Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2022-48859 (GCVE-0-2022-48859)
Vulnerability from cvelistv5 – Published: 2024-07-16 12:25 – Updated: 2026-05-11 18:48| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
501ef3066c89d7f9045315e1be58749cf9e6814d , < b7c2fd1d126329340639adfb8dd2938fe4b65df7
(git)
Affected: 501ef3066c89d7f9045315e1be58749cf9e6814d , < 4cc66bf17220ff9631f9fa99b02a872e0ad5a08b (git) Affected: 501ef3066c89d7f9045315e1be58749cf9e6814d , < c9ffa3e2bc451816ce0295e40063514fabf2bd36 (git) |
guessed | |
| Linux | Linux |
Affected:
5.10
Unaffected: 0 , < 5.10 (semver) Unaffected: 5.15.29 , ≤ 5.15.* (semver) Unaffected: 5.16.15 , ≤ 5.16.* (semver) Unaffected: 5.17 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-03T15:25:01.643Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2022-48859",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T16:25:39.171520Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-09-11T17:34:07.633Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/net/ethernet/marvell/prestera/prestera_main.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "b7c2fd1d126329340639adfb8dd2938fe4b65df7",
"status": "affected",
"version": "501ef3066c89d7f9045315e1be58749cf9e6814d",
"versionType": "git"
},
{
"lessThan": "4cc66bf17220ff9631f9fa99b02a872e0ad5a08b",
"status": "affected",
"version": "501ef3066c89d7f9045315e1be58749cf9e6814d",
"versionType": "git"
},
{
"lessThan": "c9ffa3e2bc451816ce0295e40063514fabf2bd36",
"status": "affected",
"version": "501ef3066c89d7f9045315e1be58749cf9e6814d",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/net/ethernet/marvell/prestera/prestera_main.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.10"
},
{
"lessThan": "5.10",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.29",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.16.*",
"status": "unaffected",
"version": "5.16.15",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "5.17",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.29",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.16.15",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.17",
"versionStartIncluding": "5.10",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nnet: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr\n\nThis node pointer is returned by of_find_compatible_node() with\nrefcount incremented. Calling of_node_put() to aovid the refcount leak."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T18:48:32.200Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7"
},
{
"url": "https://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b"
},
{
"url": "https://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36"
}
],
"title": "net: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2022-48859",
"datePublished": "2024-07-16T12:25:23.799Z",
"dateReserved": "2024-07-16T11:38:08.919Z",
"dateUpdated": "2026-05-11T18:48:32.200Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2022-48859",
"date": "2026-10-06",
"epss": "0.0021",
"percentile": "0.1032"
},
"fkie_nvd": {
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "88937CAB-8166-494A-8CFE-8970F9B81F69",
"versionEndExcluding": "5.15.29",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "83FDEDF2-0E19-4879-91FD-171E66D1B335",
"versionEndExcluding": "5.16.15",
"versionStartIncluding": "5.16",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nnet: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr\n\nThis node pointer is returned by of_find_compatible_node() with\nrefcount incremented. Calling of_node_put() to aovid the refcount leak."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: net: marvell: prestera: Agregar falta of_node_put() en prestera_switch_set_base_mac_addr Este puntero de nodo lo devuelve of_find_compatible_node() con refcount incrementado. Llamar a of_node_put() para evitar la fuga de recuento."
}
],
"id": "CVE-2022-48859",
"lastModified": "2024-11-21T07:34:13.757",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2024-07-16T13:15:12.873",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-401"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/net/ethernet/marvell/prestera/prestera_main.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "b7c2fd1d126329340639adfb8dd2938fe4b65df7",
"status": "affected",
"version": "501ef3066c89d7f9045315e1be58749cf9e6814d",
"versionType": "git"
},
{
"lessThan": "4cc66bf17220ff9631f9fa99b02a872e0ad5a08b",
"status": "affected",
"version": "501ef3066c89d7f9045315e1be58749cf9e6814d",
"versionType": "git"
},
{
"lessThan": "c9ffa3e2bc451816ce0295e40063514fabf2bd36",
"status": "affected",
"version": "501ef3066c89d7f9045315e1be58749cf9e6814d",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/net/ethernet/marvell/prestera/prestera_main.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.10"
},
{
"lessThan": "5.10",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.29",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.16.*",
"status": "unaffected",
"version": "5.16.15",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "5.17",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "88937CAB-8166-494A-8CFE-8970F9B81F69",
"versionEndExcluding": "5.15.29",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "83FDEDF2-0E19-4879-91FD-171E66D1B335",
"versionEndExcluding": "5.16.15",
"versionStartIncluding": "5.16",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nnet: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr\n\nThis node pointer is returned by of_find_compatible_node() with\nrefcount incremented. Calling of_node_put() to aovid the refcount leak."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: net: marvell: prestera: Agregar falta of_node_put() en prestera_switch_set_base_mac_addr Este puntero de nodo lo devuelve of_find_compatible_node() con refcount incrementado. Llamar a of_node_put() para evitar la fuga de recuento."
}
],
"id": "CVE-2022-48859",
"lastModified": "2026-06-17T05:16:24.130",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2022-48859",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T16:25:39.171520Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-07-16T13:15:12.873",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-401"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Low",
"current_release_date": "2025-11-21T14:38:43+00:00",
"cve": "CVE-2022-48859",
"id": "CVE-2022-48859",
"initial_release_date": "2022-01-01T00:00:00+00:00",
"product_status:known_not_affected": "198",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: net: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2022/cve-2022-48859.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-09-11T02:33:21Z",
"cve": "CVE-2022-48859",
"id": "CVE-2022-48859",
"initial_release_date": "2024-07-18T03:05:31Z",
"product_status:known_affected": "295",
"product_status:known_not_affected": "254",
"product_status:recommended": "426",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2022-48859",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2022-48859.json",
"version": "48"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-03T15:25:01.643Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2022-48859",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T16:25:39.171520Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-09-11T12:42:20.815Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/net/ethernet/marvell/prestera/prestera_main.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "b7c2fd1d126329340639adfb8dd2938fe4b65df7",
"status": "affected",
"version": "501ef3066c89d7f9045315e1be58749cf9e6814d",
"versionType": "git"
},
{
"lessThan": "4cc66bf17220ff9631f9fa99b02a872e0ad5a08b",
"status": "affected",
"version": "501ef3066c89d7f9045315e1be58749cf9e6814d",
"versionType": "git"
},
{
"lessThan": "c9ffa3e2bc451816ce0295e40063514fabf2bd36",
"status": "affected",
"version": "501ef3066c89d7f9045315e1be58749cf9e6814d",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/net/ethernet/marvell/prestera/prestera_main.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.10"
},
{
"lessThan": "5.10",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.29",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.16.*",
"status": "unaffected",
"version": "5.16.15",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "5.17",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.29",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.16.15",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.17",
"versionStartIncluding": "5.10",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nnet: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr\n\nThis node pointer is returned by of_find_compatible_node() with\nrefcount incremented. Calling of_node_put() to aovid the refcount leak."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T18:48:32.200Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7"
},
{
"url": "https://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b"
},
{
"url": "https://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36"
}
],
"title": "net: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2022-48859",
"datePublished": "2024-07-16T12:25:23.799Z",
"dateReserved": "2024-07-16T11:38:08.919Z",
"dateUpdated": "2026-05-11T18:48:32.200Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
CERTFR-2024-AVI-0693
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une élévation de privilèges et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP5 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | openSUSE Leap Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-26558",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26558"
},
{
"name": "CVE-2021-0129",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0129"
},
{
"name": "CVE-2021-43389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43389"
},
{
"name": "CVE-2022-20368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20368"
},
{
"name": "CVE-2022-0854",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0854"
},
{
"name": "CVE-2022-2964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2964"
},
{
"name": "CVE-2022-28748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28748"
},
{
"name": "CVE-2023-1582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1582"
},
{
"name": "CVE-2023-37453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37453"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-24023",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24023"
},
{
"name": "CVE-2023-51780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51780"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52594"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2023-52612",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52612"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-26659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26659"
},
{
"name": "CVE-2023-52507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52507"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26800"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26750"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2024-26780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26780"
},
{
"name": "CVE-2024-26641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26641"
},
{
"name": "CVE-2023-52580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52580"
},
{
"name": "CVE-2024-26863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26863"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26615"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-26644",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26644"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2024-26623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26623"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2021-47219",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47219"
},
{
"name": "CVE-2021-47197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47197"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2021-47201",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47201"
},
{
"name": "CVE-2021-47194",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47194"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2023-52672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52672"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2024-35805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35805"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35934"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-26944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26944"
},
{
"name": "CVE-2024-27064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27064"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2021-4439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4439"
},
{
"name": "CVE-2021-47089",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47089"
},
{
"name": "CVE-2021-47103",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47103"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2021-47515",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47515"
},
{
"name": "CVE-2021-47539",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47539"
},
{
"name": "CVE-2021-47566",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47566"
},
{
"name": "CVE-2021-47571",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47571"
},
{
"name": "CVE-2021-47572",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47572"
},
{
"name": "CVE-2021-47576",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47576"
},
{
"name": "CVE-2021-47577",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47577"
},
{
"name": "CVE-2021-47578",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47578"
},
{
"name": "CVE-2021-47580",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47580"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2021-47583",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47583"
},
{
"name": "CVE-2021-47584",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47584"
},
{
"name": "CVE-2021-47585",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47585"
},
{
"name": "CVE-2021-47586",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47586"
},
{
"name": "CVE-2021-47587",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47587"
},
{
"name": "CVE-2021-47589",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47589"
},
{
"name": "CVE-2021-47592",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47592"
},
{
"name": "CVE-2021-47595",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47595"
},
{
"name": "CVE-2021-47596",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47596"
},
{
"name": "CVE-2021-47597",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47597"
},
{
"name": "CVE-2021-47600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47600"
},
{
"name": "CVE-2021-47601",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47601"
},
{
"name": "CVE-2021-47602",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47602"
},
{
"name": "CVE-2021-47603",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47603"
},
{
"name": "CVE-2021-47604",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47604"
},
{
"name": "CVE-2021-47605",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47605"
},
{
"name": "CVE-2021-47607",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47607"
},
{
"name": "CVE-2021-47608",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47608"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2021-47610",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47610"
},
{
"name": "CVE-2021-47611",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47611"
},
{
"name": "CVE-2021-47612",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47612"
},
{
"name": "CVE-2021-47614",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47614"
},
{
"name": "CVE-2021-47615",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47615"
},
{
"name": "CVE-2021-47616",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47616"
},
{
"name": "CVE-2021-47617",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47617"
},
{
"name": "CVE-2021-47618",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47618"
},
{
"name": "CVE-2021-47619",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47619"
},
{
"name": "CVE-2021-47620",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47620"
},
{
"name": "CVE-2022-48711",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48711"
},
{
"name": "CVE-2022-48712",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48712"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48714",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48714"
},
{
"name": "CVE-2022-48715",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48715"
},
{
"name": "CVE-2022-48716",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48716"
},
{
"name": "CVE-2022-48717",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48717"
},
{
"name": "CVE-2022-48718",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48718"
},
{
"name": "CVE-2022-48720",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48720"
},
{
"name": "CVE-2022-48721",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48721"
},
{
"name": "CVE-2022-48722",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48722"
},
{
"name": "CVE-2022-48723",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48723"
},
{
"name": "CVE-2022-48724",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48724"
},
{
"name": "CVE-2022-48725",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48725"
},
{
"name": "CVE-2022-48726",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48726"
},
{
"name": "CVE-2022-48727",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48727"
},
{
"name": "CVE-2022-48728",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48728"
},
{
"name": "CVE-2022-48729",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48729"
},
{
"name": "CVE-2022-48730",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48730"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48733",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48733"
},
{
"name": "CVE-2022-48734",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48734"
},
{
"name": "CVE-2022-48735",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48735"
},
{
"name": "CVE-2022-48736",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48736"
},
{
"name": "CVE-2022-48737",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48737"
},
{
"name": "CVE-2022-48738",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48738"
},
{
"name": "CVE-2022-48739",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48739"
},
{
"name": "CVE-2022-48740",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48740"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2022-48744",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48744"
},
{
"name": "CVE-2022-48745",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48745"
},
{
"name": "CVE-2022-48746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48746"
},
{
"name": "CVE-2022-48747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48747"
},
{
"name": "CVE-2022-48748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48748"
},
{
"name": "CVE-2022-48749",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48749"
},
{
"name": "CVE-2022-48751",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48751"
},
{
"name": "CVE-2022-48752",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48752"
},
{
"name": "CVE-2022-48753",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48753"
},
{
"name": "CVE-2022-48754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48754"
},
{
"name": "CVE-2022-48755",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48755"
},
{
"name": "CVE-2022-48756",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48756"
},
{
"name": "CVE-2022-48758",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48758"
},
{
"name": "CVE-2022-48759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48759"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2022-48761",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48761"
},
{
"name": "CVE-2022-48763",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48763"
},
{
"name": "CVE-2022-48765",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48765"
},
{
"name": "CVE-2022-48766",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48766"
},
{
"name": "CVE-2022-48767",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48767"
},
{
"name": "CVE-2022-48768",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48768"
},
{
"name": "CVE-2022-48769",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48769"
},
{
"name": "CVE-2022-48770",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48770"
},
{
"name": "CVE-2022-48771",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48771"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52846"
},
{
"name": "CVE-2023-52869",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52869"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36592"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38545"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47145",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47145"
},
{
"name": "CVE-2021-47547",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47547"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52765"
},
{
"name": "CVE-2023-52767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52767"
},
{
"name": "CVE-2023-52768",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52768"
},
{
"name": "CVE-2023-52769",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52769"
},
{
"name": "CVE-2023-52776",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52776"
},
{
"name": "CVE-2023-52780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52780"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52783",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52783"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52801"
},
{
"name": "CVE-2023-52812",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52812"
},
{
"name": "CVE-2023-52827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52827"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52850"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2023-52862",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52862"
},
{
"name": "CVE-2023-52863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52863"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2023-52874",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52874"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2023-52883",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52883"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38391"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39362",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39362"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2023-52751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52751"
},
{
"name": "CVE-2024-26785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26785"
},
{
"name": "CVE-2024-27402",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27402"
},
{
"name": "CVE-2024-27404",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27404"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2016-20022",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-20022"
},
{
"name": "CVE-2021-47086",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47086"
},
{
"name": "CVE-2021-47126",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47126"
},
{
"name": "CVE-2021-47186",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47186"
},
{
"name": "CVE-2021-47291",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47291"
},
{
"name": "CVE-2021-47295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47295"
},
{
"name": "CVE-2021-47546",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47546"
},
{
"name": "CVE-2021-47588",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47588"
},
{
"name": "CVE-2021-47590",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47590"
},
{
"name": "CVE-2021-47591",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47591"
},
{
"name": "CVE-2021-47593",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47593"
},
{
"name": "CVE-2021-47598",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47598"
},
{
"name": "CVE-2021-47599",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47599"
},
{
"name": "CVE-2021-47606",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47606"
},
{
"name": "CVE-2021-47622",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47622"
},
{
"name": "CVE-2021-47623",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47623"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2022-48774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48774"
},
{
"name": "CVE-2022-48775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48775"
},
{
"name": "CVE-2022-48776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48776"
},
{
"name": "CVE-2022-48777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48777"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48780"
},
{
"name": "CVE-2022-48783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48783"
},
{
"name": "CVE-2022-48784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48784"
},
{
"name": "CVE-2022-48785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48785"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48788",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48788"
},
{
"name": "CVE-2022-48789",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48789"
},
{
"name": "CVE-2022-48790",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48790"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48792",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48792"
},
{
"name": "CVE-2022-48793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48793"
},
{
"name": "CVE-2022-48794",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48794"
},
{
"name": "CVE-2022-48796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48796"
},
{
"name": "CVE-2022-48797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48797"
},
{
"name": "CVE-2022-48798",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48798"
},
{
"name": "CVE-2022-48799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48799"
},
{
"name": "CVE-2022-48800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48800"
},
{
"name": "CVE-2022-48801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48801"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48803"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2022-48805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48805"
},
{
"name": "CVE-2022-48806",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48806"
},
{
"name": "CVE-2022-48807",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48807"
},
{
"name": "CVE-2022-48809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48809"
},
{
"name": "CVE-2022-48810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48810"
},
{
"name": "CVE-2022-48811",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48811"
},
{
"name": "CVE-2022-48812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48812"
},
{
"name": "CVE-2022-48813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48813"
},
{
"name": "CVE-2022-48814",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48814"
},
{
"name": "CVE-2022-48815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48815"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2022-48817",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48817"
},
{
"name": "CVE-2022-48818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48818"
},
{
"name": "CVE-2022-48820",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48820"
},
{
"name": "CVE-2022-48821",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48821"
},
{
"name": "CVE-2022-48822",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48822"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48824"
},
{
"name": "CVE-2022-48825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48825"
},
{
"name": "CVE-2022-48826",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48826"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2022-48828",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48828"
},
{
"name": "CVE-2022-48829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48829"
},
{
"name": "CVE-2022-48830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48830"
},
{
"name": "CVE-2022-48831",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48831"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48838",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48838"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48840"
},
{
"name": "CVE-2022-48841",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48841"
},
{
"name": "CVE-2022-48842",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48842"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48844",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48844"
},
{
"name": "CVE-2022-48846",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48846"
},
{
"name": "CVE-2022-48847",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48847"
},
{
"name": "CVE-2022-48849",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48849"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48851"
},
{
"name": "CVE-2022-48852",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48852"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48855",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48855"
},
{
"name": "CVE-2022-48856",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48856"
},
{
"name": "CVE-2022-48857",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48857"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2022-48859",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48859"
},
{
"name": "CVE-2022-48860",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48860"
},
{
"name": "CVE-2022-48861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48861"
},
{
"name": "CVE-2022-48862",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48862"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2022-48864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48864"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2023-31315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31315"
},
{
"name": "CVE-2023-52573",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52573"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0693",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-16T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une \u00e9l\u00e9vation de privil\u00e8ges et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2911-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242911-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2894-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242894-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2892-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242892-1"
},
{
"published_at": "2024-08-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2923-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242923-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2939-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242939-1"
},
{
"published_at": "2024-08-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2929-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242929-1"
},
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2902-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242902-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2895-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242895-1"
},
{
"published_at": "2024-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2874-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242874-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2896-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242896-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2893-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242893-1"
},
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2901-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242901-1"
}
]
}
CERTFR-2024-AVI-0717
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | Public Cloud Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Software Development Kit 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 12 12-SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP6 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap 15.6 |
| Title | Publication Time | Tags | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Software Development Kit 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 12 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-26558",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26558"
},
{
"name": "CVE-2021-0129",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0129"
},
{
"name": "CVE-2022-20368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20368"
},
{
"name": "CVE-2022-2964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2964"
},
{
"name": "CVE-2022-28748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28748"
},
{
"name": "CVE-2023-1582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1582"
},
{
"name": "CVE-2023-37453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37453"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-51780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51780"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52594"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2023-52612",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52612"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-26659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26659"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26800"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-26737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26737"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2023-52616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52616"
},
{
"name": "CVE-2024-26750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26750"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26816"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2023-52640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52640"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2023-52641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52641"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2023-52635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52635"
},
{
"name": "CVE-2024-26774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26774"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26780"
},
{
"name": "CVE-2024-26731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26731"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2024-26641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26641"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2023-52503",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52503"
},
{
"name": "CVE-2023-52580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52580"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26863"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26861"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26978"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26615"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26883"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26885"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-27030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27030"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2024-27046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27046"
},
{
"name": "CVE-2024-26903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26903"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-27022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27022"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26650"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2024-26623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26623"
},
{
"name": "CVE-2024-26632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26632"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2021-47219",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47219"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2021-47197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47197"
},
{
"name": "CVE-2024-26856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26856"
},
{
"name": "CVE-2024-26881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26881"
},
{
"name": "CVE-2023-52652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52652"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2024-26972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26972"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2024-26836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26836"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26783"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2021-47194",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47194"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52681"
},
{
"name": "CVE-2023-52687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52687"
},
{
"name": "CVE-2023-52695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52695"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2023-52771",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52771"
},
{
"name": "CVE-2023-52772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52772"
},
{
"name": "CVE-2023-6238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6238"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26652",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26652"
},
{
"name": "CVE-2024-26657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26657"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2024-26786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26786"
},
{
"name": "CVE-2024-26794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26794"
},
{
"name": "CVE-2024-26832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26832"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26854"
},
{
"name": "CVE-2024-26858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26858"
},
{
"name": "CVE-2024-26860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26860"
},
{
"name": "CVE-2024-26868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26868"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26909"
},
{
"name": "CVE-2024-26932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26932"
},
{
"name": "CVE-2024-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26945"
},
{
"name": "CVE-2024-26946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26946"
},
{
"name": "CVE-2024-26949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26949"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-26963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26963"
},
{
"name": "CVE-2024-26986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26986"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-26991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26991"
},
{
"name": "CVE-2024-26995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26995"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-27067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27067"
},
{
"name": "CVE-2024-27080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27080"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2024-27411",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27411"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-35786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35786"
},
{
"name": "CVE-2024-35788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35788"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35800"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35841"
},
{
"name": "CVE-2024-35842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35842"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35883"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35909"
},
{
"name": "CVE-2024-35911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35911"
},
{
"name": "CVE-2024-35916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35916"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35921"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35928"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-35953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35953"
},
{
"name": "CVE-2024-35954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35954"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-35972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35972"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35975"
},
{
"name": "CVE-2024-35977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35977"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36018"
},
{
"name": "CVE-2024-36019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36019"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36885"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2023-52672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52672"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2024-35805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35805"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35934"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-26944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26944"
},
{
"name": "CVE-2024-27064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27064"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2021-47103",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47103"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2021-47580",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47580"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2021-47597",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47597"
},
{
"name": "CVE-2021-47600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47600"
},
{
"name": "CVE-2021-47619",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47619"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48730",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48730"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48749",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48749"
},
{
"name": "CVE-2022-48756",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48756"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52869",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52869"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36592"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47547",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47547"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52765"
},
{
"name": "CVE-2023-52767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52767"
},
{
"name": "CVE-2023-52768",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52768"
},
{
"name": "CVE-2023-52769",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52769"
},
{
"name": "CVE-2023-52776",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52776"
},
{
"name": "CVE-2023-52780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52780"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52783",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52783"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52801"
},
{
"name": "CVE-2023-52812",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52812"
},
{
"name": "CVE-2023-52827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52827"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52850"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2023-52862",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52862"
},
{
"name": "CVE-2023-52863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52863"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2023-52874",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52874"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2023-52883",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52883"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38391"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39362",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39362"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2023-52751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52751"
},
{
"name": "CVE-2024-26785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26785"
},
{
"name": "CVE-2024-27402",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27402"
},
{
"name": "CVE-2024-27404",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27404"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2021-47086",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47086"
},
{
"name": "CVE-2021-47126",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47126"
},
{
"name": "CVE-2021-47186",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47186"
},
{
"name": "CVE-2021-47291",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47291"
},
{
"name": "CVE-2021-47295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47295"
},
{
"name": "CVE-2021-47546",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47546"
},
{
"name": "CVE-2021-47588",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47588"
},
{
"name": "CVE-2021-47590",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47590"
},
{
"name": "CVE-2021-47591",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47591"
},
{
"name": "CVE-2021-47593",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47593"
},
{
"name": "CVE-2021-47598",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47598"
},
{
"name": "CVE-2021-47599",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47599"
},
{
"name": "CVE-2021-47606",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47606"
},
{
"name": "CVE-2021-47622",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47622"
},
{
"name": "CVE-2021-47623",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47623"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2022-48774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48774"
},
{
"name": "CVE-2022-48775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48775"
},
{
"name": "CVE-2022-48776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48776"
},
{
"name": "CVE-2022-48777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48777"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48780"
},
{
"name": "CVE-2022-48783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48783"
},
{
"name": "CVE-2022-48784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48784"
},
{
"name": "CVE-2022-48785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48785"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48788",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48788"
},
{
"name": "CVE-2022-48789",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48789"
},
{
"name": "CVE-2022-48790",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48790"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48792",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48792"
},
{
"name": "CVE-2022-48793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48793"
},
{
"name": "CVE-2022-48794",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48794"
},
{
"name": "CVE-2022-48796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48796"
},
{
"name": "CVE-2022-48797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48797"
},
{
"name": "CVE-2022-48798",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48798"
},
{
"name": "CVE-2022-48799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48799"
},
{
"name": "CVE-2022-48800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48800"
},
{
"name": "CVE-2022-48801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48801"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48803"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2022-48805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48805"
},
{
"name": "CVE-2022-48806",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48806"
},
{
"name": "CVE-2022-48807",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48807"
},
{
"name": "CVE-2022-48809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48809"
},
{
"name": "CVE-2022-48810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48810"
},
{
"name": "CVE-2022-48811",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48811"
},
{
"name": "CVE-2022-48812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48812"
},
{
"name": "CVE-2022-48813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48813"
},
{
"name": "CVE-2022-48814",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48814"
},
{
"name": "CVE-2022-48815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48815"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2022-48817",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48817"
},
{
"name": "CVE-2022-48818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48818"
},
{
"name": "CVE-2022-48820",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48820"
},
{
"name": "CVE-2022-48821",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48821"
},
{
"name": "CVE-2022-48822",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48822"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48824"
},
{
"name": "CVE-2022-48825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48825"
},
{
"name": "CVE-2022-48826",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48826"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2022-48828",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48828"
},
{
"name": "CVE-2022-48829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48829"
},
{
"name": "CVE-2022-48830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48830"
},
{
"name": "CVE-2022-48831",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48831"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48838",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48838"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48840"
},
{
"name": "CVE-2022-48841",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48841"
},
{
"name": "CVE-2022-48842",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48842"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48844",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48844"
},
{
"name": "CVE-2022-48846",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48846"
},
{
"name": "CVE-2022-48847",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48847"
},
{
"name": "CVE-2022-48849",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48849"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48851"
},
{
"name": "CVE-2022-48852",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48852"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48855",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48855"
},
{
"name": "CVE-2022-48856",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48856"
},
{
"name": "CVE-2022-48857",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48857"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2022-48859",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48859"
},
{
"name": "CVE-2022-48860",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48860"
},
{
"name": "CVE-2022-48861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48861"
},
{
"name": "CVE-2022-48862",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48862"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2022-48864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48864"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2023-31315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31315"
},
{
"name": "CVE-2023-52573",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52573"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0717",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-23T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-08-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2980-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242980-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2940-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242940-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2944-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242944-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2943-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242943-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2948-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242948-1"
},
{
"published_at": "2024-08-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2973-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242973-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2947-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242947-1"
}
]
}
CERTFR-2024-AVI-0693
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une élévation de privilèges et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP5 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | openSUSE Leap Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-26558",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26558"
},
{
"name": "CVE-2021-0129",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0129"
},
{
"name": "CVE-2021-43389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43389"
},
{
"name": "CVE-2022-20368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20368"
},
{
"name": "CVE-2022-0854",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0854"
},
{
"name": "CVE-2022-2964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2964"
},
{
"name": "CVE-2022-28748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28748"
},
{
"name": "CVE-2023-1582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1582"
},
{
"name": "CVE-2023-37453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37453"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-24023",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24023"
},
{
"name": "CVE-2023-51780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51780"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52594"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2023-52612",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52612"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-26659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26659"
},
{
"name": "CVE-2023-52507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52507"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26800"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26750"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2024-26780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26780"
},
{
"name": "CVE-2024-26641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26641"
},
{
"name": "CVE-2023-52580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52580"
},
{
"name": "CVE-2024-26863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26863"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26615"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-26644",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26644"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2024-26623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26623"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2021-47219",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47219"
},
{
"name": "CVE-2021-47197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47197"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2021-47201",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47201"
},
{
"name": "CVE-2021-47194",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47194"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2023-52672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52672"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2024-35805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35805"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35934"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-26944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26944"
},
{
"name": "CVE-2024-27064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27064"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2021-4439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4439"
},
{
"name": "CVE-2021-47089",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47089"
},
{
"name": "CVE-2021-47103",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47103"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2021-47515",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47515"
},
{
"name": "CVE-2021-47539",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47539"
},
{
"name": "CVE-2021-47566",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47566"
},
{
"name": "CVE-2021-47571",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47571"
},
{
"name": "CVE-2021-47572",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47572"
},
{
"name": "CVE-2021-47576",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47576"
},
{
"name": "CVE-2021-47577",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47577"
},
{
"name": "CVE-2021-47578",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47578"
},
{
"name": "CVE-2021-47580",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47580"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2021-47583",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47583"
},
{
"name": "CVE-2021-47584",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47584"
},
{
"name": "CVE-2021-47585",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47585"
},
{
"name": "CVE-2021-47586",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47586"
},
{
"name": "CVE-2021-47587",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47587"
},
{
"name": "CVE-2021-47589",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47589"
},
{
"name": "CVE-2021-47592",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47592"
},
{
"name": "CVE-2021-47595",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47595"
},
{
"name": "CVE-2021-47596",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47596"
},
{
"name": "CVE-2021-47597",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47597"
},
{
"name": "CVE-2021-47600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47600"
