Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2026-45893 (GCVE-0-2026-45893)
Vulnerability from cvelistv5 – Published: 2026-05-27 12:17 – Updated: 2026-05-27 12:17| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
e6e8bf418850d7958311a96ccfb594f2bcc8313e , < 47e351dfef60ab0e3285133556e1a9c7f646a969
(git)
Affected: e6e8bf418850d7958311a96ccfb594f2bcc8313e , < e027999049c493fb728ead5a90db76942181a935 (git) Affected: e6e8bf418850d7958311a96ccfb594f2bcc8313e , < 226c3b10aab23f73b03c47e7773107de56ba3a4e (git) Affected: e6e8bf418850d7958311a96ccfb594f2bcc8313e , < 6fc367bfd4c8886e6b1742aabbd1c0bdc310db3a (git) |
guessed | |
| Linux | Linux |
Affected:
4.11
Unaffected: 0 , < 4.11 (semver) Unaffected: 6.12.75 , ≤ 6.12.* (semver) Unaffected: 6.18.14 , ≤ 6.18.* (semver) Unaffected: 6.19.4 , ≤ 6.19.* (semver) Unaffected: 7.0 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"security/apparmor/include/match.h",
"security/apparmor/match.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "47e351dfef60ab0e3285133556e1a9c7f646a969",
"status": "affected",
"version": "e6e8bf418850d7958311a96ccfb594f2bcc8313e",
"versionType": "git"
},
{
"lessThan": "e027999049c493fb728ead5a90db76942181a935",
"status": "affected",
"version": "e6e8bf418850d7958311a96ccfb594f2bcc8313e",
"versionType": "git"
},
{
"lessThan": "226c3b10aab23f73b03c47e7773107de56ba3a4e",
"status": "affected",
"version": "e6e8bf418850d7958311a96ccfb594f2bcc8313e",
"versionType": "git"
},
{
"lessThan": "6fc367bfd4c8886e6b1742aabbd1c0bdc310db3a",
"status": "affected",
"version": "e6e8bf418850d7958311a96ccfb594f2bcc8313e",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"security/apparmor/include/match.h",
"security/apparmor/match.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.11"
},
{
"lessThan": "4.11",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.75",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.14",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.19.*",
"status": "unaffected",
"version": "6.19.4",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.0",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.12.75",
"versionStartIncluding": "4.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.18.14",
"versionStartIncluding": "4.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.19.4",
"versionStartIncluding": "4.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "7.0",
"versionStartIncluding": "4.11",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\napparmor: Fix \u0026 Optimize table creation from possibly unaligned memory\n\nSource blob may come from userspace and might be unaligned.\nTry to optize the copying process by avoiding unaligned memory accesses.\n\n- Added Fixes tag\n- Added \"Fix \u0026\" to description as this doesn\u0027t just optimize but fixes\n a potential unaligned memory access\n[jj: remove duplicate word \"convert\" in comment trigger checkpatch warning]"
}
],
"providerMetadata": {
"dateUpdated": "2026-05-27T12:17:04.135Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/47e351dfef60ab0e3285133556e1a9c7f646a969"
},
{
"url": "https://git.kernel.org/stable/c/e027999049c493fb728ead5a90db76942181a935"
},
{
"url": "https://git.kernel.org/stable/c/226c3b10aab23f73b03c47e7773107de56ba3a4e"
},
{
"url": "https://git.kernel.org/stable/c/6fc367bfd4c8886e6b1742aabbd1c0bdc310db3a"
}
],
"title": "apparmor: Fix \u0026 Optimize table creation from possibly unaligned memory",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2026-45893",
"datePublished": "2026-05-27T12:17:04.135Z",
"dateReserved": "2026-05-13T15:03:33.083Z",
"dateUpdated": "2026-05-27T12:17:04.135Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2026-45893",
"date": "2026-10-01",
"epss": "0.00166",
"percentile": "0.05222"
},
"microsoft_vex": {
"current_release_date": "2026-09-24T02:32:24.000Z",
"cve": "CVE-2026-45893",
"id": "msrc_CVE-2026-45893",
"initial_release_date": "2026-05-28T01:06:31.000Z",
"product_status:known_affected": "8",
"source": "Microsoft CSAF VEX",
"status": "final",
"title": "apparmor: Fix \u0026 Optimize table creation from possibly unaligned memory",
"url": "https://msrc.microsoft.com/csaf/vex/2026/msrc_cve-2026-45893.json",
"version": "11"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"security/apparmor/include/match.h",
"security/apparmor/match.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "47e351dfef60ab0e3285133556e1a9c7f646a969",
"status": "affected",
"version": "e6e8bf418850d7958311a96ccfb594f2bcc8313e",
"versionType": "git"
},
{
"lessThan": "e027999049c493fb728ead5a90db76942181a935",
"status": "affected",
"version": "e6e8bf418850d7958311a96ccfb594f2bcc8313e",
"versionType": "git"
},
{
"lessThan": "226c3b10aab23f73b03c47e7773107de56ba3a4e",
"status": "affected",
"version": "e6e8bf418850d7958311a96ccfb594f2bcc8313e",
"versionType": "git"
},
{
"lessThan": "6fc367bfd4c8886e6b1742aabbd1c0bdc310db3a",
"status": "affected",
"version": "e6e8bf418850d7958311a96ccfb594f2bcc8313e",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"security/apparmor/include/match.h",
"security/apparmor/match.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.11"
},
{
"lessThan": "4.11",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.75",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.14",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.19.*",
"status": "unaffected",
"version": "6.19.4",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.0",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "9460E9E9-5019-444D-B0AD-BB3A9C752456",
"versionEndExcluding": "6.12.75",
"versionStartIncluding": "4.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "BF463CB7-1F58-4607-B847-77ED23E4B9B7",
"versionEndExcluding": "6.18.14",
"versionStartIncluding": "6.13",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "672A3E79-EC03-479D-8503-361DFBDC8092",
"versionEndExcluding": "6.19.4",
"versionStartIncluding": "6.19",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\napparmor: Fix \u0026 Optimize table creation from possibly unaligned memory\n\nSource blob may come from userspace and might be unaligned.\nTry to optize the copying process by avoiding unaligned memory accesses.\n\n- Added Fixes tag\n- Added \"Fix \u0026\" to description as this doesn\u0027t just optimize but fixes\n a potential unaligned memory access\n[jj: remove duplicate word \"convert\" in comment trigger checkpatch warning]"
}
],
"id": "CVE-2026-45893",
"lastModified": "2026-06-25T21:10:15.113",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.1,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.2,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2026-05-27T14:17:03.487",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/226c3b10aab23f73b03c47e7773107de56ba3a4e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/47e351dfef60ab0e3285133556e1a9c7f646a969"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/6fc367bfd4c8886e6b1742aabbd1c0bdc310db3a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/e027999049c493fb728ead5a90db76942181a935"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-125"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "None",
"current_release_date": "2026-06-28T07:39:58+00:00",
"cve": "CVE-2026-45893",
"id": "CVE-2026-45893",
"initial_release_date": "2026-05-27T00:00:00+00:00",
"product_status:known_not_affected": "274",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: apparmor: Fix \u0026#38; Optimize table creation from possibly unaligned memory",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2026/cve-2026-45893.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-08-27T17:00:35Z",
"cve": "CVE-2026-45893",
"id": "CVE-2026-45893",
"initial_release_date": "2026-05-28T03:56:43Z",
"product_status:known_affected": "295",
"product_status:known_not_affected": "6",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2026-45893",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2026-45893.json",
"version": "4"
}
}
}
BDU:2026-13812 (CVE-2026-45893)
Vulnerability from fstec – Published: 2026-09-03 – Updated: 2026-09-03 – View on bdu.fstec.ru Fixed{
"CVSS 2.0": "AV:L/AC:L/Au:S/C:C/I:N/A:C",
"CVSS 3.0": "AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:H",
"CVSS 4.0": null,
"remediation_\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": null,
"remediation_\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435": null,
"\u0412\u0435\u043d\u0434\u043e\u0440 \u041f\u041e": "Canonical Ltd., \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0412\u0435\u0440\u0441\u0438\u044f \u041f\u041e": "16.04 LTS (Ubuntu), 18.04 LTS (Ubuntu), 20.04 LTS (Ubuntu), 11 (Debian GNU/Linux), 12 (Debian GNU/Linux), 22.04 LTS (Ubuntu), 24.04 LTS (Ubuntu), 13 (Debian GNU/Linux), \u043e\u0442 6.19 \u0434\u043e 6.19.3 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 6.13 \u0434\u043e 6.18.13 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 4.11 \u0434\u043e 6.12.74 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux)",
"\u0412\u043e\u0437\u043c\u043e\u0436\u043d\u044b\u0435 \u043c\u0435\u0440\u044b \u043f\u043e \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044e": "\u0412 \u0443\u0441\u043b\u043e\u0432\u0438\u044f\u0445 \u043e\u0442\u0441\u0443\u0442\u0441\u0442\u0432\u0438\u044f \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0439 \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u043e\u0442 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0443\u0435\u0442\u0441\u044f \u043f\u0440\u0438\u0434\u0435\u0440\u0436\u0438\u0432\u0430\u0442\u044c\u0441\u044f \"\u0420\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439 \u043f\u043e \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0439 \u043d\u0430\u0441\u0442\u0440\u043e\u0439\u043a\u0435 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u044b\u0445 \u0441\u0438\u0441\u0442\u0435\u043c LINUX\", \u0438\u0437\u043b\u043e\u0436\u0435\u043d\u043d\u044b\u0445 \u0432 \u043c\u0435\u0442\u043e\u0434\u0438\u0447\u0435\u0441\u043a\u043e\u043c \u0434\u043e\u043a\u0443\u043c\u0435\u043d\u0442\u0435 \u0424\u0421\u0422\u042d\u041a \u0420\u043e\u0441\u0441\u0438\u0438, \u0443\u0442\u0432\u0435\u0440\u0436\u0434\u0451\u043d\u043d\u043e\u043c 25 \u0434\u0435\u043a\u0430\u0431\u0440\u044f 2022 \u0433\u043e\u0434\u0430.\n\n\u0418\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0435 \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439:\n\u0414\u043b\u044f Linux:\nhttps://git.kernel.org/stable/c/47e351dfef60ab0e3285133556e1a9c7f646a969\nhttps://git.kernel.org/stable/c/e027999049c493fb728ead5a90db76942181a935\nhttps://git.kernel.org/stable/c/226c3b10aab23f73b03c47e7773107de56ba3a4e\nhttps://git.kernel.org/linus/6fc367bfd4c8886e6b1742aabbd1c0bdc310db3a\n\n\u0414\u043b\u044f Debian GNU/Linux:\nhttps://security-tracker.debian.org/tracker/CVE-2026-45893\n\n\u0414\u043b\u044f Ubuntu:\nhttps://ubuntu.com/security/CVE-2026-45893",
"\u0414\u0430\u0442\u0430 \u0432\u044b\u044f\u0432\u043b\u0435\u043d\u0438\u044f": "22.01.2026",
"\u0414\u0430\u0442\u0430 \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0433\u043e \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f": "03.09.2026",
"\u0414\u0430\u0442\u0430 \u043f\u0443\u0431\u043b\u0438\u043a\u0430\u0446\u0438\u0438": "03.09.2026",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": "BDU:2026-13812",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440\u044b \u0434\u0440\u0443\u0433\u0438\u0445 \u0441\u0438\u0441\u0442\u0435\u043c \u043e\u043f\u0438\u0441\u0430\u043d\u0438\u0439 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "CVE-2026-45893",
"\u0418\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f \u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0430",
"\u041a\u043b\u0430\u0441\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u0434\u0430",
"\u041d\u0430\u0437\u0432\u0430\u043d\u0438\u0435 \u041f\u041e": "Ubuntu, Debian GNU/Linux, Linux",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u041e\u0421 \u0438 \u0442\u0438\u043f \u0430\u043f\u043f\u0430\u0440\u0430\u0442\u043d\u043e\u0439 \u043f\u043b\u0430\u0442\u0444\u043e\u0440\u043c\u044b": "Canonical Ltd. Ubuntu 16.04 LTS , Canonical Ltd. Ubuntu 18.04 LTS , Canonical Ltd. Ubuntu 20.04 LTS , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 11 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 12 , Canonical Ltd. Ubuntu 22.04 LTS , Canonical Ltd. Ubuntu 24.04 LTS , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 13 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.19 \u0434\u043e 6.19.3 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.13 \u0434\u043e 6.18.13 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 4.11 \u0434\u043e 6.12.74 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e ",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 unpack_table() \u043c\u043e\u0434\u0443\u043b\u044f security/apparmor/match.c \u043a\u043e\u043c\u043f\u043e\u043d\u0435\u043d\u0442\u0430 \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 AppArmor \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux, \u043f\u043e\u0437\u0432\u043e\u043b\u044f\u044e\u0449\u0430\u044f \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0440\u0430\u0441\u043a\u0440\u044b\u0442\u044c \u0437\u0430\u0449\u0438\u0449\u0430\u0435\u043c\u0443\u044e \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044e \u0438\u043b\u0438 \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041d\u0430\u043b\u0438\u0447\u0438\u0435 \u044d\u043a\u0441\u043f\u043b\u043e\u0439\u0442\u0430": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "\u0427\u0442\u0435\u043d\u0438\u0435 \u0437\u0430 \u0433\u0440\u0430\u043d\u0438\u0446\u0430\u043c\u0438 \u0431\u0443\u0444\u0435\u0440\u0430 (CWE-125), \u041d\u0435\u043f\u0440\u0430\u0432\u0438\u043b\u044c\u043d\u043e\u0435 null-\u043f\u0440\u0435\u043a\u0440\u0430\u0449\u0435\u043d\u0438\u0435 (CWE-170), \u0421\u043c\u0435\u0449\u0435\u043d\u0438\u0435 \u0443\u043a\u0430\u0437\u0430\u0442\u0435\u043b\u044f \u0437\u0430 \u0443\u043a\u0430\u0437\u0430\u043d\u043d\u044b\u0435 \u0433\u0440\u0430\u043d\u0438\u0446\u044b (CWE-823)",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 unpack_table() \u043c\u043e\u0434\u0443\u043b\u044f security/apparmor/match.c \u043a\u043e\u043c\u043f\u043e\u043d\u0435\u043d\u0442\u0430 \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 AppArmor \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux \u0441\u0432\u044f\u0437\u0430\u043d\u0430 \u0441\u043e \u0441\u043c\u0435\u0449\u0435\u043d\u0438\u0435\u043c \u0443\u043a\u0430\u0437\u0430\u0442\u0435\u043b\u044f \u0437\u0430 \u0433\u0440\u0430\u043d\u0438\u0446\u044b \u0432\u044b\u0434\u0435\u043b\u0435\u043d\u043d\u043e\u0439 \u043f\u0430\u043c\u044f\u0442\u0438. \u042d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u044f \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438 \u043c\u043e\u0436\u0435\u0442 \u043f\u043e\u0437\u0432\u043e\u043b\u0438\u0442\u044c \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0440\u0430\u0441\u043a\u0440\u044b\u0442\u044c \u0437\u0430\u0449\u0438\u0449\u0430\u0435\u043c\u0443\u044e \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044e \u0438\u043b\u0438 \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041f\u043e\u0441\u043b\u0435\u0434\u0441\u0442\u0432\u0438\u044f \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": null,
"\u041f\u0440\u043e\u0447\u0430\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f": null,
"\u0421\u0432\u044f\u0437\u044c \u0441 \u0438\u043d\u0446\u0438\u0434\u0435\u043d\u0442\u0430\u043c\u0438 \u0418\u0411": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041e\u043f\u0443\u0431\u043b\u0438\u043a\u043e\u0432\u0430\u043d\u0430",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044f": "\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438": "\u041c\u0430\u043d\u0438\u043f\u0443\u043b\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u0435 \u0441\u0442\u0440\u0443\u043a\u0442\u0443\u0440\u0430\u043c\u0438 \u0434\u0430\u043d\u043d\u044b\u0445",
"\u0421\u0441\u044b\u043b\u043a\u0438 \u043d\u0430 \u0438\u0441\u0442\u043e\u0447\u043d\u0438\u043a\u0438": "https://www.cve.org/CVERecord?id=CVE-2026-45893\nhttps://git.kernel.org/stable/c/47e351dfef60ab0e3285133556e1a9c7f646a969\nhttps://git.kernel.org/stable/c/e027999049c493fb728ead5a90db76942181a935\nhttps://git.kernel.org/stable/c/226c3b10aab23f73b03c47e7773107de56ba3a4e\nhttps://git.kernel.org/linus/6fc367bfd4c8886e6b1742aabbd1c0bdc310db3a\nhttps://security-tracker.debian.org/tracker/CVE-2026-45893\nhttps://ubuntu.com/security/CVE-2026-45893",
"\u0421\u0442\u0430\u0442\u0443\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041f\u043e\u0434\u0442\u0432\u0435\u0440\u0436\u0434\u0435\u043d\u0430 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u0435\u043c",
"\u0422\u0438\u043f \u041f\u041e": "\u041e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u0430\u044f \u0441\u0438\u0441\u0442\u0435\u043c\u0430",
"\u0422\u0438\u043f \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "CWE-125, CWE-170, CWE-823",
"\u0423\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 2.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 6,2)\n\u0412\u044b\u0441\u043e\u043a\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 3.1 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 7,1)"
}
BELL-CVE-2026-45893 (CVE-2026-45893)
Vulnerability from osv_bellsoft – Published: 2026-05-29 06:10 – Updated: 2026-06-24 20:15 – Source website| URL | Type | |
|---|---|---|
{
"affected": [
{
"package": {
"ecosystem": "Alpaquita:23",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=23"
},
"ranges": [
{
"events": [
{
"introduced": "6.1.170-r0"
}
],
"type": "ECOSYSTEM"
}
]
},
{
"package": {
"ecosystem": "Alpaquita:25",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=25"
},
"ranges": [
{
"events": [
{
"introduced": "6.12.74-r0"
},
{
"fixed": "6.12.80-r0"
}
],
"type": "ECOSYSTEM"
}
]
},
{
"package": {
"ecosystem": "Alpaquita:stream",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=stream"
},
"ranges": [
{
"events": [
{
"introduced": "6.12.92-r1"
},
{
"fixed": "6.18.35-r1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"id": "BELL-CVE-2026-45893",
"modified": "2026-06-24T20:15:11.271616Z",
"published": "2026-05-29T06:10:54.637205Z",
"references": [
{
"type": "ADVISORY",
"url": "https://docs.bell-sw.com/security/cves/CVE-2026-45893"
}
],
"schema_version": "1.7.4",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:H",
"type": "CVSS_V3"
}
],
"upstream": [
"CVE-2026-45893"
]
}
CERTFR-2026-AVI-0831
Vulnerability from certfr_avis - Published: 2026-07-03 - Updated: 2026-07-03
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 25.10",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-46325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46325"
},
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-23198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23198"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-43078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43078"
},
{
"name": "CVE-2026-31713",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31713"
},
{
"name": "CVE-2026-23202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23202"
},
{
"name": "CVE-2026-23260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23260"
},
{
"name": "CVE-2026-23167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23167"
},
{
"name": "CVE-2026-45905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45905"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-43414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43414"
},
{
"name": "CVE-2026-46010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46010"
},
{
"name": "CVE-2026-23129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23129"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2026-31582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31582"
},
{
"name": "CVE-2026-46045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46045"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2026-23098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23098"
},
{
"name": "CVE-2026-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47329"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2025-68749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68749"
},
{
"name": "CVE-2026-46081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46081"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-45884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45884"
},
{
"name": "CVE-2026-46087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46087"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-23126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23126"
},
{
"name": "CVE-2026-46255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46255"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2026-23054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23054"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-31402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31402"
},
{
"name": "CVE-2026-46042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46042"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-43317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43317"
},
{
"name": "CVE-2026-23159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23159"
},
{
"name": "CVE-2025-68725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68725"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2026-46076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46076"
},
{
"name": "CVE-2026-23450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23450"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2026-31704",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31704"
},
{
"name": "CVE-2026-31685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31685"
},
{
"name": "CVE-2026-43073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43073"
},
{
"name": "CVE-2026-43143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43143"
},
{
"name": "CVE-2026-46013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46013"
},
{
"name": "CVE-2026-23069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23069"
},
{
"name": "CVE-2026-22992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22992"
},
{
"name": "CVE-2026-46065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46065"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2025-71191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71191"
},
{
"name": "CVE-2026-31593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31593"
},
{
"name": "CVE-2026-46007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46007"
},
{
"name": "CVE-2026-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47330"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-45923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45923"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-45910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45910"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-31600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31600"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-45928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45928"
},
{
"name": "CVE-2026-45988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45988"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2025-40039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40039"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-23020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23020"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-46063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46063"
},
{
"name": "CVE-2026-23187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23187"
},
{
"name": "CVE-2026-46280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46280"
},
{
"name": "CVE-2026-43011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43011"
},
{
"name": "CVE-2026-43167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43167"
},
{
"name": "CVE-2026-45976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45976"
},
{
"name": "CVE-2026-43248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43248"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-23136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23136"
},
{
"name": "CVE-2026-23139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23139"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-46287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46287"
},
{
"name": "CVE-2025-71189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71189"
},
{
"name": "CVE-2026-23179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23179"
},
{
"name": "CVE-2026-31613",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31613"
},
{
"name": "CVE-2026-23090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23090"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-46032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46032"
},
{
"name": "CVE-2026-23035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23035"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2026-31574",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31574"
},
{
"name": "CVE-2026-46057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46057"
},
{
"name": "CVE-2026-23258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23258"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2026-23064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23064"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2026-43284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43284"
},
{
"name": "CVE-2026-45995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45995"
},
{
"name": "CVE-2026-46034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46034"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-23061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23061"
},
{
"name": "CVE-2026-23059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23059"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-45996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45996"
},
{
"name": "CVE-2026-46286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46286"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-23135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23135"
},
{
"name": "CVE-2026-23047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23047"
},
{
"name": "CVE-2025-68365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68365"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-43244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43244"
},
{
"name": "CVE-2026-23119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23119"
},
{
"name": "CVE-2026-23173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23173"
},
{
"name": "CVE-2026-31711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31711"
},
{
"name": "CVE-2026-31611",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31611"
},
{
"name": "CVE-2026-23123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23123"
},
{
"name": "CVE-2026-43201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43201"
},
{
"name": "CVE-2026-31714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31714"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-46260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46260"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-31431",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31431"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-43319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43319"
},
{
"name": "CVE-2026-23094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23094"
},
{
"name": "CVE-2026-23049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23049"
},
{
"name": "CVE-2026-46092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46092"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2026-31614",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31614"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2026-23101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23101"
},
{
"name": "CVE-2026-46001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46001"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-46071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46071"
},
{
"name": "CVE-2026-23099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23099"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-45851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45851"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-31478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31478"
},
{
"name": "CVE-2026-45859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45859"
},
{
"name": "CVE-2026-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23085"
},
{
"name": "CVE-2026-46066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46066"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-43153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43153"
},
{
"name": "CVE-2026-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23150"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-45917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45917"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-46031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46031"
},
{
"name": "CVE-2026-46277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46277"
},
{
"name": "CVE-2026-23163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23163"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-23057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23057"
},
{
"name": "CVE-2025-37926",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37926"
},
{
"name": "CVE-2026-45865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45865"
},
{
"name": "CVE-2026-31635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31635"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-43033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43033"
},
{
"name": "CVE-2026-46265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46265"
},
{
"name": "CVE-2026-45972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45972"
},
{
"name": "CVE-2026-23166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23166"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-22991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22991"
},
{
"name": "CVE-2026-23264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23264"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-46074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46074"
},
{
"name": "CVE-2026-47331",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47331"
},
{
"name": "CVE-2026-31595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31595"
},
{
"name": "CVE-2026-46332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46332"
},
{
"name": "CVE-2026-43503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43503"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-45989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45989"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-45881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45881"
},
{
"name": "CVE-2026-43350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43350"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2026-43376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43376"
},
{
"name": "CVE-2026-23256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23256"
},
{
"name": "CVE-2026-23116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23116"
},
{
"name": "CVE-2026-46261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46261"
},
{
"name": "CVE-2026-31659",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31659"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2026-45861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45861"
},
{
"name": "CVE-2026-31591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31591"
},
{
"name": "CVE-2026-46041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46041"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2025-71200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71200"
},
{
"name": "CVE-2026-43117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43117"
},
{
"name": "CVE-2026-46083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46083"
},
{
"name": "CVE-2026-22980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22980"
},
{
"name": "CVE-2026-45914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45914"
},
{
"name": "CVE-2026-23172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23172"
},
{
"name": "CVE-2026-43493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43493"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-43383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43383"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-43500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43500"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-23133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23133"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-31703",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31703"
},
{
"name": "CVE-2026-23131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23131"
},
{
"name": "CVE-2026-23212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23212"
},
{
"name": "CVE-2026-23032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23032"
},
{
"name": "CVE-2026-23170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23170"
},
{
"name": "CVE-2026-46097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46097"
},
{
"name": "CVE-2026-23204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23204"
},
{
"name": "CVE-2026-23019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23019"
},
{
"name": "CVE-2026-23230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23230"
},
{
"name": "CVE-2025-71188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71188"
},
{
"name": "CVE-2026-46030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46030"
},
{
"name": "CVE-2026-43170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43170"
},
{
"name": "CVE-2026-31693",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31693"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-23125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23125"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-43150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43150"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45913"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-23005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23005"
},
{
"name": "CVE-2026-47328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47328"
},
{
"name": "CVE-2026-23214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23214"
},
{
"name": "CVE-2026-46005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46005"
},
{
"name": "CVE-2026-45962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45962"
},
{
"name": "CVE-2026-31718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31718"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-23030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23030"
},
{
"name": "CVE-2026-46247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46247"
},
{
"name": "CVE-2026-46069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46069"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2026-23178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23178"
},
{
"name": "CVE-2026-46288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46288"
},
{
"name": "CVE-2026-43288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43288"
},
{
"name": "CVE-2026-22997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22997"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2025-71294",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71294"
},
{
"name": "CVE-2026-31609",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31609"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2025-71196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71196"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-31533",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31533"
},
{
"name": "CVE-2026-46059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46059"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-46323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46323"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-46103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46103"
},
{
"name": "CVE-2026-43348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43348"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-46043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46043"
},
{
"name": "CVE-2026-23191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23191"
},
{
"name": "CVE-2026-31601",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31601"
},
{
"name": "CVE-2026-23078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23078"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-31418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31418"
},
{
"name": "CVE-2026-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47332"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-45981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45981"
},
{
"name": "CVE-2026-31620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31620"
},
{
"name": "CVE-2026-43197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43197"
},
{
"name": "CVE-2026-46278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46278"
},
{
"name": "CVE-2026-46011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46011"
},
{
"name": "CVE-2026-46095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46095"
},
{
"name": "CVE-2026-43253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43253"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2025-71220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71220"
},
{
"name": "CVE-2025-71295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71295"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-23103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23103"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-43491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43491"
},
{
"name": "CVE-2026-46100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46100"
},
{
"name": "CVE-2025-71199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71199"
},
{
"name": "CVE-2026-46012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46012"
},
{
"name": "CVE-2026-31606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31606"
},
{
"name": "CVE-2025-68358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68358"
},
{
"name": "CVE-2026-23180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23180"
},
{
"name": "CVE-2026-45999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45999"
},
{
"name": "CVE-2026-45973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45973"
},
{
"name": "CVE-2026-23006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23006"
},
{
"name": "CVE-2026-43249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43249"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2025-71195",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71195"
},
{
"name": "CVE-2026-22994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22994"
},
{
"name": "CVE-2026-31705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31705"
},
{
"name": "CVE-2026-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52905"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-23083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23083"
},
{
"name": "CVE-2026-23262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23262"
},
{
"name": "CVE-2026-23088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23088"
},
{
"name": "CVE-2026-46038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46038"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-45878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45878"
},
{
"name": "CVE-2026-23108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23108"
},
{
"name": "CVE-2026-23267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23267"
},
{
"name": "CVE-2025-71180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71180"
},
{
"name": "CVE-2026-46000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46000"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47334"
},
{
"name": "CVE-2025-71194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71194"
},
{
"name": "CVE-2026-45982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45982"
},
{
"name": "CVE-2026-31669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31669"
},
{
"name": "CVE-2026-23200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23200"
},
{
"name": "CVE-2026-22999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22999"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-23068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23068"
},
{
"name": "CVE-2026-23089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23089"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-23216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23216"
},
{
"name": "CVE-2025-71225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71225"
},
{
"name": "CVE-2026-46276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46276"
},
{
"name": "CVE-2026-23071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23071"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-23056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23056"
},
{
"name": "CVE-2026-31608",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31608"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-43173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43173"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-43077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43077"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-46283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46283"
},
{
"name": "CVE-2026-45957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45957"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-23063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23063"
},
{
"name": "CVE-2026-23427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23427"
},
{
"name": "CVE-2026-47335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47335"
},
{
"name": "CVE-2026-23073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23073"
},
{
"name": "CVE-2026-46020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46020"
},
{
"name": "CVE-2026-23058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23058"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2025-71182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71182"
},
{
"name": "CVE-2026-45997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45997"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-23038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23038"
},
{
"name": "CVE-2026-43402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43402"
},
{
"name": "CVE-2025-71286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71286"
},
{
"name": "CVE-2026-46090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46090"
},
{
"name": "CVE-2026-22990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22990"
},
{
"name": "CVE-2026-23000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23000"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2025-71186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71186"
},
{
"name": "CVE-2026-47336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47336"
},
{
"name": "CVE-2026-23176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23176"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-23026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23026"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-23128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23128"
},
{
"name": "CVE-2026-46300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46300"
},
{
"name": "CVE-2026-43271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43271"
},
{
"name": "CVE-2025-71190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71190"
},
{
"name": "CVE-2026-23140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23140"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2026-46026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46026"
},
{
"name": "CVE-2026-43258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43258"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-23107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23107"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-43304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43304"
},
{
"name": "CVE-2026-45886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45886"
},
{
"name": "CVE-2026-22978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22978"
},
{
"name": "CVE-2026-43378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43378"
},
{
"name": "CVE-2026-43384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43384"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23146"
},
{
"name": "CVE-2026-43501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43501"
},
{
"name": "CVE-2026-45998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45998"
},
{
"name": "CVE-2026-23037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23037"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2026-23001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23001"
},
{
"name": "CVE-2025-71224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71224"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2026-23193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23193"
},
{
"name": "CVE-2026-31610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31610"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-46008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46008"
},
{
"name": "CVE-2026-23215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23215"
},
{
"name": "CVE-2026-43238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43238"
},
{
"name": "CVE-2026-31592",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31592"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-45991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45991"
},
{
"name": "CVE-2026-23025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23025"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-31712",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31712"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-31707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31707"
},
{
"name": "CVE-2026-23151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23151"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-45880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45880"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-46067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46067"
},
{
"name": "CVE-2026-43349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43349"
},
{
"name": "CVE-2026-22982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22982"
},
{
"name": "CVE-2026-46290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46290"
},
{
"name": "CVE-2026-23205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23205"
},
{
"name": "CVE-2026-46036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46036"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-46279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46279"
},
{
"name": "CVE-2026-46135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46135"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-45990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45990"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2025-71222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71222"
},
{
"name": "CVE-2026-31504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31504"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-45895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45895"
},
{
"name": "CVE-2026-46075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46075"
},
{
"name": "CVE-2026-23142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23142"
},
{
"name": "CVE-2025-71229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71229"
},
{
"name": "CVE-2026-23213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23213"
},
{
"name": "CVE-2026-31607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31607"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-23091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23091"
},
{
"name": "CVE-2026-46054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46054"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-45877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45877"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-46282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46282"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2025-71192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71192"
},
{
"name": "CVE-2026-47327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47327"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-23121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23121"
},
{
"name": "CVE-2026-31637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31637"
},
{
"name": "CVE-2026-31612",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31612"
},
{
"name": "CVE-2026-23428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23428"
},
{
"name": "CVE-2026-23274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23274"
},
{
"name": "CVE-2026-43199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43199"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-46073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46073"
},
{
"name": "CVE-2026-31621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31621"
},
{
"name": "CVE-2025-71297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71297"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2026-47326",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47326"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-31604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31604"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2026-23144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23144"
},
{
"name": "CVE-2026-23087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23087"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-31584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31584"
},
{
"name": "CVE-2026-31419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31419"
},
{
"name": "CVE-2025-71185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71185"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-43221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43221"
},
{
"name": "CVE-2025-71268",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71268"
},
{
"name": "CVE-2026-46281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46281"
},
{
"name": "CVE-2026-23096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23096"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2025-68351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68351"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-31717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31717"
},
{
"name": "CVE-2026-43300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43300"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-43189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43189"
},
{
"name": "CVE-2025-40149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40149"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-23164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23164"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-46035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46035"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-31715",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31715"
},
{
"name": "CVE-2026-23278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23278"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-23124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23124"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-23257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23257"
},
{
"name": "CVE-2025-71160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71160"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2024-58096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58096"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2025-71162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71162"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-23075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23075"
},
{
"name": "CVE-2026-23120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23120"
},
{
"name": "CVE-2026-43222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43222"
},
{
"name": "CVE-2025-68803",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68803"
},
{
"name": "CVE-2026-22996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22996"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-46016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46016"
},
{
"name": "CVE-2026-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47337"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-23168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23168"
},
{
"name": "CVE-2024-50004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50004"
},
{
"name": "CVE-2026-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46316"
},
{
"name": "CVE-2026-23105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23105"
},
{
"name": "CVE-2026-31682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31682"
},
{
"name": "CVE-2026-22976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22976"
},
{
"name": "CVE-2026-46068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46068"
},
{
"name": "CVE-2026-43406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43406"
},
{
"name": "CVE-2026-45893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45893"
},
{
"name": "CVE-2026-46056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46056"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2026-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23141"
},
{
"name": "CVE-2026-23065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23065"
},
{
"name": "CVE-2026-23182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23182"
},
{
"name": "CVE-2026-31709",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31709"
},
{
"name": "CVE-2026-43215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43215"
},
{
"name": "CVE-2026-23086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23086"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-52904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52904"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-46086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46086"
},
{
"name": "CVE-2025-71273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71273"
},
{
"name": "CVE-2025-71291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71291"
},
{
"name": "CVE-2026-46094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46094"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-23455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23455"
},
{
"name": "CVE-2026-23233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23233"
},
{
"name": "CVE-2026-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53174"
},
{
"name": "CVE-2026-23261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23261"
},
{
"name": "CVE-2026-43341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43341"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-43239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43239"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-23156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23156"
},
{
"name": "CVE-2026-46060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46060"
},
{
"name": "CVE-2025-71193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71193"
},
{
"name": "CVE-2026-23095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23095"
},
{
"name": "CVE-2026-45882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45882"
},
{
"name": "CVE-2026-46084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46084"
},
{
"name": "CVE-2026-46079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46079"
},
{
"name": "CVE-2025-71163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71163"
},
{
"name": "CVE-2026-23062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23062"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23160"
},
{
"name": "CVE-2026-46333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46333"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-43071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43071"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-46085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46085"
},
{
"name": "CVE-2026-22984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22984"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47333"
},
{
"name": "CVE-2026-46029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46029"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2026-45898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45898"
},
{
"name": "CVE-2026-23206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23206"
},
{
"name": "CVE-2024-58097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58097"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-46021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46021"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-23033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23033"
},
{
"name": "CVE-2026-31676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31676"
},
{
"name": "CVE-2026-43318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43318"
},
{
"name": "CVE-2026-22977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22977"
},
{
"name": "CVE-2026-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23145"
},
{
"name": "CVE-2026-43186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43186"
},
{
"name": "CVE-2026-43083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43083"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-23003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23003"
},
{
"name": "CVE-2026-31649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31649"
},
{
"name": "CVE-2026-31719",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31719"
},
{
"name": "CVE-2026-23076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23076"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2025-68823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68823"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43256"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-23394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23394"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-23010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23010"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-23272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23272"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-45872",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45872"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-31575",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31575"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-31589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31589"
