
"name": "CVE-2025-71229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71229"
},
{
"name": "CVE-2025-71231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71231"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-23176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23176"
},
{
"name": "CVE-2026-23180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23180"
},
{
"name": "CVE-2026-23182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23182"
},
{
"name": "CVE-2026-23190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23190"
},
{
"name": "CVE-2026-23193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23193"
},
{
"name": "CVE-2026-23198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23198"
},
{
"name": "CVE-2026-23202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23202"
},
{
"name": "CVE-2026-23204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23204"
},
{
"name": "CVE-2026-23206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23206"
},
{
"name": "CVE-2026-23216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23216"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-23230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23230"
},
{
"name": "CVE-2026-23212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23212"
},
{
"name": "CVE-2026-22981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22981"
},
{
"name": "CVE-2026-22986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22986"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-23233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23233"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2022-49803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49803"
},
{
"name": "CVE-2022-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49961"
},
{
"name": "CVE-2022-50552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50552"
},
{
"name": "CVE-2023-52682",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52682"
},
{
"name": "CVE-2023-53629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53629"
},
{
"name": "CVE-2025-68334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68334"
},
{
"name": "CVE-2025-71152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71152"
},
{
"name": "CVE-2025-71158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71158"
},
{
"name": "CVE-2025-71161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71161"
},
{
"name": "CVE-2025-71188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71188"
},
{
"name": "CVE-2025-71221",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71221"
},
{
"name": "CVE-2026-23004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23004"
},
{
"name": "CVE-2026-23066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23066"
},
{
"name": "CVE-2026-23113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23113"
},
{
"name": "CVE-2026-23118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23118"
},
{
"name": "CVE-2026-23119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23119"
},
{
"name": "CVE-2026-23120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23120"
},
{
"name": "CVE-2026-23121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23121"
},
{
"name": "CVE-2026-23124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23124"
},
{
"name": "CVE-2026-23125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23125"
},
{
"name": "CVE-2026-23126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23126"
},
{
"name": "CVE-2026-23128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23128"
},
{
"name": "CVE-2026-23133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23133"
},
{
"name": "CVE-2026-23137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23137"
},
{
"name": "CVE-2026-23138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23138"
},
{
"name": "CVE-2026-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23141"
},
{
"name": "CVE-2026-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23145"
},
{
"name": "CVE-2026-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23146"
},
{
"name": "CVE-2026-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23150"
},
{
"name": "CVE-2026-23154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23154"
},
{
"name": "CVE-2026-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23157"
},
{
"name": "CVE-2026-23164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23164"
},
{
"name": "CVE-2026-23167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23167"
},
{
"name": "CVE-2026-23170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23170"
},
{
"name": "CVE-2026-23171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23171"
},
{
"name": "CVE-2026-23207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23207"
},
{
"name": "CVE-2026-23226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23226"
},
{
"name": "CVE-2026-23227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23227"
},
{
"name": "CVE-2025-71200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71200"
},
{
"name": "CVE-2026-23017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23017"
},
{
"name": "CVE-2026-23104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23104"
},
{
"name": "CVE-2026-23116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23116"
},
{
"name": "CVE-2026-23129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23129"
},
{
"name": "CVE-2026-23135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23135"
},
{
"name": "CVE-2026-23139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23139"
},
{
"name": "CVE-2026-23151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23151"
},
{
"name": "CVE-2026-23152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23152"
},
{
"name": "CVE-2026-23156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23156"
},
{
"name": "CVE-2026-23163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23163"
},
{
"name": "CVE-2026-23166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23166"
},
{
"name": "CVE-2026-23172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23172"
},
{
"name": "CVE-2026-23173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23173"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-23267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23267"
},
{
"name": "CVE-2026-31788",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31788"
},
{
"name": "CVE-2026-23070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23070"
},
{
"name": "CVE-2026-23131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23131"
},
{
"name": "CVE-2026-23244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23244"
},
{
"name": "CVE-2026-23245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23245"
},
{
"name": "CVE-2026-23246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23246"
},
{
"name": "CVE-2026-23253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23253"
},
{
"name": "CVE-2026-23271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23271"
},
{
"name": "CVE-2026-23277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23277"
},
{
"name": "CVE-2026-23279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23279"
},
{
"name": "CVE-2026-23281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23281"
},
{
"name": "CVE-2026-23284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23284"
},
{
"name": "CVE-2026-23285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23285"
},
{
"name": "CVE-2026-23286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23286"
},
{
"name": "CVE-2026-23289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23289"
},
{
"name": "CVE-2026-23290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23290"
},
{
"name": "CVE-2026-23291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23291"
},
{
"name": "CVE-2026-23292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23292"
},
{
"name": "CVE-2026-23293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23293"
},
{
"name": "CVE-2026-23296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23296"
},
{
"name": "CVE-2026-23298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23298"
},
{
"name": "CVE-2026-23300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23300"
},
{
"name": "CVE-2026-23303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23303"
},
{
"name": "CVE-2026-23304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23304"
},
{
"name": "CVE-2026-23306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23306"
},
{
"name": "CVE-2026-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23307"
},
{
"name": "CVE-2026-23310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23310"
},
{
"name": "CVE-2026-23312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23312"
},
{
"name": "CVE-2026-23315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23315"
},
{
"name": "CVE-2026-23317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23317"
},
{
"name": "CVE-2026-23318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23318"
},
{
"name": "CVE-2026-23319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23319"
},
{
"name": "CVE-2026-23324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23324"
},
{
"name": "CVE-2026-23334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23334"
},
{
"name": "CVE-2026-23336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23336"
},
{
"name": "CVE-2026-23340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23340"
},
{
"name": "CVE-2026-23343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23343"
},
{
"name": "CVE-2026-23347",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23347"
},
{
"name": "CVE-2026-23352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23352"
},
{
"name": "CVE-2026-23356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23356"
},
{
"name": "CVE-2026-23357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23357"
},
{
"name": "CVE-2026-23359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23359"
},
{
"name": "CVE-2026-23364",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23364"
},
{
"name": "CVE-2026-23365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23365"
},
{
"name": "CVE-2026-23367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23367"
},
{
"name": "CVE-2026-23368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23368"
},
{
"name": "CVE-2026-23370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23370"
},
{
"name": "CVE-2026-23379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23379"
},
{
"name": "CVE-2026-23381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23381"
},
{
"name": "CVE-2026-23382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23382"
},
{
"name": "CVE-2026-23388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23388"
},
{
"name": "CVE-2026-23391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23391"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-23395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23395"
},
{
"name": "CVE-2026-23396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23396"
},
{
"name": "CVE-2026-23397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23397"
},
{
"name": "CVE-2026-23398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23398"
},
{
"name": "CVE-2026-31394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31394"
},
{
"name": "CVE-2026-23144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23144"
},
{
"name": "CVE-2026-23272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23272"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-31408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31408"
},
{
"name": "CVE-2026-31414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31414"
},
{
"name": "CVE-2026-31416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31416"
},
{
"name": "CVE-2026-31417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31417"
},
{
"name": "CVE-2026-31418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31418"
},
{
"name": "CVE-2026-31421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31421"
},
{
"name": "CVE-2026-31422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31422"
},
{
"name": "CVE-2026-31423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31423"
},
{
"name": "CVE-2026-31424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31424"
},
{
"name": "CVE-2026-31426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31426"
},
{
"name": "CVE-2026-31427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31427"
},
{
"name": "CVE-2026-31428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31428"
},
{
"name": "CVE-2025-71269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71269"
},
{
"name": "CVE-2026-23136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23136"
},
{
"name": "CVE-2026-23140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23140"
},
{
"name": "CVE-2026-23255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23255"
},
{
"name": "CVE-2026-23262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23262"
},
{
"name": "CVE-2026-23270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23270"
},
{
"name": "CVE-2026-23278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23278"
},
{
"name": "CVE-2026-23335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23335"
},
{
"name": "CVE-2026-23361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23361"
},
{
"name": "CVE-2026-23383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23383"
},
{
"name": "CVE-2026-23386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23386"
},
{
"name": "CVE-2026-23412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23412"
},
{
"name": "CVE-2026-23413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23413"
},
{
"name": "CVE-2026-23414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23414"
},
{
"name": "CVE-2026-23419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23419"
},
{
"name": "CVE-2026-31402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31402"
},
{
"name": "CVE-2026-23360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23360"
},
{
"name": "CVE-2026-31439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31439"
},
{
"name": "CVE-2026-31441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31441"
},
{
"name": "CVE-2026-31444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31444"
},
{
"name": "CVE-2026-31446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31446"
},
{
"name": "CVE-2026-31447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31447"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-31450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31450"
},
{
"name": "CVE-2026-31451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31451"
},
{
"name": "CVE-2026-31452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31452"
},
{
"name": "CVE-2026-31453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31453"
},
{
"name": "CVE-2026-31454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31454"
},
{
"name": "CVE-2026-31455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31455"
},
{
"name": "CVE-2026-31458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31458"
},
{
"name": "CVE-2026-31467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31467"
},
{
"name": "CVE-2026-31469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31469"
},
{
"name": "CVE-2026-31473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31473"
},
{
"name": "CVE-2026-31474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31474"
},
{
"name": "CVE-2026-31476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31476"
},
{
"name": "CVE-2026-31483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31483"
},
{
"name": "CVE-2026-31485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31485"
},
{
"name": "CVE-2026-31494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31494"
},
{
"name": "CVE-2026-31495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31495"
},
{
"name": "CVE-2026-31496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31496"
},
{
"name": "CVE-2026-31497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31497"
},
{
"name": "CVE-2026-31500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31500"
},
{
"name": "CVE-2026-31503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31503"
},
{
"name": "CVE-2026-31507",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31507"
},
{
"name": "CVE-2026-31509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31509"
},
{
"name": "CVE-2026-31510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31510"
},
{
"name": "CVE-2026-31515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31515"
},
{
"name": "CVE-2026-31518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31518"
},
{
"name": "CVE-2026-31519",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31519"
},
{
"name": "CVE-2026-31520",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31520"
},
{
"name": "CVE-2026-31521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31521"
},
{
"name": "CVE-2026-31522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31522"
},
{
"name": "CVE-2026-31523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31523"
},
{
"name": "CVE-2026-31524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31524"
},
{
"name": "CVE-2026-31525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31525"
},
{
"name": "CVE-2026-31528",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31528"
},
{
"name": "CVE-2026-31555",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31555"
},
{
"name": "CVE-2026-31563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31563"
},
{
"name": "CVE-2026-31565",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31565"
},
{
"name": "CVE-2026-31566",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31566"
},
{
"name": "CVE-2026-31570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31570"
},
{
"name": "CVE-2026-31589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31589"
},
{
"name": "CVE-2026-31591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31591"
},
{
"name": "CVE-2026-31593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31593"
},
{
"name": "CVE-2026-31600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31600"
},
{
"name": "CVE-2026-31601",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31601"
},
{
"name": "CVE-2026-31608",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31608"
},
{
"name": "CVE-2026-31609",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31609"
},
{
"name": "CVE-2026-31620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31620"
},
{
"name": "CVE-2026-31621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31621"
},
{
"name": "CVE-2026-31674",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31674"
},
{
"name": "CVE-2026-31675",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31675"
},
{
"name": "CVE-2026-31678",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31678"
},
{
"name": "CVE-2026-31679",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31679"
},
{
"name": "CVE-2026-31680",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31680"
},
{
"name": "CVE-2026-31682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31682"
},
{
"name": "CVE-2026-31430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31430"
},
{
"name": "CVE-2026-31508",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31508"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-31587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31587"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2026-31595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31595"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-31604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31604"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-31607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31607"
},
{
"name": "CVE-2026-31610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31610"
},
{
"name": "CVE-2026-31611",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31611"
},
{
"name": "CVE-2026-31612",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31612"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-31634",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31634"
},
{
"name": "CVE-2026-31637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31637"
},
{
"name": "CVE-2026-31638",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31638"
},
{
"name": "CVE-2026-31639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31639"
},
{
"name": "CVE-2026-31642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31642"
},
{
"name": "CVE-2026-31646",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31646"
},
{
"name": "CVE-2026-31648",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31648"
},
{
"name": "CVE-2026-31649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31649"
},
{
"name": "CVE-2026-31651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31651"
},
{
"name": "CVE-2026-31655",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31655"
},
{
"name": "CVE-2026-31656",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31656"
},
{
"name": "CVE-2026-31657",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31657"
},
{
"name": "CVE-2026-31658",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31658"
},
{
"name": "CVE-2026-31659",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31659"
},
{
"name": "CVE-2026-31660",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31660"
},
{
"name": "CVE-2026-31661",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31661"
},
{
"name": "CVE-2026-31662",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31662"
},
{
"name": "CVE-2026-31664",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31664"
},
{
"name": "CVE-2026-31665",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31665"
},
{
"name": "CVE-2026-31667",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31667"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-31669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31669"
},
{
"name": "CVE-2026-31670",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31670"
},
{
"name": "CVE-2026-31671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31671"
},
{
"name": "CVE-2026-31672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31672"
},
{
"name": "CVE-2026-31673",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31673"
},
{
"name": "CVE-2026-31676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31676"
},
{
"name": "CVE-2026-31681",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31681"
},
{
"name": "CVE-2026-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31684"
},
{
"name": "CVE-2026-31685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31685"
},
{
"name": "CVE-2026-31689",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31689"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-31700",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31700"
},
{
"name": "CVE-2026-31702",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31702"
},
{
"name": "CVE-2026-31704",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31704"
},
{
"name": "CVE-2026-31705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31705"
},
{
"name": "CVE-2026-31708",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31708"
},
{
"name": "CVE-2026-31711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31711"
},
{
"name": "CVE-2026-31721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31721"
},
{
"name": "CVE-2026-23362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23362"
},
{
"name": "CVE-2026-23287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23287"
},
{
"name": "CVE-2026-23321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23321"
},
{
"name": "CVE-2026-23339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23339"
},
{
"name": "CVE-2026-23372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23372"
},
{
"name": "CVE-2026-23378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23378"
},
{
"name": "CVE-2026-23401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23401"
},
{
"name": "CVE-2026-23420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23420"
},
{
"name": "CVE-2026-23426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23426"
},
{
"name": "CVE-2026-23428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23428"
},
{
"name": "CVE-2026-23434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23434"
},
{
"name": "CVE-2026-23438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23438"
},
{
"name": "CVE-2026-23439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23439"
},
{
"name": "CVE-2026-23446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23446"
},
{
"name": "CVE-2026-23449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23449"
},
{
"name": "CVE-2026-23450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23450"
},
{
"name": "CVE-2026-23452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23452"
},
{
"name": "CVE-2026-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23454"
},
{
"name": "CVE-2026-23455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23455"
},
{
"name": "CVE-2026-23456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23456"
},
{
"name": "CVE-2026-23457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23457"
},
{
"name": "CVE-2026-23458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23458"
},
{
"name": "CVE-2026-23460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23460"
},
{
"name": "CVE-2026-23462",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23462"
},
{
"name": "CVE-2026-23463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23463"
},
{
"name": "CVE-2026-23474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23474"
},
{
"name": "CVE-2026-23475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23475"
},
{
"name": "CVE-2026-31389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31389"
},
{
"name": "CVE-2026-31391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31391"
},
{
"name": "CVE-2026-31392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31392"
},
{
"name": "CVE-2026-31393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31393"
},
{
"name": "CVE-2026-31396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31396"
},
{
"name": "CVE-2026-31399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31399"
},
{
"name": "CVE-2026-31400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31400"
},
{
"name": "CVE-2026-31403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31403"
},
{
"name": "CVE-2026-31405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31405"
},
{
"name": "CVE-2026-31409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31409"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-31412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31412"
},
{
"name": "CVE-2026-31415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31415"
},
{
"name": "CVE-2026-31425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31425"
},
{
"name": "CVE-2026-31433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31433"
},
{
"name": "CVE-2026-31434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31434"
},
{
"name": "CVE-2026-31464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31464"
},
{
"name": "CVE-2026-31466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31466"
},
{
"name": "CVE-2026-31477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31477"
},
{
"name": "CVE-2026-31478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31478"
},
{
"name": "CVE-2026-31480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31480"
},
{
"name": "CVE-2026-31492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31492"
},
{
"name": "CVE-2026-31498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31498"
},
{
"name": "CVE-2026-31512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31512"
},
{
"name": "CVE-2026-31540",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31540"
},
{
"name": "CVE-2026-31545",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31545"
},
{
"name": "CVE-2026-31546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31546"
},
{
"name": "CVE-2026-31548",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31548"
},
{
"name": "CVE-2026-31549",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31549"
},
{
"name": "CVE-2026-31550",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31550"
},
{
"name": "CVE-2026-31551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31551"
},
{
"name": "CVE-2026-31552",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31552"
},
{
"name": "CVE-2026-31683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31683"
},
{
"name": "CVE-2026-31695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31695"
},
{
"name": "CVE-2026-31720",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31720"
},
{
"name": "CVE-2026-31726",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31726"
},
{
"name": "CVE-2026-31728",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31728"
},
{
"name": "CVE-2026-31737",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31737"
},
{
"name": "CVE-2026-31738",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31738"
},
{
"name": "CVE-2026-31747",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31747"
},
{
"name": "CVE-2026-31748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31748"
},
{
"name": "CVE-2026-31749",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31749"
},
{
"name": "CVE-2026-31751",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31751"
},
{
"name": "CVE-2026-31752",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31752"
},
{
"name": "CVE-2026-31754",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31754"
},
{
"name": "CVE-2026-31755",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31755"
},
{
"name": "CVE-2026-31756",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31756"
},
{
"name": "CVE-2026-31758",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31758"
},
{
"name": "CVE-2026-31759",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31759"
},
{
"name": "CVE-2026-31761",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31761"
},
{
"name": "CVE-2026-31762",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31762"
},
{
"name": "CVE-2026-31763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31763"
},
{
"name": "CVE-2026-31768",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31768"
},
{
"name": "CVE-2026-31770",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31770"
},
{
"name": "CVE-2026-31773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31773"
},
{
"name": "CVE-2026-31778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31778"
},
{
"name": "CVE-2026-31779",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31779"
},
{
"name": "CVE-2026-31780",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31780"
},
{
"name": "CVE-2026-31781",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31781"
},
{
"name": "CVE-2026-43011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43011"
},
{
"name": "CVE-2026-43013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43013"
},
{
"name": "CVE-2026-43014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43014"
},
{
"name": "CVE-2026-43015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43015"
},
{
"name": "CVE-2026-43017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43017"
},
{
"name": "CVE-2026-43018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43018"
},
{
"name": "CVE-2026-43020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43020"
},
{
"name": "CVE-2026-43023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43023"
},
{
"name": "CVE-2026-43024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43024"
},
{
"name": "CVE-2026-43025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43025"
},
{
"name": "CVE-2026-43026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43026"
},
{
"name": "CVE-2026-43027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43027"
},
{
"name": "CVE-2026-43028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43028"
},
{
"name": "CVE-2026-43030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43030"
},
{
"name": "CVE-2026-43032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43032"
},
{
"name": "CVE-2026-43035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43035"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-43040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43040"
},
{
"name": "CVE-2026-43041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43041"
},
{
"name": "CVE-2026-43043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43043"
},
{
"name": "CVE-2026-43046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43046"
},
{
"name": "CVE-2026-43047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43047"
},
{
"name": "CVE-2026-43050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43050"
},
{
"name": "CVE-2026-43051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43051"
},
{
"name": "CVE-2026-43054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43054"
},
{
"name": "CVE-2026-43057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43057"
},
{
"name": "CVE-2026-23249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23249"
},
{
"name": "CVE-2026-23276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23276"
},
{
"name": "CVE-2026-23302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23302"
},
{
"name": "CVE-2026-23308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23308"
},
{
"name": "CVE-2026-23313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23313"
},
{
"name": "CVE-2026-23325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23325"
},
{
"name": "CVE-2026-23330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23330"
},
{
"name": "CVE-2026-23363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23363"
},
{
"name": "CVE-2026-23369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23369"
},
{
"name": "CVE-2026-23374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23374"
},
{
"name": "CVE-2026-23375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23375"
},
{
"name": "CVE-2026-23387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23387"
},
{
"name": "CVE-2026-23389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23389"
},
{
"name": "CVE-2026-23399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23399"
},
{
"name": "CVE-2026-23427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23427"
},
{
"name": "CVE-2026-23440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23440"
},
{
"name": "CVE-2026-23441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23441"
},
{
"name": "CVE-2026-23442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23442"
},
{
"name": "CVE-2026-23444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23444"
},
{
"name": "CVE-2026-23447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23447"
},
{
"name": "CVE-2026-23448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23448"
},
{
"name": "CVE-2026-23461",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23461"
},
{
"name": "CVE-2026-23464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23464"
},
{
"name": "CVE-2026-23465",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23465"
},
{
"name": "CVE-2026-23470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23470"
},
{
"name": "CVE-2026-31407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31407"
},
{
"name": "CVE-2026-31429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31429"
},
{
"name": "CVE-2026-31432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31432"
},
{
"name": "CVE-2026-31436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31436"
},
{
"name": "CVE-2026-31438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31438"
},
{
"name": "CVE-2026-31440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31440"
},
{
"name": "CVE-2026-31449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31449"
},
{
"name": "CVE-2026-31470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31470"
},
{
"name": "CVE-2026-31482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31482"
},
{
"name": "CVE-2026-31487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31487"
},
{
"name": "CVE-2026-31488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31488"
},
{
"name": "CVE-2026-31489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31489"
},
{
"name": "CVE-2026-31502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31502"
},
{
"name": "CVE-2026-31505",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31505"
},
{
"name": "CVE-2026-31506",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31506"
},
{
"name": "CVE-2026-31511",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31511"
},
{
"name": "CVE-2026-31516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31516"
},
{
"name": "CVE-2026-31527",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31527"
},
{
"name": "CVE-2026-31530",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31530"
},
{
"name": "CVE-2026-31542",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31542"
},
{
"name": "CVE-2026-31554",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31554"
},
{
"name": "CVE-2026-31556",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31556"
},
{
"name": "CVE-2026-31557",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31557"
},
{
"name": "CVE-2026-31575",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31575"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-31582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31582"
},
{
"name": "CVE-2026-31584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31584"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-31606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31606"
},
{
"name": "CVE-2026-31614",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31614"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-31645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31645"
},
{
"name": "CVE-2026-31677",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31677"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-31693",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31693"
},
{
"name": "CVE-2025-71294",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71294"
},
{
"name": "CVE-2026-43201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43201"
},
{
"name": "CVE-2026-43300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43300"
},
{
"name": "CVE-2026-43320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43320"
},
{
"name": "CVE-2025-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54518"
},
{
"name": "CVE-2026-43284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43284"
},
{
"name": "CVE-2026-43500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43500"
},
{
"name": "CVE-2026-23468",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23468"
},
{
"name": "CVE-2026-31709",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31709"
},
{
"name": "CVE-2026-31715",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31715"
},
{
"name": "CVE-2026-23123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23123"
},
{
"name": "CVE-2026-23142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23142"
},
{
"name": "CVE-2026-23148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23148"
},
{
"name": "CVE-2026-23159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23159"
},
{
"name": "CVE-2026-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23160"
},
{
"name": "CVE-2026-23168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23168"
},
{
"name": "CVE-2026-23256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23256"
},
{
"name": "CVE-2026-23257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23257"
},
{
"name": "CVE-2026-23258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23258"
},
{
"name": "CVE-2026-31499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31499"
},
{
"name": "CVE-2026-43088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43088"
},
{
"name": "CVE-2026-43109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43109"
},
{
"name": "CVE-2026-43490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43490"
},
{
"name": "CVE-2026-31635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31635"
},
{
"name": "CVE-2026-43494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43494"
},
{
"name": "CVE-2026-43503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43503"
},
{
"name": "CVE-2026-46174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46174"
},
{
"name": "CVE-2026-43110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43110"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-43334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43334"
},
{
"name": "CVE-2026-43437",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43437"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-31613",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31613"
},
{
"name": "CVE-2026-43329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43329"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2026-46028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46028"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-43060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43060"
},
{
"name": "CVE-2026-43061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43061"
},
{
"name": "CVE-2026-43062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43062"
},
{
"name": "CVE-2026-43066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43066"
},
{
"name": "CVE-2026-43068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43068"
},
{
"name": "CVE-2026-43069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43069"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-43327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43327"
},
{
"name": "CVE-2026-43328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43328"
},
{
"name": "CVE-2026-43336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43336"
},
{
"name": "CVE-2026-43339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43339"
},
{
"name": "CVE-2026-43340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43340"
},
{
"name": "CVE-2026-43342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43342"
},
{
"name": "CVE-2026-43343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43343"
},
{
"name": "CVE-2026-43355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43355"
},
{
"name": "CVE-2026-43357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43357"
},
{
"name": "CVE-2026-43363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43363"
},
{
"name": "CVE-2026-43370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43370"
},
{
"name": "CVE-2026-43373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43373"
},
{
"name": "CVE-2026-43381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43381"
},
{
"name": "CVE-2026-43382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43382"
},
{
"name": "CVE-2026-43383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43383"
},
{
"name": "CVE-2026-43386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43386"
},
{
"name": "CVE-2026-43387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43387"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-43411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43411"
},
{
"name": "CVE-2026-43420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43420"
},
{
"name": "CVE-2026-43424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43424"
},
{
"name": "CVE-2026-43425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43425"
},
{
"name": "CVE-2026-43426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43426"
},
{
"name": "CVE-2026-43427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43427"
},
{
"name": "CVE-2026-43428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43428"
},
{
"name": "CVE-2026-43429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43429"
},
{
"name": "CVE-2026-43430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43430"
},
{
"name": "CVE-2026-43432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43432"
},
{
"name": "CVE-2026-43439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43439"
},
{
"name": "CVE-2026-43445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43445"
},
{
"name": "CVE-2026-43449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43449"
},
{
"name": "CVE-2026-43450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43450"
},
{
"name": "CVE-2026-43451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43451"
},
{
"name": "CVE-2026-43452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43452"
},
{
"name": "CVE-2026-43453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43453"
},
{
"name": "CVE-2026-43458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43458"
},
{
"name": "CVE-2026-43459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43459"
},
{
"name": "CVE-2026-43466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43466"
},
{
"name": "CVE-2026-43472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43472"
},
{
"name": "CVE-2026-43475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43475"
},
{
"name": "CVE-2026-43480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43480"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-45899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45899"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-45914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45914"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-45920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45920"
},
{
"name": "CVE-2026-45923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45923"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-45956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45956"
},
{
"name": "CVE-2026-45958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45958"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-45981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45981"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-45985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45985"
},
{
"name": "CVE-2026-23418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23418"
},
{
"name": "CVE-2026-31579",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31579"
},
{
"name": "CVE-2026-43044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43044"
},
{
"name": "CVE-2026-43082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43082"
},
{
"name": "CVE-2026-43120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43120"
},
{
"name": "CVE-2026-43153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43153"
},
{
"name": "CVE-2026-43214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43214"
},
{
"name": "CVE-2026-43265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43265"
},
{
"name": "CVE-2026-43330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43330"
},
{
"name": "CVE-2026-43365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43365"
},
{
"name": "CVE-2026-43366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43366"
},
{
"name": "CVE-2026-43419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43419"
},
{
"name": "CVE-2026-43441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43441"
},
{
"name": "CVE-2026-45834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45834"
},
{
"name": "CVE-2026-45835",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45835"
},
{
"name": "CVE-2026-45836",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45836"
},
{
"name": "CVE-2026-45838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45838"
},
{
"name": "CVE-2026-45839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45839"
},
{
"name": "CVE-2026-45840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45840"
},
{
"name": "CVE-2026-45841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45841"
},
{
"name": "CVE-2026-45842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45842"
},
{
"name": "CVE-2026-45843",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45843"
},
{
"name": "CVE-2026-45844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45844"
},
{
"name": "CVE-2026-45845",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45845"
},
{
"name": "CVE-2026-45846",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45846"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-45988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45988"
},
{
"name": "CVE-2026-45989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45989"
},
{
"name": "CVE-2026-45991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45991"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2026-45996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45996"
},
{
"name": "CVE-2026-45997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45997"
},
{
"name": "CVE-2026-45999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45999"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-46003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46003"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-46005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46005"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-46011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46011"
},
{
"name": "CVE-2026-46012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46012"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-46016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46016"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-46021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46021"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-46026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46026"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-46031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46031"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-46038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46038"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-46043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46043"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-46052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46052"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2026-46056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46056"
},
{
"name": "CVE-2026-46058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46058"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-46063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46063"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-46065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46065"
},
{
"name": "CVE-2026-46068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46068"
},
{
"name": "CVE-2026-46069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46069"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-46075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46075"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-46079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46079"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-46083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46083"
},
{
"name": "CVE-2026-46084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46084"
},
{
"name": "CVE-2026-46085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46085"
},
{
"name": "CVE-2026-46086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46086"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-46089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46089"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2026-46094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46094"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-46103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46103"
},
{
"name": "CVE-2026-46106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46106"
},
{
"name": "CVE-2026-46107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46107"
},
{
"name": "CVE-2026-46108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46108"
},
{
"name": "CVE-2026-46109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46109"
},
{
"name": "CVE-2026-46110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46110"
},
{
"name": "CVE-2026-46111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46111"
},
{
"name": "CVE-2026-46112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46112"
},
{
"name": "CVE-2026-46113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46113"
},
{
"name": "CVE-2026-46114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46114"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-46116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46116"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46120"
},
{
"name": "CVE-2026-46122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46122"
},
{
"name": "CVE-2026-46123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46123"
},
{
"name": "CVE-2026-46124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46124"
},
{
"name": "CVE-2026-46125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46125"
},
{
"name": "CVE-2026-46127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46127"
},
{
"name": "CVE-2026-46128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46128"
},
{
"name": "CVE-2026-46129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46129"
},
{
"name": "CVE-2026-46131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46131"
},
{
"name": "CVE-2026-46132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46132"
},
{
"name": "CVE-2026-46133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46133"
},
{
"name": "CVE-2026-46136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46136"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2026-46138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46138"
},
{
"name": "CVE-2026-46142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46142"
},
{
"name": "CVE-2026-46144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46144"
},
{
