Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2023-53234 (GCVE-0-2023-53234)
Vulnerability from cvelistv5 – Published: 2025-09-15 14:22 – Updated: 2026-05-23 15:28- CWE-401 - Missing Release of Memory after Effective Lifetime
| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
450caf1faa0d7bbbd1da93d3ee8c5edea7bc51a8 , < bf26b0e430ce34261f45959989edaf680b64d538
(git)
Affected: f4c36f1999745c2160422fe2f362deadbe3a136b , < 8c1655600f4f2839fb844fe8c70b2b65fadc7a56 (git) Affected: ca7851d46de8a8d69022c4e5feed0820483b5f46 , < 59e391b3fc507a15b7e8e9d9f4de87cae177c366 (git) Affected: 72139dfa2464e43957d330266994740bb7be2535 , < c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3 (git) Affected: 72139dfa2464e43957d330266994740bb7be2535 , < 23cc41c3f19c4d858c3708f1c0a06e94958e6c3b (git) Affected: 72139dfa2464e43957d330266994740bb7be2535 , < ac099d94e0480c937aa9172ab64074981ca1a4d3 (git) Affected: 72139dfa2464e43957d330266994740bb7be2535 , < 50808d034e199fe3ff7a9d2068a4eebeb6b4098a (git) Affected: 72139dfa2464e43957d330266994740bb7be2535 , < 13721a2ac66b246f5802ba1b75ad8637e53eeecc (git) Affected: f76905ce52653e8a821963c35d9013cff19b1399 (git) Affected: 4.14.182 , < 4.14.308 (semver) Affected: 4.19.93 , < 4.19.276 (semver) Affected: 5.4.8 , < 5.4.235 (semver) Affected: 4.9.225 , < 4.10 (semver) |
guessed | |
| Linux | Linux |
Affected:
5.5
Unaffected: 0 , < 5.5 (semver) Unaffected: 4.14.308 , ≤ 4.14.* (semver) Unaffected: 4.19.276 , ≤ 4.19.* (semver) Unaffected: 5.4.235 , ≤ 5.4.* (semver) Unaffected: 5.10.173 , ≤ 5.10.* (semver) Unaffected: 5.15.100 , ≤ 5.15.* (semver) Unaffected: 6.1.18 , ≤ 6.1.* (semver) Unaffected: 6.2.5 , ≤ 6.2.* (semver) Unaffected: 6.3 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2023-53234",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2026-01-14T17:55:57.957947Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-401",
"description": "CWE-401 Missing Release of Memory after Effective Lifetime",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-01-14T18:02:49.667Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/watchdog/watchdog_dev.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "bf26b0e430ce34261f45959989edaf680b64d538",
"status": "affected",
"version": "450caf1faa0d7bbbd1da93d3ee8c5edea7bc51a8",
"versionType": "git"
},
{
"lessThan": "8c1655600f4f2839fb844fe8c70b2b65fadc7a56",
"status": "affected",
"version": "f4c36f1999745c2160422fe2f362deadbe3a136b",
"versionType": "git"
},
{
"lessThan": "59e391b3fc507a15b7e8e9d9f4de87cae177c366",
"status": "affected",
"version": "ca7851d46de8a8d69022c4e5feed0820483b5f46",
"versionType": "git"
},
{
"lessThan": "c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "23cc41c3f19c4d858c3708f1c0a06e94958e6c3b",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "ac099d94e0480c937aa9172ab64074981ca1a4d3",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "50808d034e199fe3ff7a9d2068a4eebeb6b4098a",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "13721a2ac66b246f5802ba1b75ad8637e53eeecc",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"status": "affected",
"version": "f76905ce52653e8a821963c35d9013cff19b1399",
"versionType": "git"
},
{
"lessThan": "4.14.308",
"status": "affected",
"version": "4.14.182",
"versionType": "semver"
},
{
"lessThan": "4.19.276",
"status": "affected",
"version": "4.19.93",
"versionType": "semver"
},
{
"lessThan": "5.4.235",
"status": "affected",
"version": "5.4.8",
"versionType": "semver"
},
{
"lessThan": "4.10",
"status": "affected",
"version": "4.9.225",
"versionType": "semver"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/watchdog/watchdog_dev.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.5"
},
{
"lessThan": "5.5",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.14.*",
"status": "unaffected",
"version": "4.14.308",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.276",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.235",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.173",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.100",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.18",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.2.*",
"status": "unaffected",
"version": "6.2.5",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.3",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.14.308",
"versionStartIncluding": "4.14.182",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.276",
"versionStartIncluding": "4.19.93",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.235",
"versionStartIncluding": "5.4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.173",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.100",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.18",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.2.5",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.3",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionStartIncluding": "4.9.225",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nwatchdog: Fix kmemleak in watchdog_cdev_register\n\nkmemleak reports memory leaks in watchdog_dev_register, as follows:\nunreferenced object 0xffff888116233000 (size 2048):\n comm \"\"modprobe\"\", pid 28147, jiffies 4353426116 (age 61.741s)\n hex dump (first 32 bytes):\n 80 fa b9 05 81 88 ff ff 08 30 23 16 81 88 ff ff .........0#.....\n 08 30 23 16 81 88 ff ff 00 00 00 00 00 00 00 00 .0#.............\n backtrace:\n [\u003c000000007f001ffd\u003e] __kmem_cache_alloc_node+0x157/0x220\n [\u003c000000006a389304\u003e] kmalloc_trace+0x21/0x110\n [\u003c000000008d640eea\u003e] watchdog_dev_register+0x4e/0x780 [watchdog]\n [\u003c0000000053c9f248\u003e] __watchdog_register_device+0x4f0/0x680 [watchdog]\n [\u003c00000000b2979824\u003e] watchdog_register_device+0xd2/0x110 [watchdog]\n [\u003c000000001f730178\u003e] 0xffffffffc10880ae\n [\u003c000000007a1a8bcc\u003e] do_one_initcall+0xcb/0x4d0\n [\u003c00000000b98be325\u003e] do_init_module+0x1ca/0x5f0\n [\u003c0000000046d08e7c\u003e] load_module+0x6133/0x70f0\n ...\n\nunreferenced object 0xffff888105b9fa80 (size 16):\n comm \"\"modprobe\"\", pid 28147, jiffies 4353426116 (age 61.741s)\n hex dump (first 16 bytes):\n 77 61 74 63 68 64 6f 67 31 00 b9 05 81 88 ff ff watchdog1.......\n backtrace:\n [\u003c000000007f001ffd\u003e] __kmem_cache_alloc_node+0x157/0x220\n [\u003c00000000486ab89b\u003e] __kmalloc_node_track_caller+0x44/0x1b0\n [\u003c000000005a39aab0\u003e] kvasprintf+0xb5/0x140\n [\u003c0000000024806f85\u003e] kvasprintf_const+0x55/0x180\n [\u003c000000009276cb7f\u003e] kobject_set_name_vargs+0x56/0x150\n [\u003c00000000a92e820b\u003e] dev_set_name+0xab/0xe0\n [\u003c00000000cec812c6\u003e] watchdog_dev_register+0x285/0x780 [watchdog]\n [\u003c0000000053c9f248\u003e] __watchdog_register_device+0x4f0/0x680 [watchdog]\n [\u003c00000000b2979824\u003e] watchdog_register_device+0xd2/0x110 [watchdog]\n [\u003c000000001f730178\u003e] 0xffffffffc10880ae\n [\u003c000000007a1a8bcc\u003e] do_one_initcall+0xcb/0x4d0\n [\u003c00000000b98be325\u003e] do_init_module+0x1ca/0x5f0\n [\u003c0000000046d08e7c\u003e] load_module+0x6133/0x70f0\n ...\n\nThe reason is that put_device is not be called if cdev_device_add fails\nand wdd-\u003eid != 0.\n\nwatchdog_cdev_register\n wd_data = kzalloc [1]\n err = dev_set_name [2]\n ..\n err = cdev_device_add\n if (err) {\n if (wdd-\u003eid == 0) { // wdd-\u003eid != 0\n ..\n }\n return err; // [1],[2] would be leaked\n\nTo fix it, call put_device in all wdd-\u003eid cases."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-23T15:28:21.133Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/bf26b0e430ce34261f45959989edaf680b64d538"
},
{
"url": "https://git.kernel.org/stable/c/8c1655600f4f2839fb844fe8c70b2b65fadc7a56"
},
{
"url": "https://git.kernel.org/stable/c/59e391b3fc507a15b7e8e9d9f4de87cae177c366"
},
{
"url": "https://git.kernel.org/stable/c/c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3"
},
{
"url": "https://git.kernel.org/stable/c/23cc41c3f19c4d858c3708f1c0a06e94958e6c3b"
},
{
"url": "https://git.kernel.org/stable/c/ac099d94e0480c937aa9172ab64074981ca1a4d3"
},
{
"url": "https://git.kernel.org/stable/c/50808d034e199fe3ff7a9d2068a4eebeb6b4098a"
},
{
"url": "https://git.kernel.org/stable/c/13721a2ac66b246f5802ba1b75ad8637e53eeecc"
}
],
"title": "watchdog: Fix kmemleak in watchdog_cdev_register",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-53234",
"datePublished": "2025-09-15T14:22:07.219Z",
"dateReserved": "2025-09-15T14:19:21.847Z",
"dateUpdated": "2026-05-23T15:28:21.133Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2023-53234",
"date": "2026-09-19",
"epss": "0.00156",
"percentile": "0.05179"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/watchdog/watchdog_dev.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "bf26b0e430ce34261f45959989edaf680b64d538",
"status": "affected",
"version": "450caf1faa0d7bbbd1da93d3ee8c5edea7bc51a8",
"versionType": "git"
},
{
"lessThan": "8c1655600f4f2839fb844fe8c70b2b65fadc7a56",
"status": "affected",
"version": "f4c36f1999745c2160422fe2f362deadbe3a136b",
"versionType": "git"
},
{
"lessThan": "59e391b3fc507a15b7e8e9d9f4de87cae177c366",
"status": "affected",
"version": "ca7851d46de8a8d69022c4e5feed0820483b5f46",
"versionType": "git"
},
{
"lessThan": "c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "23cc41c3f19c4d858c3708f1c0a06e94958e6c3b",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "ac099d94e0480c937aa9172ab64074981ca1a4d3",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "50808d034e199fe3ff7a9d2068a4eebeb6b4098a",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "13721a2ac66b246f5802ba1b75ad8637e53eeecc",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"status": "affected",
"version": "f76905ce52653e8a821963c35d9013cff19b1399",
"versionType": "git"
},
{
"lessThan": "4.14.308",
"status": "affected",
"version": "4.14.182",
"versionType": "semver"
},
{
"lessThan": "4.19.276",
"status": "affected",
"version": "4.19.93",
"versionType": "semver"
},
{
"lessThan": "5.4.235",
"status": "affected",
"version": "5.4.8",
"versionType": "semver"
},
{
"lessThan": "4.10",
"status": "affected",
"version": "4.9.225",
"versionType": "semver"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/watchdog/watchdog_dev.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.5"
},
{
"lessThan": "5.5",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.14.*",
"status": "unaffected",
"version": "4.14.308",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.276",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.235",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.173",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.100",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.18",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.2.*",
"status": "unaffected",
"version": "6.2.5",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.3",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "1F06A06D-F043-4FC9-8009-F0FF564F7BE3",
"versionEndExcluding": "4.10",
"versionStartIncluding": "4.9.225",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "7E1FBE0A-26CC-4282-B501-BD09D83D5D84",
"versionEndExcluding": "4.14.308",
"versionStartIncluding": "4.14.182",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "5455A75D-91F0-4B25-BC8B-D3E815C7F427",
"versionEndExcluding": "4.19.276",
"versionStartIncluding": "4.19.93",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "D7780B7C-3278-476C-AA1E-432CCA8F6041",
"versionEndExcluding": "5.4.235",
"versionStartIncluding": "5.4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "4D810CFB-B7C5-493C-B98A-0D5F0D8A47B6",
"versionEndExcluding": "5.10.173",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "6D7E5BB5-018B-46B7-A2C4-1ADB75099822",
"versionEndExcluding": "5.15.100",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "C8D24FD5-5A98-4042-9419-39DCFCBEFFF5",
"versionEndExcluding": "6.1.18",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "0575B33B-A320-4E51-84CA-10C937341E02",
"versionEndExcluding": "6.2.5",
"versionStartIncluding": "6.2",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nwatchdog: Fix kmemleak in watchdog_cdev_register\n\nkmemleak reports memory leaks in watchdog_dev_register, as follows:\nunreferenced object 0xffff888116233000 (size 2048):\n comm \"\"modprobe\"\", pid 28147, jiffies 4353426116 (age 61.741s)\n hex dump (first 32 bytes):\n 80 fa b9 05 81 88 ff ff 08 30 23 16 81 88 ff ff .........0#.....\n 08 30 23 16 81 88 ff ff 00 00 00 00 00 00 00 00 .0#.............\n backtrace:\n [\u003c000000007f001ffd\u003e] __kmem_cache_alloc_node+0x157/0x220\n [\u003c000000006a389304\u003e] kmalloc_trace+0x21/0x110\n [\u003c000000008d640eea\u003e] watchdog_dev_register+0x4e/0x780 [watchdog]\n [\u003c0000000053c9f248\u003e] __watchdog_register_device+0x4f0/0x680 [watchdog]\n [\u003c00000000b2979824\u003e] watchdog_register_device+0xd2/0x110 [watchdog]\n [\u003c000000001f730178\u003e] 0xffffffffc10880ae\n [\u003c000000007a1a8bcc\u003e] do_one_initcall+0xcb/0x4d0\n [\u003c00000000b98be325\u003e] do_init_module+0x1ca/0x5f0\n [\u003c0000000046d08e7c\u003e] load_module+0x6133/0x70f0\n ...\n\nunreferenced object 0xffff888105b9fa80 (size 16):\n comm \"\"modprobe\"\", pid 28147, jiffies 4353426116 (age 61.741s)\n hex dump (first 16 bytes):\n 77 61 74 63 68 64 6f 67 31 00 b9 05 81 88 ff ff watchdog1.......\n backtrace:\n [\u003c000000007f001ffd\u003e] __kmem_cache_alloc_node+0x157/0x220\n [\u003c00000000486ab89b\u003e] __kmalloc_node_track_caller+0x44/0x1b0\n [\u003c000000005a39aab0\u003e] kvasprintf+0xb5/0x140\n [\u003c0000000024806f85\u003e] kvasprintf_const+0x55/0x180\n [\u003c000000009276cb7f\u003e] kobject_set_name_vargs+0x56/0x150\n [\u003c00000000a92e820b\u003e] dev_set_name+0xab/0xe0\n [\u003c00000000cec812c6\u003e] watchdog_dev_register+0x285/0x780 [watchdog]\n [\u003c0000000053c9f248\u003e] __watchdog_register_device+0x4f0/0x680 [watchdog]\n [\u003c00000000b2979824\u003e] watchdog_register_device+0xd2/0x110 [watchdog]\n [\u003c000000001f730178\u003e] 0xffffffffc10880ae\n [\u003c000000007a1a8bcc\u003e] do_one_initcall+0xcb/0x4d0\n [\u003c00000000b98be325\u003e] do_init_module+0x1ca/0x5f0\n [\u003c0000000046d08e7c\u003e] load_module+0x6133/0x70f0\n ...\n\nThe reason is that put_device is not be called if cdev_device_add fails\nand wdd-\u003eid != 0.\n\nwatchdog_cdev_register\n wd_data = kzalloc [1]\n err = dev_set_name [2]\n ..\n err = cdev_device_add\n if (err) {\n if (wdd-\u003eid == 0) { // wdd-\u003eid != 0\n ..\n }\n return err; // [1],[2] would be leaked\n\nTo fix it, call put_device in all wdd-\u003eid cases."