},
{
"name": "CVE-2026-23084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23084"
},
{
"name": "CVE-2026-23190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23190"
},
{
"name": "CVE-2026-22979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22979"
},
{
"name": "CVE-2026-43114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43114"
},
{
"name": "CVE-2026-31702",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31702"
},
{
"name": "CVE-2026-23011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23011"
},
{
"name": "CVE-2026-31587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31587"
},
{
"name": "CVE-2026-43278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43278"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52906"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-31708",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31708"
},
{
"name": "CVE-2026-23110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23110"
},
{
"name": "CVE-2026-46093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46093"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2026-31657",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31657"
},
{
"name": "CVE-2026-43125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43125"
},
{
"name": "CVE-2026-46025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46025"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-46246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46246"
},
{
"name": "CVE-2026-46003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46003"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2026-45921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45921"
},
{
"name": "CVE-2026-23148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23148"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-43169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43169"
},
{
"name": "CVE-2025-71197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71197"
},
{
"name": "CVE-2026-43175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43175"
},
{
"name": "CVE-2026-43320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43320"
},
{
"name": "CVE-2026-23031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23031"
},
{
"name": "CVE-2026-52907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52907"
},
{
"name": "CVE-2026-23102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23102"
},
{
"name": "CVE-2026-22998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22998"
},
{
"name": "CVE-2026-23050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23050"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-46096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46096"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-45849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45849"
},
{
"name": "CVE-2026-31706",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31706"
},
{
"name": "CVE-2026-31436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31436"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-43214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43214"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2025-71272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71272"
},
{
"name": "CVE-2026-23113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23113"
},
{
"name": "CVE-2025-71231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71231"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-46251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46251"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-23097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23097"
},
{
"name": "CVE-2026-31700",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31700"
},
{
"name": "CVE-2026-43212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43212"
},
{
"name": "CVE-2026-46089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46089"
},
{
"name": "CVE-2025-71198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71198"
},
{
"name": "CVE-2026-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52933"
},
{
"name": "CVE-2026-43128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43128"
},
{
"name": "CVE-2026-23021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23021"
},
{
"name": "CVE-2026-43250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43250"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-23093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23093"
},
{
"name": "CVE-2026-46028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46028"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2025-71183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71183"
},
{
"name": "CVE-2026-23249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23249"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-31710",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31710"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-43072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43072"
},
{
"name": "CVE-2026-23053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23053"
},
{
"name": "CVE-2026-46014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46014"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2025-71184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71184"
},
{
"name": "CVE-2026-46052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46052"
},
{
"name": "CVE-2026-46061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46061"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2025-71305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71305"
},
{
"name": "CVE-2026-43297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43297"
},
{
"name": "CVE-2025-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68263"
},
{
"name": "CVE-2026-45938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45938"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-43157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43157"
},
{
"name": "CVE-2026-45947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45947"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-46284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46284"
},
{
"name": "CVE-2026-46039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46039"
},
{
"name": "CVE-2026-46155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46155"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-31579",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31579"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-46048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46048"
},
{
"name": "CVE-2026-43137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43137"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-46254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46254"
},
{
"name": "CVE-2026-23080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23080"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-23351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23351"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-23254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23254"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-46058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46058"
},
{
"name": "CVE-2026-43494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43494"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
}
],
"initial_release_date": "2026-07-03T00:00:00",
"last_revision_date": "2026-07-03T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0831",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-07-03T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8491-1",
"url": "https://ubuntu.com/security/notices/USN-8491-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8497-1",
"url": "https://ubuntu.com/security/notices/USN-8497-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8499-1",
"url": "https://ubuntu.com/security/notices/USN-8499-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8493-2",
"url": "https://ubuntu.com/security/notices/USN-8493-2"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8488-1",
"url": "https://ubuntu.com/security/notices/USN-8488-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-2",
"url": "https://ubuntu.com/security/notices/USN-8492-2"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8498-1",
"url": "https://ubuntu.com/security/notices/USN-8498-1"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8489-1",
"url": "https://ubuntu.com/security/notices/USN-8489-1"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-1",
"url": "https://ubuntu.com/security/notices/USN-8492-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8488-2",
"url": "https://ubuntu.com/security/notices/USN-8488-2"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8493-1",
"url": "https://ubuntu.com/security/notices/USN-8493-1"
},
{
"published_at": "2026-07-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8490-1",
"url": "https://ubuntu.com/security/notices/USN-8490-1"
},
{
"published_at": "2026-07-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8501-1",
"url": "https://ubuntu.com/security/notices/USN-8501-1"
}
]
}
CERTFR-2026-AVI-0861
Vulnerability from certfr_avis - Published: 2026-07-10 - Updated: 2026-07-10
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 25.10",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-46325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46325"
},
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-23198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23198"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-43078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43078"
},
{
"name": "CVE-2026-31713",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31713"
},
{
"name": "CVE-2026-23202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23202"
},
{
"name": "CVE-2026-45905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45905"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-43414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43414"
},
{
"name": "CVE-2026-46010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46010"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2026-31582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31582"
},
{
"name": "CVE-2026-46045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46045"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2025-71134",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71134"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2026-46081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46081"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-45884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45884"
},
{
"name": "CVE-2026-46087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46087"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-46255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46255"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2021-47202",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47202"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-31402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31402"
},
{
"name": "CVE-2026-46042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46042"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-43317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43317"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2026-46076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46076"
},
{
"name": "CVE-2026-23450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23450"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2026-31704",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31704"
},
{
"name": "CVE-2026-31685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31685"
},
{
"name": "CVE-2026-43073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43073"
},
{
"name": "CVE-2026-43143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43143"
},
{
"name": "CVE-2026-46013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46013"
},
{
"name": "CVE-2026-46065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46065"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2026-31593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31593"
},
{
"name": "CVE-2026-46007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46007"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-45923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45923"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-45910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45910"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-31600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31600"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-45928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45928"
},
{
"name": "CVE-2026-45988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45988"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-46063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46063"
},
{
"name": "CVE-2026-46280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46280"
},
{
"name": "CVE-2026-43011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43011"
},
{
"name": "CVE-2026-43167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43167"
},
{
"name": "CVE-2026-45976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45976"
},
{
"name": "CVE-2026-43248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43248"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-46287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46287"
},
{
"name": "CVE-2025-71088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71088"
},
{
"name": "CVE-2026-31613",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31613"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-46032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46032"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2026-31574",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31574"
},
{
"name": "CVE-2026-46057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46057"
},
{
"name": "CVE-2026-23258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23258"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2026-43284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43284"
},
{
"name": "CVE-2026-45995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45995"
},
{
"name": "CVE-2026-46034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46034"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-45996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45996"
},
{
"name": "CVE-2026-46286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46286"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-43244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43244"
},
{
"name": "CVE-2026-31711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31711"
},
{
"name": "CVE-2026-31611",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31611"
},
{
"name": "CVE-2026-43201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43201"
},
{
"name": "CVE-2024-56643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56643"
},
{
"name": "CVE-2026-31714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31714"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-46260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46260"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-31431",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31431"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-43319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43319"
},
{
"name": "CVE-2026-46092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46092"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2026-31614",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31614"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2025-71090",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71090"
},
{
"name": "CVE-2026-46001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46001"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-46071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46071"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-45851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45851"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-31478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31478"
},
{
"name": "CVE-2025-71142",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71142"
},
{
"name": "CVE-2026-45859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45859"
},
{
"name": "CVE-2026-46066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46066"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-43153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43153"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-45917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45917"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-46031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46031"
},
{
"name": "CVE-2026-46277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46277"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-45865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45865"
},
{
"name": "CVE-2026-31635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31635"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-43033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43033"
},
{
"name": "CVE-2026-46265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46265"
},
{
"name": "CVE-2026-45972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45972"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-46074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46074"
},
{
"name": "CVE-2026-31595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31595"
},
{
"name": "CVE-2026-46332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46332"
},
{
"name": "CVE-2026-43503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43503"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-45989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45989"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2025-71144",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71144"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-45881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45881"
},
{
"name": "CVE-2026-43350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43350"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2026-43376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43376"
},
{
"name": "CVE-2026-23256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23256"
},
{
"name": "CVE-2026-46261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46261"
},
{
"name": "CVE-2026-31659",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31659"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2026-45861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45861"
},
{
"name": "CVE-2026-31591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31591"
},
{
"name": "CVE-2026-46041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46041"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2026-43117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43117"
},
{
"name": "CVE-2026-46083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46083"
},
{
"name": "CVE-2026-45914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45914"
},
{
"name": "CVE-2026-43493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43493"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-43383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43383"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-43500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43500"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-31703",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31703"
},
{
"name": "CVE-2026-46097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46097"
},
{
"name": "CVE-2026-23273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23273"
},
{
"name": "CVE-2026-23230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23230"
},
{
"name": "CVE-2026-46030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46030"
},
{
"name": "CVE-2026-43170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43170"
},
{
"name": "CVE-2026-31693",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31693"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-43150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43150"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45913"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-46005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46005"
},
{
"name": "CVE-2026-45962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45962"
},
{
"name": "CVE-2026-31718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31718"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-46247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46247"
},
{
"name": "CVE-2026-46069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46069"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2026-46288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46288"
},
{
"name": "CVE-2026-43288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43288"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2025-71294",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71294"
},
{
"name": "CVE-2026-31609",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31609"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-31533",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31533"
},
{
"name": "CVE-2026-46059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46059"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-46103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46103"
},
{
"name": "CVE-2026-43348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43348"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-46043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46043"
},
{
"name": "CVE-2026-31601",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31601"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-31418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31418"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-45981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45981"
},
{
"name": "CVE-2026-31620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31620"
},
{
"name": "CVE-2026-43197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43197"
},
{
"name": "CVE-2026-46278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46278"
},
{
"name": "CVE-2026-46011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46011"
},
{
"name": "CVE-2026-46095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46095"
},
{
"name": "CVE-2026-43253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43253"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2025-71220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71220"
},
{
"name": "CVE-2025-71295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71295"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-43491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43491"
},
{
"name": "CVE-2026-46100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46100"
},
{
"name": "CVE-2026-46012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46012"
},
{
"name": "CVE-2026-31606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31606"
},
{
"name": "CVE-2026-23180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23180"
},
{
"name": "CVE-2026-45999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45999"
},
{
"name": "CVE-2026-45973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45973"
},
{
"name": "CVE-2026-43249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43249"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2026-31705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31705"
},
{
"name": "CVE-2026-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52905"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-45966",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45966"
},
{
"name": "CVE-2026-23262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23262"
},
{
"name": "CVE-2026-46038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46038"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-45878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45878"
},
{
"name": "CVE-2026-23267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23267"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-45982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45982"
},
{
"name": "CVE-2026-31669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31669"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-23216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23216"
},
{
"name": "CVE-2026-46276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46276"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-31608",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31608"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-43173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43173"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-43077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43077"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-46283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46283"
},
{
"name": "CVE-2026-45957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45957"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-23427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23427"
},
{
"name": "CVE-2026-46020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46020"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2026-45997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45997"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-43402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43402"
},
{
"name": "CVE-2025-71286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71286"
},
{
"name": "CVE-2026-46090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46090"
},
{
"name": "CVE-2026-23176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23176"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-46300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46300"
},
{
"name": "CVE-2026-43271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43271"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2026-46026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46026"
},
{
"name": "CVE-2026-43258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43258"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-43304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43304"
},
{
"name": "CVE-2026-45886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45886"
},
{
"name": "CVE-2026-43378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43378"
},
{
"name": "CVE-2026-43384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43384"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2025-71141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71141"
},
{
"name": "CVE-2026-43501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43501"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2025-71224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71224"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2026-23193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23193"
},
{
"name": "CVE-2026-31610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31610"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-46008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46008"
},
{
"name": "CVE-2026-43238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43238"
},
{
"name": "CVE-2026-31592",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31592"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-45991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45991"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-31712",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31712"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-31707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31707"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-45880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45880"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-46067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46067"
},
{
"name": "CVE-2026-43349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43349"
},
{
"name": "CVE-2026-46036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46036"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-46279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46279"
},
{
"name": "CVE-2026-46135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46135"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-45990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45990"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2025-71222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71222"
},
{
"name": "CVE-2026-31504",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31504"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-45895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45895"
},
{
"name": "CVE-2026-46075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46075"
},
{
"name": "CVE-2025-71229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71229"
},
{
"name": "CVE-2026-31607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31607"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-46054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46054"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-45877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45877"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-46282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46282"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-31637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31637"
},
{
"name": "CVE-2026-31612",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31612"
},
{
"name": "CVE-2026-23428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23428"
},
{
"name": "CVE-2026-23274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23274"
},
{
"name": "CVE-2026-43199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43199"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-46073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46073"
},
{
"name": "CVE-2026-31621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31621"
},
{
"name": "CVE-2025-71297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71297"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-31604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31604"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2025-71152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71152"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-31584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31584"
},
{
"name": "CVE-2026-31419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31419"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-43221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43221"
},
{
"name": "CVE-2026-46281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46281"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-31717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31717"
},
{
"name": "CVE-2026-43300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43300"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-43189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43189"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-46035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46035"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-31715",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31715"
},
{
"name": "CVE-2026-23278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23278"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-23257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23257"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-43222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43222"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-46016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46016"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46316"
},
{
"name": "CVE-2026-31682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31682"
},
{
"name": "CVE-2026-46068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46068"
},
{
"name": "CVE-2026-43406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43406"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2026-45893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45893"
},
{
"name": "CVE-2026-46056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46056"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2026-23182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23182"
},
{
"name": "CVE-2026-31709",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31709"
},
{
"name": "CVE-2026-43215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43215"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-52904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52904"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-46086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46086"
},
{
"name": "CVE-2025-71273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71273"
},
{
"name": "CVE-2025-71291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71291"
},
{
"name": "CVE-2026-46094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46094"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-23455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23455"
},
{
"name": "CVE-2026-23233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23233"
},
{
"name": "CVE-2026-43341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43341"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-43239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43239"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-46060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46060"
},
{
"name": "CVE-2026-45882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45882"
},
{
"name": "CVE-2026-46084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46084"
},
{
"name": "CVE-2026-46079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46079"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-46333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46333"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-43071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43071"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-46085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46085"
},
{
"name": "CVE-2025-71155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71155"
},
{
"name": "CVE-2026-22984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22984"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-46029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46029"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2026-45898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45898"
},
{
"name": "CVE-2026-23206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23206"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-46021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46021"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-43318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43318"
},
{
"name": "CVE-2026-43186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43186"
},
{
"name": "CVE-2026-43083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43083"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-31649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31649"
},
{
"name": "CVE-2026-31719",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31719"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43256"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-23394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23394"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-23272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23272"
},
{
"name": "CVE-2026-23112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23112"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-45872",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45872"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-31575",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31575"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-31589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31589"
},
{
"name": "CVE-2026-23190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23190"
},
{
"name": "CVE-2026-43114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43114"
},
{
"name": "CVE-2026-31702",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31702"
},
{
"name": "CVE-2026-31587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31587"
},
{
"name": "CVE-2026-43278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43278"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52906"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-31708",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31708"
},
{
"name": "CVE-2026-46093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46093"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2026-31657",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31657"
},
{
"name": "CVE-2026-43125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43125"
},
{
"name": "CVE-2026-46025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46025"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-46246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46246"
},
{
"name": "CVE-2026-46003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46003"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2026-45921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45921"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-43169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43169"
},
{
"name": "CVE-2026-43175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43175"
},
{
"name": "CVE-2026-43320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43320"
},
{
"name": "CVE-2025-71127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71127"
},
{
"name": "CVE-2026-52907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52907"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-46096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46096"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-45849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45849"
},
{
"name": "CVE-2026-31706",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31706"
},
{
"name": "CVE-2026-31436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31436"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-43214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43214"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2025-71272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71272"
},
{
"name": "CVE-2025-71231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71231"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-46251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46251"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-31700",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31700"
},
{
"name": "CVE-2026-43212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43212"
},
{
"name": "CVE-2026-46089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46089"
},
{
"name": "CVE-2026-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52933"
},
{
"name": "CVE-2026-43128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43128"
},
{
"name": "CVE-2026-23231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23231"
},
{
"name": "CVE-2026-43250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43250"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-46028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46028"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2026-23249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23249"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-31710",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31710"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-43072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43072"
},
{
"name": "CVE-2026-46014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46014"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2026-46052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46052"
},
{
"name": "CVE-2026-46061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46061"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2025-71305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71305"
},
{
"name": "CVE-2026-43297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43297"
},
{
"name": "CVE-2025-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68263"
},
{
"name": "CVE-2026-45938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45938"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-43157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43157"
},
{
"name": "CVE-2026-45947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45947"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-46284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46284"
},
{
"name": "CVE-2026-46039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46039"
},
{
"name": "CVE-2026-46155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46155"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-31579",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31579"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-43137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43137"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-46254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46254"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-23351",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23351"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-46058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46058"
},
{
"name": "CVE-2026-43494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43494"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
}
],
"initial_release_date": "2026-07-10T00:00:00",
"last_revision_date": "2026-07-10T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0861",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-07-10T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8527-1",
"url": "https://ubuntu.com/security/notices/USN-8527-1"
},
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8528-1",
"url": "https://ubuntu.com/security/notices/USN-8528-1"
},
{
"published_at": "2026-07-06",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8507-1",
"url": "https://ubuntu.com/security/notices/USN-8507-1"
},
{
"published_at": "2026-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8490-2",
"url": "https://ubuntu.com/security/notices/USN-8490-2"
},
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8530-1",
"url": "https://ubuntu.com/security/notices/USN-8530-1"
},
{
"published_at": "2026-07-06",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8508-1",
"url": "https://ubuntu.com/security/notices/USN-8508-1"
},
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8529-1",
"url": "https://ubuntu.com/security/notices/USN-8529-1"
},
{
"published_at": "2026-07-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-4",
"url": "https://ubuntu.com/security/notices/USN-8492-4"
},
{
"published_at": "2026-07-10",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-5",
"url": "https://ubuntu.com/security/notices/USN-8492-5"
},
{
"published_at": "2026-07-06",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8492-3",
"url": "https://ubuntu.com/security/notices/USN-8492-3"
}
]
}
CERTFR-2026-AVI-0954
Vulnerability from certfr_avis - Published: 2026-07-31 - Updated: 2026-07-31
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 26.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2025-40103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40103"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2024-46715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46715"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2025-21709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21709"
},
{
"name": "CVE-2025-62626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62626"
},
{
"name": "CVE-2025-40323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40323"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2023-45896",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45896"
},
{
"name": "CVE-2024-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47809"
},
{
"name": "CVE-2024-56557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56557"
},
{
"name": "CVE-2024-56584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56584"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2024-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53221"
},
{
"name": "CVE-2024-56657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56657"
},
{
"name": "CVE-2024-56719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56719"
},
{
"name": "CVE-2025-21739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21739"
},
{
"name": "CVE-2025-21712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21712"
},
{
"name": "CVE-2025-21863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21863"
},
{
"name": "CVE-2025-22107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22107"
},
{
"name": "CVE-2025-22116",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22116"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2022-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50073"
},
{
"name": "CVE-2022-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50116"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2025-38105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38105"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2025-38426",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38426"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2025-40135",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40135"
},
{
"name": "CVE-2025-68214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68214"
},
{
"name": "CVE-2025-68307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68307"
},
{
"name": "CVE-2025-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68206"
},
{
"name": "CVE-2025-68239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68239"
},
{
"name": "CVE-2025-68256",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68256"
},
{
"name": "CVE-2025-68736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68736"
},
{
"name": "CVE-2025-40150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40150"
},
{
"name": "CVE-2025-68175",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68175"
},
{
"name": "CVE-2025-68263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68263"
},
{
"name": "CVE-2025-68358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68358"
},
{
"name": "CVE-2026-22985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22985"
},
{
"name": "CVE-2025-71089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71089"
},
{
"name": "CVE-2025-71150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71150"
},
{
"name": "CVE-2025-71160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71160"
},
{
"name": "CVE-2025-71162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71162"
},
{
"name": "CVE-2025-71163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71163"
},
{
"name": "CVE-2025-71180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71180"
},
{
"name": "CVE-2025-71182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71182"
},
{
"name": "CVE-2025-71183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71183"
},
{
"name": "CVE-2025-71184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71184"
},
{
"name": "CVE-2025-71185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71185"
},
{
"name": "CVE-2025-71186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71186"
},
{
"name": "CVE-2025-71189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71189"
},
{
"name": "CVE-2025-71190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71190"
},
{
"name": "CVE-2025-71191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71191"
},
{
"name": "CVE-2025-71192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71192"
},
{
"name": "CVE-2025-71193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71193"
},
{
"name": "CVE-2025-71194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71194"
},
{
"name": "CVE-2025-71195",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71195"
},
{
"name": "CVE-2025-71196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71196"
},
{
"name": "CVE-2025-71197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71197"
},
{
"name": "CVE-2025-71198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71198"
},
{
"name": "CVE-2025-71199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71199"
},
{
"name": "CVE-2026-22976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22976"
},
{
"name": "CVE-2026-22977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22977"
},
{
"name": "CVE-2026-22978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22978"
},
{
"name": "CVE-2026-22979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22979"
},
{
"name": "CVE-2026-22980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22980"
},
{
"name": "CVE-2026-22982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22982"
},
{
"name": "CVE-2026-22984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22984"
},
{
"name": "CVE-2026-22989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22989"
},
{
"name": "CVE-2026-22990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22990"
},
{
"name": "CVE-2026-22991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22991"
},
{
"name": "CVE-2026-22992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22992"
},
{
"name": "CVE-2026-22994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22994"
},
{
"name": "CVE-2026-22996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22996"
},
{
"name": "CVE-2026-22997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22997"
},
{
"name": "CVE-2026-22998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22998"
},
{
"name": "CVE-2026-22999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22999"
},
{
"name": "CVE-2026-23000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23000"
},
{
"name": "CVE-2026-23001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23001"
},
{
"name": "CVE-2026-23002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23002"
},
{
"name": "CVE-2026-23003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23003"
},
{
"name": "CVE-2026-23005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23005"
},
{
"name": "CVE-2026-23006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23006"
},
{
"name": "CVE-2026-23010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23010"
},
{
"name": "CVE-2026-23011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23011"
},
{
"name": "CVE-2026-23013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23013"
},
{
"name": "CVE-2026-23019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23019"
},
{
"name": "CVE-2026-23020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23020"
},
{
"name": "CVE-2026-23021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23021"
},
{
"name": "CVE-2026-23023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23023"
},
{
"name": "CVE-2026-23025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23025"
},
{
"name": "CVE-2026-23026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23026"
},
{
"name": "CVE-2026-23030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23030"
},
{
"name": "CVE-2026-23031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23031"
},
{
"name": "CVE-2026-23032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23032"
},
{
"name": "CVE-2026-23033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23033"
},
{
"name": "CVE-2026-23035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23035"
},
{
"name": "CVE-2026-23037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23037"
},
{
"name": "CVE-2026-23038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23038"
},
{
"name": "CVE-2026-23047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23047"
},
{
"name": "CVE-2026-23049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23049"
},
{
"name": "CVE-2026-23050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23050"
},
{
"name": "CVE-2026-23053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23053"
},
{
"name": "CVE-2026-23054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23054"
},
{
"name": "CVE-2026-23055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23055"
},
{
"name": "CVE-2026-23056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23056"
},
{
"name": "CVE-2026-23057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23057"
},
{
"name": "CVE-2026-23058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23058"
},
{
"name": "CVE-2026-23059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23059"
},
{
"name": "CVE-2026-23061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23061"
},
{
"name": "CVE-2026-23062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23062"
},
{
"name": "CVE-2026-23063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23063"
},
{
"name": "CVE-2026-23064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23064"
},
{
"name": "CVE-2026-23065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23065"
},
{
"name": "CVE-2026-23068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23068"
},
{
"name": "CVE-2026-23069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23069"
},
{
"name": "CVE-2026-23071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23071"
},
{
"name": "CVE-2026-23072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23072"
},
{
"name": "CVE-2026-23073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23073"
},
{
"name": "CVE-2026-23075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23075"
},
{
"name": "CVE-2026-23076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23076"
},
{
"name": "CVE-2026-23078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23078"
},
{
"name": "CVE-2026-23080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23080"
},
{
"name": "CVE-2026-23083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23083"
},
{
"name": "CVE-2026-23084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23084"
},
{
"name": "CVE-2026-23085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23085"
},
{
"name": "CVE-2026-23086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23086"
},
{
"name": "CVE-2026-23087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23087"
},
{
"name": "CVE-2026-23088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23088"
},
{
"name": "CVE-2026-23089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23089"
},
{
"name": "CVE-2026-23090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23090"
},
{
"name": "CVE-2026-23093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23093"
},
{
"name": "CVE-2026-23094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23094"
},
{
"name": "CVE-2026-23095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23095"
},
{
"name": "CVE-2026-23096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23096"
},
{
"name": "CVE-2026-23097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23097"
},
{
"name": "CVE-2026-23098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23098"
},
{
"name": "CVE-2026-23099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23099"
},
{
"name": "CVE-2026-23101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23101"
},
{
"name": "CVE-2026-23102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23102"
},
{
"name": "CVE-2026-23103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23103"
},
{
"name": "CVE-2026-23105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23105"
},
{
"name": "CVE-2026-23107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23107"
},
{
"name": "CVE-2026-23108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23108"
},
{
"name": "CVE-2026-23110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23110"
},
{
"name": "CVE-2026-22993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22993"
},
{
"name": "CVE-2025-71203",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71203"
},
{
"name": "CVE-2025-71220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71220"
},
{
"name": "CVE-2025-71222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71222"
},
{
"name": "CVE-2025-71224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71224"
},
{
"name": "CVE-2025-71229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71229"
},
{
"name": "CVE-2025-71231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71231"
},
{
"name": "CVE-2025-71232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71232"
},
{
"name": "CVE-2025-71233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71233"
},
{
"name": "CVE-2025-71235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71235"
},
{
"name": "CVE-2025-71236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71236"
},
{
"name": "CVE-2025-71237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71237"
},
{
"name": "CVE-2026-23169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23169"
},
{
"name": "CVE-2026-23176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23176"
},
{
"name": "CVE-2026-23180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23180"
},
{
"name": "CVE-2026-23182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23182"
},
{
"name": "CVE-2026-23190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23190"
},
{
"name": "CVE-2026-23193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23193"
},
{
"name": "CVE-2026-23198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23198"
},
{
"name": "CVE-2026-23202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23202"
},
{
"name": "CVE-2026-23204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23204"
},
{
"name": "CVE-2026-23206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23206"
},
{
"name": "CVE-2026-23216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23216"
},
{
"name": "CVE-2026-23220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23220"
},
{
"name": "CVE-2026-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23222"
},
{
"name": "CVE-2026-23228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23228"
},
{
"name": "CVE-2026-23229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23229"
},
{
"name": "CVE-2026-23230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23230"
},
{
"name": "CVE-2026-23212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23212"
},
{
"name": "CVE-2026-22981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22981"