"name": "CVE-2026-46145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46145"
},
{
"name": "CVE-2026-46146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46146"
},
{
"name": "CVE-2026-46149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46149"
},
{
"name": "CVE-2026-46150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46150"
},
{
"name": "CVE-2026-46151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46151"
},
{
"name": "CVE-2026-46152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46152"
},
{
"name": "CVE-2026-46155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46155"
},
{
"name": "CVE-2026-46156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46156"
},
{
"name": "CVE-2026-46159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46159"
},
{
"name": "CVE-2026-46160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46160"
},
{
"name": "CVE-2026-46161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46161"
},
{
"name": "CVE-2026-46163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46163"
},
{
"name": "CVE-2026-46164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46164"
},
{
"name": "CVE-2026-46165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46165"
},
{
"name": "CVE-2026-46167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46167"
},
{
"name": "CVE-2026-46168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46168"
},
{
"name": "CVE-2026-46172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46172"
},
{
"name": "CVE-2026-46173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46173"
},
{
"name": "CVE-2026-46176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46176"
},
{
"name": "CVE-2026-46177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46177"
},
{
"name": "CVE-2026-46178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46178"
},
{
"name": "CVE-2026-46180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46180"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-46186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46186"
},
{
"name": "CVE-2026-46187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46187"
},
{
"name": "CVE-2026-46189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46189"
},
{
"name": "CVE-2026-46190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46190"
},
{
"name": "CVE-2026-46191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46191"
},
{
"name": "CVE-2026-46193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46193"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-46196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46196"
},
{
"name": "CVE-2026-46197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46197"
},
{
"name": "CVE-2026-46198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46198"
},
{
"name": "CVE-2026-46199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46199"
},
{
"name": "CVE-2026-46204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46204"
},
{
"name": "CVE-2026-46205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46205"
},
{
"name": "CVE-2026-46206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46206"
},
{
"name": "CVE-2026-46208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46208"
},
{
"name": "CVE-2026-46209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46209"
},
{
"name": "CVE-2026-46212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46212"
},
{
"name": "CVE-2026-46214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46214"
},
{
"name": "CVE-2026-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46218"
},
{
"name": "CVE-2026-46219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46219"
},
{
"name": "CVE-2026-46220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46220"
},
{
"name": "CVE-2026-46225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46225"
},
{
"name": "CVE-2026-46226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46226"
},
{
"name": "CVE-2026-46227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46227"
},
{
"name": "CVE-2026-46229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46229"
},
{
"name": "CVE-2026-46230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46230"
},
{
"name": "CVE-2026-46231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46231"
},
{
"name": "CVE-2026-46233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46233"
},
{
"name": "CVE-2026-46234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46234"
},
{
"name": "CVE-2026-46236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46236"
},
{
"name": "CVE-2026-46238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46238"
},
{
"name": "CVE-2026-46273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46273"
},
{
"name": "CVE-2026-31729",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31729"
},
{
"name": "CVE-2026-43012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43012"
},
{
"name": "CVE-2026-43112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43112"
},
{
"name": "CVE-2026-43252",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43252"
},
{
"name": "CVE-2026-43333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43333"
},
{
"name": "CVE-2026-43338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43338"
},
{
"name": "CVE-2026-43341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43341"
},
{
"name": "CVE-2026-43359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43359"
},
{
"name": "CVE-2026-43360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43360"
},
{
"name": "CVE-2026-43361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43361"
},
{
"name": "CVE-2026-43362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43362"
},
{
"name": "CVE-2026-43414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43414"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-43501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43501"
},
{
"name": "CVE-2026-45910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45910"
},
{
"name": "CVE-2026-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43056"
},
{
"name": "CVE-2026-43125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43125"
},
{
"name": "CVE-2026-46054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46054"
},
{
"name": "CVE-2026-46181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46181"
},
{
"name": "CVE-2026-31772",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31772"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-46117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46117"
},
{
"name": "CVE-2026-46135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46135"
},
{
"name": "CVE-2026-46166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46166"
},
{
"name": "CVE-2026-31717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31717"
},
{
"name": "CVE-2026-43245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43245"
},
{
"name": "CVE-2026-46158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46158"
},
{
"name": "CVE-2026-46170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46170"
},
{
"name": "CVE-2026-46203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46203"
},
{
"name": "CVE-2026-46216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46216"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-46315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46315"
},
{
"name": "CVE-2026-46320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46320"
},
{
"name": "CVE-2026-46321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46321"
},
{
"name": "CVE-2026-46322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46322"
},
{
"name": "CVE-2026-52911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52911"
},
{
"name": "CVE-2026-31703",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31703"
},
{
"name": "CVE-2026-31767",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31767"
},
{
"name": "CVE-2026-43052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43052"
},
{
"name": "CVE-2026-43059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43059"
},
{
"name": "CVE-2026-43065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43065"
},
{
"name": "CVE-2026-43150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43150"
},
{
"name": "CVE-2026-43197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43197"
},
{
"name": "CVE-2026-43249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43249"
},
{
"name": "CVE-2026-43332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43332"
},
{
"name": "CVE-2026-43406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43406"
},
{
"name": "CVE-2026-43413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43413"
},
{
"name": "CVE-2026-43455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43455"
},
{
"name": "CVE-2026-43483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43483"
},
{
"name": "CVE-2026-45878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45878"
},
{
"name": "CVE-2026-45886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45886"
},
{
"name": "CVE-2026-45898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45898"
},
{
"name": "CVE-2026-45942",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45942"
},
{
"name": "CVE-2026-46090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46090"
},
{
"name": "CVE-2026-46157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46157"
},
{
"name": "CVE-2026-46169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46169"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46316"
},
{
"name": "CVE-2026-46317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46317"
},
{
"name": "CVE-2026-46274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46274"
},
{
"name": "CVE-2026-46280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46280"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-46287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46287"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-46291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46291"
},
{
"name": "CVE-2026-46292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46292"
},
{
"name": "CVE-2026-46293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46293"
},
{
"name": "CVE-2026-46296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46296"
},
{
"name": "CVE-2026-46299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46299"
},
{
"name": "CVE-2026-46301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46301"
},
{
"name": "CVE-2026-46303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46303"
},
{
"name": "CVE-2026-46304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46304"
},
{
"name": "CVE-2026-46306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46306"
},
{
"name": "CVE-2026-46307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46307"
},
{
"name": "CVE-2026-46312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46312"
},
{
"name": "CVE-2026-46319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46319"
},
{
"name": "CVE-2026-46275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46275"
},
{
"name": "CVE-2026-52912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52912"
},
{
"name": "CVE-2026-52913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52913"
},
{
"name": "CVE-2026-52915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52915"
},
{
"name": "CVE-2026-52916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52916"
},
{
"name": "CVE-2026-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52919"
},
{
"name": "CVE-2026-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52921"
},
{
"name": "CVE-2026-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52922"
},
{
"name": "CVE-2026-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52923"
},
{
"name": "CVE-2026-52926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52926"
},
{
"name": "CVE-2026-52927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52927"
},
{
"name": "CVE-2026-52931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52931"
},
{
"name": "CVE-2026-52934",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52934"
},
{
"name": "CVE-2026-52941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52941"
},
{
"name": "CVE-2026-52943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52943"
},
{
"name": "CVE-2026-53080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53080"
},
{
"name": "CVE-2026-43074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43074"
},
{
"name": "CVE-2026-52918",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52918"
},
{
"name": "CVE-2026-52944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52944"
},
{
"name": "CVE-2025-71272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71272"
},
{
"name": "CVE-2025-71273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71273"
},
{
"name": "CVE-2025-71286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71286"
},
{
"name": "CVE-2025-71291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71291"
},
{
"name": "CVE-2025-71295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71295"
},
{
"name": "CVE-2025-71297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71297"
},
{
"name": "CVE-2025-71305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71305"
},
{
"name": "CVE-2026-31574",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31574"
},
{
"name": "CVE-2026-31592",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31592"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-31706",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31706"
},
{
"name": "CVE-2026-31707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31707"
},
{
"name": "CVE-2026-31710",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31710"
},
{
"name": "CVE-2026-31712",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31712"
},
{
"name": "CVE-2026-31713",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31713"
},
{
"name": "CVE-2026-31714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31714"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-31718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31718"
},
{
"name": "CVE-2026-31719",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31719"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-43071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43071"
},
{
"name": "CVE-2026-43072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43072"
},
{
"name": "CVE-2026-43073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43073"
},
{
"name": "CVE-2026-43083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43083"
},
{
"name": "CVE-2026-43114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43114"
},
{
"name": "CVE-2026-43117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43117"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-43128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43128"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-43137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43137"
},
{
"name": "CVE-2026-43143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43143"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-43157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43157"
},
{
"name": "CVE-2026-43167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43167"
},
{
"name": "CVE-2026-43169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43169"
},
{
"name": "CVE-2026-43170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43170"
},
{
"name": "CVE-2026-43173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43173"
},
{
"name": "CVE-2026-43175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43175"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2026-43186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43186"
},
{
"name": "CVE-2026-43189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43189"
},
{
"name": "CVE-2026-43199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43199"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-43212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43212"
},
{
"name": "CVE-2026-43215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43215"
},
{
"name": "CVE-2026-43221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43221"
},
{
"name": "CVE-2026-43222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43222"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2026-43238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43238"
},
{
"name": "CVE-2026-43239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43239"
},
{
"name": "CVE-2026-43244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43244"
},
{
"name": "CVE-2026-43248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43248"
},
{
"name": "CVE-2026-43250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43250"
},
{
"name": "CVE-2026-43253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43253"
},
{
"name": "CVE-2026-43256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43256"
},
{
"name": "CVE-2026-43258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43258"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2026-43271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43271"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-43278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43278"
},
{
"name": "CVE-2026-43288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43288"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2026-43297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43297"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-43304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43304"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-43317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43317"
},
{
"name": "CVE-2026-43318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43318"
},
{
"name": "CVE-2026-43319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43319"
},
{
"name": "CVE-2026-43348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43348"
},
{
"name": "CVE-2026-43349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43349"
},
{
"name": "CVE-2026-43350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43350"
},
{
"name": "CVE-2026-43376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43376"
},
{
"name": "CVE-2026-43378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43378"
},
{
"name": "CVE-2026-43384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43384"
},
{
"name": "CVE-2026-43402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43402"
},
{
"name": "CVE-2026-43491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43491"
},
{
"name": "CVE-2026-43493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43493"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2026-45849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45849"
},
{
"name": "CVE-2026-45851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45851"
},
{
"name": "CVE-2026-45859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45859"
},
{
"name": "CVE-2026-45861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45861"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-45865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45865"
},
{
"name": "CVE-2026-45872",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45872"
},
{
"name": "CVE-2026-45877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45877"
},
{
"name": "CVE-2026-45880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45880"
},
{
"name": "CVE-2026-45881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45881"
},
{
"name": "CVE-2026-45882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45882"
},
{
"name": "CVE-2026-45884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45884"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-45893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45893"
},
{
"name": "CVE-2026-45895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45895"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-45905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45905"
},
{
"name": "CVE-2026-45913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45913"
},
{
"name": "CVE-2026-45917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45917"
},
{
"name": "CVE-2026-45921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45921"
},
{
"name": "CVE-2026-45928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45928"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-45938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45938"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-45947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45947"
},
{
"name": "CVE-2026-45957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45957"
},
{
"name": "CVE-2026-45962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45962"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-45972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45972"
},
{
"name": "CVE-2026-45973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45973"
},
{
"name": "CVE-2026-45976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45976"
},
{
"name": "CVE-2026-45982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45982"
},
{
"name": "CVE-2026-45990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45990"
},
{
"name": "CVE-2026-45995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45995"
},
{
"name": "CVE-2026-46001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46001"
},
{
"name": "CVE-2026-46007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46007"
},
{
"name": "CVE-2026-46008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46008"
},
{
"name": "CVE-2026-46010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46010"
},
{
"name": "CVE-2026-46013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46013"
},
{
"name": "CVE-2026-46014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46014"
},
{
"name": "CVE-2026-46020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46020"
},
{
"name": "CVE-2026-46025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46025"
},
{
"name": "CVE-2026-46029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46029"
},
{
"name": "CVE-2026-46030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46030"
},
{
"name": "CVE-2026-46032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46032"
},
{
"name": "CVE-2026-46034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46034"
},
{
"name": "CVE-2026-46035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46035"
},
{
"name": "CVE-2026-46036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46036"
},
{
"name": "CVE-2026-46039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46039"
},
{
"name": "CVE-2026-46041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46041"
},
{
"name": "CVE-2026-46042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46042"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-46045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46045"
},
{
"name": "CVE-2026-46057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46057"
},
{
"name": "CVE-2026-46059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46059"
},
{
"name": "CVE-2026-46060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46060"
},
{
"name": "CVE-2026-46061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46061"
},
{
"name": "CVE-2026-46066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46066"
},
{
"name": "CVE-2026-46067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46067"
},
{
"name": "CVE-2026-46071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46071"
},
{
"name": "CVE-2026-46073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46073"
},
{
"name": "CVE-2026-46074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46074"
},
{
"name": "CVE-2026-46076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46076"
},
{
"name": "CVE-2026-46081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46081"
},
{
"name": "CVE-2026-46087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46087"
},
{
"name": "CVE-2026-46092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46092"
},
{
"name": "CVE-2026-46093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46093"
},
{
"name": "CVE-2026-46095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46095"
},
{
"name": "CVE-2026-46096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46096"
},
{
"name": "CVE-2026-46097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46097"
},
{
"name": "CVE-2026-46100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46100"
},
{
"name": "CVE-2026-46246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46246"
},
{
"name": "CVE-2026-46247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46247"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-46251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46251"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-46254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46254"
},
{
"name": "CVE-2026-46255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46255"
},
{
"name": "CVE-2026-46260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46260"
},
{
"name": "CVE-2026-46261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46261"
},
{
"name": "CVE-2026-46265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46265"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-46276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46276"
},
{
"name": "CVE-2026-46277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46277"
},
{
"name": "CVE-2026-46278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46278"
},
{
"name": "CVE-2026-46279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46279"
},
{
"name": "CVE-2026-46281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46281"
},
{
"name": "CVE-2026-46282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46282"
},
{
"name": "CVE-2026-46283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46283"
},
{
"name": "CVE-2026-46284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46284"
},
{
"name": "CVE-2026-46286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46286"
},
{
"name": "CVE-2026-46288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46288"
},
{
"name": "CVE-2026-46290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46290"
},
{
"name": "CVE-2026-46325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46325"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2026-46332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46332"
},
{
"name": "CVE-2026-52904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52904"
},
{
"name": "CVE-2026-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52905"
},
{
"name": "CVE-2026-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52906"
},
{
"name": "CVE-2026-52907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52907"
},
{
"name": "CVE-2026-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52933"
},
{
"name": "CVE-2026-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53174"
},
{
"name": "CVE-2026-43036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43036"
},
{
"name": "CVE-2026-43049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43049"
},
{
"name": "CVE-2026-43119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43119"
},
{
"name": "CVE-2026-43345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43345"
},
{
"name": "CVE-2026-43405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43405"
},
{
"name": "CVE-2026-43469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43469"
},
{
"name": "CVE-2026-46162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46162"
},
{
"name": "CVE-2026-52928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52928"
},
{
"name": "CVE-2026-46242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46242"
},
{
"name": "CVE-2026-52975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52975"
},
{
"name": "CVE-2026-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53070"
},
{
"name": "CVE-2026-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53101"
},
{
"name": "CVE-2026-31630",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31630"
},
{
"name": "CVE-2026-43064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43064"
},
{
"name": "CVE-2026-43075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43075"
},
{
"name": "CVE-2026-43076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43076"
},
{
"name": "CVE-2026-43079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43079"
},
{
"name": "CVE-2026-43080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43080"
},
{
"name": "CVE-2026-43085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43085"
},
{
"name": "CVE-2026-43089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43089"
},
{
"name": "CVE-2026-43093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43093"
},
{
"name": "CVE-2026-43094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43094"
},
{
"name": "CVE-2026-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43098"
},
{
"name": "CVE-2026-43099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43099"
},
{
"name": "CVE-2026-43103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43103"
},
{
"name": "CVE-2026-43104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43104"
},
{
"name": "CVE-2026-43105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43105"
},
{
"name": "CVE-2026-43111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43111"
},
{
"name": "CVE-2026-43113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43113"
},
{
"name": "CVE-2026-43421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43421"
},
{
"name": "CVE-2026-43492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43492"
},
{
"name": "CVE-2026-43495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43495"
},
{
"name": "CVE-2026-43496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43496"
},
{
"name": "CVE-2026-43497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43497"
},
{
"name": "CVE-2026-43502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43502"
},
{
"name": "CVE-2026-46143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46143"
},
{
"name": "CVE-2026-46179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46179"
},
{
"name": "CVE-2026-46184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46184"
},
{
"name": "CVE-2026-46235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46235"
},
{
"name": "CVE-2026-46294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46294"
},
{
"name": "CVE-2026-46314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46314"
},
{
"name": "CVE-2026-52914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52914"
},
{
"name": "CVE-2026-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52920"
},
{
"name": "CVE-2026-52925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52925"
},
{
"name": "CVE-2026-52954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52954"
},
{
"name": "CVE-2026-52955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52955"
},
{
"name": "CVE-2026-52957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52957"
},
{
"name": "CVE-2026-52958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52958"
},
{
"name": "CVE-2026-52962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52962"
},
{
"name": "CVE-2026-52963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52963"
},
{
"name": "CVE-2026-52967",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52967"
},
{
"name": "CVE-2026-52968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52968"
},
{
"name": "CVE-2026-52969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52969"
},
{
"name": "CVE-2026-52970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52970"
},
{
"name": "CVE-2026-52974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52974"
},
{
"name": "CVE-2026-52977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52977"
},
{
"name": "CVE-2026-52981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52981"
},
{
"name": "CVE-2026-52982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52982"
},
{
"name": "CVE-2026-52984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52984"
},
{
"name": "CVE-2026-52985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52985"
},
{
"name": "CVE-2026-52986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52986"
},
{
"name": "CVE-2026-52989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52989"
},
{
"name": "CVE-2026-52992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52992"
},
{
"name": "CVE-2026-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52993"
},
{
"name": "CVE-2026-52995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52995"
},
{
"name": "CVE-2026-52998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52998"
},
{
"name": "CVE-2026-52999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52999"
},
{
"name": "CVE-2026-53001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53001"
},
{
"name": "CVE-2026-53002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53002"
},
{
"name": "CVE-2026-53003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53003"
},
{
"name": "CVE-2026-53004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53004"
},
{
"name": "CVE-2026-43081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43081"
},
{
"name": "CVE-2026-43086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43086"
},
{
"name": "CVE-2026-43107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43107"
},
{
"name": "CVE-2026-43456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43456"
},
{
"name": "CVE-2026-53053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53053"
},
{
"name": "CVE-2026-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53122"
},
{
"name": "CVE-2026-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53281"
},
{
"name": "CVE-2026-53006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53006"
},
{
"name": "CVE-2026-53011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53011"
},
{
"name": "CVE-2026-53012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53012"
},
{
"name": "CVE-2026-53016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53016"
},
{
"name": "CVE-2026-53021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53021"
},
{
"name": "CVE-2026-53022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53022"
},
{
"name": "CVE-2026-53023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53023"
},
{
"name": "CVE-2026-53033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53033"
},
{
"name": "CVE-2026-53034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53034"
},
{
"name": "CVE-2026-53035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53035"
},
{
"name": "CVE-2026-53036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53036"
},
{
"name": "CVE-2026-53037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53037"
},
{
"name": "CVE-2026-53039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53039"
},
{
"name": "CVE-2026-53040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53040"
},
{
"name": "CVE-2026-53041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53041"
},
{
"name": "CVE-2026-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53043"
},
{
"name": "CVE-2026-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53045"
},
{
"name": "CVE-2026-53046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53046"
},
{
"name": "CVE-2026-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53047"
},
{
"name": "CVE-2026-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53048"
},
{
"name": "CVE-2026-53049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53049"
},
{
"name": "CVE-2026-53050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53050"
},
{
"name": "CVE-2026-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53052"
},
{
"name": "CVE-2026-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53056"
},
{
"name": "CVE-2026-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53059"
},
{
"name": "CVE-2026-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53060"
},
{
"name": "CVE-2026-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53061"
},
{
"name": "CVE-2026-53062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53062"
},
{
"name": "CVE-2026-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53063"
},
{
"name": "CVE-2026-53064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53064"
},
{
"name": "CVE-2026-53065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53065"
},
{
"name": "CVE-2026-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53066"
},
{
"name": "CVE-2026-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53068"
},
{
"name": "CVE-2026-53069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53069"
},
{
"name": "CVE-2026-53071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53071"
},
{
"name": "CVE-2026-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53072"
},
{
"name": "CVE-2026-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53073"
},
{
"name": "CVE-2026-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53074"
},
{
"name": "CVE-2026-53075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53075"
},
{
"name": "CVE-2026-53077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53077"
},
{
"name": "CVE-2026-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53082"
},
{
"name": "CVE-2026-53086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53086"
},
{
"name": "CVE-2026-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53088"
},
{
"name": "CVE-2026-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53093"
},
{
"name": "CVE-2026-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53096"
},
{
"name": "CVE-2026-53111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53111"
},
{
"name": "CVE-2026-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53112"
},
{
"name": "CVE-2026-53128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53128"
},
{
"name": "CVE-2026-53130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53130"
},
{
"name": "CVE-2026-53279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53279"
},
{
"name": "CVE-2026-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53287"
},
{
"name": "CVE-2026-53289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53289"
},
{
"name": "CVE-2026-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53291"
},
{
"name": "CVE-2026-53294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53294"
},
{
"name": "CVE-2026-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53295"
},
{
"name": "CVE-2026-53296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53296"
},
{
"name": "CVE-2026-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53303"
},
{
"name": "CVE-2026-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53304"
},
{
"name": "CVE-2026-53306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53306"
},
{
"name": "CVE-2026-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53309"
},
{
"name": "CVE-2026-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53314"
},
{
"name": "CVE-2026-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53320"
},
{
"name": "CVE-2026-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53354"
},
{
"name": "CVE-2026-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53357"
},
{
"name": "CVE-2026-43281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43281"
},
{
"name": "CVE-2026-52936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52936"
},
{
"name": "CVE-2026-53013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53013"
},
{
"name": "CVE-2026-53032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53032"
},
{
"name": "CVE-2026-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53058"
},
{
"name": "CVE-2026-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53076"
},
{
"name": "CVE-2026-53094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53094"
},
{
"name": "CVE-2026-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53110"
},
{
"name": "CVE-2026-53126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53126"
},
{
"name": "CVE-2026-53293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53293"
},
{
"name": "CVE-2026-43185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43185"
},
{
"name": "CVE-2026-64208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64208"
},
{
"name": "CVE-2026-64209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64209"
},
{
"name": "CVE-2026-64210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64210"
},
{
"name": "CVE-2026-64211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64211"
},
{
"name": "CVE-2026-64212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64212"
},
{
"name": "CVE-2026-64213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64213"
},
{
"name": "CVE-2026-64214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64214"
},
{
"name": "CVE-2026-64215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64215"
},
{
"name": "CVE-2026-64216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64216"
},
{
"name": "CVE-2026-64217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64217"
},
{
"name": "CVE-2026-64218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64218"
},
{
"name": "CVE-2026-64219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64219"
},
{
"name": "CVE-2026-64220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64220"
},
{
"name": "CVE-2026-64221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64221"
},
{
"name": "CVE-2026-64222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64222"
},
{
"name": "CVE-2026-64223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64223"
},
{
"name": "CVE-2026-64224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64224"
},
{
"name": "CVE-2026-64225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64225"
},
{
"name": "CVE-2026-64226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64226"
},
{
"name": "CVE-2026-64227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64227"
},
{
"name": "CVE-2026-64228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64228"
},
{
"name": "CVE-2026-64229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64229"
},
{
"name": "CVE-2026-64230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64230"
},
{
"name": "CVE-2026-64231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64231"
},
{
"name": "CVE-2026-64232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64232"
},
{
"name": "CVE-2026-64233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64233"
},
{
"name": "CVE-2026-64234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64234"
},
{
"name": "CVE-2026-64235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64235"
},
{
"name": "CVE-2026-64236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64236"
},
{
"name": "CVE-2026-64237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64237"
},
{
"name": "CVE-2026-64238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64238"
},
{
"name": "CVE-2026-64239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64239"
},
{
"name": "CVE-2026-64240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64240"
},
{
"name": "CVE-2026-64241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64241"
},
{
"name": "CVE-2026-64242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64242"
},
{
"name": "CVE-2026-64243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64243"
},
{
"name": "CVE-2026-64515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64515"
},
{
"name": "CVE-2026-64516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64516"
},
{
"name": "CVE-2026-64517",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64517"
},
{
"name": "CVE-2026-64518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64518"
},
{
"name": "CVE-2025-71187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71187"
},
{
"name": "CVE-2025-71201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71201"
},
{
"name": "CVE-2025-71287",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71287"
},
{
"name": "CVE-2025-71288",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71288"
},
{
"name": "CVE-2026-22987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22987"
},
{
"name": "CVE-2026-23007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23007"
},
{
"name": "CVE-2026-23008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23008"
},
{
"name": "CVE-2026-23009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23009"
},
{
"name": "CVE-2026-23012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23012"
},
{
"name": "CVE-2026-23014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23014"
},
{
"name": "CVE-2026-23015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23015"
},
{
"name": "CVE-2026-23018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23018"
},
{
"name": "CVE-2026-23022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23022"
},
{
"name": "CVE-2026-23024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23024"
},
{
"name": "CVE-2026-23034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23034"
},
{
"name": "CVE-2026-23036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23036"
},
{
"name": "CVE-2026-23042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23042"
},
{
"name": "CVE-2026-23044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23044"
},
{
"name": "CVE-2026-23045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23045"
},
{
"name": "CVE-2026-23046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23046"
},
{
"name": "CVE-2026-23051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23051"
},
{
"name": "CVE-2026-23052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23052"
},
{
"name": "CVE-2026-23067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23067"
},
{
"name": "CVE-2026-23077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23077"
},
{
"name": "CVE-2026-23079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23079"
},
{
"name": "CVE-2026-23081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23081"
},
{
"name": "CVE-2026-23092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23092"
},
{
"name": "CVE-2026-23106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23106"
},
{
"name": "CVE-2026-23109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23109"
},
{
"name": "CVE-2026-23114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23114"
},
{
"name": "CVE-2026-23115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23115"
},
{
"name": "CVE-2026-23122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23122"
},
{
"name": "CVE-2026-23130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23130"
},
{
"name": "CVE-2026-23143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23143"
},
{
"name": "CVE-2026-23147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23147"
},
{
"name": "CVE-2026-23158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23158"
},
{
"name": "CVE-2026-23161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23161"
},
{
"name": "CVE-2026-23162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23162"
},
{
"name": "CVE-2026-23165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23165"
},
{
"name": "CVE-2026-31413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31413"
},
{
"name": "CVE-2026-31722",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31722"
},
{
"name": "CVE-2026-31723",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31723"
},
{
"name": "CVE-2026-31724",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31724"
},
{
"name": "CVE-2026-31725",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31725"
},
{
"name": "CVE-2026-31730",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31730"
},
{
"name": "CVE-2026-31731",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31731"
},
{
"name": "CVE-2026-31740",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31740"
},
{
"name": "CVE-2026-31741",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31741"
},
{
"name": "CVE-2026-43007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43007"
},
{
"name": "CVE-2026-43016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43016"
},
{
"name": "CVE-2026-43019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43019"
},
{
"name": "CVE-2026-43084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43084"
},
{
"name": "CVE-2026-43091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43091"
},
{
"name": "CVE-2026-43092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43092"
},
{
"name": "CVE-2026-43129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43129"
},
{
"name": "CVE-2026-43162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43162"
},
{
"name": "CVE-2026-43324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43324"
},
{
"name": "CVE-2026-43368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43368"
},
{
"name": "CVE-2026-43371",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43371"
},
{
"name": "CVE-2026-43372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43372"
},
{
"name": "CVE-2026-43377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43377"
},
{
"name": "CVE-2026-43380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43380"
},
{
"name": "CVE-2026-43395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43395"
},
{
"name": "CVE-2026-43397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43397"
},
{
"name": "CVE-2026-43408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43408"
},
{
"name": "CVE-2026-43409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43409"
},
{
"name": "CVE-2026-43412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43412"
},
{
"name": "CVE-2026-43415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43415"
},
{
"name": "CVE-2026-43436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43436"
},
{
"name": "CVE-2026-43448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43448"
},
{
"name": "CVE-2026-43457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43457"
},
{
"name": "CVE-2026-43467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43467"
},
{
"name": "CVE-2026-43468",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43468"
},
{
"name": "CVE-2026-43471",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43471"
},
{
"name": "CVE-2026-43473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43473"
},
{
"name": "CVE-2026-43476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43476"
},
{
"name": "CVE-2026-43484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43484"
},
{
"name": "CVE-2026-43488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43488"
},
{
"name": "CVE-2026-43498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43498"
},
{
"name": "CVE-2026-45837",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45837"
},
{
"name": "CVE-2026-45855",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45855"
},
{
"name": "CVE-2026-45858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45858"
},
{
"name": "CVE-2026-45911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45911"
},
{
"name": "CVE-2026-45924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45924"
},
{
"name": "CVE-2026-45943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45943"
},
{
"name": "CVE-2026-46104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46104"
},
{
"name": "CVE-2026-46105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46105"
},
{
"name": "CVE-2026-46118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46118"
},
{
"name": "CVE-2026-46121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46121"
},
{
"name": "CVE-2026-46126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46126"
},
{
"name": "CVE-2026-46130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46130"
},
{
"name": "CVE-2026-46134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46134"
},
{
"name": "CVE-2026-46139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46139"
},
{
"name": "CVE-2026-46140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46140"
},
{
"name": "CVE-2026-46141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46141"
},
{
"name": "CVE-2026-46147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46147"
},
{
"name": "CVE-2026-46148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46148"
},
{
"name": "CVE-2026-46153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46153"
},
{
"name": "CVE-2026-46154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46154"
},
{
"name": "CVE-2026-46171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46171"
},
{
"name": "CVE-2026-46175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46175"
},
{
"name": "CVE-2026-46182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46182"
},
{
"name": "CVE-2026-46183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46183"
},
{
"name": "CVE-2026-46188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46188"
},
{
"name": "CVE-2026-46192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46192"
},
{
"name": "CVE-2026-46194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46194"
},
{
"name": "CVE-2026-46200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46200"
},
{
"name": "CVE-2026-46201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46201"
},
{
"name": "CVE-2026-46202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46202"
},
{
"name": "CVE-2026-46207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46207"
},
{
"name": "CVE-2026-46210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46210"
},
{
"name": "CVE-2026-46211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46211"
},
{
"name": "CVE-2026-46213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46213"
},
{
"name": "CVE-2026-46215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46215"
},
{
"name": "CVE-2026-46221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46221"
},
{
"name": "CVE-2026-46222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46222"
},
{
"name": "CVE-2026-46223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46223"
},
{
"name": "CVE-2026-46224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46224"
},
{
"name": "CVE-2026-46228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46228"
},