}
],
"id": "CVE-2023-53234",
"lastModified": "2026-06-17T06:44:35.080",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-53234",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2026-01-14T17:55:57.957947Z",
"version": "2.0.3"
}
}
]
},
"published": "2025-09-15T15:15:50.420",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/13721a2ac66b246f5802ba1b75ad8637e53eeecc"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/23cc41c3f19c4d858c3708f1c0a06e94958e6c3b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/50808d034e199fe3ff7a9d2068a4eebeb6b4098a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/59e391b3fc507a15b7e8e9d9f4de87cae177c366"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8c1655600f4f2839fb844fe8c70b2b65fadc7a56"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ac099d94e0480c937aa9172ab64074981ca1a4d3"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/bf26b0e430ce34261f45959989edaf680b64d538"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-401"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"description": [
{
"lang": "en",
"value": "CWE-401"
}
],
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Low",
"current_release_date": "2026-06-30T10:30:02+00:00",
"cve": "CVE-2023-53234",
"id": "CVE-2023-53234",
"initial_release_date": "2023-01-01T00:00:00+00:00",
"product_status:known_affected": "170",
"product_status:known_not_affected": "104",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: watchdog: Fix kmemleak in watchdog_cdev_register",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2023/cve-2023-53234.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-09-01T01:16:24Z",
"cve": "CVE-2023-53234",
"id": "CVE-2023-53234",
"initial_release_date": "2025-09-17T23:29:19Z",
"product_status:known_affected": "413",
"product_status:known_not_affected": "326",
"product_status:recommended": "206",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2023-53234",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2023-53234.json",
"version": "19"
},
"vulnrichment": {
"containers": {
"adp": [
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2023-53234",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2026-01-14T17:55:57.957947Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-401",
"description": "CWE-401 Missing Release of Memory after Effective Lifetime",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-01-14T17:55:53.727Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/watchdog/watchdog_dev.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "bf26b0e430ce34261f45959989edaf680b64d538",
"status": "affected",
"version": "450caf1faa0d7bbbd1da93d3ee8c5edea7bc51a8",
"versionType": "git"
},
{
"lessThan": "8c1655600f4f2839fb844fe8c70b2b65fadc7a56",
"status": "affected",
"version": "f4c36f1999745c2160422fe2f362deadbe3a136b",
"versionType": "git"
},
{
"lessThan": "59e391b3fc507a15b7e8e9d9f4de87cae177c366",
"status": "affected",
"version": "ca7851d46de8a8d69022c4e5feed0820483b5f46",
"versionType": "git"
},
{
"lessThan": "c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "23cc41c3f19c4d858c3708f1c0a06e94958e6c3b",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "ac099d94e0480c937aa9172ab64074981ca1a4d3",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "50808d034e199fe3ff7a9d2068a4eebeb6b4098a",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "13721a2ac66b246f5802ba1b75ad8637e53eeecc",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"status": "affected",
"version": "f76905ce52653e8a821963c35d9013cff19b1399",
"versionType": "git"
},
{
"lessThan": "4.14.308",
"status": "affected",
"version": "4.14.182",
"versionType": "semver"
},
{
"lessThan": "4.19.276",
"status": "affected",
"version": "4.19.93",
"versionType": "semver"
},
{
"lessThan": "5.4.235",
"status": "affected",
"version": "5.4.8",
"versionType": "semver"
},
{
"lessThan": "4.10",
"status": "affected",
"version": "4.9.225",
"versionType": "semver"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/watchdog/watchdog_dev.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.5"
},
{
"lessThan": "5.5",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.14.*",
"status": "unaffected",
"version": "4.14.308",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.276",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.235",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.173",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.100",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.18",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.2.*",
"status": "unaffected",
"version": "6.2.5",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.3",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.14.308",
"versionStartIncluding": "4.14.182",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.276",
"versionStartIncluding": "4.19.93",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.235",
"versionStartIncluding": "5.4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.173",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.100",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.18",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.2.5",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.3",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionStartIncluding": "4.9.225",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nwatchdog: Fix kmemleak in watchdog_cdev_register\n\nkmemleak reports memory leaks in watchdog_dev_register, as follows:\nunreferenced object 0xffff888116233000 (size 2048):\n comm \"\"modprobe\"\", pid 28147, jiffies 4353426116 (age 61.741s)\n hex dump (first 32 bytes):\n 80 fa b9 05 81 88 ff ff 08 30 23 16 81 88 ff ff .........0#.....\n 08 30 23 16 81 88 ff ff 00 00 00 00 00 00 00 00 .0#.............\n backtrace:\n [\u003c000000007f001ffd\u003e] __kmem_cache_alloc_node+0x157/0x220\n [\u003c000000006a389304\u003e] kmalloc_trace+0x21/0x110\n [\u003c000000008d640eea\u003e] watchdog_dev_register+0x4e/0x780 [watchdog]\n [\u003c0000000053c9f248\u003e] __watchdog_register_device+0x4f0/0x680 [watchdog]\n [\u003c00000000b2979824\u003e] watchdog_register_device+0xd2/0x110 [watchdog]\n [\u003c000000001f730178\u003e] 0xffffffffc10880ae\n [\u003c000000007a1a8bcc\u003e] do_one_initcall+0xcb/0x4d0\n [\u003c00000000b98be325\u003e] do_init_module+0x1ca/0x5f0\n [\u003c0000000046d08e7c\u003e] load_module+0x6133/0x70f0\n ...\n\nunreferenced object 0xffff888105b9fa80 (size 16):\n comm \"\"modprobe\"\", pid 28147, jiffies 4353426116 (age 61.741s)\n hex dump (first 16 bytes):\n 77 61 74 63 68 64 6f 67 31 00 b9 05 81 88 ff ff watchdog1.......\n backtrace:\n [\u003c000000007f001ffd\u003e] __kmem_cache_alloc_node+0x157/0x220\n [\u003c00000000486ab89b\u003e] __kmalloc_node_track_caller+0x44/0x1b0\n [\u003c000000005a39aab0\u003e] kvasprintf+0xb5/0x140\n [\u003c0000000024806f85\u003e] kvasprintf_const+0x55/0x180\n [\u003c000000009276cb7f\u003e] kobject_set_name_vargs+0x56/0x150\n [\u003c00000000a92e820b\u003e] dev_set_name+0xab/0xe0\n [\u003c00000000cec812c6\u003e] watchdog_dev_register+0x285/0x780 [watchdog]\n [\u003c0000000053c9f248\u003e] __watchdog_register_device+0x4f0/0x680 [watchdog]\n [\u003c00000000b2979824\u003e] watchdog_register_device+0xd2/0x110 [watchdog]\n [\u003c000000001f730178\u003e] 0xffffffffc10880ae\n [\u003c000000007a1a8bcc\u003e] do_one_initcall+0xcb/0x4d0\n [\u003c00000000b98be325\u003e] do_init_module+0x1ca/0x5f0\n [\u003c0000000046d08e7c\u003e] load_module+0x6133/0x70f0\n ...\n\nThe reason is that put_device is not be called if cdev_device_add fails\nand wdd-\u003eid != 0.\n\nwatchdog_cdev_register\n wd_data = kzalloc [1]\n err = dev_set_name [2]\n ..\n err = cdev_device_add\n if (err) {\n if (wdd-\u003eid == 0) { // wdd-\u003eid != 0\n ..\n }\n return err; // [1],[2] would be leaked\n\nTo fix it, call put_device in all wdd-\u003eid cases."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-23T15:28:21.133Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/bf26b0e430ce34261f45959989edaf680b64d538"
},
{
"url": "https://git.kernel.org/stable/c/8c1655600f4f2839fb844fe8c70b2b65fadc7a56"
},
{
"url": "https://git.kernel.org/stable/c/59e391b3fc507a15b7e8e9d9f4de87cae177c366"
},
{
"url": "https://git.kernel.org/stable/c/c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3"
},
{
"url": "https://git.kernel.org/stable/c/23cc41c3f19c4d858c3708f1c0a06e94958e6c3b"
},
{
"url": "https://git.kernel.org/stable/c/ac099d94e0480c937aa9172ab64074981ca1a4d3"
},
{
"url": "https://git.kernel.org/stable/c/50808d034e199fe3ff7a9d2068a4eebeb6b4098a"
},
{
"url": "https://git.kernel.org/stable/c/13721a2ac66b246f5802ba1b75ad8637e53eeecc"
}
],
"title": "watchdog: Fix kmemleak in watchdog_cdev_register",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-53234",
"datePublished": "2025-09-15T14:22:07.219Z",
"dateReserved": "2025-09-15T14:19:21.847Z",
"dateUpdated": "2026-05-23T15:28:21.133Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
CERTFR-2025-AVI-0895
Vulnerability from certfr_avis - Published: 2025-10-17 - Updated: 2025-10-17
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une atteinte à la confidentialité des données, une atteinte à l'intégrité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 LTSS | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | Confidential Computing Module | Confidential Computing Module 15-SP6 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 LTSS | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.2 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.2 | ||
| SUSE | Legacy Module | Legacy Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Enterprise Storage | SUSE Enterprise Storage 7.1 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | Legacy Module | Legacy Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 LTSS | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Confidential Computing Module 15-SP6",
"product": {
"name": "Confidential Computing Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP6",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP6",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "SUSE Enterprise Storage",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP6",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP7",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP7",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP7",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2023-53443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53443"
},
{
"name": "CVE-2023-53453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53453"
},
{
"name": "CVE-2022-50378",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50378"
},
{
"name": "CVE-2025-38380",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38380"
},
{
"name": "CVE-2022-50291",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50291"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2022-50433",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50433"
},
{
"name": "CVE-2022-50356",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50356"
},
{
"name": "CVE-2023-53473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53473"
},
{
"name": "CVE-2022-49138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49138"
},
{
"name": "CVE-2022-50425",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50425"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2022-50367",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50367"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2023-53347",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53347"
},
{
"name": "CVE-2023-53475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53475"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2022-50398",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50398"
},
{
"name": "CVE-2023-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53393"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-28328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28328"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2022-50469",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50469"
},
{
"name": "CVE-2022-50429",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50429"
},
{
"name": "CVE-2023-53193",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53193"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2023-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53317"
},
{
"name": "CVE-2023-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53176"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2022-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50298"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2022-50288",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50288"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2023-5633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5633"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2023-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53349"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2023-53405",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53405"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53320"
},
{
"name": "CVE-2023-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53359"
},
{
"name": "CVE-2022-50466",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50466"
},
{
"name": "CVE-2023-53509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53509"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53199"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53415",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53415"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2024-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53194"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2022-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50255"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53449"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2022-50368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50368"
},
{
"name": "CVE-2023-53511",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53511"
},
{
"name": "CVE-2025-38216",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38216"
},
{
"name": "CVE-2022-50349",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50349"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53494",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53494"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2025-39811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39811"
},
{
"name": "CVE-2022-50358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50358"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2022-50386",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50386"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2022-50244",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50244"
},
{
"name": "CVE-2025-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38563"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2022-50323",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50323"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2022-50441",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50441"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2022-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50294"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2022-50242",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50242"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2025-22023",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22023"
},
{
"name": "CVE-2025-38500",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38500"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53390"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2022-50379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50379"
},
{
"name": "CVE-2022-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50257"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2022-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50301"
},
{
"name": "CVE-2022-50432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50432"
},
{
"name": "CVE-2023-53340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53340"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2023-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52923"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2022-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50304"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53427",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53427"
},
{
"name": "CVE-2023-53498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53498"
},
{
"name": "CVE-2023-4130",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4130"
},
{
"name": "CVE-2023-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53242"
},
{
"name": "CVE-2022-50395",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50395"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2022-50456",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50456"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2024-58238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58238"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2022-50458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50458"
},
{
"name": "CVE-2022-50321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50321"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2025-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38565"
},
{
"name": "CVE-2022-50439",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50439"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2023-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53216"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53239"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2022-50434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50434"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2022-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50234"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2022-50353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50353"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2022-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49975"
},
{
"name": "CVE-2022-50404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50404"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2022-50360",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50360"
},
{
"name": "CVE-2023-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53388"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2022-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50264"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39857"
},
{
"name": "CVE-2022-50452",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50452"
},
{
"name": "CVE-2022-50320",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50320"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38709"
},
{
"name": "CVE-2022-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50286"
},
{
"name": "CVE-2022-50449",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50449"
},
{
"name": "CVE-2023-53431",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53431"
},
{
"name": "CVE-2022-50324",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50324"
},
{
"name": "CVE-2024-58090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58090"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2025-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39865"
},
{
"name": "CVE-2025-39816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39816"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-37958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37958"
},
{
"name": "CVE-2022-50447",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50447"
},
{
"name": "CVE-2022-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50251"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2022-50373",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50373"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2022-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50269"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2022-50437",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50437"
},
{
"name": "CVE-2022-50391",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50391"
},
{
"name": "CVE-2023-53476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53476"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2023-53468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53468"
},
{
"name": "CVE-2022-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50261"
},
{
"name": "CVE-2022-50351",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50351"
},
{
"name": "CVE-2022-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50272"
},
{
"name": "CVE-2022-50331",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50331"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-39823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39823"
},
{
"name": "CVE-2025-38234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38234"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2023-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53232"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-38011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38011"
},
{
"name": "CVE-2022-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50268"
},
{
"name": "CVE-2022-36280",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36280"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2022-50444",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50444"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2023-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53241"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53381"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2022-50419",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50419"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2023-53332",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53332"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2022-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50289"
},
{
"name": "CVE-2022-50329",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50329"
},
{
"name": "CVE-2025-39842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39842"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53270"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2023-53284",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53284"
},
{
"name": "CVE-2022-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50265"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2022-50409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50409"
},
{
"name": "CVE-2022-50453",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50453"
},
{
"name": "CVE-2023-53512",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53512"
},
{
"name": "CVE-2022-50418",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50418"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2025-21791",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21791"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2022-50253",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50253"
},
{
"name": "CVE-2022-50405",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50405"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2023-53378",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53378"
},
{
"name": "CVE-2025-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38597"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2022-50333",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50333"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2025-39885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39885"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2022-50330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50330"
},
{
"name": "CVE-2023-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53223"
},
{
"name": "CVE-2022-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2602"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2022-50309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50309"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53308",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53308"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2022-50297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50297"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2022-50435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50435"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2022-50411",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50411"
},
{
"name": "CVE-2022-50465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50465"
},
{
"name": "CVE-2022-50346",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50346"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2023-53458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53458"
},
{
"name": "CVE-2022-50393",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50393"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2022-50417",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50417"
},
{
"name": "CVE-2023-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53326"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53171"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2023-53489",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53489"
},
{
"name": "CVE-2022-50370",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50370"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53474",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53474"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2022-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50247"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2022-50325",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50325"
},
{
"name": "CVE-2022-50355",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50355"
},
{
"name": "CVE-2023-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53400"
},
{
"name": "CVE-2022-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50292"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2025-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38616"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2022-50406",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50406"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-38656",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38656"
},
{
"name": "CVE-2022-50454",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50454"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2022-50354",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50354"
},
{
"name": "CVE-2022-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50249"
},
{
"name": "CVE-2023-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53237"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53471"
},
{
"name": "CVE-2023-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53182"
},
{
"name": "CVE-2025-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38541"
},
{
"name": "CVE-2023-53416",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53416"
},
{
"name": "CVE-2022-50344",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50344"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2022-50388",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50388"
},
{
"name": "CVE-2023-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53178"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2021-4460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4460"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53259"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2022-50318",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50318"
},
{
"name": "CVE-2023-53413",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53413"
},
{
"name": "CVE-2022-50389",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50389"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53524"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2022-50390",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50390"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2022-50359",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50359"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2022-50285",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50285"
},
{
"name": "CVE-2022-2978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2978"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2023-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53335"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53464"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2023-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53334"
},
{
"name": "CVE-2022-43945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43945"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38089"
},
{
"name": "CVE-2022-50352",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50352"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2022-50342",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50342"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2023-53406",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53406"
},
{
"name": "CVE-2025-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38621"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2022-50408",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50408"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2022-50399",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50399"
},
{
"name": "CVE-2022-50372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50372"
},
{
"name": "CVE-2025-39834",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39834"
},
{
"name": "CVE-2022-50431",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50431"
},
{
"name": "CVE-2022-50357",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50357"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2022-50303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50303"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2023-53404",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53404"
},
{
"name": "CVE-2025-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38556"
},
{
"name": "CVE-2025-38678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38678"
},
{
"name": "CVE-2023-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53344"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2022-50468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50468"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2022-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50282"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2023-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53276"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38628"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2022-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50250"
},
{
"name": "CVE-2023-53466",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53466"
},
{
"name": "CVE-2023-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53168"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-21692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21692"
},
{
"name": "CVE-2022-50347",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50347"
},
{
"name": "CVE-2025-39754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39754"
},
{
"name": "CVE-2023-53506",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53506"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2023-53398",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53398"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2023-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53149"
},
{
"name": "CVE-2022-50443",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50443"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2023-53409",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53409"
},
{
"name": "CVE-2023-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53396"
},
{
"name": "CVE-2022-50260",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50260"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2023-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53282"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2023-53435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53435"
},
{
"name": "CVE-2022-50328",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50328"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2022-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50267"
},
{
"name": "CVE-2023-53437",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53437"
},
{
"name": "CVE-2022-50317",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50317"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2023-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53250"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2022-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50235"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2022-50364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50364"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2022-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50276"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2022-50464",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50464"
},
{
"name": "CVE-2023-3867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3867"
},
{
"name": "CVE-2022-50401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50401"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2022-50376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50376"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2023-53422",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53422"
},
{
"name": "CVE-2023-53383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53383"
},
{
"name": "CVE-2023-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53244"
},
{
"name": "CVE-2022-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50275"
},
{
"name": "CVE-2023-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53373"
},
{
"name": "CVE-2022-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50287"
},
{
"name": "CVE-2023-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53375"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2022-50308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50308"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2023-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53197"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-40300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40300"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53229"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2022-50414",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50414"
},
{
"name": "CVE-2023-53521",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53521"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2022-50339",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50339"
},
{
"name": "CVE-2022-50436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50436"
},
{
"name": "CVE-2022-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50271"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2022-50241",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50241"
},
{
"name": "CVE-2025-39807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39807"
},
{
"name": "CVE-2022-50258",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50258"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2025-22022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22022"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-39922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39922"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2022-50365",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50365"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2022-50312",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50312"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2025-38477",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38477"
},
{
"name": "CVE-2022-50340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50340"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2023-53440",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53440"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2022-50374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50374"