},
{
"name": "CVE-2026-22986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22986"
},
{
"name": "CVE-2025-71238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71238"
},
{
"name": "CVE-2026-23100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23100"
},
{
"name": "CVE-2026-23221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23221"
},
{
"name": "CVE-2026-23233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23233"
},
{
"name": "CVE-2026-23234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23234"
},
{
"name": "CVE-2026-23235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23235"
},
{
"name": "CVE-2026-23236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23236"
},
{
"name": "CVE-2026-23237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23237"
},
{
"name": "CVE-2026-23238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23238"
},
{
"name": "CVE-2022-49803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49803"
},
{
"name": "CVE-2022-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49961"
},
{
"name": "CVE-2022-50552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50552"
},
{
"name": "CVE-2023-52682",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52682"
},
{
"name": "CVE-2023-53629",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53629"
},
{
"name": "CVE-2025-68334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68334"
},
{
"name": "CVE-2025-71152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71152"
},
{
"name": "CVE-2025-71158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71158"
},
{
"name": "CVE-2025-71161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71161"
},
{
"name": "CVE-2025-71188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71188"
},
{
"name": "CVE-2025-71221",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71221"
},
{
"name": "CVE-2026-23004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23004"
},
{
"name": "CVE-2026-23066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23066"
},
{
"name": "CVE-2026-23113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23113"
},
{
"name": "CVE-2026-23118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23118"
},
{
"name": "CVE-2026-23119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23119"
},
{
"name": "CVE-2026-23120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23120"
},
{
"name": "CVE-2026-23121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23121"
},
{
"name": "CVE-2026-23124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23124"
},
{
"name": "CVE-2026-23125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23125"
},
{
"name": "CVE-2026-23126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23126"
},
{
"name": "CVE-2026-23128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23128"
},
{
"name": "CVE-2026-23133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23133"
},
{
"name": "CVE-2026-23137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23137"
},
{
"name": "CVE-2026-23138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23138"
},
{
"name": "CVE-2026-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23141"
},
{
"name": "CVE-2026-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23145"
},
{
"name": "CVE-2026-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23146"
},
{
"name": "CVE-2026-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23150"
},
{
"name": "CVE-2026-23154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23154"
},
{
"name": "CVE-2026-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23157"
},
{
"name": "CVE-2026-23164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23164"
},
{
"name": "CVE-2026-23167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23167"
},
{
"name": "CVE-2026-23170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23170"
},
{
"name": "CVE-2026-23171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23171"
},
{
"name": "CVE-2026-23207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23207"
},
{
"name": "CVE-2026-23226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23226"
},
{
"name": "CVE-2026-23227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23227"
},
{
"name": "CVE-2025-71200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71200"
},
{
"name": "CVE-2026-23017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23017"
},
{
"name": "CVE-2026-23104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23104"
},
{
"name": "CVE-2026-23116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23116"
},
{
"name": "CVE-2026-23129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23129"
},
{
"name": "CVE-2026-23135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23135"
},
{
"name": "CVE-2026-23139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23139"
},
{
"name": "CVE-2026-23151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23151"
},
{
"name": "CVE-2026-23152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23152"
},
{
"name": "CVE-2026-23156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23156"
},
{
"name": "CVE-2026-23163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23163"
},
{
"name": "CVE-2026-23166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23166"
},
{
"name": "CVE-2026-23172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23172"
},
{
"name": "CVE-2026-23173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23173"
},
{
"name": "CVE-2025-71239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71239"
},
{
"name": "CVE-2025-71265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71265"
},
{
"name": "CVE-2025-71266",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71266"
},
{
"name": "CVE-2025-71267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71267"
},
{
"name": "CVE-2026-23241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23241"
},
{
"name": "CVE-2026-23242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23242"
},
{
"name": "CVE-2026-23243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23243"
},
{
"name": "CVE-2026-23266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23266"
},
{
"name": "CVE-2026-23267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23267"
},
{
"name": "CVE-2026-31788",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31788"
},
{
"name": "CVE-2026-23070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23070"
},
{
"name": "CVE-2026-23131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23131"
},
{
"name": "CVE-2026-23244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23244"
},
{
"name": "CVE-2026-23245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23245"
},
{
"name": "CVE-2026-23246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23246"
},
{
"name": "CVE-2026-23253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23253"
},
{
"name": "CVE-2026-23271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23271"
},
{
"name": "CVE-2026-23277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23277"
},
{
"name": "CVE-2026-23279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23279"
},
{
"name": "CVE-2026-23281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23281"
},
{
"name": "CVE-2026-23284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23284"
},
{
"name": "CVE-2026-23285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23285"
},
{
"name": "CVE-2026-23286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23286"
},
{
"name": "CVE-2026-23289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23289"
},
{
"name": "CVE-2026-23290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23290"
},
{
"name": "CVE-2026-23291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23291"
},
{
"name": "CVE-2026-23292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23292"
},
{
"name": "CVE-2026-23293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23293"
},
{
"name": "CVE-2026-23296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23296"
},
{
"name": "CVE-2026-23298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23298"
},
{
"name": "CVE-2026-23300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23300"
},
{
"name": "CVE-2026-23303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23303"
},
{
"name": "CVE-2026-23304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23304"
},
{
"name": "CVE-2026-23306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23306"
},
{
"name": "CVE-2026-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23307"
},
{
"name": "CVE-2026-23310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23310"
},
{
"name": "CVE-2026-23312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23312"
},
{
"name": "CVE-2026-23315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23315"
},
{
"name": "CVE-2026-23317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23317"
},
{
"name": "CVE-2026-23318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23318"
},
{
"name": "CVE-2026-23319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23319"
},
{
"name": "CVE-2026-23324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23324"
},
{
"name": "CVE-2026-23334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23334"
},
{
"name": "CVE-2026-23336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23336"
},
{
"name": "CVE-2026-23340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23340"
},
{
"name": "CVE-2026-23343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23343"
},
{
"name": "CVE-2026-23347",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23347"
},
{
"name": "CVE-2026-23352",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23352"
},
{
"name": "CVE-2026-23356",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23356"
},
{
"name": "CVE-2026-23357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23357"
},
{
"name": "CVE-2026-23359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23359"
},
{
"name": "CVE-2026-23364",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23364"
},
{
"name": "CVE-2026-23365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23365"
},
{
"name": "CVE-2026-23367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23367"
},
{
"name": "CVE-2026-23368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23368"
},
{
"name": "CVE-2026-23370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23370"
},
{
"name": "CVE-2026-23379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23379"
},
{
"name": "CVE-2026-23381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23381"
},
{
"name": "CVE-2026-23382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23382"
},
{
"name": "CVE-2026-23388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23388"
},
{
"name": "CVE-2026-23391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23391"
},
{
"name": "CVE-2026-23392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23392"
},
{
"name": "CVE-2026-23395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23395"
},
{
"name": "CVE-2026-23396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23396"
},
{
"name": "CVE-2026-23397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23397"
},
{
"name": "CVE-2026-23398",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23398"
},
{
"name": "CVE-2026-31394",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31394"
},
{
"name": "CVE-2026-23144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23144"
},
{
"name": "CVE-2026-23272",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23272"
},
{
"name": "CVE-2025-54505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54505"
},
{
"name": "CVE-2026-31408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31408"
},
{
"name": "CVE-2026-31414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31414"
},
{
"name": "CVE-2026-31416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31416"
},
{
"name": "CVE-2026-31417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31417"
},
{
"name": "CVE-2026-31418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31418"
},
{
"name": "CVE-2026-31421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31421"
},
{
"name": "CVE-2026-31422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31422"
},
{
"name": "CVE-2026-31423",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31423"
},
{
"name": "CVE-2026-31424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31424"
},
{
"name": "CVE-2026-31426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31426"
},
{
"name": "CVE-2026-31427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31427"
},
{
"name": "CVE-2026-31428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31428"
},
{
"name": "CVE-2025-71269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71269"
},
{
"name": "CVE-2026-23136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23136"
},
{
"name": "CVE-2026-23140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23140"
},
{
"name": "CVE-2026-23255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23255"
},
{
"name": "CVE-2026-23262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23262"
},
{
"name": "CVE-2026-23270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23270"
},
{
"name": "CVE-2026-23278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23278"
},
{
"name": "CVE-2026-23335",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23335"
},
{
"name": "CVE-2026-23361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23361"
},
{
"name": "CVE-2026-23383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23383"
},
{
"name": "CVE-2026-23386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23386"
},
{
"name": "CVE-2026-23412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23412"
},
{
"name": "CVE-2026-23413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23413"
},
{
"name": "CVE-2026-23414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23414"
},
{
"name": "CVE-2026-23419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23419"
},
{
"name": "CVE-2026-31402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31402"
},
{
"name": "CVE-2026-23360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23360"
},
{
"name": "CVE-2026-31439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31439"
},
{
"name": "CVE-2026-31441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31441"
},
{
"name": "CVE-2026-31444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31444"
},
{
"name": "CVE-2026-31446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31446"
},
{
"name": "CVE-2026-31447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31447"
},
{
"name": "CVE-2026-31448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31448"
},
{
"name": "CVE-2026-31450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31450"
},
{
"name": "CVE-2026-31451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31451"
},
{
"name": "CVE-2026-31452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31452"
},
{
"name": "CVE-2026-31453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31453"
},
{
"name": "CVE-2026-31454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31454"
},
{
"name": "CVE-2026-31455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31455"
},
{
"name": "CVE-2026-31458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31458"
},
{
"name": "CVE-2026-31467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31467"
},
{
"name": "CVE-2026-31469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31469"
},
{
"name": "CVE-2026-31473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31473"
},
{
"name": "CVE-2026-31474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31474"
},
{
"name": "CVE-2026-31476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31476"
},
{
"name": "CVE-2026-31483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31483"
},
{
"name": "CVE-2026-31485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31485"
},
{
"name": "CVE-2026-31494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31494"
},
{
"name": "CVE-2026-31495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31495"
},
{
"name": "CVE-2026-31496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31496"
},
{
"name": "CVE-2026-31497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31497"
},
{
"name": "CVE-2026-31500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31500"
},
{
"name": "CVE-2026-31503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31503"
},
{
"name": "CVE-2026-31507",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31507"
},
{
"name": "CVE-2026-31509",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31509"
},
{
"name": "CVE-2026-31510",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31510"
},
{
"name": "CVE-2026-31515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31515"
},
{
"name": "CVE-2026-31518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31518"
},
{
"name": "CVE-2026-31519",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31519"
},
{
"name": "CVE-2026-31520",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31520"
},
{
"name": "CVE-2026-31521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31521"
},
{
"name": "CVE-2026-31522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31522"
},
{
"name": "CVE-2026-31523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31523"
},
{
"name": "CVE-2026-31524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31524"
},
{
"name": "CVE-2026-31525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31525"
},
{
"name": "CVE-2026-31528",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31528"
},
{
"name": "CVE-2026-31555",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31555"
},
{
"name": "CVE-2026-31563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31563"
},
{
"name": "CVE-2026-31565",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31565"
},
{
"name": "CVE-2026-31566",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31566"
},
{
"name": "CVE-2026-31570",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31570"
},
{
"name": "CVE-2026-31589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31589"
},
{
"name": "CVE-2026-31591",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31591"
},
{
"name": "CVE-2026-31593",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31593"
},
{
"name": "CVE-2026-31600",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31600"
},
{
"name": "CVE-2026-31601",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31601"
},
{
"name": "CVE-2026-31608",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31608"
},
{
"name": "CVE-2026-31609",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31609"
},
{
"name": "CVE-2026-31620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31620"
},
{
"name": "CVE-2026-31621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31621"
},
{
"name": "CVE-2026-31674",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31674"
},
{
"name": "CVE-2026-31675",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31675"
},
{
"name": "CVE-2026-31678",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31678"
},
{
"name": "CVE-2026-31679",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31679"
},
{
"name": "CVE-2026-31680",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31680"
},
{
"name": "CVE-2026-31682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31682"
},
{
"name": "CVE-2026-31430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31430"
},
{
"name": "CVE-2026-31508",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31508"
},
{
"name": "CVE-2026-31532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31532"
},
{
"name": "CVE-2026-31577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31577"
},
{
"name": "CVE-2026-31578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31578"
},
{
"name": "CVE-2026-31583",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31583"
},
{
"name": "CVE-2026-31585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31585"
},
{
"name": "CVE-2026-31586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31586"
},
{
"name": "CVE-2026-31587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31587"
},
{
"name": "CVE-2026-31588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31588"
},
{
"name": "CVE-2026-31590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31590"
},
{
"name": "CVE-2026-31594",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31594"
},
{
"name": "CVE-2026-31595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31595"
},
{
"name": "CVE-2026-31596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31596"
},
{
"name": "CVE-2026-31597",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31597"
},
{
"name": "CVE-2026-31599",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31599"
},
{
"name": "CVE-2026-31603",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31603"
},
{
"name": "CVE-2026-31604",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31604"
},
{
"name": "CVE-2026-31605",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31605"
},
{
"name": "CVE-2026-31607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31607"
},
{
"name": "CVE-2026-31610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31610"
},
{
"name": "CVE-2026-31611",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31611"
},
{
"name": "CVE-2026-31612",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31612"
},
{
"name": "CVE-2026-31615",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31615"
},
{
"name": "CVE-2026-31618",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31618"
},
{
"name": "CVE-2026-31619",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31619"
},
{
"name": "CVE-2026-31622",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31622"
},
{
"name": "CVE-2026-31623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31623"
},
{
"name": "CVE-2026-31624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31624"
},
{
"name": "CVE-2026-31625",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31625"
},
{
"name": "CVE-2026-31626",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31626"
},
{
"name": "CVE-2026-31627",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31627"
},
{
"name": "CVE-2026-31628",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31628"
},
{
"name": "CVE-2026-31629",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31629"
},
{
"name": "CVE-2026-31634",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31634"
},
{
"name": "CVE-2026-31637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31637"
},
{
"name": "CVE-2026-31638",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31638"
},
{
"name": "CVE-2026-31639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31639"
},
{
"name": "CVE-2026-31642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31642"
},
{
"name": "CVE-2026-31646",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31646"
},
{
"name": "CVE-2026-31648",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31648"
},
{
"name": "CVE-2026-31649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31649"
},
{
"name": "CVE-2026-31651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31651"
},
{
"name": "CVE-2026-31655",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31655"
},
{
"name": "CVE-2026-31656",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31656"
},
{
"name": "CVE-2026-31657",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31657"
},
{
"name": "CVE-2026-31658",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31658"
},
{
"name": "CVE-2026-31659",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31659"
},
{
"name": "CVE-2026-31660",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31660"
},
{
"name": "CVE-2026-31661",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31661"
},
{
"name": "CVE-2026-31662",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31662"
},
{
"name": "CVE-2026-31664",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31664"
},
{
"name": "CVE-2026-31665",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31665"
},
{
"name": "CVE-2026-31667",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31667"
},
{
"name": "CVE-2026-31668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31668"
},
{
"name": "CVE-2026-31669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31669"
},
{
"name": "CVE-2026-31670",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31670"
},
{
"name": "CVE-2026-31671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31671"
},
{
"name": "CVE-2026-31672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31672"
},
{
"name": "CVE-2026-31673",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31673"
},
{
"name": "CVE-2026-31676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31676"
},
{
"name": "CVE-2026-31681",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31681"
},
{
"name": "CVE-2026-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31684"
},
{
"name": "CVE-2026-31685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31685"
},
{
"name": "CVE-2026-31689",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31689"
},
{
"name": "CVE-2026-31694",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31694"
},
{
"name": "CVE-2026-31696",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31696"
},
{
"name": "CVE-2026-31697",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31697"
},
{
"name": "CVE-2026-31698",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31698"
},
{
"name": "CVE-2026-31699",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31699"
},
{
"name": "CVE-2026-31700",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31700"
},
{
"name": "CVE-2026-31702",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31702"
},
{
"name": "CVE-2026-31704",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31704"
},
{
"name": "CVE-2026-31705",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31705"
},
{
"name": "CVE-2026-31708",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31708"
},
{
"name": "CVE-2026-31711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31711"
},
{
"name": "CVE-2026-31721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31721"
},
{
"name": "CVE-2026-23362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23362"
},
{
"name": "CVE-2026-23287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23287"
},
{
"name": "CVE-2026-23321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23321"
},
{
"name": "CVE-2026-23339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23339"
},
{
"name": "CVE-2026-23372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23372"
},
{
"name": "CVE-2026-23378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23378"
},
{
"name": "CVE-2026-23401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23401"
},
{
"name": "CVE-2026-23420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23420"
},
{
"name": "CVE-2026-23426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23426"
},
{
"name": "CVE-2026-23428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23428"
},
{
"name": "CVE-2026-23434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23434"
},
{
"name": "CVE-2026-23438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23438"
},
{
"name": "CVE-2026-23439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23439"
},
{
"name": "CVE-2026-23446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23446"
},
{
"name": "CVE-2026-23449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23449"
},
{
"name": "CVE-2026-23450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23450"
},
{
"name": "CVE-2026-23452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23452"
},
{
"name": "CVE-2026-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23454"
},
{
"name": "CVE-2026-23455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23455"
},
{
"name": "CVE-2026-23456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23456"
},
{
"name": "CVE-2026-23457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23457"
},
{
"name": "CVE-2026-23458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23458"
},
{
"name": "CVE-2026-23460",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23460"
},
{
"name": "CVE-2026-23462",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23462"
},
{
"name": "CVE-2026-23463",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23463"
},
{
"name": "CVE-2026-23474",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23474"
},
{
"name": "CVE-2026-23475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23475"
},
{
"name": "CVE-2026-31389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31389"
},
{
"name": "CVE-2026-31391",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31391"
},
{
"name": "CVE-2026-31392",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31392"
},
{
"name": "CVE-2026-31393",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31393"
},
{
"name": "CVE-2026-31396",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31396"
},
{
"name": "CVE-2026-31399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31399"
},
{
"name": "CVE-2026-31400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31400"
},
{
"name": "CVE-2026-31403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31403"
},
{
"name": "CVE-2026-31405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31405"
},
{
"name": "CVE-2026-31409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31409"
},
{
"name": "CVE-2026-31411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31411"
},
{
"name": "CVE-2026-31412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31412"
},
{
"name": "CVE-2026-31415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31415"
},
{
"name": "CVE-2026-31425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31425"
},
{
"name": "CVE-2026-31433",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31433"
},
{
"name": "CVE-2026-31434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31434"
},
{
"name": "CVE-2026-31464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31464"
},
{
"name": "CVE-2026-31466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31466"
},
{
"name": "CVE-2026-31477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31477"
},
{
"name": "CVE-2026-31478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31478"
},
{
"name": "CVE-2026-31480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31480"
},
{
"name": "CVE-2026-31492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31492"
},
{
"name": "CVE-2026-31498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31498"
},
{
"name": "CVE-2026-31512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31512"
},
{
"name": "CVE-2026-31540",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31540"
},
{
"name": "CVE-2026-31545",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31545"
},
{
"name": "CVE-2026-31546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31546"
},
{
"name": "CVE-2026-31548",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31548"
},
{
"name": "CVE-2026-31549",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31549"
},
{
"name": "CVE-2026-31550",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31550"
},
{
"name": "CVE-2026-31551",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31551"
},
{
"name": "CVE-2026-31552",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31552"
},
{
"name": "CVE-2026-31683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31683"
},
{
"name": "CVE-2026-31695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31695"
},
{
"name": "CVE-2026-31720",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31720"
},
{
"name": "CVE-2026-31726",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31726"
},
{
"name": "CVE-2026-31728",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31728"
},
{
"name": "CVE-2026-31737",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31737"
},
{
"name": "CVE-2026-31738",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31738"
},
{
"name": "CVE-2026-31747",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31747"
},
{
"name": "CVE-2026-31748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31748"
},
{
"name": "CVE-2026-31749",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31749"
},
{
"name": "CVE-2026-31751",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31751"
},
{
"name": "CVE-2026-31752",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31752"
},
{
"name": "CVE-2026-31754",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31754"
},
{
"name": "CVE-2026-31755",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31755"
},
{
"name": "CVE-2026-31756",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31756"
},
{
"name": "CVE-2026-31758",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31758"
},
{
"name": "CVE-2026-31759",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31759"
},
{
"name": "CVE-2026-31761",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31761"
},
{
"name": "CVE-2026-31762",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31762"
},
{
"name": "CVE-2026-31763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31763"
},
{
"name": "CVE-2026-31768",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31768"
},
{
"name": "CVE-2026-31770",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31770"
},
{
"name": "CVE-2026-31773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31773"
},
{
"name": "CVE-2026-31778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31778"
},
{
"name": "CVE-2026-31779",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31779"
},
{
"name": "CVE-2026-31780",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31780"
},
{
"name": "CVE-2026-31781",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31781"
},
{
"name": "CVE-2026-43011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43011"
},
{
"name": "CVE-2026-43013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43013"
},
{
"name": "CVE-2026-43014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43014"
},
{
"name": "CVE-2026-43015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43015"
},
{
"name": "CVE-2026-43017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43017"
},
{
"name": "CVE-2026-43018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43018"
},
{
"name": "CVE-2026-43020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43020"
},
{
"name": "CVE-2026-43023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43023"
},
{
"name": "CVE-2026-43024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43024"
},
{
"name": "CVE-2026-43025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43025"
},
{
"name": "CVE-2026-43026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43026"
},
{
"name": "CVE-2026-43027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43027"
},
{
"name": "CVE-2026-43028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43028"
},
{
"name": "CVE-2026-43030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43030"
},
{
"name": "CVE-2026-43032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43032"
},
{
"name": "CVE-2026-43035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43035"
},
{
"name": "CVE-2026-43037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43037"
},
{
"name": "CVE-2026-43038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43038"
},
{
"name": "CVE-2026-43040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43040"
},
{
"name": "CVE-2026-43041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43041"
},
{
"name": "CVE-2026-43043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43043"
},
{
"name": "CVE-2026-43046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43046"
},
{
"name": "CVE-2026-43047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43047"
},
{
"name": "CVE-2026-43050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43050"
},
{
"name": "CVE-2026-43051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43051"
},
{
"name": "CVE-2026-43054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43054"
},
{
"name": "CVE-2026-43057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43057"
},
{
"name": "CVE-2026-23249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23249"
},
{
"name": "CVE-2026-23276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23276"
},
{
"name": "CVE-2026-23302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23302"
},
{
"name": "CVE-2026-23308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23308"
},
{
"name": "CVE-2026-23313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23313"
},
{
"name": "CVE-2026-23325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23325"
},
{
"name": "CVE-2026-23330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23330"
},
{
"name": "CVE-2026-23363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23363"
},
{
"name": "CVE-2026-23369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23369"
},
{
"name": "CVE-2026-23374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23374"
},
{
"name": "CVE-2026-23375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23375"
},
{
"name": "CVE-2026-23387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23387"
},
{
"name": "CVE-2026-23389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23389"
},
{
"name": "CVE-2026-23399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23399"
},
{
"name": "CVE-2026-23427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23427"
},
{
"name": "CVE-2026-23440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23440"
},
{
"name": "CVE-2026-23441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23441"
},
{
"name": "CVE-2026-23442",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23442"
},
{
"name": "CVE-2026-23444",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23444"
},
{
"name": "CVE-2026-23447",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23447"
},
{
"name": "CVE-2026-23448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23448"
},
{
"name": "CVE-2026-23461",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23461"
},
{
"name": "CVE-2026-23464",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23464"
},
{
"name": "CVE-2026-23465",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23465"
},
{
"name": "CVE-2026-23470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23470"
},
{
"name": "CVE-2026-31407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31407"
},
{
"name": "CVE-2026-31429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31429"
},
{
"name": "CVE-2026-31432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31432"
},
{
"name": "CVE-2026-31436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31436"
},
{
"name": "CVE-2026-31438",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31438"
},
{
"name": "CVE-2026-31440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31440"
},
{
"name": "CVE-2026-31449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31449"
},
{
"name": "CVE-2026-31470",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31470"
},
{
"name": "CVE-2026-31482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31482"
},
{
"name": "CVE-2026-31487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31487"
},
{
"name": "CVE-2026-31488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31488"
},
{
"name": "CVE-2026-31489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31489"
},
{
"name": "CVE-2026-31502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31502"
},
{
"name": "CVE-2026-31505",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31505"
},
{
"name": "CVE-2026-31506",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31506"
},
{
"name": "CVE-2026-31511",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31511"
},
{
"name": "CVE-2026-31516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31516"
},
{
"name": "CVE-2026-31527",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31527"
},
{
"name": "CVE-2026-31530",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31530"
},
{
"name": "CVE-2026-31542",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31542"
},
{
"name": "CVE-2026-31554",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31554"
},
{
"name": "CVE-2026-31556",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31556"
},
{
"name": "CVE-2026-31557",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31557"
},
{
"name": "CVE-2026-31575",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31575"
},
{
"name": "CVE-2026-31576",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31576"
},
{
"name": "CVE-2026-31580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31580"
},
{
"name": "CVE-2026-31581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31581"
},
{
"name": "CVE-2026-31582",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31582"
},
{
"name": "CVE-2026-31584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31584"
},
{
"name": "CVE-2026-31598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31598"
},
{
"name": "CVE-2026-31602",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31602"
},
{
"name": "CVE-2026-31606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31606"
},
{
"name": "CVE-2026-31614",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31614"
},
{
"name": "CVE-2026-31616",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31616"
},
{
"name": "CVE-2026-31617",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31617"
},
{
"name": "CVE-2026-31645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31645"
},
{
"name": "CVE-2026-31677",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31677"
},
{
"name": "CVE-2026-31686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31686"
},
{
"name": "CVE-2026-31693",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31693"
},
{
"name": "CVE-2025-71294",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71294"
},
{
"name": "CVE-2026-43201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43201"
},
{
"name": "CVE-2026-43300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43300"
},
{
"name": "CVE-2026-43320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43320"
},
{
"name": "CVE-2025-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54518"
},
{
"name": "CVE-2026-43284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43284"
},
{
"name": "CVE-2026-43500",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43500"
},
{
"name": "CVE-2026-23468",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23468"
},
{
"name": "CVE-2026-31709",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31709"
},
{
"name": "CVE-2026-31715",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31715"
},
{
"name": "CVE-2026-23123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23123"
},
{
"name": "CVE-2026-23142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23142"
},
{
"name": "CVE-2026-23148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23148"
},
{
"name": "CVE-2026-23159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23159"
},
{
"name": "CVE-2026-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23160"
},
{
"name": "CVE-2026-23168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23168"
},
{
"name": "CVE-2026-23256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23256"
},
{
"name": "CVE-2026-23257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23257"
},
{
"name": "CVE-2026-23258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23258"
},
{
"name": "CVE-2026-31499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31499"
},
{
"name": "CVE-2026-43088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43088"
},
{
"name": "CVE-2026-43109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43109"
},
{
"name": "CVE-2026-43490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43490"
},
{
"name": "CVE-2026-31635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31635"
},
{
"name": "CVE-2026-43494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43494"
},
{
"name": "CVE-2026-43503",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43503"
},
{
"name": "CVE-2026-46174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46174"
},
{
"name": "CVE-2026-43110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43110"
},
{
"name": "CVE-2026-43190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43190"
},
{
"name": "CVE-2026-43255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43255"
},
{
"name": "CVE-2026-43264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43264"
},
{
"name": "CVE-2026-43334",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43334"
},
{
"name": "CVE-2026-43437",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43437"
},
{
"name": "CVE-2026-43158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43158"
},
{
"name": "CVE-2026-43163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43163"
},
{
"name": "CVE-2026-31613",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31613"
},
{
"name": "CVE-2026-43329",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43329"
},
{
"name": "CVE-2026-46243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46243"
},
{
"name": "CVE-2026-46028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46028"
},
{
"name": "CVE-2025-71274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71274"
},
{
"name": "CVE-2025-71292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71292"
},
{
"name": "CVE-2025-71304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71304"
},
{
"name": "CVE-2026-43060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43060"
},
{
"name": "CVE-2026-43061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43061"
},
{
"name": "CVE-2026-43062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43062"
},
{
"name": "CVE-2026-43066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43066"
},
{
"name": "CVE-2026-43068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43068"
},
{
"name": "CVE-2026-43069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43069"
},
{
"name": "CVE-2026-43124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43124"
},
{
"name": "CVE-2026-43130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43130"
},
{
"name": "CVE-2026-43132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43132"
},
{
"name": "CVE-2026-43134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43134"
},
{
"name": "CVE-2026-43135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43135"
},
{
"name": "CVE-2026-43136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43136"
},
{
"name": "CVE-2026-43139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43139"
},
{
"name": "CVE-2026-43140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43140"
},
{
"name": "CVE-2026-43141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43141"
},
{
"name": "CVE-2026-43147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43147"
},
{
"name": "CVE-2026-43149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43149"
},
{
"name": "CVE-2026-43152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43152"
},
{
"name": "CVE-2026-43156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43156"
},
{
"name": "CVE-2026-43159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43159"
},
{
"name": "CVE-2026-43168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43168"
},
{
"name": "CVE-2026-43171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43171"
},
{
"name": "CVE-2026-43180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43180"
},
{
"name": "CVE-2026-43183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43183"
},
{
"name": "CVE-2026-43184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43184"
},
{
"name": "CVE-2026-43187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43187"
},
{
"name": "CVE-2026-43194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43194"
},
{
"name": "CVE-2026-43196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43196"
},
{
"name": "CVE-2026-43202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43202"
},
{
"name": "CVE-2026-43203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43203"
},
{
"name": "CVE-2026-43206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43206"
},
{
"name": "CVE-2026-43207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43207"
},
{
"name": "CVE-2026-43209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43209"
},
{
"name": "CVE-2026-43211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43211"
},
{
"name": "CVE-2026-43218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43218"
},
{
"name": "CVE-2026-43223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43223"
},
{
"name": "CVE-2026-43226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43226"
},
{
"name": "CVE-2026-43227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43227"
},
{
"name": "CVE-2026-43230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43230"
},
{
"name": "CVE-2026-43231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43231"
},
{
"name": "CVE-2026-43232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43232"
},
{
"name": "CVE-2026-43233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43233"
},
{
"name": "CVE-2026-43236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43236"
},
{
"name": "CVE-2026-43241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43241"
},
{
"name": "CVE-2026-43242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43242"
},
{
"name": "CVE-2026-43246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43246"
},
{
"name": "CVE-2026-43251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43251"
},
{
"name": "CVE-2026-43257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43257"
},
{
"name": "CVE-2026-43261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43261"
},
{
"name": "CVE-2026-43266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43266"
},
{
"name": "CVE-2026-43268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43268"
},
{
"name": "CVE-2026-43269",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43269"
},
{
"name": "CVE-2026-43270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43270"
},
{
"name": "CVE-2026-43273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43273"
},
{
"name": "CVE-2026-43277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43277"
},
{
"name": "CVE-2026-43283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43283"
},
{
"name": "CVE-2026-43287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43287"
},
{
"name": "CVE-2026-43289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43289"
},
{
"name": "CVE-2026-43295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43295"
},
{
"name": "CVE-2026-43296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43296"
},
{
"name": "CVE-2026-43314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43314"
},
{
"name": "CVE-2026-43316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43316"
},
{
"name": "CVE-2026-43327",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43327"
},
{
"name": "CVE-2026-43328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43328"
},
{
"name": "CVE-2026-43336",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43336"
},
{
"name": "CVE-2026-43339",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43339"
},
{
"name": "CVE-2026-43340",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43340"
},
{
"name": "CVE-2026-43342",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43342"
},
{
"name": "CVE-2026-43343",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43343"
},
{
"name": "CVE-2026-43355",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43355"
},
{
"name": "CVE-2026-43357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43357"
},
{
"name": "CVE-2026-43363",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43363"
},
{
"name": "CVE-2026-43370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43370"
},
{
"name": "CVE-2026-43373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43373"
},
{
"name": "CVE-2026-43381",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43381"
},
{
"name": "CVE-2026-43382",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43382"
},
{
"name": "CVE-2026-43383",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43383"
},
{
"name": "CVE-2026-43386",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43386"
},
{
"name": "CVE-2026-43387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43387"
},
{
"name": "CVE-2026-43407",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43407"
},
{
"name": "CVE-2026-43411",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43411"
},
{
"name": "CVE-2026-43420",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43420"
},
{
"name": "CVE-2026-43424",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43424"
},
{
"name": "CVE-2026-43425",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43425"
},
{
"name": "CVE-2026-43426",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43426"
},
{
"name": "CVE-2026-43427",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43427"
},
{
"name": "CVE-2026-43428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43428"
},
{
"name": "CVE-2026-43429",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43429"
},
{
"name": "CVE-2026-43430",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43430"
},
{
"name": "CVE-2026-43432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43432"
},
{
"name": "CVE-2026-43439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43439"
},
{
"name": "CVE-2026-43445",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43445"
},
{
"name": "CVE-2026-43449",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43449"
},
{
"name": "CVE-2026-43450",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43450"
},
{
"name": "CVE-2026-43451",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43451"
},
{
"name": "CVE-2026-43452",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43452"
},
{
"name": "CVE-2026-43453",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43453"
},
{
"name": "CVE-2026-43458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43458"
},
{
"name": "CVE-2026-43459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43459"
},
{
"name": "CVE-2026-43466",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43466"
},
{
"name": "CVE-2026-43472",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43472"
},
{
"name": "CVE-2026-43475",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43475"
},
{
"name": "CVE-2026-43480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43480"
},
{
"name": "CVE-2026-45848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45848"
},
{
"name": "CVE-2026-45852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45852"
},
{
"name": "CVE-2026-45856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45856"
},
{
"name": "CVE-2026-45857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45857"
},
{
"name": "CVE-2026-45860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45860"
},
{
"name": "CVE-2026-45862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45862"
},
{
"name": "CVE-2026-45866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45866"
},
{
"name": "CVE-2026-45867",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45867"
},
{
"name": "CVE-2026-45868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45868"
},
{
"name": "CVE-2026-45869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45869"
},
{
"name": "CVE-2026-45870",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45870"
},
{
"name": "CVE-2026-45871",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45871"
},
{
"name": "CVE-2026-45873",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45873"
},
{
"name": "CVE-2026-45875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45875"
},
{
"name": "CVE-2026-45879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45879"
},
{
"name": "CVE-2026-45883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45883"
},
{
"name": "CVE-2026-45885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45885"
},
{
"name": "CVE-2026-45890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45890"
},
{
"name": "CVE-2026-45899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45899"
},
{
"name": "CVE-2026-45904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45904"
},
{
"name": "CVE-2026-45912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45912"
},
{
"name": "CVE-2026-45914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45914"
},
{
"name": "CVE-2026-45915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45915"
},
{
"name": "CVE-2026-45916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45916"
},
{
"name": "CVE-2026-45919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45919"
},
{
"name": "CVE-2026-45920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45920"
},
{
"name": "CVE-2026-45923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45923"
},
{
"name": "CVE-2026-45936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45936"
},
{
"name": "CVE-2026-45941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45941"
},
{
"name": "CVE-2026-45948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45948"
},
{
"name": "CVE-2026-45954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45954"
},
{
"name": "CVE-2026-45956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45956"
},
{
"name": "CVE-2026-45958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45958"
},
{
"name": "CVE-2026-45960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45960"
},
{
"name": "CVE-2026-45964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45964"
},
{
"name": "CVE-2026-45965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45965"
},
{
"name": "CVE-2026-45968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45968"
},
{
"name": "CVE-2026-45970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45970"
},
{
"name": "CVE-2026-45974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45974"
},
{
"name": "CVE-2026-45978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45978"
},
{
"name": "CVE-2026-45981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45981"
},
{
"name": "CVE-2026-45983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45983"
},
{
"name": "CVE-2026-45984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45984"
},
{
"name": "CVE-2026-45985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45985"
},
{
"name": "CVE-2026-23418",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23418"
},
{
"name": "CVE-2026-31579",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31579"
},
{
"name": "CVE-2026-43044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43044"
},
{
"name": "CVE-2026-43082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43082"
},
{
"name": "CVE-2026-43120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43120"
},
{
"name": "CVE-2026-43153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43153"
},
{
"name": "CVE-2026-43214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43214"
},
{
"name": "CVE-2026-43265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43265"
},
{
"name": "CVE-2026-43330",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43330"
},
{
"name": "CVE-2026-43365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43365"
},
{