{
"name": "CVE-2026-46232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46232"
},
{
"name": "CVE-2026-46239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46239"
},
{
"name": "CVE-2026-46240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46240"
},
{
"name": "CVE-2026-46241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46241"
},
{
"name": "CVE-2026-46295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46295"
},
{
"name": "CVE-2026-46297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46297"
},
{
"name": "CVE-2026-46298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46298"
},
{
"name": "CVE-2026-46302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46302"
},
{
"name": "CVE-2026-46305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46305"
},
{
"name": "CVE-2026-46308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46308"
},
{
"name": "CVE-2026-46309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46309"
},
{
"name": "CVE-2026-46310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46310"
},
{
"name": "CVE-2026-46311",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46311"
},
{
"name": "CVE-2026-46313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46313"
},
{
"name": "CVE-2026-46318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46318"
},
{
"name": "CVE-2026-46324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46324"
},
{
"name": "CVE-2026-52932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52932"
},
{
"name": "CVE-2026-52937",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52937"
},
{
"name": "CVE-2026-52949",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52949"
},
{
"name": "CVE-2026-52950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52950"
},
{
"name": "CVE-2026-52951",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52951"
},
{
"name": "CVE-2026-52952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52952"
},
{
"name": "CVE-2026-52953",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52953"
},
{
"name": "CVE-2026-52956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52956"
},
{
"name": "CVE-2026-52959",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52959"
},
{
"name": "CVE-2026-52960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52960"
},
{
"name": "CVE-2026-52961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52961"
},
{
"name": "CVE-2026-52964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52964"
},
{
"name": "CVE-2026-52965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52965"
},
{
"name": "CVE-2026-52971",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52971"
},
{
"name": "CVE-2026-52973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52973"
},
{
"name": "CVE-2026-52976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52976"
},
{
"name": "CVE-2026-52978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52978"
},
{
"name": "CVE-2026-52979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52979"
},
{
"name": "CVE-2026-52980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52980"
},
{
"name": "CVE-2026-52983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52983"
},
{
"name": "CVE-2026-52987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52987"
},
{
"name": "CVE-2026-52988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52988"
},
{
"name": "CVE-2026-52990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52990"
},
{
"name": "CVE-2026-52991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52991"
},
{
"name": "CVE-2026-52994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52994"
},
{
"name": "CVE-2026-52996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52996"
},
{
"name": "CVE-2026-52997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52997"
},
{
"name": "CVE-2026-53000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53000"
},
{
"name": "CVE-2026-53005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53005"
},
{
"name": "CVE-2026-53007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53007"
},
{
"name": "CVE-2026-53008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53008"
},
{
"name": "CVE-2026-53009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53009"
},
{
"name": "CVE-2026-53010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53010"
},
{
"name": "CVE-2026-53014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53014"
},
{
"name": "CVE-2026-53015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53015"
},
{
"name": "CVE-2026-53017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53017"
},
{
"name": "CVE-2026-53018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53018"
},
{
"name": "CVE-2026-53019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53019"
},
{
"name": "CVE-2026-53020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53020"
},
{
"name": "CVE-2026-53024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53024"
},
{
"name": "CVE-2026-53025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53025"
},
{
"name": "CVE-2026-53026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53026"
},
{
"name": "CVE-2026-53027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53027"
},
{
"name": "CVE-2026-53028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53028"
},
{
"name": "CVE-2026-53029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53029"
},
{
"name": "CVE-2026-53030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53030"
},
{
"name": "CVE-2026-53031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53031"
},
{
"name": "CVE-2026-53038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53038"
},
{
"name": "CVE-2026-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53042"
},
{
"name": "CVE-2026-53044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53044"
},
{
"name": "CVE-2026-53051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53051"
},
{
"name": "CVE-2026-53054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53054"
},
{
"name": "CVE-2026-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53055"
},
{
"name": "CVE-2026-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53057"
},
{
"name": "CVE-2026-53067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53067"
},
{
"name": "CVE-2026-53078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53078"
},
{
"name": "CVE-2026-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53079"
},
{
"name": "CVE-2026-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53081"
},
{
"name": "CVE-2026-53083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53083"
},
{
"name": "CVE-2026-53084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53084"
},
{
"name": "CVE-2026-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53085"
},
{
"name": "CVE-2026-53087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53087"
},
{
"name": "CVE-2026-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53089"
},
{
"name": "CVE-2026-53090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53090"
},
{
"name": "CVE-2026-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53091"
},
{
"name": "CVE-2026-53092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53092"
},
{
"name": "CVE-2026-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53095"
},
{
"name": "CVE-2026-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53097"
},
{
"name": "CVE-2026-53098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53098"
},
{
"name": "CVE-2026-53099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53099"
},
{
"name": "CVE-2026-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53100"
},
{
"name": "CVE-2026-53102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53102"
},
{
"name": "CVE-2026-53103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53103"
},
{
"name": "CVE-2026-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53104"
},
{
"name": "CVE-2026-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53105"
},
{
"name": "CVE-2026-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53106"
},
{
"name": "CVE-2026-53107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53107"
},
{
"name": "CVE-2026-53108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53108"
},
{
"name": "CVE-2026-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53109"
},
{
"name": "CVE-2026-53113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53113"
},
{
"name": "CVE-2026-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53114"
},
{
"name": "CVE-2026-53115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53115"
},
{
"name": "CVE-2026-53116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53116"
},
{
"name": "CVE-2026-53117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53117"
},
{
"name": "CVE-2026-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53118"
},
{
"name": "CVE-2026-53119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53119"
},
{
"name": "CVE-2026-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53120"
},
{
"name": "CVE-2026-53121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53121"
},
{
"name": "CVE-2026-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53123"
},
{
"name": "CVE-2026-53124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53124"
},
{
"name": "CVE-2026-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53125"
},
{
"name": "CVE-2026-53127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53127"
},
{
"name": "CVE-2026-53129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53129"
},
{
"name": "CVE-2026-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53277"
},
{
"name": "CVE-2026-53278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53278"
},
{
"name": "CVE-2026-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53280"
},
{
"name": "CVE-2026-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53282"
},
{
"name": "CVE-2026-53283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53283"
},
{
"name": "CVE-2026-53284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53284"
},
{
"name": "CVE-2026-53285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53285"
},
{
"name": "CVE-2026-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53286"
},
{
"name": "CVE-2026-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53288"
},
{
"name": "CVE-2026-53290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53290"
},
{
"name": "CVE-2026-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53292"
},
{
"name": "CVE-2026-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53297"
},
{
"name": "CVE-2026-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53298"
},
{
"name": "CVE-2026-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53299"
},
{
"name": "CVE-2026-53300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53300"
},
{
"name": "CVE-2026-53301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53301"
},
{
"name": "CVE-2026-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53302"
},
{
"name": "CVE-2026-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53305"
},
{
"name": "CVE-2026-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53307"
},
{
"name": "CVE-2026-53308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53308"
},
{
"name": "CVE-2026-53310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53310"
},
{
"name": "CVE-2026-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53311"
},
{
"name": "CVE-2026-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53312"
},
{
"name": "CVE-2026-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53313"
},
{
"name": "CVE-2026-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53315"
},
{
"name": "CVE-2026-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53316"
},
{
"name": "CVE-2026-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53317"
},
{
"name": "CVE-2026-53318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53318"
},
{
"name": "CVE-2026-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53319"
},
{
"name": "CVE-2026-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53321"
},
{
"name": "CVE-2026-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53322"
},
{
"name": "CVE-2026-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53323"
},
{
"name": "CVE-2026-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53324"
},
{
"name": "CVE-2026-53358",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53358"
},
{
"name": "CVE-2026-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53360"
},
{
"name": "CVE-2026-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53364"
},
{
"name": "CVE-2026-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53365"
},
{
"name": "CVE-2026-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53367"
},
{
"name": "CVE-2026-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53368"
},
{
"name": "CVE-2026-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53369"
},
{
"name": "CVE-2026-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53370"
},
{
"name": "CVE-2026-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53371"
},
{
"name": "CVE-2026-53372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53372"
},
{
"name": "CVE-2026-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53373"
},
{
"name": "CVE-2026-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53374"
},
{
"name": "CVE-2026-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53375"
},
{
"name": "CVE-2026-53376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53376"
},
{
"name": "CVE-2026-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53377"
},
{
"name": "CVE-2026-53378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53378"
},
{
"name": "CVE-2026-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53379"
},
{
"name": "CVE-2026-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53380"
},
{
"name": "CVE-2026-63837",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63837"
},
{
"name": "CVE-2026-63838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63838"
},
{
"name": "CVE-2026-63839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63839"
},
{
"name": "CVE-2026-63840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63840"
},
{
"name": "CVE-2026-63841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63841"
},
{
"name": "CVE-2026-63842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63842"
},
{
"name": "CVE-2026-63843",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63843"
},
{
"name": "CVE-2026-63844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63844"
},
{
"name": "CVE-2026-63845",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63845"
},
{
"name": "CVE-2026-63846",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63846"
},
{
"name": "CVE-2026-63847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63847"
},
{
"name": "CVE-2026-63848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63848"
},
{
"name": "CVE-2026-63849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63849"
},
{
"name": "CVE-2026-63850",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63850"
},
{
"name": "CVE-2026-63851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63851"
},
{
"name": "CVE-2026-63852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63852"
},
{
"name": "CVE-2026-63853",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63853"
},
{
"name": "CVE-2026-63854",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63854"
},
{
"name": "CVE-2026-63855",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63855"
},
{
"name": "CVE-2026-63856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63856"
},
{
"name": "CVE-2026-63857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63857"
},
{
"name": "CVE-2026-63858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63858"
},
{
"name": "CVE-2026-63859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63859"
},
{
"name": "CVE-2026-63860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63860"
},
{
"name": "CVE-2026-63861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63861"
},
{
"name": "CVE-2026-63862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63862"
},
{
"name": "CVE-2026-63863",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63863"
},
{
"name": "CVE-2026-63864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63864"
},
{
"name": "CVE-2026-63865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63865"
},
{
"name": "CVE-2026-63866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63866"
},
{
"name": "CVE-2026-63875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63875"
},
{
"name": "CVE-2026-63876",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63876"
},
{
"name": "CVE-2026-63877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63877"
},
{
"name": "CVE-2026-63878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63878"
},
{
"name": "CVE-2026-63879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63879"
},
{
"name": "CVE-2026-63880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63880"
},
{
"name": "CVE-2026-63881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63881"
},
{
"name": "CVE-2026-63882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63882"
},
{
"name": "CVE-2026-63883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63883"
},
{
"name": "CVE-2026-63884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63884"
},
{
"name": "CVE-2026-63886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63886"
},
{
"name": "CVE-2026-63887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63887"
},
{
"name": "CVE-2026-63888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63888"
},
{
"name": "CVE-2026-63889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63889"
},
{
"name": "CVE-2026-63890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63890"
},
{
"name": "CVE-2026-63891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63891"
},
{
"name": "CVE-2026-63892",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63892"
},
{
"name": "CVE-2026-63893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63893"
},
{
"name": "CVE-2026-63894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63894"
},
{
"name": "CVE-2026-63895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63895"
},
{
"name": "CVE-2026-63896",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63896"
},
{
"name": "CVE-2026-63897",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63897"
},
{
"name": "CVE-2026-63898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63898"
},
{
"name": "CVE-2026-63899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63899"
},
{
"name": "CVE-2026-63900",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63900"
},
{
"name": "CVE-2026-63901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63901"
},
{
"name": "CVE-2026-63902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63902"
},
{
"name": "CVE-2026-63903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63903"
},
{
"name": "CVE-2026-63904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63904"
},
{
"name": "CVE-2026-63905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63905"
},
{
"name": "CVE-2026-63906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63906"
},
{
"name": "CVE-2026-63907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63907"
},
{
"name": "CVE-2026-63908",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63908"
},
{
"name": "CVE-2026-63909",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63909"
},
{
"name": "CVE-2026-63910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63910"
},
{
"name": "CVE-2026-63911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63911"
},
{
"name": "CVE-2026-63912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63912"
},
{
"name": "CVE-2026-63913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63913"
},
{
"name": "CVE-2026-63914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63914"
},
{
"name": "CVE-2026-63915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63915"
},
{
"name": "CVE-2026-63916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63916"
},
{
"name": "CVE-2026-63917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63917"
},
{
"name": "CVE-2026-63918",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63918"
},
{
"name": "CVE-2026-63919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63919"
},
{
"name": "CVE-2026-63920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63920"
},
{
"name": "CVE-2026-63921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63921"
},
{
"name": "CVE-2026-63922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63922"
},
{
"name": "CVE-2026-63923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63923"
},
{
"name": "CVE-2026-63924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63924"
},
{
"name": "CVE-2026-63925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63925"
},
{
"name": "CVE-2026-63926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63926"
},
{
"name": "CVE-2026-63927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63927"
},
{
"name": "CVE-2026-63928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63928"
},
{
"name": "CVE-2026-63929",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63929"
},
{
"name": "CVE-2026-63930",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63930"
},
{
"name": "CVE-2026-63931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63931"
},
{
"name": "CVE-2026-63932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63932"
},
{
"name": "CVE-2026-63933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63933"
},
{
"name": "CVE-2026-63934",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63934"
},
{
"name": "CVE-2026-63935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63935"
},
{
"name": "CVE-2026-63936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63936"
},
{
"name": "CVE-2026-63937",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63937"
},
{
"name": "CVE-2026-63938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63938"
},
{
"name": "CVE-2026-63939",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63939"
},
{
"name": "CVE-2026-63940",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63940"
},
{
"name": "CVE-2026-63941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63941"
},
{
"name": "CVE-2026-63942",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63942"
},
{
"name": "CVE-2026-63943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63943"
},
{
"name": "CVE-2026-63944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63944"
},
{
"name": "CVE-2026-63945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63945"
},
{
"name": "CVE-2026-63946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63946"
},
{
"name": "CVE-2026-63947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63947"
},
{
"name": "CVE-2026-63948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63948"
},
{
"name": "CVE-2026-63949",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63949"
},
{
"name": "CVE-2026-63950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63950"
},
{
"name": "CVE-2026-63951",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63951"
},
{
"name": "CVE-2026-63952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63952"
},
{
"name": "CVE-2026-63953",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63953"
},
{
"name": "CVE-2026-63954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63954"
},
{
"name": "CVE-2026-63955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63955"
},
{
"name": "CVE-2026-63956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63956"
},
{
"name": "CVE-2026-63957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63957"
},
{
"name": "CVE-2026-63958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63958"
},
{
"name": "CVE-2026-63959",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63959"
},
{
"name": "CVE-2026-63960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63960"
},
{
"name": "CVE-2026-63961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63961"
},
{
"name": "CVE-2026-63962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63962"
},
{
"name": "CVE-2026-63963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63963"
},
{
"name": "CVE-2026-63964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63964"
},
{
"name": "CVE-2026-63965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63965"
},
{
"name": "CVE-2026-63966",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63966"
},
{
"name": "CVE-2026-63967",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63967"
},
{
"name": "CVE-2026-63968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63968"
},
{
"name": "CVE-2026-63969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63969"
},
{
"name": "CVE-2026-63970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63970"
},
{
"name": "CVE-2026-63971",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63971"
},
{
"name": "CVE-2026-63972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63972"
},
{
"name": "CVE-2026-63973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63973"
},
{
"name": "CVE-2026-63974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63974"
},
{
"name": "CVE-2026-63975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63975"
},
{
"name": "CVE-2026-63976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63976"
},
{
"name": "CVE-2026-63977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63977"
},
{
"name": "CVE-2026-63978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63978"
},
{
"name": "CVE-2026-63979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63979"
},
{
"name": "CVE-2026-63980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63980"
},
{
"name": "CVE-2026-63981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63981"
},
{
"name": "CVE-2026-63982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63982"
},
{
"name": "CVE-2026-63983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63983"
},
{
"name": "CVE-2026-63984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63984"
},
{
"name": "CVE-2026-63985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63985"
},
{
"name": "CVE-2026-63986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63986"
},
{
"name": "CVE-2026-63987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63987"
},
{
"name": "CVE-2026-63988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63988"
},
{
"name": "CVE-2026-63989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63989"
},
{
"name": "CVE-2026-63990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63990"
},
{
"name": "CVE-2026-63991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63991"
},
{
"name": "CVE-2026-63992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63992"
},
{
"name": "CVE-2026-63993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63993"
},
{
"name": "CVE-2026-63994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63994"
},
{
"name": "CVE-2026-63995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63995"
},
{
"name": "CVE-2026-63996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63996"
},
{
"name": "CVE-2026-63997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63997"
},
{
"name": "CVE-2026-63998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63998"
},
{
"name": "CVE-2026-63999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63999"
},
{
"name": "CVE-2026-64000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64000"
},
{
"name": "CVE-2026-64001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64001"
},
{
"name": "CVE-2026-64002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64002"
},
{
"name": "CVE-2026-64003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64003"
},
{
"name": "CVE-2026-64004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64004"
},
{
"name": "CVE-2026-64005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64005"
},
{
"name": "CVE-2026-64006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64006"
},
{
"name": "CVE-2026-64007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64007"
},
{
"name": "CVE-2026-64008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64008"
},
{
"name": "CVE-2026-64009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64009"
},
{
"name": "CVE-2026-64010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64010"
},
{
"name": "CVE-2026-64011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64011"
},
{
"name": "CVE-2026-64012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64012"
},
{
"name": "CVE-2026-64013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64013"
},
{
"name": "CVE-2026-64014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64014"
},
{
"name": "CVE-2026-64015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64015"
},
{
"name": "CVE-2026-64017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64017"
},
{
"name": "CVE-2026-64018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64018"
},
{
"name": "CVE-2026-64019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64019"
},
{
"name": "CVE-2026-64020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64020"
},
{
"name": "CVE-2026-64021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64021"
},
{
"name": "CVE-2026-64022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64022"
},
{
"name": "CVE-2026-64023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64023"
},
{
"name": "CVE-2026-64024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64024"
},
{
"name": "CVE-2026-64025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64025"
},
{
"name": "CVE-2026-64026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64026"
},
{
"name": "CVE-2026-64027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64027"
},
{
"name": "CVE-2026-64029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64029"
},
{
"name": "CVE-2026-64030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64030"
},
{
"name": "CVE-2026-64031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64031"
},
{
"name": "CVE-2026-64032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64032"
},
{
"name": "CVE-2026-64033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64033"
},
{
"name": "CVE-2026-64034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64034"
},
{
"name": "CVE-2026-64035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64035"
},
{
"name": "CVE-2026-64036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64036"
},
{
"name": "CVE-2026-64037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64037"
},
{
"name": "CVE-2026-64038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64038"
},
{
"name": "CVE-2026-64039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64039"
},
{
"name": "CVE-2026-64040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64040"
},
{
"name": "CVE-2026-64041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64041"
},
{
"name": "CVE-2026-64042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64042"
},
{
"name": "CVE-2026-64043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64043"
},
{
"name": "CVE-2026-64044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64044"
},
{
"name": "CVE-2026-64045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64045"
},
{
"name": "CVE-2026-64046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64046"
},
{
"name": "CVE-2026-64047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64047"
},
{
"name": "CVE-2026-64048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64048"
},
{
"name": "CVE-2026-64049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64049"
},
{
"name": "CVE-2026-64050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64050"
},
{
"name": "CVE-2026-64051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64051"
},
{
"name": "CVE-2026-64052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64052"
},
{
"name": "CVE-2026-64053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64053"
},
{
"name": "CVE-2026-64054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64054"
},
{
"name": "CVE-2026-64055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64055"
},
{
"name": "CVE-2026-64056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64056"
},
{
"name": "CVE-2026-64057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64057"
},
{
"name": "CVE-2026-64058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64058"
},
{
"name": "CVE-2026-64059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64059"
},
{
"name": "CVE-2026-64060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64060"
},
{
"name": "CVE-2026-64061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64061"
},
{
"name": "CVE-2026-64062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64062"
},
{
"name": "CVE-2026-64063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64063"
},
{
"name": "CVE-2026-64064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64064"
},
{
"name": "CVE-2026-64065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64065"
},
{
"name": "CVE-2026-64066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64066"
},
{
"name": "CVE-2026-64067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64067"
},
{
"name": "CVE-2026-64068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64068"
},
{
"name": "CVE-2026-64069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64069"
},
{
"name": "CVE-2026-64070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64070"
},
{
"name": "CVE-2026-64071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64071"
},
{
"name": "CVE-2026-64072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64072"
},
{
"name": "CVE-2026-64073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64073"
},
{
"name": "CVE-2026-64074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64074"
},
{
"name": "CVE-2026-64075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64075"
},
{
"name": "CVE-2026-64076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64076"
},
{
"name": "CVE-2026-64077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64077"
},
{
"name": "CVE-2026-64078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64078"
},
{
"name": "CVE-2026-64079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64079"
},
{
"name": "CVE-2026-64080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64080"
},
{
"name": "CVE-2026-64081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64081"
},
{
"name": "CVE-2026-64082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64082"
},
{
"name": "CVE-2026-64083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64083"
},
{
"name": "CVE-2026-64084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64084"
},
{
"name": "CVE-2026-64085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64085"
},
{
"name": "CVE-2026-64086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64086"
},
{
"name": "CVE-2026-64087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64087"
},
{
"name": "CVE-2026-64088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64088"
},
{
"name": "CVE-2026-64089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64089"
},
{
"name": "CVE-2026-64090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64090"
},
{
"name": "CVE-2026-64091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64091"
},
{
"name": "CVE-2026-64093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64093"
},
{
"name": "CVE-2026-64094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64094"
},
{
"name": "CVE-2026-64095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64095"
},
{
"name": "CVE-2026-64096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64096"
},
{
"name": "CVE-2026-64097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64097"
},
{
"name": "CVE-2026-64098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64098"
},
{
"name": "CVE-2026-64099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64099"
},
{
"name": "CVE-2026-64100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64100"
},
{
"name": "CVE-2026-64101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64101"
},
{
"name": "CVE-2026-64102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64102"
},
{
"name": "CVE-2026-64103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64103"
},
{
"name": "CVE-2026-64104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64104"
},
{
"name": "CVE-2026-64105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64105"
},
{
"name": "CVE-2026-64106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64106"
},
{
"name": "CVE-2026-64107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64107"
},
{
"name": "CVE-2026-64108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64108"
},
{
"name": "CVE-2026-64109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64109"
},
{
"name": "CVE-2026-64110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64110"
},
{
"name": "CVE-2026-64111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64111"
},
{
"name": "CVE-2026-64112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64112"
},
{
"name": "CVE-2026-64113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64113"
},
{
"name": "CVE-2026-64114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64114"
},
{
"name": "CVE-2026-64115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64115"
},
{
"name": "CVE-2026-64116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64116"
},
{
"name": "CVE-2026-64117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64117"
},
{
"name": "CVE-2026-64118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64118"
},
{
"name": "CVE-2026-64119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64119"
},
{
"name": "CVE-2026-64120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64120"
},
{
"name": "CVE-2026-64121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64121"
},
{
"name": "CVE-2026-64122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64122"
},
{
"name": "CVE-2026-64123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64123"
},
{
"name": "CVE-2026-64124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64124"
},
{
"name": "CVE-2026-64125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64125"
},
{
"name": "CVE-2026-64126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64126"
},
{
"name": "CVE-2026-64127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64127"
},
{
"name": "CVE-2026-64128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64128"
},
{
"name": "CVE-2026-64129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64129"
},
{
"name": "CVE-2026-64130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64130"
},
{
"name": "CVE-2026-64131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64131"
},
{
"name": "CVE-2026-64132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64132"
},
{
"name": "CVE-2026-64133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64133"
},
{
"name": "CVE-2026-64134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64134"
},
{
"name": "CVE-2026-64135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64135"
},
{
"name": "CVE-2026-64136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64136"
},
{
"name": "CVE-2026-64137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64137"
},
{
"name": "CVE-2026-64138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64138"
},
{
"name": "CVE-2026-64139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64139"
},
{
"name": "CVE-2026-64140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64140"
},
{
"name": "CVE-2026-64141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64141"
},
{
"name": "CVE-2026-64142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64142"
},
{
"name": "CVE-2026-64143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64143"
},
{
"name": "CVE-2026-64144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64144"
},
{
"name": "CVE-2026-64145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64145"
},
{
"name": "CVE-2026-64146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64146"
},
{
"name": "CVE-2026-64147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64147"
},
{
"name": "CVE-2026-64148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64148"
},
{
"name": "CVE-2026-64149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64149"
},
{
"name": "CVE-2026-64150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64150"
},
{
"name": "CVE-2026-64151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64151"
},
{
"name": "CVE-2026-64152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64152"
},
{
"name": "CVE-2026-64153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64153"
},
{
"name": "CVE-2026-64154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64154"
},
{
"name": "CVE-2026-64155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64155"
},
{
"name": "CVE-2026-64156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64156"
},
{
"name": "CVE-2026-64157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64157"
},
{
"name": "CVE-2026-64158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64158"
},
{
"name": "CVE-2026-64159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64159"
},
{
"name": "CVE-2026-64160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64160"
},
{
"name": "CVE-2026-64161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64161"
},
{
"name": "CVE-2026-64162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64162"
},
{
"name": "CVE-2026-64163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64163"
},
{
"name": "CVE-2026-64164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64164"
},
{
"name": "CVE-2026-64165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64165"
},
{
"name": "CVE-2026-64166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64166"
},
{
"name": "CVE-2026-64167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64167"
},
{
"name": "CVE-2026-64168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64168"
},
{
"name": "CVE-2026-64169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64169"
},
{
"name": "CVE-2026-64170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64170"
},
{
"name": "CVE-2026-64171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64171"
},
{
"name": "CVE-2026-64172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64172"
},
{
"name": "CVE-2026-64173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64173"
},
{
"name": "CVE-2026-64174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64174"
},
{
"name": "CVE-2026-64175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64175"
},
{
"name": "CVE-2026-64176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64176"
},
{
"name": "CVE-2026-64177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64177"
},
{
"name": "CVE-2026-64178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64178"
},
{
"name": "CVE-2026-64179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64179"
},
{
"name": "CVE-2026-64180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64180"
},
{
"name": "CVE-2026-64181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64181"
},
{
"name": "CVE-2026-64182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64182"
},
{
"name": "CVE-2026-64183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64183"
},
{
"name": "CVE-2026-64184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64184"
},
{
"name": "CVE-2026-64185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64185"
},
{
"name": "CVE-2026-64186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64186"
},
{
"name": "CVE-2026-64519",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64519"
},
{
"name": "CVE-2026-64520",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64520"
},
{
"name": "CVE-2026-64521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64521"
},
{
"name": "CVE-2026-64522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64522"
},
{
"name": "CVE-2026-64523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64523"
},
{
"name": "CVE-2026-64524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64524"
},
{
"name": "CVE-2026-64525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64525"
},
{
"name": "CVE-2026-64526",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64526"
},
{
"name": "CVE-2026-64527",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64527"
},
{
"name": "CVE-2026-64528",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64528"
}
],
"initial_release_date": "2026-07-31T00:00:00",
"last_revision_date": "2026-07-31T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0954",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-07-31T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-07-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8622-1",
"url": "https://ubuntu.com/security/notices/USN-8622-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8620-1",
"url": "https://ubuntu.com/security/notices/USN-8620-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8604-1",
"url": "https://ubuntu.com/security/notices/USN-8604-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8615-1",
"url": "https://ubuntu.com/security/notices/USN-8615-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8574-3",
"url": "https://ubuntu.com/security/notices/USN-8574-3"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8619-1",
"url": "https://ubuntu.com/security/notices/USN-8619-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8595-2",
"url": "https://ubuntu.com/security/notices/USN-8595-2"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8570-2",
"url": "https://ubuntu.com/security/notices/USN-8570-2"
},
{
"published_at": "2026-07-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8623-1",
"url": "https://ubuntu.com/security/notices/USN-8623-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8575-3",
"url": "https://ubuntu.com/security/notices/USN-8575-3"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8608-1",
"url": "https://ubuntu.com/security/notices/USN-8608-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8547-2",
"url": "https://ubuntu.com/security/notices/USN-8547-2"
},
{
"published_at": "2026-07-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8615-2",
"url": "https://ubuntu.com/security/notices/USN-8615-2"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8618-1",
"url": "https://ubuntu.com/security/notices/USN-8618-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8617-1",
"url": "https://ubuntu.com/security/notices/USN-8617-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8609-1",
"url": "https://ubuntu.com/security/notices/USN-8609-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8607-1",
"url": "https://ubuntu.com/security/notices/USN-8607-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8595-3",
"url": "https://ubuntu.com/security/notices/USN-8595-3"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8605-1",
"url": "https://ubuntu.com/security/notices/USN-8605-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8616-1",
"url": "https://ubuntu.com/security/notices/USN-8616-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8603-1",
"url": "https://ubuntu.com/security/notices/USN-8603-1"
},
{
"published_at": "2026-07-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8620-2",
"url": "https://ubuntu.com/security/notices/USN-8620-2"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8610-1",
"url": "https://ubuntu.com/security/notices/USN-8610-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8606-1",
"url": "https://ubuntu.com/security/notices/USN-8606-1"
}
]
}
FKIE_CVE-2026-45914
Vulnerability from fkie_nvd - Published: 2026-05-27 14:17 - Updated: 2026-06-24 14:55| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/05112ba67c824ab416cd54307c0b50aba9f0047a | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/14a38784e09aebc21207dc32fffa05247fc3dd64 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/894d9c7aab68fd0c70c78b1d03c8fa589fb0f67d | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/8bde3e395a85017f12af2b0ba5c3684f5af9c006 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/914b47c9b824d3d74f31c764163edf93302100b1 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/efd68429f23fb4015b0ebc2392334059e06fad18 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/f448acd86835a650f9ea83460b9ca347d3aafba5 | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | 6.19 | |
| linux | linux_kernel | 6.19 | |
| linux | linux_kernel | 6.19 | |
| linux | linux_kernel | 6.19 | |
| linux | linux_kernel | 6.19 | |
| linux | linux_kernel | 6.19 | |
| linux | linux_kernel | 6.19 | |
| linux | linux_kernel | 6.19 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/hwmon/ibmpex.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "05112ba67c824ab416cd54307c0b50aba9f0047a",
"status": "affected",
"version": "3ce9b7ae9d4d148672b35147aaf7987a4f82bb94",
"versionType": "git"
},
{
"lessThan": "efd68429f23fb4015b0ebc2392334059e06fad18",
"status": "affected",
"version": "533ead425f8109b02fecc7e72d612b8898ec347a",
"versionType": "git"
},
{
"lessThan": "f448acd86835a650f9ea83460b9ca347d3aafba5",
"status": "affected",
"version": "fa37adcf1d564ef58b9dfb01b6c36d35c5294bad",
"versionType": "git"
},
{
"lessThan": "914b47c9b824d3d74f31c764163edf93302100b1",
"status": "affected",
"version": "68d62e5bebbd118b763e8bb210d5cf2198ef450c",
"versionType": "git"
},
{
"lessThan": "14a38784e09aebc21207dc32fffa05247fc3dd64",
"status": "affected",
"version": "5aa2139201667c1f644601e4529c4acd6bf8db5a",
"versionType": "git"
},
{
"lessThan": "894d9c7aab68fd0c70c78b1d03c8fa589fb0f67d",
"status": "affected",
"version": "6946c726c3f4c36f0f049e6f97e88c510b15f65d",
"versionType": "git"
},
{
"lessThan": "8bde3e395a85017f12af2b0ba5c3684f5af9c006",
"status": "affected",
"version": "6946c726c3f4c36f0f049e6f97e88c510b15f65d",
"versionType": "git"
},
{
"lessThan": "5.10.252",
"status": "affected",
"version": "5.10.248",
"versionType": "semver"
},
{
"lessThan": "6.1.165",
"status": "affected",
"version": "6.1.160",
"versionType": "semver"
},
{
"lessThan": "6.6.128",
"status": "affected",
"version": "6.6.120",
"versionType": "semver"
},
{
"lessThan": "6.12.75",
"status": "affected",
"version": "6.12.64",
"versionType": "semver"
},
{
"lessThan": "6.18.14",
"status": "affected",
"version": "6.18.3",
"versionType": "semver"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/hwmon/ibmpex.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "6.19"
},
{
"lessThan": "6.19",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.252",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.165",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.128",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.75",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.14",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.19.*",
"status": "unaffected",
"version": "6.19.4",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.0",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "0FF383F2-E238-49E9-870A-004DCE6EC4EE",
"versionEndExcluding": "5.10.252",
"versionStartIncluding": "5.10.248",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "29CE5815-AC25-4B86-8093-9B7C33747C6A",
"versionEndExcluding": "6.1.165",
"versionStartIncluding": "6.1.160",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F93EE437-1C07-464F-9047-8987F00BA711",
"versionEndExcluding": "6.6.128",
"versionStartIncluding": "6.6.120",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E27D5D92-2E0F-4CED-BEFE-15984B8B010D",
"versionEndExcluding": "6.12.75",
"versionStartIncluding": "6.12.64",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "1F86B087-7282-4A5E-92B3-E7448F7492B3",
"versionEndExcluding": "6.18.14",
"versionStartIncluding": "6.18.3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "411B9362-5B74-4569-8450-50CAD50DE99C",
"versionEndExcluding": "6.19.4",
"versionStartIncluding": "6.19.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:-:*:*:*:*:*:*",
"matchCriteriaId": "35C8A871-4971-433E-A046-FC9F7B7D190A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc2:*:*:*:*:*:*",
"matchCriteriaId": "C47E4CC9-C826-4FA9-B014-7FE3D9B318B2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc3:*:*:*:*:*:*",
"matchCriteriaId": "F71D92C0-C023-48BD-B3B6-70B638EEE298",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc4:*:*:*:*:*:*",
"matchCriteriaId": "13580667-0A98-40CC-B29F-D12790B91BDB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc5:*:*:*:*:*:*",
"matchCriteriaId": "CAD1FED7-CF48-47BF-AC7D-7B6FA3C065FC",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc6:*:*:*:*:*:*",
"matchCriteriaId": "3EF854A1-ABB1-4E93-BE9A-44569EC76C0D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc7:*:*:*:*:*:*",
"matchCriteriaId": "F5DC0CA6-F0AF-4DDF-A882-3DADB9A886A7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.19:rc8:*:*:*:*:*:*",
"matchCriteriaId": "EB5B7DFC-C36B-45D8-922C-877569FDDF43",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nRevert \"hwmon: (ibmpex) fix use-after-free in high/low store\"\n\nThis reverts commit 6946c726c3f4c36f0f049e6f97e88c510b15f65d.\n\nJean Delvare points out that the patch does not completely\nfix the reported problem, that it in fact introduces a\n(new) race condition, and that it may actually not be needed in\nthe first place.\n\nVarious AI reviews agree. Specific and relevant AI feedback:\n\n\"\nThis reordering sets the driver data to NULL before removing the sensor\nattributes in the loop below.\n\nibmpex_show_sensor() retrieves this driver data via dev_get_drvdata() but\ndoes not check if it is NULL before dereferencing it to access\ndata-\u003esensors[].\n\nIf a userspace process reads a sensor file (like temp1_input) while this\ndelete function is running, could it race with the dev_set_drvdata(...,\nNULL) call here and crash in ibmpex_show_sensor()?\n\nWould it be safer to keep the original order where device_remove_file() is\ncalled before clearing the driver data? device_remove_file() should wait\nfor any active sysfs callbacks to complete, which might already prevent the\nuse-after-free this patch intends to fix.\n\"\n\nRevert the offending patch. If it can be shown that the originally reported\nalleged race condition does indeed exist, it can always be re-introduced\nwith a complete fix."