},
{
"name": "CVE-2021-47601",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47601"
},
{
"name": "CVE-2021-47602",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47602"
},
{
"name": "CVE-2021-47603",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47603"
},
{
"name": "CVE-2021-47604",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47604"
},
{
"name": "CVE-2021-47605",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47605"
},
{
"name": "CVE-2021-47607",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47607"
},
{
"name": "CVE-2021-47608",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47608"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2021-47610",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47610"
},
{
"name": "CVE-2021-47611",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47611"
},
{
"name": "CVE-2021-47612",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47612"
},
{
"name": "CVE-2021-47614",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47614"
},
{
"name": "CVE-2021-47615",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47615"
},
{
"name": "CVE-2021-47616",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47616"
},
{
"name": "CVE-2021-47617",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47617"
},
{
"name": "CVE-2021-47618",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47618"
},
{
"name": "CVE-2021-47619",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47619"
},
{
"name": "CVE-2021-47620",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47620"
},
{
"name": "CVE-2022-48711",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48711"
},
{
"name": "CVE-2022-48712",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48712"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48714",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48714"
},
{
"name": "CVE-2022-48715",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48715"
},
{
"name": "CVE-2022-48716",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48716"
},
{
"name": "CVE-2022-48717",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48717"
},
{
"name": "CVE-2022-48718",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48718"
},
{
"name": "CVE-2022-48720",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48720"
},
{
"name": "CVE-2022-48721",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48721"
},
{
"name": "CVE-2022-48722",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48722"
},
{
"name": "CVE-2022-48723",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48723"
},
{
"name": "CVE-2022-48724",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48724"
},
{
"name": "CVE-2022-48725",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48725"
},
{
"name": "CVE-2022-48726",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48726"
},
{
"name": "CVE-2022-48727",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48727"
},
{
"name": "CVE-2022-48728",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48728"
},
{
"name": "CVE-2022-48729",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48729"
},
{
"name": "CVE-2022-48730",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48730"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48733",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48733"
},
{
"name": "CVE-2022-48734",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48734"
},
{
"name": "CVE-2022-48735",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48735"
},
{
"name": "CVE-2022-48736",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48736"
},
{
"name": "CVE-2022-48737",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48737"
},
{
"name": "CVE-2022-48738",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48738"
},
{
"name": "CVE-2022-48739",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48739"
},
{
"name": "CVE-2022-48740",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48740"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2022-48744",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48744"
},
{
"name": "CVE-2022-48745",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48745"
},
{
"name": "CVE-2022-48746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48746"
},
{
"name": "CVE-2022-48747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48747"
},
{
"name": "CVE-2022-48748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48748"
},
{
"name": "CVE-2022-48749",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48749"
},
{
"name": "CVE-2022-48751",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48751"
},
{
"name": "CVE-2022-48752",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48752"
},
{
"name": "CVE-2022-48753",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48753"
},
{
"name": "CVE-2022-48754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48754"
},
{
"name": "CVE-2022-48755",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48755"
},
{
"name": "CVE-2022-48756",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48756"
},
{
"name": "CVE-2022-48758",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48758"
},
{
"name": "CVE-2022-48759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48759"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2022-48761",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48761"
},
{
"name": "CVE-2022-48763",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48763"
},
{
"name": "CVE-2022-48765",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48765"
},
{
"name": "CVE-2022-48766",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48766"
},
{
"name": "CVE-2022-48767",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48767"
},
{
"name": "CVE-2022-48768",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48768"
},
{
"name": "CVE-2022-48769",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48769"
},
{
"name": "CVE-2022-48770",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48770"
},
{
"name": "CVE-2022-48771",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48771"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52846"
},
{
"name": "CVE-2023-52869",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52869"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36592"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38545"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47145",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47145"
},
{
"name": "CVE-2021-47547",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47547"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52765"
},
{
"name": "CVE-2023-52767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52767"
},
{
"name": "CVE-2023-52768",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52768"
},
{
"name": "CVE-2023-52769",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52769"
},
{
"name": "CVE-2023-52776",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52776"
},
{
"name": "CVE-2023-52780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52780"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52783",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52783"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52801"
},
{
"name": "CVE-2023-52812",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52812"
},
{
"name": "CVE-2023-52827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52827"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52850"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2023-52862",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52862"
},
{
"name": "CVE-2023-52863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52863"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2023-52874",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52874"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2023-52883",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52883"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38391"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39362",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39362"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2023-52751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52751"
},
{
"name": "CVE-2024-26785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26785"
},
{
"name": "CVE-2024-27402",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27402"
},
{
"name": "CVE-2024-27404",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27404"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2016-20022",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-20022"
},
{
"name": "CVE-2021-47086",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47086"
},
{
"name": "CVE-2021-47126",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47126"
},
{
"name": "CVE-2021-47186",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47186"
},
{
"name": "CVE-2021-47291",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47291"
},
{
"name": "CVE-2021-47295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47295"
},
{
"name": "CVE-2021-47546",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47546"
},
{
"name": "CVE-2021-47588",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47588"
},
{
"name": "CVE-2021-47590",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47590"
},
{
"name": "CVE-2021-47591",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47591"
},
{
"name": "CVE-2021-47593",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47593"
},
{
"name": "CVE-2021-47598",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47598"
},
{
"name": "CVE-2021-47599",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47599"
},
{
"name": "CVE-2021-47606",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47606"
},
{
"name": "CVE-2021-47622",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47622"
},
{
"name": "CVE-2021-47623",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47623"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2022-48774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48774"
},
{
"name": "CVE-2022-48775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48775"
},
{
"name": "CVE-2022-48776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48776"
},
{
"name": "CVE-2022-48777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48777"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48780"
},
{
"name": "CVE-2022-48783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48783"
},
{
"name": "CVE-2022-48784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48784"
},
{
"name": "CVE-2022-48785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48785"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48788",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48788"
},
{
"name": "CVE-2022-48789",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48789"
},
{
"name": "CVE-2022-48790",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48790"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48792",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48792"
},
{
"name": "CVE-2022-48793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48793"
},
{
"name": "CVE-2022-48794",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48794"
},
{
"name": "CVE-2022-48796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48796"
},
{
"name": "CVE-2022-48797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48797"
},
{
"name": "CVE-2022-48798",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48798"
},
{
"name": "CVE-2022-48799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48799"
},
{
"name": "CVE-2022-48800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48800"
},
{
"name": "CVE-2022-48801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48801"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48803"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2022-48805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48805"
},
{
"name": "CVE-2022-48806",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48806"
},
{
"name": "CVE-2022-48807",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48807"
},
{
"name": "CVE-2022-48809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48809"
},
{
"name": "CVE-2022-48810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48810"
},
{
"name": "CVE-2022-48811",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48811"
},
{
"name": "CVE-2022-48812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48812"
},
{
"name": "CVE-2022-48813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48813"
},
{
"name": "CVE-2022-48814",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48814"
},
{
"name": "CVE-2022-48815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48815"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2022-48817",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48817"
},
{
"name": "CVE-2022-48818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48818"
},
{
"name": "CVE-2022-48820",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48820"
},
{
"name": "CVE-2022-48821",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48821"
},
{
"name": "CVE-2022-48822",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48822"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48824"
},
{
"name": "CVE-2022-48825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48825"
},
{
"name": "CVE-2022-48826",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48826"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2022-48828",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48828"
},
{
"name": "CVE-2022-48829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48829"
},
{
"name": "CVE-2022-48830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48830"
},
{
"name": "CVE-2022-48831",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48831"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48838",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48838"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48840"
},
{
"name": "CVE-2022-48841",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48841"
},
{
"name": "CVE-2022-48842",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48842"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48844",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48844"
},
{
"name": "CVE-2022-48846",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48846"
},
{
"name": "CVE-2022-48847",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48847"
},
{
"name": "CVE-2022-48849",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48849"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48851"
},
{
"name": "CVE-2022-48852",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48852"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48855",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48855"
},
{
"name": "CVE-2022-48856",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48856"
},
{
"name": "CVE-2022-48857",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48857"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2022-48859",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48859"
},
{
"name": "CVE-2022-48860",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48860"
},
{
"name": "CVE-2022-48861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48861"
},
{
"name": "CVE-2022-48862",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48862"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2022-48864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48864"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2023-31315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31315"
},
{
"name": "CVE-2023-52573",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52573"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0693",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-16T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une \u00e9l\u00e9vation de privil\u00e8ges et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2911-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242911-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2894-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242894-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2892-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242892-1"
},
{
"published_at": "2024-08-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2923-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242923-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2939-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242939-1"
},
{
"published_at": "2024-08-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2929-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242929-1"
},
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2902-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242902-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2895-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242895-1"
},
{
"published_at": "2024-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2874-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242874-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2896-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242896-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2893-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242893-1"
},
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2901-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242901-1"
}
]
}
CERTFR-2024-AVI-0717
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | Public Cloud Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Software Development Kit 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 12 12-SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP6 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap 15.6 |
| Title | Publication Time | Tags | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Software Development Kit 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 12 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-26558",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26558"
},
{
"name": "CVE-2021-0129",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0129"
},
{
"name": "CVE-2022-20368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20368"
},
{
"name": "CVE-2022-2964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2964"
},
{
"name": "CVE-2022-28748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28748"
},
{
"name": "CVE-2023-1582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1582"
},
{
"name": "CVE-2023-37453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37453"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-51780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51780"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52594"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2023-52612",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52612"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-26659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26659"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26800"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-26737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26737"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2023-52616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52616"
},
{
"name": "CVE-2024-26750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26750"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26816"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2023-52640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52640"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2023-52641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52641"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2023-52635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52635"
},
{
"name": "CVE-2024-26774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26774"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26780"
},
{
"name": "CVE-2024-26731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26731"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2024-26641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26641"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2023-52503",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52503"
},
{
"name": "CVE-2023-52580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52580"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26863"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26861"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26978"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26615"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26883"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26885"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-27030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27030"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2024-27046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27046"
},
{
"name": "CVE-2024-26903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26903"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-27022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27022"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26650"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2024-26623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26623"
},
{
"name": "CVE-2024-26632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26632"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2021-47219",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47219"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2021-47197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47197"
},
{
"name": "CVE-2024-26856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26856"
},
{
"name": "CVE-2024-26881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26881"
},
{
"name": "CVE-2023-52652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52652"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2024-26972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26972"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2024-26836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26836"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26783"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2021-47194",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47194"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52681"
},
{
"name": "CVE-2023-52687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52687"
},
{
"name": "CVE-2023-52695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52695"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2023-52771",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52771"
},
{
"name": "CVE-2023-52772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52772"
},
{
"name": "CVE-2023-6238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6238"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26652",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26652"
},
{
"name": "CVE-2024-26657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26657"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2024-26786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26786"
},
{
"name": "CVE-2024-26794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26794"
},
{
"name": "CVE-2024-26832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26832"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26854"
},
{
"name": "CVE-2024-26858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26858"
},
{
"name": "CVE-2024-26860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26860"
},
{
"name": "CVE-2024-26868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26868"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26909"
},
{
"name": "CVE-2024-26932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26932"
},
{
"name": "CVE-2024-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26945"
},
{
"name": "CVE-2024-26946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26946"
},
{
"name": "CVE-2024-26949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26949"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-26963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26963"
},
{
"name": "CVE-2024-26986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26986"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-26991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26991"
},
{
"name": "CVE-2024-26995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26995"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-27067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27067"
},
{
"name": "CVE-2024-27080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27080"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2024-27411",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27411"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-35786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35786"
},
{
"name": "CVE-2024-35788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35788"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35800"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35841"
},
{
"name": "CVE-2024-35842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35842"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35883"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35909"
},
{
"name": "CVE-2024-35911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35911"
},
{
"name": "CVE-2024-35916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35916"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35921"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35928"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-35953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35953"
},
{
"name": "CVE-2024-35954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35954"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-35972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35972"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35975"
},
{
"name": "CVE-2024-35977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35977"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36018"
},
{
"name": "CVE-2024-36019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36019"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36885"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2023-52672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52672"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2024-35805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35805"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35934"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-26944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26944"
},
{
"name": "CVE-2024-27064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27064"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2021-47103",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47103"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2021-47580",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47580"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2021-47597",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47597"
},
{
"name": "CVE-2021-47600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47600"
},
{
"name": "CVE-2021-47619",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47619"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48730",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48730"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48749",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48749"
},
{
"name": "CVE-2022-48756",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48756"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52869",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52869"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36592"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47547",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47547"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52765"
},
{
"name": "CVE-2023-52767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52767"
},
{
"name": "CVE-2023-52768",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52768"
},
{
"name": "CVE-2023-52769",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52769"
},
{
"name": "CVE-2023-52776",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52776"
},
{
"name": "CVE-2023-52780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52780"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52783",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52783"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52801"
},
{
"name": "CVE-2023-52812",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52812"
},
{
"name": "CVE-2023-52827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52827"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52850"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2023-52862",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52862"
},
{
"name": "CVE-2023-52863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52863"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2023-52874",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52874"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2023-52883",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52883"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38391"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39362",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39362"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2023-52751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52751"
},
{
"name": "CVE-2024-26785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26785"
},
{
"name": "CVE-2024-27402",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27402"
},
{
"name": "CVE-2024-27404",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27404"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2021-47086",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47086"
},
{
"name": "CVE-2021-47126",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47126"
},
{
"name": "CVE-2021-47186",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47186"
},
{
"name": "CVE-2021-47291",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47291"
},
{
"name": "CVE-2021-47295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47295"
},
{
"name": "CVE-2021-47546",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47546"
},
{
"name": "CVE-2021-47588",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47588"
},
{
"name": "CVE-2021-47590",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47590"
},
{
"name": "CVE-2021-47591",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47591"
},
{
"name": "CVE-2021-47593",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47593"
},
{
"name": "CVE-2021-47598",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47598"
},
{
"name": "CVE-2021-47599",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47599"
},
{
"name": "CVE-2021-47606",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47606"
},
{
"name": "CVE-2021-47622",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47622"
},
{
"name": "CVE-2021-47623",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47623"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2022-48774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48774"
},
{
"name": "CVE-2022-48775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48775"
},
{
"name": "CVE-2022-48776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48776"
},
{
"name": "CVE-2022-48777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48777"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48780"
},
{
"name": "CVE-2022-48783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48783"
},
{
"name": "CVE-2022-48784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48784"
},
{
"name": "CVE-2022-48785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48785"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48788",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48788"
},
{
"name": "CVE-2022-48789",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48789"
},
{
"name": "CVE-2022-48790",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48790"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48792",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48792"
},
{
"name": "CVE-2022-48793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48793"
},
{
"name": "CVE-2022-48794",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48794"
},
{
"name": "CVE-2022-48796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48796"
},
{
"name": "CVE-2022-48797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48797"
},
{
"name": "CVE-2022-48798",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48798"
},
{
"name": "CVE-2022-48799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48799"
},
{
"name": "CVE-2022-48800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48800"
},
{
"name": "CVE-2022-48801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48801"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48803"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2022-48805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48805"
},
{
"name": "CVE-2022-48806",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48806"
},
{
"name": "CVE-2022-48807",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48807"
},
{
"name": "CVE-2022-48809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48809"
},
{
"name": "CVE-2022-48810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48810"
},
{
"name": "CVE-2022-48811",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48811"
},
{
"name": "CVE-2022-48812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48812"
},
{
"name": "CVE-2022-48813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48813"
},
{
"name": "CVE-2022-48814",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48814"
},
{
"name": "CVE-2022-48815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48815"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2022-48817",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48817"
},
{
"name": "CVE-2022-48818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48818"
},
{
"name": "CVE-2022-48820",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48820"
},
{
"name": "CVE-2022-48821",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48821"
},
{
"name": "CVE-2022-48822",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48822"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48824"
},
{
"name": "CVE-2022-48825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48825"
},
{
"name": "CVE-2022-48826",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48826"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2022-48828",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48828"
},
{
"name": "CVE-2022-48829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48829"
},
{
"name": "CVE-2022-48830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48830"
},
{
"name": "CVE-2022-48831",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48831"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48838",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48838"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48840"
},
{
"name": "CVE-2022-48841",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48841"
},
{
"name": "CVE-2022-48842",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48842"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48844",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48844"
},
{
"name": "CVE-2022-48846",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48846"
},
{
"name": "CVE-2022-48847",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48847"
},
{
"name": "CVE-2022-48849",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48849"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48851"
},
{
"name": "CVE-2022-48852",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48852"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48855",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48855"
},
{
"name": "CVE-2022-48856",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48856"
},
{
"name": "CVE-2022-48857",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48857"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2022-48859",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48859"
},
{
"name": "CVE-2022-48860",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48860"
},
{
"name": "CVE-2022-48861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48861"
},
{
"name": "CVE-2022-48862",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48862"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2022-48864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48864"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2023-31315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31315"
},
{
"name": "CVE-2023-52573",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52573"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0717",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-23T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-08-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2980-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242980-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2940-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242940-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2944-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242944-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2943-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242943-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2948-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242948-1"
},
{
"published_at": "2024-08-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2973-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242973-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2947-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242947-1"
}
]
}
BDU:2024-06614 (CVE-2022-48859)
Vulnerability from fstec – Published: 2024-09-03 – Updated: 2024-10-08 – View on bdu.fstec.ru Fixed- CWE-401 - Неправильное освобождение памяти перед удалением последней ссылки («утечка памяти»)
{
"CVSS 2.0": "AV:L/AC:L/Au:S/C:N/I:N/A:C",
"CVSS 3.0": "AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"CVSS 4.0": null,
"remediation_\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": null,
"remediation_\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435": null,
"\u0412\u0435\u043d\u0434\u043e\u0440 \u041f\u041e": "\u041e\u041e\u041e \u00ab\u0420\u0435\u0434 \u0421\u043e\u0444\u0442\u00bb, \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0412\u0435\u0440\u0441\u0438\u044f \u041f\u041e": "7.3 (\u0420\u0415\u0414 \u041e\u0421), \u043e\u0442 5.16 \u0434\u043e 5.16.15 (Linux), \u043e\u0442 5.10 \u0434\u043e 5.15.29 (Linux)",
"\u0412\u043e\u0437\u043c\u043e\u0436\u043d\u044b\u0435 \u043c\u0435\u0440\u044b \u043f\u043e \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044e": "\u0414\u043b\u044f Linux:\nhttps://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b \nhttps://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7 \nhttps://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36\n\u0414\u043b\u044f \u0420\u0435\u0434\u041e\u0421: http://repo.red-soft.ru/redos/7.3c/x86_64/updates/",
"\u0414\u0430\u0442\u0430 \u0432\u044b\u044f\u0432\u043b\u0435\u043d\u0438\u044f": "16.07.2024",
"\u0414\u0430\u0442\u0430 \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0433\u043e \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f": "08.10.2024",
"\u0414\u0430\u0442\u0430 \u043f\u0443\u0431\u043b\u0438\u043a\u0430\u0446\u0438\u0438": "03.09.2024",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": "BDU:2024-06614",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440\u044b \u0434\u0440\u0443\u0433\u0438\u0445 \u0441\u0438\u0441\u0442\u0435\u043c \u043e\u043f\u0438\u0441\u0430\u043d\u0438\u0439 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "CVE-2022-48859",
"\u0418\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f \u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0430",
"\u041a\u043b\u0430\u0441\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u0434\u0430",
"\u041d\u0430\u0437\u0432\u0430\u043d\u0438\u0435 \u041f\u041e": "\u0420\u0415\u0414 \u041e\u0421 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21163751), Linux",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u041e\u0421 \u0438 \u0442\u0438\u043f \u0430\u043f\u043f\u0430\u0440\u0430\u0442\u043d\u043e\u0439 \u043f\u043b\u0430\u0442\u0444\u043e\u0440\u043c\u044b": "\u041e\u041e\u041e \u00ab\u0420\u0435\u0434 \u0421\u043e\u0444\u0442\u00bb \u0420\u0415\u0414 \u041e\u0421 7.3 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21163751), \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.16 \u0434\u043e 5.16.15 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.10 \u0434\u043e 5.15.29 ",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u043c\u043f\u043e\u043d\u0435\u043d\u0442\u0430 prestera \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux, \u043f\u043e\u0437\u0432\u043e\u043b\u044f\u044e\u0449\u0430\u044f \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041d\u0430\u043b\u0438\u0447\u0438\u0435 \u044d\u043a\u0441\u043f\u043b\u043e\u0439\u0442\u0430": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "\u041d\u0435\u043f\u0440\u0430\u0432\u0438\u043b\u044c\u043d\u043e\u0435 \u043e\u0441\u0432\u043e\u0431\u043e\u0436\u0434\u0435\u043d\u0438\u0435 \u043f\u0430\u043c\u044f\u0442\u0438 \u043f\u0435\u0440\u0435\u0434 \u0443\u0434\u0430\u043b\u0435\u043d\u0438\u0435\u043c \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0439 \u0441\u0441\u044b\u043b\u043a\u0438 (\u00ab\u0443\u0442\u0435\u0447\u043a\u0430 \u043f\u0430\u043c\u044f\u0442\u0438\u00bb) (CWE-401)",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u043c\u043f\u043e\u043d\u0435\u043d\u0442\u0430 prestera \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux \u0441\u0432\u044f\u0437\u0430\u043d\u0430 \u0441 \u043e\u0442\u0441\u0443\u0442\u0441\u0442\u0432\u0438\u0435\u043c \u043e\u0441\u0432\u043e\u0431\u043e\u0436\u0434\u0435\u043d\u0438\u044f \u043f\u0430\u043c\u044f\u0442\u0438 \u043f\u043e\u0441\u043b\u0435 \u044d\u0444\u0444\u0435\u043a\u0442\u0438\u0432\u043d\u043e\u0433\u043e \u0441\u0440\u043e\u043a\u0430 \u0441\u043b\u0443\u0436\u0431\u044b. \u042d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u044f \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438 \u043c\u043e\u0436\u0435\u0442 \u043f\u043e\u0437\u0432\u043e\u043b\u0438\u0442\u044c \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041f\u043e\u0441\u043b\u0435\u0434\u0441\u0442\u0432\u0438\u044f \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": null,
"\u041f\u0440\u043e\u0447\u0430\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f": null,
"\u0421\u0432\u044f\u0437\u044c \u0441 \u0438\u043d\u0446\u0438\u0434\u0435\u043d\u0442\u0430\u043c\u0438 \u0418\u0411": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041e\u043f\u0443\u0431\u043b\u0438\u043a\u043e\u0432\u0430\u043d\u0430",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044f": "\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438": "\u0418\u0441\u0447\u0435\u0440\u043f\u0430\u043d\u0438\u0435 \u0440\u0435\u0441\u0443\u0440\u0441\u043e\u0432",
"\u0421\u0441\u044b\u043b\u043a\u0438 \u043d\u0430 \u0438\u0441\u0442\u043e\u0447\u043d\u0438\u043a\u0438": "https://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b\nhttps://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7\nhttps://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36\nhttps://redos.red-soft.ru/support/secure/",
"\u0421\u0442\u0430\u0442\u0443\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041f\u043e\u0434\u0442\u0432\u0435\u0440\u0436\u0434\u0435\u043d\u0430 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u0435\u043c",
"\u0422\u0438\u043f \u041f\u041e": "\u041e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u0430\u044f \u0441\u0438\u0441\u0442\u0435\u043c\u0430",
"\u0422\u0438\u043f \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "CWE-401",
"\u0423\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 2.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 4,6)\n\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 3.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 5,5)"
}
FKIE_CVE-2022-48859
Vulnerability from fkie_nvd - Published: 2024-07-16 13:15 - Updated: 2026-06-17 05:16| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/net/ethernet/marvell/prestera/prestera_main.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "b7c2fd1d126329340639adfb8dd2938fe4b65df7",
"status": "affected",
"version": "501ef3066c89d7f9045315e1be58749cf9e6814d",
"versionType": "git"
},
{
"lessThan": "4cc66bf17220ff9631f9fa99b02a872e0ad5a08b",
"status": "affected",
"version": "501ef3066c89d7f9045315e1be58749cf9e6814d",
"versionType": "git"
},
{
"lessThan": "c9ffa3e2bc451816ce0295e40063514fabf2bd36",
"status": "affected",
"version": "501ef3066c89d7f9045315e1be58749cf9e6814d",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/net/ethernet/marvell/prestera/prestera_main.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.10"
},
{
"lessThan": "5.10",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.29",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.16.*",
"status": "unaffected",
"version": "5.16.15",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "5.17",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "88937CAB-8166-494A-8CFE-8970F9B81F69",
"versionEndExcluding": "5.15.29",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "83FDEDF2-0E19-4879-91FD-171E66D1B335",
"versionEndExcluding": "5.16.15",
"versionStartIncluding": "5.16",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nnet: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr\n\nThis node pointer is returned by of_find_compatible_node() with\nrefcount incremented. Calling of_node_put() to aovid the refcount leak."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: net: marvell: prestera: Agregar falta of_node_put() en prestera_switch_set_base_mac_addr Este puntero de nodo lo devuelve of_find_compatible_node() con refcount incrementado. Llamar a of_node_put() para evitar la fuga de recuento."
}
],
"id": "CVE-2022-48859",
"lastModified": "2026-06-17T05:16:24.130",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2022-48859",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T16:25:39.171520Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-07-16T13:15:12.873",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-401"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-8RJJ-J4HJ-JC98
Vulnerability from github – Published: 2024-07-16 15:30 – Updated: 2024-07-23 15:31In the Linux kernel, the following vulnerability has been resolved:
net: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr
This node pointer is returned by of_find_compatible_node() with refcount incremented. Calling of_node_put() to aovid the refcount leak.
{
"affected": [],
"aliases": [
"CVE-2022-48859"
],
"database_specific": {
"cwe_ids": [
"CWE-401"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-07-16T13:15:12Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nnet: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr\n\nThis node pointer is returned by of_find_compatible_node() with\nrefcount incremented. Calling of_node_put() to aovid the refcount leak.",
"id": "GHSA-8rjj-j4hj-jc98",
"modified": "2024-07-23T15:31:08Z",
"published": "2024-07-16T15:30:50Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48859"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/4cc66bf17220ff9631f9fa99b02a872e0ad5a08b"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/b7c2fd1d126329340639adfb8dd2938fe4b65df7"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/c9ffa3e2bc451816ce0295e40063514fabf2bd36"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2024-1941 (CVE-2021-47205)
Vulnerability from osv_openeuler – Published: 2024-08-02 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
clk: sunxi-ng: Unregister clocks/resets when unbinding
Currently, unbinding a CCU driver unmaps the device's MMIO region, while leaving its clocks/resets and their providers registered. This can cause a page fault later when some clock operation tries to perform MMIO. Fix this by separating the CCU initialization from the memory allocation, and then using a devres callback to unregister the clocks and resets.
This also fixes a memory leak of the struct ccu_reset, and uses the
correct owner (the specific platform driver) for the clocks and resets.
Early OF clock providers are never unregistered, and limited error handling is possible, so they are mostly unchanged. The error reporting is made more consistent by moving the message inside of_sunxi_ccu_probe.(CVE-2021-47205)
In the Linux kernel, the following vulnerability has been resolved:
thermal/int340x_thermal: handle data_vault when the value is ZERO_SIZE_PTR
In some case, the GDDV returns a package with a buffer which has zero length. It causes that kmemdup() returns ZERO_SIZE_PTR (0x10).
Then the data_vault_read() got NULL point dereference problem when accessing the 0x10 value in data_vault.
[ 71.024560] BUG: kernel NULL pointer dereference, address: 0000000000000010
This patch uses ZERO_OR_NULL_PTR() for checking ZERO_SIZE_PTR or NULL value in data_vault.(CVE-2022-48703)
In the Linux kernel, the following vulnerability has been resolved:
net/smc: Avoid overwriting the copies of clcsock callback functions
The callback functions of clcsock will be saved and replaced during the fallback. But if the fallback happens more than once, then the copies of these callback functions will be overwritten incorrectly, resulting in a loop call issue:
clcsk->sk_error_report |- smc_fback_error_report() <------------------------------| |- smc_fback_forward_wakeup() | (loop) |- clcsock_callback() (incorrectly overwritten) | |- smc->clcsk_error_report() ------------------|
So this patch fixes the issue by saving these function pointers only once in the fallback and avoiding overwriting.(CVE-2022-48780)
In the Linux kernel, the following vulnerability has been resolved:
net: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr
This node pointer is returned by of_find_compatible_node() with refcount incremented. Calling of_node_put() to aovid the refcount leak.(CVE-2022-48859)
In the Linux kernel, the following vulnerability has been resolved:
of: Fix double free in of_parse_phandle_with_args_map
In of_parse_phandle_with_args_map() the inner loop that iterates through the map entries calls of_node_put(new) to free the reference acquired by the previous iteration of the inner loop. This assumes that the value of "new" is NULL on the first iteration of the inner loop.
Make sure that this is true in all iterations of the outer loop by setting "new" to NULL after its value is assigned to "cur".
Extend the unittest to detect the double free and add an additional test case that actually triggers this path.(CVE-2023-52679)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nft_set_pipapo: do not free live element
Pablo reports a crash with large batches of elements with a back-to-back add/remove pattern. Quoting Pablo:
add_elem("00000000") timeout 100 ms ... add_elem("0000000X") timeout 100 ms del_elem("0000000X") <---------------- delete one that was just added ... add_elem("00005000") timeout 100 ms
1) nft_pipapo_remove() removes element 0000000X Then, KASAN shows a splat.
Looking at the remove function there is a chance that we will drop a rule that maps to a non-deactivated element.
Removal happens in two steps, first we do a lookup for key k and return the to-be-removed element and mark it as inactive in the next generation. Then, in a second step, the element gets removed from the set/map.
The _remove function does not work correctly if we have more than one element that share the same key.
This can happen if we insert an element into a set when the set already holds an element with same key, but the element mapping to the existing key has timed out or is not active in the next generation.
In such case its possible that removal will unmap the wrong element. If this happens, we will leak the non-deactivated element, it becomes unreachable.
The element that got deactivated (and will be freed later) will remain reachable in the set data structure, this can result in a crash when such an element is retrieved during lookup (stale pointer).
Add a check that the fully matching key does in fact map to the element that we have marked as inactive in the deactivation step. If not, we need to continue searching.
Add a bug/warn trap at the end of the function as well, the remove function must not ever be called with an invisible/unreachable/non-existent element.
v2: avoid uneeded temporary variable (Stefano)(CVE-2024-26924)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_tables: release mutex after nft_gc_seq_end from abort path
The commit mutex should not be released during the critical section between nft_gc_seq_begin() and nft_gc_seq_end(), otherwise, async GC worker could collect expired objects and get the released commit lock within the same GC sequence.
nf_tables_module_autoload() temporarily releases the mutex to load module dependencies, then it goes back to replay the transaction again. Move it at the end of the abort phase after nft_gc_seq_end() is called.(CVE-2024-26925)
In the Linux kernel, the following vulnerability has been resolved:
net/sched: Fix mirred deadlock on device recursion
When the mirred action is used on a classful egress qdisc and a packet is mirrored or redirected to self we hit a qdisc lock deadlock. See trace below.
[..... other info removed for brevity....] [ 82.890906] [ 82.890906] ============================================ [ 82.890906] WARNING: possible recursive locking detected [ 82.890906] 6.8.0-05205-g77fadd89fe2d-dirty #213 Tainted: G W [ 82.890906] -------------------------------------------- [ 82.890906] ping/418 is trying to acquire lock: [ 82.890906] ffff888006994110 (&sch->q.lock){+.-.}-{3:3}, at: __dev_queue_xmit+0x1778/0x3550 [ 82.890906] [ 82.890906] but task is already holding lock: [ 82.890906] ffff888006994110 (&sch->q.lock){+.-.}-{3:3}, at: __dev_queue_xmit+0x1778/0x3550 [ 82.890906] [ 82.890906] other info that might help us debug this: [ 82.890906] Possible unsafe locking scenario: [ 82.890906] [ 82.890906] CPU0 [ 82.890906] ---- [ 82.890906] lock(&sch->q.lock); [ 82.890906] lock(&sch->q.lock); [ 82.890906] [ 82.890906] *** DEADLOCK *** [ 82.890906] [..... other info removed for brevity....]
Example setup (eth0->eth0) to recreate tc qdisc add dev eth0 root handle 1: htb default 30 tc filter add dev eth0 handle 1: protocol ip prio 2 matchall \ action mirred egress redirect dev eth0
Another example(eth0->eth1->eth0) to recreate tc qdisc add dev eth0 root handle 1: htb default 30 tc filter add dev eth0 handle 1: protocol ip prio 2 matchall \ action mirred egress redirect dev eth1
tc qdisc add dev eth1 root handle 1: htb default 30 tc filter add dev eth1 handle 1: protocol ip prio 2 matchall \ action mirred egress redirect dev eth0
We fix this by adding an owner field (CPU id) to struct Qdisc set after root qdisc is entered. When the softirq enters it a second time, if the qdisc owner is the same CPU, the packet is dropped to break the loop.(CVE-2024-27010)
In the Linux kernel, the following vulnerability has been resolved:
dma-mapping: benchmark: fix node id validation
While validating node ids in map_benchmark_ioctl(), node_possible() may be provided with invalid argument outside of [0,MAX_NUMNODES-1] range leading to:
BUG: KASAN: wild-memory-access in map_benchmark_ioctl (kernel/dma/map_benchmark.c:214) Read of size 8 at addr 1fffffff8ccb6398 by task dma_map_benchma/971 CPU: 7 PID: 971 Comm: dma_map_benchma Not tainted 6.9.0-rc6 #37 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996) Call Trace: <TASK> dump_stack_lvl (lib/dump_stack.c:117) kasan_report (mm/kasan/report.c:603) kasan_check_range (mm/kasan/generic.c:189) variable_test_bit (arch/x86/include/asm/bitops.h:227) [inline] arch_test_bit (arch/x86/include/asm/bitops.h:239) [inline] _test_bit at (include/asm-generic/bitops/instrumented-non-atomic.h:142) [inline] node_state (include/linux/nodemask.h:423) [inline] map_benchmark_ioctl (kernel/dma/map_benchmark.c:214) full_proxy_unlocked_ioctl (fs/debugfs/file.c:333) __x64_sys_ioctl (fs/ioctl.c:890) do_syscall_64 (arch/x86/entry/common.c:83) entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
Compare node ids with sane bounds first. NUMA_NO_NODE is considered a special valid case meaning that benchmarking kthreads won't be bound to a cpuset of a given node.
Found by Linux Verification Center (linuxtesting.org).(CVE-2024-34777)
In the Linux kernel, the following vulnerability has been resolved:
md/dm-raid: don't call md_reap_sync_thread() directly
Currently md_reap_sync_thread() is called from raid_message() directly without holding 'reconfig_mutex', this is definitely unsafe because md_reap_sync_thread() can change many fields that is protected by 'reconfig_mutex'.
However, hold 'reconfig_mutex' here is still problematic because this will cause deadlock, for example, commit 130443d60b1b ("md: refactor idle/frozen_sync_thread() to fix deadlock").
Fix this problem by using stop_sync_thread() to unregister sync_thread, like md/raid did.(CVE-2024-35808)
In the Linux kernel, the following vulnerability has been resolved:
net: mvpp2: clear BM pool before initialization
Register value persist after booting the kernel using kexec which results in kernel panic. Thus clear the BM pool registers before initialisation to fix the issue.(CVE-2024-35837)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_tables: flush pending destroy work before exit_net release
Similar to 2c9f0293280e ("netfilter: nf_tables: flush pending destroy work before netlink notifier") to address a race between exit_net and the destroy workqueue.
The trace below shows an element to be released via destroy workqueue while exit_net path (triggered via module removal) has already released the set that is used in such transaction.