"name": "CVE-2026-43366",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43366"
},
{
"name": "CVE-2026-43419",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43419"
},
{
"name": "CVE-2026-43441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43441"
},
{
"name": "CVE-2026-45834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45834"
},
{
"name": "CVE-2026-45835",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45835"
},
{
"name": "CVE-2026-45836",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45836"
},
{
"name": "CVE-2026-45838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45838"
},
{
"name": "CVE-2026-45839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45839"
},
{
"name": "CVE-2026-45840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45840"
},
{
"name": "CVE-2026-45841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45841"
},
{
"name": "CVE-2026-45842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45842"
},
{
"name": "CVE-2026-45843",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45843"
},
{
"name": "CVE-2026-45844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45844"
},
{
"name": "CVE-2026-45845",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45845"
},
{
"name": "CVE-2026-45846",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45846"
},
{
"name": "CVE-2026-45986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45986"
},
{
"name": "CVE-2026-45987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45987"
},
{
"name": "CVE-2026-45988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45988"
},
{
"name": "CVE-2026-45989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45989"
},
{
"name": "CVE-2026-45991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45991"
},
{
"name": "CVE-2026-45994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45994"
},
{
"name": "CVE-2026-45996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45996"
},
{
"name": "CVE-2026-45997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45997"
},
{
"name": "CVE-2026-45999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45999"
},
{
"name": "CVE-2026-46002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46002"
},
{
"name": "CVE-2026-46003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46003"
},
{
"name": "CVE-2026-46004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46004"
},
{
"name": "CVE-2026-46005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46005"
},
{
"name": "CVE-2026-46006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46006"
},
{
"name": "CVE-2026-46009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46009"
},
{
"name": "CVE-2026-46011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46011"
},
{
"name": "CVE-2026-46012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46012"
},
{
"name": "CVE-2026-46015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46015"
},
{
"name": "CVE-2026-46016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46016"
},
{
"name": "CVE-2026-46018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46018"
},
{
"name": "CVE-2026-46019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46019"
},
{
"name": "CVE-2026-46021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46021"
},
{
"name": "CVE-2026-46022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46022"
},
{
"name": "CVE-2026-46023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46023"
},
{
"name": "CVE-2026-46024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46024"
},
{
"name": "CVE-2026-46026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46026"
},
{
"name": "CVE-2026-46027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46027"
},
{
"name": "CVE-2026-46031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46031"
},
{
"name": "CVE-2026-46033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46033"
},
{
"name": "CVE-2026-46037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46037"
},
{
"name": "CVE-2026-46038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46038"
},
{
"name": "CVE-2026-46040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46040"
},
{
"name": "CVE-2026-46043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46043"
},
{
"name": "CVE-2026-46046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46046"
},
{
"name": "CVE-2026-46047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46047"
},
{
"name": "CVE-2026-46049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46049"
},
{
"name": "CVE-2026-46050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46050"
},
{
"name": "CVE-2026-46051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46051"
},
{
"name": "CVE-2026-46052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46052"
},
{
"name": "CVE-2026-46053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46053"
},
{
"name": "CVE-2026-46056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46056"
},
{
"name": "CVE-2026-46058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46058"
},
{
"name": "CVE-2026-46062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46062"
},
{
"name": "CVE-2026-46063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46063"
},
{
"name": "CVE-2026-46064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46064"
},
{
"name": "CVE-2026-46065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46065"
},
{
"name": "CVE-2026-46068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46068"
},
{
"name": "CVE-2026-46069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46069"
},
{
"name": "CVE-2026-46070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46070"
},
{
"name": "CVE-2026-46072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46072"
},
{
"name": "CVE-2026-46075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46075"
},
{
"name": "CVE-2026-46077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46077"
},
{
"name": "CVE-2026-46078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46078"
},
{
"name": "CVE-2026-46079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46079"
},
{
"name": "CVE-2026-46080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46080"
},
{
"name": "CVE-2026-46082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46082"
},
{
"name": "CVE-2026-46083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46083"
},
{
"name": "CVE-2026-46084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46084"
},
{
"name": "CVE-2026-46085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46085"
},
{
"name": "CVE-2026-46086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46086"
},
{
"name": "CVE-2026-46088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46088"
},
{
"name": "CVE-2026-46089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46089"
},
{
"name": "CVE-2026-46091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46091"
},
{
"name": "CVE-2026-46094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46094"
},
{
"name": "CVE-2026-46098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46098"
},
{
"name": "CVE-2026-46099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46099"
},
{
"name": "CVE-2026-46101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46101"
},
{
"name": "CVE-2026-46102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46102"
},
{
"name": "CVE-2026-46103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46103"
},
{
"name": "CVE-2026-46106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46106"
},
{
"name": "CVE-2026-46107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46107"
},
{
"name": "CVE-2026-46108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46108"
},
{
"name": "CVE-2026-46109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46109"
},
{
"name": "CVE-2026-46110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46110"
},
{
"name": "CVE-2026-46111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46111"
},
{
"name": "CVE-2026-46112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46112"
},
{
"name": "CVE-2026-46113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46113"
},
{
"name": "CVE-2026-46114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46114"
},
{
"name": "CVE-2026-46115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46115"
},
{
"name": "CVE-2026-46116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46116"
},
{
"name": "CVE-2026-46119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46119"
},
{
"name": "CVE-2026-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46120"
},
{
"name": "CVE-2026-46122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46122"
},
{
"name": "CVE-2026-46123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46123"
},
{
"name": "CVE-2026-46124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46124"
},
{
"name": "CVE-2026-46125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46125"
},
{
"name": "CVE-2026-46127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46127"
},
{
"name": "CVE-2026-46128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46128"
},
{
"name": "CVE-2026-46129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46129"
},
{
"name": "CVE-2026-46131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46131"
},
{
"name": "CVE-2026-46132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46132"
},
{
"name": "CVE-2026-46133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46133"
},
{
"name": "CVE-2026-46136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46136"
},
{
"name": "CVE-2026-46137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46137"
},
{
"name": "CVE-2026-46138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46138"
},
{
"name": "CVE-2026-46142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46142"
},
{
"name": "CVE-2026-46144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46144"
},
{
"name": "CVE-2026-46145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46145"
},
{
"name": "CVE-2026-46146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46146"
},
{
"name": "CVE-2026-46149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46149"
},
{
"name": "CVE-2026-46150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46150"
},
{
"name": "CVE-2026-46151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46151"
},
{
"name": "CVE-2026-46152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46152"
},
{
"name": "CVE-2026-46155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46155"
},
{
"name": "CVE-2026-46156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46156"
},
{
"name": "CVE-2026-46159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46159"
},
{
"name": "CVE-2026-46160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46160"
},
{
"name": "CVE-2026-46161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46161"
},
{
"name": "CVE-2026-46163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46163"
},
{
"name": "CVE-2026-46164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46164"
},
{
"name": "CVE-2026-46165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46165"
},
{
"name": "CVE-2026-46167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46167"
},
{
"name": "CVE-2026-46168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46168"
},
{
"name": "CVE-2026-46172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46172"
},
{
"name": "CVE-2026-46173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46173"
},
{
"name": "CVE-2026-46176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46176"
},
{
"name": "CVE-2026-46177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46177"
},
{
"name": "CVE-2026-46178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46178"
},
{
"name": "CVE-2026-46180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46180"
},
{
"name": "CVE-2026-46185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46185"
},
{
"name": "CVE-2026-46186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46186"
},
{
"name": "CVE-2026-46187",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46187"
},
{
"name": "CVE-2026-46189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46189"
},
{
"name": "CVE-2026-46190",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46190"
},
{
"name": "CVE-2026-46191",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46191"
},
{
"name": "CVE-2026-46193",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46193"
},
{
"name": "CVE-2026-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46195"
},
{
"name": "CVE-2026-46196",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46196"
},
{
"name": "CVE-2026-46197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46197"
},
{
"name": "CVE-2026-46198",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46198"
},
{
"name": "CVE-2026-46199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46199"
},
{
"name": "CVE-2026-46204",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46204"
},
{
"name": "CVE-2026-46205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46205"
},
{
"name": "CVE-2026-46206",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46206"
},
{
"name": "CVE-2026-46208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46208"
},
{
"name": "CVE-2026-46209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46209"
},
{
"name": "CVE-2026-46212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46212"
},
{
"name": "CVE-2026-46214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46214"
},
{
"name": "CVE-2026-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46218"
},
{
"name": "CVE-2026-46219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46219"
},
{
"name": "CVE-2026-46220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46220"
},
{
"name": "CVE-2026-46225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46225"
},
{
"name": "CVE-2026-46226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46226"
},
{
"name": "CVE-2026-46227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46227"
},
{
"name": "CVE-2026-46229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46229"
},
{
"name": "CVE-2026-46230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46230"
},
{
"name": "CVE-2026-46231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46231"
},
{
"name": "CVE-2026-46233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46233"
},
{
"name": "CVE-2026-46234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46234"
},
{
"name": "CVE-2026-46236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46236"
},
{
"name": "CVE-2026-46238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46238"
},
{
"name": "CVE-2026-46273",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46273"
},
{
"name": "CVE-2026-31729",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31729"
},
{
"name": "CVE-2026-43012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43012"
},
{
"name": "CVE-2026-43112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43112"
},
{
"name": "CVE-2026-43252",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43252"
},
{
"name": "CVE-2026-43333",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43333"
},
{
"name": "CVE-2026-43338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43338"
},
{
"name": "CVE-2026-43341",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43341"
},
{
"name": "CVE-2026-43359",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43359"
},
{
"name": "CVE-2026-43360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43360"
},
{
"name": "CVE-2026-43361",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43361"
},
{
"name": "CVE-2026-43362",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43362"
},
{
"name": "CVE-2026-43414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43414"
},
{
"name": "CVE-2026-43499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43499"
},
{
"name": "CVE-2026-43501",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43501"
},
{
"name": "CVE-2026-45910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45910"
},
{
"name": "CVE-2026-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43056"
},
{
"name": "CVE-2026-43125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43125"
},
{
"name": "CVE-2026-46054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46054"
},
{
"name": "CVE-2026-46181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46181"
},
{
"name": "CVE-2026-31772",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31772"
},
{
"name": "CVE-2026-43279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43279"
},
{
"name": "CVE-2026-46117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46117"
},
{
"name": "CVE-2026-46135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46135"
},
{
"name": "CVE-2026-46166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46166"
},
{
"name": "CVE-2026-31717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31717"
},
{
"name": "CVE-2026-43245",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43245"
},
{
"name": "CVE-2026-46158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46158"
},
{
"name": "CVE-2026-46170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46170"
},
{
"name": "CVE-2026-46203",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46203"
},
{
"name": "CVE-2026-46216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46216"
},
{
"name": "CVE-2026-46244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46244"
},
{
"name": "CVE-2026-46315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46315"
},
{
"name": "CVE-2026-46320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46320"
},
{
"name": "CVE-2026-46321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46321"
},
{
"name": "CVE-2026-46322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46322"
},
{
"name": "CVE-2026-52911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52911"
},
{
"name": "CVE-2026-31703",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31703"
},
{
"name": "CVE-2026-31767",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31767"
},
{
"name": "CVE-2026-43052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43052"
},
{
"name": "CVE-2026-43059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43059"
},
{
"name": "CVE-2026-43065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43065"
},
{
"name": "CVE-2026-43150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43150"
},
{
"name": "CVE-2026-43197",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43197"
},
{
"name": "CVE-2026-43249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43249"
},
{
"name": "CVE-2026-43332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43332"
},
{
"name": "CVE-2026-43406",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43406"
},
{
"name": "CVE-2026-43413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43413"
},
{
"name": "CVE-2026-43455",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43455"
},
{
"name": "CVE-2026-43483",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43483"
},
{
"name": "CVE-2026-45878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45878"
},
{
"name": "CVE-2026-45886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45886"
},
{
"name": "CVE-2026-45898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45898"
},
{
"name": "CVE-2026-45942",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45942"
},
{
"name": "CVE-2026-46090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46090"
},
{
"name": "CVE-2026-46157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46157"
},
{
"name": "CVE-2026-46169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46169"
},
{
"name": "CVE-2026-46259",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46259"
},
{
"name": "CVE-2026-46316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46316"
},
{
"name": "CVE-2026-46317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46317"
},
{
"name": "CVE-2026-46274",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46274"
},
{
"name": "CVE-2026-46280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46280"
},
{
"name": "CVE-2026-46285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46285"
},
{
"name": "CVE-2026-46287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46287"
},
{
"name": "CVE-2026-46289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46289"
},
{
"name": "CVE-2026-46291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46291"
},
{
"name": "CVE-2026-46292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46292"
},
{
"name": "CVE-2026-46293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46293"
},
{
"name": "CVE-2026-46296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46296"
},
{
"name": "CVE-2026-46299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46299"
},
{
"name": "CVE-2026-46301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46301"
},
{
"name": "CVE-2026-46303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46303"
},
{
"name": "CVE-2026-46304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46304"
},
{
"name": "CVE-2026-46306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46306"
},
{
"name": "CVE-2026-46307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46307"
},
{
"name": "CVE-2026-46312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46312"
},
{
"name": "CVE-2026-46319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46319"
},
{
"name": "CVE-2026-46275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46275"
},
{
"name": "CVE-2026-52912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52912"
},
{
"name": "CVE-2026-52913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52913"
},
{
"name": "CVE-2026-52915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52915"
},
{
"name": "CVE-2026-52916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52916"
},
{
"name": "CVE-2026-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52919"
},
{
"name": "CVE-2026-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52921"
},
{
"name": "CVE-2026-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52922"
},
{
"name": "CVE-2026-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52923"
},
{
"name": "CVE-2026-52926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52926"
},
{
"name": "CVE-2026-52927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52927"
},
{
"name": "CVE-2026-52931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52931"
},
{
"name": "CVE-2026-52934",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52934"
},
{
"name": "CVE-2026-52941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52941"
},
{
"name": "CVE-2026-52943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52943"
},
{
"name": "CVE-2026-53080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53080"
},
{
"name": "CVE-2026-43074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43074"
},
{
"name": "CVE-2026-52918",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52918"
},
{
"name": "CVE-2026-52944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52944"
},
{
"name": "CVE-2025-71272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71272"
},
{
"name": "CVE-2025-71273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71273"
},
{
"name": "CVE-2025-71286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71286"
},
{
"name": "CVE-2025-71291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71291"
},
{
"name": "CVE-2025-71295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71295"
},
{
"name": "CVE-2025-71297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71297"
},
{
"name": "CVE-2025-71305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71305"
},
{
"name": "CVE-2026-31574",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31574"
},
{
"name": "CVE-2026-31592",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31592"
},
{
"name": "CVE-2026-31687",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31687"
},
{
"name": "CVE-2026-31701",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31701"
},
{
"name": "CVE-2026-31706",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31706"
},
{
"name": "CVE-2026-31707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31707"
},
{
"name": "CVE-2026-31710",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31710"
},
{
"name": "CVE-2026-31712",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31712"
},
{
"name": "CVE-2026-31713",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31713"
},
{
"name": "CVE-2026-31714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31714"
},
{
"name": "CVE-2026-31716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31716"
},
{
"name": "CVE-2026-31718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31718"
},
{
"name": "CVE-2026-31719",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31719"
},
{
"name": "CVE-2026-43058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43058"
},
{
"name": "CVE-2026-43071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43071"
},
{
"name": "CVE-2026-43072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43072"
},
{
"name": "CVE-2026-43073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43073"
},
{
"name": "CVE-2026-43083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43083"
},
{
"name": "CVE-2026-43114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43114"
},
{
"name": "CVE-2026-43117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43117"
},
{
"name": "CVE-2026-43123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43123"
},
{
"name": "CVE-2026-43128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43128"
},
{
"name": "CVE-2026-43133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43133"
},
{
"name": "CVE-2026-43137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43137"
},
{
"name": "CVE-2026-43143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43143"
},
{
"name": "CVE-2026-43145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43145"
},
{
"name": "CVE-2026-43148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43148"
},
{
"name": "CVE-2026-43157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43157"
},
{
"name": "CVE-2026-43167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43167"
},
{
"name": "CVE-2026-43169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43169"
},
{
"name": "CVE-2026-43170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43170"
},
{
"name": "CVE-2026-43173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43173"
},
{
"name": "CVE-2026-43175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43175"
},
{
"name": "CVE-2026-43182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43182"
},
{
"name": "CVE-2026-43186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43186"
},
{
"name": "CVE-2026-43189",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43189"
},
{
"name": "CVE-2026-43199",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43199"
},
{
"name": "CVE-2026-43200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43200"
},
{
"name": "CVE-2026-43205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43205"
},
{
"name": "CVE-2026-43212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43212"
},
{
"name": "CVE-2026-43215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43215"
},
{
"name": "CVE-2026-43221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43221"
},
{
"name": "CVE-2026-43222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43222"
},
{
"name": "CVE-2026-43225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43225"
},
{
"name": "CVE-2026-43238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43238"
},
{
"name": "CVE-2026-43239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43239"
},
{
"name": "CVE-2026-43244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43244"
},
{
"name": "CVE-2026-43248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43248"
},
{
"name": "CVE-2026-43250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43250"
},
{
"name": "CVE-2026-43253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43253"
},
{
"name": "CVE-2026-43256",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43256"
},
{
"name": "CVE-2026-43258",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43258"
},
{
"name": "CVE-2026-43262",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43262"
},
{
"name": "CVE-2026-43271",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43271"
},
{
"name": "CVE-2026-43275",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43275"
},
{
"name": "CVE-2026-43278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43278"
},
{
"name": "CVE-2026-43288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43288"
},
{
"name": "CVE-2026-43291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43291"
},
{
"name": "CVE-2026-43297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43297"
},
{
"name": "CVE-2026-43302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43302"
},
{
"name": "CVE-2026-43304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43304"
},
{
"name": "CVE-2026-43312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43312"
},
{
"name": "CVE-2026-43313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43313"
},
{
"name": "CVE-2026-43315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43315"
},
{
"name": "CVE-2026-43317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43317"
},
{
"name": "CVE-2026-43318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43318"
},
{
"name": "CVE-2026-43319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43319"
},
{
"name": "CVE-2026-43348",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43348"
},
{
"name": "CVE-2026-43349",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43349"
},
{
"name": "CVE-2026-43350",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43350"
},
{
"name": "CVE-2026-43376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43376"
},
{
"name": "CVE-2026-43378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43378"
},
{
"name": "CVE-2026-43384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43384"
},
{
"name": "CVE-2026-43402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43402"
},
{
"name": "CVE-2026-43491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43491"
},
{
"name": "CVE-2026-43493",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43493"
},
{
"name": "CVE-2026-45847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45847"
},
{
"name": "CVE-2026-45849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45849"
},
{
"name": "CVE-2026-45851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45851"
},
{
"name": "CVE-2026-45859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45859"
},
{
"name": "CVE-2026-45861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45861"
},
{
"name": "CVE-2026-45864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45864"
},
{
"name": "CVE-2026-45865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45865"
},
{
"name": "CVE-2026-45872",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45872"
},
{
"name": "CVE-2026-45877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45877"
},
{
"name": "CVE-2026-45880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45880"
},
{
"name": "CVE-2026-45881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45881"
},
{
"name": "CVE-2026-45882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45882"
},
{
"name": "CVE-2026-45884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45884"
},
{
"name": "CVE-2026-45891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45891"
},
{
"name": "CVE-2026-45893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45893"
},
{
"name": "CVE-2026-45895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45895"
},
{
"name": "CVE-2026-45902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45902"
},
{
"name": "CVE-2026-45905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45905"
},
{
"name": "CVE-2026-45913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45913"
},
{
"name": "CVE-2026-45917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45917"
},
{
"name": "CVE-2026-45921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45921"
},
{
"name": "CVE-2026-45928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45928"
},
{
"name": "CVE-2026-45935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45935"
},
{
"name": "CVE-2026-45938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45938"
},
{
"name": "CVE-2026-45946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45946"
},
{
"name": "CVE-2026-45947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45947"
},
{
"name": "CVE-2026-45957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45957"
},
{
"name": "CVE-2026-45962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45962"
},
{
"name": "CVE-2026-45969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45969"
},
{
"name": "CVE-2026-45972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45972"
},
{
"name": "CVE-2026-45973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45973"
},
{
"name": "CVE-2026-45976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45976"
},
{
"name": "CVE-2026-45982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45982"
},
{
"name": "CVE-2026-45990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45990"
},
{
"name": "CVE-2026-45995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45995"
},
{
"name": "CVE-2026-46001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46001"
},
{
"name": "CVE-2026-46007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46007"
},
{
"name": "CVE-2026-46008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46008"
},
{
"name": "CVE-2026-46010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46010"
},
{
"name": "CVE-2026-46013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46013"
},
{
"name": "CVE-2026-46014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46014"
},
{
"name": "CVE-2026-46020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46020"
},
{
"name": "CVE-2026-46025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46025"
},
{
"name": "CVE-2026-46029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46029"
},
{
"name": "CVE-2026-46030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46030"
},
{
"name": "CVE-2026-46032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46032"
},
{
"name": "CVE-2026-46034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46034"
},
{
"name": "CVE-2026-46035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46035"
},
{
"name": "CVE-2026-46036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46036"
},
{
"name": "CVE-2026-46039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46039"
},
{
"name": "CVE-2026-46041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46041"
},
{
"name": "CVE-2026-46042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46042"
},
{
"name": "CVE-2026-46044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46044"
},
{
"name": "CVE-2026-46045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46045"
},
{
"name": "CVE-2026-46057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46057"
},
{
"name": "CVE-2026-46059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46059"
},
{
"name": "CVE-2026-46060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46060"
},
{
"name": "CVE-2026-46061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46061"
},
{
"name": "CVE-2026-46066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46066"
},
{
"name": "CVE-2026-46067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46067"
},
{
"name": "CVE-2026-46071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46071"
},
{
"name": "CVE-2026-46073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46073"
},
{
"name": "CVE-2026-46074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46074"
},
{
"name": "CVE-2026-46076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46076"
},
{
"name": "CVE-2026-46081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46081"
},
{
"name": "CVE-2026-46087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46087"
},
{
"name": "CVE-2026-46092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46092"
},
{
"name": "CVE-2026-46093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46093"
},
{
"name": "CVE-2026-46095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46095"
},
{
"name": "CVE-2026-46096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46096"
},
{
"name": "CVE-2026-46097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46097"
},
{
"name": "CVE-2026-46100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46100"
},
{
"name": "CVE-2026-46246",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46246"
},
{
"name": "CVE-2026-46247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46247"
},
{
"name": "CVE-2026-46249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46249"
},
{
"name": "CVE-2026-46250",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46250"
},
{
"name": "CVE-2026-46251",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46251"
},
{
"name": "CVE-2026-46253",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46253"
},
{
"name": "CVE-2026-46254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46254"
},
{
"name": "CVE-2026-46255",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46255"
},
{
"name": "CVE-2026-46260",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46260"
},
{
"name": "CVE-2026-46261",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46261"
},
{
"name": "CVE-2026-46265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46265"
},
{
"name": "CVE-2026-46266",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46266"
},
{
"name": "CVE-2026-46267",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46267"
},
{
"name": "CVE-2026-46270",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46270"
},
{
"name": "CVE-2026-46276",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46276"
},
{
"name": "CVE-2026-46277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46277"
},
{
"name": "CVE-2026-46278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46278"
},
{
"name": "CVE-2026-46279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46279"
},
{
"name": "CVE-2026-46281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46281"
},
{
"name": "CVE-2026-46282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46282"
},
{
"name": "CVE-2026-46283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46283"
},
{
"name": "CVE-2026-46284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46284"
},
{
"name": "CVE-2026-46286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46286"
},
{
"name": "CVE-2026-46288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46288"
},
{
"name": "CVE-2026-46290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46290"
},
{
"name": "CVE-2026-46325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46325"
},
{
"name": "CVE-2026-46328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46328"
},
{
"name": "CVE-2026-46332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46332"
},
{
"name": "CVE-2026-52904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52904"
},
{
"name": "CVE-2026-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52905"
},
{
"name": "CVE-2026-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52906"
},
{
"name": "CVE-2026-52907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52907"
},
{
"name": "CVE-2026-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52933"
},
{
"name": "CVE-2026-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53174"
},
{
"name": "CVE-2026-43036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43036"
},
{
"name": "CVE-2026-43049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43049"
},
{
"name": "CVE-2026-43119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43119"
},
{
"name": "CVE-2026-43345",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43345"
},
{
"name": "CVE-2026-43405",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43405"
},
{
"name": "CVE-2026-43469",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43469"
},
{
"name": "CVE-2026-46162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46162"
},
{
"name": "CVE-2026-52928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52928"
},
{
"name": "CVE-2026-46242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46242"
},
{
"name": "CVE-2026-52975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52975"
},
{
"name": "CVE-2026-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53070"
},
{
"name": "CVE-2026-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53101"
},
{
"name": "CVE-2026-31630",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31630"
},
{
"name": "CVE-2026-43064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43064"
},
{
"name": "CVE-2026-43075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43075"
},
{
"name": "CVE-2026-43076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43076"
},
{
"name": "CVE-2026-43079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43079"
},
{
"name": "CVE-2026-43080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43080"
},
{
"name": "CVE-2026-43085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43085"
},
{
"name": "CVE-2026-43089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43089"
},
{
"name": "CVE-2026-43093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43093"
},
{
"name": "CVE-2026-43094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43094"
},
{
"name": "CVE-2026-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43098"
},
{
"name": "CVE-2026-43099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43099"
},
{
"name": "CVE-2026-43103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43103"
},
{
"name": "CVE-2026-43104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43104"
},
{
"name": "CVE-2026-43105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43105"
},
{
"name": "CVE-2026-43111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43111"
},
{
"name": "CVE-2026-43113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43113"
},
{
"name": "CVE-2026-43421",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43421"
},
{
"name": "CVE-2026-43492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43492"
},
{
"name": "CVE-2026-43495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43495"
},
{
"name": "CVE-2026-43496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43496"
},
{
"name": "CVE-2026-43497",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43497"
},
{
"name": "CVE-2026-43502",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43502"
},
{
"name": "CVE-2026-46143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46143"
},
{
"name": "CVE-2026-46179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46179"
},
{
"name": "CVE-2026-46184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46184"
},
{
"name": "CVE-2026-46235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46235"
},
{
"name": "CVE-2026-46294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46294"
},
{
"name": "CVE-2026-46314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46314"
},
{
"name": "CVE-2026-52914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52914"
},
{
"name": "CVE-2026-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52920"
},
{
"name": "CVE-2026-52925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52925"
},
{
"name": "CVE-2026-52954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52954"
},
{
"name": "CVE-2026-52955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52955"
},
{
"name": "CVE-2026-52957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52957"
},
{
"name": "CVE-2026-52958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52958"
},
{
"name": "CVE-2026-52962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52962"
},
{
"name": "CVE-2026-52963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52963"
},
{
"name": "CVE-2026-52967",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52967"
},
{
"name": "CVE-2026-52968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52968"
},
{
"name": "CVE-2026-52969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52969"
},
{
"name": "CVE-2026-52970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52970"
},
{
"name": "CVE-2026-52974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52974"
},
{
"name": "CVE-2026-52977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52977"
},
{
"name": "CVE-2026-52981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52981"
},
{
"name": "CVE-2026-52982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52982"
},
{
"name": "CVE-2026-52984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52984"
},
{
"name": "CVE-2026-52985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52985"
},
{
"name": "CVE-2026-52986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52986"
},
{
"name": "CVE-2026-52989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52989"
},
{
"name": "CVE-2026-52992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52992"
},
{
"name": "CVE-2026-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52993"
},
{
"name": "CVE-2026-52995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52995"
},
{
"name": "CVE-2026-52998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52998"
},
{
"name": "CVE-2026-52999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52999"
},
{
"name": "CVE-2026-53001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53001"
},
{
"name": "CVE-2026-53002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53002"
},
{
"name": "CVE-2026-53003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53003"
},
{
"name": "CVE-2026-53004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53004"
},
{
"name": "CVE-2026-43081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43081"
},
{
"name": "CVE-2026-43086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43086"
},
{
"name": "CVE-2026-43107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43107"
},
{
"name": "CVE-2026-43456",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43456"
},
{
"name": "CVE-2026-53053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53053"
},
{
"name": "CVE-2026-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53122"
},
{
"name": "CVE-2026-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53281"
},
{
"name": "CVE-2026-53006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53006"
},
{
"name": "CVE-2026-53011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53011"
},
{
"name": "CVE-2026-53012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53012"
},
{
"name": "CVE-2026-53016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53016"
},
{
"name": "CVE-2026-53021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53021"
},
{
"name": "CVE-2026-53022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53022"
},
{
"name": "CVE-2026-53023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53023"
},
{
"name": "CVE-2026-53033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53033"
},
{
"name": "CVE-2026-53034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53034"
},
{
"name": "CVE-2026-53035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53035"
},
{
"name": "CVE-2026-53036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53036"
},
{
"name": "CVE-2026-53037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53037"
},
{
"name": "CVE-2026-53039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53039"
},
{
"name": "CVE-2026-53040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53040"
},
{
"name": "CVE-2026-53041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53041"
},
{
"name": "CVE-2026-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53043"
},
{
"name": "CVE-2026-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53045"
},
{
"name": "CVE-2026-53046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53046"
},
{
"name": "CVE-2026-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53047"
},
{
"name": "CVE-2026-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53048"
},
{
"name": "CVE-2026-53049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53049"
},
{
"name": "CVE-2026-53050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53050"
},
{
"name": "CVE-2026-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53052"
},
{
"name": "CVE-2026-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53056"
},
{
"name": "CVE-2026-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53059"
},
{
"name": "CVE-2026-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53060"
},
{
"name": "CVE-2026-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53061"
},
{
"name": "CVE-2026-53062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53062"
},
{
"name": "CVE-2026-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53063"
},
{
"name": "CVE-2026-53064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53064"
},
{
"name": "CVE-2026-53065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53065"
},
{
"name": "CVE-2026-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53066"
},
{
"name": "CVE-2026-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53068"
},
{
"name": "CVE-2026-53069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53069"
},
{
"name": "CVE-2026-53071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53071"
},
{
"name": "CVE-2026-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53072"
},
{
"name": "CVE-2026-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53073"
},
{
"name": "CVE-2026-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53074"
},
{
"name": "CVE-2026-53075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53075"
},
{
"name": "CVE-2026-53077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53077"
},
{
"name": "CVE-2026-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53082"
},
{
"name": "CVE-2026-53086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53086"
},
{
"name": "CVE-2026-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53088"
},
{
"name": "CVE-2026-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53093"
},
{
"name": "CVE-2026-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53096"
},
{
"name": "CVE-2026-53111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53111"
},
{
"name": "CVE-2026-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53112"
},
{
"name": "CVE-2026-53128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53128"
},
{
"name": "CVE-2026-53130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53130"
},
{
"name": "CVE-2026-53279",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53279"
},
{
"name": "CVE-2026-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53287"
},
{
"name": "CVE-2026-53289",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53289"
},
{
"name": "CVE-2026-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53291"
},
{
"name": "CVE-2026-53294",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53294"
},
{
"name": "CVE-2026-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53295"
},
{
"name": "CVE-2026-53296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53296"
},
{
"name": "CVE-2026-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53303"
},
{
"name": "CVE-2026-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53304"
},
{
"name": "CVE-2026-53306",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53306"
},
{
"name": "CVE-2026-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53309"
},
{
"name": "CVE-2026-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53314"
},
{
"name": "CVE-2026-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53320"
},
{
"name": "CVE-2026-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53354"
},
{
"name": "CVE-2026-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53357"
},
{
"name": "CVE-2026-43281",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43281"
},
{
"name": "CVE-2026-52936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52936"
},
{
"name": "CVE-2026-53013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53013"
},
{
"name": "CVE-2026-53032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53032"
},
{
"name": "CVE-2026-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53058"
},
{
"name": "CVE-2026-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53076"
},
{
"name": "CVE-2026-53094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53094"
},
{
"name": "CVE-2026-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53110"
},
{
"name": "CVE-2026-53126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53126"
},
{
"name": "CVE-2026-53293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53293"
},
{
"name": "CVE-2026-43185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43185"
},
{
"name": "CVE-2026-64208",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64208"
},
{
"name": "CVE-2026-64209",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64209"
},
{
"name": "CVE-2026-64210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64210"
},
{
"name": "CVE-2026-64211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64211"
},
{
"name": "CVE-2026-64212",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64212"
},
{
"name": "CVE-2026-64213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64213"
},
{
"name": "CVE-2026-64214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64214"
},
{
"name": "CVE-2026-64215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64215"
},
{
"name": "CVE-2026-64216",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64216"
},
{
"name": "CVE-2026-64217",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64217"
},
{
"name": "CVE-2026-64218",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64218"
},
{
"name": "CVE-2026-64219",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64219"
},
{
"name": "CVE-2026-64220",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64220"
},
{
"name": "CVE-2026-64221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64221"
},
{
"name": "CVE-2026-64222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64222"
},
{
"name": "CVE-2026-64223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64223"
},
{
"name": "CVE-2026-64224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64224"
},
{
"name": "CVE-2026-64225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64225"
},
{
"name": "CVE-2026-64226",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64226"
},
{
"name": "CVE-2026-64227",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64227"
},
{
"name": "CVE-2026-64228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64228"
},
{
"name": "CVE-2026-64229",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64229"
},
{
"name": "CVE-2026-64230",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64230"
},
{
"name": "CVE-2026-64231",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64231"
},
{
"name": "CVE-2026-64232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64232"
},
{
"name": "CVE-2026-64233",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64233"
},
{
"name": "CVE-2026-64234",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64234"
},
{
"name": "CVE-2026-64235",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64235"
},
{
"name": "CVE-2026-64236",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64236"
},
{
"name": "CVE-2026-64237",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64237"
},
{
"name": "CVE-2026-64238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64238"
},
{
"name": "CVE-2026-64239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64239"
},
{
"name": "CVE-2026-64240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64240"
},
{
"name": "CVE-2026-64241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64241"
},
{
"name": "CVE-2026-64242",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64242"
},
{
"name": "CVE-2026-64243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64243"
},
{
"name": "CVE-2026-64515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64515"
},
{
"name": "CVE-2026-64516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64516"
},
{
"name": "CVE-2026-64517",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64517"
},
{
"name": "CVE-2026-64518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64518"
},
{
"name": "CVE-2025-71187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71187"
},
{
"name": "CVE-2025-71201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71201"
},
{
"name": "CVE-2025-71287",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71287"
},
{
"name": "CVE-2025-71288",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-71288"
},
{
"name": "CVE-2026-22987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22987"
},
{
"name": "CVE-2026-23007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23007"
},
{
"name": "CVE-2026-23008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23008"
},
{
"name": "CVE-2026-23009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23009"
},
{
"name": "CVE-2026-23012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23012"
},
{
"name": "CVE-2026-23014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23014"
},
{
"name": "CVE-2026-23015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23015"
},
{
"name": "CVE-2026-23018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23018"
},
{
"name": "CVE-2026-23022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23022"
},
{
"name": "CVE-2026-23024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23024"
},
{
"name": "CVE-2026-23034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23034"
},
{
"name": "CVE-2026-23036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23036"
},
{
"name": "CVE-2026-23042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23042"
},
{
"name": "CVE-2026-23044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23044"
},
{
"name": "CVE-2026-23045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23045"
},
{
"name": "CVE-2026-23046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23046"
},
{
"name": "CVE-2026-23051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23051"
},
{
"name": "CVE-2026-23052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23052"
},
{
"name": "CVE-2026-23067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23067"
},
{
"name": "CVE-2026-23077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23077"
},
{
"name": "CVE-2026-23079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23079"
},
{
"name": "CVE-2026-23081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23081"
},
{
"name": "CVE-2026-23092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23092"
},
{
"name": "CVE-2026-23106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23106"
},
{
"name": "CVE-2026-23109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23109"
},
{
"name": "CVE-2026-23114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23114"
},
{
"name": "CVE-2026-23115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23115"
},
{
"name": "CVE-2026-23122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23122"
},
{
"name": "CVE-2026-23130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23130"
},
{
"name": "CVE-2026-23143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23143"