}
],
"id": "CVE-2026-45914",
"lastModified": "2026-06-24T14:55:01.837",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2026-05-27T14:17:06.180",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/05112ba67c824ab416cd54307c0b50aba9f0047a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/14a38784e09aebc21207dc32fffa05247fc3dd64"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/894d9c7aab68fd0c70c78b1d03c8fa589fb0f67d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8bde3e395a85017f12af2b0ba5c3684f5af9c006"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/914b47c9b824d3d74f31c764163edf93302100b1"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/efd68429f23fb4015b0ebc2392334059e06fad18"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f448acd86835a650f9ea83460b9ca347d3aafba5"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Undergoing Analysis",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-416"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-WF7M-GFFH-F29C
Vulnerability from github – Published: 2026-05-27 15:33 – Updated: 2026-06-24 15:31In the Linux kernel, the following vulnerability has been resolved:
Revert "hwmon: (ibmpex) fix use-after-free in high/low store"
This reverts commit 6946c726c3f4c36f0f049e6f97e88c510b15f65d.
Jean Delvare points out that the patch does not completely fix the reported problem, that it in fact introduces a (new) race condition, and that it may actually not be needed in the first place.
Various AI reviews agree. Specific and relevant AI feedback:
" This reordering sets the driver data to NULL before removing the sensor attributes in the loop below.
ibmpex_show_sensor() retrieves this driver data via dev_get_drvdata() but does not check if it is NULL before dereferencing it to access data->sensors[].
If a userspace process reads a sensor file (like temp1_input) while this delete function is running, could it race with the dev_set_drvdata(..., NULL) call here and crash in ibmpex_show_sensor()?
Would it be safer to keep the original order where device_remove_file() is called before clearing the driver data? device_remove_file() should wait for any active sysfs callbacks to complete, which might already prevent the use-after-free this patch intends to fix. "
Revert the offending patch. If it can be shown that the originally reported alleged race condition does indeed exist, it can always be re-introduced with a complete fix.
{
"affected": [],
"aliases": [
"CVE-2026-45914"
],
"database_specific": {
"cwe_ids": [
"CWE-416"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2026-05-27T14:17:06Z",
"severity": "HIGH"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nRevert \"hwmon: (ibmpex) fix use-after-free in high/low store\"\n\nThis reverts commit 6946c726c3f4c36f0f049e6f97e88c510b15f65d.\n\nJean Delvare points out that the patch does not completely\nfix the reported problem, that it in fact introduces a\n(new) race condition, and that it may actually not be needed in\nthe first place.\n\nVarious AI reviews agree. Specific and relevant AI feedback:\n\n\"\nThis reordering sets the driver data to NULL before removing the sensor\nattributes in the loop below.\n\nibmpex_show_sensor() retrieves this driver data via dev_get_drvdata() but\ndoes not check if it is NULL before dereferencing it to access\ndata-\u003esensors[].\n\nIf a userspace process reads a sensor file (like temp1_input) while this\ndelete function is running, could it race with the dev_set_drvdata(...,\nNULL) call here and crash in ibmpex_show_sensor()?\n\nWould it be safer to keep the original order where device_remove_file() is\ncalled before clearing the driver data? device_remove_file() should wait\nfor any active sysfs callbacks to complete, which might already prevent the\nuse-after-free this patch intends to fix.\n\"\n\nRevert the offending patch. If it can be shown that the originally reported\nalleged race condition does indeed exist, it can always be re-introduced\nwith a complete fix.",
"id": "GHSA-wf7m-gffh-f29c",
"modified": "2026-06-24T15:31:40Z",
"published": "2026-05-27T15:33:16Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45914"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/05112ba67c824ab416cd54307c0b50aba9f0047a"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/14a38784e09aebc21207dc32fffa05247fc3dd64"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/894d9c7aab68fd0c70c78b1d03c8fa589fb0f67d"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/8bde3e395a85017f12af2b0ba5c3684f5af9c006"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/914b47c9b824d3d74f31c764163edf93302100b1"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/efd68429f23fb4015b0ebc2392334059e06fad18"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/f448acd86835a650f9ea83460b9ca347d3aafba5"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2026-2674 (CVE-2025-39759)
Vulnerability from osv_openeuler – Published: 2026-06-12 11:11 – Updated: 2026-08-06 11:11 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
btrfs: qgroup: fix race between quota disable and quota rescan ioctl
There's a race between a task disabling quotas and another running the rescan ioctl that can result in a use-after-free of qgroup records from the fs_info->qgroup_tree rbtree.
This happens as follows:
1) Task A enters btrfs_ioctl_quota_rescan() -> btrfs_qgroup_rescan();
2) Task B enters btrfs_quota_disable() and calls btrfs_qgroup_wait_for_completion(), which does nothing because at that point fs_info->qgroup_rescan_running is false (it wasn't set yet by task A);
3) Task B calls btrfs_free_qgroup_config() which starts freeing qgroups from fs_info->qgroup_tree without taking the lock fs_info->qgroup_lock;
4) Task A enters qgroup_rescan_zero_tracking() which starts iterating the fs_info->qgroup_tree tree while holding fs_info->qgroup_lock, but task B is freeing qgroup records from that tree without holding the lock, resulting in a use-after-free.
Fix this by taking fs_info->qgroup_lock at btrfs_free_qgroup_config(). Also at btrfs_qgroup_rescan() don't start the rescan worker if quotas were already disabled.(CVE-2025-39759)
In the Linux kernel, the following vulnerability has been resolved:
wifi: wilc1000: avoid buffer overflow in WID string configuration
Fix the following copy overflow warning identified by Smatch checker.
drivers/net/wireless/microchip/wilc1000/wlan_cfg.c:184 wilc_wlan_parse_response_frame() error: '__memcpy()' 'cfg->s[i]->str' copy overflow (512 vs 65537)
This patch introduces size check before accessing the memory buffer. The checks are base on the WID type of received data from the firmware. For WID string configuration, the size limit is determined by individual element size in 'struct wilc_cfg_str_vals' that is maintained in 'len' field of 'struct wilc_cfg_str'.(CVE-2025-39952)
In the Linux kernel, the following vulnerability has been resolved:
iio: accel: bmc150: Fix irq assumption regression
The code in bmc150-accel-core.c unconditionally calls bmc150_accel_set_interrupt() in the iio_buffer_setup_ops, such as on the runtime PM resume path giving a kernel splat like this if the device has no interrupts:
Unable to handle kernel NULL pointer dereference at virtual address 00000001 when read
PC is at bmc150_accel_set_interrupt+0x98/0x194 LR is at __pm_runtime_resume+0x5c/0x64 (...) Call trace: bmc150_accel_set_interrupt from bmc150_accel_buffer_postenable+0x40/0x108 bmc150_accel_buffer_postenable from __iio_update_buffers+0xbe0/0xcbc __iio_update_buffers from enable_store+0x84/0xc8 enable_store from kernfs_fop_write_iter+0x154/0x1b4
This bug seems to have been in the driver since the beginning, but it only manifests recently, I do not know why.
Store the IRQ number in the state struct, as this is a common pattern in other drivers, then use this to determine if we have IRQ support or not.(CVE-2025-68330)
In the Linux kernel, the following vulnerability has been resolved:
staging: most: remove broken i2c driver
The MOST I2C driver has been completely broken for five years without anyone noticing so remove the driver from staging.
Specifically, commit 723de0f9171e ("staging: most: remove device from interface structure") started requiring drivers to set the interface device pointer before registration, but the I2C driver was never updated which results in a NULL pointer dereference if anyone ever tries to probe it.(CVE-2025-68755)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: fix NULL dereference on root when tracing inode eviction
When evicting an inode the first thing we do is to setup tracing for it, which implies fetching the root's id. But in btrfs_evict_inode() the root might be NULL, as implied in the next check that we do in btrfs_evict_inode().
Hence, we either should set the ->root_objectid to 0 in case the root is NULL, or we move tracing setup after checking that the root is not NULL. Setting the rootid to 0 at least gives us the possibility to trace this call even in the case when the root is NULL, so that's the solution taken here.(CVE-2025-71184)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: udlfb: avoid divide-by-zero on FBIOPUT_VSCREENINFO
Much like commit 19f953e74356 ("fbdev: fb_pm2fb: Avoid potential divide by zero error"), we also need to prevent that same crash from happening in the udlfb driver as it uses pixclock directly when dividing, which will crash.(CVE-2026-31605)
In the Linux kernel, the following vulnerability has been resolved:
usbip: validate number_of_packets in usbip_pack_ret_submit()
When a USB/IP client receives a RET_SUBMIT response, usbip_pack_ret_submit() unconditionally overwrites urb->number_of_packets from the network PDU. This value is subsequently used as the loop bound in usbip_recv_iso() and usbip_pad_iso() to iterate over urb->iso_frame_desc[], a flexible array whose size was fixed at URB allocation time based on the original number_of_packets from the CMD_SUBMIT.
A malicious USB/IP server can set number_of_packets in the response to a value larger than what was originally submitted, causing a heap out-of-bounds write when usbip_recv_iso() writes to urb->iso_frame_desc[i] beyond the allocated region.
KASAN confirmed this with kernel 7.0.0-rc5:
BUG: KASAN: slab-out-of-bounds in usbip_recv_iso+0x46a/0x640 Write of size 4 at addr ffff888106351d40 by task vhci_rx/69
The buggy address is located 0 bytes to the right of allocated 320-byte region [ffff888106351c00, ffff888106351d40)
The server side (stub_rx.c) and gadget side (vudc_rx.c) already validate number_of_packets in the CMD_SUBMIT path since commits c6688ef9f297 ("usbip: fix stub_rx: harden CMD_SUBMIT path to handle malicious input") and b78d830f0049 ("usbip: fix vudc_rx: harden CMD_SUBMIT path to handle malicious input"). The server side validates against USBIP_MAX_ISO_PACKETS because no URB exists yet at that point. On the client side we have the original URB, so we can use the tighter bound: the response must not exceed the original number_of_packets.
This mirrors the existing validation of actual_length against transfer_buffer_length in usbip_recv_xbuff(), which checks the response value against the original allocation size.
Kelvin Mbogo's series ("usb: usbip: fix integer overflow in usbip_recv_iso()", v2) hardens the receive-side functions themselves; this patch complements that work by catching the bad value at its source -- in usbip_pack_ret_submit() before the overwrite -- and using the tighter per-URB allocation bound rather than the global USBIP_MAX_ISO_PACKETS limit.
Fix this by checking rpdu->number_of_packets against urb->number_of_packets in usbip_pack_ret_submit() before the overwrite. On violation, clamp to zero so that usbip_recv_iso() and usbip_pad_iso() safely return early.(CVE-2026-31607)
In the Linux kernel, the following vulnerability has been resolved:
usb: gadget: renesas_usb3: validate endpoint index in standard request handlers
The GET_STATUS and SET/CLEAR_FEATURE handlers extract the endpoint number from the host-supplied wIndex without any sort of validation. Fix this up by validating the number of endpoints actually match up with the number the device has before attempting to dereference a pointer based on this math.
This is just like what was done in commit ee0d382feb44 ("usb: gadget: aspeed_udc: validate endpoint index for ast udc") for the aspeed driver.(CVE-2026-31615)
In the Linux kernel, the following vulnerability has been resolved:
usb: gadget: f_phonet: fix skb frags[] overflow in pn_rx_complete()
A broken/bored/mean USB host can overflow the skb_shared_info->frags[] array on a Linux gadget exposing a Phonet function by sending an unbounded sequence of full-page OUT transfers.
pn_rx_complete() finalizes the skb only when req->actual < req->length, where req->length is set to PAGE_SIZE by the gadget. If the host always sends exactly PAGE_SIZE bytes per transfer, fp->rx.skb will never be reset and each completion will add another fragment via skb_add_rx_frag(). Once nr_frags exceeds MAX_SKB_FRAGS (default 17), subsequent frag stores overwrite memory adjacent to the shinfo on the heap.
Drop the skb and account a length error when the frag limit is reached, matching the fix applied in t7xx by commit f0813bcd2d9d ("net: wwan: t7xx: fix potential skb->frags overflow in RX path").(CVE-2026-31616)
In the Linux kernel, the following vulnerability has been resolved:
usb: gadget: f_ncm: validate minimum block_len in ncm_unwrap_ntb()
The block_len read from the host-supplied NTB header is checked against ntb_max but has no lower bound. When block_len is smaller than opts->ndp_size, the bounds check of: ndp_index > (block_len - opts->ndp_size) will underflow producing a huge unsigned value that ndp_index can never exceed, defeating the check entirely.
The same underflow occurs in the datagram index checks against block_len - opts->dpe_size. With those checks neutered, a malicious USB host can choose ndp_index and datagram offsets that point past the actual transfer, and the skb_put_data() copies adjacent kernel memory into the network skb.
Fix this by rejecting block lengths that cannot hold at least the NTB header plus one NDP. This will make block_len - opts->ndp_size and block_len - opts->dpe_size both well-defined.
Commit 8d2b1a1ec9f5 ("CDC-NCM: avoid overflow in sanity checking") fixed a related class of issues on the host side of NCM.(CVE-2026-31617)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: tdfxfb: avoid divide-by-zero on FBIOPUT_VSCREENINFO
Much like commit 19f953e74356 ("fbdev: fb_pm2fb: Avoid potential divide by zero error"), we also need to prevent that same crash from happening in the udlfb driver as it uses pixclock directly when dividing, which will crash.(CVE-2026-31618)
In the Linux kernel, the following vulnerability has been resolved:
net/packet: fix TOCTOU race on mmap'd vnet_hdr in tpacket_snd()
In tpacket_snd(), when PACKET_VNET_HDR is enabled, vnet_hdr points directly into the mmap'd TX ring buffer shared with userspace. The kernel validates the header via __packet_snd_vnet_parse() but then re-reads all fields later in virtio_net_hdr_to_skb(). A concurrent userspace thread can modify the vnet_hdr fields between validation and use, bypassing all safety checks.
The non-TPACKET path (packet_snd()) already correctly copies vnet_hdr to a stack-local variable. All other vnet_hdr consumers in the kernel (tun.c, tap.c, virtio_net.c) also use stack copies. The TPACKET TX path is the only caller of virtio_net_hdr_to_skb() that reads directly from user-controlled shared memory.
Fix this by copying vnet_hdr from the mmap'd ring buffer to a stack-local variable before validation and use, consistent with the approach used in packet_snd() and all other callers.(CVE-2026-31700)
In the Linux kernel, the following vulnerability has been resolved:
Buffer overflow in drivers/xen/sys-hypervisor.c
The build id returned by HYPERVISOR_xen_version(XENVER_build_id) is neither NUL terminated nor a string.
The first causes a buffer overflow as sprintf in buildid_show will read and copy till it finds a NUL.
00000000 f4 91 51 f4 dd 38 9e 9d 65 47 52 eb 10 71 db 50 |..Q..8..eGR..q.P| 00000010 b9 a8 01 42 6f 2e 32 |...Bo.2| 00000017
So use a memcpy instead of sprintf to have the correct value:
00000000 f4 91 51 f4 dd 00 9e 9d 65 47 52 eb 10 71 db 50 |..Q.....eGR..q.P| 00000010 b9 a8 01 42 |...B| 00000014
(the above have a hack to embed a zero inside and check it's returned correctly).
This is XSA-485 / CVE-2026-31786(CVE-2026-31786)
In the Linux kernel, the following vulnerability has been resolved:
crypto: algif_aead - Fix minimum RX size check for decryption
The check for the minimum receive buffer size did not take the tag size into account during decryption. Fix this by adding the required extra length.(CVE-2026-43077)
In the Linux kernel, the following vulnerability has been resolved:
crypto: af_alg - Fix page reassignment overflow in af_alg_pull_tsgl
When page reassignment was added to af_alg_pull_tsgl the original loop wasn't updated so it may try to reassign one more page than necessary.
Add the check to the reassignment so that this does not happen.
Also update the comment which still refers to the obsolete offset argument.(CVE-2026-43078)
In the Linux kernel, the following vulnerability has been resolved:
xfrm: Wait for RCU readers during policy netns exit
xfrm_policy_fini() frees the policy_bydst hash tables after flushing the policy work items and deleting all policies, but it does not wait for concurrent RCU readers to leave their read-side critical sections first.
The policy_bydst tables are published via rcu_assign_pointer() and are looked up through rcu_dereference_check(), so netns teardown must also wait for an RCU grace period before freeing the table memory.
Fix this by adding synchronize_rcu() before freeing the policy hash tables.(CVE-2026-43091)
In the Linux kernel, the following vulnerability has been resolved:
xsk: tighten UMEM headroom validation to account for tailroom and min frame
The current headroom validation in xdp_umem_reg() could leave us with insufficient space dedicated to even receive minimum-sized ethernet frame. Furthermore if multi-buffer would come to play then skb_shared_info stored at the end of XSK frame would be corrupted.
HW typically works with 128-aligned sizes so let us provide this value as bare minimum.
Multi-buffer setting is known later in the configuration process so besides accounting for 128 bytes, let us also take care of tailroom space upfront.(CVE-2026-43093)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: ctnetlink: ensure safe access to master conntrack
Holding reference on the expectation is not sufficient, the master conntrack object can just go away, making exp->master invalid.
To access exp->master safely:
-
Grab the nf_conntrack_expect_lock, this gets serialized with clean_from_lists() which also holds this lock when the master conntrack goes away.
-
Hold reference on master conntrack via nf_conntrack_find_get(). Not so easy since the master tuple to look up for the master conntrack is not available in the existing problematic paths.
This patch goes for extending the nf_conntrack_expect_lock section to address this issue for simplicity, in the cases that are described below this is just slightly extending the lock section.
The add expectation command already holds a reference to the master conntrack from ctnetlink_create_expect().
However, the delete expectation command needs to grab the spinlock before looking up for the expectation. Expand the existing spinlock section to address this to cover the expectation lookup. Note that, the nf_ct_expect_iterate_net() calls already grabs the spinlock while iterating over the expectation table, which is correct.
The get expectation command needs to grab the spinlock to ensure master conntrack does not go away. This also expands the existing spinlock section to cover the expectation lookup too. I needed to move the netlink skb allocation out of the spinlock to keep it GFP_KERNEL.
For the expectation events, the IPEXP_DESTROY event is already delivered under the spinlock, just move the delivery of IPEXP_NEW under the spinlock too because the master conntrack event cache is reached through exp->master.
While at it, add lockdep notations to help identify what codepaths need to grab the spinlock.(CVE-2026-43116)
In the Linux kernel, the following vulnerability has been resolved:
dlm: validate length in dlm_search_rsb_tree
The len parameter in dlm_dump_rsb_name() is not validated and comes from network messages. When it exceeds DLM_RESNAME_MAXLEN, it can cause out-of-bounds write in dlm_search_rsb_tree().
Add length validation to prevent potential buffer overflow.(CVE-2026-43125)
In the Linux kernel, the following vulnerability has been resolved:
iommu/vt-d: Flush dev-IOTLB only when PCIe device is accessible in scalable mode
Commit 4fc82cd907ac ("iommu/vt-d: Don't issue ATS Invalidation request when device is disconnected") relies on pci_dev_is_disconnected() to skip ATS invalidation for safely-removed devices, but it does not cover link-down caused by faults, which can still hard-lock the system.
For example, if a VM fails to connect to the PCIe device, "virsh destroy" is executed to release resources and isolate the fault, but a hard-lockup occurs while releasing the group fd.
Call Trace: qi_submit_sync qi_flush_dev_iotlb intel_pasid_tear_down_entry device_block_translation blocking_domain_attach_dev __iommu_attach_device __iommu_device_set_domain __iommu_group_set_domain_internal iommu_detach_group vfio_iommu_type1_detach_group vfio_group_detach_container vfio_group_fops_release __fput
Although pci_device_is_present() is slower than pci_dev_is_disconnected(), it still takes only ~70 µs on a ConnectX-5 (8 GT/s, x2) and becomes even faster as PCIe speed and width increase.
Besides, devtlb_invalidation_with_pasid() is called only in the paths below, which are far less frequent than memory map/unmap.
- mm-struct release
- {attach,release}_dev
- set/remove PASID
- dirty-tracking setup
The gain in system stability far outweighs the negligible cost of using pci_device_is_present() instead of pci_dev_is_disconnected() to decide when to skip ATS invalidation, especially under GDR high-load conditions.(CVE-2026-43130)
In the Linux kernel, the following vulnerability has been resolved:
xfrm6: fix uninitialized saddr in xfrm6_get_saddr()
xfrm6_get_saddr() does not check the return value of ipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable source address (returns -EADDRNOTAVAIL), saddr->in6 is left uninitialized, but xfrm6_get_saddr() still returns 0 (success).
This causes the caller xfrm_tmpl_resolve_one() to use the uninitialized address in xfrm_state_find(), triggering KMSAN warning:
===================================================== BUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940 xfrm_state_find+0x2424/0xa940 xfrm_resolve_and_create_bundle+0x906/0x5a20 xfrm_lookup_with_ifid+0xcc0/0x3770 xfrm_lookup_route+0x63/0x2b0 ip_route_output_flow+0x1ce/0x270 udp_sendmsg+0x2ce1/0x3400 inet_sendmsg+0x1ef/0x2a0 __sock_sendmsg+0x278/0x3d0 __sys_sendto+0x593/0x720 __x64_sys_sendto+0x130/0x200 x64_sys_call+0x332b/0x3e70 do_syscall_64+0xd3/0xf80 entry_SYSCALL_64_after_hwframe+0x77/0x7f
Local variable tmp.i.i created at: xfrm_resolve_and_create_bundle+0x3e3/0x5a20 xfrm_lookup_with_ifid+0xcc0/0x3770 =====================================================
Fix by checking the return value of ipv6_dev_get_saddr() and propagating the error.(CVE-2026-43139)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: xt_tcpmss: check remaining length before reading optlen
Quoting reporter: In net/netfilter/xt_tcpmss.c (lines 53-68), the TCP option parser reads op[i+1] directly without validating the remaining option length.
If the last byte of the option field is not EOL/NOP (0/1), the code attempts to index op[i+1]. In the case where i + 1 == optlen, this causes an out-of-bounds read, accessing memory past the optlen boundary (either reading beyond the stack buffer _opt or the following payload).(CVE-2026-43190)
In the Linux kernel, the following vulnerability has been resolved:
tcp: fix potential race in tcp_v6_syn_recv_sock()
Code in tcp_v6_syn_recv_sock() after the call to tcp_v4_syn_recv_sock() is done too late.
After tcp_v4_syn_recv_sock(), the child socket is already visible from TCP ehash table and other cpus might use it.
Since newinet->pinet6 is still pointing to the listener ipv6_pinfo bad things can happen as syzbot found.
Move the problematic code in tcp_v6_mapped_child_init() and call this new helper from tcp_v4_syn_recv_sock() before the ehash insertion.
This allows the removal of one tcp_sync_mss(), since tcp_v4_syn_recv_sock() will call it with the correct context.(CVE-2026-43198)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_conntrack_h323: fix OOB read in decode_choice()
In decode_choice(), the boundary check before get_len() uses the
variable len, which is still 0 from its initialization at the top of
the function:
unsigned int type, ext, len = 0;
...
if (ext || (son->attr & OPEN)) {
BYTE_ALIGN(bs);
if (nf_h323_error_boundary(bs, len, 0)) /* len is 0 here */
return H323_ERROR_BOUND;
len = get_len(bs); /* OOB read */
When the bitstream is exactly consumed (bs->cur == bs->end), the check nf_h323_error_boundary(bs, 0, 0) evaluates to (bs->cur + 0 > bs->end), which is false. The subsequent get_len() call then dereferences *bs->cur++, reading 1 byte past the end of the buffer. If that byte has bit 7 set, get_len() reads a second byte as well.
This can be triggered remotely by sending a crafted Q.931 SETUP message with a User-User Information Element containing exactly 2 bytes of PER-encoded data ({0x08, 0x00}) to port 1720 through a firewall with the nf_conntrack_h323 helper active. The decoder fully consumes the PER buffer before reaching this code path, resulting in a 1-2 byte heap-buffer-overflow read confirmed by AddressSanitizer.
Fix this by checking for 2 bytes (the maximum that get_len() may read)
instead of the uninitialized len. This matches the pattern used at
every other get_len() call site in the same file, where the caller
checks for 2 bytes of available data before calling get_len().(CVE-2026-43233)
In the Linux kernel, the following vulnerability has been resolved:
iommu/amd: move wait_on_sem() out of spinlock
With iommu.strict=1, the existing completion wait path can cause soft lockups under stressed environment, as wait_on_sem() busy-waits under the spinlock with interrupts disabled.
Move the completion wait in iommu_completion_wait() out of the spinlock. wait_on_sem() only polls the hardware-updated cmd_sem and does not require iommu->lock, so holding the lock during the busy wait unnecessarily increases contention and extends the time with interrupts disabled.(CVE-2026-43253)
In the Linux kernel, the following vulnerability has been resolved:
spi: spidev: fix lock inversion between spi_lock and buf_lock
The spidev driver previously used two mutexes, spi_lock and buf_lock, but acquired them in different orders depending on the code path:
write()/read(): buf_lock -> spi_lock ioctl(): spi_lock -> buf_lock
This AB-BA locking pattern triggers lockdep warnings and can cause real deadlocks:
WARNING: possible circular locking dependency detected spidev_ioctl() -> mutex_lock(&spidev->buf_lock) spidev_sync_write() -> mutex_lock(&spidev->spi_lock) *** DEADLOCK ***
The issue is reproducible with a simple userspace program that performs write() and SPI_IOC_WR_MAX_SPEED_HZ ioctl() calls from separate threads on the same spidev file descriptor.
Fix this by simplifying the locking model and removing the lock inversion entirely. spidev_sync() no longer performs any locking, and all callers serialize access using spi_lock.
buf_lock is removed since its functionality is fully covered by spi_lock, eliminating the possibility of lock ordering issues.
This removes the lock inversion and prevents deadlocks without changing userspace ABI or behaviour.(CVE-2026-43319)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: prevent possible UaF in addrconf_permanent_addr()
The mentioned helper try to warn the user about an exceptional condition, but the message is delivered too late, accessing the ipv6 after its possible deletion.
Reorder the statement to avoid the possible UaF; while at it, place the warning outside the idev->lock as it needs no protection.(CVE-2026-43339)
In the Linux kernel, the following vulnerability has been resolved:
net/tcp-md5: Fix MAC comparison to be constant-time
To prevent timing attacks, MACs need to be compared in constant time. Use the appropriate helper function for this.(CVE-2026-43383)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nfnetlink_cthelper: fix OOB read in nfnl_cthelper_dump_table()
nfnl_cthelper_dump_table() has a 'goto restart' that jumps to a label inside the for loop body. When the "last" helper saved in cb->args[1] is deleted between dump rounds, every entry fails the (cur != last) check, so cb->args[1] is never cleared. The for loop finishes with cb->args[0] == nf_ct_helper_hsize, and the 'goto restart' jumps back into the loop body bypassing the bounds check, causing an 8-byte out-of-bounds read on nf_ct_helper_hash[nf_ct_helper_hsize].
The 'goto restart' block was meant to re-traverse the current bucket when "last" is no longer found, but it was placed after the for loop instead of inside it. Move the block into the for loop body so that the restart only occurs while cb->args[0] is still within bounds.
BUG: KASAN: slab-out-of-bounds in nfnl_cthelper_dump_table+0x9f/0x1b0 Read of size 8 at addr ffff888104ca3000 by task poc_cthelper/131 Call Trace: nfnl_cthelper_dump_table+0x9f/0x1b0 netlink_dump+0x333/0x880 netlink_recvmsg+0x3e2/0x4b0 sock_recvmsg+0xde/0xf0 __sys_recvfrom+0x150/0x200 __x64_sys_recvfrom+0x76/0x90 do_syscall_64+0xc3/0x6e0
Allocated by task 1: __kvmalloc_node_noprof+0x21b/0x700 nf_ct_alloc_hashtable+0x65/0xd0 nf_conntrack_helper_init+0x21/0x60 nf_conntrack_init_start+0x18d/0x300 nf_conntrack_standalone_init+0x12/0xc0(CVE-2026-43450)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: x_tables: guard option walkers against 1-byte tail reads
When the last byte of options is a non-single-byte option kind, walkers that advance with i += op[i + 1] ? : 1 can read op[i + 1] past the end of the option area.
Add an explicit i == optlen - 1 check before dereferencing op[i + 1] in xt_tcpudp and xt_dccp option walkers.(CVE-2026-43452)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nft_set_pipapo: fix stack out-of-bounds read in pipapo_drop()
pipapo_drop() passes rulemap[i + 1].n to pipapo_unmap() as the to_offset argument on every iteration, including the last one where i == m->field_count - 1. This reads one element past the end of the stack-allocated rulemap array (declared as rulemap[NFT_PIPAPO_MAX_FIELDS] with NFT_PIPAPO_MAX_FIELDS == 16).
Although pipapo_unmap() returns early when is_last is true without using the to_offset value, the argument is evaluated at the call site before the function body executes, making this a genuine out-of-bounds stack read confirmed by KASAN:
BUG: KASAN: stack-out-of-bounds in pipapo_drop+0x50c/0x57c [nf_tables] Read of size 4 at addr ffff8000810e71a4
This frame has 1 object: [32, 160) 'rulemap'
The buggy address is at offset 164 -- exactly 4 bytes past the end of the rulemap array.
Pass 0 instead of rulemap[i + 1].n on the last iteration to avoid the out-of-bounds read.(CVE-2026-43453)
In the Linux kernel, the following vulnerability has been resolved:
rtmutex: Use waiter::task instead of current in remove_waiter()
remove_waiter() is used by the slowlock paths, but it is also used for proxy-lock rollback in rt_mutex_start_proxy_lock() when invoked from futex_requeue().
In the latter case waiter::task is not current, but remove_waiter() operates on current for the dequeue operation. That results in several problems:
1) the rbtree dequeue happens without waiter::task::pi_lock being held
2) the waiter task's pi_blocked_on state is not cleared, which leaves a dangling pointer primed for UAF around.
3) rt_mutex_adjust_prio_chain() operates on the wrong top priority waiter task
Use waiter::task instead of current in all related operations in remove_waiter() to cure those problems.
tglx: Fixup rt_mutex_adjust_prio_chain(), add a comment and amend the changelog
In the Linux kernel, the following vulnerability has been resolved:
openvswitch: cap upcall PID array size and pre-size vport replies
The vport netlink reply helpers allocate a fixed-size skb with nlmsg_new(NLMSG_DEFAULT_SIZE, ...) but serialize the full upcall PID array via ovs_vport_get_upcall_portids(). Since ovs_vport_set_upcall_portids() accepts any non-zero multiple of sizeof(u32) with no upper bound, a CAP_NET_ADMIN user can install a PID array large enough to overflow the reply buffer, causing nla_put() to fail with -EMSGSIZE and hitting BUG_ON(err < 0). On systems with unprivileged user namespaces enabled (e.g., Ubuntu default), this is reachable via unshare -Urn since OVS vport mutation operations use GENL_UNS_ADMIN_PERM.
kernel BUG at net/openvswitch/datapath.c:2414! Oops: invalid opcode: 0000 [#1] SMP KASAN NOPTI CPU: 1 UID: 0 PID: 65 Comm: poc Not tainted 7.0.0-rc7-00195-geb216e422044 #1 RIP: 0010:ovs_vport_cmd_set+0x34c/0x400 Call Trace: <TASK> genl_family_rcv_msg_doit (net/netlink/genetlink.c:1116) genl_rcv_msg (net/netlink/genetlink.c:1194) netlink_rcv_skb (net/netlink/af_netlink.c:2550) genl_rcv (net/netlink/genetlink.c:1219) netlink_unicast (net/netlink/af_netlink.c:1344) netlink_sendmsg (net/netlink/af_netlink.c:1894) __sys_sendto (net/socket.c:2206) __x64_sys_sendto (net/socket.c:2209) do_syscall_64 (arch/x86/entry/syscall_64.c:63) entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130) </TASK> Kernel panic - not syncing: Fatal exception
Reject attempts to set more PIDs than nr_cpu_ids in ovs_vport_set_upcall_portids(), and pre-compute the worst-case reply size in ovs_vport_cmd_msg_size() based on that bound, similar to the existing ovs_dp_cmd_msg_size(). nr_cpu_ids matches the cap already used by the per-CPU dispatch configuration on the datapath side (ovs_dp_cmd_fill_info() serialises at most nr_cpu_ids PIDs), so the two sides stay consistent.(CVE-2026-45840)
In the Linux kernel, the following vulnerability has been resolved:
slip: bound decode() reads against the compressed packet length
slhc_uncompress() parses a VJ-compressed TCP header by advancing a pointer through the packet via decode() and pull16(). Neither helper bounds-checks against isize, and decode() masks its return with & 0xffff so it can never return the -1 that callers test for -- those error paths are dead code.