[ 1360.547789] BUG: KASAN: slab-use-after-free in nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables] [ 1360.547861] Read of size 8 at addr ffff888140500cc0 by task kworker/4:1/152465 [ 1360.547870] CPU: 4 PID: 152465 Comm: kworker/4:1 Not tainted 6.8.0+ #359 [ 1360.547882] Workqueue: events nf_tables_trans_destroy_work [nf_tables] [ 1360.547984] Call Trace: [ 1360.547991] <TASK> [ 1360.547998] dump_stack_lvl+0x53/0x70 [ 1360.548014] print_report+0xc4/0x610 [ 1360.548026] ? __virt_addr_valid+0xba/0x160 [ 1360.548040] ? __pfx__raw_spin_lock_irqsave+0x10/0x10 [ 1360.548054] ? nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables] [ 1360.548176] kasan_report+0xae/0xe0 [ 1360.548189] ? nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables] [ 1360.548312] nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables] [ 1360.548447] ? __pfx_nf_tables_trans_destroy_work+0x10/0x10 [nf_tables] [ 1360.548577] ? _raw_spin_unlock_irq+0x18/0x30 [ 1360.548591] process_one_work+0x2f1/0x670 [ 1360.548610] worker_thread+0x4d3/0x760 [ 1360.548627] ? __pfx_worker_thread+0x10/0x10 [ 1360.548640] kthread+0x16b/0x1b0 [ 1360.548653] ? __pfx_kthread+0x10/0x10 [ 1360.548665] ret_from_fork+0x2f/0x50 [ 1360.548679] ? __pfx_kthread+0x10/0x10 [ 1360.548690] ret_from_fork_asm+0x1a/0x30 [ 1360.548707] </TASK>
[ 1360.548719] Allocated by task 192061: [ 1360.548726] kasan_save_stack+0x20/0x40 [ 1360.548739] kasan_save_track+0x14/0x30 [ 1360.548750] __kasan_kmalloc+0x8f/0xa0 [ 1360.548760] __kmalloc_node+0x1f1/0x450 [ 1360.548771] nf_tables_newset+0x10c7/0x1b50 [nf_tables] [ 1360.548883] nfnetlink_rcv_batch+0xbc4/0xdc0 [nfnetlink] [ 1360.548909] nfnetlink_rcv+0x1a8/0x1e0 [nfnetlink] [ 1360.548927] netlink_unicast+0x367/0x4f0 [ 1360.548935] netlink_sendmsg+0x34b/0x610 [ 1360.548944] _syssendmsg+0x4d4/0x510 [ 1360.548953] _sys_sendmsg+0xc9/0x120 [ 1360.548961] __sys_sendmsg+0xbe/0x140 [ 1360.548971] do_syscall_64+0x55/0x120 [ 1360.548982] entry_SYSCALL_64_after_hwframe+0x55/0x5d
[ 1360.548994] Freed by task 192222: [ 1360.548999] kasan_save_stack+0x20/0x40 [ 1360.549009] kasan_save_track+0x14/0x30 [ 1360.549019] kasan_save_free_info+0x3b/0x60 [ 1360.549028] poison_slab_object+0x100/0x180 [ 1360.549036] __kasan_slab_free+0x14/0x30 [ 1360.549042] kfree+0xb6/0x260 [ 1360.549049] __nft_release_table+0x473/0x6a0 [nf_tables] [ 1360.549131] nf_tables_exit_net+0x170/0x240 [nf_tables] [ 1360.549221] ops_exit_list+0x50/0xa0 [ 1360.549229] free_exit_list+0x101/0x140 [ 1360.549236] unregister_pernet_operations+0x107/0x160 [ 1360.549245] unregister_pernet_subsys+0x1c/0x30 [ 1360.549254] nf_tables_module_exit+0x43/0x80 [nf_tables] [ 1360.549345] __do_sys_delete_module+0x253/0x370 [ 1360.549352] do_syscall_64+0x55/0x120 [ 1360.549360] entry_SYSCALL_64_after_hwframe+0x55/0x5d
(gdb) list *__nft_release_table+0x473 0x1e033 is in __nft_release_table (net/netfilter/nf_tables_api.c:11354). 11349 list_for_each_entry_safe(flowtable, nf, &table->flowtables, list) { 11350 list_del(&flowtable->list); 11351 nft_use_dec(&table->use); 11352 nf_tables_flowtable_destroy(flowtable); 11353 } 11354 list_for_each_entry_safe(set, ns, &table->sets, list) { 11355 list_del(&set->list); 11356 nft_use_dec(&table->use); 11357 if (set->flags & (NFT_SET_MAP | NFT_SET_OBJECT)) 11358 nft_map_deactivat ---truncated---(CVE-2024-35899)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu: Skip do PCI error slot reset during RAS recovery
Why: The PCI error slot reset maybe triggered after inject ue to UMC multi times, this caused system hang. [ 557.371857] amdgpu 0000:af:00.0: amdgpu: GPU reset succeeded, trying to resume [ 557.373718] [drm] PCIE GART of 512M enabled. [ 557.373722] [drm] PTB located at 0x0000031FED700000 [ 557.373788] [drm] VRAM is lost due to GPU reset! [ 557.373789] [drm] PSP is resuming... [ 557.547012] mlx5_core 0000:55:00.0: mlx5_pci_err_detected Device state = 1 pci_status: 0. Exit, result = 3, need reset [ 557.547067] [drm] PCI error: detected callback, state(1)!! [ 557.547069] [drm] No support for XGMI hive yet... [ 557.548125] mlx5_core 0000:55:00.0: mlx5_pci_slot_reset Device state = 1 pci_status: 0. Enter [ 557.607763] mlx5_core 0000:55:00.0: wait vital counter value 0x16b5b after 1 iterations [ 557.607777] mlx5_core 0000:55:00.0: mlx5_pci_slot_reset Device state = 1 pci_status: 1. Exit, err = 0, result = 5, recovered [ 557.610492] [drm] PCI error: slot reset callback!! ... [ 560.689382] amdgpu 0000:3f:00.0: amdgpu: GPU reset(2) succeeded! [ 560.689546] amdgpu 0000:5a:00.0: amdgpu: GPU reset(2) succeeded! [ 560.689562] general protection fault, probably for non-canonical address 0x5f080b54534f611f: 0000 [#1] SMP NOPTI [ 560.701008] CPU: 16 PID: 2361 Comm: kworker/u448:9 Tainted: G OE 5.15.0-91-generic #101-Ubuntu [ 560.712057] Hardware name: Microsoft C278A/C278A, BIOS C2789.5.BS.1C11.AG.1 11/08/2023 [ 560.720959] Workqueue: amdgpu-reset-hive amdgpu_ras_do_recovery [amdgpu] [ 560.728887] RIP: 0010:amdgpu_device_gpu_recover.cold+0xbf1/0xcf5 [amdgpu] [ 560.736891] Code: ff 41 89 c6 e9 1b ff ff ff 44 0f b6 45 b0 e9 4f ff ff ff be 01 00 00 00 4c 89 e7 e8 76 c9 8b ff 44 0f b6 45 b0 e9 3c fd ff ff <48> 83 ba 18 02 00 00 00 0f 84 6a f8 ff ff 48 8d 7a 78 be 01 00 00 [ 560.757967] RSP: 0018:ffa0000032e53d80 EFLAGS: 00010202 [ 560.763848] RAX: ffa00000001dfd10 RBX: ffa0000000197090 RCX: ffa0000032e53db0 [ 560.771856] RDX: 5f080b54534f5f07 RSI: 0000000000000000 RDI: ff11000128100010 [ 560.779867] RBP: ffa0000032e53df0 R08: 0000000000000000 R09: ffffffffffe77f08 [ 560.787879] R10: 0000000000ffff0a R11: 0000000000000001 R12: 0000000000000000 [ 560.795889] R13: ffa0000032e53e00 R14: 0000000000000000 R15: 0000000000000000 [ 560.803889] FS: 0000000000000000(0000) GS:ff11007e7e800000(0000) knlGS:0000000000000000 [ 560.812973] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 560.819422] CR2: 000055a04c118e68 CR3: 0000000007410005 CR4: 0000000000771ee0 [ 560.827433] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 [ 560.835433] DR3: 0000000000000000 DR6: 00000000fffe07f0 DR7: 0000000000000400 [ 560.843444] PKRU: 55555554 [ 560.846480] Call Trace: [ 560.849225] <TASK> [ 560.851580] ? show_trace_log_lvl+0x1d6/0x2ea [ 560.856488] ? show_trace_log_lvl+0x1d6/0x2ea [ 560.861379] ? amdgpu_ras_do_recovery+0x1b2/0x210 [amdgpu] [ 560.867778] ? show_regs.part.0+0x23/0x29 [ 560.872293] ? __die_body.cold+0x8/0xd [ 560.876502] ? die_addr+0x3e/0x60 [ 560.880238] ? exc_general_protection+0x1c5/0x410 [ 560.885532] ? asm_exc_general_protection+0x27/0x30 [ 560.891025] ? amdgpu_device_gpu_recover.cold+0xbf1/0xcf5 [amdgpu] [ 560.898323] amdgpu_ras_do_recovery+0x1b2/0x210 [amdgpu] [ 560.904520] process_one_work+0x228/0x3d0 How: In RAS recovery, mode-1 reset is issued from RAS fatal error handling and expected all the nodes in a hive to be reset. no need to issue another mode-1 during this procedure.(CVE-2024-35931)
In the Linux kernel, the following vulnerability has been resolved:
fs/9p: fix uninitialized values during inode evict
If an iget fails due to not being able to retrieve information from the server then the inode structure is only partially initialized. When the inode gets evicted, references to uninitialized structures (like fscache cookies) were being made.
This patch checks for a bad_inode before doing anything other than clearing the inode from the cache. Since the inode is bad, it shouldn't have any state associated with it that needs to be written back (and there really isn't a way to complete those anyways).(CVE-2024-36923)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: fix potential kernel bug due to lack of writeback flag waiting
Destructive writes to a block device on which nilfs2 is mounted can cause a kernel bug in the folio/page writeback start routine or writeback end routine (__folio_start_writeback in the log below):
kernel BUG at mm/page-writeback.c:3070! Oops: invalid opcode: 0000 [#1] PREEMPT SMP KASAN PTI ... RIP: 0010:__folio_start_writeback+0xbaa/0x10e0 Code: 25 ff 0f 00 00 0f 84 18 01 00 00 e8 40 ca c6 ff e9 17 f6 ff ff e8 36 ca c6 ff 4c 89 f7 48 c7 c6 80 c0 12 84 e8 e7 b3 0f 00 90 <0f> 0b e8 1f ca c6 ff 4c 89 f7 48 c7 c6 a0 c6 12 84 e8 d0 b3 0f 00 ... Call Trace: <TASK> nilfs_segctor_do_construct+0x4654/0x69d0 [nilfs2] nilfs_segctor_construct+0x181/0x6b0 [nilfs2] nilfs_segctor_thread+0x548/0x11c0 [nilfs2] kthread+0x2f0/0x390 ret_from_fork+0x4b/0x80 ret_from_fork_asm+0x1a/0x30 </TASK>
This is because when the log writer starts a writeback for segment summary blocks or a super root block that use the backing device's page cache, it does not wait for the ongoing folio/page writeback, resulting in an inconsistent writeback state.
Fix this issue by waiting for ongoing writebacks when putting folios/pages on the backing device into writeback state.(CVE-2024-37078)
In the Linux kernel, the following vulnerability has been resolved:
drm: bridge: cdns-mhdp8546: Fix possible null pointer dereference
In cdns_mhdp_atomic_enable(), the return value of drm_mode_duplicate() is assigned to mhdp_state->current_mode, and there is a dereference of it in drm_mode_set_name(), which will lead to a NULL pointer dereference on failure of drm_mode_duplicate().
Fix this bug add a check of mhdp_state->current_mode.(CVE-2024-38548)
In the Linux kernel, the following vulnerability has been resolved:
wifi: carl9170: add a proper sanity check for endpoints
Syzkaller reports [1] hitting a warning which is caused by presence of a wrong endpoint type at the URB sumbitting stage. While there was a check for a specific 4th endpoint, since it can switch types between bulk and interrupt, other endpoints are trusted implicitly. Similar warning is triggered in a couple of other syzbot issues [2].
Fix the issue by doing a comprehensive check of all endpoints taking into account difference between high- and full-speed configuration.
[1] Syzkaller report: ... WARNING: CPU: 0 PID: 4721 at drivers/usb/core/urb.c:504 usb_submit_urb+0xed6/0x1880 drivers/usb/core/urb.c:504 ... Call Trace: <TASK> carl9170_usb_send_rx_irq_urb+0x273/0x340 drivers/net/wireless/ath/carl9170/usb.c:504 carl9170_usb_init_device drivers/net/wireless/ath/carl9170/usb.c:939 [inline] carl9170_usb_firmware_finish drivers/net/wireless/ath/carl9170/usb.c:999 [inline] carl9170_usb_firmware_step2+0x175/0x240 drivers/net/wireless/ath/carl9170/usb.c:1028 request_firmware_work_func+0x130/0x240 drivers/base/firmware_loader/main.c:1107 process_one_work+0x9bf/0x1710 kernel/workqueue.c:2289 worker_thread+0x669/0x1090 kernel/workqueue.c:2436 kthread+0x2e8/0x3a0 kernel/kthread.c:376 ret_from_fork+0x1f/0x30 arch/x86/entry/entry_64.S:308 </TASK>
[2] Related syzkaller crashes:(CVE-2024-38567)
In the Linux kernel, the following vulnerability has been resolved:
macintosh/via-macii: Fix "BUG: sleeping function called from invalid context"
The via-macii ADB driver calls request_irq() after disabling hard interrupts. But disabling interrupts isn't necessary here because the VIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)
In the Linux kernel, the following vulnerability has been resolved:
media: i2c: et8ek8: Don't strip remove function when driver is builtin
Using __exit for the remove function results in the remove callback being discarded with CONFIG_VIDEO_ET8EK8=y. When such a device gets unbound (e.g. using sysfs or hotplug), the driver is just removed without the cleanup being performed. This results in resource leaks. Fix it by compiling in the remove callback unconditionally.
This also fixes a W=1 modpost warning:
WARNING: modpost: drivers/media/i2c/et8ek8/et8ek8: section mismatch in reference: et8ek8_i2c_driver+0x10 (section: .data) -> et8ek8_remove (section: .exit.text)(CVE-2024-38611)
In the Linux kernel, the following vulnerability has been resolved:
media: stk1160: fix bounds checking in stk1160_copy_video()
The subtract in this condition is reversed. The ->length is the length of the buffer. The ->bytesused is how many bytes we have copied thus far. When the condition is reversed that means the result of the subtraction is always negative but since it's unsigned then the result is a very high positive value. That means the overflow check is never true.
Additionally, the ->bytesused doesn't actually work for this purpose because we're not writing to "buf->mem + buf->bytesused". Instead, the math to calculate the destination where we are writing is a bit involved. You calculate the number of full lines already written, multiply by two, skip a line if necessary so that we start on an odd numbered line, and add the offset into the line.
To fix this buffer overflow, just take the actual destination where we are writing, if the offset is already out of bounds print an error and return. Otherwise, write up to buf->length bytes.(CVE-2024-38621)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: savage: Handle err return when savagefb_check_var failed
The commit 04e5eac8f3ab("fbdev: savage: Error out if pixclock equals zero") checks the value of pixclock to avoid divide-by-zero error. However the function savagefb_probe doesn't handle the error return of savagefb_check_var. When pixclock is 0, it will cause divide-by-zero error.(CVE-2024-39475)
In the Linux kernel, the following vulnerability has been resolved:
md/raid5: fix deadlock that raid5d() wait for itself to clear MD_SB_CHANGE_PENDING
Xiao reported that lvm2 test lvconvert-raid-takeover.sh can hang with small possibility, the root cause is exactly the same as commit bed9e27baf52 ("Revert "md/raid5: Wait for MD_SB_CHANGE_PENDING in raid5d"")
However, Dan reported another hang after that, and junxiao investigated the problem and found out that this is caused by plugged bio can't issue from raid5d().
Current implementation in raid5d() has a weird dependence:
1) md_check_recovery() from raid5d() must hold 'reconfig_mutex' to clear MD_SB_CHANGE_PENDING; 2) raid5d() handles IO in a deadloop, until all IO are issued; 3) IO from raid5d() must wait for MD_SB_CHANGE_PENDING to be cleared;
This behaviour is introduce before v2.6, and for consequence, if other context hold 'reconfig_mutex', and md_check_recovery() can't update super_block, then raid5d() will waste one cpu 100% by the deadloop, until 'reconfig_mutex' is released.
Refer to the implementation from raid1 and raid10, fix this problem by skipping issue IO if MD_SB_CHANGE_PENDING is still set after md_check_recovery(), daemon thread will be woken up when 'reconfig_mutex' is released. Meanwhile, the hang problem will be fixed as well.(CVE-2024-39476)
In the Linux kernel, the following vulnerability has been resolved:
mmc: davinci: Don't strip remove function when driver is builtin
Using __exit for the remove function results in the remove callback being discarded with CONFIG_MMC_DAVINCI=y. When such a device gets unbound (e.g. using sysfs or hotplug), the driver is just removed without the cleanup being performed. This results in resource leaks. Fix it by compiling in the remove callback unconditionally.
This also fixes a W=1 modpost warning:
WARNING: modpost: drivers/mmc/host/davinci_mmc: section mismatch in reference: davinci_mmcsd_driver+0x10 (section: .data) -> davinci_mmcsd_remove (section: .exit.text)(CVE-2024-39484)
In the Linux kernel, the following vulnerability has been resolved:
liquidio: Adjust a NULL pointer handling path in lio_vf_rep_copy_packet
In lio_vf_rep_copy_packet() pg_info->page is compared to a NULL value, but then it is unconditionally passed to skb_add_rx_frag() which looks strange and could lead to null pointer dereference.
lio_vf_rep_copy_packet() call trace looks like: octeon_droq_process_packets octeon_droq_fast_process_packets octeon_droq_dispatch_pkt octeon_create_recv_info ...search in the dispatch_list... ->disp_fn(rdisp->rinfo, ...) lio_vf_rep_pkt_recv(struct octeon_recv_info *recv_info, ...) In this path there is no code which sets pg_info->page to NULL. So this check looks unneeded and doesn't solve potential problem. But I guess the author had reason to add a check and I have no such card and can't do real test. In addition, the code in the function liquidio_push_packet() in liquidio/lio_core.c does exactly the same.
Based on this, I consider the most acceptable compromise solution to adjust this issue by moving skb_add_rx_frag() into conditional scope.
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-39506)
In the Linux kernel, the following vulnerability has been resolved:
io_uring/io-wq: Use set_bit() and test_bit() at worker->flags
Utilize set_bit() and test_bit() on worker->flags within io_uring/io-wq to address potential data races.
The structure io_worker->flags may be accessed through various data paths, leading to concurrency issues. When KCSAN is enabled, it reveals data races occurring in io_worker_handle_work and io_wq_activate_free_worker functions.
BUG: KCSAN: data-race in io_worker_handle_work / io_wq_activate_free_worker
write to 0xffff8885c4246404 of 4 bytes by task 49071 on cpu 28:
io_worker_handle_work (io_uring/io-wq.c:434 io_uring/io-wq.c:569)
io_wq_worker (io_uring/io-wq.c:?)
<snip>
read to 0xffff8885c4246404 of 4 bytes by task 49024 on cpu 5:
io_wq_activate_free_worker (io_uring/io-wq.c:? io_uring/io-wq.c:285)
io_wq_enqueue (io_uring/io-wq.c:947)
io_queue_iowq (io_uring/io_uring.c:524)
io_req_task_submit (io_uring/io_uring.c:1511)
io_handle_tw_list (io_uring/io_uring.c:1198)
<snip>
Line numbers against commit 18daea77cca6 ("Merge tag 'for-linus' of git://git.kernel.org/pub/scm/virt/kvm/kvm").
These races involve writes and reads to the same memory location by different tasks running on different CPUs. To mitigate this, refactor the code to use atomic operations such as set_bit(), test_bit(), and clear_bit() instead of basic "and" and "or" operations. This ensures thread-safe manipulation of worker flags.
Also, move create_index to avoid holes in the structure.(CVE-2024-39508)
In the Linux kernel, the following vulnerability has been resolved:
riscv: rewrite __kernel_map_pages() to fix sleeping in invalid context
__kernel_map_pages() is a debug function which clears the valid bit in page table entry for deallocated pages to detect illegal memory accesses to freed pages.
This function set/clear the valid bit using __set_memory(). __set_memory() acquires init_mm's semaphore, and this operation may sleep. This is problematic, because __kernel_map_pages() can be called in atomic context, and thus is illegal to sleep. An example warning that this causes:
BUG: sleeping function called from invalid context at kernel/locking/rwsem.c:1578 in_atomic(): 1, irqs_disabled(): 0, non_block: 0, pid: 2, name: kthreadd preempt_count: 2, expected: 0 CPU: 0 PID: 2 Comm: kthreadd Not tainted 6.9.0-g1d4c6d784ef6 #37 Hardware name: riscv-virtio,qemu (DT) Call Trace: [<ffffffff800060dc>] dump_backtrace+0x1c/0x24 [<ffffffff8091ef6e>] show_stack+0x2c/0x38 [<ffffffff8092baf8>] dump_stack_lvl+0x5a/0x72 [<ffffffff8092bb24>] dump_stack+0x14/0x1c [<ffffffff8003b7ac>] __might_resched+0x104/0x10e [<ffffffff8003b7f4>] __might_sleep+0x3e/0x62 [<ffffffff8093276a>] down_write+0x20/0x72 [<ffffffff8000cf00>] __set_memory+0x82/0x2fa [<ffffffff8000d324>] __kernel_map_pages+0x5a/0xd4 [<ffffffff80196cca>] __alloc_pages_bulk+0x3b2/0x43a [<ffffffff8018ee82>] __vmalloc_node_range+0x196/0x6ba [<ffffffff80011904>] copy_process+0x72c/0x17ec [<ffffffff80012ab4>] kernel_clone+0x60/0x2fe [<ffffffff80012f62>] kernel_thread+0x82/0xa0 [<ffffffff8003552c>] kthreadd+0x14a/0x1be [<ffffffff809357de>] ret_from_fork+0xe/0x1c
Rewrite this function with apply_to_existing_page_range(). It is fine to not have any locking, because __kernel_map_pages() works with pages being allocated/deallocated and those pages are not changed by anyone else in the meantime.(CVE-2024-40915)
In the Linux kernel, the following vulnerability has been resolved:
iommu: Return right value in iommu_sva_bind_device()
iommu_sva_bind_device() should return either a sva bond handle or an ERR_PTR value in error cases. Existing drivers (idxd and uacce) only check the return value with IS_ERR(). This could potentially lead to a kernel NULL pointer dereference issue if the function returns NULL instead of an error pointer.
In reality, this doesn't cause any problems because iommu_sva_bind_device() only returns NULL when the kernel is not configured with CONFIG_IOMMU_SVA. In this case, iommu_dev_enable_feature(dev, IOMMU_DEV_FEAT_SVA) will return an error, and the device drivers won't call iommu_sva_bind_device() at all.(CVE-2024-40945)
In the Linux kernel, the following vulnerability has been resolved:
ima: Avoid blocking in RCU read-side critical section
A panic happens in ima_match_policy:
BUG: unable to handle kernel NULL pointer dereference at 0000000000000010 PGD 42f873067 P4D 0 Oops: 0000 [#1] SMP NOPTI CPU: 5 PID: 1286325 Comm: kubeletmonit.sh Kdump: loaded Tainted: P Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 0.0.0 02/06/2015 RIP: 0010:ima_match_policy+0x84/0x450 Code: 49 89 fc 41 89 cf 31 ed 89 44 24 14 eb 1c 44 39 7b 18 74 26 41 83 ff 05 74 20 48 8b 1b 48 3b 1d f2 b9 f4 00 0f 84 9c 01 00 00 <44> 85 73 10 74 ea 44 8b 6b 14 41 f6 c5 01 75 d4 41 f6 c5 02 74 0f RSP: 0018:ff71570009e07a80 EFLAGS: 00010207 RAX: 0000000000000000 RBX: 0000000000000000 RCX: 0000000000000200 RDX: ffffffffad8dc7c0 RSI: 0000000024924925 RDI: ff3e27850dea2000 RBP: 0000000000000000 R08: 0000000000000000 R09: ffffffffabfce739 R10: ff3e27810cc42400 R11: 0000000000000000 R12: ff3e2781825ef970 R13: 00000000ff3e2785 R14: 000000000000000c R15: 0000000000000001 FS: 00007f5195b51740(0000) GS:ff3e278b12d40000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000000000000010 CR3: 0000000626d24002 CR4: 0000000000361ee0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: ima_get_action+0x22/0x30 process_measurement+0xb0/0x830 ? page_add_file_rmap+0x15/0x170 ? alloc_set_pte+0x269/0x4c0 ? prep_new_page+0x81/0x140 ? simple_xattr_get+0x75/0xa0 ? selinux_file_open+0x9d/0xf0 ima_file_check+0x64/0x90 path_openat+0x571/0x1720 do_filp_open+0x9b/0x110 ? page_counter_try_charge+0x57/0xc0 ? files_cgroup_alloc_fd+0x38/0x60 ? __alloc_fd+0xd4/0x250 ? do_sys_open+0x1bd/0x250 do_sys_open+0x1bd/0x250 do_syscall_64+0x5d/0x1d0 entry_SYSCALL_64_after_hwframe+0x65/0xca
Commit c7423dbdbc9e ("ima: Handle -ESTALE returned by ima_filter_rule_match()") introduced call to ima_lsm_copy_rule within a RCU read-side critical section which contains kmalloc with GFP_KERNEL. This implies a possible sleep and violates limitations of RCU read-side critical sections on non-PREEMPT systems.
Sleeping within RCU read-side critical section might cause synchronize_rcu() returning early and break RCU protection, allowing a UAF to happen.
The root cause of this issue could be described as follows: | Thread A | Thread B | | |ima_match_policy | | | rcu_read_lock | |ima_lsm_update_rule | | | synchronize_rcu | | | | kmalloc(GFP_KERNEL)| | | sleep | ==> synchronize_rcu returns early | kfree(entry) | | | | entry = entry->next| ==> UAF happens and entry now becomes NULL (or could be anything). | | entry->action | ==> Accessing entry might cause panic.
To fix this issue, we are converting all kmalloc that is called within RCU read-side critical section to use GFP_ATOMIC.
PM: fixed missing comment, long lines, !CONFIG_IMA_LSM_RULES case
In the Linux kernel, the following vulnerability has been resolved:
dmaengine: idxd: Fix possible Use-After-Free in irq_process_work_list
Use list_for_each_entry_safe() to allow iterating through the list and deleting the entry in the iteration process. The descriptor is freed via idxd_desc_complete() and there's a slight chance may cause issue for the list iterator when the descriptor is reused by another thread without it being deleted from the list.(CVE-2024-40956)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: prevent possible NULL dereference in rt6_probe()
syzbot caught a NULL dereference in rt6_probe() [1]
Bail out if __in6_dev_get() returns NULL.
[1] Oops: general protection fault, probably for non-canonical address 0xdffffc00000000cb: 0000 [#1] PREEMPT SMP KASAN PTI KASAN: null-ptr-deref in range [0x0000000000000658-0x000000000000065f] CPU: 1 PID: 22444 Comm: syz-executor.0 Not tainted 6.10.0-rc2-syzkaller-00383-gb8481381d4e2 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024 RIP: 0010:rt6_probe net/ipv6/route.c:656 [inline] RIP: 0010:find_match+0x8c4/0xf50 net/ipv6/route.c:758 Code: 14 fd f7 48 8b 85 38 ff ff ff 48 c7 45 b0 00 00 00 00 48 8d b8 5c 06 00 00 48 b8 00 00 00 00 00 fc ff df 48 89 fa 48 c1 ea 03 <0f> b6 14 02 48 89 f8 83 e0 07 83 c0 03 38 d0 7c 08 84 d2 0f 85 19 RSP: 0018:ffffc900034af070 EFLAGS: 00010203 RAX: dffffc0000000000 RBX: 0000000000000000 RCX: ffffc90004521000 RDX: 00000000000000cb RSI: ffffffff8990d0cd RDI: 000000000000065c RBP: ffffc900034af150 R08: 0000000000000005 R09: 0000000000000000 R10: 0000000000000001 R11: 0000000000000002 R12: 000000000000000a R13: 1ffff92000695e18 R14: ffff8880244a1d20 R15: 0000000000000000 FS: 00007f4844a5a6c0(0000) GS:ffff8880b9300000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000001b31b27000 CR3: 000000002d42c000 CR4: 00000000003506f0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> rt6_nh_find_match+0xfa/0x1a0 net/ipv6/route.c:784 nexthop_for_each_fib6_nh+0x26d/0x4a0 net/ipv4/nexthop.c:1496 __find_rr_leaf+0x6e7/0xe00 net/ipv6/route.c:825 find_rr_leaf net/ipv6/route.c:853 [inline] rt6_select net/ipv6/route.c:897 [inline] fib6_table_lookup+0x57e/0xa30 net/ipv6/route.c:2195 ip6_pol_route+0x1cd/0x1150 net/ipv6/route.c:2231 pol_lookup_func include/net/ip6_fib.h:616 [inline] fib6_rule_lookup+0x386/0x720 net/ipv6/fib6_rules.c:121 ip6_route_output_flags_noref net/ipv6/route.c:2639 [inline] ip6_route_output_flags+0x1d0/0x640 net/ipv6/route.c:2651 ip6_dst_lookup_tail.constprop.0+0x961/0x1760 net/ipv6/ip6_output.c:1147 ip6_dst_lookup_flow+0x99/0x1d0 net/ipv6/ip6_output.c:1250 rawv6_sendmsg+0xdab/0x4340 net/ipv6/raw.c:898 inet_sendmsg+0x119/0x140 net/ipv4/af_inet.c:853 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg net/socket.c:745 [inline] sock_write_iter+0x4b8/0x5c0 net/socket.c:1160 new_sync_write fs/read_write.c:497 [inline] vfs_write+0x6b6/0x1140 fs/read_write.c:590 ksys_write+0x1f8/0x260 fs/read_write.c:643 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcd/0x250 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-40960)
In the Linux kernel, the following vulnerability has been resolved:
serial: imx: Introduce timeout when waiting on transmitter empty
By waiting at most 1 second for USR2_TXDC to be set, we avoid a potential deadlock.
In case of the timeout, there is not much we can do, so we simply ignore the transmitter state and optimistically try to continue.(CVE-2024-40967)
In the Linux kernel, the following vulnerability has been resolved:
ext4: do not create EA inode under buffer lock
ext4_xattr_set_entry() creates new EA inodes while holding buffer lock on the external xattr block. This is problematic as it nests all the allocation locking (which acquires locks on other buffers) under the buffer lock. This can even deadlock when the filesystem is corrupted and e.g. quota file is setup to contain xattr block as data block. Move the allocation of EA inode out of ext4_xattr_set_entry() into the callers.(CVE-2024-40972)
In the Linux kernel, the following vulnerability has been resolved:
drop_monitor: replace spin_lock by raw_spin_lock
trace_drop_common() is called with preemption disabled, and it acquires a spin_lock. This is problematic for RT kernels because spin_locks are sleeping locks in this configuration, which causes the following splat:
BUG: sleeping function called from invalid context at kernel/locking/spinlock_rt.c:48 in_atomic(): 1, irqs_disabled(): 1, non_block: 0, pid: 449, name: rcuc/47 preempt_count: 1, expected: 0 RCU nest depth: 2, expected: 2 5 locks held by rcuc/47/449: #0: ff1100086ec30a60 ((softirq_ctrl.lock)){+.+.}-{2:2}, at: __local_bh_disable_ip+0x105/0x210 #1: ffffffffb394a280 (rcu_read_lock){....}-{1:2}, at: rt_spin_lock+0xbf/0x130 #2: ffffffffb394a280 (rcu_read_lock){....}-{1:2}, at: __local_bh_disable_ip+0x11c/0x210 #3: ffffffffb394a160 (rcu_callback){....}-{0:0}, at: rcu_do_batch+0x360/0xc70 #4: ff1100086ee07520 (&data->lock){+.+.}-{2:2}, at: trace_drop_common.constprop.0+0xb5/0x290 irq event stamp: 139909 hardirqs last enabled at (139908): [<ffffffffb1df2b33>] _raw_spin_unlock_irqrestore+0x63/0x80 hardirqs last disabled at (139909): [<ffffffffb19bd03d>] trace_drop_common.constprop.0+0x26d/0x290 softirqs last enabled at (139892): [<ffffffffb07a1083>] __local_bh_enable_ip+0x103/0x170 softirqs last disabled at (139898): [<ffffffffb0909b33>] rcu_cpu_kthread+0x93/0x1f0 Preemption disabled at: [<ffffffffb1de786b>] rt_mutex_slowunlock+0xab/0x2e0 CPU: 47 PID: 449 Comm: rcuc/47 Not tainted 6.9.0-rc2-rt1+ #7 Hardware name: Dell Inc. PowerEdge R650/0Y2G81, BIOS 1.6.5 04/15/2022 Call Trace: <TASK> dump_stack_lvl+0x8c/0xd0 dump_stack+0x14/0x20 __might_resched+0x21e/0x2f0 rt_spin_lock+0x5e/0x130 ? trace_drop_common.constprop.0+0xb5/0x290 ? skb_queue_purge_reason.part.0+0x1bf/0x230 trace_drop_common.constprop.0+0xb5/0x290 ? preempt_count_sub+0x1c/0xd0 ? _raw_spin_unlock_irqrestore+0x4a/0x80 ? __pfx_trace_drop_common.constprop.0+0x10/0x10 ? rt_mutex_slowunlock+0x26a/0x2e0 ? skb_queue_purge_reason.part.0+0x1bf/0x230 ? __pfx_rt_mutex_slowunlock+0x10/0x10 ? skb_queue_purge_reason.part.0+0x1bf/0x230 trace_kfree_skb_hit+0x15/0x20 trace_kfree_skb+0xe9/0x150 kfree_skb_reason+0x7b/0x110 skb_queue_purge_reason.part.0+0x1bf/0x230 ? __pfx_skb_queue_purge_reason.part.0+0x10/0x10 ? mark_lock.part.0+0x8a/0x520 ...
trace_drop_common() also disables interrupts, but this is a minor issue because we could easily replace it with a local_lock.
Replace the spin_lock with raw_spin_lock to avoid sleeping in atomic context.(CVE-2024-40980)
In the Linux kernel, the following vulnerability has been resolved:
batman-adv: bypass empty buckets in batadv_purge_orig_ref()
Many syzbot reports are pointing to soft lockups in batadv_purge_orig_ref() [1]
Root cause is unknown, but we can avoid spending too much time there and perhaps get more interesting reports.
[1]
watchdog: BUG: soft lockup - CPU#0 stuck for 27s! [kworker/u4:6:621] Modules linked in: irq event stamp: 6182794 hardirqs last enabled at (6182793): [<ffff8000801dae10>] __local_bh_enable_ip+0x224/0x44c kernel/softirq.c:386 hardirqs last disabled at (6182794): [<ffff80008ad66a78>] __el1_irq arch/arm64/kernel/entry-common.c:533 [inline] hardirqs last disabled at (6182794): [<ffff80008ad66a78>] el1_interrupt+0x24/0x68 arch/arm64/kernel/entry-common.c:551 softirqs last enabled at (6182792): [<ffff80008aab71c4>] spin_unlock_bh include/linux/spinlock.h:396 [inline] softirqs last enabled at (6182792): [<ffff80008aab71c4>] batadv_purge_orig_ref+0x114c/0x1228 net/batman-adv/originator.c:1287 softirqs last disabled at (6182790): [<ffff80008aab61dc>] spin_lock_bh include/linux/spinlock.h:356 [inline] softirqs last disabled at (6182790): [<ffff80008aab61dc>] batadv_purge_orig_ref+0x164/0x1228 net/batman-adv/originator.c:1271 CPU: 0 PID: 621 Comm: kworker/u4:6 Not tainted 6.8.0-rc7-syzkaller-g707081b61156 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/29/2024 Workqueue: bat_events batadv_purge_orig pstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--) pc : should_resched arch/arm64/include/asm/preempt.h:79 [inline] pc : __local_bh_enable_ip+0x228/0x44c kernel/softirq.c:388 lr : __local_bh_enable_ip+0x224/0x44c kernel/softirq.c:386 sp : ffff800099007970 x29: ffff800099007980 x28: 1fffe00018fce1bd x27: dfff800000000000 x26: ffff0000d2620008 x25: ffff0000c7e70de8 x24: 0000000000000001 x23: 1fffe00018e57781 x22: dfff800000000000 x21: ffff80008aab71c4 x20: ffff0001b40136c0 x19: ffff0000c72bbc08 x18: 1fffe0001a817bb0 x17: ffff800125414000 x16: ffff80008032116c x15: 0000000000000001 x14: 1fffe0001ee9d610 x13: 0000000000000000 x12: 0000000000000003 x11: 0000000000000000 x10: 0000000000ff0100 x9 : 0000000000000000 x8 : 00000000005e5789 x7 : ffff80008aab61dc x6 : 0000000000000000 x5 : 0000000000000000 x4 : 0000000000000001 x3 : 0000000000000000 x2 : 0000000000000006 x1 : 0000000000000080 x0 : ffff800125414000 Call trace: __daif_local_irq_enable arch/arm64/include/asm/irqflags.h:27 [inline] arch_local_irq_enable arch/arm64/include/asm/irqflags.h:49 [inline] __local_bh_enable_ip+0x228/0x44c kernel/softirq.c:386 __raw_spin_unlock_bh include/linux/spinlock_api_smp.h:167 [inline] _raw_spin_unlock_bh+0x3c/0x4c kernel/locking/spinlock.c:210 spin_unlock_bh include/linux/spinlock.h:396 [inline] batadv_purge_orig_ref+0x114c/0x1228 net/batman-adv/originator.c:1287 batadv_purge_orig+0x20/0x70 net/batman-adv/originator.c:1300 process_one_work+0x694/0x1204 kernel/workqueue.c:2633 process_scheduled_works kernel/workqueue.c:2706 [inline] worker_thread+0x938/0xef4 kernel/workqueue.c:2787 kthread+0x288/0x310 kernel/kthread.c:388 ret_from_fork+0x10/0x20 arch/arm64/kernel/entry.S:860 Sending NMI from CPU 0 to CPUs 1: NMI backtrace for cpu 1 CPU: 1 PID: 0 Comm: swapper/1 Not tainted 6.8.0-rc7-syzkaller-g707081b61156 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/29/2024 pstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--) pc : arch_local_irq_enable+0x8/0xc arch/arm64/include/asm/irqflags.h:51 lr : default_idle_call+0xf8/0x128 kernel/sched/idle.c:103 sp : ffff800093a17d30 x29: ffff800093a17d30 x28: dfff800000000000 x27: 1ffff00012742fb4 x26: ffff80008ec9d000 x25: 0000000000000000 x24: 0000000000000002 x23: 1ffff00011d93a74 x22: ffff80008ec9d3a0 x21: 0000000000000000 x20: ffff0000c19dbc00 x19: ffff8000802d0fd8 x18: 1fffe00036804396 x17: ffff80008ec9d000 x16: ffff8000802d089c x15: 0000000000000001 ---truncated---(CVE-2024-40981)
In the Linux kernel, the following vulnerability has been resolved:
net/sched: act_api: fix possible infinite loop in tcf_idr_check_alloc()
syzbot found hanging tasks waiting on rtnl_lock [1]
A reproducer is available in the syzbot bug.