},
{
"name": "CVE-2026-23147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23147"
},
{
"name": "CVE-2026-23158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23158"
},
{
"name": "CVE-2026-23161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23161"
},
{
"name": "CVE-2026-23162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23162"
},
{
"name": "CVE-2026-23165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23165"
},
{
"name": "CVE-2026-31413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31413"
},
{
"name": "CVE-2026-31722",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31722"
},
{
"name": "CVE-2026-31723",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31723"
},
{
"name": "CVE-2026-31724",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31724"
},
{
"name": "CVE-2026-31725",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31725"
},
{
"name": "CVE-2026-31730",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31730"
},
{
"name": "CVE-2026-31731",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31731"
},
{
"name": "CVE-2026-31740",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31740"
},
{
"name": "CVE-2026-31741",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31741"
},
{
"name": "CVE-2026-43007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43007"
},
{
"name": "CVE-2026-43016",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43016"
},
{
"name": "CVE-2026-43019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43019"
},
{
"name": "CVE-2026-43084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43084"
},
{
"name": "CVE-2026-43091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43091"
},
{
"name": "CVE-2026-43092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43092"
},
{
"name": "CVE-2026-43129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43129"
},
{
"name": "CVE-2026-43162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43162"
},
{
"name": "CVE-2026-43324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43324"
},
{
"name": "CVE-2026-43368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43368"
},
{
"name": "CVE-2026-43371",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43371"
},
{
"name": "CVE-2026-43372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43372"
},
{
"name": "CVE-2026-43377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43377"
},
{
"name": "CVE-2026-43380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43380"
},
{
"name": "CVE-2026-43395",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43395"
},
{
"name": "CVE-2026-43397",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43397"
},
{
"name": "CVE-2026-43408",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43408"
},
{
"name": "CVE-2026-43409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43409"
},
{
"name": "CVE-2026-43412",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43412"
},
{
"name": "CVE-2026-43415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43415"
},
{
"name": "CVE-2026-43436",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43436"
},
{
"name": "CVE-2026-43448",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43448"
},
{
"name": "CVE-2026-43457",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43457"
},
{
"name": "CVE-2026-43467",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43467"
},
{
"name": "CVE-2026-43468",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43468"
},
{
"name": "CVE-2026-43471",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43471"
},
{
"name": "CVE-2026-43473",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43473"
},
{
"name": "CVE-2026-43476",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43476"
},
{
"name": "CVE-2026-43484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43484"
},
{
"name": "CVE-2026-43488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43488"
},
{
"name": "CVE-2026-43498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43498"
},
{
"name": "CVE-2026-45837",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45837"
},
{
"name": "CVE-2026-45855",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45855"
},
{
"name": "CVE-2026-45858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45858"
},
{
"name": "CVE-2026-45911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45911"
},
{
"name": "CVE-2026-45924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45924"
},
{
"name": "CVE-2026-45943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45943"
},
{
"name": "CVE-2026-46104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46104"
},
{
"name": "CVE-2026-46105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46105"
},
{
"name": "CVE-2026-46118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46118"
},
{
"name": "CVE-2026-46121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46121"
},
{
"name": "CVE-2026-46126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46126"
},
{
"name": "CVE-2026-46130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46130"
},
{
"name": "CVE-2026-46134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46134"
},
{
"name": "CVE-2026-46139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46139"
},
{
"name": "CVE-2026-46140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46140"
},
{
"name": "CVE-2026-46141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46141"
},
{
"name": "CVE-2026-46147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46147"
},
{
"name": "CVE-2026-46148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46148"
},
{
"name": "CVE-2026-46153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46153"
},
{
"name": "CVE-2026-46154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46154"
},
{
"name": "CVE-2026-46171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46171"
},
{
"name": "CVE-2026-46175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46175"
},
{
"name": "CVE-2026-46182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46182"
},
{
"name": "CVE-2026-46183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46183"
},
{
"name": "CVE-2026-46188",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46188"
},
{
"name": "CVE-2026-46192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46192"
},
{
"name": "CVE-2026-46194",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46194"
},
{
"name": "CVE-2026-46200",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46200"
},
{
"name": "CVE-2026-46201",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46201"
},
{
"name": "CVE-2026-46202",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46202"
},
{
"name": "CVE-2026-46207",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46207"
},
{
"name": "CVE-2026-46210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46210"
},
{
"name": "CVE-2026-46211",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46211"
},
{
"name": "CVE-2026-46213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46213"
},
{
"name": "CVE-2026-46215",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46215"
},
{
"name": "CVE-2026-46221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46221"
},
{
"name": "CVE-2026-46222",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46222"
},
{
"name": "CVE-2026-46223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46223"
},
{
"name": "CVE-2026-46224",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46224"
},
{
"name": "CVE-2026-46228",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46228"
},
{
"name": "CVE-2026-46232",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46232"
},
{
"name": "CVE-2026-46239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46239"
},
{
"name": "CVE-2026-46240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46240"
},
{
"name": "CVE-2026-46241",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46241"
},
{
"name": "CVE-2026-46295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46295"
},
{
"name": "CVE-2026-46297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46297"
},
{
"name": "CVE-2026-46298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46298"
},
{
"name": "CVE-2026-46302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46302"
},
{
"name": "CVE-2026-46305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46305"
},
{
"name": "CVE-2026-46308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46308"
},
{
"name": "CVE-2026-46309",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46309"
},
{
"name": "CVE-2026-46310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46310"
},
{
"name": "CVE-2026-46311",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46311"
},
{
"name": "CVE-2026-46313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46313"
},
{
"name": "CVE-2026-46318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46318"
},
{
"name": "CVE-2026-46324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46324"
},
{
"name": "CVE-2026-52932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52932"
},
{
"name": "CVE-2026-52937",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52937"
},
{
"name": "CVE-2026-52949",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52949"
},
{
"name": "CVE-2026-52950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52950"
},
{
"name": "CVE-2026-52951",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52951"
},
{
"name": "CVE-2026-52952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52952"
},
{
"name": "CVE-2026-52953",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52953"
},
{
"name": "CVE-2026-52956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52956"
},
{
"name": "CVE-2026-52959",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52959"
},
{
"name": "CVE-2026-52960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52960"
},
{
"name": "CVE-2026-52961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52961"
},
{
"name": "CVE-2026-52964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52964"
},
{
"name": "CVE-2026-52965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52965"
},
{
"name": "CVE-2026-52971",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52971"
},
{
"name": "CVE-2026-52973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52973"
},
{
"name": "CVE-2026-52976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52976"
},
{
"name": "CVE-2026-52978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52978"
},
{
"name": "CVE-2026-52979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52979"
},
{
"name": "CVE-2026-52980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52980"
},
{
"name": "CVE-2026-52983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52983"
},
{
"name": "CVE-2026-52987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52987"
},
{
"name": "CVE-2026-52988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52988"
},
{
"name": "CVE-2026-52990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52990"
},
{
"name": "CVE-2026-52991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52991"
},
{
"name": "CVE-2026-52994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52994"
},
{
"name": "CVE-2026-52996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52996"
},
{
"name": "CVE-2026-52997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52997"
},
{
"name": "CVE-2026-53000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53000"
},
{
"name": "CVE-2026-53005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53005"
},
{
"name": "CVE-2026-53007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53007"
},
{
"name": "CVE-2026-53008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53008"
},
{
"name": "CVE-2026-53009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53009"
},
{
"name": "CVE-2026-53010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53010"
},
{
"name": "CVE-2026-53014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53014"
},
{
"name": "CVE-2026-53015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53015"
},
{
"name": "CVE-2026-53017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53017"
},
{
"name": "CVE-2026-53018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53018"
},
{
"name": "CVE-2026-53019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53019"
},
{
"name": "CVE-2026-53020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53020"
},
{
"name": "CVE-2026-53024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53024"
},
{
"name": "CVE-2026-53025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53025"
},
{
"name": "CVE-2026-53026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53026"
},
{
"name": "CVE-2026-53027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53027"
},
{
"name": "CVE-2026-53028",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53028"
},
{
"name": "CVE-2026-53029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53029"
},
{
"name": "CVE-2026-53030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53030"
},
{
"name": "CVE-2026-53031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53031"
},
{
"name": "CVE-2026-53038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53038"
},
{
"name": "CVE-2026-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53042"
},
{
"name": "CVE-2026-53044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53044"
},
{
"name": "CVE-2026-53051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53051"
},
{
"name": "CVE-2026-53054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53054"
},
{
"name": "CVE-2026-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53055"
},
{
"name": "CVE-2026-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53057"
},
{
"name": "CVE-2026-53067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53067"
},
{
"name": "CVE-2026-53078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53078"
},
{
"name": "CVE-2026-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53079"
},
{
"name": "CVE-2026-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53081"
},
{
"name": "CVE-2026-53083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53083"
},
{
"name": "CVE-2026-53084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53084"
},
{
"name": "CVE-2026-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53085"
},
{
"name": "CVE-2026-53087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53087"
},
{
"name": "CVE-2026-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53089"
},
{
"name": "CVE-2026-53090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53090"
},
{
"name": "CVE-2026-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53091"
},
{
"name": "CVE-2026-53092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53092"
},
{
"name": "CVE-2026-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53095"
},
{
"name": "CVE-2026-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53097"
},
{
"name": "CVE-2026-53098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53098"
},
{
"name": "CVE-2026-53099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53099"
},
{
"name": "CVE-2026-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53100"
},
{
"name": "CVE-2026-53102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53102"
},
{
"name": "CVE-2026-53103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53103"
},
{
"name": "CVE-2026-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53104"
},
{
"name": "CVE-2026-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53105"
},
{
"name": "CVE-2026-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53106"
},
{
"name": "CVE-2026-53107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53107"
},
{
"name": "CVE-2026-53108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53108"
},
{
"name": "CVE-2026-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53109"
},
{
"name": "CVE-2026-53113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53113"
},
{
"name": "CVE-2026-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53114"
},
{
"name": "CVE-2026-53115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53115"
},
{
"name": "CVE-2026-53116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53116"
},
{
"name": "CVE-2026-53117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53117"
},
{
"name": "CVE-2026-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53118"
},
{
"name": "CVE-2026-53119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53119"
},
{
"name": "CVE-2026-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53120"
},
{
"name": "CVE-2026-53121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53121"
},
{
"name": "CVE-2026-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53123"
},
{
"name": "CVE-2026-53124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53124"
},
{
"name": "CVE-2026-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53125"
},
{
"name": "CVE-2026-53127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53127"
},
{
"name": "CVE-2026-53129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53129"
},
{
"name": "CVE-2026-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53277"
},
{
"name": "CVE-2026-53278",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53278"
},
{
"name": "CVE-2026-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53280"
},
{
"name": "CVE-2026-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53282"
},
{
"name": "CVE-2026-53283",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53283"
},
{
"name": "CVE-2026-53284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53284"
},
{
"name": "CVE-2026-53285",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53285"
},
{
"name": "CVE-2026-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53286"
},
{
"name": "CVE-2026-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53288"
},
{
"name": "CVE-2026-53290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53290"
},
{
"name": "CVE-2026-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53292"
},
{
"name": "CVE-2026-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53297"
},
{
"name": "CVE-2026-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53298"
},
{
"name": "CVE-2026-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53299"
},
{
"name": "CVE-2026-53300",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53300"
},
{
"name": "CVE-2026-53301",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53301"
},
{
"name": "CVE-2026-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53302"
},
{
"name": "CVE-2026-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53305"
},
{
"name": "CVE-2026-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53307"
},
{
"name": "CVE-2026-53308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53308"
},
{
"name": "CVE-2026-53310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53310"
},
{
"name": "CVE-2026-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53311"
},
{
"name": "CVE-2026-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53312"
},
{
"name": "CVE-2026-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53313"
},
{
"name": "CVE-2026-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53315"
},
{
"name": "CVE-2026-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53316"
},
{
"name": "CVE-2026-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53317"
},
{
"name": "CVE-2026-53318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53318"
},
{
"name": "CVE-2026-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53319"
},
{
"name": "CVE-2026-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53321"
},
{
"name": "CVE-2026-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53322"
},
{
"name": "CVE-2026-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53323"
},
{
"name": "CVE-2026-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53324"
},
{
"name": "CVE-2026-53358",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53358"
},
{
"name": "CVE-2026-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53360"
},
{
"name": "CVE-2026-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53364"
},
{
"name": "CVE-2026-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53365"
},
{
"name": "CVE-2026-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53367"
},
{
"name": "CVE-2026-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53368"
},
{
"name": "CVE-2026-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53369"
},
{
"name": "CVE-2026-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53370"
},
{
"name": "CVE-2026-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53371"
},
{
"name": "CVE-2026-53372",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53372"
},
{
"name": "CVE-2026-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53373"
},
{
"name": "CVE-2026-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53374"
},
{
"name": "CVE-2026-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53375"
},
{
"name": "CVE-2026-53376",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53376"
},
{
"name": "CVE-2026-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53377"
},
{
"name": "CVE-2026-53378",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53378"
},
{
"name": "CVE-2026-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53379"
},
{
"name": "CVE-2026-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53380"
},
{
"name": "CVE-2026-63837",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63837"
},
{
"name": "CVE-2026-63838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63838"
},
{
"name": "CVE-2026-63839",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63839"
},
{
"name": "CVE-2026-63840",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63840"
},
{
"name": "CVE-2026-63841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63841"
},
{
"name": "CVE-2026-63842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63842"
},
{
"name": "CVE-2026-63843",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63843"
},
{
"name": "CVE-2026-63844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63844"
},
{
"name": "CVE-2026-63845",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63845"
},
{
"name": "CVE-2026-63846",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63846"
},
{
"name": "CVE-2026-63847",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63847"
},
{
"name": "CVE-2026-63848",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63848"
},
{
"name": "CVE-2026-63849",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63849"
},
{
"name": "CVE-2026-63850",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63850"
},
{
"name": "CVE-2026-63851",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63851"
},
{
"name": "CVE-2026-63852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63852"
},
{
"name": "CVE-2026-63853",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63853"
},
{
"name": "CVE-2026-63854",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63854"
},
{
"name": "CVE-2026-63855",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63855"
},
{
"name": "CVE-2026-63856",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63856"
},
{
"name": "CVE-2026-63857",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63857"
},
{
"name": "CVE-2026-63858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63858"
},
{
"name": "CVE-2026-63859",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63859"
},
{
"name": "CVE-2026-63860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63860"
},
{
"name": "CVE-2026-63861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63861"
},
{
"name": "CVE-2026-63862",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63862"
},
{
"name": "CVE-2026-63863",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63863"
},
{
"name": "CVE-2026-63864",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63864"
},
{
"name": "CVE-2026-63865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63865"
},
{
"name": "CVE-2026-63866",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63866"
},
{
"name": "CVE-2026-63875",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63875"
},
{
"name": "CVE-2026-63876",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63876"
},
{
"name": "CVE-2026-63877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63877"
},
{
"name": "CVE-2026-63878",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63878"
},
{
"name": "CVE-2026-63879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63879"
},
{
"name": "CVE-2026-63880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63880"
},
{
"name": "CVE-2026-63881",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63881"
},
{
"name": "CVE-2026-63882",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63882"
},
{
"name": "CVE-2026-63883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63883"
},
{
"name": "CVE-2026-63884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63884"
},
{
"name": "CVE-2026-63886",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63886"
},
{
"name": "CVE-2026-63887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63887"
},
{
"name": "CVE-2026-63888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63888"
},
{
"name": "CVE-2026-63889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63889"
},
{
"name": "CVE-2026-63890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63890"
},
{
"name": "CVE-2026-63891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63891"
},
{
"name": "CVE-2026-63892",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63892"
},
{
"name": "CVE-2026-63893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63893"
},
{
"name": "CVE-2026-63894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63894"
},
{
"name": "CVE-2026-63895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63895"
},
{
"name": "CVE-2026-63896",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63896"
},
{
"name": "CVE-2026-63897",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63897"
},
{
"name": "CVE-2026-63898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63898"
},
{
"name": "CVE-2026-63899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63899"
},
{
"name": "CVE-2026-63900",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63900"
},
{
"name": "CVE-2026-63901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63901"
},
{
"name": "CVE-2026-63902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63902"
},
{
"name": "CVE-2026-63903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63903"
},
{
"name": "CVE-2026-63904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63904"
},
{
"name": "CVE-2026-63905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63905"
},
{
"name": "CVE-2026-63906",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63906"
},
{
"name": "CVE-2026-63907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63907"
},
{
"name": "CVE-2026-63908",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63908"
},
{
"name": "CVE-2026-63909",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63909"
},
{
"name": "CVE-2026-63910",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63910"
},
{
"name": "CVE-2026-63911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63911"
},
{
"name": "CVE-2026-63912",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63912"
},
{
"name": "CVE-2026-63913",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63913"
},
{
"name": "CVE-2026-63914",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63914"
},
{
"name": "CVE-2026-63915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63915"
},
{
"name": "CVE-2026-63916",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63916"
},
{
"name": "CVE-2026-63917",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63917"
},
{
"name": "CVE-2026-63918",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63918"
},
{
"name": "CVE-2026-63919",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63919"
},
{
"name": "CVE-2026-63920",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63920"
},
{
"name": "CVE-2026-63921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63921"
},
{
"name": "CVE-2026-63922",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63922"
},
{
"name": "CVE-2026-63923",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63923"
},
{
"name": "CVE-2026-63924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63924"
},
{
"name": "CVE-2026-63925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63925"
},
{
"name": "CVE-2026-63926",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63926"
},
{
"name": "CVE-2026-63927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63927"
},
{
"name": "CVE-2026-63928",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63928"
},
{
"name": "CVE-2026-63929",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63929"
},
{
"name": "CVE-2026-63930",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63930"
},
{
"name": "CVE-2026-63931",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63931"
},
{
"name": "CVE-2026-63932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63932"
},
{
"name": "CVE-2026-63933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63933"
},
{
"name": "CVE-2026-63934",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63934"
},
{
"name": "CVE-2026-63935",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63935"
},
{
"name": "CVE-2026-63936",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63936"
},
{
"name": "CVE-2026-63937",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63937"
},
{
"name": "CVE-2026-63938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63938"
},
{
"name": "CVE-2026-63939",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63939"
},
{
"name": "CVE-2026-63940",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63940"
},
{
"name": "CVE-2026-63941",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63941"
},
{
"name": "CVE-2026-63942",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63942"
},
{
"name": "CVE-2026-63943",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63943"
},
{
"name": "CVE-2026-63944",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63944"
},
{
"name": "CVE-2026-63945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63945"
},
{
"name": "CVE-2026-63946",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63946"
},
{
"name": "CVE-2026-63947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63947"
},
{
"name": "CVE-2026-63948",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63948"
},
{
"name": "CVE-2026-63949",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63949"
},
{
"name": "CVE-2026-63950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63950"
},
{
"name": "CVE-2026-63951",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63951"
},
{
"name": "CVE-2026-63952",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63952"
},
{
"name": "CVE-2026-63953",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63953"
},
{
"name": "CVE-2026-63954",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63954"
},
{
"name": "CVE-2026-63955",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63955"
},
{
"name": "CVE-2026-63956",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63956"
},
{
"name": "CVE-2026-63957",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63957"
},
{
"name": "CVE-2026-63958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63958"
},
{
"name": "CVE-2026-63959",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63959"
},
{
"name": "CVE-2026-63960",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63960"
},
{
"name": "CVE-2026-63961",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63961"
},
{
"name": "CVE-2026-63962",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63962"
},
{
"name": "CVE-2026-63963",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63963"
},
{
"name": "CVE-2026-63964",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63964"
},
{
"name": "CVE-2026-63965",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63965"
},
{
"name": "CVE-2026-63966",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63966"
},
{
"name": "CVE-2026-63967",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63967"
},
{
"name": "CVE-2026-63968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63968"
},
{
"name": "CVE-2026-63969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63969"
},
{
"name": "CVE-2026-63970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63970"
},
{
"name": "CVE-2026-63971",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63971"
},
{
"name": "CVE-2026-63972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63972"
},
{
"name": "CVE-2026-63973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63973"
},
{
"name": "CVE-2026-63974",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63974"
},
{
"name": "CVE-2026-63975",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63975"
},
{
"name": "CVE-2026-63976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63976"
},
{
"name": "CVE-2026-63977",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63977"
},
{
"name": "CVE-2026-63978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63978"
},
{
"name": "CVE-2026-63979",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63979"
},
{
"name": "CVE-2026-63980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63980"
},
{
"name": "CVE-2026-63981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63981"
},
{
"name": "CVE-2026-63982",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63982"
},
{
"name": "CVE-2026-63983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63983"
},
{
"name": "CVE-2026-63984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63984"
},
{
"name": "CVE-2026-63985",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63985"
},
{
"name": "CVE-2026-63986",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63986"
},
{
"name": "CVE-2026-63987",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63987"
},
{
"name": "CVE-2026-63988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63988"
},
{
"name": "CVE-2026-63989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63989"
},
{
"name": "CVE-2026-63990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63990"
},
{
"name": "CVE-2026-63991",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63991"
},
{
"name": "CVE-2026-63992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63992"
},
{
"name": "CVE-2026-63993",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63993"
},
{
"name": "CVE-2026-63994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63994"
},
{
"name": "CVE-2026-63995",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63995"
},
{
"name": "CVE-2026-63996",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63996"
},
{
"name": "CVE-2026-63997",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63997"
},
{
"name": "CVE-2026-63998",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63998"
},
{
"name": "CVE-2026-63999",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-63999"
},
{
"name": "CVE-2026-64000",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64000"
},
{
"name": "CVE-2026-64001",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64001"
},
{
"name": "CVE-2026-64002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64002"
},
{
"name": "CVE-2026-64003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64003"
},
{
"name": "CVE-2026-64004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64004"
},
{
"name": "CVE-2026-64005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64005"
},
{
"name": "CVE-2026-64006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64006"
},
{
"name": "CVE-2026-64007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64007"
},
{
"name": "CVE-2026-64008",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64008"
},
{
"name": "CVE-2026-64009",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64009"
},
{
"name": "CVE-2026-64010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64010"
},
{
"name": "CVE-2026-64011",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64011"
},
{
"name": "CVE-2026-64012",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64012"
},
{
"name": "CVE-2026-64013",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64013"
},
{
"name": "CVE-2026-64014",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64014"
},
{
"name": "CVE-2026-64015",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64015"
},
{
"name": "CVE-2026-64017",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64017"
},
{
"name": "CVE-2026-64018",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64018"
},
{
"name": "CVE-2026-64019",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64019"
},
{
"name": "CVE-2026-64020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64020"
},
{
"name": "CVE-2026-64021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64021"
},
{
"name": "CVE-2026-64022",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64022"
},
{
"name": "CVE-2026-64023",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64023"
},
{
"name": "CVE-2026-64024",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64024"
},
{
"name": "CVE-2026-64025",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64025"
},
{
"name": "CVE-2026-64026",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64026"
},
{
"name": "CVE-2026-64027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64027"
},
{
"name": "CVE-2026-64029",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64029"
},
{
"name": "CVE-2026-64030",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64030"
},
{
"name": "CVE-2026-64031",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64031"
},
{
"name": "CVE-2026-64032",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64032"
},
{
"name": "CVE-2026-64033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64033"
},
{
"name": "CVE-2026-64034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64034"
},
{
"name": "CVE-2026-64035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64035"
},
{
"name": "CVE-2026-64036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64036"
},
{
"name": "CVE-2026-64037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64037"
},
{
"name": "CVE-2026-64038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64038"
},
{
"name": "CVE-2026-64039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64039"
},
{
"name": "CVE-2026-64040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64040"
},
{
"name": "CVE-2026-64041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64041"
},
{
"name": "CVE-2026-64042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64042"
},
{
"name": "CVE-2026-64043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64043"
},
{
"name": "CVE-2026-64044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64044"
},
{
"name": "CVE-2026-64045",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64045"
},
{
"name": "CVE-2026-64046",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64046"
},
{
"name": "CVE-2026-64047",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64047"
},
{
"name": "CVE-2026-64048",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64048"
},
{
"name": "CVE-2026-64049",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64049"
},
{
"name": "CVE-2026-64050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64050"
},
{
"name": "CVE-2026-64051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64051"
},
{
"name": "CVE-2026-64052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64052"
},
{
"name": "CVE-2026-64053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64053"
},
{
"name": "CVE-2026-64054",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64054"
},
{
"name": "CVE-2026-64055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64055"
},
{
"name": "CVE-2026-64056",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64056"
},
{
"name": "CVE-2026-64057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64057"
},
{
"name": "CVE-2026-64058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64058"
},
{
"name": "CVE-2026-64059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64059"
},
{
"name": "CVE-2026-64060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64060"
},
{
"name": "CVE-2026-64061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64061"
},
{
"name": "CVE-2026-64062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64062"
},
{
"name": "CVE-2026-64063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64063"
},
{
"name": "CVE-2026-64064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64064"
},
{
"name": "CVE-2026-64065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64065"
},
{
"name": "CVE-2026-64066",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64066"
},
{
"name": "CVE-2026-64067",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64067"
},
{
"name": "CVE-2026-64068",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64068"
},
{
"name": "CVE-2026-64069",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64069"
},
{
"name": "CVE-2026-64070",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64070"
},
{
"name": "CVE-2026-64071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64071"
},
{
"name": "CVE-2026-64072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64072"
},
{
"name": "CVE-2026-64073",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64073"
},
{
"name": "CVE-2026-64074",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64074"
},
{
"name": "CVE-2026-64075",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64075"
},
{
"name": "CVE-2026-64076",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64076"
},
{
"name": "CVE-2026-64077",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64077"
},
{
"name": "CVE-2026-64078",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64078"
},
{
"name": "CVE-2026-64079",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64079"
},
{
"name": "CVE-2026-64080",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64080"
},
{
"name": "CVE-2026-64081",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64081"
},
{
"name": "CVE-2026-64082",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64082"
},
{
"name": "CVE-2026-64083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64083"
},
{
"name": "CVE-2026-64084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64084"
},
{
"name": "CVE-2026-64085",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64085"
},
{
"name": "CVE-2026-64086",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64086"
},
{
"name": "CVE-2026-64087",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64087"
},
{
"name": "CVE-2026-64088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64088"
},
{
"name": "CVE-2026-64089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64089"
},
{
"name": "CVE-2026-64090",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64090"
},
{
"name": "CVE-2026-64091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64091"
},
{
"name": "CVE-2026-64093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64093"
},
{
"name": "CVE-2026-64094",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64094"
},
{
"name": "CVE-2026-64095",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64095"
},
{
"name": "CVE-2026-64096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64096"
},
{
"name": "CVE-2026-64097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64097"
},
{
"name": "CVE-2026-64098",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64098"
},
{
"name": "CVE-2026-64099",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64099"
},
{
"name": "CVE-2026-64100",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64100"
},
{
"name": "CVE-2026-64101",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64101"
},
{
"name": "CVE-2026-64102",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64102"
},
{
"name": "CVE-2026-64103",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64103"
},
{
"name": "CVE-2026-64104",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64104"
},
{
"name": "CVE-2026-64105",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64105"
},
{
"name": "CVE-2026-64106",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64106"
},
{
"name": "CVE-2026-64107",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64107"
},
{
"name": "CVE-2026-64108",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64108"
},
{
"name": "CVE-2026-64109",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64109"
},
{
"name": "CVE-2026-64110",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64110"
},
{
"name": "CVE-2026-64111",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64111"
},
{
"name": "CVE-2026-64112",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64112"
},
{
"name": "CVE-2026-64113",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64113"
},
{
"name": "CVE-2026-64114",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64114"
},
{
"name": "CVE-2026-64115",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64115"
},
{
"name": "CVE-2026-64116",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64116"
},
{
"name": "CVE-2026-64117",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64117"
},
{
"name": "CVE-2026-64118",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64118"
},
{
"name": "CVE-2026-64119",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64119"
},
{
"name": "CVE-2026-64120",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64120"
},
{
"name": "CVE-2026-64121",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64121"
},
{
"name": "CVE-2026-64122",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64122"
},
{
"name": "CVE-2026-64123",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64123"
},
{
"name": "CVE-2026-64124",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64124"
},
{
"name": "CVE-2026-64125",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64125"
},
{
"name": "CVE-2026-64126",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64126"
},
{
"name": "CVE-2026-64127",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64127"
},
{
"name": "CVE-2026-64128",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64128"
},
{
"name": "CVE-2026-64129",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64129"
},
{
"name": "CVE-2026-64130",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64130"
},
{
"name": "CVE-2026-64131",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64131"
},
{
"name": "CVE-2026-64132",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64132"
},
{
"name": "CVE-2026-64133",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64133"
},
{
"name": "CVE-2026-64134",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64134"
},
{
"name": "CVE-2026-64135",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64135"
},
{
"name": "CVE-2026-64136",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64136"
},
{
"name": "CVE-2026-64137",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64137"
},
{
"name": "CVE-2026-64138",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64138"
},
{
"name": "CVE-2026-64139",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64139"
},
{
"name": "CVE-2026-64140",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64140"
},
{
"name": "CVE-2026-64141",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64141"
},
{
"name": "CVE-2026-64142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64142"
},
{
"name": "CVE-2026-64143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64143"
},
{
"name": "CVE-2026-64144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64144"
},
{
"name": "CVE-2026-64145",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64145"
},
{
"name": "CVE-2026-64146",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64146"
},
{
"name": "CVE-2026-64147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64147"
},
{
"name": "CVE-2026-64148",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64148"
},
{
"name": "CVE-2026-64149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64149"
},
{
"name": "CVE-2026-64150",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64150"
},
{
"name": "CVE-2026-64151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64151"
},
{
"name": "CVE-2026-64152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64152"
},
{
"name": "CVE-2026-64153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64153"
},
{
"name": "CVE-2026-64154",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64154"
},
{
"name": "CVE-2026-64155",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64155"
},
{
"name": "CVE-2026-64156",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64156"
},
{
"name": "CVE-2026-64157",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64157"
},
{
"name": "CVE-2026-64158",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64158"
},
{
"name": "CVE-2026-64159",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64159"
},
{
"name": "CVE-2026-64160",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64160"
},
{
"name": "CVE-2026-64161",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64161"
},
{
"name": "CVE-2026-64162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64162"
},
{
"name": "CVE-2026-64163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64163"
},
{
"name": "CVE-2026-64164",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64164"
},
{
"name": "CVE-2026-64165",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64165"
},
{
"name": "CVE-2026-64166",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64166"
},
{
"name": "CVE-2026-64167",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64167"
},
{
"name": "CVE-2026-64168",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64168"
},
{
"name": "CVE-2026-64169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64169"
},
{
"name": "CVE-2026-64170",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64170"
},
{
"name": "CVE-2026-64171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64171"
},
{
"name": "CVE-2026-64172",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64172"
},
{
"name": "CVE-2026-64173",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64173"
},
{
"name": "CVE-2026-64174",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64174"
},
{
"name": "CVE-2026-64175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64175"
},
{
"name": "CVE-2026-64176",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64176"
},
{
"name": "CVE-2026-64177",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64177"
},
{
"name": "CVE-2026-64178",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64178"
},
{
"name": "CVE-2026-64179",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64179"
},
{
"name": "CVE-2026-64180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64180"
},
{
"name": "CVE-2026-64181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64181"
},
{
"name": "CVE-2026-64182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64182"
},
{
"name": "CVE-2026-64183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64183"
},
{
"name": "CVE-2026-64184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64184"
},
{
"name": "CVE-2026-64185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64185"
},
{
"name": "CVE-2026-64186",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64186"
},
{
"name": "CVE-2026-64519",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64519"
},
{
"name": "CVE-2026-64520",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64520"
},
{
"name": "CVE-2026-64521",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64521"
},
{
"name": "CVE-2026-64522",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64522"
},
{
"name": "CVE-2026-64523",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64523"
},
{
"name": "CVE-2026-64524",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64524"
},
{
"name": "CVE-2026-64525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64525"
},
{
"name": "CVE-2026-64526",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64526"
},
{
"name": "CVE-2026-64527",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64527"
},
{
"name": "CVE-2026-64528",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64528"
}
],
"initial_release_date": "2026-07-31T00:00:00",
"last_revision_date": "2026-07-31T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0954",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-07-31T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-07-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8622-1",
"url": "https://ubuntu.com/security/notices/USN-8622-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8620-1",
"url": "https://ubuntu.com/security/notices/USN-8620-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8604-1",
"url": "https://ubuntu.com/security/notices/USN-8604-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8615-1",
"url": "https://ubuntu.com/security/notices/USN-8615-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8574-3",
"url": "https://ubuntu.com/security/notices/USN-8574-3"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8619-1",
"url": "https://ubuntu.com/security/notices/USN-8619-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8595-2",
"url": "https://ubuntu.com/security/notices/USN-8595-2"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8570-2",
"url": "https://ubuntu.com/security/notices/USN-8570-2"
},
{
"published_at": "2026-07-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8623-1",
"url": "https://ubuntu.com/security/notices/USN-8623-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8575-3",
"url": "https://ubuntu.com/security/notices/USN-8575-3"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8608-1",
"url": "https://ubuntu.com/security/notices/USN-8608-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8547-2",
"url": "https://ubuntu.com/security/notices/USN-8547-2"
},
{
"published_at": "2026-07-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8615-2",
"url": "https://ubuntu.com/security/notices/USN-8615-2"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8618-1",
"url": "https://ubuntu.com/security/notices/USN-8618-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8617-1",
"url": "https://ubuntu.com/security/notices/USN-8617-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8609-1",
"url": "https://ubuntu.com/security/notices/USN-8609-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8607-1",
"url": "https://ubuntu.com/security/notices/USN-8607-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8595-3",
"url": "https://ubuntu.com/security/notices/USN-8595-3"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8605-1",
"url": "https://ubuntu.com/security/notices/USN-8605-1"
},
{
"published_at": "2026-07-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8616-1",
"url": "https://ubuntu.com/security/notices/USN-8616-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8603-1",
"url": "https://ubuntu.com/security/notices/USN-8603-1"
},
{
"published_at": "2026-07-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8620-2",
"url": "https://ubuntu.com/security/notices/USN-8620-2"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8610-1",
"url": "https://ubuntu.com/security/notices/USN-8610-1"
},
{
"published_at": "2026-07-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8606-1",
"url": "https://ubuntu.com/security/notices/USN-8606-1"
}
]
}
FKIE_CVE-2026-45893
Vulnerability from fkie_nvd - Published: 2026-05-27 14:17 - Updated: 2026-06-25 21:10| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/226c3b10aab23f73b03c47e7773107de56ba3a4e | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/47e351dfef60ab0e3285133556e1a9c7f646a969 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/6fc367bfd4c8886e6b1742aabbd1c0bdc310db3a | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/e027999049c493fb728ead5a90db76942181a935 | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"security/apparmor/include/match.h",
"security/apparmor/match.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "47e351dfef60ab0e3285133556e1a9c7f646a969",
"status": "affected",
"version": "e6e8bf418850d7958311a96ccfb594f2bcc8313e",
"versionType": "git"
},
{
"lessThan": "e027999049c493fb728ead5a90db76942181a935",
"status": "affected",
"version": "e6e8bf418850d7958311a96ccfb594f2bcc8313e",
"versionType": "git"
},
{
"lessThan": "226c3b10aab23f73b03c47e7773107de56ba3a4e",
"status": "affected",
"version": "e6e8bf418850d7958311a96ccfb594f2bcc8313e",
"versionType": "git"
},
{
"lessThan": "6fc367bfd4c8886e6b1742aabbd1c0bdc310db3a",
"status": "affected",
"version": "e6e8bf418850d7958311a96ccfb594f2bcc8313e",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"security/apparmor/include/match.h",
"security/apparmor/match.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.11"
},
{
"lessThan": "4.11",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.75",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.18.*",
"status": "unaffected",
"version": "6.18.14",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.19.*",
"status": "unaffected",
"version": "6.19.4",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "7.0",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "9460E9E9-5019-444D-B0AD-BB3A9C752456",
"versionEndExcluding": "6.12.75",
"versionStartIncluding": "4.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "BF463CB7-1F58-4607-B847-77ED23E4B9B7",
"versionEndExcluding": "6.18.14",
"versionStartIncluding": "6.13",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "672A3E79-EC03-479D-8503-361DFBDC8092",
"versionEndExcluding": "6.19.4",
"versionStartIncluding": "6.19",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\napparmor: Fix \u0026 Optimize table creation from possibly unaligned memory\n\nSource blob may come from userspace and might be unaligned.\nTry to optize the copying process by avoiding unaligned memory accesses.\n\n- Added Fixes tag\n- Added \"Fix \u0026\" to description as this doesn\u0027t just optimize but fixes\n a potential unaligned memory access\n[jj: remove duplicate word \"convert\" in comment trigger checkpatch warning]"
}
],
"id": "CVE-2026-45893",
"lastModified": "2026-06-25T21:10:15.113",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.1,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.2,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2026-05-27T14:17:03.487",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/226c3b10aab23f73b03c47e7773107de56ba3a4e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/47e351dfef60ab0e3285133556e1a9c7f646a969"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/6fc367bfd4c8886e6b1742aabbd1c0bdc310db3a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/e027999049c493fb728ead5a90db76942181a935"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-125"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-44WW-RW32-794R
Vulnerability from github – Published: 2026-05-27 15:33 – Updated: 2026-06-25 21:31In the Linux kernel, the following vulnerability has been resolved:
apparmor: Fix & Optimize table creation from possibly unaligned memory
Source blob may come from userspace and might be unaligned. Try to optize the copying process by avoiding unaligned memory accesses.