},
{
"name": "CVE-2022-50375",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50375"
},
{
"name": "CVE-2024-58239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58239"
},
{
"name": "CVE-2022-50460",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50460"
},
{
"name": "CVE-2023-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53307"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2025-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38605"
},
{
"name": "CVE-2022-50362",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50362"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53525",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53525"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53261"
},
{
"name": "CVE-2022-50396",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50396"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2023-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53246"
},
{
"name": "CVE-2024-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53168"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2022-50423",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50423"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
},
{
"name": "CVE-2022-50239",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50239"
},
{
"name": "CVE-2023-53532",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53532"
},
{
"name": "CVE-2022-50348",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50348"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2023-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53213"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53277"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2023-4515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4515"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53299"
},
{
"name": "CVE-2023-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53268"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2022-50394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50394"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2022-50266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50266"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39830"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39695"
},
{
"name": "CVE-2023-53254",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53254"
},
{
"name": "CVE-2022-50430",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50430"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2023-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53295"
},
{
"name": "CVE-2023-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53298"
},
{
"name": "CVE-2025-38205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38205"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53281"
},
{
"name": "CVE-2023-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53330"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2022-50422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50422"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2022-50412",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50412"
},
{
"name": "CVE-2022-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50299"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2023-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53315"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2023-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53297"
},
{
"name": "CVE-2023-53499",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53499"
},
{
"name": "CVE-2023-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53234"
},
{
"name": "CVE-2025-21969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21969"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2025-39678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39678"
},
{
"name": "CVE-2023-53414",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53414"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2023-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53265"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2022-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50246"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53302"
},
{
"name": "CVE-2023-53482",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53482"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2022-50392",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50392"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2022-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50233"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2025-39682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39682"
},
{
"name": "CVE-2022-50410",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50410"
},
{
"name": "CVE-2022-50428",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50428"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2022-50402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50402"
},
{
"name": "CVE-2025-38643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38643"
},
{
"name": "CVE-2022-50427",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50427"
},
{
"name": "CVE-2022-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50278"
},
{
"name": "CVE-2023-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53273"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-38360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38360"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39835",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39835"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2022-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50279"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53348",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53348"
},
{
"name": "CVE-2023-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53219"
},
{
"name": "CVE-2022-50467",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50467"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2022-50440",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50440"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2022-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50248"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2022-50311",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50311"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2022-50381",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50381"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2022-50385",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50385"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2022-50459",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50459"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2022-50277",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50277"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2023-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53337"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53452"
},
{
"name": "CVE-2022-50369",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50369"
},
{
"name": "CVE-2023-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53153"
}
],
"initial_release_date": "2025-10-17T00:00:00",
"last_revision_date": "2025-10-17T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0895",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-10-17T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es, une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03615-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503615-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03553-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503553-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03557-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503557-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03539-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503539-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03543-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503543-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03580-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503580-1"
},
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03613-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503613-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03600-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503600-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03602-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503602-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03561-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503561-1"
},
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03614-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503614-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03567-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503567-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03554-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503554-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03576-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503576-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03626-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503626-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03548-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503548-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03551-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503551-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03601-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503601-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03578-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503578-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03575-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503575-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03562-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503562-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03572-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503572-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03550-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503550-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03568-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503568-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03569-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503569-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03563-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503563-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03566-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503566-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03555-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503555-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03529-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503529-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03538-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503538-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03571-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503571-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03559-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503559-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03528-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503528-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03583-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503583-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03552-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503552-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03577-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503577-1"
}
]
}
CERTFR-2025-AVI-0921
Vulnerability from certfr_avis - Published: 2025-10-24 - Updated: 2025-10-24
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | Public Cloud Module | Public Cloud Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 LTSS | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | Public Cloud Module | Public Cloud Module 15-SP6 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Public Cloud Module 15-SP7",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3 LTS",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3 LTS",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3 LTS",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP7",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2023-53443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53443"
},
{
"name": "CVE-2025-38490",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38490"
},
{
"name": "CVE-2023-53453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53453"
},
{
"name": "CVE-2025-38380",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38380"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2023-53473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53473"
},
{
"name": "CVE-2022-49138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49138"
},
{
"name": "CVE-2022-50425",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50425"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2022-50367",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50367"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2023-53475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53475"
},
{
"name": "CVE-2025-38471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38471"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2023-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53393"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2025-23155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23155"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-28328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28328"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2022-50469",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50469"
},
{
"name": "CVE-2022-50429",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50429"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2023-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53317"
},
{
"name": "CVE-2023-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53176"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2022-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50298"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2023-5633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5633"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2023-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53349"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2023-53405",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53405"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53359"
},
{
"name": "CVE-2022-50466",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50466"
},
{
"name": "CVE-2023-53509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53509"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53199"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53415",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53415"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2022-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50255"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2025-39828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39828"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53449"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2022-50368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50368"
},
{
"name": "CVE-2025-38216",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38216"
},
{
"name": "CVE-2022-50349",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50349"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53494",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53494"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2025-39811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39811"
},
{
"name": "CVE-2022-50358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50358"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2022-50386",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50386"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38563"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2022-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50294"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2025-38521",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38521"
},
{
"name": "CVE-2025-38500",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38500"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53390"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2022-50379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50379"
},
{
"name": "CVE-2022-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50257"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2022-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50301"
},
{
"name": "CVE-2022-50432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50432"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2023-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52923"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53427",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53427"
},
{
"name": "CVE-2023-53498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53498"
},
{
"name": "CVE-2023-4130",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4130"
},
{
"name": "CVE-2023-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53242"
},
{
"name": "CVE-2022-50395",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50395"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2022-50456",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50456"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2024-58238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58238"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2022-50458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50458"
},
{
"name": "CVE-2022-50321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50321"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2025-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38565"
},
{
"name": "CVE-2022-50439",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50439"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2023-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53216"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53239"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2022-50434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50434"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2022-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50234"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2022-50353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50353"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2022-50404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50404"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2023-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53388"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2022-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50264"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39857"
},
{
"name": "CVE-2022-50320",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50320"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38709"
},
{
"name": "CVE-2022-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50286"
},
{
"name": "CVE-2022-50449",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50449"
},
{
"name": "CVE-2023-53431",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53431"
},
{
"name": "CVE-2022-50324",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50324"
},
{
"name": "CVE-2024-58090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58090"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2025-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39865"
},
{
"name": "CVE-2025-39816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39816"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-37958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37958"
},
{
"name": "CVE-2022-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50251"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2022-50373",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50373"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2022-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50269"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2022-50437",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50437"
},
{
"name": "CVE-2024-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49974"
},
{
"name": "CVE-2022-50391",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50391"
},
{
"name": "CVE-2023-53476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53476"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2023-53468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53468"
},
{
"name": "CVE-2022-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50261"
},
{
"name": "CVE-2022-50351",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50351"
},
{
"name": "CVE-2022-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50272"
},
{
"name": "CVE-2022-50331",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50331"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-39823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39823"
},
{
"name": "CVE-2025-38234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38234"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2022-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50268"
},
{
"name": "CVE-2022-36280",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36280"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2022-50444",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50444"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2023-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53241"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53381"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2022-50419",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50419"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2022-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50289"
},
{
"name": "CVE-2022-50329",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50329"
},
{
"name": "CVE-2025-39842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39842"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53270"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2025-38511",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38511"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2022-50409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50409"
},
{
"name": "CVE-2022-50453",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50453"
},
{
"name": "CVE-2023-53512",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53512"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2025-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38597"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2022-50333",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50333"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2025-39885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39885"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2022-50330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50330"
},
{
"name": "CVE-2023-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53223"
},
{
"name": "CVE-2022-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2602"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2022-50309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50309"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2022-50297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50297"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2022-50435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50435"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2022-50411",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50411"
},
{
"name": "CVE-2022-50465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50465"
},
{
"name": "CVE-2025-38396",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38396"
},
{
"name": "CVE-2022-50346",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50346"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2023-53458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53458"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2022-50417",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50417"
},
{
"name": "CVE-2023-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53326"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53171"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2022-50370",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50370"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53474",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53474"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2022-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50247"
},
{
"name": "CVE-2025-38110",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38110"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2022-50355",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50355"
},
{
"name": "CVE-2023-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53400"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2025-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38616"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-38656",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38656"
},
{
"name": "CVE-2022-50454",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50454"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2022-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50249"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53471"
},
{
"name": "CVE-2023-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53182"
},
{
"name": "CVE-2025-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38541"
},
{
"name": "CVE-2023-53416",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53416"
},
{
"name": "CVE-2022-50344",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50344"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2022-50388",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50388"
},
{
"name": "CVE-2023-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53178"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53259"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2022-50318",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50318"
},
{
"name": "CVE-2023-53413",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53413"
},
{
"name": "CVE-2022-50389",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50389"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53524"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2022-50359",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50359"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2022-2978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2978"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38206"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2023-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53335"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53464"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2023-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53334"
},
{
"name": "CVE-2022-43945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43945"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2022-50342",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50342"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2023-53406",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53406"
},
{
"name": "CVE-2025-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38621"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2022-50408",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50408"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2022-50399",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50399"
},
{
"name": "CVE-2022-50372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50372"
},
{
"name": "CVE-2025-21971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21971"
},
{
"name": "CVE-2025-38085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38085"
},
{
"name": "CVE-2025-39834",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39834"
},
{
"name": "CVE-2022-50431",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50431"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2023-53404",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53404"
},
{
"name": "CVE-2025-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38556"
},
{
"name": "CVE-2025-38678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38678"
},
{
"name": "CVE-2023-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53344"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2022-50468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50468"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2022-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50282"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2023-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53276"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38628"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2022-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50250"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2022-50347",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50347"
},
{
"name": "CVE-2025-39754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39754"
},
{
"name": "CVE-2023-53506",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53506"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2023-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53149"
},
{
"name": "CVE-2022-50443",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50443"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2023-53409",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53409"
},
{
"name": "CVE-2023-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53396"
},
{
"name": "CVE-2022-50260",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50260"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2023-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53282"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2023-53435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53435"
},
{
"name": "CVE-2022-50328",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50328"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2022-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50267"
},
{
"name": "CVE-2023-53437",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53437"
},
{
"name": "CVE-2022-50317",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50317"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2023-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53250"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2022-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50235"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2022-50364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50364"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2022-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50276"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2023-3867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3867"
},
{
"name": "CVE-2022-50401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50401"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2022-50376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50376"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2023-53422",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53422"
},
{
"name": "CVE-2023-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53244"
},
{
"name": "CVE-2022-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50275"
},
{
"name": "CVE-2023-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53373"
},
{
"name": "CVE-2023-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53375"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2022-50308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50308"
},
{
"name": "CVE-2025-38440",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38440"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2023-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53197"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-40300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40300"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53229"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2022-50414",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50414"
},
{
"name": "CVE-2023-53521",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53521"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2022-50436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50436"
},
{
"name": "CVE-2022-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50271"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2022-50241",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50241"
},
{
"name": "CVE-2025-39807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39807"
},
{
"name": "CVE-2022-50258",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50258"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2025-22022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22022"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-39922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39922"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2022-50312",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50312"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2022-50340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50340"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2023-53440",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53440"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2022-50374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50374"
},
{
"name": "CVE-2022-50375",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50375"
},
{
"name": "CVE-2024-58239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58239"
},
{
"name": "CVE-2022-50460",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50460"
},
{
"name": "CVE-2023-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53307"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2025-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38605"
},
{
"name": "CVE-2022-50362",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50362"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53525",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53525"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53261"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2023-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53246"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2022-50423",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50423"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
},
{
"name": "CVE-2022-50239",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50239"
},
{
"name": "CVE-2022-50348",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50348"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2023-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53213"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53277"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2023-4515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4515"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53299"
},
{
"name": "CVE-2023-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53268"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2022-50394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50394"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2022-50266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50266"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39830"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39695"
},
{
"name": "CVE-2022-50430",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50430"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2023-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53295"
},
{
"name": "CVE-2023-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53298"
},
{
"name": "CVE-2025-38205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38205"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53281"