A short compressed frame whose change byte requests optional fields lets decode() read past the end of the packet. The over-read bytes are folded into the cached cstate and reflected into subsequent reconstructed packets.
Make decode() and pull16() take the packet end pointer and return -1 when exhausted. Add a bounds check before the TCP-checksum read. The existing == -1 tests now do what they were always meant to.(CVE-2026-45843)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/rxe: Fix double free in rxe_srq_from_init
In rxe_srq_from_init(), the queue pointer 'q' is assigned to 'srq->rq.queue' before copying the SRQ number to user space. If copy_to_user() fails, the function calls rxe_queue_cleanup() to free the queue, but leaves the now-invalid pointer in 'srq->rq.queue'.
The caller of rxe_srq_from_init() (rxe_create_srq) eventually calls rxe_srq_cleanup() upon receiving the error, which triggers a second rxe_queue_cleanup() on the same memory, leading to a double free.
The call trace looks like this: kmem_cache_free+0x.../0x... rxe_queue_cleanup+0x1a/0x30 [rdma_rxe] rxe_srq_cleanup+0x42/0x60 [rdma_rxe] rxe_elem_release+0x31/0x70 [rdma_rxe] rxe_create_srq+0x12b/0x1a0 [rdma_rxe] ib_create_srq_user+0x9a/0x150 [ib_core]
Fix this by moving 'srq->rq.queue = q' after copy_to_user.(CVE-2026-45852)
In the Linux kernel, the following vulnerability has been resolved:
iommu/vt-d: Flush cache for PASID table before using it
When writing the address of a freshly allocated zero-initialized PASID table to a PASID directory entry, do that after the CPU cache flush for this PASID table, not before it, to avoid the time window when this PASID table may be already used by non-coherent IOMMU hardware while its contents in RAM is still some random old data, not zero-initialized.(CVE-2026-45862)
In the Linux kernel, the following vulnerability has been resolved:
iommu/vt-d: Clear Present bit before tearing down PASID entry
The Intel VT-d Scalable Mode PASID table entry consists of 512 bits (64 bytes). When tearing down an entry, the current implementation zeros the entire 64-byte structure immediately using multiple 64-bit writes.
Since the IOMMU hardware may fetch these 64 bytes using multiple internal transactions (e.g., four 128-bit bursts), updating or zeroing the entire entry while it is active (P=1) risks a "torn" read. If a hardware fetch occurs simultaneously with the CPU zeroing the entry, the hardware could observe an inconsistent state, leading to unpredictable behavior or spurious faults.
Follow the "Guidance to Software for Invalidations" in the VT-d spec (Section 6.5.3.3) by implementing the recommended ownership handshake:
- Clear only the 'Present' (P) bit of the PASID entry.
- Use a dma_wmb() to ensure the cleared bit is visible to hardware before proceeding.
- Execute the required invalidation sequence (PASID cache, IOTLB, and Device-TLB flush) to ensure the hardware has released all cached references.
- Only after the flushes are complete, zero out the remaining fields of the PASID entry.
Also, add a dma_wmb() in pasid_set_present() to ensure that all other fields of the PASID entry are visible to the hardware before the Present bit is set.(CVE-2026-45894)
In the Linux kernel, the following vulnerability has been resolved:
xfrm: fix ip_rt_bug race in icmp_route_lookup reverse path
icmp_route_lookup() performs multiple route lookups to find a suitable route for sending ICMP error messages, with special handling for XFRM (IPsec) policies.
The lookup sequence is: 1. First, lookup output route for ICMP reply (dst = original src) 2. Pass through xfrm_lookup() for policy check 3. If blocked (-EPERM) or dst is not local, enter "reverse path" 4. In reverse path, call xfrm_decode_session_reverse() to get fl4_dec which reverses the original packet's flow (saddr<->daddr swapped) 5. If fl4_dec.saddr is local (we are the original destination), use __ip_route_output_key() for output route lookup 6. If fl4_dec.saddr is NOT local (we are a forwarding node), use ip_route_input() to simulate the reverse packet's input path 7. Finally, pass rt2 through xfrm_lookup() with XFRM_LOOKUP_ICMP flag
The bug occurs in step 6: ip_route_input() is called with fl4_dec.daddr (original packet's source) as destination. If this address becomes local between the initial check and ip_route_input() call (e.g., due to concurrent "ip addr add"), ip_route_input() returns a LOCAL route with dst.output set to ip_rt_bug.
This route is then used for ICMP output, causing dst_output() to call ip_rt_bug(), triggering a WARN_ON:
------------[ cut here ]------------ WARNING: net/ipv4/route.c:1275 at ip_rt_bug+0x21/0x30, CPU#1 Call Trace: <TASK> ip_push_pending_frames+0x202/0x240 icmp_push_reply+0x30d/0x430 __icmp_send+0x1149/0x24f0 ip_options_compile+0xa2/0xd0 ip_rcv_finish_core+0x829/0x1950 ip_rcv+0x2d7/0x420 __netif_receive_skb_one_core+0x185/0x1f0 netif_receive_skb+0x90/0x450 tun_get_user+0x3413/0x3fb0 tun_chr_write_iter+0xe4/0x220 ...
Fix this by checking rt2->rt_type after ip_route_input(). If it's RTN_LOCAL, the route cannot be used for output, so treat it as an error.
The reproducer requires kernel modification to widen the race window, making it unsuitable as a selftest. It is available at:
https://gist.github.com/mrpre/eae853b72ac6a750f5d45d64ddac1e81(CVE-2026-45905)
In the Linux kernel, the following vulnerability has been resolved:
Revert "hwmon: (ibmpex) fix use-after-free in high/low store"
This reverts commit 6946c726c3f4c36f0f049e6f97e88c510b15f65d.
Jean Delvare points out that the patch does not completely fix the reported problem, that it in fact introduces a (new) race condition, and that it may actually not be needed in the first place.
Various AI reviews agree. Specific and relevant AI feedback:
" This reordering sets the driver data to NULL before removing the sensor attributes in the loop below.
ibmpex_show_sensor() retrieves this driver data via dev_get_drvdata() but does not check if it is NULL before dereferencing it to access data->sensors[].
If a userspace process reads a sensor file (like temp1_input) while this delete function is running, could it race with the dev_set_drvdata(..., NULL) call here and crash in ibmpex_show_sensor()?
Would it be safer to keep the original order where device_remove_file() is called before clearing the driver data? device_remove_file() should wait for any active sysfs callbacks to complete, which might already prevent the use-after-free this patch intends to fix. "
Revert the offending patch. If it can be shown that the originally reported alleged race condition does indeed exist, it can always be re-introduced with a complete fix.(CVE-2026-45914)
In the Linux kernel, the following vulnerability has been resolved:
fat: avoid parent link count underflow in rmdir
Corrupted FAT images can leave a directory inode with an incorrect i_nlink (e.g. 2 even though subdirectories exist). rmdir then unconditionally calls drop_nlink(dir) and can drive i_nlink to 0, triggering the WARN_ON in drop_nlink().
Add a sanity check in vfat_rmdir() and msdos_rmdir(): only drop the parent link count when it is at least 3, otherwise report a filesystem error.(CVE-2026-45915)
In the Linux kernel, the following vulnerability has been resolved:
sched/rt: Skip currently executing CPU in rto_next_cpu()
CPU0 becomes overloaded when hosting a CPU-bound RT task, a non-CPU-bound RT task, and a CFS task stuck in kernel space. When other CPUs switch from RT to non-RT tasks, RT load balancing (LB) is triggered; with HAVE_RT_PUSH_IPI enabled, they send IPIs to CPU0 to drive the execution of rto_push_irq_work_func. During push_rt_task on CPU0, if next_task->prio < rq->donor->prio, resched_curr() sets NEED_RESCHED and after the push operation completes, CPU0 calls rto_next_cpu(). Since only CPU0 is overloaded in this scenario, rto_next_cpu() should ideally return -1 (no further IPI needed).
However, multiple CPUs invoking tell_cpu_to_push() during LB increments rd->rto_loop_next. Even when rd->rto_cpu is set to -1, the mismatch between rd->rto_loop and rd->rto_loop_next forces rto_next_cpu() to restart its search from -1. With CPU0 remaining overloaded (satisfying rt_nr_migratory && rt_nr_total > 1), it gets reselected, causing CPU0 to queue irq_work to itself and send self-IPIs repeatedly. As long as CPU0 stays overloaded and other CPUs run pull_rt_tasks(), it falls into an infinite self-IPI loop, which triggers a CPU hardlockup due to continuous self-interrupts.
The trigging scenario is as follows:
cpu0 cpu1 cpu2
pull_rt_task
tell_cpu_to_push
<------------irq_work_queue_on
rto_push_irq_work_func push_rt_task resched_curr(rq) pull_rt_task rto_next_cpu tell_cpu_to_push <-------------------------- atomic_inc(rto_loop_next) rd->rto_loop != next rto_next_cpu irq_work_queue_on rto_push_irq_work_func
Fix redundant self-IPI by filtering the initiating CPU in rto_next_cpu(). This solution has been verified to effectively eliminate spurious self-IPIs and prevent CPU hardlockup scenarios.(CVE-2026-45919)
In the Linux kernel, the following vulnerability has been resolved:
ext4: fix dirtyclusters double decrement on fs shutdown
fstests test generic/388 occasionally reproduces a warning in ext4_put_super() associated with the dirty clusters count:
WARNING: CPU: 7 PID: 76064 at fs/ext4/super.c:1324 ext4_put_super+0x48c/0x590 [ext4]
Tracing the failure shows that the warning fires due to an s_dirtyclusters_counter value of -1. IOW, this appears to be a spurious decrement as opposed to some sort of leak. Further tracing of the dirty cluster count deltas and an LLM scan of the resulting output identified the cause as a double decrement in the error path between ext4_mb_mark_diskspace_used() and the caller ext4_mb_new_blocks().
First, note that generic/388 is a shutdown vs. fsstress test and so produces a random set of operations and shutdown injections. In the problematic case, the shutdown triggers an error return from the ext4_handle_dirty_metadata() call(s) made from ext4_mb_mark_context(). The changed value is non-zero at this point, so ext4_mb_mark_diskspace_used() does not exit after the error bubbles up from ext4_mb_mark_context(). Instead, the former decrements both cluster counters and returns the error up to ext4_mb_new_blocks(). The latter falls into the !ar->len out path which decrements the dirty clusters counter a second time, creating the inconsistency.
To avoid this problem and simplify ownership of the cluster reservation in this codepath, lift the counter reduction to a single place in the caller. This makes it more clear that ext4_mb_new_blocks() is responsible for acquiring cluster reservation (via ext4_claim_free_clusters()) in the !delalloc case as well as releasing it, regardless of whether it ends up consumed or returned due to failure.(CVE-2026-45920)
In the Linux kernel, the following vulnerability has been resolved:
fs/ntfs3: Fix slab-out-of-bounds read in DeleteIndexEntryRoot
In the 'DeleteIndexEntryRoot' case of the 'do_action' function, the entry size ('esize') is retrieved from the log record without adequate bounds checking.
Specifically, the code calculates the end of the entry ('e2') using: e2 = Add2Ptr(e1, esize);
It then calculates the size for memmove using 'PtrOffset(e2, ...)', which subtracts the end pointer from the buffer limit. If 'esize' is maliciously large, 'e2' exceeds the used buffer size. This results in a negative offset which, when cast to size_t for memmove, interprets as a massive unsigned integer, leading to a heap buffer overflow.
This commit adds a check to ensure that the entry size ('esize') strictly fits within the remaining used space of the index header before performing memory operations.(CVE-2026-45935)
In the Linux kernel, the following vulnerability has been resolved:
iommu/vt-d: Clear Present bit before tearing down context entry
When tearing down a context entry, the current implementation zeros the entire 128-bit entry using multiple 64-bit writes. This creates a window where the hardware can fetch a "torn" entry — where some fields are already zeroed while the 'Present' bit is still set — leading to unpredictable behavior or spurious faults.
While x86 provides strong write ordering, the compiler may reorder writes to the two 64-bit halves of the context entry. Even without compiler reordering, the hardware fetch is not guaranteed to be atomic with respect to multiple CPU writes.
Align with the "Guidance to Software for Invalidations" in the VT-d spec (Section 6.5.3.3) by implementing the recommended ownership handshake:
- Clear only the 'Present' (P) bit of the context entry first to signal the transition of ownership from hardware to software.
- Use dma_wmb() to ensure the cleared bit is visible to the IOMMU.
- Perform the required cache and context-cache invalidation to ensure hardware no longer has cached references to the entry.
- Fully zero out the entry only after the invalidation is complete.
Also, add a dma_wmb() to context_set_present() to ensure the entry is fully initialized before the 'Present' bit becomes visible.(CVE-2026-45944)
In the Linux kernel, the following vulnerability has been resolved:
ext4: fix memory leak in ext4_ext_shift_extents()
In ext4_ext_shift_extents(), if the extent is NULL in the while loop, the function returns immediately without releasing the path obtained via ext4_find_extent(), leading to a memory leak.
Fix this by jumping to the out label to ensure the path is properly released.(CVE-2026-45948)
In the Linux kernel, the following vulnerability has been resolved:
nfsd: never defer requests during idmap lookup
During v4 request compound arg decoding, some ops (e.g. SETATTR) can trigger idmap lookup upcalls. When those upcall responses get delayed beyond the allowed time limit, cache_check() will mark the request for deferral and cause it to be dropped.
This prevents nfs4svc_encode_compoundres from being executed, and thus the session slot flag NFSD4_SLOT_INUSE never gets cleared. Subsequent client requests will fail with NFSERR_JUKEBOX, given that the slot will be marked as in-use, making the SEQUENCE op fail.
Fix this by making sure that the RQ_USEDEFERRAL flag is always clear during nfs4svc_decode_compoundargs(), since no v4 request should ever be deferred.(CVE-2026-45983)
In the Linux kernel, the following vulnerability has been resolved:
ext4: don't set EXT4_GET_BLOCKS_CONVERT when splitting before submitting I/O
When allocating blocks during within-EOF DIO and writeback with dioread_nolock enabled, EXT4_GET_BLOCKS_PRE_IO was set to split an existing large unwritten extent. However, EXT4_GET_BLOCKS_CONVERT was set when calling ext4_split_convert_extents(), which may potentially result in stale data issues.
Assume we have an unwritten extent, and then DIO writes the second half.
[UUUUUUUUUUUUUUUU] on-disk extent U: unwritten extent [UUUUUUUUUUUUUUUU] extent status tree |<- ->| ----> dio write this range
First, ext4_iomap_alloc() call ext4_map_blocks() with EXT4_GET_BLOCKS_PRE_IO, EXT4_GET_BLOCKS_UNWRIT_EXT and EXT4_GET_BLOCKS_CREATE flags set. ext4_map_blocks() find this extent and call ext4_split_convert_extents() with EXT4_GET_BLOCKS_CONVERT and the above flags set.
Then, ext4_split_convert_extents() calls ext4_split_extent() with EXT4_EXT_MAY_ZEROOUT, EXT4_EXT_MARK_UNWRIT2 and EXT4_EXT_DATA_VALID2 flags set, and it calls ext4_split_extent_at() to split the second half with EXT4_EXT_DATA_VALID2, EXT4_EXT_MARK_UNWRIT1, EXT4_EXT_MAY_ZEROOUT and EXT4_EXT_MARK_UNWRIT2 flags set. However, ext4_split_extent_at() failed to insert extent since a temporary lack -ENOSPC. It zeroes out the first half but convert the entire on-disk extent to written since the EXT4_EXT_DATA_VALID2 flag set, but left the second half as unwritten in the extent status tree.
[0000000000SSSSSS] data S: stale data, 0: zeroed [WWWWWWWWWWWWWWWW] on-disk extent W: written extent [WWWWWWWWWWUUUUUU] extent status tree
Finally, if the DIO failed to write data to the disk, the stale data in the second half will be exposed once the cached extent entry is gone.
Fix this issue by not passing EXT4_GET_BLOCKS_CONVERT when splitting an unwritten extent before submitting I/O, and make ext4_split_convert_extents() to zero out the entire extent range to zero for this case, and also mark the extent in the extent status tree for consistency.(CVE-2026-45985)
In the Linux kernel, the following vulnerability has been resolved:
KVM: nSVM: Sync interrupt shadow to cached vmcb12 after VMRUN of L2
After VMRUN in guest mode, nested_sync_control_from_vmcb02() syncs fields written by the CPU from vmcb02 to the cached vmcb12. This is because the cached vmcb12 is used as the authoritative copy of some of the controls, and is the payload when saving/restoring nested state.
int_state is also written by the CPU, specifically bit 0 (i.e. SVM_INTERRUPT_SHADOW_MASK) for nested VMs, but it is not sync'd to cached vmcb12. This does not cause a problem if KVM_SET_NESTED_STATE preceeds KVM_SET_VCPU_EVENTS in the restore path, as an interrupt shadow would be correctly restored to vmcb02 (KVM_SET_VCPU_EVENTS overwrites what KVM_SET_NESTED_STATE restored in int_state).
However, if KVM_SET_VCPU_EVENTS preceeds KVM_SET_NESTED_STATE, an interrupt shadow would be restored into vmcb01 instead of vmcb02. This would mostly be benign for L1 (delays an interrupt), but not for L2. For L2, the vCPU could hang (e.g. if a wakeup interrupt is delivered before a HLT that should have been in an interrupt shadow).
Sync int_state to the cached vmcb12 in nested_sync_control_from_vmcb02() to avoid this problem. With that, KVM_SET_NESTED_STATE restores the correct interrupt shadow state, and if KVM_SET_VCPU_EVENTS follows it would overwrite it with the same value.(CVE-2026-45987)
In the Linux kernel, the following vulnerability has been resolved:
udf: fix partition descriptor append bookkeeping
Mounting a crafted UDF image with repeated partition descriptors can trigger a heap out-of-bounds write in part_descs_loc[].
handle_partition_descriptor() deduplicates entries by partition number, but appended slots never record partnum. As a result duplicate Partition Descriptors are appended repeatedly and num_part_descs keeps growing.
Once the table is full, the growth path still sizes the allocation from partnum even though inserts are indexed by num_part_descs. If partnum is already aligned to PART_DESC_ALLOC_STEP, ALIGN(partnum, step) can keep the old capacity and the next append writes past the end of the table.
Store partnum in the appended slot and size growth from the next append count so deduplication and capacity tracking follow the same model.(CVE-2026-45991)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: usb-audio: stop parsing UAC2 rates at MAX_NR_RATES
parse_uac2_sample_rate_range() caps the number of enumerated rates at MAX_NR_RATES, but it only breaks out of the current rate loop. A malformed UAC2 RANGE response with additional triplets continues parsing the remaining triplets and repeatedly prints "invalid uac2 rates" while probe still holds register_mutex.
Stop the whole parse once the cap is reached and return the number of rates collected so far.(CVE-2026-46018)
In the Linux kernel, the following vulnerability has been resolved:
dm mirror: fix integer overflow in create_dirty_log()
The argument count calculation in create_dirty_log() performs
*args_used = 2 + param_count before validating against argc. When a
user provides a param_count close to UINT_MAX via the device mapper
table string, this unsigned addition wraps around to a small value,
causing the subsequent argc < *args_used check to be bypassed.
The overflowed param_count is then passed as argc to dm_dirty_log_create(), where it can cause out-of-bounds reads on the argv array.
Fix by comparing param_count against argc - 2 before performing the addition, following the same pattern used by parse_features() in the same file. Since argc >= 2 is already guaranteed, the subtraction is safe.(CVE-2026-46023)
In the Linux kernel, the following vulnerability has been resolved:
crypto: algif_aead - snapshot IV for async AEAD requests
AF_ALG AEAD AIO requests currently use the socket-wide IV buffer during request processing. For async requests, later socket activity can update that shared state before the original request has fully completed, which can lead to inconsistent IV handling.
Snapshot the IV into per-request storage when preparing the AEAD request, so in-flight operations no longer depend on mutable socket state.(CVE-2026-46028)
In the Linux kernel, the following vulnerability has been resolved:
KVM: nSVM: Triple fault if restore host CR3 fails on nested #VMEXIT
If loading L1's CR3 fails on a nested #VMEXIT, nested_svm_vmexit() returns an error code that is ignored by most callers, and continues to run L1 with corrupted state. A sane recovery is not possible in this case, and HW behavior is to cause a shutdown. Inject a triple fault instead, and do not return early from nested_svm_vmexit(). Continue cleaning up the vCPU state (e.g. clear pending exceptions), to handle the failure as gracefully as possible.
From the APM:
Upon #VMEXIT, the processor performs the following actions in order to return to the host execution context:
...
if (illegal host state loaded, or exception while loading host state) shutdown else execute first host instruction following the VMRUN
Remove the return value of nested_svm_vmexit(), which is mostly unchecked anyway.(CVE-2026-46032)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/rxe: Validate pad and ICRC before payload_size() in rxe_rcv
rxe_rcv() currently checks only that the incoming packet is at least header_size(pkt) bytes long before payload_size() is used.
However, payload_size() subtracts both the attacker-controlled BTH pad field and RXE_ICRC_SIZE from pkt->paylen:
payload_size = pkt->paylen - offset[RXE_PAYLOAD] - bth_pad(pkt) - RXE_ICRC_SIZE
This means a short packet can still make payload_size() underflow even if it includes enough bytes for the fixed headers. Simply requiring header_size(pkt) + RXE_ICRC_SIZE is not sufficient either, because a packet with a forged non-zero BTH pad can still leave payload_size() negative and pass an underflowed value to later receive-path users.
Fix this by validating pkt->paylen against the full minimum length required by payload_size(): header_size(pkt) + bth_pad(pkt) + RXE_ICRC_SIZE.(CVE-2026-46043)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: ctxfi: Add fallback to default RSR for S/PDIF
spdif_passthru_playback_get_resources() uses atc->pll_rate as the RSR for the MSR calculation loop. However, pll_rate is only updated in atc_pll_init() and not in hw_pll_init(), so it remains 0 after the card init.
When spdif_passthru_playback_setup() skips atc_pll_init() for 32000 Hz, (rsr * desc.msr) always becomes 0, causing the loop to spin indefinitely.
Add fallback to use atc->rsr when atc->pll_rate is 0. This reflects the hardware state, since hw_card_init() already configures the PLL to the default RSR.(CVE-2026-46049)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: hci_event: fix potential UAF in SSP passkey handlers
hci_conn lookup and field access must be covered by hdev lock in hci_user_passkey_notify_evt() and hci_keypress_notify_evt(), otherwise the connection can be freed concurrently.
Extend the hci_dev_lock critical section to cover all conn usage in both handlers.
Keep the existing keypress notification behavior unchanged by routing the early exits through a common unlock path.(CVE-2026-46056)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: defio: Disconnect deferred I/O from the lifetime of struct fb_info
Hold state of deferred I/O in struct fb_deferred_io_state. Allocate an instance as part of initializing deferred I/O and remove it only after the final mapping has been closed. If the fb_info and the contained deferred I/O meanwhile goes away, clear struct fb_deferred_io_state.info to invalidate the mapping. Any access will then result in a SIGBUS signal.
Fixes a long-standing problem, where a device hot-unplug happens while user space still has an active mapping of the graphics memory. The hot- unplug frees the instance of struct fb_info. Accessing the memory will operate on undefined state.(CVE-2026-46065)
In the Linux kernel, the following vulnerability has been resolved:
spi: fix resource leaks on device setup failure
Make sure to call controller cleanup() if spi_setup() fails while registering a device to avoid leaking any resources allocated by setup().(CVE-2026-46083)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: control: Validate buf_len before strnlen() in snd_ctl_elem_init_enum_names()
snd_ctl_elem_init_enum_names() advances pointer p through the names buffer while decrementing buf_len. If buf_len reaches zero but items remain, the next iteration calls strnlen(p, 0).
While strnlen(p, 0) returns 0 and would hit the existing name_len == 0 error path, CONFIG_FORTIFY_SOURCE's fortified strnlen() first checks maxlen against __builtin_dynamic_object_size(). When Clang loses track of p's object size inside the loop, this triggers a BRK exception panic before the return value is examined.
Add a buf_len == 0 guard at the loop entry to prevent calling fortified strnlen() on an exhausted buffer.
Found by kernel fuzz testing through Xiaomi Smartphone.(CVE-2026-46088)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: reject zero shift in nft_bitwise
Reject zero shift operands for nft_bitwise left and right shift expressions during initialization.
The carry propagation logic computes the carry from the adjacent 32-bit word using BITS_PER_TYPE(u32) - shift. A zero shift operand turns this into a 32-bit shift, which is undefined behaviour.
Reject zero shift operands in the control plane, alongside the existing check for values greater than or equal to 32, so malformed rules never reach the packet path.(CVE-2026-46101)
In the Linux kernel, the following vulnerability has been resolved:
net: strparser: fix skb_head leak in strp_abort_strp()
When the stream parser is aborted, for example after a message assembly timeout, it can still hold a reference to a partially assembled message in strp->skb_head.
That skb is not released in strp_abort_strp(), which leaks the partially assembled message and can be triggered repeatedly to exhaust memory.
Fix this by freeing strp->skb_head and resetting the parser state in the abort path. Leave strp_stop() unchanged so final cleanup still happens in strp_done() after the work and timer have been synchronized.(CVE-2026-46102)
In the Linux kernel, the following vulnerability has been resolved:
dm-thin: fix metadata refcount underflow
There's a bug in dm-thin in the function rebalance_children. If the internal btree node has one entry, the code tries to copy all btree entries from the node's child to the node itself and then decrement the child's reference count.
If the child node is shared (it has reference count > 1), we won't free it, so there would be two pointers to each of the grandchildren nodes. But the reference counts of the grandchildren is not increased, thus the reference count doesn't match the number of pointers that point to the grandchildren. This results in "device mapper: space map common: unable to decrement block" errors.
Fix this bug by incrementing reference counts on the grandchildren if the btree node is shared.(CVE-2026-46107)
In the Linux kernel, the following vulnerability has been resolved:
xfrm: defensively unhash xfrm_state lists in __xfrm_state_delete
KASAN reproduces a slab-use-after-free in __xfrm_state_delete()'s hlist_del_rcu calls under syzkaller load on linux-6.12.y stable (reproduced on 6.12.47, also reachable via the same code path on torvalds/master and on the ipsec tree). Nine unique signatures cluster in the xfrm_state lifecycle, the load-bearing one being:
BUG: KASAN: slab-use-after-free in __hlist_del include/linux/list.h:990 [inline] BUG: KASAN: slab-use-after-free in hlist_del_rcu include/linux/rculist.h:516 [inline] BUG: KASAN: slab-use-after-free in __xfrm_state_delete net/xfrm/xfrm_state.c Write of size 8 at addr ffff8881198bcb70 by task kworker/u8:9/435
Workqueue: netns cleanup_net Call Trace: __hlist_del / hlist_del_rcu __xfrm_state_delete xfrm_state_delete xfrm_state_flush xfrm_state_fini ops_exit_list cleanup_net
The other observed signatures hit the same slab object from __xfrm_state_lookup, xfrm_alloc_spi, __xfrm_state_insert and an OOB write variant of __xfrm_state_delete, all on the byseq/byspi hash chains.
__xfrm_state_delete() guards its byseq and byspi unhashes with value-based predicates:
if (x->km.seq)
hlist_del_rcu(&x->byseq);
if (x->id.spi)
hlist_del_rcu(&x->byspi);
while everywhere else in the file (e.g. state_cache, state_cache_input) the safer hlist_unhashed() check is used. xfrm_alloc_spi() sets x->id.spi = newspi inside xfrm_state_lock and then immediately inserts into byspi, but a path that observes x->id.spi != 0 outside of xfrm_state_lock can still skip-or-hit the byspi unhash inconsistently with whether x is actually on the list. The same holds for x->km.seq versus byseq, and the bydst/bysrc unhashes have no predicate at all, so a second __xfrm_state_delete() on the same object writes through LIST_POISON pprev.
The defensive change here:
- Use hlist_del_init_rcu() instead of hlist_del_rcu() on bydst, bysrc, byseq and byspi so a second deletion is a no-op rather than a write through LIST_POISON pprev. The byseq/byspi nodes are already initialised in xfrm_state_alloc().
- Test hlist_unhashed() rather than the value predicate for byseq/byspi, so the unhash decision tracks list state rather than mutable scalar fields.
Empirical verification: applied this patch on top of v6.12.47, rebuilt, and re-ran the same syzkaller harness for 1h16m on a previously-crashy configuration that produced ~100 hits each of slab-use-after-free Read in xfrm_alloc_spi / Read in __xfrm_state_lookup / Write in __xfrm_state_delete. After the patch, 7.1M execs across 32 VMs at ~1550 exec/sec produced zero xfrm_state UAF/OOB hits. /proc/slabinfo confirms the xfrm_state slab is actively allocated and freed during the run (~143 KiB resident), so the fuzzer is still exercising those code paths -- they just no longer crash.
Reproduction:
- Linux 6.12.47 x86_64 + KASAN_GENERIC + KASAN_INLINE + KCOV
- syzkaller @ 746545b8b1e4c3a128db8652b340d3df90ce61db
- 32 QEMU/KVM VMs x 2 vCPU on AWS c5.metal bare metal
- 9 unique signatures collected in ~9h, all within xfrm_state lifecycle(CVE-2026-46116)
In the Linux kernel, the following vulnerability has been resolved:
net: rtnetlink: zero ifla_vf_broadcast to avoid stack infoleak in rtnl_fill_vfinfo
rtnl_fill_vfinfo() declares struct ifla_vf_broadcast on the stack without initialisation:
struct ifla_vf_broadcast vf_broadcast;
The struct contains a single fixed 32-byte field:
/* include/uapi/linux/if_link.h */
struct ifla_vf_broadcast {
__u8 broadcast[32];
};
The function then copies dev->broadcast into it using dev->addr_len as the length:
memcpy(vf_broadcast.broadcast, dev->broadcast, dev->addr_len);
On Ethernet devices (the overwhelming majority of SR-IOV NICs) dev->addr_len is 6, so only the first 6 bytes of broadcast[] are written. The remaining 26 bytes retain whatever was previously on the kernel stack. The full struct is then handed to userspace via:
nla_put(skb, IFLA_VF_BROADCAST,
sizeof(vf_broadcast), &vf_broadcast)
leaking up to 26 bytes of uninitialised kernel stack per VF per RTM_GETLINK request, repeatable.
The other vf_* structs in the same function are explicitly zeroed for exactly this reason - see the memset() calls for ivi, vf_vlan_info, node_guid and port_guid a few lines above. vf_broadcast was simply missed when it was added.
Reachability: any unprivileged local process can open AF_NETLINK / NETLINK_ROUTE without capabilities and send RTM_GETLINK with an IFLA_EXT_MASK attribute carrying RTEXT_FILTER_VF. The kernel walks each VF and emits IFLA_VF_BROADCAST, leaking 26 bytes of stack per VF per request. Stack residue at this call site can include return addresses and transient sensitive data; KASAN with stack instrumentation, or KMSAN, will flag the nla_put() when reproduced.