When a request to add multiple actions with the same index is sent, the second request will block forever on the first request. This holds rtnl_lock, and causes tasks to hang.
Return -EAGAIN to prevent infinite looping, while keeping documented behavior.
[1]
INFO: task kworker/1:0:5088 blocked for more than 143 seconds. Not tainted 6.9.0-rc4-syzkaller-00173-g3cdb45594619 #0 "echo 0 > /proc/sys/kernel/hung_task_timeout_secs" disables this message. task:kworker/1:0 state:D stack:23744 pid:5088 tgid:5088 ppid:2 flags:0x00004000 Workqueue: events_power_efficient reg_check_chans_work Call Trace: <TASK> context_switch kernel/sched/core.c:5409 [inline] __schedule+0xf15/0x5d00 kernel/sched/core.c:6746 __schedule_loop kernel/sched/core.c:6823 [inline] schedule+0xe7/0x350 kernel/sched/core.c:6838 schedule_preempt_disabled+0x13/0x30 kernel/sched/core.c:6895 __mutex_lock_common kernel/locking/mutex.c:684 [inline] __mutex_lock+0x5b8/0x9c0 kernel/locking/mutex.c:752 wiphy_lock include/net/cfg80211.h:5953 [inline] reg_leave_invalid_chans net/wireless/reg.c:2466 [inline] reg_check_chans_work+0x10a/0x10e0 net/wireless/reg.c:2481(CVE-2024-40995)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdkfd: don't allow mapping the MMIO HDP page with large pages
We don't get the right offset in that case. The GPU has an unused 4K area of the register BAR space into which you can remap registers. We remap the HDP flush registers into this space to allow userspace (CPU or GPU) to flush the HDP when it updates VRAM. However, on systems with >4K pages, we end up exposing PAGE_SIZE of MMIO space.(CVE-2024-41011)
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"python3-perf-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-debugsource-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-source-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-tools-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-headers-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-tools-devel-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"perf-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-devel-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-debuginfo-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"perf-debuginfo-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-136.87.0.168.oe2203sp1.aarch64.rpm"
],
"src": [
"kernel-5.10.0-136.87.0.168.oe2203sp1.src.rpm"
],
"x86_64": [
"python3-perf-debuginfo-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-devel-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"perf-debuginfo-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"perf-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-debuginfo-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-source-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-headers-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-tools-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-tools-devel-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"python3-perf-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm",
"kernel-debugsource-5.10.0-136.87.0.168.oe2203sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-136.87.0.168.oe2203sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: sunxi-ng: Unregister clocks/resets when unbinding\r\n\r\nCurrently, unbinding a CCU driver unmaps the device\u0026apos;s MMIO region, while\nleaving its clocks/resets and their providers registered. This can cause\na page fault later when some clock operation tries to perform MMIO. Fix\nthis by separating the CCU initialization from the memory allocation,\nand then using a devres callback to unregister the clocks and resets.\r\n\r\nThis also fixes a memory leak of the `struct ccu_reset`, and uses the\ncorrect owner (the specific platform driver) for the clocks and resets.\r\n\r\nEarly OF clock providers are never unregistered, and limited error\nhandling is possible, so they are mostly unchanged. The error reporting\nis made more consistent by moving the message inside of_sunxi_ccu_probe.(CVE-2021-47205)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nthermal/int340x_thermal: handle data_vault when the value is ZERO_SIZE_PTR\r\n\r\nIn some case, the GDDV returns a package with a buffer which has\nzero length. It causes that kmemdup() returns ZERO_SIZE_PTR (0x10).\r\n\r\nThen the data_vault_read() got NULL point dereference problem when\naccessing the 0x10 value in data_vault.\r\n\r\n[ 71.024560] BUG: kernel NULL pointer dereference, address:\n0000000000000010\r\n\r\nThis patch uses ZERO_OR_NULL_PTR() for checking ZERO_SIZE_PTR or\nNULL value in data_vault.(CVE-2022-48703)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/smc: Avoid overwriting the copies of clcsock callback functions\r\n\r\nThe callback functions of clcsock will be saved and replaced during\nthe fallback. But if the fallback happens more than once, then the\ncopies of these callback functions will be overwritten incorrectly,\nresulting in a loop call issue:\r\n\r\nclcsk-\u0026gt;sk_error_report\n |- smc_fback_error_report() \u0026lt;------------------------------|\n |- smc_fback_forward_wakeup() | (loop)\n |- clcsock_callback() (incorrectly overwritten) |\n |- smc-\u0026gt;clcsk_error_report() ------------------|\r\n\r\nSo this patch fixes the issue by saving these function pointers only\nonce in the fallback and avoiding overwriting.(CVE-2022-48780)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr\r\n\r\nThis node pointer is returned by of_find_compatible_node() with\nrefcount incremented. Calling of_node_put() to aovid the refcount leak.(CVE-2022-48859)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nof: Fix double free in of_parse_phandle_with_args_map\r\n\r\nIn of_parse_phandle_with_args_map() the inner loop that\niterates through the map entries calls of_node_put(new)\nto free the reference acquired by the previous iteration\nof the inner loop. This assumes that the value of \u0026quot;new\u0026quot; is\nNULL on the first iteration of the inner loop.\r\n\r\nMake sure that this is true in all iterations of the outer\nloop by setting \u0026quot;new\u0026quot; to NULL after its value is assigned to \u0026quot;cur\u0026quot;.\r\n\r\nExtend the unittest to detect the double free and add an additional\ntest case that actually triggers this path.(CVE-2023-52679)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nft_set_pipapo: do not free live element\r\n\r\nPablo reports a crash with large batches of elements with a\nback-to-back add/remove pattern. Quoting Pablo:\r\n\r\n add_elem(\u0026quot;00000000\u0026quot;) timeout 100 ms\n ...\n add_elem(\u0026quot;0000000X\u0026quot;) timeout 100 ms\n del_elem(\u0026quot;0000000X\u0026quot;) \u0026lt;---------------- delete one that was just added\n ...\n add_elem(\u0026quot;00005000\u0026quot;) timeout 100 ms\r\n\r\n 1) nft_pipapo_remove() removes element 0000000X\n Then, KASAN shows a splat.\r\n\r\nLooking at the remove function there is a chance that we will drop a\nrule that maps to a non-deactivated element.\r\n\r\nRemoval happens in two steps, first we do a lookup for key k and return the\nto-be-removed element and mark it as inactive in the next generation.\nThen, in a second step, the element gets removed from the set/map.\r\n\r\nThe _remove function does not work correctly if we have more than one\nelement that share the same key.\r\n\r\nThis can happen if we insert an element into a set when the set already\nholds an element with same key, but the element mapping to the existing\nkey has timed out or is not active in the next generation.\r\n\r\nIn such case its possible that removal will unmap the wrong element.\nIf this happens, we will leak the non-deactivated element, it becomes\nunreachable.\r\n\r\nThe element that got deactivated (and will be freed later) will\nremain reachable in the set data structure, this can result in\na crash when such an element is retrieved during lookup (stale\npointer).\r\n\r\nAdd a check that the fully matching key does in fact map to the element\nthat we have marked as inactive in the deactivation step.\nIf not, we need to continue searching.\r\n\r\nAdd a bug/warn trap at the end of the function as well, the remove\nfunction must not ever be called with an invisible/unreachable/non-existent\nelement.\r\n\r\nv2: avoid uneeded temporary variable (Stefano)(CVE-2024-26924)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nf_tables: release mutex after nft_gc_seq_end from abort path\r\n\r\nThe commit mutex should not be released during the critical section\nbetween nft_gc_seq_begin() and nft_gc_seq_end(), otherwise, async GC\nworker could collect expired objects and get the released commit lock\nwithin the same GC sequence.\r\n\r\nnf_tables_module_autoload() temporarily releases the mutex to load\nmodule dependencies, then it goes back to replay the transaction again.\nMove it at the end of the abort phase after nft_gc_seq_end() is called.(CVE-2024-26925)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/sched: Fix mirred deadlock on device recursion\r\n\r\nWhen the mirred action is used on a classful egress qdisc and a packet is\nmirrored or redirected to self we hit a qdisc lock deadlock.\nSee trace below.\r\n\r\n[..... other info removed for brevity....]\n[ 82.890906]\n[ 82.890906] ============================================\n[ 82.890906] WARNING: possible recursive locking detected\n[ 82.890906] 6.8.0-05205-g77fadd89fe2d-dirty #213 Tainted: G W\n[ 82.890906] --------------------------------------------\n[ 82.890906] ping/418 is trying to acquire lock:\n[ 82.890906] ffff888006994110 (\u0026amp;sch-\u0026gt;q.lock){+.-.}-{3:3}, at:\n__dev_queue_xmit+0x1778/0x3550\n[ 82.890906]\n[ 82.890906] but task is already holding lock:\n[ 82.890906] ffff888006994110 (\u0026amp;sch-\u0026gt;q.lock){+.-.}-{3:3}, at:\n__dev_queue_xmit+0x1778/0x3550\n[ 82.890906]\n[ 82.890906] other info that might help us debug this:\n[ 82.890906] Possible unsafe locking scenario:\n[ 82.890906]\n[ 82.890906] CPU0\n[ 82.890906] ----\n[ 82.890906] lock(\u0026amp;sch-\u0026gt;q.lock);\n[ 82.890906] lock(\u0026amp;sch-\u0026gt;q.lock);\n[ 82.890906]\n[ 82.890906] *** DEADLOCK ***\n[ 82.890906]\n[..... other info removed for brevity....]\r\n\r\nExample setup (eth0-\u0026gt;eth0) to recreate\ntc qdisc add dev eth0 root handle 1: htb default 30\ntc filter add dev eth0 handle 1: protocol ip prio 2 matchall \\\n action mirred egress redirect dev eth0\r\n\r\nAnother example(eth0-\u0026gt;eth1-\u0026gt;eth0) to recreate\ntc qdisc add dev eth0 root handle 1: htb default 30\ntc filter add dev eth0 handle 1: protocol ip prio 2 matchall \\\n action mirred egress redirect dev eth1\r\n\r\ntc qdisc add dev eth1 root handle 1: htb default 30\ntc filter add dev eth1 handle 1: protocol ip prio 2 matchall \\\n action mirred egress redirect dev eth0\r\n\r\nWe fix this by adding an owner field (CPU id) to struct Qdisc set after\nroot qdisc is entered. When the softirq enters it a second time, if the\nqdisc owner is the same CPU, the packet is dropped to break the loop.(CVE-2024-27010)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndma-mapping: benchmark: fix node id validation\r\n\r\nWhile validating node ids in map_benchmark_ioctl(), node_possible() may\nbe provided with invalid argument outside of [0,MAX_NUMNODES-1] range\nleading to:\r\n\r\nBUG: KASAN: wild-memory-access in map_benchmark_ioctl (kernel/dma/map_benchmark.c:214)\nRead of size 8 at addr 1fffffff8ccb6398 by task dma_map_benchma/971\nCPU: 7 PID: 971 Comm: dma_map_benchma Not tainted 6.9.0-rc6 #37\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996)\nCall Trace:\n \u0026lt;TASK\u0026gt;\ndump_stack_lvl (lib/dump_stack.c:117)\nkasan_report (mm/kasan/report.c:603)\nkasan_check_range (mm/kasan/generic.c:189)\nvariable_test_bit (arch/x86/include/asm/bitops.h:227) [inline]\narch_test_bit (arch/x86/include/asm/bitops.h:239) [inline]\n_test_bit at (include/asm-generic/bitops/instrumented-non-atomic.h:142) [inline]\nnode_state (include/linux/nodemask.h:423) [inline]\nmap_benchmark_ioctl (kernel/dma/map_benchmark.c:214)\nfull_proxy_unlocked_ioctl (fs/debugfs/file.c:333)\n__x64_sys_ioctl (fs/ioctl.c:890)\ndo_syscall_64 (arch/x86/entry/common.c:83)\nentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\nCompare node ids with sane bounds first. NUMA_NO_NODE is considered a\nspecial valid case meaning that benchmarking kthreads won\u0026apos;t be bound to a\ncpuset of a given node.\r\n\r\nFound by Linux Verification Center (linuxtesting.org).(CVE-2024-34777)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmd/dm-raid: don\u0026apos;t call md_reap_sync_thread() directly\r\n\r\nCurrently md_reap_sync_thread() is called from raid_message() directly\nwithout holding \u0026apos;reconfig_mutex\u0026apos;, this is definitely unsafe because\nmd_reap_sync_thread() can change many fields that is protected by\n\u0026apos;reconfig_mutex\u0026apos;.\r\n\r\nHowever, hold \u0026apos;reconfig_mutex\u0026apos; here is still problematic because this\nwill cause deadlock, for example, commit 130443d60b1b (\u0026quot;md: refactor\nidle/frozen_sync_thread() to fix deadlock\u0026quot;).\r\n\r\nFix this problem by using stop_sync_thread() to unregister sync_thread,\nlike md/raid did.(CVE-2024-35808)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: mvpp2: clear BM pool before initialization\r\n\r\nRegister value persist after booting the kernel using\nkexec which results in kernel panic. Thus clear the\nBM pool registers before initialisation to fix the issue.(CVE-2024-35837)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nf_tables: flush pending destroy work before exit_net release\r\n\r\nSimilar to 2c9f0293280e (\u0026quot;netfilter: nf_tables: flush pending destroy\nwork before netlink notifier\u0026quot;) to address a race between exit_net and\nthe destroy workqueue.\r\n\r\nThe trace below shows an element to be released via destroy workqueue\nwhile exit_net path (triggered via module removal) has already released\nthe set that is used in such transaction.\r\n\r\n[ 1360.547789] BUG: KASAN: slab-use-after-free in nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables]\n[ 1360.547861] Read of size 8 at addr ffff888140500cc0 by task kworker/4:1/152465\n[ 1360.547870] CPU: 4 PID: 152465 Comm: kworker/4:1 Not tainted 6.8.0+ #359\n[ 1360.547882] Workqueue: events nf_tables_trans_destroy_work [nf_tables]\n[ 1360.547984] Call Trace:\n[ 1360.547991] \u0026lt;TASK\u0026gt;\n[ 1360.547998] dump_stack_lvl+0x53/0x70\n[ 1360.548014] print_report+0xc4/0x610\n[ 1360.548026] ? __virt_addr_valid+0xba/0x160\n[ 1360.548040] ? __pfx__raw_spin_lock_irqsave+0x10/0x10\n[ 1360.548054] ? nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables]\n[ 1360.548176] kasan_report+0xae/0xe0\n[ 1360.548189] ? nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables]\n[ 1360.548312] nf_tables_trans_destroy_work+0x3f5/0x590 [nf_tables]\n[ 1360.548447] ? __pfx_nf_tables_trans_destroy_work+0x10/0x10 [nf_tables]\n[ 1360.548577] ? _raw_spin_unlock_irq+0x18/0x30\n[ 1360.548591] process_one_work+0x2f1/0x670\n[ 1360.548610] worker_thread+0x4d3/0x760\n[ 1360.548627] ? __pfx_worker_thread+0x10/0x10\n[ 1360.548640] kthread+0x16b/0x1b0\n[ 1360.548653] ? __pfx_kthread+0x10/0x10\n[ 1360.548665] ret_from_fork+0x2f/0x50\n[ 1360.548679] ? __pfx_kthread+0x10/0x10\n[ 1360.548690] ret_from_fork_asm+0x1a/0x30\n[ 1360.548707] \u0026lt;/TASK\u0026gt;\r\n\r\n[ 1360.548719] Allocated by task 192061:\n[ 1360.548726] kasan_save_stack+0x20/0x40\n[ 1360.548739] kasan_save_track+0x14/0x30\n[ 1360.548750] __kasan_kmalloc+0x8f/0xa0\n[ 1360.548760] __kmalloc_node+0x1f1/0x450\n[ 1360.548771] nf_tables_newset+0x10c7/0x1b50 [nf_tables]\n[ 1360.548883] nfnetlink_rcv_batch+0xbc4/0xdc0 [nfnetlink]\n[ 1360.548909] nfnetlink_rcv+0x1a8/0x1e0 [nfnetlink]\n[ 1360.548927] netlink_unicast+0x367/0x4f0\n[ 1360.548935] netlink_sendmsg+0x34b/0x610\n[ 1360.548944] ____sys_sendmsg+0x4d4/0x510\n[ 1360.548953] ___sys_sendmsg+0xc9/0x120\n[ 1360.548961] __sys_sendmsg+0xbe/0x140\n[ 1360.548971] do_syscall_64+0x55/0x120\n[ 1360.548982] entry_SYSCALL_64_after_hwframe+0x55/0x5d\r\n\r\n[ 1360.548994] Freed by task 192222:\n[ 1360.548999] kasan_save_stack+0x20/0x40\n[ 1360.549009] kasan_save_track+0x14/0x30\n[ 1360.549019] kasan_save_free_info+0x3b/0x60\n[ 1360.549028] poison_slab_object+0x100/0x180\n[ 1360.549036] __kasan_slab_free+0x14/0x30\n[ 1360.549042] kfree+0xb6/0x260\n[ 1360.549049] __nft_release_table+0x473/0x6a0 [nf_tables]\n[ 1360.549131] nf_tables_exit_net+0x170/0x240 [nf_tables]\n[ 1360.549221] ops_exit_list+0x50/0xa0\n[ 1360.549229] free_exit_list+0x101/0x140\n[ 1360.549236] unregister_pernet_operations+0x107/0x160\n[ 1360.549245] unregister_pernet_subsys+0x1c/0x30\n[ 1360.549254] nf_tables_module_exit+0x43/0x80 [nf_tables]\n[ 1360.549345] __do_sys_delete_module+0x253/0x370\n[ 1360.549352] do_syscall_64+0x55/0x120\n[ 1360.549360] entry_SYSCALL_64_after_hwframe+0x55/0x5d\r\n\r\n(gdb) list *__nft_release_table+0x473\n0x1e033 is in __nft_release_table (net/netfilter/nf_tables_api.c:11354).\n11349 list_for_each_entry_safe(flowtable, nf, \u0026amp;table-\u0026gt;flowtables, list) {\n11350 list_del(\u0026amp;flowtable-\u0026gt;list);\n11351 nft_use_dec(\u0026amp;table-\u0026gt;use);\n11352 nf_tables_flowtable_destroy(flowtable);\n11353 }\n11354 list_for_each_entry_safe(set, ns, \u0026amp;table-\u0026gt;sets, list) {\n11355 list_del(\u0026amp;set-\u0026gt;list);\n11356 nft_use_dec(\u0026amp;table-\u0026gt;use);\n11357 if (set-\u0026gt;flags \u0026amp; (NFT_SET_MAP | NFT_SET_OBJECT))\n11358 nft_map_deactivat\n---truncated---(CVE-2024-35899)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu: Skip do PCI error slot reset during RAS recovery\r\n\r\nWhy:\n The PCI error slot reset maybe triggered after inject ue to UMC multi times, this\n caused system hang.\n [ 557.371857] amdgpu 0000:af:00.0: amdgpu: GPU reset succeeded, trying to resume\n [ 557.373718] [drm] PCIE GART of 512M enabled.\n [ 557.373722] [drm] PTB located at 0x0000031FED700000\n [ 557.373788] [drm] VRAM is lost due to GPU reset!\n [ 557.373789] [drm] PSP is resuming...\n [ 557.547012] mlx5_core 0000:55:00.0: mlx5_pci_err_detected Device state = 1 pci_status: 0. Exit, result = 3, need reset\n [ 557.547067] [drm] PCI error: detected callback, state(1)!!\n [ 557.547069] [drm] No support for XGMI hive yet...\n [ 557.548125] mlx5_core 0000:55:00.0: mlx5_pci_slot_reset Device state = 1 pci_status: 0. Enter\n [ 557.607763] mlx5_core 0000:55:00.0: wait vital counter value 0x16b5b after 1 iterations\n [ 557.607777] mlx5_core 0000:55:00.0: mlx5_pci_slot_reset Device state = 1 pci_status: 1. Exit, err = 0, result = 5, recovered\n [ 557.610492] [drm] PCI error: slot reset callback!!\n ...\n [ 560.689382] amdgpu 0000:3f:00.0: amdgpu: GPU reset(2) succeeded!\n [ 560.689546] amdgpu 0000:5a:00.0: amdgpu: GPU reset(2) succeeded!\n [ 560.689562] general protection fault, probably for non-canonical address 0x5f080b54534f611f: 0000 [#1] SMP NOPTI\n [ 560.701008] CPU: 16 PID: 2361 Comm: kworker/u448:9 Tainted: G OE 5.15.0-91-generic #101-Ubuntu\n [ 560.712057] Hardware name: Microsoft C278A/C278A, BIOS C2789.5.BS.1C11.AG.1 11/08/2023\n [ 560.720959] Workqueue: amdgpu-reset-hive amdgpu_ras_do_recovery [amdgpu]\n [ 560.728887] RIP: 0010:amdgpu_device_gpu_recover.cold+0xbf1/0xcf5 [amdgpu]\n [ 560.736891] Code: ff 41 89 c6 e9 1b ff ff ff 44 0f b6 45 b0 e9 4f ff ff ff be 01 00 00 00 4c 89 e7 e8 76 c9 8b ff 44 0f b6 45 b0 e9 3c fd ff ff \u0026lt;48\u0026gt; 83 ba 18 02 00 00 00 0f 84 6a f8 ff ff 48 8d 7a 78 be 01 00 00\n [ 560.757967] RSP: 0018:ffa0000032e53d80 EFLAGS: 00010202\n [ 560.763848] RAX: ffa00000001dfd10 RBX: ffa0000000197090 RCX: ffa0000032e53db0\n [ 560.771856] RDX: 5f080b54534f5f07 RSI: 0000000000000000 RDI: ff11000128100010\n [ 560.779867] RBP: ffa0000032e53df0 R08: 0000000000000000 R09: ffffffffffe77f08\n [ 560.787879] R10: 0000000000ffff0a R11: 0000000000000001 R12: 0000000000000000\n [ 560.795889] R13: ffa0000032e53e00 R14: 0000000000000000 R15: 0000000000000000\n [ 560.803889] FS: 0000000000000000(0000) GS:ff11007e7e800000(0000) knlGS:0000000000000000\n [ 560.812973] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n [ 560.819422] CR2: 000055a04c118e68 CR3: 0000000007410005 CR4: 0000000000771ee0\n [ 560.827433] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n [ 560.835433] DR3: 0000000000000000 DR6: 00000000fffe07f0 DR7: 0000000000000400\n [ 560.843444] PKRU: 55555554\n [ 560.846480] Call Trace:\n [ 560.849225] \u0026lt;TASK\u0026gt;\n [ 560.851580] ? show_trace_log_lvl+0x1d6/0x2ea\n [ 560.856488] ? show_trace_log_lvl+0x1d6/0x2ea\n [ 560.861379] ? amdgpu_ras_do_recovery+0x1b2/0x210 [amdgpu]\n [ 560.867778] ? show_regs.part.0+0x23/0x29\n [ 560.872293] ? __die_body.cold+0x8/0xd\n [ 560.876502] ? die_addr+0x3e/0x60\n [ 560.880238] ? exc_general_protection+0x1c5/0x410\n [ 560.885532] ? asm_exc_general_protection+0x27/0x30\n [ 560.891025] ? amdgpu_device_gpu_recover.cold+0xbf1/0xcf5 [amdgpu]\n [ 560.898323] amdgpu_ras_do_recovery+0x1b2/0x210 [amdgpu]\n [ 560.904520] process_one_work+0x228/0x3d0\nHow:\n In RAS recovery, mode-1 reset is issued from RAS fatal error handling and expected\n all the nodes in a hive to be reset. no need to issue another mode-1 during this procedure.(CVE-2024-35931)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/9p: fix uninitialized values during inode evict\r\n\r\nIf an iget fails due to not being able to retrieve information\nfrom the server then the inode structure is only partially\ninitialized. When the inode gets evicted, references to\nuninitialized structures (like fscache cookies) were being\nmade.\r\n\r\nThis patch checks for a bad_inode before doing anything other\nthan clearing the inode from the cache. Since the inode is\nbad, it shouldn\u0026apos;t have any state associated with it that needs\nto be written back (and there really isn\u0026apos;t a way to complete\nthose anyways).(CVE-2024-36923)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: fix potential kernel bug due to lack of writeback flag waiting\r\n\r\nDestructive writes to a block device on which nilfs2 is mounted can cause\na kernel bug in the folio/page writeback start routine or writeback end\nroutine (__folio_start_writeback in the log below):\r\n\r\n kernel BUG at mm/page-writeback.c:3070!\n Oops: invalid opcode: 0000 [#1] PREEMPT SMP KASAN PTI\n ...\n RIP: 0010:__folio_start_writeback+0xbaa/0x10e0\n Code: 25 ff 0f 00 00 0f 84 18 01 00 00 e8 40 ca c6 ff e9 17 f6 ff ff\n e8 36 ca c6 ff 4c 89 f7 48 c7 c6 80 c0 12 84 e8 e7 b3 0f 00 90 \u0026lt;0f\u0026gt;\n 0b e8 1f ca c6 ff 4c 89 f7 48 c7 c6 a0 c6 12 84 e8 d0 b3 0f 00\n ...\n Call Trace:\n \u0026lt;TASK\u0026gt;\n nilfs_segctor_do_construct+0x4654/0x69d0 [nilfs2]\n nilfs_segctor_construct+0x181/0x6b0 [nilfs2]\n nilfs_segctor_thread+0x548/0x11c0 [nilfs2]\n kthread+0x2f0/0x390\n ret_from_fork+0x4b/0x80\n ret_from_fork_asm+0x1a/0x30\n \u0026lt;/TASK\u0026gt;\r\n\r\nThis is because when the log writer starts a writeback for segment summary\nblocks or a super root block that use the backing device\u0026apos;s page cache, it\ndoes not wait for the ongoing folio/page writeback, resulting in an\ninconsistent writeback state.\r\n\r\nFix this issue by waiting for ongoing writebacks when putting\nfolios/pages on the backing device into writeback state.(CVE-2024-37078)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm: bridge: cdns-mhdp8546: Fix possible null pointer dereference\r\n\r\nIn cdns_mhdp_atomic_enable(), the return value of drm_mode_duplicate() is\nassigned to mhdp_state-\u0026gt;current_mode, and there is a dereference of it in\ndrm_mode_set_name(), which will lead to a NULL pointer dereference on\nfailure of drm_mode_duplicate().\r\n\r\nFix this bug add a check of mhdp_state-\u0026gt;current_mode.(CVE-2024-38548)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: carl9170: add a proper sanity check for endpoints\r\n\r\nSyzkaller reports [1] hitting a warning which is caused by presence\nof a wrong endpoint type at the URB sumbitting stage. While there\nwas a check for a specific 4th endpoint, since it can switch types\nbetween bulk and interrupt, other endpoints are trusted implicitly.\nSimilar warning is triggered in a couple of other syzbot issues [2].\r\n\r\nFix the issue by doing a comprehensive check of all endpoints\ntaking into account difference between high- and full-speed\nconfiguration.\r\n\r\n[1] Syzkaller report:\n...\nWARNING: CPU: 0 PID: 4721 at drivers/usb/core/urb.c:504 usb_submit_urb+0xed6/0x1880 drivers/usb/core/urb.c:504\n...\nCall Trace:\n \u0026lt;TASK\u0026gt;\n carl9170_usb_send_rx_irq_urb+0x273/0x340 drivers/net/wireless/ath/carl9170/usb.c:504\n carl9170_usb_init_device drivers/net/wireless/ath/carl9170/usb.c:939 [inline]\n carl9170_usb_firmware_finish drivers/net/wireless/ath/carl9170/usb.c:999 [inline]\n carl9170_usb_firmware_step2+0x175/0x240 drivers/net/wireless/ath/carl9170/usb.c:1028\n request_firmware_work_func+0x130/0x240 drivers/base/firmware_loader/main.c:1107\n process_one_work+0x9bf/0x1710 kernel/workqueue.c:2289\n worker_thread+0x669/0x1090 kernel/workqueue.c:2436\n kthread+0x2e8/0x3a0 kernel/kthread.c:376\n ret_from_fork+0x1f/0x30 arch/x86/entry/entry_64.S:308\n \u0026lt;/TASK\u0026gt;\r\n\r\n[2] Related syzkaller crashes:(CVE-2024-38567)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmacintosh/via-macii: Fix \u0026quot;BUG: sleeping function called from invalid context\u0026quot;\r\n\r\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0026apos;t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: i2c: et8ek8: Don\u0026apos;t strip remove function when driver is builtin\r\n\r\nUsing __exit for the remove function results in the remove callback\nbeing discarded with CONFIG_VIDEO_ET8EK8=y. When such a device gets\nunbound (e.g. using sysfs or hotplug), the driver is just removed\nwithout the cleanup being performed. This results in resource leaks. Fix\nit by compiling in the remove callback unconditionally.\r\n\r\nThis also fixes a W=1 modpost warning:\r\n\r\n\tWARNING: modpost: drivers/media/i2c/et8ek8/et8ek8: section mismatch in reference: et8ek8_i2c_driver+0x10 (section: .data) -\u0026gt; et8ek8_remove (section: .exit.text)(CVE-2024-38611)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: stk1160: fix bounds checking in stk1160_copy_video()\r\n\r\nThe subtract in this condition is reversed. The -\u0026gt;length is the length\nof the buffer. The -\u0026gt;bytesused is how many bytes we have copied thus\nfar. When the condition is reversed that means the result of the\nsubtraction is always negative but since it\u0026apos;s unsigned then the result\nis a very high positive value. That means the overflow check is never\ntrue.\r\n\r\nAdditionally, the -\u0026gt;bytesused doesn\u0026apos;t actually work for this purpose\nbecause we\u0026apos;re not writing to \u0026quot;buf-\u0026gt;mem + buf-\u0026gt;bytesused\u0026quot;. Instead, the\nmath to calculate the destination where we are writing is a bit\ninvolved. You calculate the number of full lines already written,\nmultiply by two, skip a line if necessary so that we start on an odd\nnumbered line, and add the offset into the line.\r\n\r\nTo fix this buffer overflow, just take the actual destination where we\nare writing, if the offset is already out of bounds print an error and\nreturn. Otherwise, write up to buf-\u0026gt;length bytes.(CVE-2024-38621)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfbdev: savage: Handle err return when savagefb_check_var failed\r\n\r\nThe commit 04e5eac8f3ab(\u0026quot;fbdev: savage: Error out if pixclock equals zero\u0026quot;)\nchecks the value of pixclock to avoid divide-by-zero error. However\nthe function savagefb_probe doesn\u0026apos;t handle the error return of\nsavagefb_check_var. When pixclock is 0, it will cause divide-by-zero error.(CVE-2024-39475)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmd/raid5: fix deadlock that raid5d() wait for itself to clear MD_SB_CHANGE_PENDING\r\n\r\nXiao reported that lvm2 test lvconvert-raid-takeover.sh can hang with\nsmall possibility, the root cause is exactly the same as commit\nbed9e27baf52 (\u0026quot;Revert \u0026quot;md/raid5: Wait for MD_SB_CHANGE_PENDING in raid5d\u0026quot;\u0026quot;)\r\n\r\nHowever, Dan reported another hang after that, and junxiao investigated\nthe problem and found out that this is caused by plugged bio can\u0026apos;t issue\nfrom raid5d().\r\n\r\nCurrent implementation in raid5d() has a weird dependence:\r\n\r\n1) md_check_recovery() from raid5d() must hold \u0026apos;reconfig_mutex\u0026apos; to clear\n MD_SB_CHANGE_PENDING;\n2) raid5d() handles IO in a deadloop, until all IO are issued;\n3) IO from raid5d() must wait for MD_SB_CHANGE_PENDING to be cleared;\r\n\r\nThis behaviour is introduce before v2.6, and for consequence, if other\ncontext hold \u0026apos;reconfig_mutex\u0026apos;, and md_check_recovery() can\u0026apos;t update\nsuper_block, then raid5d() will waste one cpu 100% by the deadloop, until\n\u0026apos;reconfig_mutex\u0026apos; is released.\r\n\r\nRefer to the implementation from raid1 and raid10, fix this problem by\nskipping issue IO if MD_SB_CHANGE_PENDING is still set after\nmd_check_recovery(), daemon thread will be woken up when \u0026apos;reconfig_mutex\u0026apos;\nis released. Meanwhile, the hang problem will be fixed as well.(CVE-2024-39476)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmmc: davinci: Don\u0026apos;t strip remove function when driver is builtin\r\n\r\nUsing __exit for the remove function results in the remove callback being\ndiscarded with CONFIG_MMC_DAVINCI=y. When such a device gets unbound (e.g.\nusing sysfs or hotplug), the driver is just removed without the cleanup\nbeing performed. This results in resource leaks. Fix it by compiling in the\nremove callback unconditionally.