},
{
"name": "CVE-2023-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53330"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2022-50422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50422"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2022-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50299"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2023-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53315"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2023-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53297"
},
{
"name": "CVE-2023-53499",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53499"
},
{
"name": "CVE-2023-53513",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53513"
},
{
"name": "CVE-2023-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53234"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2025-39678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39678"
},
{
"name": "CVE-2023-53414",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53414"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2023-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53265"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2022-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50246"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53302"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2022-50392",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50392"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2022-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50233"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2025-39682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39682"
},
{
"name": "CVE-2022-50410",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50410"
},
{
"name": "CVE-2022-50428",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50428"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2022-50402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50402"
},
{
"name": "CVE-2025-38084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38084"
},
{
"name": "CVE-2025-38643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38643"
},
{
"name": "CVE-2022-50427",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50427"
},
{
"name": "CVE-2022-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50278"
},
{
"name": "CVE-2023-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53273"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-38360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38360"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39835",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39835"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2022-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50279"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53219"
},
{
"name": "CVE-2022-50467",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50467"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2022-50440",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50440"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2022-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50248"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2025-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38476"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2022-50381",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50381"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2022-50385",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50385"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2022-50459",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50459"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2022-50277",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50277"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2023-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53337"
},
{
"name": "CVE-2025-38470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38470"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53452"
},
{
"name": "CVE-2022-50369",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50369"
},
{
"name": "CVE-2023-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53153"
}
],
"initial_release_date": "2025-10-24T00:00:00",
"last_revision_date": "2025-10-24T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0921",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-10-24T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03650-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503650-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03636-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503636-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03648-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503648-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03652-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503652-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20253761-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253761-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3736-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253736-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3772-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253772-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03663-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503663-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03634-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503634-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3703-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253703-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03643-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503643-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03646-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503646-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3720-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253720-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3712-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253712-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3734-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253734-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03672-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503672-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3748-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253748-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3770-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253770-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3751-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253751-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03638-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503638-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03628-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503628-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3679-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253679-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3704-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253704-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3684-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253684-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3733-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253733-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03671-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503671-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3675-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253675-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03664-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503664-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03633-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503633-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3755-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253755-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3683-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253683-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3716-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253716-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03653-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503653-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03666-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503666-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3725-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253725-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3771-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253771-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03656-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503656-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03662-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503662-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3705-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253705-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3764-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253764-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3721-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253721-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3768-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253768-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3717-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253717-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3769-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253769-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3740-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253740-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20253762-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253762-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3741-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253741-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3742-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253742-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3731-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253731-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3765-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253765-1"
}
]
}
CERTFR-2025-AVI-0895
Vulnerability from certfr_avis - Published: 2025-10-17 - Updated: 2025-10-17
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une atteinte à la confidentialité des données, une atteinte à l'intégrité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 LTSS | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | Confidential Computing Module | Confidential Computing Module 15-SP6 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 LTSS | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.2 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.2 | ||
| SUSE | Legacy Module | Legacy Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Enterprise Storage | SUSE Enterprise Storage 7.1 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | Legacy Module | Legacy Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 LTSS | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Confidential Computing Module 15-SP6",
"product": {
"name": "Confidential Computing Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP6",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP6",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "SUSE Enterprise Storage",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP6",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP7",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP7",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP7",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2023-53443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53443"
},
{
"name": "CVE-2023-53453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53453"
},
{
"name": "CVE-2022-50378",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50378"
},
{
"name": "CVE-2025-38380",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38380"
},
{
"name": "CVE-2022-50291",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50291"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2022-50433",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50433"
},
{
"name": "CVE-2022-50356",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50356"
},
{
"name": "CVE-2023-53473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53473"
},
{
"name": "CVE-2022-49138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49138"
},
{
"name": "CVE-2022-50425",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50425"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2022-50367",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50367"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2023-53347",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53347"
},
{
"name": "CVE-2023-53475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53475"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2022-50398",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50398"
},
{
"name": "CVE-2023-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53393"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-28328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28328"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2022-50469",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50469"
},
{
"name": "CVE-2022-50429",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50429"
},
{
"name": "CVE-2023-53193",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53193"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2023-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53317"
},
{
"name": "CVE-2023-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53176"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2022-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50298"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2022-50288",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50288"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2023-5633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5633"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2023-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53349"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2023-53405",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53405"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53320"
},
{
"name": "CVE-2023-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53359"
},
{
"name": "CVE-2022-50466",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50466"
},
{
"name": "CVE-2023-53509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53509"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53199"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53415",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53415"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2024-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53194"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2022-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50255"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53449"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2022-50368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50368"
},
{
"name": "CVE-2023-53511",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53511"
},
{
"name": "CVE-2025-38216",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38216"
},
{
"name": "CVE-2022-50349",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50349"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53494",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53494"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2025-39811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39811"
},
{
"name": "CVE-2022-50358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50358"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2022-50386",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50386"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2022-50244",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50244"
},
{
"name": "CVE-2025-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38563"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2022-50323",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50323"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2022-50441",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50441"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2022-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50294"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2022-50242",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50242"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2025-22023",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22023"
},
{
"name": "CVE-2025-38500",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38500"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53390"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2022-50379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50379"
},
{
"name": "CVE-2022-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50257"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2022-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50301"
},
{
"name": "CVE-2022-50432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50432"
},
{
"name": "CVE-2023-53340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53340"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2023-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52923"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2022-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50304"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53427",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53427"
},
{
"name": "CVE-2023-53498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53498"
},
{
"name": "CVE-2023-4130",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4130"
},
{
"name": "CVE-2023-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53242"
},
{
"name": "CVE-2022-50395",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50395"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2022-50456",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50456"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2024-58238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58238"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2022-50458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50458"
},
{
"name": "CVE-2022-50321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50321"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2025-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38565"
},
{
"name": "CVE-2022-50439",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50439"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2023-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53216"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53239"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2022-50434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50434"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2022-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50234"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2022-50353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50353"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2022-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49975"
},
{
"name": "CVE-2022-50404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50404"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2022-50360",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50360"
},
{
"name": "CVE-2023-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53388"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2022-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50264"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39857"
},
{
"name": "CVE-2022-50452",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50452"
},
{
"name": "CVE-2022-50320",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50320"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38709"
},
{
"name": "CVE-2022-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50286"
},
{
"name": "CVE-2022-50449",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50449"
},
{
"name": "CVE-2023-53431",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53431"
},
{
"name": "CVE-2022-50324",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50324"
},
{
"name": "CVE-2024-58090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58090"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2025-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39865"
},
{
"name": "CVE-2025-39816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39816"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-37958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37958"
},
{
"name": "CVE-2022-50447",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50447"
},
{
"name": "CVE-2022-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50251"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2022-50373",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50373"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2022-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50269"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2022-50437",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50437"
},
{
"name": "CVE-2022-50391",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50391"
},
{
"name": "CVE-2023-53476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53476"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2023-53468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53468"
},
{
"name": "CVE-2022-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50261"
},
{
"name": "CVE-2022-50351",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50351"
},
{
"name": "CVE-2022-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50272"
},
{
"name": "CVE-2022-50331",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50331"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-39823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39823"
},
{
"name": "CVE-2025-38234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38234"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2023-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53232"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-38011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38011"
},
{
"name": "CVE-2022-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50268"
},
{
"name": "CVE-2022-36280",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36280"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2022-50444",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50444"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2023-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53241"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53381"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2022-50419",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50419"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2023-53332",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53332"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2022-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50289"
},
{
"name": "CVE-2022-50329",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50329"
},
{
"name": "CVE-2025-39842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39842"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53270"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2023-53284",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53284"
},
{
"name": "CVE-2022-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50265"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2022-50409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50409"
},
{
"name": "CVE-2022-50453",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50453"
},
{
"name": "CVE-2023-53512",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53512"
},
{
"name": "CVE-2022-50418",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50418"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2025-21791",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21791"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2022-50253",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50253"
},
{
"name": "CVE-2022-50405",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50405"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2023-53378",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53378"
},
{
"name": "CVE-2025-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38597"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2022-50333",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50333"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2025-39885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39885"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2022-50330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50330"
},
{
"name": "CVE-2023-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53223"
},
{
"name": "CVE-2022-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2602"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2022-50309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50309"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53308",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53308"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2022-50297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50297"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2022-50435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50435"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2022-50411",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50411"
},
{
"name": "CVE-2022-50465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50465"
},
{
"name": "CVE-2022-50346",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50346"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2023-53458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53458"
},
{
"name": "CVE-2022-50393",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50393"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2022-50417",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50417"
},
{
"name": "CVE-2023-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53326"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53171"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2023-53489",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53489"
},
{
"name": "CVE-2022-50370",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50370"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53474",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53474"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2022-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50247"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2022-50325",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50325"
},
{
"name": "CVE-2022-50355",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50355"
},
{
"name": "CVE-2023-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53400"
},
{
"name": "CVE-2022-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50292"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2025-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38616"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2022-50406",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50406"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-38656",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38656"
},
{
"name": "CVE-2022-50454",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50454"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2022-50354",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50354"
},
{
"name": "CVE-2022-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50249"
},
{
"name": "CVE-2023-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53237"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53471"
},
{
"name": "CVE-2023-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53182"
},
{
"name": "CVE-2025-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38541"
},
{
"name": "CVE-2023-53416",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53416"
},
{
"name": "CVE-2022-50344",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50344"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2022-50388",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50388"
},
{
"name": "CVE-2023-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53178"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2021-4460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4460"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53259"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2022-50318",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50318"
},
{
"name": "CVE-2023-53413",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53413"
},
{
"name": "CVE-2022-50389",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50389"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53524"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2022-50390",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50390"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2022-50359",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50359"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2022-50285",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50285"
},
{
"name": "CVE-2022-2978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2978"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2023-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53335"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53464"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2023-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53334"
},
{
"name": "CVE-2022-43945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43945"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38089"
},
{
"name": "CVE-2022-50352",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50352"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2022-50342",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50342"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2023-53406",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53406"
},
{
"name": "CVE-2025-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38621"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2022-50408",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50408"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2022-50399",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50399"
},
{
"name": "CVE-2022-50372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50372"
},
{
"name": "CVE-2025-39834",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39834"
},
{
"name": "CVE-2022-50431",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50431"
},
{
"name": "CVE-2022-50357",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50357"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2022-50303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50303"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2023-53404",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53404"
},
{
"name": "CVE-2025-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38556"
},
{
"name": "CVE-2025-38678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38678"
},
{
"name": "CVE-2023-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53344"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2022-50468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50468"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2022-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50282"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2023-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53276"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38628"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2022-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50250"
},
{
"name": "CVE-2023-53466",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53466"
},
{
"name": "CVE-2023-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53168"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-21692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21692"
},
{
"name": "CVE-2022-50347",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50347"
},
{
"name": "CVE-2025-39754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39754"
},
{
"name": "CVE-2023-53506",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53506"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2023-53398",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53398"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2023-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53149"
},
{
"name": "CVE-2022-50443",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50443"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2023-53409",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53409"
},
{
"name": "CVE-2023-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53396"
},
{
"name": "CVE-2022-50260",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50260"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2023-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53282"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2023-53435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53435"
},
{
"name": "CVE-2022-50328",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50328"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2022-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50267"
},
{
"name": "CVE-2023-53437",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53437"
},
{
"name": "CVE-2022-50317",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50317"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2023-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53250"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2022-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50235"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2022-50364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50364"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2022-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50276"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2022-50464",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50464"
},
{
"name": "CVE-2023-3867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3867"
},
{
"name": "CVE-2022-50401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50401"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2022-50376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50376"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2023-53422",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53422"
},
{
"name": "CVE-2023-53383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53383"
},
{
"name": "CVE-2023-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53244"
},
{
"name": "CVE-2022-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50275"
},
{
"name": "CVE-2023-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53373"
},
{
"name": "CVE-2022-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50287"
},
{
"name": "CVE-2023-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53375"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2022-50308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50308"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2023-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53197"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-40300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40300"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53229"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2022-50414",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50414"
},
{
"name": "CVE-2023-53521",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53521"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2022-50339",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50339"