- Added Fixes tag
- Added "Fix &" to description as this doesn't just optimize but fixes a potential unaligned memory access [jj: remove duplicate word "convert" in comment trigger checkpatch warning]
{
"affected": [],
"aliases": [
"CVE-2026-45893"
],
"database_specific": {
"cwe_ids": [
"CWE-125"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2026-05-27T14:17:03Z",
"severity": "HIGH"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\napparmor: Fix \u0026 Optimize table creation from possibly unaligned memory\n\nSource blob may come from userspace and might be unaligned.\nTry to optize the copying process by avoiding unaligned memory accesses.\n\n- Added Fixes tag\n- Added \"Fix \u0026\" to description as this doesn\u0027t just optimize but fixes\n a potential unaligned memory access\n[jj: remove duplicate word \"convert\" in comment trigger checkpatch warning]",
"id": "GHSA-44ww-rw32-794r",
"modified": "2026-06-25T21:31:20Z",
"published": "2026-05-27T15:33:14Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45893"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/226c3b10aab23f73b03c47e7773107de56ba3a4e"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/47e351dfef60ab0e3285133556e1a9c7f646a969"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/6fc367bfd4c8886e6b1742aabbd1c0bdc310db3a"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/e027999049c493fb728ead5a90db76942181a935"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:H",
"type": "CVSS_V3"
}
]
}
MSRC_CVE-2026-45893
Vulnerability from csaf_microsoft - Published: 2026-05-28 01:06 - Updated: 2026-09-24 02:32OESA-2026-2676 (CVE-2025-39781)
Vulnerability from osv_openeuler – Published: 2026-06-12 11:11 – Updated: 2026-08-06 11:11 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
parisc: Drop WARN_ON_ONCE() from flush_cache_vmap
I have observed warning to occassionally trigger.(CVE-2025-39781)
In the Linux kernel, the following vulnerability has been resolved:
MIPS: ftrace: Fix memory corruption when kernel is located beyond 32 bits
Since commit e424054000878 ("MIPS: Tracing: Reduce the overhead of dynamic Function Tracer"), the macro UASM_i_LA_mostly has been used, and this macro can generate more than 2 instructions. At the same time, the code in ftrace assumes that no more than 2 instructions can be generated, which is why it stores them in an int[2] array. However, as previously noted, the macro UASM_i_LA_mostly (and now UASM_i_LA) causes a buffer overflow when _mcount is beyond 32 bits. This leads to corruption of the variables located in the __read_mostly section.
This corruption was observed because the variable __cpu_primary_thread_mask was corrupted, causing a hang very early during boot.
This fix prevents the corruption by avoiding the generation of instructions if they could exceed 2 instructions in length. Fortunately, insn_la_mcount is only used if the instrumented code is located outside the kernel code section, so dynamic ftrace can still be used, albeit in a more limited scope. This is still preferable to corrupting memory and/or crashing the kernel.(CVE-2025-71109)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/pm: Disable MMIO access during SMU Mode 1 reset
During Mode 1 reset, the ASIC undergoes a reset cycle and becomes temporarily inaccessible via PCIe. Any attempt to access MMIO registers during this window (e.g., from interrupt handlers or other driver threads) can result in uncompleted PCIe transactions, leading to NMI panics or system hangs.
To prevent this, set the no_hw_access flag to true immediately after
triggering the reset. This signals other driver components to skip
register accesses while the device is offline.
A memory barrier smp_mb() is added to ensure the flag update is
globally visible to all cores before the driver enters the sleep/wait
state.
(cherry picked from commit 7edb503fe4b6d67f47d8bb0dfafb8e699bb0f8a4)(CVE-2026-23213)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: reject new transactions if the fs is fully read-only
[BUG] There is a bug report where a heavily fuzzed fs is mounted with all rescue mount options, which leads to the following warnings during unmount:
BTRFS: Transaction aborted (error -22) Modules linked in: CPU: 0 UID: 0 PID: 9758 Comm: repro.out Not tainted 6.19.0-rc5-00002-gb71e635feefc #7 PREEMPT(full) Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014 RIP: 0010:find_free_extent_update_loop fs/btrfs/extent-tree.c:4208 [inline] RIP: 0010:find_free_extent+0x52f0/0x5d20 fs/btrfs/extent-tree.c:4611 Call Trace: <TASK> btrfs_reserve_extent+0x2cd/0x790 fs/btrfs/extent-tree.c:4705 btrfs_alloc_tree_block+0x1e1/0x10e0 fs/btrfs/extent-tree.c:5157 btrfs_force_cow_block+0x578/0x2410 fs/btrfs/ctree.c:517 btrfs_cow_block+0x3c4/0xa80 fs/btrfs/ctree.c:708 btrfs_search_slot+0xcad/0x2b50 fs/btrfs/ctree.c:2130 btrfs_truncate_inode_items+0x45d/0x2350 fs/btrfs/inode-item.c:499 btrfs_evict_inode+0x923/0xe70 fs/btrfs/inode.c:5628 evict+0x5f4/0xae0 fs/inode.c:837 __dentry_kill+0x209/0x660 fs/dcache.c:670 finish_dput+0xc9/0x480 fs/dcache.c:879 shrink_dcache_for_umount+0xa0/0x170 fs/dcache.c:1661 generic_shutdown_super+0x67/0x2c0 fs/super.c:621 kill_anon_super+0x3b/0x70 fs/super.c:1289 btrfs_kill_super+0x41/0x50 fs/btrfs/super.c:2127 deactivate_locked_super+0xbc/0x130 fs/super.c:474 cleanup_mnt+0x425/0x4c0 fs/namespace.c:1318 task_work_run+0x1d4/0x260 kernel/task_work.c:233 exit_task_work include/linux/task_work.h:40 [inline] do_exit+0x694/0x22f0 kernel/exit.c:971 do_group_exit+0x21c/0x2d0 kernel/exit.c:1112 __do_sys_exit_group kernel/exit.c:1123 [inline] __se_sys_exit_group kernel/exit.c:1121 [inline] __x64_sys_exit_group+0x3f/0x40 kernel/exit.c:1121 x64_sys_call+0x2210/0x2210 arch/x86/include/generated/asm/syscalls_64.h:232 do_syscall_x64 arch/x86/entry/syscall_64.c:63 [inline] do_syscall_64+0xe8/0xf80 arch/x86/entry/syscall_64.c:94 entry_SYSCALL_64_after_hwframe+0x77/0x7f RIP: 0033:0x44f639 Code: Unable to access opcode bytes at 0x44f60f. RSP: 002b:00007ffc15c4e088 EFLAGS: 00000246 ORIG_RAX: 00000000000000e7 RAX: ffffffffffffffda RBX: 00000000004c32f0 RCX: 000000000044f639 RDX: 000000000000003c RSI: 00000000000000e7 RDI: 0000000000000001 RBP: 0000000000000001 R08: ffffffffffffffc0 R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000246 R12: 00000000004c32f0 R13: 0000000000000001 R14: 0000000000000000 R15: 0000000000000001 </TASK>
Since rescue mount options will mark the full fs read-only, there should be no new transaction triggered.
But during unmount we will evict all inodes, which can trigger a new transaction, and triggers warnings on a heavily corrupted fs.
[CAUSE] Btrfs allows new transaction even on a read-only fs, this is to allow log replay happen even on read-only mounts, just like what ext4/xfs do.
However with rescue mount options, the fs is fully read-only and cannot be remounted read-write, thus in that case we should also reject any new transactions.
[FIX] If we find the fs has rescue mount options, we should treat the fs as error, so that no new transaction can be started.(CVE-2026-23214)
In the Linux kernel, the following vulnerability has been resolved:
driver core: platform: use generic driver_override infrastructure
When a driver is probed through __driver_attach(), the bus' match() callback is called without the device lock held, thus accessing the driver_override field without a lock, which can cause a UAF.
Fix this by using the driver-core driver_override infrastructure taking care of proper locking internally.
Note that calling match() from __driver_attach() without the device lock held is intentional. 1
In the Linux kernel, the following vulnerability has been resolved:
usbip: validate number_of_packets in usbip_pack_ret_submit()
When a USB/IP client receives a RET_SUBMIT response, usbip_pack_ret_submit() unconditionally overwrites urb->number_of_packets from the network PDU. This value is subsequently used as the loop bound in usbip_recv_iso() and usbip_pad_iso() to iterate over urb->iso_frame_desc[], a flexible array whose size was fixed at URB allocation time based on the original number_of_packets from the CMD_SUBMIT.
A malicious USB/IP server can set number_of_packets in the response to a value larger than what was originally submitted, causing a heap out-of-bounds write when usbip_recv_iso() writes to urb->iso_frame_desc[i] beyond the allocated region.
KASAN confirmed this with kernel 7.0.0-rc5:
BUG: KASAN: slab-out-of-bounds in usbip_recv_iso+0x46a/0x640 Write of size 4 at addr ffff888106351d40 by task vhci_rx/69
The buggy address is located 0 bytes to the right of allocated 320-byte region [ffff888106351c00, ffff888106351d40)
The server side (stub_rx.c) and gadget side (vudc_rx.c) already validate number_of_packets in the CMD_SUBMIT path since commits c6688ef9f297 ("usbip: fix stub_rx: harden CMD_SUBMIT path to handle malicious input") and b78d830f0049 ("usbip: fix vudc_rx: harden CMD_SUBMIT path to handle malicious input"). The server side validates against USBIP_MAX_ISO_PACKETS because no URB exists yet at that point. On the client side we have the original URB, so we can use the tighter bound: the response must not exceed the original number_of_packets.
This mirrors the existing validation of actual_length against transfer_buffer_length in usbip_recv_xbuff(), which checks the response value against the original allocation size.
Kelvin Mbogo's series ("usb: usbip: fix integer overflow in usbip_recv_iso()", v2) hardens the receive-side functions themselves; this patch complements that work by catching the bad value at its source -- in usbip_pack_ret_submit() before the overwrite -- and using the tighter per-URB allocation bound rather than the global USBIP_MAX_ISO_PACKETS limit.
Fix this by checking rpdu->number_of_packets against urb->number_of_packets in usbip_pack_ret_submit() before the overwrite. On violation, clamp to zero so that usbip_recv_iso() and usbip_pad_iso() safely return early.(CVE-2026-31607)
In the Linux kernel, the following vulnerability has been resolved:
tipc: fix bc_ackers underflow on duplicate GRP_ACK_MSG
The GRP_ACK_MSG handler in tipc_group_proto_rcv() currently decrements bc_ackers on every inbound group ACK, even when the same member has already acknowledged the current broadcast round.
Because bc_ackers is a u16, a duplicate ACK received after the last legitimate ACK wraps the counter to 65535. Once wrapped, tipc_group_bc_cong() keeps reporting congestion and later group broadcasts on the affected socket stay blocked until the group is recreated.
Fix this by ignoring duplicate or stale ACKs before touching bc_acked or bc_ackers. This makes repeated GRP_ACK_MSG handling idempotent and prevents the underflow path.(CVE-2026-31662)
In the Linux kernel, the following vulnerability has been resolved: smb: client: validate the whole DACL before rewriting it in cifsacl. build_sec_desc() and id_mode_to_cifs_acl() derive a DACL pointer from a server-supplied dacloffset and then use the incoming ACL to rebuild the chmod/chown security descriptor. The original fix only checked that the struct smb_acl header fits before reading dacl_ptr->size or dacl_ptr->num_aces. That avoids the immediate header-field OOB read, but the rewrite helpers still walk ACEs based on pdacl->num_aces with no structural validation of the incoming DACL body. A malicious server can return a truncated DACL that still contains a header, claims one or more ACEs, and then drive replace_sids_and_copy_aces() or set_chmod_dacl() past the validated extent while they compare or copy attacker-controlled ACEs.(CVE-2026-31709)
In the Linux kernel, the following vulnerability has been resolved:
usb: ulpi: fix double free in ulpi_register_interface() error path
When device_register() fails, ulpi_register() calls put_device() on ulpi->dev.
The device release callback ulpi_dev_release() drops the OF node reference and frees ulpi, but the current error path in ulpi_register_interface() then calls kfree(ulpi) again, causing a double free.
Let put_device() handle the cleanup through ulpi_dev_release() and avoid freeing ulpi again in ulpi_register_interface().(CVE-2026-31759)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_tables: reject immediate NF_QUEUE verdict
nft_queue is always used from userspace nftables to deliver the NF_QUEUE verdict. Immediately emitting an NF_QUEUE verdict is never used by the userspace nft tools, so reject immediate NF_QUEUE verdicts.
The arp family does not provide queue support, but such an immediate verdict is still reachable. Globally reject NF_QUEUE immediate verdicts to address this issue.(CVE-2026-43024)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: icmp: clear skb2->cb[] in ip6_err_gen_icmpv6_unreach()
Sashiko AI-review observed:
In ip6_err_gen_icmpv6_unreach(), the skb is an outer IPv4 ICMP error packet where its cb contains an IPv4 inet_skb_parm. When skb is cloned into skb2 and passed to icmp6_send(), it uses IP6CB(skb2).
IP6CB interprets the IPv4 inet_skb_parm as an inet6_skb_parm. The cipso offset in inet_skb_parm.opt directly overlaps with dsthao in inet6_skb_parm at offset 18.
If an attacker sends a forged ICMPv4 error with a CIPSO IP option, dsthao would be a non-zero offset. Inside icmp6_send(), mip6_addr_swap() is called and uses ipv6_find_tlv(skb, opt->dsthao, IPV6_TLV_HAO).
This would scan the inner, attacker-controlled IPv6 packet starting at that offset, potentially returning a fake TLV without checking if the remaining packet length can hold the full 18-byte struct ipv6_destopt_hao.
Could mip6_addr_swap() then perform a 16-byte swap that extends past the end of the packet data into skb_shared_info?
Should the cb array also be cleared in ip6_err_gen_icmpv6_unreach() and ip6ip6_err() to prevent this?
This patch implements the first suggestion.
I am not sure if ip6ip6_err() needs to be changed. A separate patch would be better anyway.(CVE-2026-43038)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: MGMT: Fix list corruption and UAF in command complete handlers
Commit 302a1f674c00 ("Bluetooth: MGMT: Fix possible UAFs") introduced mgmt_pending_valid(), which not only validates the pending command but also unlinks it from the pending list if it is valid. This change in semantics requires updates to several completion handlers to avoid list corruption and memory safety issues.
This patch addresses two left-over issues from the aforementioned rework:
-
In mgmt_add_adv_patterns_monitor_complete(), mgmt_pending_remove() is replaced with mgmt_pending_free() in the success path. Since mgmt_pending_valid() already unlinks the command at the beginning of the function, calling mgmt_pending_remove() leads to a double list_del() and subsequent list corruption/kernel panic.
-
In set_mesh_complete(), the use of mgmt_pending_foreach() in the error path is removed. Since the current command is already unlinked by mgmt_pending_valid(), this foreach loop would incorrectly target other pending mesh commands, potentially freeing them while they are still being processed concurrently (leading to UAFs). The redundant mgmt_cmd_status() is also simplified to use cmd->opcode directly.(CVE-2026-43059)
In the Linux kernel, the following vulnerability has been resolved:
net: ioam6: fix OOB and missing lock
When trace->type.bit6 is set:
if (trace->type.bit6) {
...
queue = skb_get_tx_queue(dev, skb);
qdisc = rcu_dereference(queue->qdisc);
This code can lead to an out-of-bounds access of the dev->_tx[] array when is_input is true. In such a case, the packet is on the RX path and skb->queue_mapping contains the RX queue index of the ingress device. If the ingress device has more RX queues than the egress device (dev) has TX queues, skb_get_queue_mapping(skb) will exceed dev->num_tx_queues. Add a check to avoid this situation since skb_get_tx_queue() does not clamp the index. This issue has also revealed that per queue visibility cannot be accurate and will be replaced later as a new feature.
While at it, add missing lock around qdisc_qstats_qlen_backlog(). The function __ioam6_fill_trace_data() is called from both softirq and process contexts, hence the use of spin_lock_bh() here.(CVE-2026-43083)
In the Linux kernel, the following vulnerability has been resolved:
net: af_key: zero aligned sockaddr tail in PF_KEY exports
PF_KEY export paths use pfkey_sockaddr_size() when reserving sockaddr
payload space, so IPv6 addresses occupy 32 bytes on the wire. However,
pfkey_sockaddr_fill() initializes only the first 28 bytes of
struct sockaddr_in6, leaving the final 4 aligned bytes uninitialized.
Not every PF_KEY message is affected. The state and policy dump builders
already zero the whole message buffer before filling the sockaddr
payloads. Keep the fix to the export paths that still append aligned
sockaddr payloads with plain skb_put():
SADB_ACQUIRESADB_X_NAT_T_NEW_MAPPINGSADB_X_MIGRATE
Fix those paths by clearing only the aligned sockaddr tail after
pfkey_sockaddr_fill().(CVE-2026-43088)
In the Linux kernel, the following vulnerability has been resolved:
xfrm_user: fix info leak in build_mapping()
struct xfrm_usersa_id has a one-byte padding hole after the proto field, which ends up never getting set to zero before copying out to userspace. Fix that up by zeroing out the whole structure before setting individual variables.(CVE-2026-43089)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: ioam: fix potential NULL dereferences in __ioam6_fill_trace_data()
We need to check __in6_dev_get() for possible NULL value, as suggested by Yiming Qian.
Also add skb_dst_dev_rcu() instead of skb_dst_dev(), and two missing READ_ONCE().
Note that @dev can't be NULL.(CVE-2026-43101)
In the Linux kernel, the following vulnerability has been resolved:
xfrm: account XFRMA_IF_ID in aevent size calculation
xfrm_get_ae() allocates the reply skb with xfrm_aevent_msgsize(), then build_aevent() appends attributes including XFRMA_IF_ID when x->if_id is set.
xfrm_aevent_msgsize() does not include space for XFRMA_IF_ID. For states with if_id, build_aevent() can fail with -EMSGSIZE and hit BUG_ON(err < 0) in xfrm_get_ae(), turning a malformed netlink interaction into a kernel panic.
Account XFRMA_IF_ID in the size calculation unconditionally and replace the BUG_ON with normal error unwinding.(CVE-2026-43107)
In the Linux kernel, the following vulnerability has been resolved:
net: usb: kaweth: remove TX queue manipulation in kaweth_set_rx_mode
kaweth_set_rx_mode(), the ndo_set_rx_mode callback, calls netif_stop_queue() and netif_wake_queue(). These are TX queue flow control functions unrelated to RX multicast configuration.
The premature netif_wake_queue() can re-enable TX while tx_urb is still in-flight, leading to a double usb_submit_urb() on the same URB:
kaweth_start_xmit() { netif_stop_queue(); usb_submit_urb(kaweth->tx_urb); }
kaweth_set_rx_mode() { netif_stop_queue(); netif_wake_queue(); // wakes TX queue before URB is done }
kaweth_start_xmit() { netif_stop_queue(); usb_submit_urb(kaweth->tx_urb); // URB submitted while active }
This triggers the WARN in usb_submit_urb():
"URB submitted while active"
This is a similar class of bug fixed in rtl8150 by
- commit 958baf5eaee3 ("net: usb: Remove disruptive netif_wake_queue in rtl8150_set_multicast").
Also kaweth_set_rx_mode() is already functionally broken, the real set_rx_mode action is performed by kaweth_async_set_rx_mode(), which in turn is not a no-op only at ndo_open() time.(CVE-2026-43180)
In the Linux kernel, the following vulnerability has been resolved:
net: consume xmit errors of GSO frames
udpgro_frglist.sh and udpgro_bench.sh are the flakiest tests currently in NIPA. They fail in the same exact way, TCP GRO test stalls occasionally and the test gets killed after 10min.
These tests use veth to simulate GRO. They attach a trivial ("return XDP_PASS;") XDP program to the veth to force TSO off and NAPI on.
Digging into the failure mode we can see that the connection is completely stuck after a burst of drops. The sender's snd_nxt is at sequence number N [1], but the receiver claims to have received (rcv_nxt) up to N + 3 * MSS [2]. Last piece of the puzzle is that senders rtx queue is not empty (let's say the block in the rtx queue is at sequence number N - 4 * MSS [3]).
In this state, sender sends a retransmission from the rtx queue with a single segment, and sequence numbers N-4MSS:N-3MSS [3]. Receiver sees it and responds with an ACK all the way up to N + 3 * MSS [2]. But sender will reject this ack as TCP_ACK_UNSENT_DATA because it has no recollection of ever sending data that far out [1]. And we are stuck.
The root cause is the mess of the xmit return codes. veth returns an error when it can't xmit a frame. We end up with a loss event like this:
| GSO super frame 1 | GSO super frame 2 | |-----------------------------------------------| | seg | seg | seg | seg | seg | seg | seg | seg | | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 |
x ok ok <ok>| ok ok ok <x>
\\
snd_nxt
"x" means packet lost by veth, and "ok" means it went thru. Since veth has TSO disabled in this test it sees individual segments. Segment 1 is on the retransmit queue and will be resent.
So why did the sender not advance snd_nxt even tho it clearly did send up to seg 8? tcp_write_xmit() interprets the return code from the core to mean that data has not been sent at all. Since TCP deals with GSO super frames, not individual segment the crux of the problem is that loss of a single segment can be interpreted as loss of all. TCP only sees the last return code for the last segment of the GSO frame (in <> brackets in the diagram above).
Of course for the problem to occur we need a setup or a device without a Qdisc. Otherwise Qdisc layer disconnects the protocol layer from the device errors completely.
We have multiple ways to fix this.
1) make veth not return an error when it lost a packet. While this is what I think we did in the past, the issue keeps reappearing and it's annoying to debug. The game of whack a mole is not great.
2) fix the damn return codes We only talk about NETDEV_TX_OK and NETDEV_TX_BUSY in the documentation, so maybe we should make the return code from ndo_start_xmit() a boolean. I like that the most, but perhaps some ancient, not-really-networking protocol would suffer.
3) make TCP ignore the errors It is not entirely clear to me what benefit TCP gets from interpreting the result of ip_queue_xmit()? Specifically once the connection is established and we're pushing data - packet loss is just packet loss?
4) this fix Ignore the rc in the Qdisc-less+GSO case, since it's unreliable. We already always return OK in the TCQ_F_CAN_BYPASS case. In the Qdisc-less case let's be a bit more conservative and only mask the GSO errors. This path is taken by non-IP-"networks" like CAN, MCTP etc, so we could regress some ancient thing. This is the simplest, but also maybe the hackiest fix?
Similar fix has been proposed by Eric in the past but never committed because original reporter was working with an OOT driver and wasn't providing feedback (see Link).(CVE-2026-43194)
In the Linux kernel, the following vulnerability has been resolved:
tcp: fix potential race in tcp_v6_syn_recv_sock()
Code in tcp_v6_syn_recv_sock() after the call to tcp_v4_syn_recv_sock() is done too late.
After tcp_v4_syn_recv_sock(), the child socket is already visible from TCP ehash table and other cpus might use it.
Since newinet->pinet6 is still pointing to the listener ipv6_pinfo bad things can happen as syzbot found.
Move the problematic code in tcp_v6_mapped_child_init() and call this new helper from tcp_v4_syn_recv_sock() before the ehash insertion.
This allows the removal of one tcp_sync_mss(), since tcp_v4_syn_recv_sock() will call it with the correct context.(CVE-2026-43198)
In the Linux kernel, the following vulnerability has been resolved:
net: Drop the lock in skb_may_tx_timestamp()
skb_may_tx_timestamp() may acquire sock::sk_callback_lock. The lock must not be taken in IRQ context, only softirq is okay. A few drivers receive the timestamp via a dedicated interrupt and complete the TX timestamp from that handler. This will lead to a deadlock if the lock is already write-locked on the same CPU.