\r\n\r\nThis also fixes a W=1 modpost warning:\r\n\r\nWARNING: modpost: drivers/mmc/host/davinci_mmc: section mismatch in\nreference: davinci_mmcsd_driver+0x10 (section: .data) -\u0026gt;\ndavinci_mmcsd_remove (section: .exit.text)(CVE-2024-39484)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nliquidio: Adjust a NULL pointer handling path in lio_vf_rep_copy_packet\r\n\r\nIn lio_vf_rep_copy_packet() pg_info-\u0026gt;page is compared to a NULL value,\nbut then it is unconditionally passed to skb_add_rx_frag() which looks\nstrange and could lead to null pointer dereference.\r\n\r\nlio_vf_rep_copy_packet() call trace looks like:\n\tocteon_droq_process_packets\n\t octeon_droq_fast_process_packets\n\t octeon_droq_dispatch_pkt\n\t octeon_create_recv_info\n\t ...search in the dispatch_list...\n\t -\u0026gt;disp_fn(rdisp-\u0026gt;rinfo, ...)\n\t lio_vf_rep_pkt_recv(struct octeon_recv_info *recv_info, ...)\nIn this path there is no code which sets pg_info-\u0026gt;page to NULL.\nSo this check looks unneeded and doesn\u0026apos;t solve potential problem.\nBut I guess the author had reason to add a check and I have no such card\nand can\u0026apos;t do real test.\nIn addition, the code in the function liquidio_push_packet() in\nliquidio/lio_core.c does exactly the same.\r\n\r\nBased on this, I consider the most acceptable compromise solution to\nadjust this issue by moving skb_add_rx_frag() into conditional scope.\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-39506)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nio_uring/io-wq: Use set_bit() and test_bit() at worker-\u0026gt;flags\r\n\r\nUtilize set_bit() and test_bit() on worker-\u0026gt;flags within io_uring/io-wq\nto address potential data races.\r\n\r\nThe structure io_worker-\u0026gt;flags may be accessed through various data\npaths, leading to concurrency issues. When KCSAN is enabled, it reveals\ndata races occurring in io_worker_handle_work and\nio_wq_activate_free_worker functions.\r\n\r\n\t BUG: KCSAN: data-race in io_worker_handle_work / io_wq_activate_free_worker\n\t write to 0xffff8885c4246404 of 4 bytes by task 49071 on cpu 28:\n\t io_worker_handle_work (io_uring/io-wq.c:434 io_uring/io-wq.c:569)\n\t io_wq_worker (io_uring/io-wq.c:?)\n\u0026lt;snip\u0026gt;\r\n\r\n\t read to 0xffff8885c4246404 of 4 bytes by task 49024 on cpu 5:\n\t io_wq_activate_free_worker (io_uring/io-wq.c:? io_uring/io-wq.c:285)\n\t io_wq_enqueue (io_uring/io-wq.c:947)\n\t io_queue_iowq (io_uring/io_uring.c:524)\n\t io_req_task_submit (io_uring/io_uring.c:1511)\n\t io_handle_tw_list (io_uring/io_uring.c:1198)\n\u0026lt;snip\u0026gt;\r\n\r\nLine numbers against commit 18daea77cca6 (\u0026quot;Merge tag \u0026apos;for-linus\u0026apos; of\ngit://git.kernel.org/pub/scm/virt/kvm/kvm\u0026quot;).\r\n\r\nThese races involve writes and reads to the same memory location by\ndifferent tasks running on different CPUs. To mitigate this, refactor\nthe code to use atomic operations such as set_bit(), test_bit(), and\nclear_bit() instead of basic \u0026quot;and\u0026quot; and \u0026quot;or\u0026quot; operations. This ensures\nthread-safe manipulation of worker flags.\r\n\r\nAlso, move `create_index` to avoid holes in the structure.(CVE-2024-39508)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nriscv: rewrite __kernel_map_pages() to fix sleeping in invalid context\r\n\r\n__kernel_map_pages() is a debug function which clears the valid bit in page\ntable entry for deallocated pages to detect illegal memory accesses to\nfreed pages.\r\n\r\nThis function set/clear the valid bit using __set_memory(). __set_memory()\nacquires init_mm\u0026apos;s semaphore, and this operation may sleep. This is\nproblematic, because __kernel_map_pages() can be called in atomic context,\nand thus is illegal to sleep. An example warning that this causes:\r\n\r\nBUG: sleeping function called from invalid context at kernel/locking/rwsem.c:1578\nin_atomic(): 1, irqs_disabled(): 0, non_block: 0, pid: 2, name: kthreadd\npreempt_count: 2, expected: 0\nCPU: 0 PID: 2 Comm: kthreadd Not tainted 6.9.0-g1d4c6d784ef6 #37\nHardware name: riscv-virtio,qemu (DT)\nCall Trace:\n[\u0026lt;ffffffff800060dc\u0026gt;] dump_backtrace+0x1c/0x24\n[\u0026lt;ffffffff8091ef6e\u0026gt;] show_stack+0x2c/0x38\n[\u0026lt;ffffffff8092baf8\u0026gt;] dump_stack_lvl+0x5a/0x72\n[\u0026lt;ffffffff8092bb24\u0026gt;] dump_stack+0x14/0x1c\n[\u0026lt;ffffffff8003b7ac\u0026gt;] __might_resched+0x104/0x10e\n[\u0026lt;ffffffff8003b7f4\u0026gt;] __might_sleep+0x3e/0x62\n[\u0026lt;ffffffff8093276a\u0026gt;] down_write+0x20/0x72\n[\u0026lt;ffffffff8000cf00\u0026gt;] __set_memory+0x82/0x2fa\n[\u0026lt;ffffffff8000d324\u0026gt;] __kernel_map_pages+0x5a/0xd4\n[\u0026lt;ffffffff80196cca\u0026gt;] __alloc_pages_bulk+0x3b2/0x43a\n[\u0026lt;ffffffff8018ee82\u0026gt;] __vmalloc_node_range+0x196/0x6ba\n[\u0026lt;ffffffff80011904\u0026gt;] copy_process+0x72c/0x17ec\n[\u0026lt;ffffffff80012ab4\u0026gt;] kernel_clone+0x60/0x2fe\n[\u0026lt;ffffffff80012f62\u0026gt;] kernel_thread+0x82/0xa0\n[\u0026lt;ffffffff8003552c\u0026gt;] kthreadd+0x14a/0x1be\n[\u0026lt;ffffffff809357de\u0026gt;] ret_from_fork+0xe/0x1c\r\n\r\nRewrite this function with apply_to_existing_page_range(). It is fine to\nnot have any locking, because __kernel_map_pages() works with pages being\nallocated/deallocated and those pages are not changed by anyone else in the\nmeantime.(CVE-2024-40915)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\niommu: Return right value in iommu_sva_bind_device()\r\n\r\niommu_sva_bind_device() should return either a sva bond handle or an\nERR_PTR value in error cases. Existing drivers (idxd and uacce) only\ncheck the return value with IS_ERR(). This could potentially lead to\na kernel NULL pointer dereference issue if the function returns NULL\ninstead of an error pointer.\r\n\r\nIn reality, this doesn\u0026apos;t cause any problems because iommu_sva_bind_device()\nonly returns NULL when the kernel is not configured with CONFIG_IOMMU_SVA.\nIn this case, iommu_dev_enable_feature(dev, IOMMU_DEV_FEAT_SVA) will\nreturn an error, and the device drivers won\u0026apos;t call iommu_sva_bind_device()\nat all.(CVE-2024-40945)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nima: Avoid blocking in RCU read-side critical section\r\n\r\nA panic happens in ima_match_policy:\r\n\r\nBUG: unable to handle kernel NULL pointer dereference at 0000000000000010\nPGD 42f873067 P4D 0\nOops: 0000 [#1] SMP NOPTI\nCPU: 5 PID: 1286325 Comm: kubeletmonit.sh\nKdump: loaded Tainted: P\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996),\n BIOS 0.0.0 02/06/2015\nRIP: 0010:ima_match_policy+0x84/0x450\nCode: 49 89 fc 41 89 cf 31 ed 89 44 24 14 eb 1c 44 39\n 7b 18 74 26 41 83 ff 05 74 20 48 8b 1b 48 3b 1d\n f2 b9 f4 00 0f 84 9c 01 00 00 \u0026lt;44\u0026gt; 85 73 10 74 ea\n 44 8b 6b 14 41 f6 c5 01 75 d4 41 f6 c5 02 74 0f\nRSP: 0018:ff71570009e07a80 EFLAGS: 00010207\nRAX: 0000000000000000 RBX: 0000000000000000 RCX: 0000000000000200\nRDX: ffffffffad8dc7c0 RSI: 0000000024924925 RDI: ff3e27850dea2000\nRBP: 0000000000000000 R08: 0000000000000000 R09: ffffffffabfce739\nR10: ff3e27810cc42400 R11: 0000000000000000 R12: ff3e2781825ef970\nR13: 00000000ff3e2785 R14: 000000000000000c R15: 0000000000000001\nFS: 00007f5195b51740(0000)\nGS:ff3e278b12d40000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000000000000010 CR3: 0000000626d24002 CR4: 0000000000361ee0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n ima_get_action+0x22/0x30\n process_measurement+0xb0/0x830\n ? page_add_file_rmap+0x15/0x170\n ? alloc_set_pte+0x269/0x4c0\n ? prep_new_page+0x81/0x140\n ? simple_xattr_get+0x75/0xa0\n ? selinux_file_open+0x9d/0xf0\n ima_file_check+0x64/0x90\n path_openat+0x571/0x1720\n do_filp_open+0x9b/0x110\n ? page_counter_try_charge+0x57/0xc0\n ? files_cgroup_alloc_fd+0x38/0x60\n ? __alloc_fd+0xd4/0x250\n ? do_sys_open+0x1bd/0x250\n do_sys_open+0x1bd/0x250\n do_syscall_64+0x5d/0x1d0\n entry_SYSCALL_64_after_hwframe+0x65/0xca\r\n\r\nCommit c7423dbdbc9e (\u0026quot;ima: Handle -ESTALE returned by\nima_filter_rule_match()\u0026quot;) introduced call to ima_lsm_copy_rule within a\nRCU read-side critical section which contains kmalloc with GFP_KERNEL.\nThis implies a possible sleep and violates limitations of RCU read-side\ncritical sections on non-PREEMPT systems.\r\n\r\nSleeping within RCU read-side critical section might cause\nsynchronize_rcu() returning early and break RCU protection, allowing a\nUAF to happen.\r\n\r\nThe root cause of this issue could be described as follows:\n|\tThread A\t|\tThread B\t|\n|\t\t\t|ima_match_policy\t|\n|\t\t\t| rcu_read_lock\t|\n|ima_lsm_update_rule\t|\t\t\t|\n| synchronize_rcu\t|\t\t\t|\n|\t\t\t| kmalloc(GFP_KERNEL)|\n|\t\t\t| sleep\t\t|\n==\u0026gt; synchronize_rcu returns early\n| kfree(entry)\t\t|\t\t\t|\n|\t\t\t| entry = entry-\u0026gt;next|\n==\u0026gt; UAF happens and entry now becomes NULL (or could be anything).\n|\t\t\t| entry-\u0026gt;action\t|\n==\u0026gt; Accessing entry might cause panic.\r\n\r\nTo fix this issue, we are converting all kmalloc that is called within\nRCU read-side critical section to use GFP_ATOMIC.\r\n\r\n[PM: fixed missing comment, long lines, !CONFIG_IMA_LSM_RULES case](CVE-2024-40947)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndmaengine: idxd: Fix possible Use-After-Free in irq_process_work_list\r\n\r\nUse list_for_each_entry_safe() to allow iterating through the list and\ndeleting the entry in the iteration process. The descriptor is freed via\nidxd_desc_complete() and there\u0026apos;s a slight chance may cause issue for\nthe list iterator when the descriptor is reused by another thread\nwithout it being deleted from the list.(CVE-2024-40956)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: prevent possible NULL dereference in rt6_probe()\r\n\r\nsyzbot caught a NULL dereference in rt6_probe() [1]\r\n\r\nBail out if __in6_dev_get() returns NULL.\r\n\r\n[1]\nOops: general protection fault, probably for non-canonical address 0xdffffc00000000cb: 0000 [#1] PREEMPT SMP KASAN PTI\nKASAN: null-ptr-deref in range [0x0000000000000658-0x000000000000065f]\nCPU: 1 PID: 22444 Comm: syz-executor.0 Not tainted 6.10.0-rc2-syzkaller-00383-gb8481381d4e2 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024\n RIP: 0010:rt6_probe net/ipv6/route.c:656 [inline]\n RIP: 0010:find_match+0x8c4/0xf50 net/ipv6/route.c:758\nCode: 14 fd f7 48 8b 85 38 ff ff ff 48 c7 45 b0 00 00 00 00 48 8d b8 5c 06 00 00 48 b8 00 00 00 00 00 fc ff df 48 89 fa 48 c1 ea 03 \u0026lt;0f\u0026gt; b6 14 02 48 89 f8 83 e0 07 83 c0 03 38 d0 7c 08 84 d2 0f 85 19\nRSP: 0018:ffffc900034af070 EFLAGS: 00010203\nRAX: dffffc0000000000 RBX: 0000000000000000 RCX: ffffc90004521000\nRDX: 00000000000000cb RSI: ffffffff8990d0cd RDI: 000000000000065c\nRBP: ffffc900034af150 R08: 0000000000000005 R09: 0000000000000000\nR10: 0000000000000001 R11: 0000000000000002 R12: 000000000000000a\nR13: 1ffff92000695e18 R14: ffff8880244a1d20 R15: 0000000000000000\nFS: 00007f4844a5a6c0(0000) GS:ffff8880b9300000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000001b31b27000 CR3: 000000002d42c000 CR4: 00000000003506f0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n \u0026lt;TASK\u0026gt;\n rt6_nh_find_match+0xfa/0x1a0 net/ipv6/route.c:784\n nexthop_for_each_fib6_nh+0x26d/0x4a0 net/ipv4/nexthop.c:1496\n __find_rr_leaf+0x6e7/0xe00 net/ipv6/route.c:825\n find_rr_leaf net/ipv6/route.c:853 [inline]\n rt6_select net/ipv6/route.c:897 [inline]\n fib6_table_lookup+0x57e/0xa30 net/ipv6/route.c:2195\n ip6_pol_route+0x1cd/0x1150 net/ipv6/route.c:2231\n pol_lookup_func include/net/ip6_fib.h:616 [inline]\n fib6_rule_lookup+0x386/0x720 net/ipv6/fib6_rules.c:121\n ip6_route_output_flags_noref net/ipv6/route.c:2639 [inline]\n ip6_route_output_flags+0x1d0/0x640 net/ipv6/route.c:2651\n ip6_dst_lookup_tail.constprop.0+0x961/0x1760 net/ipv6/ip6_output.c:1147\n ip6_dst_lookup_flow+0x99/0x1d0 net/ipv6/ip6_output.c:1250\n rawv6_sendmsg+0xdab/0x4340 net/ipv6/raw.c:898\n inet_sendmsg+0x119/0x140 net/ipv4/af_inet.c:853\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg net/socket.c:745 [inline]\n sock_write_iter+0x4b8/0x5c0 net/socket.c:1160\n new_sync_write fs/read_write.c:497 [inline]\n vfs_write+0x6b6/0x1140 fs/read_write.c:590\n ksys_write+0x1f8/0x260 fs/read_write.c:643\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcd/0x250 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-40960)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nserial: imx: Introduce timeout when waiting on transmitter empty\r\n\r\nBy waiting at most 1 second for USR2_TXDC to be set, we avoid a potential\ndeadlock.\r\n\r\nIn case of the timeout, there is not much we can do, so we simply ignore\nthe transmitter state and optimistically try to continue.(CVE-2024-40967)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\next4: do not create EA inode under buffer lock\r\n\r\next4_xattr_set_entry() creates new EA inodes while holding buffer lock\non the external xattr block. This is problematic as it nests all the\nallocation locking (which acquires locks on other buffers) under the\nbuffer lock. This can even deadlock when the filesystem is corrupted and\ne.g. quota file is setup to contain xattr block as data block. Move the\nallocation of EA inode out of ext4_xattr_set_entry() into the callers.(CVE-2024-40972)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrop_monitor: replace spin_lock by raw_spin_lock\r\n\r\ntrace_drop_common() is called with preemption disabled, and it acquires\na spin_lock. This is problematic for RT kernels because spin_locks are\nsleeping locks in this configuration, which causes the following splat:\r\n\r\nBUG: sleeping function called from invalid context at kernel/locking/spinlock_rt.c:48\nin_atomic(): 1, irqs_disabled(): 1, non_block: 0, pid: 449, name: rcuc/47\npreempt_count: 1, expected: 0\nRCU nest depth: 2, expected: 2\n5 locks held by rcuc/47/449:\n #0: ff1100086ec30a60 ((softirq_ctrl.lock)){+.+.}-{2:2}, at: __local_bh_disable_ip+0x105/0x210\n #1: ffffffffb394a280 (rcu_read_lock){....}-{1:2}, at: rt_spin_lock+0xbf/0x130\n #2: ffffffffb394a280 (rcu_read_lock){....}-{1:2}, at: __local_bh_disable_ip+0x11c/0x210\n #3: ffffffffb394a160 (rcu_callback){....}-{0:0}, at: rcu_do_batch+0x360/0xc70\n #4: ff1100086ee07520 (\u0026amp;data-\u0026gt;lock){+.+.}-{2:2}, at: trace_drop_common.constprop.0+0xb5/0x290\nirq event stamp: 139909\nhardirqs last enabled at (139908): [\u0026lt;ffffffffb1df2b33\u0026gt;] _raw_spin_unlock_irqrestore+0x63/0x80\nhardirqs last disabled at (139909): [\u0026lt;ffffffffb19bd03d\u0026gt;] trace_drop_common.constprop.0+0x26d/0x290\nsoftirqs last enabled at (139892): [\u0026lt;ffffffffb07a1083\u0026gt;] __local_bh_enable_ip+0x103/0x170\nsoftirqs last disabled at (139898): [\u0026lt;ffffffffb0909b33\u0026gt;] rcu_cpu_kthread+0x93/0x1f0\nPreemption disabled at:\n[\u0026lt;ffffffffb1de786b\u0026gt;] rt_mutex_slowunlock+0xab/0x2e0\nCPU: 47 PID: 449 Comm: rcuc/47 Not tainted 6.9.0-rc2-rt1+ #7\nHardware name: Dell Inc. PowerEdge R650/0Y2G81, BIOS 1.6.5 04/15/2022\nCall Trace:\n \u0026lt;TASK\u0026gt;\n dump_stack_lvl+0x8c/0xd0\n dump_stack+0x14/0x20\n __might_resched+0x21e/0x2f0\n rt_spin_lock+0x5e/0x130\n ? trace_drop_common.constprop.0+0xb5/0x290\n ? skb_queue_purge_reason.part.0+0x1bf/0x230\n trace_drop_common.constprop.0+0xb5/0x290\n ? preempt_count_sub+0x1c/0xd0\n ? _raw_spin_unlock_irqrestore+0x4a/0x80\n ? __pfx_trace_drop_common.constprop.0+0x10/0x10\n ? rt_mutex_slowunlock+0x26a/0x2e0\n ? skb_queue_purge_reason.part.0+0x1bf/0x230\n ? __pfx_rt_mutex_slowunlock+0x10/0x10\n ? skb_queue_purge_reason.part.0+0x1bf/0x230\n trace_kfree_skb_hit+0x15/0x20\n trace_kfree_skb+0xe9/0x150\n kfree_skb_reason+0x7b/0x110\n skb_queue_purge_reason.part.0+0x1bf/0x230\n ? __pfx_skb_queue_purge_reason.part.0+0x10/0x10\n ? mark_lock.part.0+0x8a/0x520\n...\r\n\r\ntrace_drop_common() also disables interrupts, but this is a minor issue\nbecause we could easily replace it with a local_lock.\r\n\r\nReplace the spin_lock with raw_spin_lock to avoid sleeping in atomic\ncontext.(CVE-2024-40980)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbatman-adv: bypass empty buckets in batadv_purge_orig_ref()\r\n\r\nMany syzbot reports are pointing to soft lockups in\nbatadv_purge_orig_ref() [1]\r\n\r\nRoot cause is unknown, but we can avoid spending too much\ntime there and perhaps get more interesting reports.\r\n\r\n[1]\r\n\r\nwatchdog: BUG: soft lockup - CPU#0 stuck for 27s! [kworker/u4:6:621]\nModules linked in:\nirq event stamp: 6182794\n hardirqs last enabled at (6182793): [\u0026lt;ffff8000801dae10\u0026gt;] __local_bh_enable_ip+0x224/0x44c kernel/softirq.c:386\n hardirqs last disabled at (6182794): [\u0026lt;ffff80008ad66a78\u0026gt;] __el1_irq arch/arm64/kernel/entry-common.c:533 [inline]\n hardirqs last disabled at (6182794): [\u0026lt;ffff80008ad66a78\u0026gt;] el1_interrupt+0x24/0x68 arch/arm64/kernel/entry-common.c:551\n softirqs last enabled at (6182792): [\u0026lt;ffff80008aab71c4\u0026gt;] spin_unlock_bh include/linux/spinlock.h:396 [inline]\n softirqs last enabled at (6182792): [\u0026lt;ffff80008aab71c4\u0026gt;] batadv_purge_orig_ref+0x114c/0x1228 net/batman-adv/originator.c:1287\n softirqs last disabled at (6182790): [\u0026lt;ffff80008aab61dc\u0026gt;] spin_lock_bh include/linux/spinlock.h:356 [inline]\n softirqs last disabled at (6182790): [\u0026lt;ffff80008aab61dc\u0026gt;] batadv_purge_orig_ref+0x164/0x1228 net/batman-adv/originator.c:1271\nCPU: 0 PID: 621 Comm: kworker/u4:6 Not tainted 6.8.0-rc7-syzkaller-g707081b61156 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/29/2024\nWorkqueue: bat_events batadv_purge_orig\npstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n pc : should_resched arch/arm64/include/asm/preempt.h:79 [inline]\n pc : __local_bh_enable_ip+0x228/0x44c kernel/softirq.c:388\n lr : __local_bh_enable_ip+0x224/0x44c kernel/softirq.c:386\nsp : ffff800099007970\nx29: ffff800099007980 x28: 1fffe00018fce1bd x27: dfff800000000000\nx26: ffff0000d2620008 x25: ffff0000c7e70de8 x24: 0000000000000001\nx23: 1fffe00018e57781 x22: dfff800000000000 x21: ffff80008aab71c4\nx20: ffff0001b40136c0 x19: ffff0000c72bbc08 x18: 1fffe0001a817bb0\nx17: ffff800125414000 x16: ffff80008032116c x15: 0000000000000001\nx14: 1fffe0001ee9d610 x13: 0000000000000000 x12: 0000000000000003\nx11: 0000000000000000 x10: 0000000000ff0100 x9 : 0000000000000000\nx8 : 00000000005e5789 x7 : ffff80008aab61dc x6 : 0000000000000000\nx5 : 0000000000000000 x4 : 0000000000000001 x3 : 0000000000000000\nx2 : 0000000000000006 x1 : 0000000000000080 x0 : ffff800125414000\nCall trace:\n __daif_local_irq_enable arch/arm64/include/asm/irqflags.h:27 [inline]\n arch_local_irq_enable arch/arm64/include/asm/irqflags.h:49 [inline]\n __local_bh_enable_ip+0x228/0x44c kernel/softirq.c:386\n __raw_spin_unlock_bh include/linux/spinlock_api_smp.h:167 [inline]\n _raw_spin_unlock_bh+0x3c/0x4c kernel/locking/spinlock.c:210\n spin_unlock_bh include/linux/spinlock.h:396 [inline]\n batadv_purge_orig_ref+0x114c/0x1228 net/batman-adv/originator.c:1287\n batadv_purge_orig+0x20/0x70 net/batman-adv/originator.c:1300\n process_one_work+0x694/0x1204 kernel/workqueue.c:2633\n process_scheduled_works kernel/workqueue.c:2706 [inline]\n worker_thread+0x938/0xef4 kernel/workqueue.c:2787\n kthread+0x288/0x310 kernel/kthread.c:388\n ret_from_fork+0x10/0x20 arch/arm64/kernel/entry.S:860\nSending NMI from CPU 0 to CPUs 1:\nNMI backtrace for cpu 1\nCPU: 1 PID: 0 Comm: swapper/1 Not tainted 6.8.0-rc7-syzkaller-g707081b61156 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/29/2024\npstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n pc : arch_local_irq_enable+0x8/0xc arch/arm64/include/asm/irqflags.h:51\n lr : default_idle_call+0xf8/0x128 kernel/sched/idle.c:103\nsp : ffff800093a17d30\nx29: ffff800093a17d30 x28: dfff800000000000 x27: 1ffff00012742fb4\nx26: ffff80008ec9d000 x25: 0000000000000000 x24: 0000000000000002\nx23: 1ffff00011d93a74 x22: ffff80008ec9d3a0 x21: 0000000000000000\nx20: ffff0000c19dbc00 x19: ffff8000802d0fd8 x18: 1fffe00036804396\nx17: ffff80008ec9d000 x16: ffff8000802d089c x15: 0000000000000001\n---truncated---(CVE-2024-40981)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/sched: act_api: fix possible infinite loop in tcf_idr_check_alloc()\r\n\r\nsyzbot found hanging tasks waiting on rtnl_lock [1]\r\n\r\nA reproducer is available in the syzbot bug.\r\n\r\nWhen a request to add multiple actions with the same index is sent, the\nsecond request will block forever on the first request. This holds\nrtnl_lock, and causes tasks to hang.\r\n\r\nReturn -EAGAIN to prevent infinite looping, while keeping documented\nbehavior.\r\n\r\n[1]\r\n\r\nINFO: task kworker/1:0:5088 blocked for more than 143 seconds.\nNot tainted 6.9.0-rc4-syzkaller-00173-g3cdb45594619 #0\n\u0026quot;echo 0 \u0026gt; /proc/sys/kernel/hung_task_timeout_secs\u0026quot; disables this message.\ntask:kworker/1:0 state:D stack:23744 pid:5088 tgid:5088 ppid:2 flags:0x00004000\nWorkqueue: events_power_efficient reg_check_chans_work\nCall Trace:\n\u0026lt;TASK\u0026gt;\ncontext_switch kernel/sched/core.c:5409 [inline]\n__schedule+0xf15/0x5d00 kernel/sched/core.c:6746\n__schedule_loop kernel/sched/core.c:6823 [inline]\nschedule+0xe7/0x350 kernel/sched/core.c:6838\nschedule_preempt_disabled+0x13/0x30 kernel/sched/core.c:6895\n__mutex_lock_common kernel/locking/mutex.c:684 [inline]\n__mutex_lock+0x5b8/0x9c0 kernel/locking/mutex.c:752\nwiphy_lock include/net/cfg80211.h:5953 [inline]\nreg_leave_invalid_chans net/wireless/reg.c:2466 [inline]\nreg_check_chans_work+0x10a/0x10e0 net/wireless/reg.c:2481(CVE-2024-40995)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdkfd: don\u0026apos;t allow mapping the MMIO HDP page with large pages\r\n\r\nWe don\u0026apos;t get the right offset in that case. The GPU has\nan unused 4K area of the register BAR space into which you can\nremap registers. We remap the HDP flush registers into this\nspace to allow userspace (CPU or GPU) to flush the HDP when it\nupdates VRAM. However, on systems with \u0026gt;4K pages, we end up\nexposing PAGE_SIZE of MMIO space.(CVE-2024-41011)",
"id": "OESA-2024-1941",
"modified": "2026-08-06T11:07:24Z",
"published": "2024-08-02T11:07:24Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/security-bulletins/detail?id=openEuler-SA-2024-1941"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47205"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48703"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48780"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48859"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52679"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26924"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26925"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27010"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-34777"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35808"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35837"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35899"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35931"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36923"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-37078"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38548"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38567"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38607"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38611"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38621"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39475"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39476"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39484"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39506"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39508"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40915"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40945"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40947"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40956"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40960"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40967"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40972"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40980"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40981"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40995"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41011"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47205",
"CVE-2022-48703",
"CVE-2022-48780",
"CVE-2022-48859",
"CVE-2023-52679",
"CVE-2024-26924",
"CVE-2024-26925",
"CVE-2024-27010",
"CVE-2024-34777",
"CVE-2024-35808",
"CVE-2024-35837",
"CVE-2024-35899",
"CVE-2024-35931",
"CVE-2024-36923",
"CVE-2024-37078",
"CVE-2024-38548",
"CVE-2024-38567",
"CVE-2024-38607",
"CVE-2024-38611",
"CVE-2024-38621",
"CVE-2024-39475",
"CVE-2024-39476",
"CVE-2024-39484",
"CVE-2024-39506",
"CVE-2024-39508",
"CVE-2024-40915",
"CVE-2024-40945",
"CVE-2024-40947",
"CVE-2024-40956",
"CVE-2024-40960",
"CVE-2024-40967",
"CVE-2024-40972",
"CVE-2024-40980",
"CVE-2024-40981",
"CVE-2024-40995",
"CVE-2024-41011"
]
}
OESA-2024-1942 (CVE-2021-47205)
Vulnerability from osv_openeuler – Published: 2024-08-02 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
clk: sunxi-ng: Unregister clocks/resets when unbinding
Currently, unbinding a CCU driver unmaps the device's MMIO region, while leaving its clocks/resets and their providers registered. This can cause a page fault later when some clock operation tries to perform MMIO. Fix this by separating the CCU initialization from the memory allocation, and then using a devres callback to unregister the clocks and resets.
This also fixes a memory leak of the struct ccu_reset, and uses the
correct owner (the specific platform driver) for the clocks and resets.
Early OF clock providers are never unregistered, and limited error handling is possible, so they are mostly unchanged. The error reporting is made more consistent by moving the message inside of_sunxi_ccu_probe.(CVE-2021-47205)
In the Linux kernel, the following vulnerability has been resolved:
thermal/int340x_thermal: handle data_vault when the value is ZERO_SIZE_PTR
In some case, the GDDV returns a package with a buffer which has zero length. It causes that kmemdup() returns ZERO_SIZE_PTR (0x10).
Then the data_vault_read() got NULL point dereference problem when accessing the 0x10 value in data_vault.
[ 71.024560] BUG: kernel NULL pointer dereference, address: 0000000000000010
This patch uses ZERO_OR_NULL_PTR() for checking ZERO_SIZE_PTR or NULL value in data_vault.(CVE-2022-48703)
In the Linux kernel, the following vulnerability has been resolved:
net: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr
This node pointer is returned by of_find_compatible_node() with refcount incremented. Calling of_node_put() to aovid the refcount leak.(CVE-2022-48859)
In the Linux kernel, the following vulnerability has been resolved:
of: Fix double free in of_parse_phandle_with_args_map
In of_parse_phandle_with_args_map() the inner loop that iterates through the map entries calls of_node_put(new) to free the reference acquired by the previous iteration of the inner loop. This assumes that the value of "new" is NULL on the first iteration of the inner loop.
Make sure that this is true in all iterations of the outer loop by setting "new" to NULL after its value is assigned to "cur".
Extend the unittest to detect the double free and add an additional test case that actually triggers this path.(CVE-2023-52679)
In the Linux kernel, the following vulnerability has been resolved:
media: gspca: cpia1: shift-out-of-bounds in set_flicker
Syzkaller reported the following issue: UBSAN: shift-out-of-bounds in drivers/media/usb/gspca/cpia1.c:1031:27 shift exponent 245 is too large for 32-bit type 'int'
When the value of the variable "sd->params.exposure.gain" exceeds the number of bits in an integer, a shift-out-of-bounds error is reported. It is triggered because the variable "currentexp" cannot be left-shifted by more than the number of bits in an integer. In order to avoid invalid range during left-shift, the conditional expression is added.(CVE-2023-52764)
In the Linux kernel, the following vulnerability has been resolved:
init/main.c: Fix potential static_command_line memory overflow
We allocate memory of size 'xlen + strlen(boot_command_line) + 1' for static_command_line, but the strings copied into static_command_line are extra_command_line and command_line, rather than extra_command_line and boot_command_line.
When strlen(command_line) > strlen(boot_command_line), static_command_line will overflow.
This patch just recovers strlen(command_line) which was miss-consolidated with strlen(boot_command_line) in the commit f5c7310ac73e ("init/main: add checks for the return value of memblock_alloc*()")(CVE-2024-26988)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_tables: restore set elements when delete set fails
From abort path, nft_mapelem_activate() needs to restore refcounters to the original state. Currently, it uses the set->ops->walk() to iterate over these set elements. The existing set iterator skips inactive elements in the next generation, this does not work from the abort path to restore the original state since it has to skip active elements instead (not inactive ones).
This patch moves the check for inactive elements to the set iterator callback, then it reverses the logic for the .activate case which needs to skip active elements.
Toggle next generation bit for elements when delete set command is invoked and call nft_clear() from .activate (abort) path to restore the next generation bit.