},
{
"name": "CVE-2022-50436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50436"
},
{
"name": "CVE-2022-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50271"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2022-50241",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50241"
},
{
"name": "CVE-2025-39807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39807"
},
{
"name": "CVE-2022-50258",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50258"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2025-22022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22022"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-39922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39922"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2022-50365",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50365"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2022-50312",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50312"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2025-38477",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38477"
},
{
"name": "CVE-2022-50340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50340"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2023-53440",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53440"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2022-50374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50374"
},
{
"name": "CVE-2022-50375",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50375"
},
{
"name": "CVE-2024-58239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58239"
},
{
"name": "CVE-2022-50460",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50460"
},
{
"name": "CVE-2023-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53307"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2025-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38605"
},
{
"name": "CVE-2022-50362",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50362"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53525",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53525"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53261"
},
{
"name": "CVE-2022-50396",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50396"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2023-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53246"
},
{
"name": "CVE-2024-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53168"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2022-50423",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50423"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
},
{
"name": "CVE-2022-50239",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50239"
},
{
"name": "CVE-2023-53532",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53532"
},
{
"name": "CVE-2022-50348",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50348"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2023-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53213"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53277"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2023-4515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4515"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53299"
},
{
"name": "CVE-2023-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53268"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2022-50394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50394"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2022-50266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50266"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39830"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39695"
},
{
"name": "CVE-2023-53254",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53254"
},
{
"name": "CVE-2022-50430",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50430"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2023-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53295"
},
{
"name": "CVE-2023-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53298"
},
{
"name": "CVE-2025-38205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38205"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53281"
},
{
"name": "CVE-2023-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53330"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2022-50422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50422"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2022-50412",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50412"
},
{
"name": "CVE-2022-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50299"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2023-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53315"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2023-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53297"
},
{
"name": "CVE-2023-53499",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53499"
},
{
"name": "CVE-2023-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53234"
},
{
"name": "CVE-2025-21969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21969"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2025-39678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39678"
},
{
"name": "CVE-2023-53414",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53414"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2023-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53265"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2022-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50246"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53302"
},
{
"name": "CVE-2023-53482",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53482"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2022-50392",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50392"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2022-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50233"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2025-39682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39682"
},
{
"name": "CVE-2022-50410",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50410"
},
{
"name": "CVE-2022-50428",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50428"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2022-50402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50402"
},
{
"name": "CVE-2025-38643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38643"
},
{
"name": "CVE-2022-50427",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50427"
},
{
"name": "CVE-2022-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50278"
},
{
"name": "CVE-2023-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53273"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-38360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38360"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39835",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39835"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2022-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50279"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53348",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53348"
},
{
"name": "CVE-2023-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53219"
},
{
"name": "CVE-2022-50467",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50467"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2022-50440",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50440"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2022-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50248"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2022-50311",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50311"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2022-50381",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50381"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2022-50385",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50385"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2022-50459",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50459"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2022-50277",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50277"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2023-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53337"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53452"
},
{
"name": "CVE-2022-50369",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50369"
},
{
"name": "CVE-2023-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53153"
}
],
"initial_release_date": "2025-10-17T00:00:00",
"last_revision_date": "2025-10-17T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0895",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-10-17T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es, une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03615-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503615-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03553-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503553-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03557-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503557-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03539-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503539-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03543-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503543-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03580-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503580-1"
},
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03613-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503613-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03600-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503600-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03602-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503602-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03561-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503561-1"
},
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03614-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503614-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03567-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503567-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03554-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503554-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03576-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503576-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03626-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503626-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03548-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503548-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03551-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503551-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03601-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503601-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03578-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503578-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03575-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503575-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03562-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503562-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03572-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503572-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03550-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503550-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03568-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503568-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03569-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503569-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03563-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503563-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03566-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503566-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03555-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503555-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03529-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503529-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03538-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503538-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03571-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503571-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03559-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503559-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03528-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503528-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03583-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503583-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03552-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503552-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03577-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503577-1"
}
]
}
CERTFR-2025-AVI-0921
Vulnerability from certfr_avis - Published: 2025-10-24 - Updated: 2025-10-24
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | Public Cloud Module | Public Cloud Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 LTSS | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | Public Cloud Module | Public Cloud Module 15-SP6 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Public Cloud Module 15-SP7",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3 LTS",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3 LTS",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3 LTS",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP7",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2023-53443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53443"
},
{
"name": "CVE-2025-38490",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38490"
},
{
"name": "CVE-2023-53453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53453"
},
{
"name": "CVE-2025-38380",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38380"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2023-53473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53473"
},
{
"name": "CVE-2022-49138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49138"
},
{
"name": "CVE-2022-50425",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50425"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2022-50367",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50367"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2023-53475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53475"
},
{
"name": "CVE-2025-38471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38471"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2023-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53393"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2025-23155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23155"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-28328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28328"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2022-50469",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50469"
},
{
"name": "CVE-2022-50429",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50429"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2023-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53317"
},
{
"name": "CVE-2023-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53176"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2022-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50298"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2023-5633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5633"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2023-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53349"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2023-53405",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53405"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53359"
},
{
"name": "CVE-2022-50466",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50466"
},
{
"name": "CVE-2023-53509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53509"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53199"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53415",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53415"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2022-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50255"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2025-39828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39828"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53449"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2022-50368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50368"
},
{
"name": "CVE-2025-38216",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38216"
},
{
"name": "CVE-2022-50349",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50349"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53494",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53494"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2025-39811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39811"
},
{
"name": "CVE-2022-50358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50358"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2022-50386",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50386"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38563"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2022-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50294"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2025-38521",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38521"
},
{
"name": "CVE-2025-38500",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38500"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53390"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2022-50379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50379"
},
{
"name": "CVE-2022-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50257"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2022-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50301"
},
{
"name": "CVE-2022-50432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50432"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2023-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52923"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53427",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53427"
},
{
"name": "CVE-2023-53498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53498"
},
{
"name": "CVE-2023-4130",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4130"
},
{
"name": "CVE-2023-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53242"
},
{
"name": "CVE-2022-50395",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50395"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2022-50456",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50456"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2024-58238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58238"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2022-50458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50458"
},
{
"name": "CVE-2022-50321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50321"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2025-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38565"
},
{
"name": "CVE-2022-50439",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50439"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2023-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53216"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53239"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2022-50434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50434"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2022-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50234"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2022-50353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50353"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2022-50404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50404"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2023-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53388"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2022-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50264"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39857"
},
{
"name": "CVE-2022-50320",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50320"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38709"
},
{
"name": "CVE-2022-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50286"
},
{
"name": "CVE-2022-50449",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50449"
},
{
"name": "CVE-2023-53431",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53431"
},
{
"name": "CVE-2022-50324",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50324"
},
{
"name": "CVE-2024-58090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58090"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2025-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39865"
},
{
"name": "CVE-2025-39816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39816"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-37958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37958"
},
{
"name": "CVE-2022-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50251"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2022-50373",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50373"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2022-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50269"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2022-50437",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50437"
},
{
"name": "CVE-2024-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49974"
},
{
"name": "CVE-2022-50391",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50391"
},
{
"name": "CVE-2023-53476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53476"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2023-53468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53468"
},
{
"name": "CVE-2022-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50261"
},
{
"name": "CVE-2022-50351",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50351"
},
{
"name": "CVE-2022-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50272"
},
{
"name": "CVE-2022-50331",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50331"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-39823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39823"
},
{
"name": "CVE-2025-38234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38234"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2022-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50268"
},
{
"name": "CVE-2022-36280",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36280"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2022-50444",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50444"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2023-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53241"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53381"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2022-50419",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50419"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2022-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50289"
},
{
"name": "CVE-2022-50329",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50329"
},
{
"name": "CVE-2025-39842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39842"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53270"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2025-38511",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38511"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2022-50409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50409"
},
{
"name": "CVE-2022-50453",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50453"
},
{
"name": "CVE-2023-53512",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53512"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2025-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38597"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2022-50333",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50333"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2025-39885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39885"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2022-50330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50330"
},
{
"name": "CVE-2023-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53223"
},
{
"name": "CVE-2022-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2602"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2022-50309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50309"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2022-50297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50297"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2022-50435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50435"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2022-50411",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50411"
},
{
"name": "CVE-2022-50465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50465"
},
{
"name": "CVE-2025-38396",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38396"
},
{
"name": "CVE-2022-50346",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50346"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2023-53458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53458"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2022-50417",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50417"
},
{
"name": "CVE-2023-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53326"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53171"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2022-50370",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50370"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53474",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53474"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2022-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50247"
},
{
"name": "CVE-2025-38110",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38110"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2022-50355",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50355"
},
{
"name": "CVE-2023-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53400"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2025-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38616"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-38656",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38656"
},
{
"name": "CVE-2022-50454",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50454"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2022-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50249"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53471"
},
{
"name": "CVE-2023-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53182"
},
{
"name": "CVE-2025-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38541"
},
{
"name": "CVE-2023-53416",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53416"
},
{
"name": "CVE-2022-50344",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50344"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2022-50388",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50388"
},
{
"name": "CVE-2023-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53178"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53259"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2022-50318",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50318"
},
{
"name": "CVE-2023-53413",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53413"
},
{
"name": "CVE-2022-50389",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50389"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53524"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2022-50359",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50359"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2022-2978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2978"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38206"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2023-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53335"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53464"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2023-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53334"
},
{
"name": "CVE-2022-43945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43945"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2022-50342",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50342"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2023-53406",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53406"
},
{
"name": "CVE-2025-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38621"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2022-50408",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50408"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2022-50399",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50399"
},
{
"name": "CVE-2022-50372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50372"
},
{
"name": "CVE-2025-21971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21971"
},
{
"name": "CVE-2025-38085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38085"
},
{
"name": "CVE-2025-39834",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39834"
},
{
"name": "CVE-2022-50431",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50431"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2023-53404",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53404"
},
{
"name": "CVE-2025-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38556"
},
{
"name": "CVE-2025-38678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38678"
},
{
"name": "CVE-2023-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53344"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2022-50468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50468"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2022-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50282"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2023-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53276"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38628"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2022-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50250"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2022-50347",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50347"
},
{
"name": "CVE-2025-39754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39754"
},
{
"name": "CVE-2023-53506",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53506"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2023-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53149"
},
{
"name": "CVE-2022-50443",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50443"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2023-53409",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53409"
},
{
"name": "CVE-2023-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53396"
},
{
"name": "CVE-2022-50260",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50260"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2023-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53282"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2023-53435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53435"
},
{
"name": "CVE-2022-50328",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50328"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2022-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50267"
},
{
"name": "CVE-2023-53437",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53437"
},
{
"name": "CVE-2022-50317",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50317"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2023-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53250"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2022-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50235"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2022-50364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50364"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2022-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50276"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2023-3867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3867"
},
{
"name": "CVE-2022-50401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50401"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2022-50376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50376"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2023-53422",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53422"
},
{
"name": "CVE-2023-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53244"
},
{
"name": "CVE-2022-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50275"
},
{
"name": "CVE-2023-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53373"
},
{
"name": "CVE-2023-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53375"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2022-50308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50308"
},
{
"name": "CVE-2025-38440",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38440"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2023-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53197"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-40300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40300"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53229"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2022-50414",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50414"
},
{
"name": "CVE-2023-53521",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53521"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2022-50436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50436"
},
{
"name": "CVE-2022-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50271"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2022-50241",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50241"
},
{
"name": "CVE-2025-39807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39807"
},
{
"name": "CVE-2022-50258",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50258"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2025-22022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22022"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-39922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39922"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2022-50312",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50312"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2022-50340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50340"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2023-53440",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53440"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2022-50374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50374"
},
{
"name": "CVE-2022-50375",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50375"
},
{
"name": "CVE-2024-58239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58239"
},
{
"name": "CVE-2022-50460",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50460"
},
{
"name": "CVE-2023-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53307"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2025-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38605"
},
{
"name": "CVE-2022-50362",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50362"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53525",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53525"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53261"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2023-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53246"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2022-50423",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50423"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