Zero the on-stack struct before the partial memcpy, matching the existing pattern used for the other vf_* structs in the same function.(CVE-2026-46132)
In the Linux kernel, xfrm6_rcv_encap() performs an IPv6 route lookup when the skb does not already have a dst attached. ip6_route_input_lookup() returns a referenced dst entry even when the lookup resolves to an error route. If dst->error is set, xfrm6_rcv_encap() drops the skb without attaching the dst to the skb and without releasing the reference returned by the lookup. Repeated packets hitting this path therefore leak dst entries.(CVE-2026-46172)
In the Linux kernel, the mlx4_ib_create_srq() function fails to release resources allocated by mlx4_srq_alloc() in error handling paths, leading to a resource leak. An attacker could exploit this vulnerability to cause resource exhaustion or denial of service.(CVE-2026-46178)
In the Linux kernel, the ua101 driver has a division by zero vulnerability at probe. The detect_usb_format() function lacks a sanity check for the bNrChannels field. When a malicious USB audio device provides bNrChannels=0, frame_bytes becomes zero and is later used as a divisor in playback_urb_complete() and capture_urb_complete(), causing a kernel crash. USB core does not validate class-specific descriptor fields, so drivers must verify them before use.(CVE-2026-46184)
In the Linux kernel, drm_gem_fb_init_with_funcs() computes sub-sampled plane dimensions using plain integer division, while the ioctl-level framebuffer_check() uses DIV_ROUND_UP via drm_format_info_plane_width/height(). This inconsistency causes incorrect GEM object size validation for certain pixel formats and dimensions, e.g., NV12 with height=1 results in height=0, leading to an integer overflow in size check and allowing undersized GEM objects to pass, potentially causing out-of-bounds memory access by the GPU.(CVE-2026-46209)
In the Linux kernel, the following vulnerability has been resolved: MIPS: Work around LLVM bug when gp is used as global register variable On MIPS, __current_thread_info is defined as global register variable locating in $gp, and is simply assigned with new address during kernel relocation. This however is broken with LLVM, which always restores $gp if it finds $gp is clobbered in any form, including when intentionally through a global register variable. This is against GCC's documentation[1], which requires a callee-saved register used as global register variable not to be restored if it's clobbered. As a result, $gp will continue to point to the unrelocated kernel after the epilog of relocate_kernel(), leading to an early crash in init_idle, [ 0.000000] CPU 0 Unable to handle kernel paging request at virtual address 0000000000000000, epc == ffffffff81afada8, ra == ffffffff81afad90 [ 0.000000] Oops[#1]: [ 0.000000] CPU: 0 UID: 0 PID: 0 Comm: swapper Tainted: G W 6.19.0-rc5-00262-gd3eeb99bbc99-dirty #188 VOLUNTARY [ 0.000000] Tainted: [W]=WARN [ 0.000000] Hardware name: loongson,loongson64v-4core-virtio [ 0.000000] $ 0 : 0000000000000000 0000000000000000 0000000000000001 0000000000000000 [ 0.000000] $ 4 : ffffffff80b80ec0 ffffffff80b53d48 0000000000000000 00000000000f4240 [ 0.000000] $ 8 : 0000000000000100 ffffffff81d82f80 ffffffff81d82f80 0000000000000001 [ 0.000000] $12 : 0000000000000000 ffffffff81776f58 00000000000005da 0000000000000002 [ 0.000000] $16 : ffffffff80b80e40 0000000000000000 ffffffff80b81614 9800000005dfbe80 [ 0.000000] $20 : 00000000540000e0 ffffffff81980000 0000000000000000 ffffffff80f81c80 [ 0.000000] $24 : 0000000000000a26 ffffffff8114fb90 [ 0.000000] $28 : ffffffff80b50000 ffffffff80b53d40 0000000000000000 ffffffff81afad90 [ 0.000000] Hi : 0000000000000000 [ 0.000000] Lo : 0000000000000000 [ 0.000000] epc : ffffffff81afada8 init_idle+0x130/0x270 [ 0.000000] ra : ffffffff81afad90 init_idle+0x118/0x270 [ 0.000000] Status: 540000e2 KX SX UX KERNEL EXL [ 0.000000] Cause : 00000008 (ExcCode 02) [ 0.000000] BadVA : 0000000000000000 [ 0.000000] PrId : 00006305 (ICT Loongson-3) [ 0.000000] Process swapper (pid: 0, threadinfo=(_ptrval_), task=(_ptrval_), tls=0000000000000000) [ 0.000000] Stack : 9800000005dfbf00 ffffffff8178e950 0000000000000000 0000000000000000 [ 0.000000] 0000000000000000 ffffffff81970000 000000000000003f ffffffff810a6528 [ 0.000000] 0000000000000001 9800000005dfbe80 9800000005dfbf00 ffffffff81980000 [ 0.000000] ffffffff810a6450 ffffffff81afb6c0 0000000000000000 ffffffff810a2258 [ 0.000000] ffffffff81d82ec8 ffffffff8198d010 ffffffff81b67e80 ffffffff8197dd98 [ 0.000000] ffffffff81d81c80 ffffffff81930000 0000000000000040 0000000000000000 [ 0.000000] 0000000000000000 0000000000000000 0000000000000000 0000000000000000 [ 0.000000] 0000000000000000 000000000000009e ffffffff9fc01000 0000000000000000 [ 0.000000] 0000000000000000 0000000000000000 0000000000000000 0000000000000000 [ 0.000000] 0000000000000000 ffffffff81ae86dc ffffffff81b3c741 0000000000000002 [ 0.000000] ... [ 0.000000] Call Trace: [ 0.000000] [<ffffffff81afada8>] init_idle+0x130/0x270 [ 0.000000] [<ffffffff81afb6c0>] sched_init+0x5c8/0x6c0 [ 0.000000] [<ffffffff81ae86dc>] start_kernel+0x27c/0x7a8 This bug has been reported to LLVM[2] and affects version from (at least) 18 to 21. Let's work around this by using inline assembly to assign $gp before a fix is widely available. The Linux kernel CVE team has assigned CVE-2026-46250 to this issue.(CVE-2026-46250)
In the Linux kernel, the following vulnerability has been resolved: pstore/ram: fix buffer overflow in persistent_ram_save_old() persistent_ram_save_old() can be called multiple times for the same persistent_ram_zone (e.g., via ramoops_pstore_read -> ramoops_get_next_prz for PSTORE_TYPE_DMESG records). Currently, the function only allocates prz->old_log when it is NULL, but it unconditionally updates prz->old_log_size to the current buffer size and then performs memcpy_fromio() using this new size. If the buffer size has grown since the first allocation (which can happen across different kernel boot cycles), this leads to: 1. A heap buffer overflow (OOB write) in the memcpy_fromio() calls 2. A subsequent OOB read when ramoops_pstore_read() accesses the buffer using the incorrect (larger) old_log_size The KASAN splat would look similar to: BUG: KASAN: slab-out-of-bounds in ramoops_pstore_read+0x... Read of size N at addr ... by task ... The conditions are likely extremely hard to hit: 0. Crash with a ramoops write of less-than-record-max-size bytes. 1. Reboot: ramoops registers, pstore_get_records(0) reads old crash, allocates old_log with size X 2. Crash handler registered, timer started (if pstore_update_ms >= 0) 3. Oops happens (non-fatal, system continues) 4. pstore_dump() writes oops via ramoops_pstore_write() size Y (>X) 5. pstore_new_entry = 1, pstore_timer_kick() called 6. System continues running (not a panic oops) 7. Timer fires after pstore_update_ms milliseconds 8. pstore_timefunc() → schedule_work() → pstore_dowork() → pstore_get_records(1) 9. ramoops_get_next_prz() → persistent_ram_save_old() 10. buffer_size() returns Y, but old_log is X bytes 11. Y > X: memcpy_fromio() overflows heap Requirements: - a prior crash record exists that did not fill the record size (almost impossible since the crash handler writes as much as it can possibly fit into the record, capped by max record size and the kmsg buffer almost always exceeds the max record size) - pstore_update_ms >= 0 (disabled by default) - Non-fatal oops (system survives) Free and reallocate the buffer when the new size differs from the previously allocated size. This ensures old_log always has sufficient space for the data being copied. The Linux kernel CVE team has assigned CVE-2026-46253 to this issue.(CVE-2026-46253)
In the Linux kernel, the following vulnerability has been resolved: procfs: fix missing RCU protection when reading real_parent in do_task_stat() When reading /proc/[pid]/stat, do_task_stat() accesses task->real_parent without proper RCU protection, which leads to: cpu 0 cpu 1 ----- ----- do_task_stat var = task->real_parent release_task call_rcu(delayed_put_task_struct) task_tgid_nr_ns(var) rcu_read_lock <--- Too late to protect task->real_parent! task_pid_ptr <--- UAF! rcu_read_unlock This patch uses task_ppid_nr_ns() instead of task_tgid_nr_ns() to add proper RCU protection for accessing task->real_parent. The Linux kernel CVE team has assigned CVE-2026-46259 to this issue.(CVE-2026-46259)
In the Linux kernel, the following vulnerability has been resolved: RDMA/hns: Fix WQ_MEM_RECLAIM warning When sunrpc is used, if a reset triggered, our wq may lead the following trace: workqueue: WQ_MEM_RECLAIM xprtiod:xprt_rdma_connect_worker [rpcrdma] is flushing !WQ_MEM_RECLAIM hns_roce_irq_workq:flush_work_handle [hns_roce_hw_v2] WARNING: CPU: 0 PID: 8250 at kernel/workqueue.c:2644 check_flush_dependency+0xe0/0x144 Call trace: check_flush_dependency+0xe0/0x144 start_flush_work.constprop.0+0x1d0/0x2f0 __flush_work.isra.0+0x40/0xb0 flush_work+0x14/0x30 hns_roce_v2_destroy_qp+0xac/0x1e0 [hns_roce_hw_v2] ib_destroy_qp_user+0x9c/0x2b4 rdma_destroy_qp+0x34/0xb0 rpcrdma_ep_destroy+0x28/0xcc [rpcrdma] rpcrdma_ep_put+0x74/0xb4 [rpcrdma] rpcrdma_xprt_disconnect+0x1d8/0x260 [rpcrdma] xprt_rdma_connect_worker+0xc0/0x120 [rpcrdma] process_one_work+0x1cc/0x4d0 worker_thread+0x154/0x414 kthread+0x104/0x144 ret_from_fork+0x10/0x18 Since QP destruction frees memory, this wq should have the WQ_MEM_RECLAIM. The Linux kernel CVE team has assigned CVE-2026-46265 to this issue.(CVE-2026-46265)
| URL | Type | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"bpftool-debuginfo-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-debuginfo-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-debugsource-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-devel-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-headers-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-source-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-tools-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"kernel-tools-devel-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"perf-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"perf-debuginfo-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"python3-perf-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-318.0.0.221.oe2203sp4.aarch64.rpm"
],
"src": [
"kernel-5.10.0-318.0.0.221.oe2203sp4.src.rpm"
],
"x86_64": [
"bpftool-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"bpftool-debuginfo-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-debuginfo-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-debugsource-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-devel-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-headers-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-source-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-tools-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"kernel-tools-devel-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"perf-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"perf-debuginfo-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"python3-perf-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-318.0.0.221.oe2203sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-318.0.0.221.oe2203sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbtrfs: qgroup: fix race between quota disable and quota rescan ioctl\n\nThere\u0026apos;s a race between a task disabling quotas and another running the\nrescan ioctl that can result in a use-after-free of qgroup records from\nthe fs_info-\u0026gt;qgroup_tree rbtree.\n\nThis happens as follows:\n\n1) Task A enters btrfs_ioctl_quota_rescan() -\u0026gt; btrfs_qgroup_rescan();\n\n2) Task B enters btrfs_quota_disable() and calls\n btrfs_qgroup_wait_for_completion(), which does nothing because at that\n point fs_info-\u0026gt;qgroup_rescan_running is false (it wasn\u0026apos;t set yet by\n task A);\n\n3) Task B calls btrfs_free_qgroup_config() which starts freeing qgroups\n from fs_info-\u0026gt;qgroup_tree without taking the lock fs_info-\u0026gt;qgroup_lock;\n\n4) Task A enters qgroup_rescan_zero_tracking() which starts iterating\n the fs_info-\u0026gt;qgroup_tree tree while holding fs_info-\u0026gt;qgroup_lock,\n but task B is freeing qgroup records from that tree without holding\n the lock, resulting in a use-after-free.\n\nFix this by taking fs_info-\u0026gt;qgroup_lock at btrfs_free_qgroup_config().\nAlso at btrfs_qgroup_rescan() don\u0026apos;t start the rescan worker if quotas\nwere already disabled.(CVE-2025-39759)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: wilc1000: avoid buffer overflow in WID string configuration\n\nFix the following copy overflow warning identified by Smatch checker.\n\n drivers/net/wireless/microchip/wilc1000/wlan_cfg.c:184 wilc_wlan_parse_response_frame()\n error: \u0026apos;__memcpy()\u0026apos; \u0026apos;cfg-\u0026gt;s[i]-\u0026gt;str\u0026apos; copy overflow (512 vs 65537)\n\nThis patch introduces size check before accessing the memory buffer.\nThe checks are base on the WID type of received data from the firmware.\nFor WID string configuration, the size limit is determined by individual\nelement size in \u0026apos;struct wilc_cfg_str_vals\u0026apos; that is maintained in \u0026apos;len\u0026apos; field\nof \u0026apos;struct wilc_cfg_str\u0026apos;.(CVE-2025-39952)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niio: accel: bmc150: Fix irq assumption regression\n\nThe code in bmc150-accel-core.c unconditionally calls\nbmc150_accel_set_interrupt() in the iio_buffer_setup_ops,\nsuch as on the runtime PM resume path giving a kernel\nsplat like this if the device has no interrupts:\n\nUnable to handle kernel NULL pointer dereference at virtual\n address 00000001 when read\n\nPC is at bmc150_accel_set_interrupt+0x98/0x194\nLR is at __pm_runtime_resume+0x5c/0x64\n(...)\nCall trace:\nbmc150_accel_set_interrupt from bmc150_accel_buffer_postenable+0x40/0x108\nbmc150_accel_buffer_postenable from __iio_update_buffers+0xbe0/0xcbc\n__iio_update_buffers from enable_store+0x84/0xc8\nenable_store from kernfs_fop_write_iter+0x154/0x1b4\n\nThis bug seems to have been in the driver since the beginning,\nbut it only manifests recently, I do not know why.\n\nStore the IRQ number in the state struct, as this is a common\npattern in other drivers, then use this to determine if we have\nIRQ support or not.(CVE-2025-68330)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nstaging: most: remove broken i2c driver\n\nThe MOST I2C driver has been completely broken for five years without\nanyone noticing so remove the driver from staging.\n\nSpecifically, commit 723de0f9171e (\u0026quot;staging: most: remove device from\ninterface structure\u0026quot;) started requiring drivers to set the interface\ndevice pointer before registration, but the I2C driver was never updated\nwhich results in a NULL pointer dereference if anyone ever tries to\nprobe it.(CVE-2025-68755)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbtrfs: fix NULL dereference on root when tracing inode eviction\n\nWhen evicting an inode the first thing we do is to setup tracing for it,\nwhich implies fetching the root\u0026apos;s id. But in btrfs_evict_inode() the\nroot might be NULL, as implied in the next check that we do in\nbtrfs_evict_inode().\n\nHence, we either should set the -\u0026gt;root_objectid to 0 in case the root is\nNULL, or we move tracing setup after checking that the root is not\nNULL. Setting the rootid to 0 at least gives us the possibility to trace\nthis call even in the case when the root is NULL, so that\u0026apos;s the solution\ntaken here.(CVE-2025-71184)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfbdev: udlfb: avoid divide-by-zero on FBIOPUT_VSCREENINFO\n\nMuch like commit 19f953e74356 (\u0026quot;fbdev: fb_pm2fb: Avoid potential divide\nby zero error\u0026quot;), we also need to prevent that same crash from happening\nin the udlfb driver as it uses pixclock directly when dividing, which\nwill crash.(CVE-2026-31605)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusbip: validate number_of_packets in usbip_pack_ret_submit()\n\nWhen a USB/IP client receives a RET_SUBMIT response,\nusbip_pack_ret_submit() unconditionally overwrites\nurb-\u0026gt;number_of_packets from the network PDU. This value is\nsubsequently used as the loop bound in usbip_recv_iso() and\nusbip_pad_iso() to iterate over urb-\u0026gt;iso_frame_desc[], a flexible\narray whose size was fixed at URB allocation time based on the\n*original* number_of_packets from the CMD_SUBMIT.\n\nA malicious USB/IP server can set number_of_packets in the response\nto a value larger than what was originally submitted, causing a heap\nout-of-bounds write when usbip_recv_iso() writes to\nurb-\u0026gt;iso_frame_desc[i] beyond the allocated region.\n\nKASAN confirmed this with kernel 7.0.0-rc5:\n\n BUG: KASAN: slab-out-of-bounds in usbip_recv_iso+0x46a/0x640\n Write of size 4 at addr ffff888106351d40 by task vhci_rx/69\n\n The buggy address is located 0 bytes to the right of\n allocated 320-byte region [ffff888106351c00, ffff888106351d40)\n\nThe server side (stub_rx.c) and gadget side (vudc_rx.c) already\nvalidate number_of_packets in the CMD_SUBMIT path since commits\nc6688ef9f297 (\u0026quot;usbip: fix stub_rx: harden CMD_SUBMIT path to handle\nmalicious input\u0026quot;) and b78d830f0049 (\u0026quot;usbip: fix vudc_rx: harden\nCMD_SUBMIT path to handle malicious input\u0026quot;). The server side validates\nagainst USBIP_MAX_ISO_PACKETS because no URB exists yet at that point.\nOn the client side we have the original URB, so we can use the tighter\nbound: the response must not exceed the original number_of_packets.\n\nThis mirrors the existing validation of actual_length against\ntransfer_buffer_length in usbip_recv_xbuff(), which checks the\nresponse value against the original allocation size.\n\nKelvin Mbogo\u0026apos;s series (\u0026quot;usb: usbip: fix integer overflow in\nusbip_recv_iso()\u0026quot;, v2) hardens the receive-side functions themselves;\nthis patch complements that work by catching the bad value at its\nsource -- in usbip_pack_ret_submit() before the overwrite -- and\nusing the tighter per-URB allocation bound rather than the global\nUSBIP_MAX_ISO_PACKETS limit.\n\nFix this by checking rpdu-\u0026gt;number_of_packets against\nurb-\u0026gt;number_of_packets in usbip_pack_ret_submit() before the\noverwrite. On violation, clamp to zero so that usbip_recv_iso() and\nusbip_pad_iso() safely return early.(CVE-2026-31607)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: gadget: renesas_usb3: validate endpoint index in standard request handlers\n\nThe GET_STATUS and SET/CLEAR_FEATURE handlers extract the endpoint\nnumber from the host-supplied wIndex without any sort of validation.\nFix this up by validating the number of endpoints actually match up with\nthe number the device has before attempting to dereference a pointer\nbased on this math.\n\nThis is just like what was done in commit ee0d382feb44 (\u0026quot;usb: gadget:\naspeed_udc: validate endpoint index for ast udc\u0026quot;) for the aspeed driver.(CVE-2026-31615)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: gadget: f_phonet: fix skb frags[] overflow in pn_rx_complete()\n\nA broken/bored/mean USB host can overflow the skb_shared_info-\u0026gt;frags[]\narray on a Linux gadget exposing a Phonet function by sending an\nunbounded sequence of full-page OUT transfers.\n\npn_rx_complete() finalizes the skb only when req-\u0026gt;actual \u0026lt; req-\u0026gt;length,\nwhere req-\u0026gt;length is set to PAGE_SIZE by the gadget. If the host always\nsends exactly PAGE_SIZE bytes per transfer, fp-\u0026gt;rx.skb will never be\nreset and each completion will add another fragment via\nskb_add_rx_frag(). Once nr_frags exceeds MAX_SKB_FRAGS (default 17),\nsubsequent frag stores overwrite memory adjacent to the shinfo on the\nheap.\n\nDrop the skb and account a length error when the frag limit is reached,\nmatching the fix applied in t7xx by commit f0813bcd2d9d (\u0026quot;net: wwan:\nt7xx: fix potential skb-\u0026gt;frags overflow in RX path\u0026quot;).(CVE-2026-31616)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: gadget: f_ncm: validate minimum block_len in ncm_unwrap_ntb()\n\nThe block_len read from the host-supplied NTB header is checked against\nntb_max but has no lower bound. When block_len is smaller than\nopts-\u0026gt;ndp_size, the bounds check of:\n\tndp_index \u0026gt; (block_len - opts-\u0026gt;ndp_size)\nwill underflow producing a huge unsigned value that ndp_index can never\nexceed, defeating the check entirely.\n\nThe same underflow occurs in the datagram index checks against block_len\n- opts-\u0026gt;dpe_size. With those checks neutered, a malicious USB host can\nchoose ndp_index and datagram offsets that point past the actual\ntransfer, and the skb_put_data() copies adjacent kernel memory into the\nnetwork skb.\n\nFix this by rejecting block lengths that cannot hold at least the NTB\nheader plus one NDP. This will make block_len - opts-\u0026gt;ndp_size and\nblock_len - opts-\u0026gt;dpe_size both well-defined.\n\nCommit 8d2b1a1ec9f5 (\u0026quot;CDC-NCM: avoid overflow in sanity checking\u0026quot;) fixed\na related class of issues on the host side of NCM.(CVE-2026-31617)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfbdev: tdfxfb: avoid divide-by-zero on FBIOPUT_VSCREENINFO\n\nMuch like commit 19f953e74356 (\u0026quot;fbdev: fb_pm2fb: Avoid potential divide\nby zero error\u0026quot;), we also need to prevent that same crash from happening\nin the udlfb driver as it uses pixclock directly when dividing, which\nwill crash.(CVE-2026-31618)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/packet: fix TOCTOU race on mmap\u0026apos;d vnet_hdr in tpacket_snd()\n\nIn tpacket_snd(), when PACKET_VNET_HDR is enabled, vnet_hdr points\ndirectly into the mmap\u0026apos;d TX ring buffer shared with userspace. The\nkernel validates the header via __packet_snd_vnet_parse() but then\nre-reads all fields later in virtio_net_hdr_to_skb(). A concurrent\nuserspace thread can modify the vnet_hdr fields between validation\nand use, bypassing all safety checks.\n\nThe non-TPACKET path (packet_snd()) already correctly copies vnet_hdr\nto a stack-local variable. All other vnet_hdr consumers in the kernel\n(tun.c, tap.c, virtio_net.c) also use stack copies. The TPACKET TX\npath is the only caller of virtio_net_hdr_to_skb() that reads directly\nfrom user-controlled shared memory.\n\nFix this by copying vnet_hdr from the mmap\u0026apos;d ring buffer to a\nstack-local variable before validation and use, consistent with the\napproach used in packet_snd() and all other callers.(CVE-2026-31700)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBuffer overflow in drivers/xen/sys-hypervisor.c\n\nThe build id returned by HYPERVISOR_xen_version(XENVER_build_id) is\nneither NUL terminated nor a string.\n\nThe first causes a buffer overflow as sprintf in buildid_show will\nread and copy till it finds a NUL.\n\n00000000 f4 91 51 f4 dd 38 9e 9d 65 47 52 eb 10 71 db 50 |..Q..8..eGR..q.P|\n00000010 b9 a8 01 42 6f 2e 32 |...Bo.2|\n00000017\n\nSo use a memcpy instead of sprintf to have the correct value:\n\n00000000 f4 91 51 f4 dd 00 9e 9d 65 47 52 eb 10 71 db 50 |..Q.....eGR..q.P|\n00000010 b9 a8 01 42 |...B|\n00000014\n\n(the above have a hack to embed a zero inside and check it\u0026apos;s\nreturned correctly).\n\nThis is XSA-485 / CVE-2026-31786(CVE-2026-31786)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: algif_aead - Fix minimum RX size check for decryption\n\nThe check for the minimum receive buffer size did not take the\ntag size into account during decryption. Fix this by adding the\nrequired extra length.(CVE-2026-43077)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: af_alg - Fix page reassignment overflow in af_alg_pull_tsgl\n\nWhen page reassignment was added to af_alg_pull_tsgl the original\nloop wasn\u0026apos;t updated so it may try to reassign one more page than\nnecessary.\n\nAdd the check to the reassignment so that this does not happen.\n\nAlso update the comment which still refers to the obsolete offset\nargument.(CVE-2026-43078)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm: Wait for RCU readers during policy netns exit\n\nxfrm_policy_fini() frees the policy_bydst hash tables after flushing the\npolicy work items and deleting all policies, but it does not wait for\nconcurrent RCU readers to leave their read-side critical sections first.\n\nThe policy_bydst tables are published via rcu_assign_pointer() and are\nlooked up through rcu_dereference_check(), so netns teardown must also\nwait for an RCU grace period before freeing the table memory.\n\nFix this by adding synchronize_rcu() before freeing the policy hash tables.(CVE-2026-43091)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxsk: tighten UMEM headroom validation to account for tailroom and min frame\n\nThe current headroom validation in xdp_umem_reg() could leave us with\ninsufficient space dedicated to even receive minimum-sized ethernet\nframe. Furthermore if multi-buffer would come to play then\nskb_shared_info stored at the end of XSK frame would be corrupted.\n\nHW typically works with 128-aligned sizes so let us provide this value\nas bare minimum.\n\nMulti-buffer setting is known later in the configuration process so\nbesides accounting for 128 bytes, let us also take care of tailroom space\nupfront.(CVE-2026-43093)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: ctnetlink: ensure safe access to master conntrack\n\nHolding reference on the expectation is not sufficient, the master\nconntrack object can just go away, making exp-\u0026gt;master invalid.\n\nTo access exp-\u0026gt;master safely:\n\n- Grab the nf_conntrack_expect_lock, this gets serialized with\n clean_from_lists() which also holds this lock when the master\n conntrack goes away.\n\n- Hold reference on master conntrack via nf_conntrack_find_get().\n Not so easy since the master tuple to look up for the master conntrack\n is not available in the existing problematic paths.\n\nThis patch goes for extending the nf_conntrack_expect_lock section\nto address this issue for simplicity, in the cases that are described\nbelow this is just slightly extending the lock section.\n\nThe add expectation command already holds a reference to the master\nconntrack from ctnetlink_create_expect().\n\nHowever, the delete expectation command needs to grab the spinlock\nbefore looking up for the expectation. Expand the existing spinlock\nsection to address this to cover the expectation lookup. Note that,\nthe nf_ct_expect_iterate_net() calls already grabs the spinlock while\niterating over the expectation table, which is correct.\n\nThe get expectation command needs to grab the spinlock to ensure master\nconntrack does not go away. This also expands the existing spinlock\nsection to cover the expectation lookup too. I needed to move the\nnetlink skb allocation out of the spinlock to keep it GFP_KERNEL.\n\nFor the expectation events, the IPEXP_DESTROY event is already delivered\nunder the spinlock, just move the delivery of IPEXP_NEW under the\nspinlock too because the master conntrack event cache is reached through\nexp-\u0026gt;master.\n\nWhile at it, add lockdep notations to help identify what codepaths need\nto grab the spinlock.(CVE-2026-43116)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndlm: validate length in dlm_search_rsb_tree\n\nThe len parameter in dlm_dump_rsb_name() is not validated and comes\nfrom network messages. When it exceeds DLM_RESNAME_MAXLEN, it can\ncause out-of-bounds write in dlm_search_rsb_tree().\n\nAdd length validation to prevent potential buffer overflow.(CVE-2026-43125)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/vt-d: Flush dev-IOTLB only when PCIe device is accessible in scalable mode\n\nCommit 4fc82cd907ac (\u0026quot;iommu/vt-d: Don\u0026apos;t issue ATS Invalidation\nrequest when device is disconnected\u0026quot;) relies on\npci_dev_is_disconnected() to skip ATS invalidation for\nsafely-removed devices, but it does not cover link-down caused\nby faults, which can still hard-lock the system.\n\nFor example, if a VM fails to connect to the PCIe device,\n\u0026quot;virsh destroy\u0026quot; is executed to release resources and isolate\nthe fault, but a hard-lockup occurs while releasing the group fd.\n\nCall Trace:\n qi_submit_sync\n qi_flush_dev_iotlb\n intel_pasid_tear_down_entry\n device_block_translation\n blocking_domain_attach_dev\n __iommu_attach_device\n __iommu_device_set_domain\n __iommu_group_set_domain_internal\n iommu_detach_group\n vfio_iommu_type1_detach_group\n vfio_group_detach_container\n vfio_group_fops_release\n __fput\n\nAlthough pci_device_is_present() is slower than\npci_dev_is_disconnected(), it still takes only ~70 \u00b5s on a\nConnectX-5 (8 GT/s, x2) and becomes even faster as PCIe speed\nand width increase.\n\nBesides, devtlb_invalidation_with_pasid() is called only in the\npaths below, which are far less frequent than memory map/unmap.\n\n1. mm-struct release\n2. {attach,release}_dev\n3. set/remove PASID\n4. dirty-tracking setup\n\nThe gain in system stability far outweighs the negligible cost\nof using pci_device_is_present() instead of pci_dev_is_disconnected()\nto decide when to skip ATS invalidation, especially under GDR\nhigh-load conditions.(CVE-2026-43130)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm6: fix uninitialized saddr in xfrm6_get_saddr()\n\nxfrm6_get_saddr() does not check the return value of\nipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable\nsource address (returns -EADDRNOTAVAIL), saddr-\u0026gt;in6 is left\nuninitialized, but xfrm6_get_saddr() still returns 0 (success).\n\nThis causes the caller xfrm_tmpl_resolve_one() to use the uninitialized\naddress in xfrm_state_find(), triggering KMSAN warning:\n\n=====================================================\nBUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940\n xfrm_state_find+0x2424/0xa940\n xfrm_resolve_and_create_bundle+0x906/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n xfrm_lookup_route+0x63/0x2b0\n ip_route_output_flow+0x1ce/0x270\n udp_sendmsg+0x2ce1/0x3400\n inet_sendmsg+0x1ef/0x2a0\n __sock_sendmsg+0x278/0x3d0\n __sys_sendto+0x593/0x720\n __x64_sys_sendto+0x130/0x200\n x64_sys_call+0x332b/0x3e70\n do_syscall_64+0xd3/0xf80\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\n\nLocal variable tmp.i.i created at:\n xfrm_resolve_and_create_bundle+0x3e3/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n=====================================================\n\nFix by checking the return value of ipv6_dev_get_saddr() and propagating\nthe error.(CVE-2026-43139)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: xt_tcpmss: check remaining length before reading optlen\n\nQuoting reporter:\n In net/netfilter/xt_tcpmss.c (lines 53-68), the TCP option parser reads\n op[i+1] directly without validating the remaining option length.\n\n If the last byte of the option field is not EOL/NOP (0/1), the code attempts\n to index op[i+1]. In the case where i + 1 == optlen, this causes an\n out-of-bounds read, accessing memory past the optlen boundary\n (either reading beyond the stack buffer _opt or the\n following payload).(CVE-2026-43190)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntcp: fix potential race in tcp_v6_syn_recv_sock()\n\nCode in tcp_v6_syn_recv_sock() after the call to tcp_v4_syn_recv_sock()\nis done too late.\n\nAfter tcp_v4_syn_recv_sock(), the child socket is already visible\nfrom TCP ehash table and other cpus might use it.\n\nSince newinet-\u0026gt;pinet6 is still pointing to the listener ipv6_pinfo\nbad things can happen as syzbot found.\n\nMove the problematic code in tcp_v6_mapped_child_init()\nand call this new helper from tcp_v4_syn_recv_sock() before\nthe ehash insertion.