The splat below shows an object in mappings memleak:
[43929.457523] ------------[ cut here ]------------ [43929.457532] WARNING: CPU: 0 PID: 1139 at include/net/netfilter/nf_tables.h:1237 nft_setelem_data_deactivate+0xe4/0xf0 [nf_tables] [...] [43929.458014] RIP: 0010:nft_setelem_data_deactivate+0xe4/0xf0 [nf_tables] [43929.458076] Code: 83 f8 01 77 ab 49 8d 7c 24 08 e8 37 5e d0 de 49 8b 6c 24 08 48 8d 7d 50 e8 e9 5c d0 de 8b 45 50 8d 50 ff 89 55 50 85 c0 75 86 <0f> 0b eb 82 0f 0b eb b3 0f 1f 40 00 90 90 90 90 90 90 90 90 90 90 [43929.458081] RSP: 0018:ffff888140f9f4b0 EFLAGS: 00010246 [43929.458086] RAX: 0000000000000000 RBX: ffff8881434f5288 RCX: dffffc0000000000 [43929.458090] RDX: 00000000ffffffff RSI: ffffffffa26d28a7 RDI: ffff88810ecc9550 [43929.458093] RBP: ffff88810ecc9500 R08: 0000000000000001 R09: ffffed10281f3e8f [43929.458096] R10: 0000000000000003 R11: ffff0000ffff0000 R12: ffff8881434f52a0 [43929.458100] R13: ffff888140f9f5f4 R14: ffff888151c7a800 R15: 0000000000000002 [43929.458103] FS: 00007f0c687c4740(0000) GS:ffff888390800000(0000) knlGS:0000000000000000 [43929.458107] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [43929.458111] CR2: 00007f58dbe5b008 CR3: 0000000123602005 CR4: 00000000001706f0 [43929.458114] Call Trace: [43929.458118] <TASK> [43929.458121] ? __warn+0x9f/0x1a0 [43929.458127] ? nft_setelem_data_deactivate+0xe4/0xf0 [nf_tables] [43929.458188] ? report_bug+0x1b1/0x1e0 [43929.458196] ? handle_bug+0x3c/0x70 [43929.458200] ? exc_invalid_op+0x17/0x40 [43929.458211] ? nft_setelem_data_deactivate+0xd7/0xf0 [nf_tables] [43929.458271] ? nft_setelem_data_deactivate+0xe4/0xf0 [nf_tables] [43929.458332] nft_mapelem_deactivate+0x24/0x30 [nf_tables] [43929.458392] nft_rhash_walk+0xdd/0x180 [nf_tables] [43929.458453] ? __pfx_nft_rhash_walk+0x10/0x10 [nf_tables] [43929.458512] ? rb_insert_color+0x2e/0x280 [43929.458520] nft_map_deactivate+0xdc/0x1e0 [nf_tables] [43929.458582] ? __pfx_nft_map_deactivate+0x10/0x10 [nf_tables] [43929.458642] ? __pfx_nft_mapelem_deactivate+0x10/0x10 [nf_tables] [43929.458701] ? __rcu_read_unlock+0x46/0x70 [43929.458709] nft_delset+0xff/0x110 [nf_tables] [43929.458769] nft_flush_table+0x16f/0x460 [nf_tables] [43929.458830] nf_tables_deltable+0x501/0x580 nf_tables
In the Linux kernel, the following vulnerability has been resolved:
f2fs: fix to avoid potential panic during recovery
During recovery, if FAULT_BLOCK is on, it is possible that f2fs_reserve_new_block() will return -ENOSPC during recovery, then it may trigger panic.
Also, if fault injection rate is 1 and only FAULT_BLOCK fault type is on, it may encounter deadloop in loop of block reservation.
Let's change as below to fix these issues: - remove bug_on() to avoid panic. - limit the loop count of block reservation to avoid potential deadloop.(CVE-2024-27032)
In the Linux kernel, the following vulnerability has been resolved:
clk: Fix clk_core_get NULL dereference
It is possible for clk_core_get to dereference a NULL in the following sequence:
clk_core_get() of_clk_get_hw_from_clkspec() __of_clk_get_hw_from_provider() __clk_get_hw()
__clk_get_hw() can return NULL which is dereferenced by clk_core_get() at hw->core.
Prior to commit dde4eff47c82 ("clk: Look for parents with clkdev based clk_lookups") the check IS_ERR_OR_NULL() was performed which would have caught the NULL.
Reading the description of this function it talks about returning NULL but that cannot be so at the moment.
Update the function to check for hw before dereferencing it and return NULL if hw is NULL.(CVE-2024-27038)
In the Linux kernel, the following vulnerability has been resolved:
net: phy: fix phy_get_internal_delay accessing an empty array
The phy_get_internal_delay function could try to access to an empty array in the case that the driver is calling phy_get_internal_delay without defining delay_values and rx-internal-delay-ps or tx-internal-delay-ps is defined to 0 in the device-tree. This will lead to "unable to handle kernel NULL pointer dereference at virtual address 0". To avoid this kernel oops, the test should be delay >= 0. As there is already delay < 0 test just before, the test could only be size == 0.(CVE-2024-27047)
In the Linux kernel, the following vulnerability has been resolved:
wifi: rtl8xxxu: add cancel_work_sync() for c2hcmd_work
The workqueue might still be running, when the driver is stopped. To avoid a use-after-free, call cancel_work_sync() in rtl8xxxu_stop().(CVE-2024-27052)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_tables: do not compare internal table flags on updates
Restore skipping transaction if table update does not modify flags.(CVE-2024-27065)
In the Linux kernel, the following vulnerability has been resolved:
power: supply: bq27xxx-i2c: Do not free non existing IRQ
The bq27xxx i2c-client may not have an IRQ, in which case client->irq will be 0. bq27xxx_battery_i2c_probe() already has an if (client->irq) check wrapping the request_threaded_irq().
But bq27xxx_battery_i2c_remove() unconditionally calls free_irq(client->irq) leading to:
[ 190.310742] ------------[ cut here ]------------ [ 190.310843] Trying to free already-free IRQ 0 [ 190.310861] WARNING: CPU: 2 PID: 1304 at kernel/irq/manage.c:1893 free_irq+0x1b8/0x310
Followed by a backtrace when unbinding the driver. Add an if (client->irq) to bq27xxx_battery_i2c_remove() mirroring probe() to fix this.(CVE-2024-27412)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: hci_event: Fix handling of HCI_EV_IO_CAPA_REQUEST
If we received HCI_EV_IO_CAPA_REQUEST while HCI_OP_READ_REMOTE_EXT_FEATURES is yet to be responded assume the remote does support SSP since otherwise this event shouldn't be generated.(CVE-2024-27416)
In the Linux kernel, the following vulnerability has been resolved:
dma-mapping: benchmark: fix node id validation
While validating node ids in map_benchmark_ioctl(), node_possible() may be provided with invalid argument outside of [0,MAX_NUMNODES-1] range leading to:
BUG: KASAN: wild-memory-access in map_benchmark_ioctl (kernel/dma/map_benchmark.c:214) Read of size 8 at addr 1fffffff8ccb6398 by task dma_map_benchma/971 CPU: 7 PID: 971 Comm: dma_map_benchma Not tainted 6.9.0-rc6 #37 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996) Call Trace: <TASK> dump_stack_lvl (lib/dump_stack.c:117) kasan_report (mm/kasan/report.c:603) kasan_check_range (mm/kasan/generic.c:189) variable_test_bit (arch/x86/include/asm/bitops.h:227) [inline] arch_test_bit (arch/x86/include/asm/bitops.h:239) [inline] _test_bit at (include/asm-generic/bitops/instrumented-non-atomic.h:142) [inline] node_state (include/linux/nodemask.h:423) [inline] map_benchmark_ioctl (kernel/dma/map_benchmark.c:214) full_proxy_unlocked_ioctl (fs/debugfs/file.c:333) __x64_sys_ioctl (fs/ioctl.c:890) do_syscall_64 (arch/x86/entry/common.c:83) entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
Compare node ids with sane bounds first. NUMA_NO_NODE is considered a special valid case meaning that benchmarking kthreads won't be bound to a cpuset of a given node.
Found by Linux Verification Center (linuxtesting.org).(CVE-2024-34777)
In the Linux kernel, the following vulnerability has been resolved:
net: mvpp2: clear BM pool before initialization
Register value persist after booting the kernel using kexec which results in kernel panic. Thus clear the BM pool registers before initialisation to fix the issue.(CVE-2024-35837)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu: Skip do PCI error slot reset during RAS recovery
Why: The PCI error slot reset maybe triggered after inject ue to UMC multi times, this caused system hang. [ 557.371857] amdgpu 0000:af:00.0: amdgpu: GPU reset succeeded, trying to resume [ 557.373718] [drm] PCIE GART of 512M enabled. [ 557.373722] [drm] PTB located at 0x0000031FED700000 [ 557.373788] [drm] VRAM is lost due to GPU reset! [ 557.373789] [drm] PSP is resuming... [ 557.547012] mlx5_core 0000:55:00.0: mlx5_pci_err_detected Device state = 1 pci_status: 0. Exit, result = 3, need reset [ 557.547067] [drm] PCI error: detected callback, state(1)!! [ 557.547069] [drm] No support for XGMI hive yet... [ 557.548125] mlx5_core 0000:55:00.0: mlx5_pci_slot_reset Device state = 1 pci_status: 0. Enter [ 557.607763] mlx5_core 0000:55:00.0: wait vital counter value 0x16b5b after 1 iterations [ 557.607777] mlx5_core 0000:55:00.0: mlx5_pci_slot_reset Device state = 1 pci_status: 1. Exit, err = 0, result = 5, recovered [ 557.610492] [drm] PCI error: slot reset callback!! ... [ 560.689382] amdgpu 0000:3f:00.0: amdgpu: GPU reset(2) succeeded! [ 560.689546] amdgpu 0000:5a:00.0: amdgpu: GPU reset(2) succeeded! [ 560.689562] general protection fault, probably for non-canonical address 0x5f080b54534f611f: 0000 [#1] SMP NOPTI [ 560.701008] CPU: 16 PID: 2361 Comm: kworker/u448:9 Tainted: G OE 5.15.0-91-generic #101-Ubuntu [ 560.712057] Hardware name: Microsoft C278A/C278A, BIOS C2789.5.BS.1C11.AG.1 11/08/2023 [ 560.720959] Workqueue: amdgpu-reset-hive amdgpu_ras_do_recovery [amdgpu] [ 560.728887] RIP: 0010:amdgpu_device_gpu_recover.cold+0xbf1/0xcf5 [amdgpu] [ 560.736891] Code: ff 41 89 c6 e9 1b ff ff ff 44 0f b6 45 b0 e9 4f ff ff ff be 01 00 00 00 4c 89 e7 e8 76 c9 8b ff 44 0f b6 45 b0 e9 3c fd ff ff <48> 83 ba 18 02 00 00 00 0f 84 6a f8 ff ff 48 8d 7a 78 be 01 00 00 [ 560.757967] RSP: 0018:ffa0000032e53d80 EFLAGS: 00010202 [ 560.763848] RAX: ffa00000001dfd10 RBX: ffa0000000197090 RCX: ffa0000032e53db0 [ 560.771856] RDX: 5f080b54534f5f07 RSI: 0000000000000000 RDI: ff11000128100010 [ 560.779867] RBP: ffa0000032e53df0 R08: 0000000000000000 R09: ffffffffffe77f08 [ 560.787879] R10: 0000000000ffff0a R11: 0000000000000001 R12: 0000000000000000 [ 560.795889] R13: ffa0000032e53e00 R14: 0000000000000000 R15: 0000000000000000 [ 560.803889] FS: 0000000000000000(0000) GS:ff11007e7e800000(0000) knlGS:0000000000000000 [ 560.812973] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 560.819422] CR2: 000055a04c118e68 CR3: 0000000007410005 CR4: 0000000000771ee0 [ 560.827433] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 [ 560.835433] DR3: 0000000000000000 DR6: 00000000fffe07f0 DR7: 0000000000000400 [ 560.843444] PKRU: 55555554 [ 560.846480] Call Trace: [ 560.849225] <TASK> [ 560.851580] ? show_trace_log_lvl+0x1d6/0x2ea [ 560.856488] ? show_trace_log_lvl+0x1d6/0x2ea [ 560.861379] ? amdgpu_ras_do_recovery+0x1b2/0x210 [amdgpu] [ 560.867778] ? show_regs.part.0+0x23/0x29 [ 560.872293] ? __die_body.cold+0x8/0xd [ 560.876502] ? die_addr+0x3e/0x60 [ 560.880238] ? exc_general_protection+0x1c5/0x410 [ 560.885532] ? asm_exc_general_protection+0x27/0x30 [ 560.891025] ? amdgpu_device_gpu_recover.cold+0xbf1/0xcf5 [amdgpu] [ 560.898323] amdgpu_ras_do_recovery+0x1b2/0x210 [amdgpu] [ 560.904520] process_one_work+0x228/0x3d0 How: In RAS recovery, mode-1 reset is issued from RAS fatal error handling and expected all the nodes in a hive to be reset. no need to issue another mode-1 during this procedure.(CVE-2024-35931)
In the Linux kernel, the following vulnerability has been resolved:
fs/9p: fix uninitialized values during inode evict
If an iget fails due to not being able to retrieve information from the server then the inode structure is only partially initialized. When the inode gets evicted, references to uninitialized structures (like fscache cookies) were being made.
This patch checks for a bad_inode before doing anything other than clearing the inode from the cache. Since the inode is bad, it shouldn't have any state associated with it that needs to be written back (and there really isn't a way to complete those anyways).(CVE-2024-36923)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: fix potential kernel bug due to lack of writeback flag waiting
Destructive writes to a block device on which nilfs2 is mounted can cause a kernel bug in the folio/page writeback start routine or writeback end routine (__folio_start_writeback in the log below):
kernel BUG at mm/page-writeback.c:3070! Oops: invalid opcode: 0000 [#1] PREEMPT SMP KASAN PTI ... RIP: 0010:__folio_start_writeback+0xbaa/0x10e0 Code: 25 ff 0f 00 00 0f 84 18 01 00 00 e8 40 ca c6 ff e9 17 f6 ff ff e8 36 ca c6 ff 4c 89 f7 48 c7 c6 80 c0 12 84 e8 e7 b3 0f 00 90 <0f> 0b e8 1f ca c6 ff 4c 89 f7 48 c7 c6 a0 c6 12 84 e8 d0 b3 0f 00 ... Call Trace: <TASK> nilfs_segctor_do_construct+0x4654/0x69d0 [nilfs2] nilfs_segctor_construct+0x181/0x6b0 [nilfs2] nilfs_segctor_thread+0x548/0x11c0 [nilfs2] kthread+0x2f0/0x390 ret_from_fork+0x4b/0x80 ret_from_fork_asm+0x1a/0x30 </TASK>
This is because when the log writer starts a writeback for segment summary blocks or a super root block that use the backing device's page cache, it does not wait for the ongoing folio/page writeback, resulting in an inconsistent writeback state.
Fix this issue by waiting for ongoing writebacks when putting folios/pages on the backing device into writeback state.(CVE-2024-37078)
In the Linux kernel, the following vulnerability has been resolved:
drm: bridge: cdns-mhdp8546: Fix possible null pointer dereference
In cdns_mhdp_atomic_enable(), the return value of drm_mode_duplicate() is assigned to mhdp_state->current_mode, and there is a dereference of it in drm_mode_set_name(), which will lead to a NULL pointer dereference on failure of drm_mode_duplicate().
Fix this bug add a check of mhdp_state->current_mode.(CVE-2024-38548)
In the Linux kernel, the following vulnerability has been resolved:
wifi: carl9170: add a proper sanity check for endpoints
Syzkaller reports [1] hitting a warning which is caused by presence of a wrong endpoint type at the URB sumbitting stage. While there was a check for a specific 4th endpoint, since it can switch types between bulk and interrupt, other endpoints are trusted implicitly. Similar warning is triggered in a couple of other syzbot issues [2].
Fix the issue by doing a comprehensive check of all endpoints taking into account difference between high- and full-speed configuration.
[1] Syzkaller report: ... WARNING: CPU: 0 PID: 4721 at drivers/usb/core/urb.c:504 usb_submit_urb+0xed6/0x1880 drivers/usb/core/urb.c:504 ... Call Trace: <TASK> carl9170_usb_send_rx_irq_urb+0x273/0x340 drivers/net/wireless/ath/carl9170/usb.c:504 carl9170_usb_init_device drivers/net/wireless/ath/carl9170/usb.c:939 [inline] carl9170_usb_firmware_finish drivers/net/wireless/ath/carl9170/usb.c:999 [inline] carl9170_usb_firmware_step2+0x175/0x240 drivers/net/wireless/ath/carl9170/usb.c:1028 request_firmware_work_func+0x130/0x240 drivers/base/firmware_loader/main.c:1107 process_one_work+0x9bf/0x1710 kernel/workqueue.c:2289 worker_thread+0x669/0x1090 kernel/workqueue.c:2436 kthread+0x2e8/0x3a0 kernel/kthread.c:376 ret_from_fork+0x1f/0x30 arch/x86/entry/entry_64.S:308 </TASK>
[2] Related syzkaller crashes:(CVE-2024-38567)
In the Linux kernel, the following vulnerability has been resolved:
macintosh/via-macii: Fix "BUG: sleeping function called from invalid context"
The via-macii ADB driver calls request_irq() after disabling hard interrupts. But disabling interrupts isn't necessary here because the VIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)
In the Linux kernel, the following vulnerability has been resolved:
media: i2c: et8ek8: Don't strip remove function when driver is builtin
Using __exit for the remove function results in the remove callback being discarded with CONFIG_VIDEO_ET8EK8=y. When such a device gets unbound (e.g. using sysfs or hotplug), the driver is just removed without the cleanup being performed. This results in resource leaks. Fix it by compiling in the remove callback unconditionally.
This also fixes a W=1 modpost warning:
WARNING: modpost: drivers/media/i2c/et8ek8/et8ek8: section mismatch in reference: et8ek8_i2c_driver+0x10 (section: .data) -> et8ek8_remove (section: .exit.text)(CVE-2024-38611)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu: add error handle to avoid out-of-bounds
if the sdma_v4_0_irq_id_to_seq return -EINVAL, the process should be stop to avoid out-of-bounds read, so directly return -EINVAL.(CVE-2024-39471)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: savage: Handle err return when savagefb_check_var failed
The commit 04e5eac8f3ab("fbdev: savage: Error out if pixclock equals zero") checks the value of pixclock to avoid divide-by-zero error. However the function savagefb_probe doesn't handle the error return of savagefb_check_var. When pixclock is 0, it will cause divide-by-zero error.(CVE-2024-39475)
In the Linux kernel, the following vulnerability has been resolved:
md/raid5: fix deadlock that raid5d() wait for itself to clear MD_SB_CHANGE_PENDING
Xiao reported that lvm2 test lvconvert-raid-takeover.sh can hang with small possibility, the root cause is exactly the same as commit bed9e27baf52 ("Revert "md/raid5: Wait for MD_SB_CHANGE_PENDING in raid5d"")
However, Dan reported another hang after that, and junxiao investigated the problem and found out that this is caused by plugged bio can't issue from raid5d().
Current implementation in raid5d() has a weird dependence:
1) md_check_recovery() from raid5d() must hold 'reconfig_mutex' to clear MD_SB_CHANGE_PENDING; 2) raid5d() handles IO in a deadloop, until all IO are issued; 3) IO from raid5d() must wait for MD_SB_CHANGE_PENDING to be cleared;
This behaviour is introduce before v2.6, and for consequence, if other context hold 'reconfig_mutex', and md_check_recovery() can't update super_block, then raid5d() will waste one cpu 100% by the deadloop, until 'reconfig_mutex' is released.
Refer to the implementation from raid1 and raid10, fix this problem by skipping issue IO if MD_SB_CHANGE_PENDING is still set after md_check_recovery(), daemon thread will be woken up when 'reconfig_mutex' is released. Meanwhile, the hang problem will be fixed as well.(CVE-2024-39476)
In the Linux kernel, the following vulnerability has been resolved:
mmc: davinci: Don't strip remove function when driver is builtin
Using __exit for the remove function results in the remove callback being discarded with CONFIG_MMC_DAVINCI=y. When such a device gets unbound (e.g. using sysfs or hotplug), the driver is just removed without the cleanup being performed. This results in resource leaks. Fix it by compiling in the remove callback unconditionally.
This also fixes a W=1 modpost warning:
WARNING: modpost: drivers/mmc/host/davinci_mmc: section mismatch in reference: davinci_mmcsd_driver+0x10 (section: .data) -> davinci_mmcsd_remove (section: .exit.text)(CVE-2024-39484)
In the Linux kernel, the following vulnerability has been resolved:
liquidio: Adjust a NULL pointer handling path in lio_vf_rep_copy_packet
In lio_vf_rep_copy_packet() pg_info->page is compared to a NULL value, but then it is unconditionally passed to skb_add_rx_frag() which looks strange and could lead to null pointer dereference.
lio_vf_rep_copy_packet() call trace looks like: octeon_droq_process_packets octeon_droq_fast_process_packets octeon_droq_dispatch_pkt octeon_create_recv_info ...search in the dispatch_list... ->disp_fn(rdisp->rinfo, ...) lio_vf_rep_pkt_recv(struct octeon_recv_info *recv_info, ...) In this path there is no code which sets pg_info->page to NULL. So this check looks unneeded and doesn't solve potential problem. But I guess the author had reason to add a check and I have no such card and can't do real test. In addition, the code in the function liquidio_push_packet() in liquidio/lio_core.c does exactly the same.
Based on this, I consider the most acceptable compromise solution to adjust this issue by moving skb_add_rx_frag() into conditional scope.
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-39506)
In the Linux kernel, the following vulnerability has been resolved:
io_uring/io-wq: Use set_bit() and test_bit() at worker->flags
Utilize set_bit() and test_bit() on worker->flags within io_uring/io-wq to address potential data races.
The structure io_worker->flags may be accessed through various data paths, leading to concurrency issues. When KCSAN is enabled, it reveals data races occurring in io_worker_handle_work and io_wq_activate_free_worker functions.
BUG: KCSAN: data-race in io_worker_handle_work / io_wq_activate_free_worker
write to 0xffff8885c4246404 of 4 bytes by task 49071 on cpu 28:
io_worker_handle_work (io_uring/io-wq.c:434 io_uring/io-wq.c:569)
io_wq_worker (io_uring/io-wq.c:?)
<snip>
read to 0xffff8885c4246404 of 4 bytes by task 49024 on cpu 5:
io_wq_activate_free_worker (io_uring/io-wq.c:? io_uring/io-wq.c:285)
io_wq_enqueue (io_uring/io-wq.c:947)
io_queue_iowq (io_uring/io_uring.c:524)
io_req_task_submit (io_uring/io_uring.c:1511)
io_handle_tw_list (io_uring/io_uring.c:1198)
<snip>
Line numbers against commit 18daea77cca6 ("Merge tag 'for-linus' of git://git.kernel.org/pub/scm/virt/kvm/kvm").
These races involve writes and reads to the same memory location by different tasks running on different CPUs. To mitigate this, refactor the code to use atomic operations such as set_bit(), test_bit(), and clear_bit() instead of basic "and" and "or" operations. This ensures thread-safe manipulation of worker flags.
Also, move create_index to avoid holes in the structure.(CVE-2024-39508)
In the Linux kernel, the following vulnerability has been resolved:
riscv: rewrite __kernel_map_pages() to fix sleeping in invalid context
__kernel_map_pages() is a debug function which clears the valid bit in page table entry for deallocated pages to detect illegal memory accesses to freed pages.
This function set/clear the valid bit using __set_memory(). __set_memory() acquires init_mm's semaphore, and this operation may sleep. This is problematic, because __kernel_map_pages() can be called in atomic context, and thus is illegal to sleep. An example warning that this causes:
BUG: sleeping function called from invalid context at kernel/locking/rwsem.c:1578 in_atomic(): 1, irqs_disabled(): 0, non_block: 0, pid: 2, name: kthreadd preempt_count: 2, expected: 0 CPU: 0 PID: 2 Comm: kthreadd Not tainted 6.9.0-g1d4c6d784ef6 #37 Hardware name: riscv-virtio,qemu (DT) Call Trace: [<ffffffff800060dc>] dump_backtrace+0x1c/0x24 [<ffffffff8091ef6e>] show_stack+0x2c/0x38 [<ffffffff8092baf8>] dump_stack_lvl+0x5a/0x72 [<ffffffff8092bb24>] dump_stack+0x14/0x1c [<ffffffff8003b7ac>] __might_resched+0x104/0x10e [<ffffffff8003b7f4>] __might_sleep+0x3e/0x62 [<ffffffff8093276a>] down_write+0x20/0x72 [<ffffffff8000cf00>] __set_memory+0x82/0x2fa [<ffffffff8000d324>] __kernel_map_pages+0x5a/0xd4 [<ffffffff80196cca>] __alloc_pages_bulk+0x3b2/0x43a [<ffffffff8018ee82>] __vmalloc_node_range+0x196/0x6ba [<ffffffff80011904>] copy_process+0x72c/0x17ec [<ffffffff80012ab4>] kernel_clone+0x60/0x2fe [<ffffffff80012f62>] kernel_thread+0x82/0xa0 [<ffffffff8003552c>] kthreadd+0x14a/0x1be [<ffffffff809357de>] ret_from_fork+0xe/0x1c
Rewrite this function with apply_to_existing_page_range(). It is fine to not have any locking, because __kernel_map_pages() works with pages being allocated/deallocated and those pages are not changed by anyone else in the meantime.(CVE-2024-40915)
In the Linux kernel, the following vulnerability has been resolved:
iommu: Return right value in iommu_sva_bind_device()
iommu_sva_bind_device() should return either a sva bond handle or an ERR_PTR value in error cases. Existing drivers (idxd and uacce) only check the return value with IS_ERR(). This could potentially lead to a kernel NULL pointer dereference issue if the function returns NULL instead of an error pointer.
In reality, this doesn't cause any problems because iommu_sva_bind_device() only returns NULL when the kernel is not configured with CONFIG_IOMMU_SVA. In this case, iommu_dev_enable_feature(dev, IOMMU_DEV_FEAT_SVA) will return an error, and the device drivers won't call iommu_sva_bind_device() at all.(CVE-2024-40945)
In the Linux kernel, the following vulnerability has been resolved:
ima: Avoid blocking in RCU read-side critical section
A panic happens in ima_match_policy:
BUG: unable to handle kernel NULL pointer dereference at 0000000000000010 PGD 42f873067 P4D 0 Oops: 0000 [#1] SMP NOPTI CPU: 5 PID: 1286325 Comm: kubeletmonit.sh Kdump: loaded Tainted: P Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 0.0.0 02/06/2015 RIP: 0010:ima_match_policy+0x84/0x450 Code: 49 89 fc 41 89 cf 31 ed 89 44 24 14 eb 1c 44 39 7b 18 74 26 41 83 ff 05 74 20 48 8b 1b 48 3b 1d f2 b9 f4 00 0f 84 9c 01 00 00 <44> 85 73 10 74 ea 44 8b 6b 14 41 f6 c5 01 75 d4 41 f6 c5 02 74 0f RSP: 0018:ff71570009e07a80 EFLAGS: 00010207 RAX: 0000000000000000 RBX: 0000000000000000 RCX: 0000000000000200 RDX: ffffffffad8dc7c0 RSI: 0000000024924925 RDI: ff3e27850dea2000 RBP: 0000000000000000 R08: 0000000000000000 R09: ffffffffabfce739 R10: ff3e27810cc42400 R11: 0000000000000000 R12: ff3e2781825ef970 R13: 00000000ff3e2785 R14: 000000000000000c R15: 0000000000000001 FS: 00007f5195b51740(0000) GS:ff3e278b12d40000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000000000000010 CR3: 0000000626d24002 CR4: 0000000000361ee0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: ima_get_action+0x22/0x30 process_measurement+0xb0/0x830 ? page_add_file_rmap+0x15/0x170 ? alloc_set_pte+0x269/0x4c0 ? prep_new_page+0x81/0x140 ? simple_xattr_get+0x75/0xa0 ? selinux_file_open+0x9d/0xf0 ima_file_check+0x64/0x90 path_openat+0x571/0x1720 do_filp_open+0x9b/0x110 ? page_counter_try_charge+0x57/0xc0 ? files_cgroup_alloc_fd+0x38/0x60 ? __alloc_fd+0xd4/0x250 ? do_sys_open+0x1bd/0x250 do_sys_open+0x1bd/0x250 do_syscall_64+0x5d/0x1d0 entry_SYSCALL_64_after_hwframe+0x65/0xca
Commit c7423dbdbc9e ("ima: Handle -ESTALE returned by ima_filter_rule_match()") introduced call to ima_lsm_copy_rule within a RCU read-side critical section which contains kmalloc with GFP_KERNEL. This implies a possible sleep and violates limitations of RCU read-side critical sections on non-PREEMPT systems.
Sleeping within RCU read-side critical section might cause synchronize_rcu() returning early and break RCU protection, allowing a UAF to happen.
The root cause of this issue could be described as follows: | Thread A | Thread B | | |ima_match_policy | | | rcu_read_lock | |ima_lsm_update_rule | | | synchronize_rcu | | | | kmalloc(GFP_KERNEL)| | | sleep | ==> synchronize_rcu returns early | kfree(entry) | | | | entry = entry->next| ==> UAF happens and entry now becomes NULL (or could be anything). | | entry->action | ==> Accessing entry might cause panic.
To fix this issue, we are converting all kmalloc that is called within RCU read-side critical section to use GFP_ATOMIC.
PM: fixed missing comment, long lines, !CONFIG_IMA_LSM_RULES case
In the Linux kernel, the following vulnerability has been resolved:
dmaengine: idxd: Fix possible Use-After-Free in irq_process_work_list
Use list_for_each_entry_safe() to allow iterating through the list and deleting the entry in the iteration process. The descriptor is freed via idxd_desc_complete() and there's a slight chance may cause issue for the list iterator when the descriptor is reused by another thread without it being deleted from the list.(CVE-2024-40956)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: prevent possible NULL dereference in rt6_probe()
syzbot caught a NULL dereference in rt6_probe() [1]
Bail out if __in6_dev_get() returns NULL.
[1] Oops: general protection fault, probably for non-canonical address 0xdffffc00000000cb: 0000 [#1] PREEMPT SMP KASAN PTI KASAN: null-ptr-deref in range [0x0000000000000658-0x000000000000065f] CPU: 1 PID: 22444 Comm: syz-executor.0 Not tainted 6.10.0-rc2-syzkaller-00383-gb8481381d4e2 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024 RIP: 0010:rt6_probe net/ipv6/route.c:656 [inline] RIP: 0010:find_match+0x8c4/0xf50 net/ipv6/route.c:758 Code: 14 fd f7 48 8b 85 38 ff ff ff 48 c7 45 b0 00 00 00 00 48 8d b8 5c 06 00 00 48 b8 00 00 00 00 00 fc ff df 48 89 fa 48 c1 ea 03 <0f> b6 14 02 48 89 f8 83 e0 07 83 c0 03 38 d0 7c 08 84 d2 0f 85 19 RSP: 0018:ffffc900034af070 EFLAGS: 00010203 RAX: dffffc0000000000 RBX: 0000000000000000 RCX: ffffc90004521000 RDX: 00000000000000cb RSI: ffffffff8990d0cd RDI: 000000000000065c RBP: ffffc900034af150 R08: 0000000000000005 R09: 0000000000000000 R10: 0000000000000001 R11: 0000000000000002 R12: 000000000000000a R13: 1ffff92000695e18 R14: ffff8880244a1d20 R15: 0000000000000000 FS: 00007f4844a5a6c0(0000) GS:ffff8880b9300000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000001b31b27000 CR3: 000000002d42c000 CR4: 00000000003506f0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> rt6_nh_find_match+0xfa/0x1a0 net/ipv6/route.c:784 nexthop_for_each_fib6_nh+0x26d/0x4a0 net/ipv4/nexthop.c:1496 __find_rr_leaf+0x6e7/0xe00 net/ipv6/route.c:825 find_rr_leaf net/ipv6/route.c:853 [inline] rt6_select net/ipv6/route.c:897 [inline] fib6_table_lookup+0x57e/0xa30 net/ipv6/route.c:2195 ip6_pol_route+0x1cd/0x1150 net/ipv6/route.c:2231 pol_lookup_func include/net/ip6_fib.h:616 [inline] fib6_rule_lookup+0x386/0x720 net/ipv6/fib6_rules.c:121 ip6_route_output_flags_noref net/ipv6/route.c:2639 [inline] ip6_route_output_flags+0x1d0/0x640 net/ipv6/route.c:2651 ip6_dst_lookup_tail.constprop.0+0x961/0x1760 net/ipv6/ip6_output.c:1147 ip6_dst_lookup_flow+0x99/0x1d0 net/ipv6/ip6_output.c:1250 rawv6_sendmsg+0xdab/0x4340 net/ipv6/raw.c:898 inet_sendmsg+0x119/0x140 net/ipv4/af_inet.c:853 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg net/socket.c:745 [inline] sock_write_iter+0x4b8/0x5c0 net/socket.c:1160 new_sync_write fs/read_write.c:497 [inline] vfs_write+0x6b6/0x1140 fs/read_write.c:590 ksys_write+0x1f8/0x260 fs/read_write.c:643 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcd/0x250 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-40960)
In the Linux kernel, the following vulnerability has been resolved:
mips: bmips: BCM6358: make sure CBR is correctly set
It was discovered that some device have CBR address set to 0 causing kernel panic when arch_sync_dma_for_cpu_all is called.
This was notice in situation where the system is booted from TP1 and BMIPS_GET_CBR() returns 0 instead of a valid address and !!(read_c0_brcm_cmt_local() & (1 << 31)); not failing.
The current check whether RAC flush should be disabled or not are not enough hence lets check if CBR is a valid address or not.(CVE-2024-40963)
In the Linux kernel, the following vulnerability has been resolved:
serial: imx: Introduce timeout when waiting on transmitter empty
By waiting at most 1 second for USR2_TXDC to be set, we avoid a potential deadlock.