Taking the lock can be avoided. The socket (pointed by the skb) will remain valid until the skb is released. The ->sk_socket and ->file member will be set to NULL once the user closes the socket which may happen before the timestamp arrives. If we happen to observe the pointer while the socket is closing but before the pointer is set to NULL then we may use it because both pointer (and the file's cred member) are RCU freed.
Drop the lock. Use READ_ONCE() to obtain the individual pointer. Add a matching WRITE_ONCE() where the pointer are cleared.(CVE-2026-43216)
In the Linux kernel, the following vulnerability has been resolved:
vhost: move vdpa group bound check to vhost_vdpa
Remove duplication by consolidating these here. This reduces the posibility of a parent driver missing them.
While we're at it, fix a bug in vdpa_sim where a valid ASID can be assigned to a group equal to ngroups, causing an out of bound write.(CVE-2026-43248)
In the Linux kernel, the following vulnerability has been resolved:
mm/page_alloc: clear page->private in free_pages_prepare()
Several subsystems (slub, shmem, ttm, etc.) use page->private but don't clear it before freeing pages. When these pages are later allocated as high-order pages and split via split_page(), tail pages retain stale page->private values.
This causes a use-after-free in the swap subsystem. The swap code uses page->private to track swap count continuations, assuming freshly allocated pages have page->private == 0. When stale values are present, swap_count_continued() incorrectly assumes the continuation list is valid and iterates over uninitialized page->lru containing LIST_POISON values, causing a crash:
KASAN: maybe wild-memory-access in range [0xdead000000000100-0xdead000000000107] RIP: 0010:__do_sys_swapoff+0x1151/0x1860
Fix this by clearing page->private in free_pages_prepare(), ensuring all freed pages have clean state regardless of previous use.(CVE-2026-43303)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: SMP: force responder MITM requirements before building the pairing response
smp_cmd_pairing_req() currently builds the pairing response from the initiator auth_req before enforcing the local BT_SECURITY_HIGH requirement. If the initiator omits SMP_AUTH_MITM, the response can also omit it even though the local side still requires MITM.
tk_request() then sees an auth value without SMP_AUTH_MITM and may select JUST_CFM, making method selection inconsistent with the pairing policy the responder already enforces.
When the local side requires HIGH security, first verify that MITM can be achieved from the IO capabilities and then force SMP_AUTH_MITM in the response in both rsp.auth_req and auth. This keeps the responder auth bits and later method selection aligned.(CVE-2026-43334)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5e: RX, Fix XDP multi-buf frag counting for striding RQ
XDP multi-buf programs can modify the layout of the XDP buffer when the program calls bpf_xdp_pull_data() or bpf_xdp_adjust_tail(). The referenced commit in the fixes tag corrected the assumption in the mlx5 driver that the XDP buffer layout doesn't change during a program execution. However, this fix introduced another issue: the dropped fragments still need to be counted on the driver side to avoid page fragment reference counting issues.
The issue was discovered by the drivers/net/xdp.py selftest, more specifically the test_xdp_native_tx_mb: - The mlx5 driver allocates a page_pool page and initializes it with a frag counter of 64 (pp_ref_count=64) and the internal frag counter to 0. - The test sends one packet with no payload. - On RX (mlx5e_skb_from_cqe_mpwrq_nonlinear()), mlx5 configures the XDP buffer with the packet data starting in the first fragment which is the page mentioned above. - The XDP program runs and calls bpf_xdp_pull_data() which moves the header into the linear part of the XDP buffer. As the packet doesn't contain more data, the program drops the tail fragment since it no longer contains any payload (pp_ref_count=63). - mlx5 device skips counting this fragment. Internal frag counter remains 0. - mlx5 releases all 64 fragments of the page but page pp_ref_count is 63 => negative reference counting error.
Resulting splat during the test:
WARNING: CPU: 0 PID: 188225 at ./include/net/page_pool/helpers.h:297 mlx5e_page_release_fragmented.isra.0+0xbd/0xe0 [mlx5_core] Modules linked in: [...] CPU: 0 UID: 0 PID: 188225 Comm: ip Not tainted 6.18.0-rc7_for_upstream_min_debug_2025_12_08_11_44 #1 NONE Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.13.0-0-gf21b5a4aeb02-prebuilt.qemu.org 04/01/2014 RIP: 0010:mlx5e_page_release_fragmented.isra.0+0xbd/0xe0 [mlx5_core] [...] Call Trace: <TASK> mlx5e_free_rx_mpwqe+0x20a/0x250 [mlx5_core] mlx5e_dealloc_rx_mpwqe+0x37/0xb0 [mlx5_core] mlx5e_free_rx_descs+0x11a/0x170 [mlx5_core] mlx5e_close_rq+0x78/0xa0 [mlx5_core] mlx5e_close_queues+0x46/0x2a0 [mlx5_core] mlx5e_close_channel+0x24/0x90 [mlx5_core] mlx5e_close_channels+0x5d/0xf0 [mlx5_core] mlx5e_safe_switch_params+0x2ec/0x380 [mlx5_core] mlx5e_change_mtu+0x11d/0x490 [mlx5_core] mlx5e_change_nic_mtu+0x19/0x30 [mlx5_core] netif_set_mtu_ext+0xfc/0x240 do_setlink.isra.0+0x226/0x1100 rtnl_newlink+0x7a9/0xba0 rtnetlink_rcv_msg+0x220/0x3c0 netlink_rcv_skb+0x4b/0xf0 netlink_unicast+0x255/0x380 netlink_sendmsg+0x1f3/0x420 __sock_sendmsg+0x38/0x60 _syssendmsg+0x1e8/0x240 _sys_sendmsg+0x7c/0xb0 [...] __sys_sendmsg+0x5f/0xb0 do_syscall_64+0x55/0xc70
The problem applies for XDP_PASS as well which is handled in a different code path in the driver.
This patch fixes the issue by doing page frag counting on all the original XDP buffer fragments for all relevant XDP actions (XDP_TX , XDP_REDIRECT and XDP_PASS). This is basically reverting to the original counting before the commit in the fixes tag.
As frag_page is still pointing to the original tail, the nr_frags parameter to xdp_update_skb_frags_info() needs to be calculated in a different way to reflect the new nr_frags.(CVE-2026-43465)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5e: Fix DMA FIFO desync on error CQE SQ recovery
In case of a TX error CQE, a recovery flow is triggered, mlx5e_reset_txqsq_cc_pc() resets dma_fifo_cc to 0 but not dma_fifo_pc, desyncing the DMA FIFO producer and consumer.
After recovery, the producer pushes new DMA entries at the old dma_fifo_pc, while the consumer reads from position 0. This causes us to unmap stale DMA addresses from before the recovery.
The DMA FIFO is a purely software construct with no HW counterpart. At the point of reset, all WQEs have been flushed so dma_fifo_cc is already equal to dma_fifo_pc. There is no need to reset either counter, similar to how skb_fifo pc/cc are untouched.
Remove the 'dma_fifo_cc = 0' reset.
This fixes the following WARNING: WARNING: CPU: 0 PID: 0 at drivers/iommu/dma-iommu.c:1240 iommu_dma_unmap_page+0x79/0x90 Modules linked in: mlx5_vdpa vringh vdpa bonding mlx5_ib mlx5_vfio_pci ipip mlx5_fwctl tunnel4 mlx5_core ib_ipoib geneve ip6_gre ip_gre gre nf_tables ip6_tunnel rdma_ucm ib_uverbs ib_umad vfio_pci vfio_pci_core act_mirred act_skbedit act_vlan vhost_net vhost tap ip6table_mangle ip6table_nat ip6table_filter ip6_tables iptable_mangle cls_matchall nfnetlink_cttimeout act_gact cls_flower sch_ingress vhost_iotlb iptable_raw tunnel6 vfio_iommu_type1 vfio openvswitch nsh rpcsec_gss_krb5 auth_rpcgss oid_registry xt_conntrack xt_MASQUERADE nf_conntrack_netlink nfnetlink iptable_nat nf_nat xt_addrtype br_netfilter overlay zram zsmalloc rpcrdma ib_iser libiscsi scsi_transport_iscsi rdma_cm iw_cm ib_cm ib_core fuse [last unloaded: nf_tables] CPU: 0 UID: 0 PID: 0 Comm: swapper/0 Not tainted 6.13.0-rc5_for_upstream_min_debug_2024_12_30_21_33 #1 Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.13.0-0-gf21b5a4aeb02-prebuilt.qemu.org 04/01/2014 RIP: 0010:iommu_dma_unmap_page+0x79/0x90 Code: 2b 4d 3b 21 72 26 4d 3b 61 08 73 20 49 89 d8 44 89 f9 5b 4c 89 f2 4c 89 e6 48 89 ef 5d 41 5c 41 5d 41 5e 41 5f e9 c7 ae 9e ff <0f> 0b 5b 5d 41 5c 41 5d 41 5e 41 5f c3 66 2e 0f 1f 84 00 00 00 00 Call Trace: <IRQ> ? __warn+0x7d/0x110 ? iommu_dma_unmap_page+0x79/0x90 ? report_bug+0x16d/0x180 ? handle_bug+0x4f/0x90 ? exc_invalid_op+0x14/0x70 ? asm_exc_invalid_op+0x16/0x20 ? iommu_dma_unmap_page+0x79/0x90 ? iommu_dma_unmap_page+0x2e/0x90 dma_unmap_page_attrs+0x10d/0x1b0 mlx5e_tx_wi_dma_unmap+0xbe/0x120 [mlx5_core] mlx5e_poll_tx_cq+0x16d/0x690 [mlx5_core] mlx5e_napi_poll+0x8b/0xac0 [mlx5_core] __napi_poll+0x24/0x190 net_rx_action+0x32a/0x3b0 ? mlx5_eq_comp_int+0x7e/0x270 [mlx5_core] ? notifier_call_chain+0x35/0xa0 handle_softirqs+0xc9/0x270 irq_exit_rcu+0x71/0xd0 common_interrupt+0x7f/0xa0 </IRQ> <TASK> asm_common_interrupt+0x22/0x40(CVE-2026-43466)
In the Linux kernel, the following vulnerability has been resolved:
ipvs: skip ipv6 extension headers for csum checks
Protocol checksum validation fails for IPv6 if there are extension headers before the protocol header. iph->len already contains its offset, so use it to fix the problem.(CVE-2026-45850)
In the Linux kernel, the following vulnerability has been resolved:
apparmor: Fix & Optimize table creation from possibly unaligned memory
Source blob may come from userspace and might be unaligned. Try to optize the copying process by avoiding unaligned memory accesses.
- Added Fixes tag
- Added "Fix &" to description as this doesn't just optimize but fixes a potential unaligned memory access jj: remove duplicate word "convert" in comment trigger checkpatch warning
In the Linux kernel, the following vulnerability has been resolved:
iommu/vt-d: Clear Present bit before tearing down PASID entry
The Intel VT-d Scalable Mode PASID table entry consists of 512 bits (64 bytes). When tearing down an entry, the current implementation zeros the entire 64-byte structure immediately using multiple 64-bit writes.
Since the IOMMU hardware may fetch these 64 bytes using multiple internal transactions (e.g., four 128-bit bursts), updating or zeroing the entire entry while it is active (P=1) risks a "torn" read. If a hardware fetch occurs simultaneously with the CPU zeroing the entry, the hardware could observe an inconsistent state, leading to unpredictable behavior or spurious faults.
Follow the "Guidance to Software for Invalidations" in the VT-d spec (Section 6.5.3.3) by implementing the recommended ownership handshake:
- Clear only the 'Present' (P) bit of the PASID entry.
- Use a dma_wmb() to ensure the cleared bit is visible to hardware before proceeding.
- Execute the required invalidation sequence (PASID cache, IOTLB, and Device-TLB flush) to ensure the hardware has released all cached references.
- Only after the flushes are complete, zero out the remaining fields of the PASID entry.
Also, add a dma_wmb() in pasid_set_present() to ensure that all other fields of the PASID entry are visible to the hardware before the Present bit is set.(CVE-2026-45894)
In the Linux kernel, the following vulnerability has been resolved:
quota: fix livelock between quotactl and freeze_super
When a filesystem is frozen, quotactl_block() enters a retry loop waiting for the filesystem to thaw. It acquires s_umount, checks the freeze state, drops s_umount and uses sb_start_write() - sb_end_write() pair to wait for the unfreeze.
However, this retry loop can trigger a livelock issue, specifically on kernels with preemption disabled.
The mechanism is as follows: 1. freeze_super() sets SB_FREEZE_WRITE and calls sb_wait_write(). 2. sb_wait_write() calls percpu_down_write(), which initiates synchronize_rcu(). 3. Simultaneously, quotactl_block() spins in its retry loop, immediately executing the sb_start_write() - sb_end_write() pair. 4. Because the kernel is non-preemptible and the loop contains no scheduling points, quotactl_block() never yields the CPU. This prevents that CPU from reaching an RCU quiescent state. 5. synchronize_rcu() in the freezer thread waits indefinitely for the quotactl_block() CPU to report a quiescent state. 6. quotactl_block() spins indefinitely waiting for the freezer to advance, which it cannot do as it is blocked on the RCU sync.
This results in a hang of the freezer process and 100% CPU usage by the quota process.
While this can occur intermittently on multi-core systems, it is reliably reproducing on a node with the following script, running both the freezer and the quota toggle on the same CPU:
# mkfs.ext4 -O quota /dev/sda 2g && mkdir a_mount # mount /dev/sda -o quota,usrquota,grpquota a_mount # taskset -c 3 bash -c "while true; do xfs_freeze -f a_mount; \ xfs_freeze -u a_mount; done" & # taskset -c 3 bash -c "while true; do quotaon a_mount; \ quotaoff a_mount; done" &
Adding cond_resched() to the retry loop fixes the issue. It acts as an RCU quiescent state, allowing synchronize_rcu() in percpu_down_write() to complete.(CVE-2026-45895)
In the Linux kernel, the following vulnerability has been resolved:
fat: avoid parent link count underflow in rmdir
Corrupted FAT images can leave a directory inode with an incorrect i_nlink (e.g. 2 even though subdirectories exist). rmdir then unconditionally calls drop_nlink(dir) and can drive i_nlink to 0, triggering the WARN_ON in drop_nlink().
Add a sanity check in vfat_rmdir() and msdos_rmdir(): only drop the parent link count when it is at least 3, otherwise report a filesystem error.(CVE-2026-45915)
In the Linux kernel, the following vulnerability has been resolved:
ext4: fix dirtyclusters double decrement on fs shutdown
fstests test generic/388 occasionally reproduces a warning in ext4_put_super() associated with the dirty clusters count:
WARNING: CPU: 7 PID: 76064 at fs/ext4/super.c:1324 ext4_put_super+0x48c/0x590 [ext4]
Tracing the failure shows that the warning fires due to an s_dirtyclusters_counter value of -1. IOW, this appears to be a spurious decrement as opposed to some sort of leak. Further tracing of the dirty cluster count deltas and an LLM scan of the resulting output identified the cause as a double decrement in the error path between ext4_mb_mark_diskspace_used() and the caller ext4_mb_new_blocks().
First, note that generic/388 is a shutdown vs. fsstress test and so produces a random set of operations and shutdown injections. In the problematic case, the shutdown triggers an error return from the ext4_handle_dirty_metadata() call(s) made from ext4_mb_mark_context(). The changed value is non-zero at this point, so ext4_mb_mark_diskspace_used() does not exit after the error bubbles up from ext4_mb_mark_context(). Instead, the former decrements both cluster counters and returns the error up to ext4_mb_new_blocks(). The latter falls into the !ar->len out path which decrements the dirty clusters counter a second time, creating the inconsistency.
To avoid this problem and simplify ownership of the cluster reservation in this codepath, lift the counter reduction to a single place in the caller. This makes it more clear that ext4_mb_new_blocks() is responsible for acquiring cluster reservation (via ext4_claim_free_clusters()) in the !delalloc case as well as releasing it, regardless of whether it ends up consumed or returned due to failure.(CVE-2026-45920)
In the Linux kernel, the following vulnerability has been resolved:
iommu/vt-d: Clear Present bit before tearing down context entry
When tearing down a context entry, the current implementation zeros the entire 128-bit entry using multiple 64-bit writes. This creates a window where the hardware can fetch a "torn" entry — where some fields are already zeroed while the 'Present' bit is still set — leading to unpredictable behavior or spurious faults.
While x86 provides strong write ordering, the compiler may reorder writes to the two 64-bit halves of the context entry. Even without compiler reordering, the hardware fetch is not guaranteed to be atomic with respect to multiple CPU writes.
Align with the "Guidance to Software for Invalidations" in the VT-d spec (Section 6.5.3.3) by implementing the recommended ownership handshake:
- Clear only the 'Present' (P) bit of the context entry first to signal the transition of ownership from hardware to software.
- Use dma_wmb() to ensure the cleared bit is visible to the IOMMU.
- Perform the required cache and context-cache invalidation to ensure hardware no longer has cached references to the entry.
- Fully zero out the entry only after the invalidation is complete.
Also, add a dma_wmb() to context_set_present() to ensure the entry is fully initialized before the 'Present' bit becomes visible.(CVE-2026-45944)
In the Linux kernel, the following vulnerability has been resolved:
hwrng: core - use RCU and work_struct to fix race condition
Currently, hwrng_fill is not cleared until the hwrng_fillfn() thread exits. Since hwrng_unregister() reads hwrng_fill outside the rng_mutex lock, a concurrent hwrng_unregister() may call kthread_stop() again on the same task.
Additionally, if hwrng_unregister() is called immediately after hwrng_register(), the stopped thread may have never been executed. Thus, hwrng_fill remains dirty even after hwrng_unregister() returns. In this case, subsequent calls to hwrng_register() will fail to start new threads, and hwrng_unregister() will call kthread_stop() on the same freed task. In both cases, a use-after-free occurs:
refcount_t: addition on 0; use-after-free. WARNING: ... at lib/refcount.c:25 refcount_warn_saturate+0xec/0x1c0 Call Trace: kthread_stop+0x181/0x360 hwrng_unregister+0x288/0x380 virtrng_remove+0xe3/0x200
This patch fixes the race by protecting the global hwrng_fill pointer inside the rng_mutex lock, so that hwrng_fillfn() thread is stopped only once, and calls to kthread_run() and kthread_stop() are serialized with the lock held.
To avoid deadlock in hwrng_fillfn() while being stopped with the lock held, we convert current_rng to RCU, so that get_current_rng() can read current_rng without holding the lock. To remove the lock from put_rng(), we also delay the actual cleanup into a work_struct.
Since get_current_rng() no longer returns ERR_PTR values, the IS_ERR() checks are removed from its callers.
With hwrng_fill protected by the rng_mutex lock, hwrng_fillfn() can no longer clear hwrng_fill itself. Therefore, if hwrng_fillfn() returns directly after current_rng is dropped, kthread_stop() would be called on a freed task_struct later. To fix this, hwrng_fillfn() calls schedule() now to keep the task alive until being stopped. The kthread_stop() call is also moved from hwrng_unregister() to drop_current_rng(), ensuring kthread_stop() is called on all possible paths where current_rng becomes NULL, so that the thread would not wait forever.(CVE-2026-45949)
In the Linux kernel, the following vulnerability has been resolved:
cpuidle: Skip governor when only one idle state is available
On certain platforms (PowerNV systems without a power-mgt DT node), cpuidle may register only a single idle state. In cases where that single state is a polling state (state 0), the ladder governor may incorrectly treat state 1 as the first usable state and pass an out-of-bounds index. This can lead to a NULL enter callback being invoked, ultimately resulting in a system crash.
[ 13.342636] cpuidle-powernv : Only Snooze is available [ 13.351854] Faulting instruction address: 0x00000000 [ 13.376489] NIP [0000000000000000] 0x0 [ 13.378351] LR [c000000001e01974] cpuidle_enter_state+0x2c4/0x668
Fix this by adding a bail-out in cpuidle_select() that returns state 0 directly when state_count <= 1, bypassing the governor and keeping the tick running.(CVE-2026-45968)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/mlx5: Fix UMR hang in LAG error state unload
During firmware reset in LAG mode, a race condition causes the driver to hang indefinitely while waiting for UMR completion during device unload. See [1].
In LAG mode the bond device is only registered on the master, so it never sees sys_error events from the slave. During firmware reset this causes UMR waits to hang forever on unload as the slave is dead but the master hasn't entered error state yet, so UMR posts succeed but completions never arrive.
Fix this by adding a sys_error notifier that gets registered before MLX5_IB_STAGE_IB_REG and stays alive until after ib_unregister_device(). This ensures error events reach the bond device throughout teardown.
[1] Call Trace: __schedule+0x2bd/0x760 schedule+0x37/0xa0 schedule_preempt_disabled+0xa/0x10 __mutex_lock.isra.6+0x2b5/0x4a0 __mlx5_ib_dereg_mr+0x606/0x870 [mlx5_ib] ? __xa_erase+0x4a/0xa0 ? _cond_resched+0x15/0x30 ? wait_for_completion+0x31/0x100 ib_dereg_mr_user+0x48/0xc0 [ib_core] ? rdmacg_uncharge_hierarchy+0xa0/0x100 destroy_hw_idr_uobject+0x20/0x50 [ib_uverbs] uverbs_destroy_uobject+0x37/0x150 [ib_uverbs] __uverbs_cleanup_ufile+0xda/0x140 [ib_uverbs] uverbs_destroy_ufile_hw+0x3a/0xf0 [ib_uverbs] ib_uverbs_remove_one+0xc3/0x140 [ib_uverbs] remove_client_context+0x8b/0xd0 [ib_core] disable_device+0x8c/0x130 [ib_core] __ib_unregister_device+0x10d/0x180 [ib_core] ib_unregister_device+0x21/0x30 [ib_core] __mlx5_ib_remove+0x1e4/0x1f0 [mlx5_ib] auxiliary_bus_remove+0x1e/0x30 device_release_driver_internal+0x103/0x1f0 bus_remove_device+0xf7/0x170 device_del+0x181/0x410 mlx5_rescan_drivers_locked.part.10+0xa9/0x1d0 [mlx5_core] mlx5_disable_lag+0x253/0x260 [mlx5_core] mlx5_lag_disable_change+0x89/0xc0 [mlx5_core] mlx5_eswitch_disable+0x67/0xa0 [mlx5_core] mlx5_unload+0x15/0xd0 [mlx5_core] mlx5_unload_one+0x71/0xc0 [mlx5_core] mlx5_sync_reset_reload_work+0x83/0x100 [mlx5_core] process_one_work+0x1a7/0x360 worker_thread+0x30/0x390 ? create_worker+0x1a0/0x1a0 kthread+0x116/0x130 ? kthread_flush_work_fn+0x10/0x10 ret_from_fork+0x22/0x40(CVE-2026-45973)
In the Linux kernel, the following vulnerability has been resolved:
gfs2: Fix use-after-free in iomap inline data write path
The inline data buffer head (dibh) is being released prematurely in gfs2_iomap_begin() via release_metapath() while iomap->inline_data still points to dibh->b_data. This causes a use-after-free when iomap_write_end_inline() later attempts to write to the inline data area.
The bug sequence: 1. gfs2_iomap_begin() calls gfs2_meta_inode_buffer() to read inode metadata into dibh 2. Sets iomap->inline_data = dibh->b_data + sizeof(struct gfs2_dinode) 3. Calls release_metapath() which calls brelse(dibh), dropping refcount to 0 4. kswapd reclaims the page (~39ms later in the syzbot report) 5. iomap_write_end_inline() tries to memcpy() to iomap->inline_data 6. KASAN detects use-after-free write to freed memory
Fix by storing dibh in iomap->private and incrementing its refcount with get_bh() in gfs2_iomap_begin(). The buffer is then properly released in gfs2_iomap_end() after the inline write completes, ensuring the page stays alive for the entire iomap operation.
Note: A C reproducer is not available for this issue. The fix is based on analysis of the KASAN report and code review showing the buffer head is freed before use.
In the Linux kernel, the following vulnerability has been resolved:
drm/nouveau: fix u32 overflow in pushbuf reloc bounds check
nouveau_gem_pushbuf_reloc_apply() validates each relocation with
if (r->reloc_bo_offset + 4 > nvbo->bo.base.size)
but reloc_bo_offset is __u32 (uapi/drm/nouveau_drm.h) and the integer literal 4 promotes to unsigned int, so the addition is performed in 32 bits and wraps before the comparison against the size_t bo size.
Cast to u64 so the addition happens in 64-bit arithmetic.
In the Linux kernel, the following vulnerability has been resolved:
thermal: core: Fix thermal zone governor cleanup issues
If thermal_zone_device_register_with_trips() fails after adding a thermal governor to the thermal zone being registered, the governor is not removed from it as appropriate which may lead to a memory leak.
In turn, thermal_zone_device_unregister() calls thermal_set_governor() without acquiring the thermal zone lock beforehand which may race with a governor update via sysfs and may lead to a use-after-free in that case.
Address these issues by adding two thermal_set_governor() calls, one to thermal_release() to remove the governor from the given thermal zone, and one to the thermal zone registration error path to cover failures preceding the thermal zone device registration.(CVE-2026-46021)
In the Linux kernel, the following vulnerability has been resolved:
KVM: nSVM: Triple fault if restore host CR3 fails on nested #VMEXIT
If loading L1's CR3 fails on a nested #VMEXIT, nested_svm_vmexit() returns an error code that is ignored by most callers, and continues to run L1 with corrupted state. A sane recovery is not possible in this case, and HW behavior is to cause a shutdown. Inject a triple fault instead, and do not return early from nested_svm_vmexit(). Continue cleaning up the vCPU state (e.g. clear pending exceptions), to handle the failure as gracefully as possible.
From the APM:
Upon #VMEXIT, the processor performs the following actions in order to return to the host execution context:
...
if (illegal host state loaded, or exception while loading host state) shutdown else execute first host instruction following the VMRUN
Remove the return value of nested_svm_vmexit(), which is mostly unchecked anyway.(CVE-2026-46032)
In the Linux kernel, the following vulnerability has been resolved:
crypto: authencesn - reject short ahash digests during instance creation
authencesn requires either a zero authsize or an authsize of at least 4 bytes because the ESN encrypt/decrypt paths always move 4 bytes of high-order sequence number data at the end of the authenticated data.
While crypto_authenc_esn_setauthsize() already rejects explicit non-zero authsizes in the range 1..3, crypto_authenc_esn_create() still copied auth->digestsize into inst->alg.maxauthsize without validating it. The AEAD core then initialized the tfm's default authsize from that value.
As a result, selecting an ahash with digest size 1..3, such as cbcmac(cipher_null), exposed authencesn instances whose default authsize was invalid even though setauthsize() would have rejected the same value. AF_ALG could then trigger the ESN tail handling with a too-short tag and hit an out-of-bounds access.
Reject authencesn instances whose ahash digest size is in the invalid non-zero range 1..3 so that no tfm can inherit an unsupported default authsize.(CVE-2026-46033)
In the Linux kernel, the following vulnerability has been resolved:
ceph: only d_add() negative dentries when they are unhashed
Ceph can call d_add(dentry, NULL) on a negative dentry that is already present in the primary dcache hash.
In the current VFS that is not safe. d_add() goes through __d_add() to __d_rehash(), which unconditionally reinserts dentry->d_hash into the hlist_bl bucket. If the dentry is already hashed, reinserting the same node can corrupt the bucket, including creating a self-loop. Once that happens, __d_lookup() can spin forever in the hlist_bl walk, typically looping only on the d_name.hash mismatch check and eventually triggering RCU stall reports like this one:
rcu: INFO: rcu_sched self-detected stall on CPU rcu: 87-....: (2100 ticks this GP) idle=3a4c/1/0x4000000000000000 softirq=25003319/25003319 fqs=829 rcu: (t=2101 jiffies g=79058445 q=698988 ncpus=192) CPU: 87 UID: 2952868916 PID: 3933303 Comm: php-cgi8.3 Not tainted 6.18.17-i1-amd #950 NONE Hardware name: Dell Inc. PowerEdge R7615/0G9DHV, BIOS 1.6.6 09/22/2023 RIP: 0010:__d_lookup+0x46/0xb0 Code: c1 e8 07 48 8d 04 c2 48 8b 00 49 89 fc 49 89 f5 48 89 c3 48 83 e3 fe 48 83 f8 01 77 0f eb 2d 0f 1f 44 00 00 48 8b 1b 48 85 db <74> 20 39 6b 18 75 f3 48 8d 7b 78 e8 ba 85 d0 00 4c 39 63 10 74 1f RSP: 0018:ff745a70c8253898 EFLAGS: 00000282 RAX: ff26e470054cb208 RBX: ff26e470054cb208 RCX: 000000006e958966 RDX: ff26e48267340000 RSI: ff745a70c82539b0 RDI: ff26e458f74655c0 RBP: 000000006e958966 R08: 0000000000000180 R09: 9cd08d909b919a89 R10: ff26e458f74655c0 R11: 0000000000000000 R12: ff26e458f74655c0 R13: ff745a70c82539b0 R14: d0d0d0d0d0d0d0d0 R15: 2f2f2f2f2f2f2f2f FS: 00007f5770896980(0000) GS:ff26e482c5d88000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007f5764de50c0 CR3: 000000a72abb5001 CR4: 0000000000771ef0 PKRU: 55555554 Call Trace: <TASK> lookup_fast+0x9f/0x100 walk_component+0x1f/0x150 link_path_walk+0x20e/0x3d0 path_lookupat+0x68/0x180 filename_lookup+0xdc/0x1e0 vfs_statx+0x6c/0x140 vfs_fstatat+0x67/0xa0 __do_sys_newfstatat+0x24/0x60 do_syscall_64+0x6a/0x230 entry_SYSCALL_64_after_hwframe+0x76/0x7e
This is reachable with reused cached negative dentries. A Ceph lookup or atomic_open can be handed a negative dentry that is already hashed, and fs/ceph/dir.c then hits one of two paths that incorrectly assume "negative" also means "unhashed":
-
ceph_finish_lookup(): MDS reply is -ENOENT with no trace -> d_add(dentry, NULL)
-
ceph_lookup(): local ENOENT fast path for a complete directory with shared caps -> d_add(dentry, NULL)
Both paths can therefore re-add an already-hashed negative dentry.
Ceph already uses the correct pattern elsewhere: ceph_fill_trace() only calls d_add(dn, NULL) for a negative null-dentry reply when d_unhashed(dn) is true.
Fix both fs/ceph/dir.c sites the same way: only call d_add() for a negative dentry when it is actually unhashed. If the negative dentry is already hashed, leave it in place and reuse it as-is.
This preserves the existing behavior for unhashed dentries while avoiding d_hash list corruption for reused hashed negatives.(CVE-2026-46052)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: defio: Disconnect deferred I/O from the lifetime of struct fb_info
Hold state of deferred I/O in struct fb_deferred_io_state. Allocate an instance as part of initializing deferred I/O and remove it only after the final mapping has been closed. If the fb_info and the contained deferred I/O meanwhile goes away, clear struct fb_deferred_io_state.info to invalidate the mapping. Any access will then result in a SIGBUS signal.
Fixes a long-standing problem, where a device hot-unplug happens while user space still has an active mapping of the graphics memory. The hot- unplug frees the instance of struct fb_info. Accessing the memory will operate on undefined state.(CVE-2026-46065)
In the Linux kernel, the vlan_dev_set_egress_priority() function currently keeps cleared egress priority mappings in the hash as tombstones. Repeated set/clear cycles with distinct skb priorities accumulate mapping nodes until device teardown, causing memory leakage. This vulnerability is fixed by deleting mappings instead of keeping tombstones, using RCU protection for safe deallocation.(CVE-2026-46153)
In the Linux kernel, the following vulnerability has been resolved:
eventpoll: fix ep_remove struct eventpoll / struct file UAF
ep_remove() (via ep_remove_file()) cleared file->f_ep under file->f_lock but then kept using @file inside the critical section (is_file_epoll(), hlist_del_rcu() through the head, spin_unlock). A concurrent __fput() taking the eventpoll_release() fastpath in that window observed the transient NULL, skipped eventpoll_release_file() and ran to f_op->release / file_free().
For the epoll-watches-epoll case, f_op->release is ep_eventpoll_release() -> ep_clear_and_put() -> ep_free(), which kfree()s the watched struct eventpoll. Its embedded ->refs hlist_head is exactly where epi->fllink.pprev points, so the subsequent hlist_del_rcu()'s "*pprev = next" scribbles into freed kmalloc-192 memory.
In addition, struct file is SLAB_TYPESAFE_BY_RCU, so the slot backing @file could be recycled by alloc_empty_file() -- reinitializing f_lock and f_ep -- while ep_remove() is still nominally inside that lock. The upshot is an attacker-controllable kmem_cache_free() against the wrong slab cache.
Pin @file via epi_fget() at the top of ep_remove() and gate the critical section on the pin succeeding. With the pin held @file cannot reach refcount zero, which holds __fput() off and transitively keeps the watched struct eventpoll alive across the hlist_del_rcu() and the f_lock use, closing both UAFs.