},
{
"name": "CVE-2022-50239",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50239"
},
{
"name": "CVE-2022-50348",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50348"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2023-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53213"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53277"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2023-4515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4515"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53299"
},
{
"name": "CVE-2023-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53268"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2022-50394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50394"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2022-50266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50266"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39830"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39695"
},
{
"name": "CVE-2022-50430",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50430"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2023-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53295"
},
{
"name": "CVE-2023-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53298"
},
{
"name": "CVE-2025-38205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38205"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53281"
},
{
"name": "CVE-2023-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53330"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2022-50422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50422"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2022-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50299"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2023-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53315"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2023-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53297"
},
{
"name": "CVE-2023-53499",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53499"
},
{
"name": "CVE-2023-53513",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53513"
},
{
"name": "CVE-2023-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53234"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2025-39678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39678"
},
{
"name": "CVE-2023-53414",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53414"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2023-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53265"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2022-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50246"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53302"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2022-50392",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50392"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2022-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50233"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2025-39682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39682"
},
{
"name": "CVE-2022-50410",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50410"
},
{
"name": "CVE-2022-50428",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50428"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2022-50402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50402"
},
{
"name": "CVE-2025-38084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38084"
},
{
"name": "CVE-2025-38643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38643"
},
{
"name": "CVE-2022-50427",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50427"
},
{
"name": "CVE-2022-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50278"
},
{
"name": "CVE-2023-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53273"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-38360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38360"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39835",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39835"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2022-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50279"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53219"
},
{
"name": "CVE-2022-50467",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50467"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2022-50440",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50440"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2022-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50248"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2025-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38476"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2022-50381",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50381"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2022-50385",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50385"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2022-50459",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50459"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2022-50277",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50277"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2023-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53337"
},
{
"name": "CVE-2025-38470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38470"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53452"
},
{
"name": "CVE-2022-50369",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50369"
},
{
"name": "CVE-2023-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53153"
}
],
"initial_release_date": "2025-10-24T00:00:00",
"last_revision_date": "2025-10-24T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0921",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-10-24T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03650-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503650-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03636-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503636-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03648-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503648-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03652-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503652-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20253761-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253761-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3736-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253736-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3772-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253772-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03663-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503663-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03634-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503634-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3703-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253703-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03643-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503643-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03646-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503646-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3720-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253720-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3712-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253712-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3734-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253734-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03672-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503672-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3748-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253748-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3770-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253770-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3751-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253751-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03638-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503638-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03628-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503628-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3679-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253679-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3704-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253704-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3684-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253684-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3733-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253733-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03671-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503671-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3675-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253675-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03664-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503664-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03633-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503633-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3755-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253755-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3683-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253683-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3716-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253716-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03653-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503653-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03666-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503666-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3725-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253725-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3771-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253771-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03656-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503656-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03662-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503662-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3705-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253705-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3764-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253764-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3721-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253721-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3768-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253768-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3717-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253717-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3769-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253769-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3740-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253740-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20253762-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253762-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3741-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253741-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3742-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253742-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3731-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253731-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3765-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253765-1"
}
]
}
BDU:2026-03957 (CVE-2023-53234)
Vulnerability from fstec – Published: 2026-03-26 – Updated: 2026-03-26 – View on bdu.fstec.ru Fixed- CWE-401 - Неправильное освобождение памяти перед удалением последней ссылки («утечка памяти»)
| URL |
|---|
| https://www.cve.org/CVERecord?id=CVE-2023-53234 |
| https://git.kernel.org/stable/c/bf26b0e430ce34261f45959989edaf680b64d538 |
| https://git.kernel.org/stable/c/8c1655600f4f2839fb844fe8c70b2b65fadc7a56 |
| https://git.kernel.org/stable/c/59e391b3fc507a15b7e8e9d9f4de87cae177c366 |
| https://git.kernel.org/stable/c/c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3 |
| https://git.kernel.org/stable/c/23cc41c3f19c4d858c3708f1c0a06e94958e6c3b |
| https://git.kernel.org/stable/c/ac099d94e0480c937aa9172ab64074981ca1a4d3 |
| https://git.kernel.org/stable/c/50808d034e199fe3ff7a9d2068a4eebeb6b4098a |
| https://git.kernel.org/linus/13721a2ac66b246f5802ba1b75ad8637e53eeecc |
| https://kernel.org/pub/linux/kernel/v4.x/ChangeLog-4.14.308 |
| https://kernel.org/pub/linux/kernel/v4.x/ChangeLog-4.19.276 |
| https://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.4.235 |
| https://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.10.173 |
| https://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.15.100 |
| https://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.1.18 |
| https://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.2.5 |
| https://access.redhat.com/security/cve/cve-2023-53234 |
| https://security-tracker.debian.org/tracker/CVE-2023-53234 |
| https://ubuntu.com/security/CVE-2023-53234 |
{
"CVSS 2.0": "AV:L/AC:L/Au:S/C:N/I:N/A:C",
"CVSS 3.0": "AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"CVSS 4.0": null,
"remediation_\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": null,
"remediation_\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435": null,
"\u0412\u0435\u043d\u0434\u043e\u0440 \u041f\u041e": "Canonical Ltd., Red Hat, Inc., \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0412\u0435\u0440\u0441\u0438\u044f \u041f\u041e": "16.04 LTS (Ubuntu), 18.04 LTS (Ubuntu), 8 (Red Hat Enterprise Linux), 20.04 LTS (Ubuntu), 11 (Debian GNU/Linux), 22.04 LTS (Ubuntu), 9 (Red Hat Enterprise Linux), \u043e\u0442 5.5 \u0434\u043e 5.10.172 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.11 \u0434\u043e 5.15.99 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.16 \u0434\u043e 6.1.17 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 6.2 \u0434\u043e 6.2.4 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 4.9.225 \u0434\u043e 4.10 (Linux), \u043e\u0442 4.14.182 \u0434\u043e 4.14.307 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 4.19.93 \u0434\u043e 4.19.275 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.4.8 \u0434\u043e 5.4.234 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux)",
"\u0412\u043e\u0437\u043c\u043e\u0436\u043d\u044b\u0435 \u043c\u0435\u0440\u044b \u043f\u043e \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044e": "\u0412 \u0443\u0441\u043b\u043e\u0432\u0438\u044f\u0445 \u043e\u0442\u0441\u0443\u0442\u0441\u0442\u0432\u0438\u044f \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0439 \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u043e\u0442 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0443\u0435\u0442\u0441\u044f \u043f\u0440\u0438\u0434\u0435\u0440\u0436\u0438\u0432\u0430\u0442\u044c\u0441\u044f \"\u0420\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439 \u043f\u043e \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0439 \u043d\u0430\u0441\u0442\u0440\u043e\u0439\u043a\u0435 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u044b\u0445 \u0441\u0438\u0441\u0442\u0435\u043c LINUX\", \u0438\u0437\u043b\u043e\u0436\u0435\u043d\u043d\u044b\u0445 \u0432 \u043c\u0435\u0442\u043e\u0434\u0438\u0447\u0435\u0441\u043a\u043e\u043c \u0434\u043e\u043a\u0443\u043c\u0435\u043d\u0442\u0435 \u0424\u0421\u0422\u042d\u041a \u0420\u043e\u0441\u0441\u0438\u0438, \u0443\u0442\u0432\u0435\u0440\u0436\u0434\u0451\u043d\u043d\u043e\u043c 25 \u0434\u0435\u043a\u0430\u0431\u0440\u044f 2022 \u0433\u043e\u0434\u0430.\n\n\u0418\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0435 \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439:\n\u0414\u043b\u044f Linux:\nhttps://git.kernel.org/stable/c/bf26b0e430ce34261f45959989edaf680b64d538\nhttps://git.kernel.org/stable/c/8c1655600f4f2839fb844fe8c70b2b65fadc7a56\nhttps://git.kernel.org/stable/c/59e391b3fc507a15b7e8e9d9f4de87cae177c366\nhttps://git.kernel.org/stable/c/c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3\nhttps://git.kernel.org/stable/c/23cc41c3f19c4d858c3708f1c0a06e94958e6c3b\nhttps://git.kernel.org/stable/c/ac099d94e0480c937aa9172ab64074981ca1a4d3\nhttps://git.kernel.org/stable/c/50808d034e199fe3ff7a9d2068a4eebeb6b4098a\nhttps://git.kernel.org/linus/13721a2ac66b246f5802ba1b75ad8637e53eeecc\n\n\u0414\u043b\u044f \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u044b\u0445 \u043f\u0440\u043e\u0434\u0443\u043a\u0442\u043e\u0432 Red Hat Inc.:\nhttps://access.redhat.com/security/cve/cve-2023-53234\n\n\u0414\u043b\u044f \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u044b\u0445 \u043f\u0440\u043e\u0434\u0443\u043a\u0442\u043e\u0432 Debian GNU/Linux:\nhttps://security-tracker.debian.org/tracker/CVE-2023-53234\n\n\u0414\u043b\u044f \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u044b\u0445 \u043f\u0440\u043e\u0434\u0443\u043a\u0442\u043e\u0432 Ubuntu:\nhttps://ubuntu.com/security/CVE-2023-53234\n\n\u041a\u043e\u043c\u043f\u0435\u043d\u0441\u0438\u0440\u0443\u044e\u0449\u0438\u0435 \u043c\u0435\u0440\u044b:\n- \u043c\u0438\u043d\u0438\u043c\u0438\u0437\u0430\u0446\u0438\u044f \u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u0442\u0435\u043b\u044c\u0441\u043a\u0438\u0445 \u043f\u0440\u0438\u0432\u0438\u043b\u0435\u0433\u0438\u0439;\n- \u043e\u0442\u043a\u043b\u044e\u0447\u0435\u043d\u0438\u0435/\u0443\u0434\u0430\u043b\u0435\u043d\u0438\u0435 \u043d\u0435\u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u0435\u043c\u044b\u0445 \u0443\u0447\u0451\u0442\u043d\u044b\u0445 \u0437\u0430\u043f\u0438\u0441\u0435\u0439 \u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u0442\u0435\u043b\u0435\u0439;\n- \u043a\u043e\u043d\u0442\u0440\u043e\u043b\u044c \u0436\u0443\u0440\u043d\u0430\u043b\u043e\u0432 \u0430\u0443\u0434\u0438\u0442\u0430 \u043a\u043b\u0430\u0441\u0442\u0435\u0440\u0430 \u0434\u043b\u044f \u043e\u0442\u0441\u043b\u0435\u0436\u0438\u0432\u0430\u043d\u0438\u044f \u043f\u043e\u043f\u044b\u0442\u043e\u043a \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438.",
"\u0414\u0430\u0442\u0430 \u0432\u044b\u044f\u0432\u043b\u0435\u043d\u0438\u044f": "18.02.2023",
"\u0414\u0430\u0442\u0430 \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0433\u043e \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f": "26.03.2026",
"\u0414\u0430\u0442\u0430 \u043f\u0443\u0431\u043b\u0438\u043a\u0430\u0446\u0438\u0438": "26.03.2026",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": "BDU:2026-03957",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440\u044b \u0434\u0440\u0443\u0433\u0438\u0445 \u0441\u0438\u0441\u0442\u0435\u043c \u043e\u043f\u0438\u0441\u0430\u043d\u0438\u0439 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "CVE-2023-53234",
"\u0418\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f \u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0430",
"\u041a\u043b\u0430\u0441\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u0434\u0430",
"\u041d\u0430\u0437\u0432\u0430\u043d\u0438\u0435 \u041f\u041e": "Ubuntu, Red Hat Enterprise Linux, Debian GNU/Linux, Linux",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u041e\u0421 \u0438 \u0442\u0438\u043f \u0430\u043f\u043f\u0430\u0440\u0430\u0442\u043d\u043e\u0439 \u043f\u043b\u0430\u0442\u0444\u043e\u0440\u043c\u044b": "Canonical Ltd. Ubuntu 16.04 LTS , Canonical Ltd. Ubuntu 18.04 LTS , Red Hat, Inc. Red Hat Enterprise Linux 8 , Canonical Ltd. Ubuntu 20.04 LTS , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 11 , Canonical Ltd. Ubuntu 22.04 LTS , Red Hat, Inc. Red Hat Enterprise Linux 9 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.5 \u0434\u043e 5.10.172 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.11 \u0434\u043e 5.15.99 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.16 \u0434\u043e 6.1.17 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.2 \u0434\u043e 6.2.4 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 4.9.225 \u0434\u043e 4.10 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 4.14.182 \u0434\u043e 4.14.307 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 4.19.93 \u0434\u043e 4.19.275 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.4.8 \u0434\u043e 5.4.234 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e ",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 watchdog_cdev_register() \u043c\u043e\u0434\u0443\u043b\u044f drivers/watchdog/watchdog_dev.c \u043f\u043e\u0434\u0434\u0435\u0440\u0436\u043a\u0438 \u0441\u0442\u043e\u0440\u043e\u0436\u0435\u0432\u043e\u0433\u043e \u0442\u0430\u0439\u043c\u0435\u0440\u0430 \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux, \u043f\u043e\u0437\u0432\u043e\u043b\u044f\u044e\u0449\u0430\u044f \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041d\u0430\u043b\u0438\u0447\u0438\u0435 \u044d\u043a\u0441\u043f\u043b\u043e\u0439\u0442\u0430": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "\u041d\u0435\u043f\u0440\u0430\u0432\u0438\u043b\u044c\u043d\u043e\u0435 \u043e\u0441\u0432\u043e\u0431\u043e\u0436\u0434\u0435\u043d\u0438\u0435 \u043f\u0430\u043c\u044f\u0442\u0438 \u043f\u0435\u0440\u0435\u0434 \u0443\u0434\u0430\u043b\u0435\u043d\u0438\u0435\u043c \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0439 \u0441\u0441\u044b\u043b\u043a\u0438 (\u00ab\u0443\u0442\u0435\u0447\u043a\u0430 \u043f\u0430\u043c\u044f\u0442\u0438\u00bb) (CWE-401)",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 watchdog_cdev_register() \u043c\u043e\u0434\u0443\u043b\u044f drivers/watchdog/watchdog_dev.c \u043f\u043e\u0434\u0434\u0435\u0440\u0436\u043a\u0438 \u0441\u0442\u043e\u0440\u043e\u0436\u0435\u0432\u043e\u0433\u043e \u0442\u0430\u0439\u043c\u0435\u0440\u0430 \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux \u0441\u0432\u044f\u0437\u0430\u043d\u0430 \u0441 \u043d\u0435\u043f\u0440\u0430\u0432\u0438\u043b\u044c\u043d\u044b\u043c \u043e\u0441\u0432\u043e\u0431\u043e\u0436\u0434\u0435\u043d\u0438\u0435\u043c \u043f\u0430\u043c\u044f\u0442\u0438. \u042d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u044f \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438 \u043c\u043e\u0436\u0435\u0442 \u043f\u043e\u0437\u0432\u043e\u043b\u0438\u0442\u044c \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041f\u043e\u0441\u043b\u0435\u0434\u0441\u0442\u0432\u0438\u044f \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": null,
"\u041f\u0440\u043e\u0447\u0430\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f": null,
"\u0421\u0432\u044f\u0437\u044c \u0441 \u0438\u043d\u0446\u0438\u0434\u0435\u043d\u0442\u0430\u043c\u0438 \u0418\u0411": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041e\u043f\u0443\u0431\u043b\u0438\u043a\u043e\u0432\u0430\u043d\u0430",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044f": "\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438": "\u0418\u0441\u0447\u0435\u0440\u043f\u0430\u043d\u0438\u0435 \u0440\u0435\u0441\u0443\u0440\u0441\u043e\u0432",
"\u0421\u0441\u044b\u043b\u043a\u0438 \u043d\u0430 \u0438\u0441\u0442\u043e\u0447\u043d\u0438\u043a\u0438": "https://www.cve.org/CVERecord?id=CVE-2023-53234\nhttps://git.kernel.org/stable/c/bf26b0e430ce34261f45959989edaf680b64d538\nhttps://git.kernel.org/stable/c/8c1655600f4f2839fb844fe8c70b2b65fadc7a56\nhttps://git.kernel.org/stable/c/59e391b3fc507a15b7e8e9d9f4de87cae177c366\nhttps://git.kernel.org/stable/c/c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3\nhttps://git.kernel.org/stable/c/23cc41c3f19c4d858c3708f1c0a06e94958e6c3b\nhttps://git.kernel.org/stable/c/ac099d94e0480c937aa9172ab64074981ca1a4d3\nhttps://git.kernel.org/stable/c/50808d034e199fe3ff7a9d2068a4eebeb6b4098a\nhttps://git.kernel.org/linus/13721a2ac66b246f5802ba1b75ad8637e53eeecc\nhttps://kernel.org/pub/linux/kernel/v4.x/ChangeLog-4.14.308\nhttps://kernel.org/pub/linux/kernel/v4.x/ChangeLog-4.19.276\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.4.235\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.10.173\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.15.100\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.1.18\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.2.5\nhttps://access.redhat.com/security/cve/cve-2023-53234\nhttps://security-tracker.debian.org/tracker/CVE-2023-53234\nhttps://ubuntu.com/security/CVE-2023-53234",
"\u0421\u0442\u0430\u0442\u0443\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041f\u043e\u0434\u0442\u0432\u0435\u0440\u0436\u0434\u0435\u043d\u0430 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u0435\u043c",
"\u0422\u0438\u043f \u041f\u041e": "\u041e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u0430\u044f \u0441\u0438\u0441\u0442\u0435\u043c\u0430",
"\u0422\u0438\u043f \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "CWE-401",
"\u0423\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 2.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 4,6)\n\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 3.1 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 5,5)"
}
BELL-CVE-2023-53234 (CVE-2023-53234)
Vulnerability from osv_bellsoft – Published: 2025-09-16 06:04 – Updated: 2025-09-16 06:04 – Source website| URL | Type | |
|---|---|---|
{
"affected": [
{
"package": {
"ecosystem": "Alpaquita:stream",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=stream"
},
"ranges": [
{
"events": [
{
"introduced": "6.1.112-r0"
},
{
"fixed": "6.6.58-r0"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"id": "BELL-CVE-2023-53234",
"modified": "2025-09-16T06:04:38.91495Z",
"published": "2025-09-16T06:04:38.91493Z",
"references": [
{
"type": "ADVISORY",
"url": "https://docs.bell-sw.com/security/cves/CVE-2023-53234"
}
],
"schema_version": "1.7.4",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
],
"upstream": [
"CVE-2023-53234"
]
}
FKIE_CVE-2023-53234
Vulnerability from fkie_nvd - Published: 2025-09-15 15:15 - Updated: 2026-06-17 06:445.5 (Medium) - CVSS:3.1/
| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/13721a2ac66b246f5802ba1b75ad8637e53eeecc | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/23cc41c3f19c4d858c3708f1c0a06e94958e6c3b | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/50808d034e199fe3ff7a9d2068a4eebeb6b4098a | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/59e391b3fc507a15b7e8e9d9f4de87cae177c366 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/8c1655600f4f2839fb844fe8c70b2b65fadc7a56 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/ac099d94e0480c937aa9172ab64074981ca1a4d3 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/bf26b0e430ce34261f45959989edaf680b64d538 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3 | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/watchdog/watchdog_dev.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "bf26b0e430ce34261f45959989edaf680b64d538",
"status": "affected",
"version": "450caf1faa0d7bbbd1da93d3ee8c5edea7bc51a8",
"versionType": "git"
},
{
"lessThan": "8c1655600f4f2839fb844fe8c70b2b65fadc7a56",
"status": "affected",
"version": "f4c36f1999745c2160422fe2f362deadbe3a136b",
"versionType": "git"
},
{
"lessThan": "59e391b3fc507a15b7e8e9d9f4de87cae177c366",
"status": "affected",
"version": "ca7851d46de8a8d69022c4e5feed0820483b5f46",
"versionType": "git"
},
{
"lessThan": "c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "23cc41c3f19c4d858c3708f1c0a06e94958e6c3b",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "ac099d94e0480c937aa9172ab64074981ca1a4d3",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "50808d034e199fe3ff7a9d2068a4eebeb6b4098a",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"lessThan": "13721a2ac66b246f5802ba1b75ad8637e53eeecc",
"status": "affected",
"version": "72139dfa2464e43957d330266994740bb7be2535",
"versionType": "git"
},
{
"status": "affected",
"version": "f76905ce52653e8a821963c35d9013cff19b1399",
"versionType": "git"
},
{
"lessThan": "4.14.308",
"status": "affected",
"version": "4.14.182",
"versionType": "semver"
},
{
"lessThan": "4.19.276",
"status": "affected",
"version": "4.19.93",
"versionType": "semver"
},
{
"lessThan": "5.4.235",
"status": "affected",
"version": "5.4.8",
"versionType": "semver"
},
{
"lessThan": "4.10",
"status": "affected",
"version": "4.9.225",
"versionType": "semver"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/watchdog/watchdog_dev.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.5"
},
{
"lessThan": "5.5",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.14.*",
"status": "unaffected",
"version": "4.14.308",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.276",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.235",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.173",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.100",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.18",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.2.*",
"status": "unaffected",
"version": "6.2.5",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.3",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "1F06A06D-F043-4FC9-8009-F0FF564F7BE3",
"versionEndExcluding": "4.10",
"versionStartIncluding": "4.9.225",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "7E1FBE0A-26CC-4282-B501-BD09D83D5D84",
"versionEndExcluding": "4.14.308",
"versionStartIncluding": "4.14.182",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "5455A75D-91F0-4B25-BC8B-D3E815C7F427",
"versionEndExcluding": "4.19.276",
"versionStartIncluding": "4.19.93",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "D7780B7C-3278-476C-AA1E-432CCA8F6041",
"versionEndExcluding": "5.4.235",
"versionStartIncluding": "5.4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "4D810CFB-B7C5-493C-B98A-0D5F0D8A47B6",
"versionEndExcluding": "5.10.173",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "6D7E5BB5-018B-46B7-A2C4-1ADB75099822",
"versionEndExcluding": "5.15.100",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "C8D24FD5-5A98-4042-9419-39DCFCBEFFF5",
"versionEndExcluding": "6.1.18",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "0575B33B-A320-4E51-84CA-10C937341E02",
"versionEndExcluding": "6.2.5",
"versionStartIncluding": "6.2",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nwatchdog: Fix kmemleak in watchdog_cdev_register\n\nkmemleak reports memory leaks in watchdog_dev_register, as follows:\nunreferenced object 0xffff888116233000 (size 2048):\n comm \"\"modprobe\"\", pid 28147, jiffies 4353426116 (age 61.741s)\n hex dump (first 32 bytes):\n 80 fa b9 05 81 88 ff ff 08 30 23 16 81 88 ff ff .........0#.....\n 08 30 23 16 81 88 ff ff 00 00 00 00 00 00 00 00 .0#.............\n backtrace:\n [\u003c000000007f001ffd\u003e] __kmem_cache_alloc_node+0x157/0x220\n [\u003c000000006a389304\u003e] kmalloc_trace+0x21/0x110\n [\u003c000000008d640eea\u003e] watchdog_dev_register+0x4e/0x780 [watchdog]\n [\u003c0000000053c9f248\u003e] __watchdog_register_device+0x4f0/0x680 [watchdog]\n [\u003c00000000b2979824\u003e] watchdog_register_device+0xd2/0x110 [watchdog]\n [\u003c000000001f730178\u003e] 0xffffffffc10880ae\n [\u003c000000007a1a8bcc\u003e] do_one_initcall+0xcb/0x4d0\n [\u003c00000000b98be325\u003e] do_init_module+0x1ca/0x5f0\n [\u003c0000000046d08e7c\u003e] load_module+0x6133/0x70f0\n ...\n\nunreferenced object 0xffff888105b9fa80 (size 16):\n comm \"\"modprobe\"\", pid 28147, jiffies 4353426116 (age 61.741s)\n hex dump (first 16 bytes):\n 77 61 74 63 68 64 6f 67 31 00 b9 05 81 88 ff ff watchdog1.......\n backtrace:\n [\u003c000000007f001ffd\u003e] __kmem_cache_alloc_node+0x157/0x220\n [\u003c00000000486ab89b\u003e] __kmalloc_node_track_caller+0x44/0x1b0\n [\u003c000000005a39aab0\u003e] kvasprintf+0xb5/0x140\n [\u003c0000000024806f85\u003e] kvasprintf_const+0x55/0x180\n [\u003c000000009276cb7f\u003e] kobject_set_name_vargs+0x56/0x150\n [\u003c00000000a92e820b\u003e] dev_set_name+0xab/0xe0\n [\u003c00000000cec812c6\u003e] watchdog_dev_register+0x285/0x780 [watchdog]\n [\u003c0000000053c9f248\u003e] __watchdog_register_device+0x4f0/0x680 [watchdog]\n [\u003c00000000b2979824\u003e] watchdog_register_device+0xd2/0x110 [watchdog]\n [\u003c000000001f730178\u003e] 0xffffffffc10880ae\n [\u003c000000007a1a8bcc\u003e] do_one_initcall+0xcb/0x4d0\n [\u003c00000000b98be325\u003e] do_init_module+0x1ca/0x5f0\n [\u003c0000000046d08e7c\u003e] load_module+0x6133/0x70f0\n ...\n\nThe reason is that put_device is not be called if cdev_device_add fails\nand wdd-\u003eid != 0.\n\nwatchdog_cdev_register\n wd_data = kzalloc [1]\n err = dev_set_name [2]\n ..\n err = cdev_device_add\n if (err) {\n if (wdd-\u003eid == 0) { // wdd-\u003eid != 0\n ..\n }\n return err; // [1],[2] would be leaked\n\nTo fix it, call put_device in all wdd-\u003eid cases."
}
],
"id": "CVE-2023-53234",
"lastModified": "2026-06-17T06:44:35.080",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-53234",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2026-01-14T17:55:57.957947Z",
"version": "2.0.3"
}
}
]
},
"published": "2025-09-15T15:15:50.420",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/13721a2ac66b246f5802ba1b75ad8637e53eeecc"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/23cc41c3f19c4d858c3708f1c0a06e94958e6c3b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/50808d034e199fe3ff7a9d2068a4eebeb6b4098a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/59e391b3fc507a15b7e8e9d9f4de87cae177c366"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8c1655600f4f2839fb844fe8c70b2b65fadc7a56"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ac099d94e0480c937aa9172ab64074981ca1a4d3"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/bf26b0e430ce34261f45959989edaf680b64d538"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-401"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"description": [
{
"lang": "en",
"value": "CWE-401"
}
],
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
]
}
GHSA-44G3-HWMH-JX63
Vulnerability from github – Published: 2025-09-15 15:31 – Updated: 2025-12-03 21:30In the Linux kernel, the following vulnerability has been resolved:
watchdog: Fix kmemleak in watchdog_cdev_register
kmemleak reports memory leaks in watchdog_dev_register, as follows: unreferenced object 0xffff888116233000 (size 2048): comm ""modprobe"", pid 28147, jiffies 4353426116 (age 61.741s) hex dump (first 32 bytes): 80 fa b9 05 81 88 ff ff 08 30 23 16 81 88 ff ff .........0#..... 08 30 23 16 81 88 ff ff 00 00 00 00 00 00 00 00 .0#............. backtrace: [<000000007f001ffd>] __kmem_cache_alloc_node+0x157/0x220 [<000000006a389304>] kmalloc_trace+0x21/0x110 [<000000008d640eea>] watchdog_dev_register+0x4e/0x780 [watchdog] [<0000000053c9f248>] __watchdog_register_device+0x4f0/0x680 [watchdog] [<00000000b2979824>] watchdog_register_device+0xd2/0x110 [watchdog] [<000000001f730178>] 0xffffffffc10880ae [<000000007a1a8bcc>] do_one_initcall+0xcb/0x4d0 [<00000000b98be325>] do_init_module+0x1ca/0x5f0 [<0000000046d08e7c>] load_module+0x6133/0x70f0 ...
unreferenced object 0xffff888105b9fa80 (size 16): comm ""modprobe"", pid 28147, jiffies 4353426116 (age 61.741s) hex dump (first 16 bytes): 77 61 74 63 68 64 6f 67 31 00 b9 05 81 88 ff ff watchdog1....... backtrace: [<000000007f001ffd>] __kmem_cache_alloc_node+0x157/0x220 [<00000000486ab89b>] __kmalloc_node_track_caller+0x44/0x1b0 [<000000005a39aab0>] kvasprintf+0xb5/0x140 [<0000000024806f85>] kvasprintf_const+0x55/0x180 [<000000009276cb7f>] kobject_set_name_vargs+0x56/0x150 [<00000000a92e820b>] dev_set_name+0xab/0xe0 [<00000000cec812c6>] watchdog_dev_register+0x285/0x780 [watchdog] [<0000000053c9f248>] __watchdog_register_device+0x4f0/0x680 [watchdog] [<00000000b2979824>] watchdog_register_device+0xd2/0x110 [watchdog] [<000000001f730178>] 0xffffffffc10880ae [<000000007a1a8bcc>] do_one_initcall+0xcb/0x4d0 [<00000000b98be325>] do_init_module+0x1ca/0x5f0 [<0000000046d08e7c>] load_module+0x6133/0x70f0 ...
The reason is that put_device is not be called if cdev_device_add fails and wdd->id != 0.
watchdog_cdev_register wd_data = kzalloc [1] err = dev_set_name [2] .. err = cdev_device_add if (err) { if (wdd->id == 0) { // wdd->id != 0 .. } return err; // [1],[2] would be leaked
To fix it, call put_device in all wdd->id cases.