In case of the timeout, there is not much we can do, so we simply ignore the transmitter state and optimistically try to continue.(CVE-2024-40967)
In the Linux kernel, the following vulnerability has been resolved:
ext4: do not create EA inode under buffer lock
ext4_xattr_set_entry() creates new EA inodes while holding buffer lock on the external xattr block. This is problematic as it nests all the allocation locking (which acquires locks on other buffers) under the buffer lock. This can even deadlock when the filesystem is corrupted and e.g. quota file is setup to contain xattr block as data block. Move the allocation of EA inode out of ext4_xattr_set_entry() into the callers.(CVE-2024-40972)
In the Linux kernel, the following vulnerability has been resolved:
drop_monitor: replace spin_lock by raw_spin_lock
trace_drop_common() is called with preemption disabled, and it acquires a spin_lock. This is problematic for RT kernels because spin_locks are sleeping locks in this configuration, which causes the following splat:
BUG: sleeping function called from invalid context at kernel/locking/spinlock_rt.c:48 in_atomic(): 1, irqs_disabled(): 1, non_block: 0, pid: 449, name: rcuc/47 preempt_count: 1, expected: 0 RCU nest depth: 2, expected: 2 5 locks held by rcuc/47/449: #0: ff1100086ec30a60 ((softirq_ctrl.lock)){+.+.}-{2:2}, at: __local_bh_disable_ip+0x105/0x210 #1: ffffffffb394a280 (rcu_read_lock){....}-{1:2}, at: rt_spin_lock+0xbf/0x130 #2: ffffffffb394a280 (rcu_read_lock){....}-{1:2}, at: __local_bh_disable_ip+0x11c/0x210 #3: ffffffffb394a160 (rcu_callback){....}-{0:0}, at: rcu_do_batch+0x360/0xc70 #4: ff1100086ee07520 (&data->lock){+.+.}-{2:2}, at: trace_drop_common.constprop.0+0xb5/0x290 irq event stamp: 139909 hardirqs last enabled at (139908): [<ffffffffb1df2b33>] _raw_spin_unlock_irqrestore+0x63/0x80 hardirqs last disabled at (139909): [<ffffffffb19bd03d>] trace_drop_common.constprop.0+0x26d/0x290 softirqs last enabled at (139892): [<ffffffffb07a1083>] __local_bh_enable_ip+0x103/0x170 softirqs last disabled at (139898): [<ffffffffb0909b33>] rcu_cpu_kthread+0x93/0x1f0 Preemption disabled at: [<ffffffffb1de786b>] rt_mutex_slowunlock+0xab/0x2e0 CPU: 47 PID: 449 Comm: rcuc/47 Not tainted 6.9.0-rc2-rt1+ #7 Hardware name: Dell Inc. PowerEdge R650/0Y2G81, BIOS 1.6.5 04/15/2022 Call Trace: <TASK> dump_stack_lvl+0x8c/0xd0 dump_stack+0x14/0x20 __might_resched+0x21e/0x2f0 rt_spin_lock+0x5e/0x130 ? trace_drop_common.constprop.0+0xb5/0x290 ? skb_queue_purge_reason.part.0+0x1bf/0x230 trace_drop_common.constprop.0+0xb5/0x290 ? preempt_count_sub+0x1c/0xd0 ? _raw_spin_unlock_irqrestore+0x4a/0x80 ? __pfx_trace_drop_common.constprop.0+0x10/0x10 ? rt_mutex_slowunlock+0x26a/0x2e0 ? skb_queue_purge_reason.part.0+0x1bf/0x230 ? __pfx_rt_mutex_slowunlock+0x10/0x10 ? skb_queue_purge_reason.part.0+0x1bf/0x230 trace_kfree_skb_hit+0x15/0x20 trace_kfree_skb+0xe9/0x150 kfree_skb_reason+0x7b/0x110 skb_queue_purge_reason.part.0+0x1bf/0x230 ? __pfx_skb_queue_purge_reason.part.0+0x10/0x10 ? mark_lock.part.0+0x8a/0x520 ...
trace_drop_common() also disables interrupts, but this is a minor issue because we could easily replace it with a local_lock.
Replace the spin_lock with raw_spin_lock to avoid sleeping in atomic context.(CVE-2024-40980)
In the Linux kernel, the following vulnerability has been resolved:
batman-adv: bypass empty buckets in batadv_purge_orig_ref()
Many syzbot reports are pointing to soft lockups in batadv_purge_orig_ref() [1]
Root cause is unknown, but we can avoid spending too much time there and perhaps get more interesting reports.
[1]
watchdog: BUG: soft lockup - CPU#0 stuck for 27s! [kworker/u4:6:621] Modules linked in: irq event stamp: 6182794 hardirqs last enabled at (6182793): [<ffff8000801dae10>] __local_bh_enable_ip+0x224/0x44c kernel/softirq.c:386 hardirqs last disabled at (6182794): [<ffff80008ad66a78>] __el1_irq arch/arm64/kernel/entry-common.c:533 [inline] hardirqs last disabled at (6182794): [<ffff80008ad66a78>] el1_interrupt+0x24/0x68 arch/arm64/kernel/entry-common.c:551 softirqs last enabled at (6182792): [<ffff80008aab71c4>] spin_unlock_bh include/linux/spinlock.h:396 [inline] softirqs last enabled at (6182792): [<ffff80008aab71c4>] batadv_purge_orig_ref+0x114c/0x1228 net/batman-adv/originator.c:1287 softirqs last disabled at (6182790): [<ffff80008aab61dc>] spin_lock_bh include/linux/spinlock.h:356 [inline] softirqs last disabled at (6182790): [<ffff80008aab61dc>] batadv_purge_orig_ref+0x164/0x1228 net/batman-adv/originator.c:1271 CPU: 0 PID: 621 Comm: kworker/u4:6 Not tainted 6.8.0-rc7-syzkaller-g707081b61156 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/29/2024 Workqueue: bat_events batadv_purge_orig pstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--) pc : should_resched arch/arm64/include/asm/preempt.h:79 [inline] pc : __local_bh_enable_ip+0x228/0x44c kernel/softirq.c:388 lr : __local_bh_enable_ip+0x224/0x44c kernel/softirq.c:386 sp : ffff800099007970 x29: ffff800099007980 x28: 1fffe00018fce1bd x27: dfff800000000000 x26: ffff0000d2620008 x25: ffff0000c7e70de8 x24: 0000000000000001 x23: 1fffe00018e57781 x22: dfff800000000000 x21: ffff80008aab71c4 x20: ffff0001b40136c0 x19: ffff0000c72bbc08 x18: 1fffe0001a817bb0 x17: ffff800125414000 x16: ffff80008032116c x15: 0000000000000001 x14: 1fffe0001ee9d610 x13: 0000000000000000 x12: 0000000000000003 x11: 0000000000000000 x10: 0000000000ff0100 x9 : 0000000000000000 x8 : 00000000005e5789 x7 : ffff80008aab61dc x6 : 0000000000000000 x5 : 0000000000000000 x4 : 0000000000000001 x3 : 0000000000000000 x2 : 0000000000000006 x1 : 0000000000000080 x0 : ffff800125414000 Call trace: __daif_local_irq_enable arch/arm64/include/asm/irqflags.h:27 [inline] arch_local_irq_enable arch/arm64/include/asm/irqflags.h:49 [inline] __local_bh_enable_ip+0x228/0x44c kernel/softirq.c:386 __raw_spin_unlock_bh include/linux/spinlock_api_smp.h:167 [inline] _raw_spin_unlock_bh+0x3c/0x4c kernel/locking/spinlock.c:210 spin_unlock_bh include/linux/spinlock.h:396 [inline] batadv_purge_orig_ref+0x114c/0x1228 net/batman-adv/originator.c:1287 batadv_purge_orig+0x20/0x70 net/batman-adv/originator.c:1300 process_one_work+0x694/0x1204 kernel/workqueue.c:2633 process_scheduled_works kernel/workqueue.c:2706 [inline] worker_thread+0x938/0xef4 kernel/workqueue.c:2787 kthread+0x288/0x310 kernel/kthread.c:388 ret_from_fork+0x10/0x20 arch/arm64/kernel/entry.S:860 Sending NMI from CPU 0 to CPUs 1: NMI backtrace for cpu 1 CPU: 1 PID: 0 Comm: swapper/1 Not tainted 6.8.0-rc7-syzkaller-g707081b61156 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/29/2024 pstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--) pc : arch_local_irq_enable+0x8/0xc arch/arm64/include/asm/irqflags.h:51 lr : default_idle_call+0xf8/0x128 kernel/sched/idle.c:103 sp : ffff800093a17d30 x29: ffff800093a17d30 x28: dfff800000000000 x27: 1ffff00012742fb4 x26: ffff80008ec9d000 x25: 0000000000000000 x24: 0000000000000002 x23: 1ffff00011d93a74 x22: ffff80008ec9d3a0 x21: 0000000000000000 x20: ffff0000c19dbc00 x19: ffff8000802d0fd8 x18: 1fffe00036804396 x17: ffff80008ec9d000 x16: ffff8000802d089c x15: 0000000000000001 ---truncated---(CVE-2024-40981)
In the Linux kernel, the following vulnerability has been resolved:
ssb: Fix potential NULL pointer dereference in ssb_device_uevent()
The ssb_device_uevent() function first attempts to convert the 'dev' pointer to 'struct ssb_device *'. However, it mistakenly dereferences 'dev' before performing the NULL check, potentially leading to a NULL pointer dereference if 'dev' is NULL.
To fix this issue, move the NULL check before dereferencing the 'dev' pointer, ensuring that the pointer is valid before attempting to use it.
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-40982)
In the Linux kernel, the following vulnerability has been resolved:
net/sched: act_api: fix possible infinite loop in tcf_idr_check_alloc()
syzbot found hanging tasks waiting on rtnl_lock [1]
A reproducer is available in the syzbot bug.
When a request to add multiple actions with the same index is sent, the second request will block forever on the first request. This holds rtnl_lock, and causes tasks to hang.
Return -EAGAIN to prevent infinite looping, while keeping documented behavior.
[1]
INFO: task kworker/1:0:5088 blocked for more than 143 seconds. Not tainted 6.9.0-rc4-syzkaller-00173-g3cdb45594619 #0 "echo 0 > /proc/sys/kernel/hung_task_timeout_secs" disables this message. task:kworker/1:0 state:D stack:23744 pid:5088 tgid:5088 ppid:2 flags:0x00004000 Workqueue: events_power_efficient reg_check_chans_work Call Trace: <TASK> context_switch kernel/sched/core.c:5409 [inline] __schedule+0xf15/0x5d00 kernel/sched/core.c:6746 __schedule_loop kernel/sched/core.c:6823 [inline] schedule+0xe7/0x350 kernel/sched/core.c:6838 schedule_preempt_disabled+0x13/0x30 kernel/sched/core.c:6895 __mutex_lock_common kernel/locking/mutex.c:684 [inline] __mutex_lock+0x5b8/0x9c0 kernel/locking/mutex.c:752 wiphy_lock include/net/cfg80211.h:5953 [inline] reg_leave_invalid_chans net/wireless/reg.c:2466 [inline] reg_check_chans_work+0x10a/0x10e0 net/wireless/reg.c:2481(CVE-2024-40995)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdkfd: don't allow mapping the MMIO HDP page with large pages
We don't get the right offset in that case. The GPU has an unused 4K area of the register BAR space into which you can remap registers. We remap the HDP flush registers into this space to allow userspace (CPU or GPU) to flush the HDP when it updates VRAM. However, on systems with >4K pages, we end up exposing PAGE_SIZE of MMIO space.(CVE-2024-41011)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-debuginfo-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm",
"kernel-tools-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm",
"kernel-devel-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm",
"kernel-tools-devel-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm",
"perf-debuginfo-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm",
"kernel-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm",
"kernel-source-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm",
"kernel-debugsource-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm",
"python3-perf-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm",
"kernel-headers-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm",
"perf-5.10.0-221.0.0.124.oe2203sp3.aarch64.rpm"
],
"src": [
"kernel-5.10.0-221.0.0.124.oe2203sp3.src.rpm"
],
"x86_64": [
"kernel-tools-devel-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm",
"kernel-debugsource-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm",
"perf-debuginfo-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm",
"kernel-devel-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm",
"kernel-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm",
"perf-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm",
"kernel-headers-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm",
"python3-perf-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm",
"kernel-debuginfo-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm",
"kernel-tools-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm",
"kernel-source-5.10.0-221.0.0.124.oe2203sp3.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP3",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP3"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-221.0.0.124.oe2203sp3"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: sunxi-ng: Unregister clocks/resets when unbinding\r\n\r\nCurrently, unbinding a CCU driver unmaps the device\u0026apos;s MMIO region, while\nleaving its clocks/resets and their providers registered. This can cause\na page fault later when some clock operation tries to perform MMIO. Fix\nthis by separating the CCU initialization from the memory allocation,\nand then using a devres callback to unregister the clocks and resets.\r\n\r\nThis also fixes a memory leak of the `struct ccu_reset`, and uses the\ncorrect owner (the specific platform driver) for the clocks and resets.\r\n\r\nEarly OF clock providers are never unregistered, and limited error\nhandling is possible, so they are mostly unchanged. The error reporting\nis made more consistent by moving the message inside of_sunxi_ccu_probe.(CVE-2021-47205)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nthermal/int340x_thermal: handle data_vault when the value is ZERO_SIZE_PTR\r\n\r\nIn some case, the GDDV returns a package with a buffer which has\nzero length. It causes that kmemdup() returns ZERO_SIZE_PTR (0x10).\r\n\r\nThen the data_vault_read() got NULL point dereference problem when\naccessing the 0x10 value in data_vault.\r\n\r\n[ 71.024560] BUG: kernel NULL pointer dereference, address:\n0000000000000010\r\n\r\nThis patch uses ZERO_OR_NULL_PTR() for checking ZERO_SIZE_PTR or\nNULL value in data_vault.(CVE-2022-48703)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: marvell: prestera: Add missing of_node_put() in prestera_switch_set_base_mac_addr\r\n\r\nThis node pointer is returned by of_find_compatible_node() with\nrefcount incremented. Calling of_node_put() to aovid the refcount leak.(CVE-2022-48859)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nof: Fix double free in of_parse_phandle_with_args_map\r\n\r\nIn of_parse_phandle_with_args_map() the inner loop that\niterates through the map entries calls of_node_put(new)\nto free the reference acquired by the previous iteration\nof the inner loop. This assumes that the value of \u0026quot;new\u0026quot; is\nNULL on the first iteration of the inner loop.\r\n\r\nMake sure that this is true in all iterations of the outer\nloop by setting \u0026quot;new\u0026quot; to NULL after its value is assigned to \u0026quot;cur\u0026quot;.\r\n\r\nExtend the unittest to detect the double free and add an additional\ntest case that actually triggers this path.(CVE-2023-52679)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: gspca: cpia1: shift-out-of-bounds in set_flicker\r\n\r\nSyzkaller reported the following issue:\nUBSAN: shift-out-of-bounds in drivers/media/usb/gspca/cpia1.c:1031:27\nshift exponent 245 is too large for 32-bit type \u0026apos;int\u0026apos;\r\n\r\nWhen the value of the variable \u0026quot;sd-\u0026gt;params.exposure.gain\u0026quot; exceeds the\nnumber of bits in an integer, a shift-out-of-bounds error is reported. It\nis triggered because the variable \u0026quot;currentexp\u0026quot; cannot be left-shifted by\nmore than the number of bits in an integer. In order to avoid invalid\nrange during left-shift, the conditional expression is added.(CVE-2023-52764)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ninit/main.c: Fix potential static_command_line memory overflow\r\n\r\nWe allocate memory of size \u0026apos;xlen + strlen(boot_command_line) + 1\u0026apos; for\nstatic_command_line, but the strings copied into static_command_line are\nextra_command_line and command_line, rather than extra_command_line and\nboot_command_line.\r\n\r\nWhen strlen(command_line) \u0026gt; strlen(boot_command_line), static_command_line\nwill overflow.\r\n\r\nThis patch just recovers strlen(command_line) which was miss-consolidated\nwith strlen(boot_command_line) in the commit f5c7310ac73e (\u0026quot;init/main: add\nchecks for the return value of memblock_alloc*()\u0026quot;)(CVE-2024-26988)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nf_tables: restore set elements when delete set fails\r\n\r\nFrom abort path, nft_mapelem_activate() needs to restore refcounters to\nthe original state. Currently, it uses the set-\u0026gt;ops-\u0026gt;walk() to iterate\nover these set elements. The existing set iterator skips inactive\nelements in the next generation, this does not work from the abort path\nto restore the original state since it has to skip active elements\ninstead (not inactive ones).\r\n\r\nThis patch moves the check for inactive elements to the set iterator\ncallback, then it reverses the logic for the .activate case which\nneeds to skip active elements.\r\n\r\nToggle next generation bit for elements when delete set command is\ninvoked and call nft_clear() from .activate (abort) path to restore the\nnext generation bit.\r\n\r\nThe splat below shows an object in mappings memleak:\r\n\r\n[43929.457523] ------------[ cut here ]------------\n[43929.457532] WARNING: CPU: 0 PID: 1139 at include/net/netfilter/nf_tables.h:1237 nft_setelem_data_deactivate+0xe4/0xf0 [nf_tables]\n[...]\n[43929.458014] RIP: 0010:nft_setelem_data_deactivate+0xe4/0xf0 [nf_tables]\n[43929.458076] Code: 83 f8 01 77 ab 49 8d 7c 24 08 e8 37 5e d0 de 49 8b 6c 24 08 48 8d 7d 50 e8 e9 5c d0 de 8b 45 50 8d 50 ff 89 55 50 85 c0 75 86 \u0026lt;0f\u0026gt; 0b eb 82 0f 0b eb b3 0f 1f 40 00 90 90 90 90 90 90 90 90 90 90\n[43929.458081] RSP: 0018:ffff888140f9f4b0 EFLAGS: 00010246\n[43929.458086] RAX: 0000000000000000 RBX: ffff8881434f5288 RCX: dffffc0000000000\n[43929.458090] RDX: 00000000ffffffff RSI: ffffffffa26d28a7 RDI: ffff88810ecc9550\n[43929.458093] RBP: ffff88810ecc9500 R08: 0000000000000001 R09: ffffed10281f3e8f\n[43929.458096] R10: 0000000000000003 R11: ffff0000ffff0000 R12: ffff8881434f52a0\n[43929.458100] R13: ffff888140f9f5f4 R14: ffff888151c7a800 R15: 0000000000000002\n[43929.458103] FS: 00007f0c687c4740(0000) GS:ffff888390800000(0000) knlGS:0000000000000000\n[43929.458107] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[43929.458111] CR2: 00007f58dbe5b008 CR3: 0000000123602005 CR4: 00000000001706f0\n[43929.458114] Call Trace:\n[43929.458118] \u0026lt;TASK\u0026gt;\n[43929.458121] ? __warn+0x9f/0x1a0\n[43929.458127] ? nft_setelem_data_deactivate+0xe4/0xf0 [nf_tables]\n[43929.458188] ? report_bug+0x1b1/0x1e0\n[43929.458196] ? handle_bug+0x3c/0x70\n[43929.458200] ? exc_invalid_op+0x17/0x40\n[43929.458211] ? nft_setelem_data_deactivate+0xd7/0xf0 [nf_tables]\n[43929.458271] ? nft_setelem_data_deactivate+0xe4/0xf0 [nf_tables]\n[43929.458332] nft_mapelem_deactivate+0x24/0x30 [nf_tables]\n[43929.458392] nft_rhash_walk+0xdd/0x180 [nf_tables]\n[43929.458453] ? __pfx_nft_rhash_walk+0x10/0x10 [nf_tables]\n[43929.458512] ? rb_insert_color+0x2e/0x280\n[43929.458520] nft_map_deactivate+0xdc/0x1e0 [nf_tables]\n[43929.458582] ? __pfx_nft_map_deactivate+0x10/0x10 [nf_tables]\n[43929.458642] ? __pfx_nft_mapelem_deactivate+0x10/0x10 [nf_tables]\n[43929.458701] ? __rcu_read_unlock+0x46/0x70\n[43929.458709] nft_delset+0xff/0x110 [nf_tables]\n[43929.458769] nft_flush_table+0x16f/0x460 [nf_tables]\n[43929.458830] nf_tables_deltable+0x501/0x580 [nf_tables](CVE-2024-27012)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nf2fs: fix to avoid potential panic during recovery\r\n\r\nDuring recovery, if FAULT_BLOCK is on, it is possible that\nf2fs_reserve_new_block() will return -ENOSPC during recovery,\nthen it may trigger panic.\r\n\r\nAlso, if fault injection rate is 1 and only FAULT_BLOCK fault\ntype is on, it may encounter deadloop in loop of block reservation.\r\n\r\nLet\u0026apos;s change as below to fix these issues:\n- remove bug_on() to avoid panic.\n- limit the loop count of block reservation to avoid potential\ndeadloop.(CVE-2024-27032)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: Fix clk_core_get NULL dereference\r\n\r\nIt is possible for clk_core_get to dereference a NULL in the following\nsequence:\r\n\r\nclk_core_get()\n of_clk_get_hw_from_clkspec()\n __of_clk_get_hw_from_provider()\n __clk_get_hw()\r\n\r\n__clk_get_hw() can return NULL which is dereferenced by clk_core_get() at\nhw-\u0026gt;core.\r\n\r\nPrior to commit dde4eff47c82 (\u0026quot;clk: Look for parents with clkdev based\nclk_lookups\u0026quot;) the check IS_ERR_OR_NULL() was performed which would have\ncaught the NULL.\r\n\r\nReading the description of this function it talks about returning NULL but\nthat cannot be so at the moment.\r\n\r\nUpdate the function to check for hw before dereferencing it and return NULL\nif hw is NULL.(CVE-2024-27038)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: phy: fix phy_get_internal_delay accessing an empty array\r\n\r\nThe phy_get_internal_delay function could try to access to an empty\narray in the case that the driver is calling phy_get_internal_delay\nwithout defining delay_values and rx-internal-delay-ps or\ntx-internal-delay-ps is defined to 0 in the device-tree.\nThis will lead to \u0026quot;unable to handle kernel NULL pointer dereference at\nvirtual address 0\u0026quot;. To avoid this kernel oops, the test should be delay\n\u0026gt;= 0. As there is already delay \u0026lt; 0 test just before, the test could\nonly be size == 0.(CVE-2024-27047)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: rtl8xxxu: add cancel_work_sync() for c2hcmd_work\r\n\r\nThe workqueue might still be running, when the driver is stopped. To\navoid a use-after-free, call cancel_work_sync() in rtl8xxxu_stop().(CVE-2024-27052)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nf_tables: do not compare internal table flags on updates\r\n\r\nRestore skipping transaction if table update does not modify flags.(CVE-2024-27065)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npower: supply: bq27xxx-i2c: Do not free non existing IRQ\r\n\r\nThe bq27xxx i2c-client may not have an IRQ, in which case\nclient-\u0026gt;irq will be 0. bq27xxx_battery_i2c_probe() already has\nan if (client-\u0026gt;irq) check wrapping the request_threaded_irq().\r\n\r\nBut bq27xxx_battery_i2c_remove() unconditionally calls\nfree_irq(client-\u0026gt;irq) leading to:\r\n\r\n[ 190.310742] ------------[ cut here ]------------\n[ 190.310843] Trying to free already-free IRQ 0\n[ 190.310861] WARNING: CPU: 2 PID: 1304 at kernel/irq/manage.c:1893 free_irq+0x1b8/0x310\r\n\r\nFollowed by a backtrace when unbinding the driver. Add\nan if (client-\u0026gt;irq) to bq27xxx_battery_i2c_remove() mirroring\nprobe() to fix this.(CVE-2024-27412)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: hci_event: Fix handling of HCI_EV_IO_CAPA_REQUEST\r\n\r\nIf we received HCI_EV_IO_CAPA_REQUEST while\nHCI_OP_READ_REMOTE_EXT_FEATURES is yet to be responded assume the remote\ndoes support SSP since otherwise this event shouldn\u0026apos;t be generated.(CVE-2024-27416)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndma-mapping: benchmark: fix node id validation\r\n\r\nWhile validating node ids in map_benchmark_ioctl(), node_possible() may\nbe provided with invalid argument outside of [0,MAX_NUMNODES-1] range\nleading to:\r\n\r\nBUG: KASAN: wild-memory-access in map_benchmark_ioctl (kernel/dma/map_benchmark.c:214)\nRead of size 8 at addr 1fffffff8ccb6398 by task dma_map_benchma/971\nCPU: 7 PID: 971 Comm: dma_map_benchma Not tainted 6.9.0-rc6 #37\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996)\nCall Trace:\n \u0026lt;TASK\u0026gt;\ndump_stack_lvl (lib/dump_stack.c:117)\nkasan_report (mm/kasan/report.c:603)\nkasan_check_range (mm/kasan/generic.c:189)\nvariable_test_bit (arch/x86/include/asm/bitops.h:227) [inline]\narch_test_bit (arch/x86/include/asm/bitops.h:239) [inline]\n_test_bit at (include/asm-generic/bitops/instrumented-non-atomic.h:142) [inline]\nnode_state (include/linux/nodemask.h:423) [inline]\nmap_benchmark_ioctl (kernel/dma/map_benchmark.c:214)\nfull_proxy_unlocked_ioctl (fs/debugfs/file.c:333)\n__x64_sys_ioctl (fs/ioctl.c:890)\ndo_syscall_64 (arch/x86/entry/common.c:83)\nentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\nCompare node ids with sane bounds first. NUMA_NO_NODE is considered a\nspecial valid case meaning that benchmarking kthreads won\u0026apos;t be bound to a\ncpuset of a given node.\r\n\r\nFound by Linux Verification Center (linuxtesting.org).(CVE-2024-34777)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: mvpp2: clear BM pool before initialization\r\n\r\nRegister value persist after booting the kernel using\nkexec which results in kernel panic. Thus clear the\nBM pool registers before initialisation to fix the issue.(CVE-2024-35837)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu: Skip do PCI error slot reset during RAS recovery\r\n\r\nWhy:\n The PCI error slot reset maybe triggered after inject ue to UMC multi times, this\n caused system hang.\n [ 557.371857] amdgpu 0000:af:00.0: amdgpu: GPU reset succeeded, trying to resume\n [ 557.373718] [drm] PCIE GART of 512M enabled.\n [ 557.373722] [drm] PTB located at 0x0000031FED700000\n [ 557.373788] [drm] VRAM is lost due to GPU reset!\n [ 557.373789] [drm] PSP is resuming...\n [ 557.547012] mlx5_core 0000:55:00.0: mlx5_pci_err_detected Device state = 1 pci_status: 0. Exit, result = 3, need reset\n [ 557.547067] [drm] PCI error: detected callback, state(1)!!\n [ 557.547069] [drm] No support for XGMI hive yet...\n [ 557.548125] mlx5_core 0000:55:00.0: mlx5_pci_slot_reset Device state = 1 pci_status: 0. Enter\n [ 557.607763] mlx5_core 0000:55:00.0: wait vital counter value 0x16b5b after 1 iterations\n [ 557.607777] mlx5_core 0000:55:00.0: mlx5_pci_slot_reset Device state = 1 pci_status: 1. Exit, err = 0, result = 5, recovered\n [ 557.610492] [drm] PCI error: slot reset callback!!\n ...\n [ 560.689382] amdgpu 0000:3f:00.0: amdgpu: GPU reset(2) succeeded!\n [ 560.689546] amdgpu 0000:5a:00.0: amdgpu: GPU reset(2) succeeded!\n [ 560.689562] general protection fault, probably for non-canonical address 0x5f080b54534f611f: 0000 [#1] SMP NOPTI\n [ 560.701008] CPU: 16 PID: 2361 Comm: kworker/u448:9 Tainted: G OE 5.15.0-91-generic #101-Ubuntu\n [ 560.712057] Hardware name: Microsoft C278A/C278A, BIOS C2789.5.BS.1C11.AG.1 11/08/2023\n [ 560.720959] Workqueue: amdgpu-reset-hive amdgpu_ras_do_recovery [amdgpu]\n [ 560.728887] RIP: 0010:amdgpu_device_gpu_recover.cold+0xbf1/0xcf5 [amdgpu]\n [ 560.736891] Code: ff 41 89 c6 e9 1b ff ff ff 44 0f b6 45 b0 e9 4f ff ff ff be 01 00 00 00 4c 89 e7 e8 76 c9 8b ff 44 0f b6 45 b0 e9 3c fd ff ff \u0026lt;48\u0026gt; 83 ba 18 02 00 00 00 0f 84 6a f8 ff ff 48 8d 7a 78 be 01 00 00\n [ 560.757967] RSP: 0018:ffa0000032e53d80 EFLAGS: 00010202\n [ 560.763848] RAX: ffa00000001dfd10 RBX: ffa0000000197090 RCX: ffa0000032e53db0\n [ 560.771856] RDX: 5f080b54534f5f07 RSI: 0000000000000000 RDI: ff11000128100010\n [ 560.779867] RBP: ffa0000032e53df0 R08: 0000000000000000 R09: ffffffffffe77f08\n [ 560.787879] R10: 0000000000ffff0a R11: 0000000000000001 R12: 0000000000000000\n [ 560.795889] R13: ffa0000032e53e00 R14: 0000000000000000 R15: 0000000000000000\n [ 560.803889] FS: 0000000000000000(0000) GS:ff11007e7e800000(0000) knlGS:0000000000000000\n [ 560.812973] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n [ 560.819422] CR2: 000055a04c118e68 CR3: 0000000007410005 CR4: 0000000000771ee0\n [ 560.827433] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n [ 560.835433] DR3: 0000000000000000 DR6: 00000000fffe07f0 DR7: 0000000000000400\n [ 560.843444] PKRU: 55555554\n [ 560.846480] Call Trace:\n [ 560.849225] \u0026lt;TASK\u0026gt;\n [ 560.851580] ? show_trace_log_lvl+0x1d6/0x2ea\n [ 560.856488] ? show_trace_log_lvl+0x1d6/0x2ea\n [ 560.861379] ? amdgpu_ras_do_recovery+0x1b2/0x210 [amdgpu]\n [ 560.867778] ? show_regs.part.0+0x23/0x29\n [ 560.872293] ? __die_body.cold+0x8/0xd\n [ 560.876502] ? die_addr+0x3e/0x60\n [ 560.880238] ? exc_general_protection+0x1c5/0x410\n [ 560.885532] ? asm_exc_general_protection+0x27/0x30\n [ 560.891025] ? amdgpu_device_gpu_recover.cold+0xbf1/0xcf5 [amdgpu]\n [ 560.898323] amdgpu_ras_do_recovery+0x1b2/0x210 [amdgpu]\n [ 560.904520] process_one_work+0x228/0x3d0\nHow:\n In RAS recovery, mode-1 reset is issued from RAS fatal error handling and expected\n all the nodes in a hive to be reset. no need to issue another mode-1 during this procedure.(CVE-2024-35931)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/9p: fix uninitialized values during inode evict\r\n\r\nIf an iget fails due to not being able to retrieve information\nfrom the server then the inode structure is only partially\ninitialized. When the inode gets evicted, references to\nuninitialized structures (like fscache cookies) were being\nmade.\r\n\r\nThis patch checks for a bad_inode before doing anything other\nthan clearing the inode from the cache. Since the inode is\nbad, it shouldn\u0026apos;t have any state associated with it that needs\nto be written back (and there really isn\u0026apos;t a way to complete\nthose anyways).(CVE-2024-36923)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: fix potential kernel bug due to lack of writeback flag waiting\r\n\r\nDestructive writes to a block device on which nilfs2 is mounted can cause\na kernel bug in the folio/page writeback start routine or writeback end\nroutine (__folio_start_writeback in the log below):\r\n\r\n kernel BUG at mm/page-writeback.c:3070!\n Oops: invalid opcode: 0000 [#1] PREEMPT SMP KASAN PTI\n ...\n RIP: 0010:__folio_start_writeback+0xbaa/0x10e0\n Code: 25 ff 0f 00 00 0f 84 18 01 00 00 e8 40 ca c6 ff e9 17 f6 ff ff\n e8 36 ca c6 ff 4c 89 f7 48 c7 c6 80 c0 12 84 e8 e7 b3 0f 00 90 \u0026lt;0f\u0026gt;\n 0b e8 1f ca c6 ff 4c 89 f7 48 c7 c6 a0 c6 12 84 e8 d0 b3 0f 00\n ...\n Call Trace:\n \u0026lt;TASK\u0026gt;\n nilfs_segctor_do_construct+0x4654/0x69d0 [nilfs2]\n nilfs_segctor_construct+0x181/0x6b0 [nilfs2]\n nilfs_segctor_thread+0x548/0x11c0 [nilfs2]\n kthread+0x2f0/0x390\n ret_from_fork+0x4b/0x80\n ret_from_fork_asm+0x1a/0x30\n \u0026lt;/TASK\u0026gt;\r\n\r\nThis is because when the log writer starts a writeback for segment summary\nblocks or a super root block that use the backing device\u0026apos;s page cache, it\ndoes not wait for the ongoing folio/page writeback, resulting in an\ninconsistent writeback state.\r\n\r\nFix this issue by waiting for ongoing writebacks when putting\nfolios/pages on the backing device into writeback state.(CVE-2024-37078)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm: bridge: cdns-mhdp8546: Fix possible null pointer dereference\r\n\r\nIn cdns_mhdp_atomic_enable(), the return value of drm_mode_duplicate() is\nassigned to mhdp_state-\u0026gt;current_mode, and there is a dereference of it in\ndrm_mode_set_name(), which will lead to a NULL pointer dereference on\nfailure of drm_mode_duplicate().\r\n\r\nFix this bug add a check of mhdp_state-\u0026gt;current_mode.(CVE-2024-38548)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: carl9170: add a proper sanity check for endpoints\r\n\r\nSyzkaller reports [1] hitting a warning which is caused by presence\nof a wrong endpoint type at the URB sumbitting stage. While there\nwas a check for a specific 4th endpoint, since it can switch types\nbetween bulk and interrupt, other endpoints are trusted implicitly.\nSimilar warning is triggered in a couple of other syzbot issues [2].\r\n\r\nFix the issue by doing a comprehensive check of all endpoints\ntaking into account difference between high- and full-speed\nconfiguration.\r\n\r\n[1] Syzkaller report:\n...\nWARNING: CPU: 0 PID: 4721 at drivers/usb/core/urb.c:504 usb_submit_urb+0xed6/0x1880 drivers/usb/core/urb.c:504\n...