\n\nThis allows the removal of one tcp_sync_mss(), since\ntcp_v4_syn_recv_sock() will call it with the correct\ncontext.(CVE-2026-43198)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: nf_conntrack_h323: fix OOB read in decode_choice()\n\nIn decode_choice(), the boundary check before get_len() uses the\nvariable `len`, which is still 0 from its initialization at the top of\nthe function:\n\n unsigned int type, ext, len = 0;\n ...\n if (ext || (son-\u0026gt;attr \u0026amp; OPEN)) {\n BYTE_ALIGN(bs);\n if (nf_h323_error_boundary(bs, len, 0)) /* len is 0 here */\n return H323_ERROR_BOUND;\n len = get_len(bs); /* OOB read */\n\nWhen the bitstream is exactly consumed (bs-\u0026gt;cur == bs-\u0026gt;end), the check\nnf_h323_error_boundary(bs, 0, 0) evaluates to (bs-\u0026gt;cur + 0 \u0026gt; bs-\u0026gt;end),\nwhich is false. The subsequent get_len() call then dereferences\n*bs-\u0026gt;cur++, reading 1 byte past the end of the buffer. If that byte\nhas bit 7 set, get_len() reads a second byte as well.\n\nThis can be triggered remotely by sending a crafted Q.931 SETUP message\nwith a User-User Information Element containing exactly 2 bytes of\nPER-encoded data ({0x08, 0x00}) to port 1720 through a firewall with\nthe nf_conntrack_h323 helper active. The decoder fully consumes the\nPER buffer before reaching this code path, resulting in a 1-2 byte\nheap-buffer-overflow read confirmed by AddressSanitizer.\n\nFix this by checking for 2 bytes (the maximum that get_len() may read)\ninstead of the uninitialized `len`. This matches the pattern used at\nevery other get_len() call site in the same file, where the caller\nchecks for 2 bytes of available data before calling get_len().(CVE-2026-43233)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/amd: move wait_on_sem() out of spinlock\n\nWith iommu.strict=1, the existing completion wait path can cause soft\nlockups under stressed environment, as wait_on_sem() busy-waits under the\nspinlock with interrupts disabled.\n\nMove the completion wait in iommu_completion_wait() out of the spinlock.\nwait_on_sem() only polls the hardware-updated cmd_sem and does not require\niommu-\u0026gt;lock, so holding the lock during the busy wait unnecessarily\nincreases contention and extends the time with interrupts disabled.(CVE-2026-43253)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nspi: spidev: fix lock inversion between spi_lock and buf_lock\n\nThe spidev driver previously used two mutexes, spi_lock and buf_lock,\nbut acquired them in different orders depending on the code path:\n\n write()/read(): buf_lock -\u0026gt; spi_lock\n ioctl(): spi_lock -\u0026gt; buf_lock\n\nThis AB-BA locking pattern triggers lockdep warnings and can\ncause real deadlocks:\n\n WARNING: possible circular locking dependency detected\n spidev_ioctl() -\u0026gt; mutex_lock(\u0026amp;spidev-\u0026gt;buf_lock)\n spidev_sync_write() -\u0026gt; mutex_lock(\u0026amp;spidev-\u0026gt;spi_lock)\n *** DEADLOCK ***\n\nThe issue is reproducible with a simple userspace program that\nperforms write() and SPI_IOC_WR_MAX_SPEED_HZ ioctl() calls from\nseparate threads on the same spidev file descriptor.\n\nFix this by simplifying the locking model and removing the lock\ninversion entirely. spidev_sync() no longer performs any locking,\nand all callers serialize access using spi_lock.\n\nbuf_lock is removed since its functionality is fully covered by\nspi_lock, eliminating the possibility of lock ordering issues.\n\nThis removes the lock inversion and prevents deadlocks without\nchanging userspace ABI or behaviour.(CVE-2026-43319)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipv6: prevent possible UaF in addrconf_permanent_addr()\n\nThe mentioned helper try to warn the user about an exceptional\ncondition, but the message is delivered too late, accessing the ipv6\nafter its possible deletion.\n\nReorder the statement to avoid the possible UaF; while at it, place the\nwarning outside the idev-\u0026gt;lock as it needs no protection.(CVE-2026-43339)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/tcp-md5: Fix MAC comparison to be constant-time\n\nTo prevent timing attacks, MACs need to be compared in constant\ntime. Use the appropriate helper function for this.(CVE-2026-43383)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: nfnetlink_cthelper: fix OOB read in nfnl_cthelper_dump_table()\n\nnfnl_cthelper_dump_table() has a \u0026apos;goto restart\u0026apos; that jumps to a label\ninside the for loop body. When the \u0026quot;last\u0026quot; helper saved in cb-\u0026gt;args[1]\nis deleted between dump rounds, every entry fails the (cur != last)\ncheck, so cb-\u0026gt;args[1] is never cleared. The for loop finishes with\ncb-\u0026gt;args[0] == nf_ct_helper_hsize, and the \u0026apos;goto restart\u0026apos; jumps back\ninto the loop body bypassing the bounds check, causing an 8-byte\nout-of-bounds read on nf_ct_helper_hash[nf_ct_helper_hsize].\n\nThe \u0026apos;goto restart\u0026apos; block was meant to re-traverse the current bucket\nwhen \u0026quot;last\u0026quot; is no longer found, but it was placed after the for loop\ninstead of inside it. Move the block into the for loop body so that\nthe restart only occurs while cb-\u0026gt;args[0] is still within bounds.\n\n BUG: KASAN: slab-out-of-bounds in nfnl_cthelper_dump_table+0x9f/0x1b0\n Read of size 8 at addr ffff888104ca3000 by task poc_cthelper/131\n Call Trace:\n nfnl_cthelper_dump_table+0x9f/0x1b0\n netlink_dump+0x333/0x880\n netlink_recvmsg+0x3e2/0x4b0\n sock_recvmsg+0xde/0xf0\n __sys_recvfrom+0x150/0x200\n __x64_sys_recvfrom+0x76/0x90\n do_syscall_64+0xc3/0x6e0\n\n Allocated by task 1:\n __kvmalloc_node_noprof+0x21b/0x700\n nf_ct_alloc_hashtable+0x65/0xd0\n nf_conntrack_helper_init+0x21/0x60\n nf_conntrack_init_start+0x18d/0x300\n nf_conntrack_standalone_init+0x12/0xc0(CVE-2026-43450)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: x_tables: guard option walkers against 1-byte tail reads\n\nWhen the last byte of options is a non-single-byte option kind, walkers\nthat advance with i += op[i + 1] ? : 1 can read op[i + 1] past the end\nof the option area.\n\nAdd an explicit i == optlen - 1 check before dereferencing op[i + 1]\nin xt_tcpudp and xt_dccp option walkers.(CVE-2026-43452)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: nft_set_pipapo: fix stack out-of-bounds read in pipapo_drop()\n\npipapo_drop() passes rulemap[i + 1].n to pipapo_unmap() as the\nto_offset argument on every iteration, including the last one where\ni == m-\u0026gt;field_count - 1. This reads one element past the end of the\nstack-allocated rulemap array (declared as rulemap[NFT_PIPAPO_MAX_FIELDS]\nwith NFT_PIPAPO_MAX_FIELDS == 16).\n\nAlthough pipapo_unmap() returns early when is_last is true without\nusing the to_offset value, the argument is evaluated at the call site\nbefore the function body executes, making this a genuine out-of-bounds\nstack read confirmed by KASAN:\n\n BUG: KASAN: stack-out-of-bounds in pipapo_drop+0x50c/0x57c [nf_tables]\n Read of size 4 at addr ffff8000810e71a4\n\n This frame has 1 object:\n [32, 160) \u0026apos;rulemap\u0026apos;\n\n The buggy address is at offset 164 -- exactly 4 bytes past the end\n of the rulemap array.\n\nPass 0 instead of rulemap[i + 1].n on the last iteration to avoid\nthe out-of-bounds read.(CVE-2026-43453)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nrtmutex: Use waiter::task instead of current in remove_waiter()\n\nremove_waiter() is used by the slowlock paths, but it is also used for\nproxy-lock rollback in rt_mutex_start_proxy_lock() when invoked from\nfutex_requeue().\n\nIn the latter case waiter::task is not current, but remove_waiter()\noperates on current for the dequeue operation. That results in several\nproblems:\n\n 1) the rbtree dequeue happens without waiter::task::pi_lock being held\n\n 2) the waiter task\u0026apos;s pi_blocked_on state is not cleared, which leaves a\n dangling pointer primed for UAF around.\n\n 3) rt_mutex_adjust_prio_chain() operates on the wrong top priority waiter\n task\n\nUse waiter::task instead of current in all related operations in\nremove_waiter() to cure those problems.\n\n[ tglx: Fixup rt_mutex_adjust_prio_chain(), add a comment and amend the\n \tchangelog ](CVE-2026-43499)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nopenvswitch: cap upcall PID array size and pre-size vport replies\n\nThe vport netlink reply helpers allocate a fixed-size skb with\nnlmsg_new(NLMSG_DEFAULT_SIZE, ...) but serialize the full upcall PID\narray via ovs_vport_get_upcall_portids(). Since\novs_vport_set_upcall_portids() accepts any non-zero multiple of\nsizeof(u32) with no upper bound, a CAP_NET_ADMIN user can install a PID\narray large enough to overflow the reply buffer, causing nla_put() to\nfail with -EMSGSIZE and hitting BUG_ON(err \u0026lt; 0). On systems with\nunprivileged user namespaces enabled (e.g., Ubuntu default), this is\nreachable via unshare -Urn since OVS vport mutation operations use\nGENL_UNS_ADMIN_PERM.\n\n kernel BUG at net/openvswitch/datapath.c:2414!\n Oops: invalid opcode: 0000 [#1] SMP KASAN NOPTI\n CPU: 1 UID: 0 PID: 65 Comm: poc Not tainted 7.0.0-rc7-00195-geb216e422044 #1\n RIP: 0010:ovs_vport_cmd_set+0x34c/0x400\n Call Trace:\n \u0026lt;TASK\u0026gt;\n genl_family_rcv_msg_doit (net/netlink/genetlink.c:1116)\n genl_rcv_msg (net/netlink/genetlink.c:1194)\n netlink_rcv_skb (net/netlink/af_netlink.c:2550)\n genl_rcv (net/netlink/genetlink.c:1219)\n netlink_unicast (net/netlink/af_netlink.c:1344)\n netlink_sendmsg (net/netlink/af_netlink.c:1894)\n __sys_sendto (net/socket.c:2206)\n __x64_sys_sendto (net/socket.c:2209)\n do_syscall_64 (arch/x86/entry/syscall_64.c:63)\n entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\n \u0026lt;/TASK\u0026gt;\n Kernel panic - not syncing: Fatal exception\n\nReject attempts to set more PIDs than nr_cpu_ids in\novs_vport_set_upcall_portids(), and pre-compute the worst-case reply\nsize in ovs_vport_cmd_msg_size() based on that bound, similar to the\nexisting ovs_dp_cmd_msg_size(). nr_cpu_ids matches the cap already\nused by the per-CPU dispatch configuration on the datapath side\n(ovs_dp_cmd_fill_info() serialises at most nr_cpu_ids PIDs), so the\ntwo sides stay consistent.(CVE-2026-45840)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nslip: bound decode() reads against the compressed packet length\n\nslhc_uncompress() parses a VJ-compressed TCP header by advancing a\npointer through the packet via decode() and pull16(). Neither helper\nbounds-checks against isize, and decode() masks its return with\n\u0026amp; 0xffff so it can never return the -1 that callers test for -- those\nerror paths are dead code.\n\nA short compressed frame whose change byte requests optional fields\nlets decode() read past the end of the packet. The over-read bytes\nare folded into the cached cstate and reflected into subsequent\nreconstructed packets.\n\nMake decode() and pull16() take the packet end pointer and return -1\nwhen exhausted. Add a bounds check before the TCP-checksum read.\nThe existing == -1 tests now do what they were always meant to.(CVE-2026-45843)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/rxe: Fix double free in rxe_srq_from_init\n\nIn rxe_srq_from_init(), the queue pointer \u0026apos;q\u0026apos; is assigned to\n\u0026apos;srq-\u0026gt;rq.queue\u0026apos; before copying the SRQ number to user space.\nIf copy_to_user() fails, the function calls rxe_queue_cleanup()\nto free the queue, but leaves the now-invalid pointer in\n\u0026apos;srq-\u0026gt;rq.queue\u0026apos;.\n\nThe caller of rxe_srq_from_init() (rxe_create_srq) eventually\ncalls rxe_srq_cleanup() upon receiving the error, which triggers\na second rxe_queue_cleanup() on the same memory, leading to a\ndouble free.\n\nThe call trace looks like this:\n kmem_cache_free+0x.../0x...\n rxe_queue_cleanup+0x1a/0x30 [rdma_rxe]\n rxe_srq_cleanup+0x42/0x60 [rdma_rxe]\n rxe_elem_release+0x31/0x70 [rdma_rxe]\n rxe_create_srq+0x12b/0x1a0 [rdma_rxe]\n ib_create_srq_user+0x9a/0x150 [ib_core]\n\nFix this by moving \u0026apos;srq-\u0026gt;rq.queue = q\u0026apos; after copy_to_user.(CVE-2026-45852)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/vt-d: Flush cache for PASID table before using it\n\nWhen writing the address of a freshly allocated zero-initialized PASID\ntable to a PASID directory entry, do that after the CPU cache flush for\nthis PASID table, not before it, to avoid the time window when this\nPASID table may be already used by non-coherent IOMMU hardware while\nits contents in RAM is still some random old data, not zero-initialized.(CVE-2026-45862)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/vt-d: Clear Present bit before tearing down PASID entry\n\nThe Intel VT-d Scalable Mode PASID table entry consists of 512 bits (64\nbytes). When tearing down an entry, the current implementation zeros the\nentire 64-byte structure immediately using multiple 64-bit writes.\n\nSince the IOMMU hardware may fetch these 64 bytes using multiple\ninternal transactions (e.g., four 128-bit bursts), updating or zeroing\nthe entire entry while it is active (P=1) risks a \u0026quot;torn\u0026quot; read. If a\nhardware fetch occurs simultaneously with the CPU zeroing the entry, the\nhardware could observe an inconsistent state, leading to unpredictable\nbehavior or spurious faults.\n\nFollow the \u0026quot;Guidance to Software for Invalidations\u0026quot; in the VT-d spec\n(Section 6.5.3.3) by implementing the recommended ownership handshake:\n\n1. Clear only the \u0026apos;Present\u0026apos; (P) bit of the PASID entry.\n2. Use a dma_wmb() to ensure the cleared bit is visible to hardware\n before proceeding.\n3. Execute the required invalidation sequence (PASID cache, IOTLB, and\n Device-TLB flush) to ensure the hardware has released all cached\n references.\n4. Only after the flushes are complete, zero out the remaining fields\n of the PASID entry.\n\nAlso, add a dma_wmb() in pasid_set_present() to ensure that all other\nfields of the PASID entry are visible to the hardware before the Present\nbit is set.(CVE-2026-45894)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm: fix ip_rt_bug race in icmp_route_lookup reverse path\n\nicmp_route_lookup() performs multiple route lookups to find a suitable\nroute for sending ICMP error messages, with special handling for XFRM\n(IPsec) policies.\n\nThe lookup sequence is:\n1. First, lookup output route for ICMP reply (dst = original src)\n2. Pass through xfrm_lookup() for policy check\n3. If blocked (-EPERM) or dst is not local, enter \u0026quot;reverse path\u0026quot;\n4. In reverse path, call xfrm_decode_session_reverse() to get fl4_dec\n which reverses the original packet\u0026apos;s flow (saddr\u0026lt;-\u0026gt;daddr swapped)\n5. If fl4_dec.saddr is local (we are the original destination), use\n __ip_route_output_key() for output route lookup\n6. If fl4_dec.saddr is NOT local (we are a forwarding node), use\n ip_route_input() to simulate the reverse packet\u0026apos;s input path\n7. Finally, pass rt2 through xfrm_lookup() with XFRM_LOOKUP_ICMP flag\n\nThe bug occurs in step 6: ip_route_input() is called with fl4_dec.daddr\n(original packet\u0026apos;s source) as destination. If this address becomes local\nbetween the initial check and ip_route_input() call (e.g., due to\nconcurrent \u0026quot;ip addr add\u0026quot;), ip_route_input() returns a LOCAL route with\ndst.output set to ip_rt_bug.\n\nThis route is then used for ICMP output, causing dst_output() to call\nip_rt_bug(), triggering a WARN_ON:\n\n ------------[ cut here ]------------\n WARNING: net/ipv4/route.c:1275 at ip_rt_bug+0x21/0x30, CPU#1\n Call Trace:\n \u0026lt;TASK\u0026gt;\n ip_push_pending_frames+0x202/0x240\n icmp_push_reply+0x30d/0x430\n __icmp_send+0x1149/0x24f0\n ip_options_compile+0xa2/0xd0\n ip_rcv_finish_core+0x829/0x1950\n ip_rcv+0x2d7/0x420\n __netif_receive_skb_one_core+0x185/0x1f0\n netif_receive_skb+0x90/0x450\n tun_get_user+0x3413/0x3fb0\n tun_chr_write_iter+0xe4/0x220\n ...\n\nFix this by checking rt2-\u0026gt;rt_type after ip_route_input(). If it\u0026apos;s\nRTN_LOCAL, the route cannot be used for output, so treat it as an error.\n\nThe reproducer requires kernel modification to widen the race window,\nmaking it unsuitable as a selftest. It is available at:\n\n https://gist.github.com/mrpre/eae853b72ac6a750f5d45d64ddac1e81(CVE-2026-45905)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRevert \u0026quot;hwmon: (ibmpex) fix use-after-free in high/low store\u0026quot;\n\nThis reverts commit 6946c726c3f4c36f0f049e6f97e88c510b15f65d.\n\nJean Delvare points out that the patch does not completely\nfix the reported problem, that it in fact introduces a\n(new) race condition, and that it may actually not be needed in\nthe first place.\n\nVarious AI reviews agree. Specific and relevant AI feedback:\n\n\u0026quot;\nThis reordering sets the driver data to NULL before removing the sensor\nattributes in the loop below.\n\nibmpex_show_sensor() retrieves this driver data via dev_get_drvdata() but\ndoes not check if it is NULL before dereferencing it to access\ndata-\u0026gt;sensors[].\n\nIf a userspace process reads a sensor file (like temp1_input) while this\ndelete function is running, could it race with the dev_set_drvdata(...,\nNULL) call here and crash in ibmpex_show_sensor()?\n\nWould it be safer to keep the original order where device_remove_file() is\ncalled before clearing the driver data? device_remove_file() should wait\nfor any active sysfs callbacks to complete, which might already prevent the\nuse-after-free this patch intends to fix.\n\u0026quot;\n\nRevert the offending patch. If it can be shown that the originally reported\nalleged race condition does indeed exist, it can always be re-introduced\nwith a complete fix.(CVE-2026-45914)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfat: avoid parent link count underflow in rmdir\n\nCorrupted FAT images can leave a directory inode with an incorrect\ni_nlink (e.g. 2 even though subdirectories exist). rmdir then\nunconditionally calls drop_nlink(dir) and can drive i_nlink to 0,\ntriggering the WARN_ON in drop_nlink().\n\nAdd a sanity check in vfat_rmdir() and msdos_rmdir(): only drop the\nparent link count when it is at least 3, otherwise report a filesystem\nerror.(CVE-2026-45915)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsched/rt: Skip currently executing CPU in rto_next_cpu()\n\nCPU0 becomes overloaded when hosting a CPU-bound RT task, a non-CPU-bound\nRT task, and a CFS task stuck in kernel space. When other CPUs switch from\nRT to non-RT tasks, RT load balancing (LB) is triggered; with\nHAVE_RT_PUSH_IPI enabled, they send IPIs to CPU0 to drive the execution\nof rto_push_irq_work_func. During push_rt_task on CPU0,\nif next_task-\u0026gt;prio \u0026lt; rq-\u0026gt;donor-\u0026gt;prio, resched_curr() sets NEED_RESCHED\nand after the push operation completes, CPU0 calls rto_next_cpu().\nSince only CPU0 is overloaded in this scenario, rto_next_cpu() should\nideally return -1 (no further IPI needed).\n\nHowever, multiple CPUs invoking tell_cpu_to_push() during LB increments\nrd-\u0026gt;rto_loop_next. Even when rd-\u0026gt;rto_cpu is set to -1, the mismatch between\nrd-\u0026gt;rto_loop and rd-\u0026gt;rto_loop_next forces rto_next_cpu() to restart its\nsearch from -1. With CPU0 remaining overloaded (satisfying rt_nr_migratory\n\u0026amp;\u0026amp; rt_nr_total \u0026gt; 1), it gets reselected, causing CPU0 to queue irq_work to\nitself and send self-IPIs repeatedly. As long as CPU0 stays overloaded and\nother CPUs run pull_rt_tasks(), it falls into an infinite self-IPI loop,\nwhich triggers a CPU hardlockup due to continuous self-interrupts.\n\nThe trigging scenario is as follows:\n\n cpu0 cpu1 cpu2\n pull_rt_task\n tell_cpu_to_push\n \u0026lt;------------irq_work_queue_on\nrto_push_irq_work_func\n push_rt_task\n resched_curr(rq) pull_rt_task\n rto_next_cpu tell_cpu_to_push\n \u0026lt;-------------------------- atomic_inc(rto_loop_next)\nrd-\u0026gt;rto_loop != next\n rto_next_cpu\n irq_work_queue_on\nrto_push_irq_work_func\n\nFix redundant self-IPI by filtering the initiating CPU in rto_next_cpu().\nThis solution has been verified to effectively eliminate spurious self-IPIs\nand prevent CPU hardlockup scenarios.(CVE-2026-45919)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\next4: fix dirtyclusters double decrement on fs shutdown\n\nfstests test generic/388 occasionally reproduces a warning in\next4_put_super() associated with the dirty clusters count:\n\n WARNING: CPU: 7 PID: 76064 at fs/ext4/super.c:1324 ext4_put_super+0x48c/0x590 [ext4]\n\nTracing the failure shows that the warning fires due to an\ns_dirtyclusters_counter value of -1. IOW, this appears to be a\nspurious decrement as opposed to some sort of leak. Further tracing\nof the dirty cluster count deltas and an LLM scan of the resulting\noutput identified the cause as a double decrement in the error path\nbetween ext4_mb_mark_diskspace_used() and the caller\next4_mb_new_blocks().\n\nFirst, note that generic/388 is a shutdown vs. fsstress test and so\nproduces a random set of operations and shutdown injections. In the\nproblematic case, the shutdown triggers an error return from the\next4_handle_dirty_metadata() call(s) made from\next4_mb_mark_context(). The changed value is non-zero at this point,\nso ext4_mb_mark_diskspace_used() does not exit after the error\nbubbles up from ext4_mb_mark_context(). Instead, the former\ndecrements both cluster counters and returns the error up to\next4_mb_new_blocks(). The latter falls into the !ar-\u0026gt;len out path\nwhich decrements the dirty clusters counter a second time, creating\nthe inconsistency.\n\nTo avoid this problem and simplify ownership of the cluster\nreservation in this codepath, lift the counter reduction to a single\nplace in the caller. This makes it more clear that\next4_mb_new_blocks() is responsible for acquiring cluster\nreservation (via ext4_claim_free_clusters()) in the !delalloc case\nas well as releasing it, regardless of whether it ends up consumed\nor returned due to failure.(CVE-2026-45920)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfs/ntfs3: Fix slab-out-of-bounds read in DeleteIndexEntryRoot\n\nIn the \u0026apos;DeleteIndexEntryRoot\u0026apos; case of the \u0026apos;do_action\u0026apos; function, the\nentry size (\u0026apos;esize\u0026apos;) is retrieved from the log record without adequate\nbounds checking.\n\nSpecifically, the code calculates the end of the entry (\u0026apos;e2\u0026apos;) using:\n e2 = Add2Ptr(e1, esize);\n\nIt then calculates the size for memmove using \u0026apos;PtrOffset(e2, ...)\u0026apos;,\nwhich subtracts the end pointer from the buffer limit. If \u0026apos;esize\u0026apos; is\nmaliciously large, \u0026apos;e2\u0026apos; exceeds the used buffer size. This results in\na negative offset which, when cast to size_t for memmove, interprets\nas a massive unsigned integer, leading to a heap buffer overflow.\n\nThis commit adds a check to ensure that the entry size (\u0026apos;esize\u0026apos;) strictly\nfits within the remaining used space of the index header before performing\nmemory operations.(CVE-2026-45935)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/vt-d: Clear Present bit before tearing down context entry\n\nWhen tearing down a context entry, the current implementation zeros the\nentire 128-bit entry using multiple 64-bit writes. This creates a window\nwhere the hardware can fetch a \u0026quot;torn\u0026quot; entry \u2014 where some fields are\nalready zeroed while the \u0026apos;Present\u0026apos; bit is still set \u2014 leading to\nunpredictable behavior or spurious faults.\n\nWhile x86 provides strong write ordering, the compiler may reorder writes\nto the two 64-bit halves of the context entry. Even without compiler\nreordering, the hardware fetch is not guaranteed to be atomic with\nrespect to multiple CPU writes.\n\nAlign with the \u0026quot;Guidance to Software for Invalidations\u0026quot; in the VT-d spec\n(Section 6.5.3.3) by implementing the recommended ownership handshake:\n\n1. Clear only the \u0026apos;Present\u0026apos; (P) bit of the context entry first to\n signal the transition of ownership from hardware to software.\n2. Use dma_wmb() to ensure the cleared bit is visible to the IOMMU.\n3. Perform the required cache and context-cache invalidation to ensure\n hardware no longer has cached references to the entry.\n4. Fully zero out the entry only after the invalidation is complete.\n\nAlso, add a dma_wmb() to context_set_present() to ensure the entry\nis fully initialized before the \u0026apos;Present\u0026apos; bit becomes visible.(CVE-2026-45944)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\next4: fix memory leak in ext4_ext_shift_extents()\n\nIn ext4_ext_shift_extents(), if the extent is NULL in the while loop, the\nfunction returns immediately without releasing the path obtained via\next4_find_extent(), leading to a memory leak.\n\nFix this by jumping to the out label to ensure the path is properly\nreleased.(CVE-2026-45948)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnfsd: never defer requests during idmap lookup\n\nDuring v4 request compound arg decoding, some ops (e.g. SETATTR)\ncan trigger idmap lookup upcalls. When those upcall responses get\ndelayed beyond the allowed time limit, cache_check() will mark the\nrequest for deferral and cause it to be dropped.\n\nThis prevents nfs4svc_encode_compoundres from being executed, and\nthus the session slot flag NFSD4_SLOT_INUSE never gets cleared.\nSubsequent client requests will fail with NFSERR_JUKEBOX, given\nthat the slot will be marked as in-use, making the SEQUENCE op\nfail.\n\nFix this by making sure that the RQ_USEDEFERRAL flag is always\nclear during nfs4svc_decode_compoundargs(), since no v4 request\nshould ever be deferred.(CVE-2026-45983)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\next4: don\u0026apos;t set EXT4_GET_BLOCKS_CONVERT when splitting before submitting I/O\n\nWhen allocating blocks during within-EOF DIO and writeback with\ndioread_nolock enabled, EXT4_GET_BLOCKS_PRE_IO was set to split an\nexisting large unwritten extent. However, EXT4_GET_BLOCKS_CONVERT was\nset when calling ext4_split_convert_extents(), which may potentially\nresult in stale data issues.\n\nAssume we have an unwritten extent, and then DIO writes the second half.\n\n [UUUUUUUUUUUUUUUU] on-disk extent U: unwritten extent\n [UUUUUUUUUUUUUUUU] extent status tree\n |\u0026lt;- -\u0026gt;| ----\u0026gt; dio write this range\n\nFirst, ext4_iomap_alloc() call ext4_map_blocks() with\nEXT4_GET_BLOCKS_PRE_IO, EXT4_GET_BLOCKS_UNWRIT_EXT and\nEXT4_GET_BLOCKS_CREATE flags set. ext4_map_blocks() find this extent and\ncall ext4_split_convert_extents() with EXT4_GET_BLOCKS_CONVERT and the\nabove flags set.\n\nThen, ext4_split_convert_extents() calls ext4_split_extent() with\nEXT4_EXT_MAY_ZEROOUT, EXT4_EXT_MARK_UNWRIT2 and EXT4_EXT_DATA_VALID2\nflags set, and it calls ext4_split_extent_at() to split the second half\nwith EXT4_EXT_DATA_VALID2, EXT4_EXT_MARK_UNWRIT1, EXT4_EXT_MAY_ZEROOUT\nand EXT4_EXT_MARK_UNWRIT2 flags set. However, ext4_split_extent_at()\nfailed to insert extent since a temporary lack -ENOSPC. It zeroes out\nthe first half but convert the entire on-disk extent to written since\nthe EXT4_EXT_DATA_VALID2 flag set, but left the second half as unwritten\nin the extent status tree.\n\n [0000000000SSSSSS] data S: stale data, 0: zeroed\n [WWWWWWWWWWWWWWWW] on-disk extent W: written extent\n [WWWWWWWWWWUUUUUU] extent status tree\n\nFinally, if the DIO failed to write data to the disk, the stale data in\nthe second half will be exposed once the cached extent entry is gone.\n\nFix this issue by not passing EXT4_GET_BLOCKS_CONVERT when splitting\nan unwritten extent before submitting I/O, and make\next4_split_convert_extents() to zero out the entire extent range\nto zero for this case, and also mark the extent in the extent status\ntree for consistency.(CVE-2026-45985)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nKVM: nSVM: Sync interrupt shadow to cached vmcb12 after VMRUN of L2\n\nAfter VMRUN in guest mode, nested_sync_control_from_vmcb02() syncs\nfields written by the CPU from vmcb02 to the cached vmcb12. This is\nbecause the cached vmcb12 is used as the authoritative copy of some of\nthe controls, and is the payload when saving/restoring nested state.\n\nint_state is also written by the CPU, specifically bit 0 (i.e.\nSVM_INTERRUPT_SHADOW_MASK) for nested VMs, but it is not sync\u0026apos;d to\ncached vmcb12. This does not cause a problem if KVM_SET_NESTED_STATE\npreceeds KVM_SET_VCPU_EVENTS in the restore path, as an interrupt shadow\nwould be correctly restored to vmcb02 (KVM_SET_VCPU_EVENTS overwrites\nwhat KVM_SET_NESTED_STATE restored in int_state).\n\nHowever, if KVM_SET_VCPU_EVENTS preceeds KVM_SET_NESTED_STATE, an\ninterrupt shadow would be restored into vmcb01 instead of vmcb02. This\nwould mostly be benign for L1 (delays an interrupt), but not for L2. For\nL2, the vCPU could hang (e.g. if a wakeup interrupt is delivered before\na HLT that should have been in an interrupt shadow).\n\nSync int_state to the cached vmcb12 in nested_sync_control_from_vmcb02()\nto avoid this problem. With that, KVM_SET_NESTED_STATE restores the\ncorrect interrupt shadow state, and if KVM_SET_VCPU_EVENTS follows it\nwould overwrite it with the same value.(CVE-2026-45987)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nudf: fix partition descriptor append bookkeeping\n\nMounting a crafted UDF image with repeated partition descriptors can\ntrigger a heap out-of-bounds write in part_descs_loc[].\n\nhandle_partition_descriptor() deduplicates entries by partition number,\nbut appended slots never record partnum. As a result duplicate\nPartition Descriptors are appended repeatedly and num_part_descs keeps\ngrowing.\n\nOnce the table is full, the growth path still sizes the allocation from\npartnum even though inserts are indexed by num_part_descs. If partnum is\nalready aligned to PART_DESC_ALLOC_STEP, ALIGN(partnum, step) can keep\nthe old capacity and the next append writes past the end of the table.\n\nStore partnum in the appended slot and size growth from the next append\ncount so deduplication and capacity tracking follow the same model.(CVE-2026-45991)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nALSA: usb-audio: stop parsing UAC2 rates at MAX_NR_RATES\n\nparse_uac2_sample_rate_range() caps the number of enumerated\nrates at MAX_NR_RATES, but it only breaks out of the current\nrate loop. A malformed UAC2 RANGE response with additional\ntriplets continues parsing the remaining triplets and repeatedly\nprints \u0026quot;invalid uac2 rates\u0026quot; while probe still holds\nregister_mutex.\n\nStop the whole parse once the cap is reached and return the\nnumber of rates collected so far.(CVE-2026-46018)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndm mirror: fix integer overflow in create_dirty_log()\n\nThe argument count calculation in create_dirty_log() performs\n`*args_used = 2 + param_count` before validating against argc. When a\nuser provides a param_count close to UINT_MAX via the device mapper\ntable string, this unsigned addition wraps around to a small value,\ncausing the subsequent `argc \u0026lt; *args_used` check to be bypassed.\n\nThe overflowed param_count is then passed as argc to dm_dirty_log_create(),\nwhere it can cause out-of-bounds reads on the argv array.\n\nFix by comparing param_count against argc - 2 before performing the\naddition, following the same pattern used by parse_features() in the\nsame file. Since argc \u0026gt;= 2 is already guaranteed, the subtraction is\nsafe.