{
"affected": [],
"aliases": [
"CVE-2023-53234"
],
"database_specific": {
"cwe_ids": [
"CWE-401"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2025-09-15T15:15:50Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nwatchdog: Fix kmemleak in watchdog_cdev_register\n\nkmemleak reports memory leaks in watchdog_dev_register, as follows:\nunreferenced object 0xffff888116233000 (size 2048):\n comm \"\"modprobe\"\", pid 28147, jiffies 4353426116 (age 61.741s)\n hex dump (first 32 bytes):\n 80 fa b9 05 81 88 ff ff 08 30 23 16 81 88 ff ff .........0#.....\n 08 30 23 16 81 88 ff ff 00 00 00 00 00 00 00 00 .0#.............\n backtrace:\n [\u003c000000007f001ffd\u003e] __kmem_cache_alloc_node+0x157/0x220\n [\u003c000000006a389304\u003e] kmalloc_trace+0x21/0x110\n [\u003c000000008d640eea\u003e] watchdog_dev_register+0x4e/0x780 [watchdog]\n [\u003c0000000053c9f248\u003e] __watchdog_register_device+0x4f0/0x680 [watchdog]\n [\u003c00000000b2979824\u003e] watchdog_register_device+0xd2/0x110 [watchdog]\n [\u003c000000001f730178\u003e] 0xffffffffc10880ae\n [\u003c000000007a1a8bcc\u003e] do_one_initcall+0xcb/0x4d0\n [\u003c00000000b98be325\u003e] do_init_module+0x1ca/0x5f0\n [\u003c0000000046d08e7c\u003e] load_module+0x6133/0x70f0\n ...\n\nunreferenced object 0xffff888105b9fa80 (size 16):\n comm \"\"modprobe\"\", pid 28147, jiffies 4353426116 (age 61.741s)\n hex dump (first 16 bytes):\n 77 61 74 63 68 64 6f 67 31 00 b9 05 81 88 ff ff watchdog1.......\n backtrace:\n [\u003c000000007f001ffd\u003e] __kmem_cache_alloc_node+0x157/0x220\n [\u003c00000000486ab89b\u003e] __kmalloc_node_track_caller+0x44/0x1b0\n [\u003c000000005a39aab0\u003e] kvasprintf+0xb5/0x140\n [\u003c0000000024806f85\u003e] kvasprintf_const+0x55/0x180\n [\u003c000000009276cb7f\u003e] kobject_set_name_vargs+0x56/0x150\n [\u003c00000000a92e820b\u003e] dev_set_name+0xab/0xe0\n [\u003c00000000cec812c6\u003e] watchdog_dev_register+0x285/0x780 [watchdog]\n [\u003c0000000053c9f248\u003e] __watchdog_register_device+0x4f0/0x680 [watchdog]\n [\u003c00000000b2979824\u003e] watchdog_register_device+0xd2/0x110 [watchdog]\n [\u003c000000001f730178\u003e] 0xffffffffc10880ae\n [\u003c000000007a1a8bcc\u003e] do_one_initcall+0xcb/0x4d0\n [\u003c00000000b98be325\u003e] do_init_module+0x1ca/0x5f0\n [\u003c0000000046d08e7c\u003e] load_module+0x6133/0x70f0\n ...\n\nThe reason is that put_device is not be called if cdev_device_add fails\nand wdd-\u003eid != 0.\n\nwatchdog_cdev_register\n wd_data = kzalloc [1]\n err = dev_set_name [2]\n ..\n err = cdev_device_add\n if (err) {\n if (wdd-\u003eid == 0) { // wdd-\u003eid != 0\n ..\n }\n return err; // [1],[2] would be leaked\n\nTo fix it, call put_device in all wdd-\u003eid cases.",
"id": "GHSA-44g3-hwmh-jx63",
"modified": "2025-12-03T21:30:59Z",
"published": "2025-09-15T15:31:29Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53234"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/13721a2ac66b246f5802ba1b75ad8637e53eeecc"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/23cc41c3f19c4d858c3708f1c0a06e94958e6c3b"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/50808d034e199fe3ff7a9d2068a4eebeb6b4098a"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/59e391b3fc507a15b7e8e9d9f4de87cae177c366"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/8c1655600f4f2839fb844fe8c70b2b65fadc7a56"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/ac099d94e0480c937aa9172ab64074981ca1a4d3"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/bf26b0e430ce34261f45959989edaf680b64d538"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/c5a21a5501508ae3afa2fe6d5a3e74a37fa48df3"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2025-2468 (CVE-2022-50251)
Vulnerability from osv_openeuler – Published: 2025-10-17 11:09 – Updated: 2026-08-06 11:09 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
mmc: vub300: fix return value check of mmc_add_host()
mmc_add_host() may return error, if we ignore its return value, the memory that allocated in mmc_alloc_host() will be leaked and it will lead a kernel crash because of deleting not added device in the remove path.
So fix this by checking the return value and goto error path which will call mmc_free_host(), besides, the timer added before mmc_add_host() needs be del.
And this patch fixes another missing call mmc_free_host() if usb_control_msg() fails.(CVE-2022-50251)
In the Linux kernel, the following vulnerability has been resolved:
PNP: fix name memory leak in pnp_alloc_dev()
After commit 1fa5ae857bb1 ("driver core: get rid of struct device's bus_id string array"), the name of device is allocated dynamically, move dev_set_name() after pnp_add_id() to avoid memory leak.(CVE-2022-50278)
Rejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2022-50290)
In the Linux kernel, the following vulnerability has been resolved:
mmc: rtsx_usb_sdmmc: fix return value check of mmc_add_host()
mmc_add_host() may return error, if we ignore its return value, the memory that allocated in mmc_alloc_host() will be leaked and it will lead a kernel crash because of deleting not added device in the remove path.
So fix this by checking the return value and calling mmc_free_host() in the error path, besides, led_classdev_unregister() and pm_runtime_disable() also need be called.(CVE-2022-50347)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: L2CAP: Fix user-after-free
This uses l2cap_chan_hold_unless_zero() after calling __l2cap_get_chan_blah() to prevent the following trace:
Bluetooth: l2cap_core.c:static void l2cap_chan_destroy(struct kref *kref) Bluetooth: chan 0000000023c4974d Bluetooth: parent 00000000ae861c08 ================================================================== BUG: KASAN: use-after-free in __mutex_waiter_is_first kernel/locking/mutex.c:191 [inline] BUG: KASAN: use-after-free in __mutex_lock_common kernel/locking/mutex.c:671 [inline] BUG: KASAN: use-after-free in __mutex_lock+0x278/0x400 kernel/locking/mutex.c:729 Read of size 8 at addr ffff888006a49b08 by task kworker/u3:2/389(CVE-2022-50386)
In the Linux kernel, the following vulnerability has been resolved:
NFSD: Protect against send buffer overflow in NFSv2 READ
Since before the git era, NFSD has conserved the number of pages held by each nfsd thread by combining the RPC receive and send buffers into a single array of pages. This works because there are no cases where an operation needs a large RPC Call message and a large RPC Reply at the same time.
Once an RPC Call has been received, svc_process() updates svc_rqst::rq_res to describe the part of rq_pages that can be used for constructing the Reply. This means that the send buffer (rq_res) shrinks when the received RPC record containing the RPC Call is large.
A client can force this shrinkage on TCP by sending a correctly- formed RPC Call header contained in an RPC record that is excessively large. The full maximum payload size cannot be constructed in that case.(CVE-2022-50410)
In the Linux kernel, the following vulnerability has been resolved:
scsi: fcoe: Fix transport not deattached when fcoe_if_init() fails
fcoe_init() calls fcoe_transport_attach(&fcoe_sw_transport), but when fcoe_if_init() fails, &fcoe_sw_transport is not detached and leaves freed &fcoe_sw_transport on fcoe_transports list. This causes panic when reinserting module.
BUG: unable to handle page fault for address: fffffbfff82e2213 RIP: 0010:fcoe_transport_attach+0xe1/0x230 [libfcoe] Call Trace: <TASK> do_one_initcall+0xd0/0x4e0 load_module+0x5eee/0x7210 ...(CVE-2022-50414)
In the Linux kernel, the mxm-wmi driver's mxm_wmi_call_mxds|mx function has a memory leak vulnerability. The ACPI buffer memory (out.pointer) returned by wmi_evaluate_method() is not freed after the call, which leads to memory leak. Since the method results in ACPI buffer is not used, passing NULL to wmi_evaluate_method() fixes the memory leak.(CVE-2022-50521)
In the Linux kernel, a vulnerability exists in the VME subsystem's fake_init() function. The __root_device_register() function may fail but the error is not caught, which can cause failure when unregistering vme_root during exit, leading to null pointer dereference and potential system crash.(CVE-2022-50538)
In the Linux kernel, the following vulnerability has been resolved:
media: az6007: Fix null-ptr-deref in az6007_i2c_xfer()
In az6007_i2c_xfer, msg is controlled by user. When msg[i].buf is null and msg[i].len is zero, former checks on msg[i].buf would be passed. Malicious data finally reach az6007_i2c_xfer. If accessing msg[i].buf[0] without sanity check, null ptr deref would happen. We add check on msg[i].len to prevent crash.
Similar commit: commit 0ed554fd769a ("media: dvb-usb: az6027: fix null-ptr-deref in az6027_i2c_xfer()")(CVE-2023-53220)
In the Linux kernel, the following vulnerability has been resolved:
wifi: mwifiex: Fix OOB and integer underflow when rx packets
Make sure mwifiex_process_mgmt_packet, mwifiex_process_sta_rx_packet and mwifiex_process_uap_rx_packet, mwifiex_uap_queue_bridged_pkt and mwifiex_process_rx_packet not out-of-bounds access the skb->data buffer.(CVE-2023-53226)
In the Linux kernel, the following vulnerability has been resolved:
wifi: mac80211: fix invalid drv_sta_pre_rcu_remove calls for non-uploaded sta
Avoid potential data corruption issues caused by uninitialized driver private data structures.(CVE-2023-53229)
In the Linux kernel, the following vulnerability has been resolved:
watchdog: Fix kmemleak in watchdog_cdev_register
kmemleak reports memory leaks in watchdog_dev_register, as follows: unreferenced object 0xffff888116233000 (size 2048): comm ""modprobe"", pid 28147, jiffies 4353426116 (age 61.741s) hex dump (first 32 bytes): 80 fa b9 05 81 88 ff ff 08 30 23 16 81 88 ff ff .........0#..... 08 30 23 16 81 88 ff ff 00 00 00 00 00 00 00 00 .0#............. backtrace: [<000000007f001ffd>] __kmem_cache_alloc_node+0x157/0x220 [<000000006a389304>] kmalloc_trace+0x21/0x110 [<000000008d640eea>] watchdog_dev_register+0x4e/0x780 [watchdog] [<0000000053c9f248>] __watchdog_register_device+0x4f0/0x680 [watchdog] [<00000000b2979824>] watchdog_register_device+0xd2/0x110 [watchdog] [<000000001f730178>] 0xffffffffc10880ae [<000000007a1a8bcc>] do_one_initcall+0xcb/0x4d0 [<00000000b98be325>] do_init_module+0x1ca/0x5f0 [<0000000046d08e7c>] load_module+0x6133/0x70f0 ...
unreferenced object 0xffff888105b9fa80 (size 16): comm ""modprobe"", pid 28147, jiffies 4353426116 (age 61.741s) hex dump (first 16 bytes): 77 61 74 63 68 64 6f 67 31 00 b9 05 81 88 ff ff watchdog1....... backtrace: [<000000007f001ffd>] __kmem_cache_alloc_node+0x157/0x220 [<00000000486ab89b>] __kmalloc_node_track_caller+0x44/0x1b0 [<000000005a39aab0>] kvasprintf+0xb5/0x140 [<0000000024806f85>] kvasprintf_const+0x55/0x180 [<000000009276cb7f>] kobject_set_name_vargs+0x56/0x150 [<00000000a92e820b>] dev_set_name+0xab/0xe0 [<00000000cec812c6>] watchdog_dev_register+0x285/0x780 [watchdog] [<0000000053c9f248>] __watchdog_register_device+0x4f0/0x680 [watchdog] [<00000000b2979824>] watchdog_register_device+0xd2/0x110 [watchdog] [<000000001f730178>] 0xffffffffc10880ae [<000000007a1a8bcc>] do_one_initcall+0xcb/0x4d0 [<00000000b98be325>] do_init_module+0x1ca/0x5f0 [<0000000046d08e7c>] load_module+0x6133/0x70f0 ...
The reason is that put_device is not be called if cdev_device_add fails and wdd->id != 0.
watchdog_cdev_register wd_data = kzalloc [1] err = dev_set_name [2] .. err = cdev_device_add if (err) { if (wdd->id == 0) { // wdd->id != 0 .. } return err; // [1],[2] would be leaked
To fix it, call put_device in all wdd->id cases.(CVE-2023-53234)
In the Linux kernel, the following vulnerability has been resolved:
kobject: Add sanity check for kset->kobj.ktype in kset_register()
When I register a kset in the following way: static struct kset my_kset; kobject_set_name(&my_kset.kobj, "my_kset"); ret = kset_register(&my_kset);
A null pointer dereference exception is occurred: [ 4453.568337] Unable to handle kernel NULL pointer dereference at \ virtual address 0000000000000028 ... ... [ 4453.810361] Call trace: [ 4453.813062] kobject_get_ownership+0xc/0x34 [ 4453.817493] kobject_add_internal+0x98/0x274 [ 4453.822005] kset_register+0x5c/0xb4 [ 4453.825820] my_kobj_init+0x44/0x1000 [my_kset] ... ...
Because I didn't initialize my_kset.kobj.ktype.
According to the description in Documentation/core-api/kobject.rst: - A ktype is the type of object that embeds a kobject. Every structure that embeds a kobject needs a corresponding ktype.
So add sanity check to make sure kset->kobj.ktype is not NULL.(CVE-2023-53480)
A vulnerability was found in the Linux kernel's drm/i915/gvt module. The issue occurs during vgpu debugfs cleanup process. When destroying vgpu, the code doesn't properly check if the root debugfs is available. In remove cases, the drm minor's debugfs root might already be destroyed, which leads to kernel NULL pointer dereference and causes kernel oops as shown in the description.(CVE-2023-53625)
In the Linux kernel, the following vulnerability has been resolved:
scsi: libiscsi: Initialize iscsi_conn->dd_data only if memory is allocated
In case of an ib_fast_reg_mr allocation failure during iSER setup, the machine hits a panic because iscsi_conn->dd_data is initialized unconditionally, even when no memory is allocated (dd_size == 0). This leads invalid pointer dereference during connection teardown.
Fix by setting iscsi_conn->dd_data only if memory is actually allocated.
Panic trace:
iser: iser_create_fastreg_desc: Failed to allocate ib_fast_reg_mr err=-12 iser: iser_alloc_rx_descriptors: failed allocating rx descriptors / data buffers BUG: unable to handle page fault for address: fffffffffffffff8 RIP: 0010:swake_up_locked.part.5+0xa/0x40 Call Trace: complete+0x31/0x40 iscsi_iser_conn_stop+0x88/0xb0 [ib_iser] iscsi_stop_conn+0x66/0xc0 [scsi_transport_iscsi] iscsi_if_stop_conn+0x14a/0x150 [scsi_transport_iscsi] iscsi_if_rx+0x1135/0x1834 [scsi_transport_iscsi] ? netlink_lookup+0x12f/0x1b0 ? netlink_deliver_tap+0x2c/0x200 netlink_unicast+0x1ab/0x280 netlink_sendmsg+0x257/0x4f0 ? _copy_from_user+0x29/0x60 sock_sendmsg+0x5f/0x70(CVE-2025-38700)
In the Linux kernel, the following vulnerability has been resolved:
loop: Avoid updating block size under exclusive owner
Syzbot came up with a reproducer where a loop device block size is changed underneath a mounted filesystem. This causes a mismatch between the block device block size and the block size stored in the superblock causing confusion in various places such as fs/buffer.c. The particular issue triggered by syzbot was a warning in __getblk_slow() due to requested buffer size not matching block device block size.