\nCall Trace:\n \u0026lt;TASK\u0026gt;\n carl9170_usb_send_rx_irq_urb+0x273/0x340 drivers/net/wireless/ath/carl9170/usb.c:504\n carl9170_usb_init_device drivers/net/wireless/ath/carl9170/usb.c:939 [inline]\n carl9170_usb_firmware_finish drivers/net/wireless/ath/carl9170/usb.c:999 [inline]\n carl9170_usb_firmware_step2+0x175/0x240 drivers/net/wireless/ath/carl9170/usb.c:1028\n request_firmware_work_func+0x130/0x240 drivers/base/firmware_loader/main.c:1107\n process_one_work+0x9bf/0x1710 kernel/workqueue.c:2289\n worker_thread+0x669/0x1090 kernel/workqueue.c:2436\n kthread+0x2e8/0x3a0 kernel/kthread.c:376\n ret_from_fork+0x1f/0x30 arch/x86/entry/entry_64.S:308\n \u0026lt;/TASK\u0026gt;\r\n\r\n[2] Related syzkaller crashes:(CVE-2024-38567)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmacintosh/via-macii: Fix \u0026quot;BUG: sleeping function called from invalid context\u0026quot;\r\n\r\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0026apos;t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: i2c: et8ek8: Don\u0026apos;t strip remove function when driver is builtin\r\n\r\nUsing __exit for the remove function results in the remove callback\nbeing discarded with CONFIG_VIDEO_ET8EK8=y. When such a device gets\nunbound (e.g. using sysfs or hotplug), the driver is just removed\nwithout the cleanup being performed. This results in resource leaks. Fix\nit by compiling in the remove callback unconditionally.\r\n\r\nThis also fixes a W=1 modpost warning:\r\n\r\n\tWARNING: modpost: drivers/media/i2c/et8ek8/et8ek8: section mismatch in reference: et8ek8_i2c_driver+0x10 (section: .data) -\u0026gt; et8ek8_remove (section: .exit.text)(CVE-2024-38611)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu: add error handle to avoid out-of-bounds\r\n\r\nif the sdma_v4_0_irq_id_to_seq return -EINVAL, the process should\nbe stop to avoid out-of-bounds read, so directly return -EINVAL.(CVE-2024-39471)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfbdev: savage: Handle err return when savagefb_check_var failed\r\n\r\nThe commit 04e5eac8f3ab(\u0026quot;fbdev: savage: Error out if pixclock equals zero\u0026quot;)\nchecks the value of pixclock to avoid divide-by-zero error. However\nthe function savagefb_probe doesn\u0026apos;t handle the error return of\nsavagefb_check_var. When pixclock is 0, it will cause divide-by-zero error.(CVE-2024-39475)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmd/raid5: fix deadlock that raid5d() wait for itself to clear MD_SB_CHANGE_PENDING\r\n\r\nXiao reported that lvm2 test lvconvert-raid-takeover.sh can hang with\nsmall possibility, the root cause is exactly the same as commit\nbed9e27baf52 (\u0026quot;Revert \u0026quot;md/raid5: Wait for MD_SB_CHANGE_PENDING in raid5d\u0026quot;\u0026quot;)\r\n\r\nHowever, Dan reported another hang after that, and junxiao investigated\nthe problem and found out that this is caused by plugged bio can\u0026apos;t issue\nfrom raid5d().\r\n\r\nCurrent implementation in raid5d() has a weird dependence:\r\n\r\n1) md_check_recovery() from raid5d() must hold \u0026apos;reconfig_mutex\u0026apos; to clear\n MD_SB_CHANGE_PENDING;\n2) raid5d() handles IO in a deadloop, until all IO are issued;\n3) IO from raid5d() must wait for MD_SB_CHANGE_PENDING to be cleared;\r\n\r\nThis behaviour is introduce before v2.6, and for consequence, if other\ncontext hold \u0026apos;reconfig_mutex\u0026apos;, and md_check_recovery() can\u0026apos;t update\nsuper_block, then raid5d() will waste one cpu 100% by the deadloop, until\n\u0026apos;reconfig_mutex\u0026apos; is released.\r\n\r\nRefer to the implementation from raid1 and raid10, fix this problem by\nskipping issue IO if MD_SB_CHANGE_PENDING is still set after\nmd_check_recovery(), daemon thread will be woken up when \u0026apos;reconfig_mutex\u0026apos;\nis released. Meanwhile, the hang problem will be fixed as well.(CVE-2024-39476)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmmc: davinci: Don\u0026apos;t strip remove function when driver is builtin\r\n\r\nUsing __exit for the remove function results in the remove callback being\ndiscarded with CONFIG_MMC_DAVINCI=y. When such a device gets unbound (e.g.\nusing sysfs or hotplug), the driver is just removed without the cleanup\nbeing performed. This results in resource leaks. Fix it by compiling in the\nremove callback unconditionally.\r\n\r\nThis also fixes a W=1 modpost warning:\r\n\r\nWARNING: modpost: drivers/mmc/host/davinci_mmc: section mismatch in\nreference: davinci_mmcsd_driver+0x10 (section: .data) -\u0026gt;\ndavinci_mmcsd_remove (section: .exit.text)(CVE-2024-39484)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nliquidio: Adjust a NULL pointer handling path in lio_vf_rep_copy_packet\r\n\r\nIn lio_vf_rep_copy_packet() pg_info-\u0026gt;page is compared to a NULL value,\nbut then it is unconditionally passed to skb_add_rx_frag() which looks\nstrange and could lead to null pointer dereference.\r\n\r\nlio_vf_rep_copy_packet() call trace looks like:\n\tocteon_droq_process_packets\n\t octeon_droq_fast_process_packets\n\t octeon_droq_dispatch_pkt\n\t octeon_create_recv_info\n\t ...search in the dispatch_list...\n\t -\u0026gt;disp_fn(rdisp-\u0026gt;rinfo, ...)\n\t lio_vf_rep_pkt_recv(struct octeon_recv_info *recv_info, ...)\nIn this path there is no code which sets pg_info-\u0026gt;page to NULL.\nSo this check looks unneeded and doesn\u0026apos;t solve potential problem.\nBut I guess the author had reason to add a check and I have no such card\nand can\u0026apos;t do real test.\nIn addition, the code in the function liquidio_push_packet() in\nliquidio/lio_core.c does exactly the same.\r\n\r\nBased on this, I consider the most acceptable compromise solution to\nadjust this issue by moving skb_add_rx_frag() into conditional scope.\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-39506)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nio_uring/io-wq: Use set_bit() and test_bit() at worker-\u0026gt;flags\r\n\r\nUtilize set_bit() and test_bit() on worker-\u0026gt;flags within io_uring/io-wq\nto address potential data races.\r\n\r\nThe structure io_worker-\u0026gt;flags may be accessed through various data\npaths, leading to concurrency issues. When KCSAN is enabled, it reveals\ndata races occurring in io_worker_handle_work and\nio_wq_activate_free_worker functions.\r\n\r\n\t BUG: KCSAN: data-race in io_worker_handle_work / io_wq_activate_free_worker\n\t write to 0xffff8885c4246404 of 4 bytes by task 49071 on cpu 28:\n\t io_worker_handle_work (io_uring/io-wq.c:434 io_uring/io-wq.c:569)\n\t io_wq_worker (io_uring/io-wq.c:?)\n\u0026lt;snip\u0026gt;\r\n\r\n\t read to 0xffff8885c4246404 of 4 bytes by task 49024 on cpu 5:\n\t io_wq_activate_free_worker (io_uring/io-wq.c:? io_uring/io-wq.c:285)\n\t io_wq_enqueue (io_uring/io-wq.c:947)\n\t io_queue_iowq (io_uring/io_uring.c:524)\n\t io_req_task_submit (io_uring/io_uring.c:1511)\n\t io_handle_tw_list (io_uring/io_uring.c:1198)\n\u0026lt;snip\u0026gt;\r\n\r\nLine numbers against commit 18daea77cca6 (\u0026quot;Merge tag \u0026apos;for-linus\u0026apos; of\ngit://git.kernel.org/pub/scm/virt/kvm/kvm\u0026quot;).\r\n\r\nThese races involve writes and reads to the same memory location by\ndifferent tasks running on different CPUs. To mitigate this, refactor\nthe code to use atomic operations such as set_bit(), test_bit(), and\nclear_bit() instead of basic \u0026quot;and\u0026quot; and \u0026quot;or\u0026quot; operations. This ensures\nthread-safe manipulation of worker flags.\r\n\r\nAlso, move `create_index` to avoid holes in the structure.(CVE-2024-39508)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nriscv: rewrite __kernel_map_pages() to fix sleeping in invalid context\r\n\r\n__kernel_map_pages() is a debug function which clears the valid bit in page\ntable entry for deallocated pages to detect illegal memory accesses to\nfreed pages.\r\n\r\nThis function set/clear the valid bit using __set_memory(). __set_memory()\nacquires init_mm\u0026apos;s semaphore, and this operation may sleep. This is\nproblematic, because __kernel_map_pages() can be called in atomic context,\nand thus is illegal to sleep. An example warning that this causes:\r\n\r\nBUG: sleeping function called from invalid context at kernel/locking/rwsem.c:1578\nin_atomic(): 1, irqs_disabled(): 0, non_block: 0, pid: 2, name: kthreadd\npreempt_count: 2, expected: 0\nCPU: 0 PID: 2 Comm: kthreadd Not tainted 6.9.0-g1d4c6d784ef6 #37\nHardware name: riscv-virtio,qemu (DT)\nCall Trace:\n[\u0026lt;ffffffff800060dc\u0026gt;] dump_backtrace+0x1c/0x24\n[\u0026lt;ffffffff8091ef6e\u0026gt;] show_stack+0x2c/0x38\n[\u0026lt;ffffffff8092baf8\u0026gt;] dump_stack_lvl+0x5a/0x72\n[\u0026lt;ffffffff8092bb24\u0026gt;] dump_stack+0x14/0x1c\n[\u0026lt;ffffffff8003b7ac\u0026gt;] __might_resched+0x104/0x10e\n[\u0026lt;ffffffff8003b7f4\u0026gt;] __might_sleep+0x3e/0x62\n[\u0026lt;ffffffff8093276a\u0026gt;] down_write+0x20/0x72\n[\u0026lt;ffffffff8000cf00\u0026gt;] __set_memory+0x82/0x2fa\n[\u0026lt;ffffffff8000d324\u0026gt;] __kernel_map_pages+0x5a/0xd4\n[\u0026lt;ffffffff80196cca\u0026gt;] __alloc_pages_bulk+0x3b2/0x43a\n[\u0026lt;ffffffff8018ee82\u0026gt;] __vmalloc_node_range+0x196/0x6ba\n[\u0026lt;ffffffff80011904\u0026gt;] copy_process+0x72c/0x17ec\n[\u0026lt;ffffffff80012ab4\u0026gt;] kernel_clone+0x60/0x2fe\n[\u0026lt;ffffffff80012f62\u0026gt;] kernel_thread+0x82/0xa0\n[\u0026lt;ffffffff8003552c\u0026gt;] kthreadd+0x14a/0x1be\n[\u0026lt;ffffffff809357de\u0026gt;] ret_from_fork+0xe/0x1c\r\n\r\nRewrite this function with apply_to_existing_page_range(). It is fine to\nnot have any locking, because __kernel_map_pages() works with pages being\nallocated/deallocated and those pages are not changed by anyone else in the\nmeantime.(CVE-2024-40915)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\niommu: Return right value in iommu_sva_bind_device()\r\n\r\niommu_sva_bind_device() should return either a sva bond handle or an\nERR_PTR value in error cases. Existing drivers (idxd and uacce) only\ncheck the return value with IS_ERR(). This could potentially lead to\na kernel NULL pointer dereference issue if the function returns NULL\ninstead of an error pointer.\r\n\r\nIn reality, this doesn\u0026apos;t cause any problems because iommu_sva_bind_device()\nonly returns NULL when the kernel is not configured with CONFIG_IOMMU_SVA.\nIn this case, iommu_dev_enable_feature(dev, IOMMU_DEV_FEAT_SVA) will\nreturn an error, and the device drivers won\u0026apos;t call iommu_sva_bind_device()\nat all.(CVE-2024-40945)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nima: Avoid blocking in RCU read-side critical section\r\n\r\nA panic happens in ima_match_policy:\r\n\r\nBUG: unable to handle kernel NULL pointer dereference at 0000000000000010\nPGD 42f873067 P4D 0\nOops: 0000 [#1] SMP NOPTI\nCPU: 5 PID: 1286325 Comm: kubeletmonit.sh\nKdump: loaded Tainted: P\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996),\n BIOS 0.0.0 02/06/2015\nRIP: 0010:ima_match_policy+0x84/0x450\nCode: 49 89 fc 41 89 cf 31 ed 89 44 24 14 eb 1c 44 39\n 7b 18 74 26 41 83 ff 05 74 20 48 8b 1b 48 3b 1d\n f2 b9 f4 00 0f 84 9c 01 00 00 \u0026lt;44\u0026gt; 85 73 10 74 ea\n 44 8b 6b 14 41 f6 c5 01 75 d4 41 f6 c5 02 74 0f\nRSP: 0018:ff71570009e07a80 EFLAGS: 00010207\nRAX: 0000000000000000 RBX: 0000000000000000 RCX: 0000000000000200\nRDX: ffffffffad8dc7c0 RSI: 0000000024924925 RDI: ff3e27850dea2000\nRBP: 0000000000000000 R08: 0000000000000000 R09: ffffffffabfce739\nR10: ff3e27810cc42400 R11: 0000000000000000 R12: ff3e2781825ef970\nR13: 00000000ff3e2785 R14: 000000000000000c R15: 0000000000000001\nFS: 00007f5195b51740(0000)\nGS:ff3e278b12d40000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000000000000010 CR3: 0000000626d24002 CR4: 0000000000361ee0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n ima_get_action+0x22/0x30\n process_measurement+0xb0/0x830\n ? page_add_file_rmap+0x15/0x170\n ? alloc_set_pte+0x269/0x4c0\n ? prep_new_page+0x81/0x140\n ? simple_xattr_get+0x75/0xa0\n ? selinux_file_open+0x9d/0xf0\n ima_file_check+0x64/0x90\n path_openat+0x571/0x1720\n do_filp_open+0x9b/0x110\n ? page_counter_try_charge+0x57/0xc0\n ? files_cgroup_alloc_fd+0x38/0x60\n ? __alloc_fd+0xd4/0x250\n ? do_sys_open+0x1bd/0x250\n do_sys_open+0x1bd/0x250\n do_syscall_64+0x5d/0x1d0\n entry_SYSCALL_64_after_hwframe+0x65/0xca\r\n\r\nCommit c7423dbdbc9e (\u0026quot;ima: Handle -ESTALE returned by\nima_filter_rule_match()\u0026quot;) introduced call to ima_lsm_copy_rule within a\nRCU read-side critical section which contains kmalloc with GFP_KERNEL.\nThis implies a possible sleep and violates limitations of RCU read-side\ncritical sections on non-PREEMPT systems.\r\n\r\nSleeping within RCU read-side critical section might cause\nsynchronize_rcu() returning early and break RCU protection, allowing a\nUAF to happen.\r\n\r\nThe root cause of this issue could be described as follows:\n|\tThread A\t|\tThread B\t|\n|\t\t\t|ima_match_policy\t|\n|\t\t\t| rcu_read_lock\t|\n|ima_lsm_update_rule\t|\t\t\t|\n| synchronize_rcu\t|\t\t\t|\n|\t\t\t| kmalloc(GFP_KERNEL)|\n|\t\t\t| sleep\t\t|\n==\u0026gt; synchronize_rcu returns early\n| kfree(entry)\t\t|\t\t\t|\n|\t\t\t| entry = entry-\u0026gt;next|\n==\u0026gt; UAF happens and entry now becomes NULL (or could be anything).\n|\t\t\t| entry-\u0026gt;action\t|\n==\u0026gt; Accessing entry might cause panic.\r\n\r\nTo fix this issue, we are converting all kmalloc that is called within\nRCU read-side critical section to use GFP_ATOMIC.\r\n\r\n[PM: fixed missing comment, long lines, !CONFIG_IMA_LSM_RULES case](CVE-2024-40947)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndmaengine: idxd: Fix possible Use-After-Free in irq_process_work_list\r\n\r\nUse list_for_each_entry_safe() to allow iterating through the list and\ndeleting the entry in the iteration process. The descriptor is freed via\nidxd_desc_complete() and there\u0026apos;s a slight chance may cause issue for\nthe list iterator when the descriptor is reused by another thread\nwithout it being deleted from the list.(CVE-2024-40956)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: prevent possible NULL dereference in rt6_probe()\r\n\r\nsyzbot caught a NULL dereference in rt6_probe() [1]\r\n\r\nBail out if __in6_dev_get() returns NULL.\r\n\r\n[1]\nOops: general protection fault, probably for non-canonical address 0xdffffc00000000cb: 0000 [#1] PREEMPT SMP KASAN PTI\nKASAN: null-ptr-deref in range [0x0000000000000658-0x000000000000065f]\nCPU: 1 PID: 22444 Comm: syz-executor.0 Not tainted 6.10.0-rc2-syzkaller-00383-gb8481381d4e2 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024\n RIP: 0010:rt6_probe net/ipv6/route.c:656 [inline]\n RIP: 0010:find_match+0x8c4/0xf50 net/ipv6/route.c:758\nCode: 14 fd f7 48 8b 85 38 ff ff ff 48 c7 45 b0 00 00 00 00 48 8d b8 5c 06 00 00 48 b8 00 00 00 00 00 fc ff df 48 89 fa 48 c1 ea 03 \u0026lt;0f\u0026gt; b6 14 02 48 89 f8 83 e0 07 83 c0 03 38 d0 7c 08 84 d2 0f 85 19\nRSP: 0018:ffffc900034af070 EFLAGS: 00010203\nRAX: dffffc0000000000 RBX: 0000000000000000 RCX: ffffc90004521000\nRDX: 00000000000000cb RSI: ffffffff8990d0cd RDI: 000000000000065c\nRBP: ffffc900034af150 R08: 0000000000000005 R09: 0000000000000000\nR10: 0000000000000001 R11: 0000000000000002 R12: 000000000000000a\nR13: 1ffff92000695e18 R14: ffff8880244a1d20 R15: 0000000000000000\nFS: 00007f4844a5a6c0(0000) GS:ffff8880b9300000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000001b31b27000 CR3: 000000002d42c000 CR4: 00000000003506f0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n \u0026lt;TASK\u0026gt;\n rt6_nh_find_match+0xfa/0x1a0 net/ipv6/route.c:784\n nexthop_for_each_fib6_nh+0x26d/0x4a0 net/ipv4/nexthop.c:1496\n __find_rr_leaf+0x6e7/0xe00 net/ipv6/route.c:825\n find_rr_leaf net/ipv6/route.c:853 [inline]\n rt6_select net/ipv6/route.c:897 [inline]\n fib6_table_lookup+0x57e/0xa30 net/ipv6/route.c:2195\n ip6_pol_route+0x1cd/0x1150 net/ipv6/route.c:2231\n pol_lookup_func include/net/ip6_fib.h:616 [inline]\n fib6_rule_lookup+0x386/0x720 net/ipv6/fib6_rules.c:121\n ip6_route_output_flags_noref net/ipv6/route.c:2639 [inline]\n ip6_route_output_flags+0x1d0/0x640 net/ipv6/route.c:2651\n ip6_dst_lookup_tail.constprop.0+0x961/0x1760 net/ipv6/ip6_output.c:1147\n ip6_dst_lookup_flow+0x99/0x1d0 net/ipv6/ip6_output.c:1250\n rawv6_sendmsg+0xdab/0x4340 net/ipv6/raw.c:898\n inet_sendmsg+0x119/0x140 net/ipv4/af_inet.c:853\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg net/socket.c:745 [inline]\n sock_write_iter+0x4b8/0x5c0 net/socket.c:1160\n new_sync_write fs/read_write.c:497 [inline]\n vfs_write+0x6b6/0x1140 fs/read_write.c:590\n ksys_write+0x1f8/0x260 fs/read_write.c:643\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcd/0x250 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-40960)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmips: bmips: BCM6358: make sure CBR is correctly set\r\n\r\nIt was discovered that some device have CBR address set to 0 causing\nkernel panic when arch_sync_dma_for_cpu_all is called.\r\n\r\nThis was notice in situation where the system is booted from TP1 and\nBMIPS_GET_CBR() returns 0 instead of a valid address and\n!!(read_c0_brcm_cmt_local() \u0026amp; (1 \u0026lt;\u0026lt; 31)); not failing.\r\n\r\nThe current check whether RAC flush should be disabled or not are not\nenough hence lets check if CBR is a valid address or not.(CVE-2024-40963)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nserial: imx: Introduce timeout when waiting on transmitter empty\r\n\r\nBy waiting at most 1 second for USR2_TXDC to be set, we avoid a potential\ndeadlock.\r\n\r\nIn case of the timeout, there is not much we can do, so we simply ignore\nthe transmitter state and optimistically try to continue.(CVE-2024-40967)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\next4: do not create EA inode under buffer lock\r\n\r\next4_xattr_set_entry() creates new EA inodes while holding buffer lock\non the external xattr block. This is problematic as it nests all the\nallocation locking (which acquires locks on other buffers) under the\nbuffer lock. This can even deadlock when the filesystem is corrupted and\ne.g. quota file is setup to contain xattr block as data block. Move the\nallocation of EA inode out of ext4_xattr_set_entry() into the callers.(CVE-2024-40972)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrop_monitor: replace spin_lock by raw_spin_lock\r\n\r\ntrace_drop_common() is called with preemption disabled, and it acquires\na spin_lock. This is problematic for RT kernels because spin_locks are\nsleeping locks in this configuration, which causes the following splat:\r\n\r\nBUG: sleeping function called from invalid context at kernel/locking/spinlock_rt.c:48\nin_atomic(): 1, irqs_disabled(): 1, non_block: 0, pid: 449, name: rcuc/47\npreempt_count: 1, expected: 0\nRCU nest depth: 2, expected: 2\n5 locks held by rcuc/47/449:\n #0: ff1100086ec30a60 ((softirq_ctrl.lock)){+.+.}-{2:2}, at: __local_bh_disable_ip+0x105/0x210\n #1: ffffffffb394a280 (rcu_read_lock){....}-{1:2}, at: rt_spin_lock+0xbf/0x130\n #2: ffffffffb394a280 (rcu_read_lock){....}-{1:2}, at: __local_bh_disable_ip+0x11c/0x210\n #3: ffffffffb394a160 (rcu_callback){....}-{0:0}, at: rcu_do_batch+0x360/0xc70\n #4: ff1100086ee07520 (\u0026amp;data-\u0026gt;lock){+.+.}-{2:2}, at: trace_drop_common.constprop.0+0xb5/0x290\nirq event stamp: 139909\nhardirqs last enabled at (139908): [\u0026lt;ffffffffb1df2b33\u0026gt;] _raw_spin_unlock_irqrestore+0x63/0x80\nhardirqs last disabled at (139909): [\u0026lt;ffffffffb19bd03d\u0026gt;] trace_drop_common.constprop.0+0x26d/0x290\nsoftirqs last enabled at (139892): [\u0026lt;ffffffffb07a1083\u0026gt;] __local_bh_enable_ip+0x103/0x170\nsoftirqs last disabled at (139898): [\u0026lt;ffffffffb0909b33\u0026gt;] rcu_cpu_kthread+0x93/0x1f0\nPreemption disabled at:\n[\u0026lt;ffffffffb1de786b\u0026gt;] rt_mutex_slowunlock+0xab/0x2e0\nCPU: 47 PID: 449 Comm: rcuc/47 Not tainted 6.9.0-rc2-rt1+ #7\nHardware name: Dell Inc. PowerEdge R650/0Y2G81, BIOS 1.6.5 04/15/2022\nCall Trace:\n \u0026lt;TASK\u0026gt;\n dump_stack_lvl+0x8c/0xd0\n dump_stack+0x14/0x20\n __might_resched+0x21e/0x2f0\n rt_spin_lock+0x5e/0x130\n ? trace_drop_common.constprop.0+0xb5/0x290\n ? skb_queue_purge_reason.part.0+0x1bf/0x230\n trace_drop_common.constprop.0+0xb5/0x290\n ? preempt_count_sub+0x1c/0xd0\n ? _raw_spin_unlock_irqrestore+0x4a/0x80\n ? __pfx_trace_drop_common.constprop.0+0x10/0x10\n ? rt_mutex_slowunlock+0x26a/0x2e0\n ? skb_queue_purge_reason.part.0+0x1bf/0x230\n ? __pfx_rt_mutex_slowunlock+0x10/0x10\n ? skb_queue_purge_reason.part.0+0x1bf/0x230\n trace_kfree_skb_hit+0x15/0x20\n trace_kfree_skb+0xe9/0x150\n kfree_skb_reason+0x7b/0x110\n skb_queue_purge_reason.part.0+0x1bf/0x230\n ? __pfx_skb_queue_purge_reason.part.0+0x10/0x10\n ? mark_lock.part.0+0x8a/0x520\n...\r\n\r\ntrace_drop_common() also disables interrupts, but this is a minor issue\nbecause we could easily replace it with a local_lock.\r\n\r\nReplace the spin_lock with raw_spin_lock to avoid sleeping in atomic\ncontext.(CVE-2024-40980)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbatman-adv: bypass empty buckets in batadv_purge_orig_ref()\r\n\r\nMany syzbot reports are pointing to soft lockups in\nbatadv_purge_orig_ref() [1]\r\n\r\nRoot cause is unknown, but we can avoid spending too much\ntime there and perhaps get more interesting reports.\r\n\r\n[1]\r\n\r\nwatchdog: BUG: soft lockup - CPU#0 stuck for 27s! [kworker/u4:6:621]\nModules linked in:\nirq event stamp: 6182794\n hardirqs last enabled at (6182793): [\u0026lt;ffff8000801dae10\u0026gt;] __local_bh_enable_ip+0x224/0x44c kernel/softirq.c:386\n hardirqs last disabled at (6182794): [\u0026lt;ffff80008ad66a78\u0026gt;] __el1_irq arch/arm64/kernel/entry-common.c:533 [inline]\n hardirqs last disabled at (6182794): [\u0026lt;ffff80008ad66a78\u0026gt;] el1_interrupt+0x24/0x68 arch/arm64/kernel/entry-common.c:551\n softirqs last enabled at (6182792): [\u0026lt;ffff80008aab71c4\u0026gt;] spin_unlock_bh include/linux/spinlock.h:396 [inline]\n softirqs last enabled at (6182792): [\u0026lt;ffff80008aab71c4\u0026gt;] batadv_purge_orig_ref+0x114c/0x1228 net/batman-adv/originator.c:1287\n softirqs last disabled at (6182790): [\u0026lt;ffff80008aab61dc\u0026gt;] spin_lock_bh include/linux/spinlock.h:356 [inline]\n softirqs last disabled at (6182790): [\u0026lt;ffff80008aab61dc\u0026gt;] batadv_purge_orig_ref+0x164/0x1228 net/batman-adv/originator.c:1271\nCPU: 0 PID: 621 Comm: kworker/u4:6 Not tainted 6.8.0-rc7-syzkaller-g707081b61156 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/29/2024\nWorkqueue: bat_events batadv_purge_orig\npstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n pc : should_resched arch/arm64/include/asm/preempt.h:79 [inline]\n pc : __local_bh_enable_ip+0x228/0x44c kernel/softirq.c:388\n lr : __local_bh_enable_ip+0x224/0x44c kernel/softirq.c:386\nsp : ffff800099007970\nx29: ffff800099007980 x28: 1fffe00018fce1bd x27: dfff800000000000\nx26: ffff0000d2620008 x25: ffff0000c7e70de8 x24: 0000000000000001\nx23: 1fffe00018e57781 x22: dfff800000000000 x21: ffff80008aab71c4\nx20: ffff0001b40136c0 x19: ffff0000c72bbc08 x18: 1fffe0001a817bb0\nx17: ffff800125414000 x16: ffff80008032116c x15: 0000000000000001\nx14: 1fffe0001ee9d610 x13: 0000000000000000 x12: 0000000000000003\nx11: 0000000000000000 x10: 0000000000ff0100 x9 : 0000000000000000\nx8 : 00000000005e5789 x7 : ffff80008aab61dc x6 : 0000000000000000\nx5 : 0000000000000000 x4 : 0000000000000001 x3 : 0000000000000000\nx2 : 0000000000000006 x1 : 0000000000000080 x0 : ffff800125414000\nCall trace:\n __daif_local_irq_enable arch/arm64/include/asm/irqflags.h:27 [inline]\n arch_local_irq_enable arch/arm64/include/asm/irqflags.h:49 [inline]\n __local_bh_enable_ip+0x228/0x44c kernel/softirq.c:386\n __raw_spin_unlock_bh include/linux/spinlock_api_smp.h:167 [inline]\n _raw_spin_unlock_bh+0x3c/0x4c kernel/locking/spinlock.c:210\n spin_unlock_bh include/linux/spinlock.h:396 [inline]\n batadv_purge_orig_ref+0x114c/0x1228 net/batman-adv/originator.c:1287\n batadv_purge_orig+0x20/0x70 net/batman-adv/originator.c:1300\n process_one_work+0x694/0x1204 kernel/workqueue.c:2633\n process_scheduled_works kernel/workqueue.c:2706 [inline]\n worker_thread+0x938/0xef4 kernel/workqueue.c:2787\n kthread+0x288/0x310 kernel/kthread.c:388\n ret_from_fork+0x10/0x20 arch/arm64/kernel/entry.S:860\nSending NMI from CPU 0 to CPUs 1:\nNMI backtrace for cpu 1\nCPU: 1 PID: 0 Comm: swapper/1 Not tainted 6.8.0-rc7-syzkaller-g707081b61156 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 02/29/2024\npstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n pc : arch_local_irq_enable+0x8/0xc arch/arm64/include/asm/irqflags.h:51\n lr : default_idle_call+0xf8/0x128 kernel/sched/idle.c:103\nsp : ffff800093a17d30\nx29: ffff800093a17d30 x28: dfff800000000000 x27: 1ffff00012742fb4\nx26: ffff80008ec9d000 x25: 0000000000000000 x24: 0000000000000002\nx23: 1ffff00011d93a74 x22: ffff80008ec9d3a0 x21: 0000000000000000\nx20: ffff0000c19dbc00 x19: ffff8000802d0fd8 x18: 1fffe00036804396\nx17: ffff80008ec9d000 x16: ffff8000802d089c x15: 0000000000000001\n---truncated---(CVE-2024-40981)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nssb: Fix potential NULL pointer dereference in ssb_device_uevent()\r\n\r\nThe ssb_device_uevent() function first attempts to convert the \u0026apos;dev\u0026apos; pointer\nto \u0026apos;struct ssb_device *\u0026apos;. However, it mistakenly dereferences \u0026apos;dev\u0026apos; before\nperforming the NULL check, potentially leading to a NULL pointer\ndereference if \u0026apos;dev\u0026apos; is NULL.\r\n\r\nTo fix this issue, move the NULL check before dereferencing the \u0026apos;dev\u0026apos; pointer,\nensuring that the pointer is valid before attempting to use it.\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-40982)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/sched: act_api: fix possible infinite loop in tcf_idr_check_alloc()\r\n\r\nsyzbot found hanging tasks waiting on rtnl_lock [1]\r\n\r\nA reproducer is available in the syzbot bug.\r\n\r\nWhen a request to add multiple actions with the same index is sent, the\nsecond request will block forever on the first request. This holds\nrtnl_lock, and causes tasks to hang.\r\n\r\nReturn -EAGAIN to prevent infinite looping, while keeping documented\nbehavior.\r\n\r\n[1]\r\n\r\nINFO: task kworker/1:0:5088 blocked for more than 143 seconds.\nNot tainted 6.9.0-rc4-syzkaller-00173-g3cdb45594619 #0\n\u0026quot;echo 0 \u0026gt; /proc/sys/kernel/hung_task_timeout_secs\u0026quot; disables this message.\ntask:kworker/1:0 state:D stack:23744 pid:5088 tgid:5088 ppid:2 flags:0x00004000\nWorkqueue: events_power_efficient reg_check_chans_work\nCall Trace:\n\u0026lt;TASK\u0026gt;\ncontext_switch kernel/sched/core.c:5409 [inline]\n__schedule+0xf15/0x5d00 kernel/sched/core.c:6746\n__schedule_loop kernel/sched/core.c:6823 [inline]\nschedule+0xe7/0x350 kernel/sched/core.c:6838\nschedule_preempt_disabled+0x13/0x30 kernel/sched/core.c:6895\n__mutex_lock_common kernel/locking/mutex.c:684 [inline]\n__mutex_lock+0x5b8/0x9c0 kernel/locking/mutex.c:752\nwiphy_lock include/net/cfg80211.h:5953 [inline]\nreg_leave_invalid_chans net/wireless/reg.c:2466 [inline]\nreg_check_chans_work+0x10a/0x10e0 net/wireless/reg.c:2481(CVE-2024-40995)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdkfd: don\u0026apos;t allow mapping the MMIO HDP page with large pages\r\n\r\nWe don\u0026apos;t get the right offset in that case. The GPU has\nan unused 4K area of the register BAR space into which you can\nremap registers. We remap the HDP flush registers into this\nspace to allow userspace (CPU or GPU) to flush the HDP when it\nupdates VRAM. However, on systems with \u0026gt;4K pages, we end up\nexposing PAGE_SIZE of MMIO space.(CVE-2024-41011)",
"id": "OESA-2024-1942",
"modified": "2026-08-06T11:07:24Z",
"published": "2024-08-02T11:07:24Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/security-bulletins/detail?id=openEuler-SA-2024-1942"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47205"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48703"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48859"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52679"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52764"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26988"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27012"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27032"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27038"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27047"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27052"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27065"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27412"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27416"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-34777"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35837"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35931"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36923"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-37078"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38548"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38567"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38607"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38611"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39471"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39475"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39476"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39484"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39506"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39508"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40915"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40945"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40947"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40956"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40960"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40963"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40967"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40972"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40980"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40981"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40982"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40995"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41011"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47205",
"CVE-2022-48703",
"CVE-2022-48859",
"CVE-2023-52679",
"CVE-2023-52764",
"CVE-2024-26988",
"CVE-2024-27012",
"CVE-2024-27032",
"CVE-2024-27038",
"CVE-2024-27047",
"CVE-2024-27052",
"CVE-2024-27065",
"CVE-2024-27412",
"CVE-2024-27416",
"CVE-2024-34777",
"CVE-2024-35837",
"CVE-2024-35931",
"CVE-2024-36923",
"CVE-2024-37078",
"CVE-2024-38548",
"CVE-2024-38567",
"CVE-2024-38607",
"CVE-2024-38611",
"CVE-2024-39471",
"CVE-2024-39475",
"CVE-2024-39476",
"CVE-2024-39484",
"CVE-2024-39506",
"CVE-2024-39508",
"CVE-2024-40915",
"CVE-2024-40945",
"CVE-2024-40947",
"CVE-2024-40956",
"CVE-2024-40960",
"CVE-2024-40963",
"CVE-2024-40967",
"CVE-2024-40972",
"CVE-2024-40980",
"CVE-2024-40981",
"CVE-2024-40982",
"CVE-2024-40995",
"CVE-2024-41011"
]
}
SUSE-SU-2024:2894-1
Vulnerability from csaf_suse - Published: 2024-08-13 14:07 - Updated: 2026-09-20 16:02Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.