(CVE-2026-46023)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: algif_aead - snapshot IV for async AEAD requests\n\nAF_ALG AEAD AIO requests currently use the socket-wide IV buffer during\nrequest processing. For async requests, later socket activity can\nupdate that shared state before the original request has fully\ncompleted, which can lead to inconsistent IV handling.\n\nSnapshot the IV into per-request storage when preparing the AEAD\nrequest, so in-flight operations no longer depend on mutable socket\nstate.(CVE-2026-46028)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nKVM: nSVM: Triple fault if restore host CR3 fails on nested #VMEXIT\n\nIf loading L1\u0026apos;s CR3 fails on a nested #VMEXIT, nested_svm_vmexit()\nreturns an error code that is ignored by most callers, and continues to\nrun L1 with corrupted state. A sane recovery is not possible in this\ncase, and HW behavior is to cause a shutdown. Inject a triple fault\ninstead, and do not return early from nested_svm_vmexit(). Continue\ncleaning up the vCPU state (e.g. clear pending exceptions), to handle\nthe failure as gracefully as possible.\n\nFrom the APM:\n\n Upon #VMEXIT, the processor performs the following actions in order to\n return to the host execution context:\n\n ...\n\n if (illegal host state loaded, or exception while loading host state)\n shutdown\n else\n execute first host instruction following the VMRUN\n\nRemove the return value of nested_svm_vmexit(), which is mostly\nunchecked anyway.(CVE-2026-46032)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/rxe: Validate pad and ICRC before payload_size() in rxe_rcv\n\nrxe_rcv() currently checks only that the incoming packet is at least\nheader_size(pkt) bytes long before payload_size() is used.\n\nHowever, payload_size() subtracts both the attacker-controlled BTH pad\nfield and RXE_ICRC_SIZE from pkt-\u0026gt;paylen:\n\n payload_size = pkt-\u0026gt;paylen - offset[RXE_PAYLOAD] - bth_pad(pkt)\n - RXE_ICRC_SIZE\n\nThis means a short packet can still make payload_size() underflow even\nif it includes enough bytes for the fixed headers. Simply requiring\nheader_size(pkt) + RXE_ICRC_SIZE is not sufficient either, because a\npacket with a forged non-zero BTH pad can still leave payload_size()\nnegative and pass an underflowed value to later receive-path users.\n\nFix this by validating pkt-\u0026gt;paylen against the full minimum length\nrequired by payload_size(): header_size(pkt) + bth_pad(pkt) +\nRXE_ICRC_SIZE.(CVE-2026-46043)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nALSA: ctxfi: Add fallback to default RSR for S/PDIF\n\nspdif_passthru_playback_get_resources() uses atc-\u0026gt;pll_rate as the RSR\nfor the MSR calculation loop. However, pll_rate is only updated in\natc_pll_init() and not in hw_pll_init(), so it remains 0 after the\ncard init.\n\nWhen spdif_passthru_playback_setup() skips atc_pll_init() for\n32000 Hz, (rsr * desc.msr) always becomes 0, causing the loop to spin\nindefinitely.\n\nAdd fallback to use atc-\u0026gt;rsr when atc-\u0026gt;pll_rate is 0. This reflects\nthe hardware state, since hw_card_init() already configures the PLL\nto the default RSR.(CVE-2026-46049)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBluetooth: hci_event: fix potential UAF in SSP passkey handlers\n\nhci_conn lookup and field access must be covered by hdev lock in\nhci_user_passkey_notify_evt() and hci_keypress_notify_evt(), otherwise\nthe connection can be freed concurrently.\n\nExtend the hci_dev_lock critical section to cover all conn usage in both\nhandlers.\n\nKeep the existing keypress notification behavior unchanged by routing\nthe early exits through a common unlock path.(CVE-2026-46056)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfbdev: defio: Disconnect deferred I/O from the lifetime of struct fb_info\n\nHold state of deferred I/O in struct fb_deferred_io_state. Allocate an\ninstance as part of initializing deferred I/O and remove it only after\nthe final mapping has been closed. If the fb_info and the contained\ndeferred I/O meanwhile goes away, clear struct fb_deferred_io_state.info\nto invalidate the mapping. Any access will then result in a SIGBUS\nsignal.\n\nFixes a long-standing problem, where a device hot-unplug happens while\nuser space still has an active mapping of the graphics memory. The hot-\nunplug frees the instance of struct fb_info. Accessing the memory will\noperate on undefined state.(CVE-2026-46065)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nspi: fix resource leaks on device setup failure\n\nMake sure to call controller cleanup() if spi_setup() fails while\nregistering a device to avoid leaking any resources allocated by\nsetup().(CVE-2026-46083)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nALSA: control: Validate buf_len before strnlen() in snd_ctl_elem_init_enum_names()\n\nsnd_ctl_elem_init_enum_names() advances pointer p through the names\nbuffer while decrementing buf_len. If buf_len reaches zero but items\nremain, the next iteration calls strnlen(p, 0).\n\nWhile strnlen(p, 0) returns 0 and would hit the existing name_len == 0\nerror path, CONFIG_FORTIFY_SOURCE\u0026apos;s fortified strnlen() first checks\nmaxlen against __builtin_dynamic_object_size(). When Clang loses track\nof p\u0026apos;s object size inside the loop, this triggers a BRK exception panic\nbefore the return value is examined.\n\nAdd a buf_len == 0 guard at the loop entry to prevent calling fortified\nstrnlen() on an exhausted buffer.\n\nFound by kernel fuzz testing through Xiaomi Smartphone.(CVE-2026-46088)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: reject zero shift in nft_bitwise\n\nReject zero shift operands for nft_bitwise left and right shift\nexpressions during initialization.\n\nThe carry propagation logic computes the carry from the adjacent 32-bit\nword using BITS_PER_TYPE(u32) - shift. A zero shift operand turns this\ninto a 32-bit shift, which is undefined behaviour.\n\nReject zero shift operands in the control plane, alongside the existing\ncheck for values greater than or equal to 32, so malformed rules never\nreach the packet path.(CVE-2026-46101)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: strparser: fix skb_head leak in strp_abort_strp()\n\nWhen the stream parser is aborted, for example after a message assembly timeout,\nit can still hold a reference to a partially assembled message in\nstrp-\u0026gt;skb_head.\n\nThat skb is not released in strp_abort_strp(), which leaks the partially\nassembled message and can be triggered repeatedly to exhaust memory.\n\nFix this by freeing strp-\u0026gt;skb_head and resetting the parser state in the\nabort path. Leave strp_stop() unchanged so final cleanup still happens in\nstrp_done() after the work and timer have been synchronized.(CVE-2026-46102)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndm-thin: fix metadata refcount underflow\n\nThere\u0026apos;s a bug in dm-thin in the function rebalance_children. If the\ninternal btree node has one entry, the code tries to copy all btree\nentries from the node\u0026apos;s child to the node itself and then decrement the\nchild\u0026apos;s reference count.\n\nIf the child node is shared (it has reference count \u0026gt; 1), we won\u0026apos;t free\nit, so there would be two pointers to each of the grandchildren nodes.\nBut the reference counts of the grandchildren is not increased, thus the\nreference count doesn\u0026apos;t match the number of pointers that point to the\ngrandchildren. This results in \u0026quot;device mapper: space map common: unable\nto decrement block\u0026quot; errors.\n\nFix this bug by incrementing reference counts on the grandchildren if the\nbtree node is shared.(CVE-2026-46107)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm: defensively unhash xfrm_state lists in __xfrm_state_delete\n\nKASAN reproduces a slab-use-after-free in __xfrm_state_delete()\u0026apos;s\nhlist_del_rcu calls under syzkaller load on linux-6.12.y stable\n(reproduced on 6.12.47, also reachable via the same code path on\ntorvalds/master and on the ipsec tree). Nine unique signatures cluster\nin the xfrm_state lifecycle, the load-bearing one being:\n\n BUG: KASAN: slab-use-after-free in __hlist_del include/linux/list.h:990 [inline]\n BUG: KASAN: slab-use-after-free in hlist_del_rcu include/linux/rculist.h:516 [inline]\n BUG: KASAN: slab-use-after-free in __xfrm_state_delete net/xfrm/xfrm_state.c\n Write of size 8 at addr ffff8881198bcb70 by task kworker/u8:9/435\n\n Workqueue: netns cleanup_net\n Call Trace:\n __hlist_del / hlist_del_rcu\n __xfrm_state_delete\n xfrm_state_delete\n xfrm_state_flush\n xfrm_state_fini\n ops_exit_list\n cleanup_net\n\nThe other observed signatures hit the same slab object from\n__xfrm_state_lookup, xfrm_alloc_spi, __xfrm_state_insert and an OOB\nwrite variant of __xfrm_state_delete, all on the byseq/byspi\nhash chains.\n\n__xfrm_state_delete() guards its byseq and byspi unhashes with\nvalue-based predicates:\n\n\tif (x-\u0026gt;km.seq)\n\t\thlist_del_rcu(\u0026amp;x-\u0026gt;byseq);\n\tif (x-\u0026gt;id.spi)\n\t\thlist_del_rcu(\u0026amp;x-\u0026gt;byspi);\n\nwhile everywhere else in the file (e.g. state_cache, state_cache_input)\nthe safer hlist_unhashed() check is used. xfrm_alloc_spi() sets\nx-\u0026gt;id.spi = newspi inside xfrm_state_lock and then immediately inserts\ninto byspi, but a path that observes x-\u0026gt;id.spi != 0 outside of\nxfrm_state_lock can still skip-or-hit the byspi unhash inconsistently\nwith whether x is actually on the list. The same holds for x-\u0026gt;km.seq\nversus byseq, and the bydst/bysrc unhashes have no predicate at all,\nso a second __xfrm_state_delete() on the same object writes through\nLIST_POISON pprev.\n\nThe defensive change here:\n\n - Use hlist_del_init_rcu() instead of hlist_del_rcu() on bydst,\n bysrc, byseq and byspi so a second deletion is a no-op rather\n than a write through LIST_POISON pprev. The byseq/byspi nodes\n are already initialised in xfrm_state_alloc().\n - Test hlist_unhashed() rather than the value predicate for\n byseq/byspi, so the unhash decision tracks list state rather than\n mutable scalar fields.\n\nEmpirical verification: applied this patch on top of v6.12.47, rebuilt,\nand re-ran the same syzkaller harness for 1h16m on a previously-crashy\nconfiguration that produced ~100 hits each of slab-use-after-free\nRead in xfrm_alloc_spi / Read in __xfrm_state_lookup / Write in\n__xfrm_state_delete. After the patch, 7.1M execs across 32 VMs at\n~1550 exec/sec produced zero xfrm_state UAF/OOB hits. /proc/slabinfo\nconfirms the xfrm_state slab is actively allocated and freed during\nthe run (~143 KiB resident), so the fuzzer is still exercising those\ncode paths -- they just no longer crash.\n\nReproduction:\n\n - Linux 6.12.47 x86_64 + KASAN_GENERIC + KASAN_INLINE + KCOV\n - syzkaller @ 746545b8b1e4c3a128db8652b340d3df90ce61db\n - 32 QEMU/KVM VMs x 2 vCPU on AWS c5.metal bare metal\n - 9 unique signatures collected in ~9h, all within xfrm_state\n lifecycle(CVE-2026-46116)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: rtnetlink: zero ifla_vf_broadcast to avoid stack infoleak in rtnl_fill_vfinfo\n\nrtnl_fill_vfinfo() declares struct ifla_vf_broadcast on the stack\nwithout initialisation:\n\n\tstruct ifla_vf_broadcast vf_broadcast;\n\nThe struct contains a single fixed 32-byte field:\n\n\t/* include/uapi/linux/if_link.h */\n\tstruct ifla_vf_broadcast {\n\t\t__u8 broadcast[32];\n\t};\n\nThe function then copies dev-\u0026gt;broadcast into it using dev-\u0026gt;addr_len\nas the length:\n\n\tmemcpy(vf_broadcast.broadcast, dev-\u0026gt;broadcast, dev-\u0026gt;addr_len);\n\nOn Ethernet devices (the overwhelming majority of SR-IOV NICs)\ndev-\u0026gt;addr_len is 6, so only the first 6 bytes of broadcast[] are\nwritten. The remaining 26 bytes retain whatever was previously on\nthe kernel stack. The full struct is then handed to userspace via:\n\n\tnla_put(skb, IFLA_VF_BROADCAST,\n\t\tsizeof(vf_broadcast), \u0026amp;vf_broadcast)\n\nleaking up to 26 bytes of uninitialised kernel stack per VF per\nRTM_GETLINK request, repeatable.\n\nThe other vf_* structs in the same function are explicitly zeroed\nfor exactly this reason - see the memset() calls for ivi,\nvf_vlan_info, node_guid and port_guid a few lines above.\nvf_broadcast was simply missed when it was added.\n\nReachability: any unprivileged local process can open AF_NETLINK /\nNETLINK_ROUTE without capabilities and send RTM_GETLINK with an\nIFLA_EXT_MASK attribute carrying RTEXT_FILTER_VF. The kernel walks\neach VF and emits IFLA_VF_BROADCAST, leaking 26 bytes of stack per\nVF per request. Stack residue at this call site can include return\naddresses and transient sensitive data; KASAN with stack\ninstrumentation, or KMSAN, will flag the nla_put() when reproduced.\n\nZero the on-stack struct before the partial memcpy, matching the\nexisting pattern used for the other vf_* structs in the same\nfunction.(CVE-2026-46132)\n\nIn the Linux kernel, xfrm6_rcv_encap() performs an IPv6 route lookup when the skb does not already have a dst attached. ip6_route_input_lookup() returns a referenced dst entry even when the lookup resolves to an error route. If dst-\u0026gt;error is set, xfrm6_rcv_encap() drops the skb without attaching the dst to the skb and without releasing the reference returned by the lookup. Repeated packets hitting this path therefore leak dst entries.(CVE-2026-46172)\n\nIn the Linux kernel, the mlx4_ib_create_srq() function fails to release resources allocated by mlx4_srq_alloc() in error handling paths, leading to a resource leak. An attacker could exploit this vulnerability to cause resource exhaustion or denial of service.(CVE-2026-46178)\n\nIn the Linux kernel, the ua101 driver has a division by zero vulnerability at probe. The detect_usb_format() function lacks a sanity check for the bNrChannels field. When a malicious USB audio device provides bNrChannels=0, frame_bytes becomes zero and is later used as a divisor in playback_urb_complete() and capture_urb_complete(), causing a kernel crash. USB core does not validate class-specific descriptor fields, so drivers must verify them before use.(CVE-2026-46184)\n\nIn the Linux kernel, drm_gem_fb_init_with_funcs() computes sub-sampled plane dimensions using plain integer division, while the ioctl-level framebuffer_check() uses DIV_ROUND_UP via drm_format_info_plane_width/height(). This inconsistency causes incorrect GEM object size validation for certain pixel formats and dimensions, e.g., NV12 with height=1 results in height=0, leading to an integer overflow in size check and allowing undersized GEM objects to pass, potentially causing out-of-bounds memory access by the GPU.(CVE-2026-46209)\n\n[\u0026apos;This has been assigned CVE-2026-46243, see\u0026apos;, \u0026apos;On Thursday, May 28th, 2026 at 12:07 AM, manizada \u0026lt;manizada () pm me\u0026gt; wrote:\u0026apos;, \u0026apos;Hi folks,\\n\\nEmailing here now that the embargo agreed upon with linux-distros@ has expired.\\n\\nFlagging a local root vulnerability spanning both CIFS in the kernel and\\ncifs-utils in userspace (originally reported to kernel/cifs maintainers on May 16).\\nThe kernel-side (only) fix has now been public for over a week and is queued for stable:\\n\\n3da1fdf4efbc (\u0026quot;smb: client: reject userspace cifs.spnego descriptions\u0026quot;)\\n\\nImpact:\\n Unprivileged user -\u0026gt; root code exec on any system where:\\n - cifs-utils is installed (with the default cifs.spnego rule)\\n - CIFS kernel module is loadable/compiled-in (typically the case), and\\n - unprivileged user/mount namespaces are enabled.\\n\\nSome default AppArmor/SELinux profiles block this.\\n\\nBug:\\n An unprivileged user can call request_key(\u0026quot;cifs.spnego\u0026quot;, ...) with a forged\\n CIFS SPNEGO description. The request-key rule starts cifs.upcall as root.\\n cifs.upcall then trusts attacker-supplied pid, uid, creduid, and\\n upcall_target fields as if they came from kernel CIFS.\\n\\n For upcall_target=app, affected cifs-utils versions switch into the supplied\\n process\\\u0026apos;s namespaces and perform NSS lookup before final privilege drop.\\n A private mount namespace containing attacker-controlled /etc/nsswitch.conf\\n and libnss_*.so.2 is therefore sufficient for code execution in the root\\n helper.\\n\\nAffected distros:\\n This a non-exhaustive summary of some tested distros. The full table, including\\n the cases where stock policy blocks exploitation (but relaxing AppArmor/SELinux/etc.\\n enables exploitation), is in the attachment (and in an easier-to-read format in\\n the writeup linked below).\\n\\n Stock-default exploitable distros\\n (cifs-utils comes preinstalled in the profile + unprivileged namespaces permitted by default\\n + the AA/SELinux policies, if any, do not block the attack):\\n\\n - Linux Mint Cinnamon 21.3 and 22.3\\n - CentOS Stream 9 GNOME\\n - Rocky Linux 9 Workstation\\n - Kali Linux headless 2021.4/2022.4/2023.4/2024.4/2025.4/2026.1\\n - AlmaLinux 9.7 Workstation/Azure cloud image\\n - SLES 15 SP7/SAP 15 SP7/SAP 16\\n\\n Exploitable if cifs-utils is installed, with no other default config changes:\\n - Ubuntu 18.04/20.04/22.04 Desktop/Server\\n - Pop!_OS 22.04 Intel/24.04 Generic\\n - Ubuntu 24.04 Desktop minimal/full and Server\\n - Debian 11/12/13 netinst standard and GNOME/KDE/standard/XFCE\\n - CentOS Stream 9 Cinnamon/KDE/MATE/XFCE\\n - Rocky Linux 9 KDE/Workstation-Lite\\n - openSUSE Leap 15.6 GNOME/KDE\\n - openSUSE Tumbleweed GNOME/KDE\\n - Rocky Linux 8 GenericCloud\\n - Oracle Linux 8/9 KVM\\n - Amazon Linux 2023 KVM\\n\\nImmediate-term mitigations (aside from backporting the kernel fix):\\n - Blocking the CIFS module from loading (assuming it\\\u0026apos;s not built-in)/uninstalling cifs-utils if not used\\n - Deleting/overriding the default cifs.spnego request-key rule (if Kerberos cifs is not required),\\n e.g., after adjusting for your keyctl path:\\n\\n cat \u0026gt;/etc/request-key.d/cifs.spnego.conf \u0026lt;\u0026lt;\\\u0026apos;EOF\\\u0026apos;\\n create cifs.spnego * * /usr/sbin/keyctl negate %k 30 %S\\n EOF\\n\\n - Disabling unprivileged user namespaces\\n\\nThe CVE # assignment is still pending.\\n\\nFull writeup:\u0026apos;, \u0026apos;PoC to validate mitigations:\u0026apos;, \u0026apos;Thanks,\\n-Asim Manizada\u0026apos;](CVE-2026-46243)\n\nIn the Linux kernel, the following vulnerability has been resolved: MIPS: Work around LLVM bug when gp is used as global register variable On MIPS, __current_thread_info is defined as global register variable locating in $gp, and is simply assigned with new address during kernel relocation. This however is broken with LLVM, which always restores $gp if it finds $gp is clobbered in any form, including when intentionally through a global register variable. This is against GCC\u0026apos;s documentation[1], which requires a callee-saved register used as global register variable not to be restored if it\u0026apos;s clobbered. As a result, $gp will continue to point to the unrelocated kernel after the epilog of relocate_kernel(), leading to an early crash in init_idle, [ 0.000000] CPU 0 Unable to handle kernel paging request at virtual address 0000000000000000, epc == ffffffff81afada8, ra == ffffffff81afad90 [ 0.000000] Oops[#1]: [ 0.000000] CPU: 0 UID: 0 PID: 0 Comm: swapper Tainted: G W 6.19.0-rc5-00262-gd3eeb99bbc99-dirty #188 VOLUNTARY [ 0.000000] Tainted: [W]=WARN [ 0.000000] Hardware name: loongson,loongson64v-4core-virtio [ 0.000000] $ 0 : 0000000000000000 0000000000000000 0000000000000001 0000000000000000 [ 0.000000] $ 4 : ffffffff80b80ec0 ffffffff80b53d48 0000000000000000 00000000000f4240 [ 0.000000] $ 8 : 0000000000000100 ffffffff81d82f80 ffffffff81d82f80 0000000000000001 [ 0.000000] $12 : 0000000000000000 ffffffff81776f58 00000000000005da 0000000000000002 [ 0.000000] $16 : ffffffff80b80e40 0000000000000000 ffffffff80b81614 9800000005dfbe80 [ 0.000000] $20 : 00000000540000e0 ffffffff81980000 0000000000000000 ffffffff80f81c80 [ 0.000000] $24 : 0000000000000a26 ffffffff8114fb90 [ 0.000000] $28 : ffffffff80b50000 ffffffff80b53d40 0000000000000000 ffffffff81afad90 [ 0.000000] Hi : 0000000000000000 [ 0.000000] Lo : 0000000000000000 [ 0.000000] epc : ffffffff81afada8 init_idle+0x130/0x270 [ 0.000000] ra : ffffffff81afad90 init_idle+0x118/0x270 [ 0.000000] Status: 540000e2\tKX SX UX KERNEL EXL [ 0.000000] Cause : 00000008 (ExcCode 02) [ 0.000000] BadVA : 0000000000000000 [ 0.000000] PrId : 00006305 (ICT Loongson-3) [ 0.000000] Process swapper (pid: 0, threadinfo=(____ptrval____), task=(____ptrval____), tls=0000000000000000) [ 0.000000] Stack : 9800000005dfbf00 ffffffff8178e950 0000000000000000 0000000000000000 [ 0.000000] 0000000000000000 ffffffff81970000 000000000000003f ffffffff810a6528 [ 0.000000] 0000000000000001 9800000005dfbe80 9800000005dfbf00 ffffffff81980000 [ 0.000000] ffffffff810a6450 ffffffff81afb6c0 0000000000000000 ffffffff810a2258 [ 0.000000] ffffffff81d82ec8 ffffffff8198d010 ffffffff81b67e80 ffffffff8197dd98 [ 0.000000] ffffffff81d81c80 ffffffff81930000 0000000000000040 0000000000000000 [ 0.000000] 0000000000000000 0000000000000000 0000000000000000 0000000000000000 [ 0.000000] 0000000000000000 000000000000009e ffffffff9fc01000 0000000000000000 [ 0.000000] 0000000000000000 0000000000000000 0000000000000000 0000000000000000 [ 0.000000] 0000000000000000 ffffffff81ae86dc ffffffff81b3c741 0000000000000002 [ 0.000000] ... [ 0.000000] Call Trace: [ 0.000000] [\u0026lt;ffffffff81afada8\u0026gt;] init_idle+0x130/0x270 [ 0.000000] [\u0026lt;ffffffff81afb6c0\u0026gt;] sched_init+0x5c8/0x6c0 [ 0.000000] [\u0026lt;ffffffff81ae86dc\u0026gt;] start_kernel+0x27c/0x7a8 This bug has been reported to LLVM[2] and affects version from (at least) 18 to 21. Let\u0026apos;s work around this by using inline assembly to assign $gp before a fix is widely available. The Linux kernel CVE team has assigned CVE-2026-46250 to this issue.(CVE-2026-46250)\n\nIn the Linux kernel, the following vulnerability has been resolved: pstore/ram: fix buffer overflow in persistent_ram_save_old() persistent_ram_save_old() can be called multiple times for the same persistent_ram_zone (e.g., via ramoops_pstore_read -\u0026gt; ramoops_get_next_prz for PSTORE_TYPE_DMESG records). Currently, the function only allocates prz-\u0026gt;old_log when it is NULL, but it unconditionally updates prz-\u0026gt;old_log_size to the current buffer size and then performs memcpy_fromio() using this new size. If the buffer size has grown since the first allocation (which can happen across different kernel boot cycles), this leads to: 1. A heap buffer overflow (OOB write) in the memcpy_fromio() calls 2. A subsequent OOB read when ramoops_pstore_read() accesses the buffer using the incorrect (larger) old_log_size The KASAN splat would look similar to: BUG: KASAN: slab-out-of-bounds in ramoops_pstore_read+0x... Read of size N at addr ... by task ... The conditions are likely extremely hard to hit: 0. Crash with a ramoops write of less-than-record-max-size bytes. 1. Reboot: ramoops registers, pstore_get_records(0) reads old crash, allocates old_log with size X 2. Crash handler registered, timer started (if pstore_update_ms \u0026gt;= 0) 3. Oops happens (non-fatal, system continues) 4. pstore_dump() writes oops via ramoops_pstore_write() size Y (\u0026gt;X) 5. pstore_new_entry = 1, pstore_timer_kick() called 6. System continues running (not a panic oops) 7. Timer fires after pstore_update_ms milliseconds 8. pstore_timefunc() \u2192 schedule_work() \u2192 pstore_dowork() \u2192 pstore_get_records(1) 9. ramoops_get_next_prz() \u2192 persistent_ram_save_old() 10. buffer_size() returns Y, but old_log is X bytes 11. Y \u0026gt; X: memcpy_fromio() overflows heap Requirements: - a prior crash record exists that did not fill the record size (almost impossible since the crash handler writes as much as it can possibly fit into the record, capped by max record size and the kmsg buffer almost always exceeds the max record size) - pstore_update_ms \u0026gt;= 0 (disabled by default) - Non-fatal oops (system survives) Free and reallocate the buffer when the new size differs from the previously allocated size. This ensures old_log always has sufficient space for the data being copied. The Linux kernel CVE team has assigned CVE-2026-46253 to this issue.(CVE-2026-46253)\n\nIn the Linux kernel, the following vulnerability has been resolved: procfs: fix missing RCU protection when reading real_parent in do_task_stat() When reading /proc/[pid]/stat, do_task_stat() accesses task-\u0026gt;real_parent without proper RCU protection, which leads to: cpu 0 cpu 1 ----- ----- do_task_stat var = task-\u0026gt;real_parent release_task call_rcu(delayed_put_task_struct) task_tgid_nr_ns(var) rcu_read_lock \u0026lt;--- Too late to protect task-\u0026gt;real_parent! task_pid_ptr \u0026lt;--- UAF! rcu_read_unlock This patch uses task_ppid_nr_ns() instead of task_tgid_nr_ns() to add proper RCU protection for accessing task-\u0026gt;real_parent. The Linux kernel CVE team has assigned CVE-2026-46259 to this issue.(CVE-2026-46259)\n\nIn the Linux kernel, the following vulnerability has been resolved: RDMA/hns: Fix WQ_MEM_RECLAIM warning When sunrpc is used, if a reset triggered, our wq may lead the following trace: workqueue: WQ_MEM_RECLAIM xprtiod:xprt_rdma_connect_worker [rpcrdma] is flushing !WQ_MEM_RECLAIM hns_roce_irq_workq:flush_work_handle [hns_roce_hw_v2] WARNING: CPU: 0 PID: 8250 at kernel/workqueue.c:2644 check_flush_dependency+0xe0/0x144 Call trace: check_flush_dependency+0xe0/0x144 start_flush_work.constprop.0+0x1d0/0x2f0 __flush_work.isra.0+0x40/0xb0 flush_work+0x14/0x30 hns_roce_v2_destroy_qp+0xac/0x1e0 [hns_roce_hw_v2] ib_destroy_qp_user+0x9c/0x2b4 rdma_destroy_qp+0x34/0xb0 rpcrdma_ep_destroy+0x28/0xcc [rpcrdma] rpcrdma_ep_put+0x74/0xb4 [rpcrdma] rpcrdma_xprt_disconnect+0x1d8/0x260 [rpcrdma] xprt_rdma_connect_worker+0xc0/0x120 [rpcrdma] process_one_work+0x1cc/0x4d0 worker_thread+0x154/0x414 kthread+0x104/0x144 ret_from_fork+0x10/0x18 Since QP destruction frees memory, this wq should have the WQ_MEM_RECLAIM. The Linux kernel CVE team has assigned CVE-2026-46265 to this issue.(CVE-2026-46265)",
"id": "OESA-2026-2674",
"modified": "2026-08-06T11:11:36Z",
"published": "2026-06-12T11:11:36Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-2674"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39759"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39952"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-68330"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-68755"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-71184"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31605"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31607"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31615"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31616"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31617"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31618"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31700"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31786"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43077"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43078"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43091"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43093"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43116"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43125"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43130"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43139"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43190"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43198"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43233"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43253"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43319"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43339"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43383"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43450"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43452"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43453"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43499"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45840"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45843"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45852"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45862"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45894"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45905"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45914"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45915"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45919"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45920"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45935"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45944"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45948"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45983"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45985"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45987"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45991"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46018"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46023"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46028"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46032"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46043"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46049"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46056"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46065"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46083"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46088"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46101"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46102"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46107"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46116"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46132"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46172"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46178"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46184"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46209"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46243"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46250"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46253"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46259"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46265"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2025-39759",
"CVE-2025-39952",
"CVE-2025-68330",
"CVE-2025-68755",
"CVE-2025-71184",
"CVE-2026-31605",
"CVE-2026-31607",
"CVE-2026-31615",
"CVE-2026-31616",
"CVE-2026-31617",
"CVE-2026-31618",
"CVE-2026-31700",
"CVE-2026-31786",
"CVE-2026-43077",
"CVE-2026-43078",
"CVE-2026-43091",
"CVE-2026-43093",
"CVE-2026-43116",
"CVE-2026-43125",
"CVE-2026-43130",
"CVE-2026-43139",
"CVE-2026-43190",
"CVE-2026-43198",
"CVE-2026-43233",
"CVE-2026-43253",
"CVE-2026-43319",
"CVE-2026-43339",
"CVE-2026-43383",
"CVE-2026-43450",
"CVE-2026-43452",
"CVE-2026-43453",
"CVE-2026-43499",
"CVE-2026-45840",
"CVE-2026-45843",
"CVE-2026-45852",
"CVE-2026-45862",
"CVE-2026-45894",
"CVE-2026-45905",
"CVE-2026-45914",
"CVE-2026-45915",
"CVE-2026-45919",
"CVE-2026-45920",
"CVE-2026-45935",
"CVE-2026-45944",
"CVE-2026-45948",
"CVE-2026-45983",
"CVE-2026-45985",
"CVE-2026-45987",
"CVE-2026-45991",
"CVE-2026-46018",
"CVE-2026-46023",
"CVE-2026-46028",
"CVE-2026-46032",
"CVE-2026-46043",
"CVE-2026-46049",
"CVE-2026-46056",
"CVE-2026-46065",
"CVE-2026-46083",
"CVE-2026-46088",
"CVE-2026-46101",
"CVE-2026-46102",
"CVE-2026-46107",
"CVE-2026-46116",
"CVE-2026-46132",
"CVE-2026-46172",
"CVE-2026-46178",
"CVE-2026-46184",
"CVE-2026-46209",
"CVE-2026-46243",
"CVE-2026-46250",
"CVE-2026-46253",
"CVE-2026-46259",
"CVE-2026-46265"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.