Fix the problem by getting exclusive hold of the loop device to change its block size. This fails if somebody (such as filesystem) has already an exclusive ownership of the block device and thus prevents modifying the loop device under some exclusive owner which doesn't expect it.(CVE-2025-38709)
In the Linux kernel, the following vulnerability has been resolved:
tracing: Limit access to parser->buffer when trace_get_user failed
When the length of the string written to set_ftrace_filter exceeds FTRACE_BUFF_MAX, the following KASAN alarm will be triggered:
BUG: KASAN: slab-out-of-bounds in strsep+0x18c/0x1b0 Read of size 1 at addr ffff0000d00bd5ba by task ash/165
CPU: 1 UID: 0 PID: 165 Comm: ash Not tainted 6.16.0-g6bcdbd62bd56-dirty Hardware name: linux,dummy-virt (DT) Call trace: show_stack+0x34/0x50 (C) dump_stack_lvl+0xa0/0x158 print_address_description.constprop.0+0x88/0x398 print_report+0xb0/0x280 kasan_report+0xa4/0xf0 __asan_report_load1_noabort+0x20/0x30 strsep+0x18c/0x1b0 ftrace_process_regex.isra.0+0x100/0x2d8 ftrace_regex_release+0x484/0x618 __fput+0x364/0xa58 ____fput+0x28/0x40 task_work_run+0x154/0x278 do_notify_resume+0x1f0/0x220 el0_svc+0xec/0xf0 el0t_64_sync_handler+0xa0/0xe8 el0t_64_sync+0x1ac/0x1b0
The reason is that trace_get_user will fail when processing a string longer than FTRACE_BUFF_MAX, but not set the end of parser->buffer to 0. Then an OOB access will be triggered in ftrace_regex_release-> ftrace_process_regex->strsep->strpbrk. We can solve this problem by limiting access to parser->buffer when trace_get_user failed.(CVE-2025-39683)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"perf-debuginfo-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2510.2.0.0347.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2510.2.0.0347.oe2003sp4.src.rpm"
],
"x86_64": [
"bpftool-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"perf-debuginfo-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2510.2.0.0347.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2510.2.0.0347.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmmc: vub300: fix return value check of mmc_add_host()\n\nmmc_add_host() may return error, if we ignore its return value, the memory\nthat allocated in mmc_alloc_host() will be leaked and it will lead a kernel\ncrash because of deleting not added device in the remove path.\n\nSo fix this by checking the return value and goto error path which will call\nmmc_free_host(), besides, the timer added before mmc_add_host() needs be del.\n\nAnd this patch fixes another missing call mmc_free_host() if usb_control_msg()\nfails.(CVE-2022-50251)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nPNP: fix name memory leak in pnp_alloc_dev()\n\nAfter commit 1fa5ae857bb1 (\u0026quot;driver core: get rid of struct device\u0026apos;s\nbus_id string array\u0026quot;), the name of device is allocated dynamically,\nmove dev_set_name() after pnp_add_id() to avoid memory leak.(CVE-2022-50278)\n\nRejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2022-50290)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmmc: rtsx_usb_sdmmc: fix return value check of mmc_add_host()\n\nmmc_add_host() may return error, if we ignore its return value, the memory\nthat allocated in mmc_alloc_host() will be leaked and it will lead a kernel\ncrash because of deleting not added device in the remove path.\n\nSo fix this by checking the return value and calling mmc_free_host() in the\nerror path, besides, led_classdev_unregister() and pm_runtime_disable() also\nneed be called.(CVE-2022-50347)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBluetooth: L2CAP: Fix user-after-free\n\nThis uses l2cap_chan_hold_unless_zero() after calling\n__l2cap_get_chan_blah() to prevent the following trace:\n\nBluetooth: l2cap_core.c:static void l2cap_chan_destroy(struct kref\n*kref)\nBluetooth: chan 0000000023c4974d\nBluetooth: parent 00000000ae861c08\n==================================================================\nBUG: KASAN: use-after-free in __mutex_waiter_is_first\nkernel/locking/mutex.c:191 [inline]\nBUG: KASAN: use-after-free in __mutex_lock_common\nkernel/locking/mutex.c:671 [inline]\nBUG: KASAN: use-after-free in __mutex_lock+0x278/0x400\nkernel/locking/mutex.c:729\nRead of size 8 at addr ffff888006a49b08 by task kworker/u3:2/389(CVE-2022-50386)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nNFSD: Protect against send buffer overflow in NFSv2 READ\n\nSince before the git era, NFSD has conserved the number of pages\nheld by each nfsd thread by combining the RPC receive and send\nbuffers into a single array of pages. This works because there are\nno cases where an operation needs a large RPC Call message and a\nlarge RPC Reply at the same time.\n\nOnce an RPC Call has been received, svc_process() updates\nsvc_rqst::rq_res to describe the part of rq_pages that can be\nused for constructing the Reply. This means that the send buffer\n(rq_res) shrinks when the received RPC record containing the RPC\nCall is large.\n\nA client can force this shrinkage on TCP by sending a correctly-\nformed RPC Call header contained in an RPC record that is\nexcessively large. The full maximum payload size cannot be\nconstructed in that case.(CVE-2022-50410)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: fcoe: Fix transport not deattached when fcoe_if_init() fails\n\nfcoe_init() calls fcoe_transport_attach(\u0026amp;fcoe_sw_transport), but when\nfcoe_if_init() fails, \u0026amp;fcoe_sw_transport is not detached and leaves freed\n\u0026amp;fcoe_sw_transport on fcoe_transports list. This causes panic when\nreinserting module.\n\n BUG: unable to handle page fault for address: fffffbfff82e2213\n RIP: 0010:fcoe_transport_attach+0xe1/0x230 [libfcoe]\n Call Trace:\n \u0026lt;TASK\u0026gt;\n do_one_initcall+0xd0/0x4e0\n load_module+0x5eee/0x7210\n ...(CVE-2022-50414)\n\nIn the Linux kernel, the mxm-wmi driver\u0026apos;s mxm_wmi_call_mx[ds|mx]() function has a memory leak vulnerability. The ACPI buffer memory (out.pointer) returned by wmi_evaluate_method() is not freed after the call, which leads to memory leak. Since the method results in ACPI buffer is not used, passing NULL to wmi_evaluate_method() fixes the memory leak.(CVE-2022-50521)\n\nIn the Linux kernel, a vulnerability exists in the VME subsystem\u0026apos;s fake_init() function. The __root_device_register() function may fail but the error is not caught, which can cause failure when unregistering vme_root during exit, leading to null pointer dereference and potential system crash.(CVE-2022-50538)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmedia: az6007: Fix null-ptr-deref in az6007_i2c_xfer()\n\nIn az6007_i2c_xfer, msg is controlled by user. When msg[i].buf\nis null and msg[i].len is zero, former checks on msg[i].buf would be\npassed. Malicious data finally reach az6007_i2c_xfer. If accessing\nmsg[i].buf[0] without sanity check, null ptr deref would happen.\nWe add check on msg[i].len to prevent crash.\n\nSimilar commit:\ncommit 0ed554fd769a\n(\u0026quot;media: dvb-usb: az6027: fix null-ptr-deref in az6027_i2c_xfer()\u0026quot;)(CVE-2023-53220)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: mwifiex: Fix OOB and integer underflow when rx packets\n\nMake sure mwifiex_process_mgmt_packet,\nmwifiex_process_sta_rx_packet and mwifiex_process_uap_rx_packet,\nmwifiex_uap_queue_bridged_pkt and mwifiex_process_rx_packet\nnot out-of-bounds access the skb-\u0026gt;data buffer.(CVE-2023-53226)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: mac80211: fix invalid drv_sta_pre_rcu_remove calls for non-uploaded sta\n\nAvoid potential data corruption issues caused by uninitialized driver\nprivate data structures.(CVE-2023-53229)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwatchdog: Fix kmemleak in watchdog_cdev_register\n\nkmemleak reports memory leaks in watchdog_dev_register, as follows:\nunreferenced object 0xffff888116233000 (size 2048):\n comm \u0026quot;\u0026quot;modprobe\u0026quot;\u0026quot;, pid 28147, jiffies 4353426116 (age 61.741s)\n hex dump (first 32 bytes):\n 80 fa b9 05 81 88 ff ff 08 30 23 16 81 88 ff ff .........0#.....\n 08 30 23 16 81 88 ff ff 00 00 00 00 00 00 00 00 .0#.............\n backtrace:\n [\u0026lt;000000007f001ffd\u0026gt;] __kmem_cache_alloc_node+0x157/0x220\n [\u0026lt;000000006a389304\u0026gt;] kmalloc_trace+0x21/0x110\n [\u0026lt;000000008d640eea\u0026gt;] watchdog_dev_register+0x4e/0x780 [watchdog]\n [\u0026lt;0000000053c9f248\u0026gt;] __watchdog_register_device+0x4f0/0x680 [watchdog]\n [\u0026lt;00000000b2979824\u0026gt;] watchdog_register_device+0xd2/0x110 [watchdog]\n [\u0026lt;000000001f730178\u0026gt;] 0xffffffffc10880ae\n [\u0026lt;000000007a1a8bcc\u0026gt;] do_one_initcall+0xcb/0x4d0\n [\u0026lt;00000000b98be325\u0026gt;] do_init_module+0x1ca/0x5f0\n [\u0026lt;0000000046d08e7c\u0026gt;] load_module+0x6133/0x70f0\n ...\n\nunreferenced object 0xffff888105b9fa80 (size 16):\n comm \u0026quot;\u0026quot;modprobe\u0026quot;\u0026quot;, pid 28147, jiffies 4353426116 (age 61.741s)\n hex dump (first 16 bytes):\n 77 61 74 63 68 64 6f 67 31 00 b9 05 81 88 ff ff watchdog1.......\n backtrace:\n [\u0026lt;000000007f001ffd\u0026gt;] __kmem_cache_alloc_node+0x157/0x220\n [\u0026lt;00000000486ab89b\u0026gt;] __kmalloc_node_track_caller+0x44/0x1b0\n [\u0026lt;000000005a39aab0\u0026gt;] kvasprintf+0xb5/0x140\n [\u0026lt;0000000024806f85\u0026gt;] kvasprintf_const+0x55/0x180\n [\u0026lt;000000009276cb7f\u0026gt;] kobject_set_name_vargs+0x56/0x150\n [\u0026lt;00000000a92e820b\u0026gt;] dev_set_name+0xab/0xe0\n [\u0026lt;00000000cec812c6\u0026gt;] watchdog_dev_register+0x285/0x780 [watchdog]\n [\u0026lt;0000000053c9f248\u0026gt;] __watchdog_register_device+0x4f0/0x680 [watchdog]\n [\u0026lt;00000000b2979824\u0026gt;] watchdog_register_device+0xd2/0x110 [watchdog]\n [\u0026lt;000000001f730178\u0026gt;] 0xffffffffc10880ae\n [\u0026lt;000000007a1a8bcc\u0026gt;] do_one_initcall+0xcb/0x4d0\n [\u0026lt;00000000b98be325\u0026gt;] do_init_module+0x1ca/0x5f0\n [\u0026lt;0000000046d08e7c\u0026gt;] load_module+0x6133/0x70f0\n ...\n\nThe reason is that put_device is not be called if cdev_device_add fails\nand wdd-\u0026gt;id != 0.\n\nwatchdog_cdev_register\n wd_data = kzalloc [1]\n err = dev_set_name [2]\n ..\n err = cdev_device_add\n if (err) {\n if (wdd-\u0026gt;id == 0) { // wdd-\u0026gt;id != 0\n ..\n }\n return err; // [1],[2] would be leaked\n\nTo fix it, call put_device in all wdd-\u0026gt;id cases.(CVE-2023-53234)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nkobject: Add sanity check for kset-\u0026gt;kobj.ktype in kset_register()\n\nWhen I register a kset in the following way:\n\tstatic struct kset my_kset;\n\tkobject_set_name(\u0026amp;my_kset.kobj, \u0026quot;my_kset\u0026quot;);\n ret = kset_register(\u0026amp;my_kset);\n\nA null pointer dereference exception is occurred:\n[ 4453.568337] Unable to handle kernel NULL pointer dereference at \\\nvirtual address 0000000000000028\n... ...\n[ 4453.810361] Call trace:\n[ 4453.813062] kobject_get_ownership+0xc/0x34\n[ 4453.817493] kobject_add_internal+0x98/0x274\n[ 4453.822005] kset_register+0x5c/0xb4\n[ 4453.825820] my_kobj_init+0x44/0x1000 [my_kset]\n... ...\n\nBecause I didn\u0026apos;t initialize my_kset.kobj.ktype.\n\nAccording to the description in Documentation/core-api/kobject.rst:\n - A ktype is the type of object that embeds a kobject. Every structure\n that embeds a kobject needs a corresponding ktype.\n\nSo add sanity check to make sure kset-\u0026gt;kobj.ktype is not NULL.(CVE-2023-53480)\n\nA vulnerability was found in the Linux kernel\u0026apos;s drm/i915/gvt module. The issue occurs during vgpu debugfs cleanup process. When destroying vgpu, the code doesn\u0026apos;t properly check if the root debugfs is available. In remove cases, the drm minor\u0026apos;s debugfs root might already be destroyed, which leads to kernel NULL pointer dereference and causes kernel oops as shown in the description.(CVE-2023-53625)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: libiscsi: Initialize iscsi_conn-\u0026gt;dd_data only if memory is allocated\n\nIn case of an ib_fast_reg_mr allocation failure during iSER setup, the\nmachine hits a panic because iscsi_conn-\u0026gt;dd_data is initialized\nunconditionally, even when no memory is allocated (dd_size == 0). This\nleads invalid pointer dereference during connection teardown.\n\nFix by setting iscsi_conn-\u0026gt;dd_data only if memory is actually allocated.\n\nPanic trace:\n------------\n iser: iser_create_fastreg_desc: Failed to allocate ib_fast_reg_mr err=-12\n iser: iser_alloc_rx_descriptors: failed allocating rx descriptors / data buffers\n BUG: unable to handle page fault for address: fffffffffffffff8\n RIP: 0010:swake_up_locked.part.5+0xa/0x40\n Call Trace:\n complete+0x31/0x40\n iscsi_iser_conn_stop+0x88/0xb0 [ib_iser]\n iscsi_stop_conn+0x66/0xc0 [scsi_transport_iscsi]\n iscsi_if_stop_conn+0x14a/0x150 [scsi_transport_iscsi]\n iscsi_if_rx+0x1135/0x1834 [scsi_transport_iscsi]\n ? netlink_lookup+0x12f/0x1b0\n ? netlink_deliver_tap+0x2c/0x200\n netlink_unicast+0x1ab/0x280\n netlink_sendmsg+0x257/0x4f0\n ? _copy_from_user+0x29/0x60\n sock_sendmsg+0x5f/0x70(CVE-2025-38700)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nloop: Avoid updating block size under exclusive owner\n\nSyzbot came up with a reproducer where a loop device block size is\nchanged underneath a mounted filesystem. This causes a mismatch between\nthe block device block size and the block size stored in the superblock\ncausing confusion in various places such as fs/buffer.c. The particular\nissue triggered by syzbot was a warning in __getblk_slow() due to\nrequested buffer size not matching block device block size.\n\nFix the problem by getting exclusive hold of the loop device to change\nits block size. This fails if somebody (such as filesystem) has already\nan exclusive ownership of the block device and thus prevents modifying\nthe loop device under some exclusive owner which doesn\u0026apos;t expect it.(CVE-2025-38709)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntracing: Limit access to parser-\u0026gt;buffer when trace_get_user failed\n\nWhen the length of the string written to set_ftrace_filter exceeds\nFTRACE_BUFF_MAX, the following KASAN alarm will be triggered:\n\nBUG: KASAN: slab-out-of-bounds in strsep+0x18c/0x1b0\nRead of size 1 at addr ffff0000d00bd5ba by task ash/165\n\nCPU: 1 UID: 0 PID: 165 Comm: ash Not tainted 6.16.0-g6bcdbd62bd56-dirty\nHardware name: linux,dummy-virt (DT)\nCall trace:\n show_stack+0x34/0x50 (C)\n dump_stack_lvl+0xa0/0x158\n print_address_description.constprop.0+0x88/0x398\n print_report+0xb0/0x280\n kasan_report+0xa4/0xf0\n __asan_report_load1_noabort+0x20/0x30\n strsep+0x18c/0x1b0\n ftrace_process_regex.isra.0+0x100/0x2d8\n ftrace_regex_release+0x484/0x618\n __fput+0x364/0xa58\n ____fput+0x28/0x40\n task_work_run+0x154/0x278\n do_notify_resume+0x1f0/0x220\n el0_svc+0xec/0xf0\n el0t_64_sync_handler+0xa0/0xe8\n el0t_64_sync+0x1ac/0x1b0\n\nThe reason is that trace_get_user will fail when processing a string\nlonger than FTRACE_BUFF_MAX, but not set the end of parser-\u0026gt;buffer to 0.\nThen an OOB access will be triggered in ftrace_regex_release-\u0026gt;\nftrace_process_regex-\u0026gt;strsep-\u0026gt;strpbrk. We can solve this problem by\nlimiting access to parser-\u0026gt;buffer when trace_get_user failed.(CVE-2025-39683)",
"id": "OESA-2025-2468",
"modified": "2026-08-06T11:09:33Z",
"published": "2025-10-17T11:09:33Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2025-2468"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50251"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50278"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50290"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50347"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50386"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50410"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50414"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50521"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50538"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53220"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53226"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53229"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53234"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53480"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53625"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38700"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38709"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39683"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:A/AC:L/PR:L/UI:N/S:U/C:H/I:L/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2022-50251",
"CVE-2022-50278",
"CVE-2022-50290",
"CVE-2022-50347",
"CVE-2022-50386",
"CVE-2022-50410",
"CVE-2022-50414",
"CVE-2022-50521",
"CVE-2022-50538",
"CVE-2023-53220",
"CVE-2023-53226",
"CVE-2023-53229",
"CVE-2023-53234",
"CVE-2023-53480",
"CVE-2023-53625",
"CVE-2025-38700",
"CVE-2025-38709",
"CVE-2025-39683"
]
}
SUSE-SU-2025:03615-1
Vulnerability from csaf_suse - Published: 2025-10-16 05:49 - Updated: 2025-10-16 05:49Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.