If the pin fails @file has already reached refcount zero and its __fput() is in flight. Because we bailed before clearing f_ep, that path takes the eventpoll_release() slow path into eventpoll_release_file() and blocks on ep->mtx until the waiter side's ep_clear_and_put() drops it. The bailed epi's share of ep->refcount stays intact, so the trailing ep_refcount_dec_and_test() in ep_clear_and_put() cannot free the eventpoll out from under eventpoll_release_file(); the orphaned epi is then cleaned up there.
A successful pin also proves we are not racing eventpoll_release_file() on this epi, so drop the now-redundant re-check of epi->dying under f_lock. The cheap lockless READ_ONCE(epi->dying) fast-path bailout stays.(CVE-2026-46242)
In the Linux kernel, the following vulnerability has been resolved: drm/amd/display: Fix dc_link NULL handling in HPD init amdgpu_dm_hpd_init() may see connectors without a valid dc_link. The code already checks dc_link for the polling decision, but later unconditionally dereferences it when setting up HPD interrupts. Assign dc_link early and skip connectors where it is NULL. Fixes the below: drivers/gpu/drm/amd/amdgpu/../display/amdgpu_dm/amdgpu_dm_irq.c:940 amdgpu_dm_hpd_init() error: we previously assumed 'dc_link' could be null (see line 931) drivers/gpu/drm/amd/amdgpu/../display/amdgpu_dm/amdgpu_dm_irq.c 923 / 924 * Analog connectors may be hot-plugged unlike other connector 925 * types that don't support HPD. Only poll analog connectors. 926 / 927 use_polling |= 928 amdgpu_dm_connector->dc_link && ^^^^^^^^^^^^^^^^^^^^^^^^^^^^ The patch adds this NULL check but hopefully it can be removed 929 dc_connector_supports_analog(amdgpu_dm_connector->dc_link->link_id.id); 930 931 dc_link = amdgpu_dm_connector->dc_link; dc_link assigned here. 932 933 / 934 * Get a base driver irq reference for hpd ints for the lifetime 935 * of dm. Note that only hpd interrupt types are registered with 936 * base driver; hpd_rx types aren't. IOW, amdgpu_irq_get/put on 937 * hpd_rx isn't available. DM currently controls hpd_rx 938 * explicitly with dc_interrupt_set() 939 / --> 940 if (dc_link->irq_source_hpd != DC_IRQ_SOURCE_INVALID) { ^^^^^^^^^^^^^^^^^^^^^^^ If it's NULL then we are trouble because we dereference it here. 941 irq_type = dc_link->irq_source_hpd - DC_IRQ_SOURCE_HPD1; 942 /* 943 * TODO: There's a mismatch between mode_info.num_hpd 944 * and what bios reports as the # of connectors with hpd The Linux kernel CVE team has assigned CVE-2026-46245 to this issue.(CVE-2026-46245)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"bpftool-debuginfo-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"kernel-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"kernel-debuginfo-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"kernel-debugsource-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"kernel-devel-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"kernel-extra-modules-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"kernel-headers-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"kernel-source-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"kernel-tools-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"kernel-tools-debuginfo-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"kernel-tools-devel-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"perf-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"perf-debuginfo-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"python3-perf-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm",
"python3-perf-debuginfo-6.6.0-145.3.15.146.oe2403sp3.aarch64.rpm"
],
"src": [
"kernel-6.6.0-145.3.15.146.oe2403sp3.src.rpm"
],
"x86_64": [
"bpftool-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"bpftool-debuginfo-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"kernel-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"kernel-debuginfo-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"kernel-debugsource-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"kernel-devel-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"kernel-extra-modules-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"kernel-headers-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"kernel-source-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"kernel-tools-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"kernel-tools-debuginfo-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"kernel-tools-devel-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"perf-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"perf-debuginfo-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"python3-perf-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm",
"python3-perf-debuginfo-6.6.0-145.3.15.146.oe2403sp3.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:24.03-LTS-SP3",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-24.03-LTS-SP3"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "6.6.0-145.3.15.146.oe2403sp3"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nparisc: Drop WARN_ON_ONCE() from flush_cache_vmap\n\nI have observed warning to occassionally trigger.(CVE-2025-39781)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nMIPS: ftrace: Fix memory corruption when kernel is located beyond 32 bits\n\nSince commit e424054000878 (\u0026quot;MIPS: Tracing: Reduce the overhead of\ndynamic Function Tracer\u0026quot;), the macro UASM_i_LA_mostly has been used,\nand this macro can generate more than 2 instructions. At the same\ntime, the code in ftrace assumes that no more than 2 instructions can\nbe generated, which is why it stores them in an int[2] array. However,\nas previously noted, the macro UASM_i_LA_mostly (and now UASM_i_LA)\ncauses a buffer overflow when _mcount is beyond 32 bits. This leads to\ncorruption of the variables located in the __read_mostly section.\n\nThis corruption was observed because the variable\n__cpu_primary_thread_mask was corrupted, causing a hang very early\nduring boot.\n\nThis fix prevents the corruption by avoiding the generation of\ninstructions if they could exceed 2 instructions in\nlength. Fortunately, insn_la_mcount is only used if the instrumented\ncode is located outside the kernel code section, so dynamic ftrace can\nstill be used, albeit in a more limited scope. This is still\npreferable to corrupting memory and/or crashing the kernel.(CVE-2025-71109)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrm/amd/pm: Disable MMIO access during SMU Mode 1 reset\n\nDuring Mode 1 reset, the ASIC undergoes a reset cycle and becomes\ntemporarily inaccessible via PCIe. Any attempt to access MMIO registers\nduring this window (e.g., from interrupt handlers or other driver threads)\ncan result in uncompleted PCIe transactions, leading to NMI panics or\nsystem hangs.\n\nTo prevent this, set the `no_hw_access` flag to true immediately after\ntriggering the reset. This signals other driver components to skip\nregister accesses while the device is offline.\n\nA memory barrier `smp_mb()` is added to ensure the flag update is\nglobally visible to all cores before the driver enters the sleep/wait\nstate.\n\n(cherry picked from commit 7edb503fe4b6d67f47d8bb0dfafb8e699bb0f8a4)(CVE-2026-23213)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbtrfs: reject new transactions if the fs is fully read-only\n\n[BUG]\nThere is a bug report where a heavily fuzzed fs is mounted with all\nrescue mount options, which leads to the following warnings during\nunmount:\n\n BTRFS: Transaction aborted (error -22)\n Modules linked in:\n CPU: 0 UID: 0 PID: 9758 Comm: repro.out Not tainted\n 6.19.0-rc5-00002-gb71e635feefc #7 PREEMPT(full)\n Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014\n RIP: 0010:find_free_extent_update_loop fs/btrfs/extent-tree.c:4208 [inline]\n RIP: 0010:find_free_extent+0x52f0/0x5d20 fs/btrfs/extent-tree.c:4611\n Call Trace:\n \u0026lt;TASK\u0026gt;\n btrfs_reserve_extent+0x2cd/0x790 fs/btrfs/extent-tree.c:4705\n btrfs_alloc_tree_block+0x1e1/0x10e0 fs/btrfs/extent-tree.c:5157\n btrfs_force_cow_block+0x578/0x2410 fs/btrfs/ctree.c:517\n btrfs_cow_block+0x3c4/0xa80 fs/btrfs/ctree.c:708\n btrfs_search_slot+0xcad/0x2b50 fs/btrfs/ctree.c:2130\n btrfs_truncate_inode_items+0x45d/0x2350 fs/btrfs/inode-item.c:499\n btrfs_evict_inode+0x923/0xe70 fs/btrfs/inode.c:5628\n evict+0x5f4/0xae0 fs/inode.c:837\n __dentry_kill+0x209/0x660 fs/dcache.c:670\n finish_dput+0xc9/0x480 fs/dcache.c:879\n shrink_dcache_for_umount+0xa0/0x170 fs/dcache.c:1661\n generic_shutdown_super+0x67/0x2c0 fs/super.c:621\n kill_anon_super+0x3b/0x70 fs/super.c:1289\n btrfs_kill_super+0x41/0x50 fs/btrfs/super.c:2127\n deactivate_locked_super+0xbc/0x130 fs/super.c:474\n cleanup_mnt+0x425/0x4c0 fs/namespace.c:1318\n task_work_run+0x1d4/0x260 kernel/task_work.c:233\n exit_task_work include/linux/task_work.h:40 [inline]\n do_exit+0x694/0x22f0 kernel/exit.c:971\n do_group_exit+0x21c/0x2d0 kernel/exit.c:1112\n __do_sys_exit_group kernel/exit.c:1123 [inline]\n __se_sys_exit_group kernel/exit.c:1121 [inline]\n __x64_sys_exit_group+0x3f/0x40 kernel/exit.c:1121\n x64_sys_call+0x2210/0x2210 arch/x86/include/generated/asm/syscalls_64.h:232\n do_syscall_x64 arch/x86/entry/syscall_64.c:63 [inline]\n do_syscall_64+0xe8/0xf80 arch/x86/entry/syscall_64.c:94\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\n RIP: 0033:0x44f639\n Code: Unable to access opcode bytes at 0x44f60f.\n RSP: 002b:00007ffc15c4e088 EFLAGS: 00000246 ORIG_RAX: 00000000000000e7\n RAX: ffffffffffffffda RBX: 00000000004c32f0 RCX: 000000000044f639\n RDX: 000000000000003c RSI: 00000000000000e7 RDI: 0000000000000001\n RBP: 0000000000000001 R08: ffffffffffffffc0 R09: 0000000000000000\n R10: 0000000000000000 R11: 0000000000000246 R12: 00000000004c32f0\n R13: 0000000000000001 R14: 0000000000000000 R15: 0000000000000001\n \u0026lt;/TASK\u0026gt;\n\nSince rescue mount options will mark the full fs read-only, there should\nbe no new transaction triggered.\n\nBut during unmount we will evict all inodes, which can trigger a new\ntransaction, and triggers warnings on a heavily corrupted fs.\n\n[CAUSE]\nBtrfs allows new transaction even on a read-only fs, this is to allow\nlog replay happen even on read-only mounts, just like what ext4/xfs do.\n\nHowever with rescue mount options, the fs is fully read-only and cannot\nbe remounted read-write, thus in that case we should also reject any new\ntransactions.\n\n[FIX]\nIf we find the fs has rescue mount options, we should treat the fs as\nerror, so that no new transaction can be started.(CVE-2026-23214)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndriver core: platform: use generic driver_override infrastructure\n\nWhen a driver is probed through __driver_attach(), the bus\u0026apos; match()\ncallback is called without the device lock held, thus accessing the\ndriver_override field without a lock, which can cause a UAF.\n\nFix this by using the driver-core driver_override infrastructure taking\ncare of proper locking internally.\n\nNote that calling match() from __driver_attach() without the device lock\nheld is intentional. [1](CVE-2026-31527)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusbip: validate number_of_packets in usbip_pack_ret_submit()\n\nWhen a USB/IP client receives a RET_SUBMIT response,\nusbip_pack_ret_submit() unconditionally overwrites\nurb-\u0026gt;number_of_packets from the network PDU. This value is\nsubsequently used as the loop bound in usbip_recv_iso() and\nusbip_pad_iso() to iterate over urb-\u0026gt;iso_frame_desc[], a flexible\narray whose size was fixed at URB allocation time based on the\n*original* number_of_packets from the CMD_SUBMIT.\n\nA malicious USB/IP server can set number_of_packets in the response\nto a value larger than what was originally submitted, causing a heap\nout-of-bounds write when usbip_recv_iso() writes to\nurb-\u0026gt;iso_frame_desc[i] beyond the allocated region.\n\nKASAN confirmed this with kernel 7.0.0-rc5:\n\n BUG: KASAN: slab-out-of-bounds in usbip_recv_iso+0x46a/0x640\n Write of size 4 at addr ffff888106351d40 by task vhci_rx/69\n\n The buggy address is located 0 bytes to the right of\n allocated 320-byte region [ffff888106351c00, ffff888106351d40)\n\nThe server side (stub_rx.c) and gadget side (vudc_rx.c) already\nvalidate number_of_packets in the CMD_SUBMIT path since commits\nc6688ef9f297 (\u0026quot;usbip: fix stub_rx: harden CMD_SUBMIT path to handle\nmalicious input\u0026quot;) and b78d830f0049 (\u0026quot;usbip: fix vudc_rx: harden\nCMD_SUBMIT path to handle malicious input\u0026quot;). The server side validates\nagainst USBIP_MAX_ISO_PACKETS because no URB exists yet at that point.\nOn the client side we have the original URB, so we can use the tighter\nbound: the response must not exceed the original number_of_packets.\n\nThis mirrors the existing validation of actual_length against\ntransfer_buffer_length in usbip_recv_xbuff(), which checks the\nresponse value against the original allocation size.\n\nKelvin Mbogo\u0026apos;s series (\u0026quot;usb: usbip: fix integer overflow in\nusbip_recv_iso()\u0026quot;, v2) hardens the receive-side functions themselves;\nthis patch complements that work by catching the bad value at its\nsource -- in usbip_pack_ret_submit() before the overwrite -- and\nusing the tighter per-URB allocation bound rather than the global\nUSBIP_MAX_ISO_PACKETS limit.\n\nFix this by checking rpdu-\u0026gt;number_of_packets against\nurb-\u0026gt;number_of_packets in usbip_pack_ret_submit() before the\noverwrite. On violation, clamp to zero so that usbip_recv_iso() and\nusbip_pad_iso() safely return early.(CVE-2026-31607)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntipc: fix bc_ackers underflow on duplicate GRP_ACK_MSG\n\nThe GRP_ACK_MSG handler in tipc_group_proto_rcv() currently decrements\nbc_ackers on every inbound group ACK, even when the same member has\nalready acknowledged the current broadcast round.\n\nBecause bc_ackers is a u16, a duplicate ACK received after the last\nlegitimate ACK wraps the counter to 65535. Once wrapped,\ntipc_group_bc_cong() keeps reporting congestion and later group\nbroadcasts on the affected socket stay blocked until the group is\nrecreated.\n\nFix this by ignoring duplicate or stale ACKs before touching bc_acked or\nbc_ackers. This makes repeated GRP_ACK_MSG handling idempotent and\nprevents the underflow path.(CVE-2026-31662)\n\nIn the Linux kernel, the following vulnerability has been resolved: smb: client: validate the whole DACL before rewriting it in cifsacl. build_sec_desc() and id_mode_to_cifs_acl() derive a DACL pointer from a server-supplied dacloffset and then use the incoming ACL to rebuild the chmod/chown security descriptor. The original fix only checked that the struct smb_acl header fits before reading dacl_ptr-\u0026gt;size or dacl_ptr-\u0026gt;num_aces. That avoids the immediate header-field OOB read, but the rewrite helpers still walk ACEs based on pdacl-\u0026gt;num_aces with no structural validation of the incoming DACL body. A malicious server can return a truncated DACL that still contains a header, claims one or more ACEs, and then drive replace_sids_and_copy_aces() or set_chmod_dacl() past the validated extent while they compare or copy attacker-controlled ACEs.(CVE-2026-31709)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: ulpi: fix double free in ulpi_register_interface() error path\n\nWhen device_register() fails, ulpi_register() calls put_device() on\nulpi-\u0026gt;dev.\n\nThe device release callback ulpi_dev_release() drops the OF node\nreference and frees ulpi, but the current error path in\nulpi_register_interface() then calls kfree(ulpi) again, causing a\ndouble free.\n\nLet put_device() handle the cleanup through ulpi_dev_release() and\navoid freeing ulpi again in ulpi_register_interface().(CVE-2026-31759)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: nf_tables: reject immediate NF_QUEUE verdict\n\nnft_queue is always used from userspace nftables to deliver the NF_QUEUE\nverdict. Immediately emitting an NF_QUEUE verdict is never used by the\nuserspace nft tools, so reject immediate NF_QUEUE verdicts.\n\nThe arp family does not provide queue support, but such an immediate\nverdict is still reachable. Globally reject NF_QUEUE immediate verdicts\nto address this issue.(CVE-2026-43024)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipv6: icmp: clear skb2-\u0026gt;cb[] in ip6_err_gen_icmpv6_unreach()\n\nSashiko AI-review observed:\n\n In ip6_err_gen_icmpv6_unreach(), the skb is an outer IPv4 ICMP error packet\n where its cb contains an IPv4 inet_skb_parm. When skb is cloned into skb2\n and passed to icmp6_send(), it uses IP6CB(skb2).\n\n IP6CB interprets the IPv4 inet_skb_parm as an inet6_skb_parm. The cipso\n offset in inet_skb_parm.opt directly overlaps with dsthao in inet6_skb_parm\n at offset 18.\n\n If an attacker sends a forged ICMPv4 error with a CIPSO IP option, dsthao\n would be a non-zero offset. Inside icmp6_send(), mip6_addr_swap() is called\n and uses ipv6_find_tlv(skb, opt-\u0026gt;dsthao, IPV6_TLV_HAO).\n\n This would scan the inner, attacker-controlled IPv6 packet starting at that\n offset, potentially returning a fake TLV without checking if the remaining\n packet length can hold the full 18-byte struct ipv6_destopt_hao.\n\n Could mip6_addr_swap() then perform a 16-byte swap that extends past the end\n of the packet data into skb_shared_info?\n\n Should the cb array also be cleared in ip6_err_gen_icmpv6_unreach() and\n ip6ip6_err() to prevent this?\n\nThis patch implements the first suggestion.\n\nI am not sure if ip6ip6_err() needs to be changed.\nA separate patch would be better anyway.(CVE-2026-43038)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBluetooth: MGMT: Fix list corruption and UAF in command complete handlers\n\nCommit 302a1f674c00 (\u0026quot;Bluetooth: MGMT: Fix possible UAFs\u0026quot;) introduced\nmgmt_pending_valid(), which not only validates the pending command but\nalso unlinks it from the pending list if it is valid. This change in\nsemantics requires updates to several completion handlers to avoid list\ncorruption and memory safety issues.\n\nThis patch addresses two left-over issues from the aforementioned rework:\n\n1. In mgmt_add_adv_patterns_monitor_complete(), mgmt_pending_remove()\nis replaced with mgmt_pending_free() in the success path. Since\nmgmt_pending_valid() already unlinks the command at the beginning of\nthe function, calling mgmt_pending_remove() leads to a double list_del()\nand subsequent list corruption/kernel panic.\n\n2. In set_mesh_complete(), the use of mgmt_pending_foreach() in the error\npath is removed. Since the current command is already unlinked by\nmgmt_pending_valid(), this foreach loop would incorrectly target other\npending mesh commands, potentially freeing them while they are still being\nprocessed concurrently (leading to UAFs). The redundant mgmt_cmd_status()\nis also simplified to use cmd-\u0026gt;opcode directly.(CVE-2026-43059)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: ioam6: fix OOB and missing lock\n\nWhen trace-\u0026gt;type.bit6 is set:\n\n if (trace-\u0026gt;type.bit6) {\n ...\n queue = skb_get_tx_queue(dev, skb);\n qdisc = rcu_dereference(queue-\u0026gt;qdisc);\n\nThis code can lead to an out-of-bounds access of the dev-\u0026gt;_tx[] array\nwhen is_input is true. In such a case, the packet is on the RX path and\nskb-\u0026gt;queue_mapping contains the RX queue index of the ingress device. If\nthe ingress device has more RX queues than the egress device (dev) has\nTX queues, skb_get_queue_mapping(skb) will exceed dev-\u0026gt;num_tx_queues.\nAdd a check to avoid this situation since skb_get_tx_queue() does not\nclamp the index. This issue has also revealed that per queue visibility\ncannot be accurate and will be replaced later as a new feature.\n\nWhile at it, add missing lock around qdisc_qstats_qlen_backlog(). The\nfunction __ioam6_fill_trace_data() is called from both softirq and\nprocess contexts, hence the use of spin_lock_bh() here.(CVE-2026-43083)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: af_key: zero aligned sockaddr tail in PF_KEY exports\n\nPF_KEY export paths use `pfkey_sockaddr_size()` when reserving sockaddr\npayload space, so IPv6 addresses occupy 32 bytes on the wire. However,\n`pfkey_sockaddr_fill()` initializes only the first 28 bytes of\n`struct sockaddr_in6`, leaving the final 4 aligned bytes uninitialized.\n\nNot every PF_KEY message is affected. The state and policy dump builders\nalready zero the whole message buffer before filling the sockaddr\npayloads. Keep the fix to the export paths that still append aligned\nsockaddr payloads with plain `skb_put()`:\n\n - `SADB_ACQUIRE`\n - `SADB_X_NAT_T_NEW_MAPPING`\n - `SADB_X_MIGRATE`\n\nFix those paths by clearing only the aligned sockaddr tail after\n`pfkey_sockaddr_fill()`.(CVE-2026-43088)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm_user: fix info leak in build_mapping()\n\nstruct xfrm_usersa_id has a one-byte padding hole after the proto\nfield, which ends up never getting set to zero before copying out to\nuserspace. Fix that up by zeroing out the whole structure before\nsetting individual variables.(CVE-2026-43089)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipv6: ioam: fix potential NULL dereferences in __ioam6_fill_trace_data()\n\nWe need to check __in6_dev_get() for possible NULL value, as\nsuggested by Yiming Qian.\n\nAlso add skb_dst_dev_rcu() instead of skb_dst_dev(),\nand two missing READ_ONCE().\n\nNote that @dev can\u0026apos;t be NULL.(CVE-2026-43101)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm: account XFRMA_IF_ID in aevent size calculation\n\nxfrm_get_ae() allocates the reply skb with xfrm_aevent_msgsize(), then\nbuild_aevent() appends attributes including XFRMA_IF_ID when x-\u0026gt;if_id is\nset.\n\nxfrm_aevent_msgsize() does not include space for XFRMA_IF_ID. For states\nwith if_id, build_aevent() can fail with -EMSGSIZE and hit BUG_ON(err \u0026lt; 0)\nin xfrm_get_ae(), turning a malformed netlink interaction into a kernel\npanic.\n\nAccount XFRMA_IF_ID in the size calculation unconditionally and replace\nthe BUG_ON with normal error unwinding.(CVE-2026-43107)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: usb: kaweth: remove TX queue manipulation in kaweth_set_rx_mode\n\nkaweth_set_rx_mode(), the ndo_set_rx_mode callback, calls\nnetif_stop_queue() and netif_wake_queue(). These are TX queue flow\ncontrol functions unrelated to RX multicast configuration.\n\nThe premature netif_wake_queue() can re-enable TX while tx_urb is still\nin-flight, leading to a double usb_submit_urb() on the same URB:\n\nkaweth_start_xmit() {\n netif_stop_queue();\n usb_submit_urb(kaweth-\u0026gt;tx_urb);\n}\n\nkaweth_set_rx_mode() {\n netif_stop_queue();\n netif_wake_queue(); // wakes TX queue before URB is done\n}\n\nkaweth_start_xmit() {\n netif_stop_queue();\n usb_submit_urb(kaweth-\u0026gt;tx_urb); // URB submitted while active\n}\n\nThis triggers the WARN in usb_submit_urb():\n\n \u0026quot;URB submitted while active\u0026quot;\n\nThis is a similar class of bug fixed in rtl8150 by\n\n- commit 958baf5eaee3 (\u0026quot;net: usb: Remove disruptive netif_wake_queue in rtl8150_set_multicast\u0026quot;).\n\nAlso kaweth_set_rx_mode() is already functionally broken, the\nreal set_rx_mode action is performed by kaweth_async_set_rx_mode(),\nwhich in turn is not a no-op only at ndo_open() time.(CVE-2026-43180)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: consume xmit errors of GSO frames\n\nudpgro_frglist.sh and udpgro_bench.sh are the flakiest tests\ncurrently in NIPA. They fail in the same exact way, TCP GRO\ntest stalls occasionally and the test gets killed after 10min.\n\nThese tests use veth to simulate GRO. They attach a trivial\n(\u0026quot;return XDP_PASS;\u0026quot;) XDP program to the veth to force TSO off\nand NAPI on.\n\nDigging into the failure mode we can see that the connection\nis completely stuck after a burst of drops. The sender\u0026apos;s snd_nxt\nis at sequence number N [1], but the receiver claims to have\nreceived (rcv_nxt) up to N + 3 * MSS [2]. Last piece of the puzzle\nis that senders rtx queue is not empty (let\u0026apos;s say the block in\nthe rtx queue is at sequence number N - 4 * MSS [3]).\n\nIn this state, sender sends a retransmission from the rtx queue\nwith a single segment, and sequence numbers N-4*MSS:N-3*MSS [3].\nReceiver sees it and responds with an ACK all the way up to\nN + 3 * MSS [2]. But sender will reject this ack as TCP_ACK_UNSENT_DATA\nbecause it has no recollection of ever sending data that far out [1].\nAnd we are stuck.\n\nThe root cause is the mess of the xmit return codes. veth returns\nan error when it can\u0026apos;t xmit a frame. We end up with a loss event\nlike this:\n\n -------------------------------------------------\n | GSO super frame 1 | GSO super frame 2 |\n |-----------------------------------------------|\n | seg | seg | seg | seg | seg | seg | seg | seg |\n | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 |\n -------------------------------------------------\n x ok ok \u0026lt;ok\u0026gt;| ok ok ok \u0026lt;x\u0026gt;\n \\\\\n\t\t\t snd_nxt\n\n\u0026quot;x\u0026quot; means packet lost by veth, and \u0026quot;ok\u0026quot; means it went thru.\nSince veth has TSO disabled in this test it sees individual segments.\nSegment 1 is on the retransmit queue and will be resent.\n\nSo why did the sender not advance snd_nxt even tho it clearly did\nsend up to seg 8? tcp_write_xmit() interprets the return code\nfrom the core to mean that data has not been sent at all. Since\nTCP deals with GSO super frames, not individual segment the crux\nof the problem is that loss of a single segment can be interpreted\nas loss of all. TCP only sees the last return code for the last\nsegment of the GSO frame (in \u0026lt;\u0026gt; brackets in the diagram above).\n\nOf course for the problem to occur we need a setup or a device\nwithout a Qdisc. Otherwise Qdisc layer disconnects the protocol\nlayer from the device errors completely.\n\nWe have multiple ways to fix this.\n\n 1) make veth not return an error when it lost a packet.\n While this is what I think we did in the past, the issue keeps\n reappearing and it\u0026apos;s annoying to debug. The game of whack\n a mole is not great.\n\n 2) fix the damn return codes\n We only talk about NETDEV_TX_OK and NETDEV_TX_BUSY in the\n documentation, so maybe we should make the return code from\n ndo_start_xmit() a boolean. I like that the most, but perhaps\n some ancient, not-really-networking protocol would suffer.\n\n 3) make TCP ignore the errors\n It is not entirely clear to me what benefit TCP gets from\n interpreting the result of ip_queue_xmit()? Specifically once\n the connection is established and we\u0026apos;re pushing data - packet\n loss is just packet loss?\n\n 4) this fix\n Ignore the rc in the Qdisc-less+GSO case, since it\u0026apos;s unreliable.\n We already always return OK in the TCQ_F_CAN_BYPASS case.\n In the Qdisc-less case let\u0026apos;s be a bit more conservative and only\n mask the GSO errors. This path is taken by non-IP-\u0026quot;networks\u0026quot;\n like CAN, MCTP etc, so we could regress some ancient thing.\n This is the simplest, but also maybe the hackiest fix?\n\nSimilar fix has been proposed by Eric in the past but never committed\nbecause original reporter was working with an OOT driver and wasn\u0026apos;t\nproviding feedback (see Link).(CVE-2026-43194)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntcp: fix potential race in tcp_v6_syn_recv_sock()\n\nCode in tcp_v6_syn_recv_sock() after the call to tcp_v4_syn_recv_sock()\nis done too late.\n\nAfter tcp_v4_syn_recv_sock(), the child socket is already visible\nfrom TCP ehash table and other cpus might use it.\n\nSince newinet-\u0026gt;pinet6 is still pointing to the listener ipv6_pinfo\nbad things can happen as syzbot found.\n\nMove the problematic code in tcp_v6_mapped_child_init()\nand call this new helper from tcp_v4_syn_recv_sock() before\nthe ehash insertion.\n\nThis allows the removal of one tcp_sync_mss(), since\ntcp_v4_syn_recv_sock() will call it with the correct\ncontext.(CVE-2026-43198)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: Drop the lock in skb_may_tx_timestamp()\n\nskb_may_tx_timestamp() may acquire sock::sk_callback_lock. The lock must\nnot be taken in IRQ context, only softirq is okay. A few drivers receive\nthe timestamp via a dedicated interrupt and complete the TX timestamp\nfrom that handler. This will lead to a deadlock if the lock is already\nwrite-locked on the same CPU.\n\nTaking the lock can be avoided. The socket (pointed by the skb) will\nremain valid until the skb is released. The -\u0026gt;sk_socket and -\u0026gt;file\nmember will be set to NULL once the user closes the socket which may\nhappen before the timestamp arrives.\nIf we happen to observe the pointer while the socket is closing but\nbefore the pointer is set to NULL then we may use it because both\npointer (and the file\u0026apos;s cred member) are RCU freed.\n\nDrop the lock. Use READ_ONCE() to obtain the individual pointer. Add a\nmatching WRITE_ONCE() where the pointer are cleared.(CVE-2026-43216)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nvhost: move vdpa group bound check to vhost_vdpa\n\nRemove duplication by consolidating these here. This reduces the\nposibility of a parent driver missing them.\n\nWhile we\u0026apos;re at it, fix a bug in vdpa_sim where a valid ASID can be\nassigned to a group equal to ngroups, causing an out of bound write.(CVE-2026-43248)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmm/page_alloc: clear page-\u0026gt;private in free_pages_prepare()\n\nSeveral subsystems (slub, shmem, ttm, etc.) use page-\u0026gt;private but don\u0026apos;t\nclear it before freeing pages. When these pages are later allocated as\nhigh-order pages and split via split_page(), tail pages retain stale\npage-\u0026gt;private values.\n\nThis causes a use-after-free in the swap subsystem. The swap code uses\npage-\u0026gt;private to track swap count continuations, assuming freshly\nallocated pages have page-\u0026gt;private == 0. When stale values are present,\nswap_count_continued() incorrectly assumes the continuation list is valid\nand iterates over uninitialized page-\u0026gt;lru containing LIST_POISON values,\ncausing a crash:\n\n KASAN: maybe wild-memory-access in range [0xdead000000000100-0xdead000000000107]\n RIP: 0010:__do_sys_swapoff+0x1151/0x1860\n\nFix this by clearing page-\u0026gt;private in free_pages_prepare(), ensuring all\nfreed pages have clean state regardless of previous use.(CVE-2026-43303)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBluetooth: SMP: force responder MITM requirements before building the pairing response\n\nsmp_cmd_pairing_req() currently builds the pairing response from the\ninitiator auth_req before enforcing the local BT_SECURITY_HIGH\nrequirement. If the initiator omits SMP_AUTH_MITM, the response can\nalso omit it even though the local side still requires MITM.\n\ntk_request() then sees an auth value without SMP_AUTH_MITM and may\nselect JUST_CFM, making method selection inconsistent with the pairing\npolicy the responder already enforces.\n\nWhen the local side requires HIGH security, first verify that MITM can\nbe achieved from the IO capabilities and then force SMP_AUTH_MITM in the\nresponse in both rsp.auth_req and auth. This keeps the responder auth bits\nand later method selection aligned.(CVE-2026-43334)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/mlx5e: RX, Fix XDP multi-buf frag counting for striding RQ\n\nXDP multi-buf programs can modify the layout of the XDP buffer when the\nprogram calls bpf_xdp_pull_data() or bpf_xdp_adjust_tail(). The\nreferenced commit in the fixes tag corrected the assumption in the mlx5\ndriver that the XDP buffer layout doesn\u0026apos;t change during a program\nexecution. However, this fix introduced another issue: the dropped\nfragments still need to be counted on the driver side to avoid page\nfragment reference counting issues.\n\nThe issue was discovered by the drivers/net/xdp.py selftest,\nmore specifically the test_xdp_native_tx_mb:\n- The mlx5 driver allocates a page_pool page and initializes it with\n a frag counter of 64 (pp_ref_count=64) and the internal frag counter\n to 0.\n- The test sends one packet with no payload.\n- On RX (mlx5e_skb_from_cqe_mpwrq_nonlinear()), mlx5 configures the XDP\n buffer with the packet data starting in the first fragment which is the\n page mentioned above.\n- The XDP program runs and calls bpf_xdp_pull_data() which moves the\n header into the linear part of the XDP buffer. As the packet doesn\u0026apos;t\n contain more data, the program drops the tail fragment since it no\n longer contains any payload (pp_ref_count=63).\n- mlx5 device skips counting this fragment. Internal frag counter\n remains 0.\n- mlx5 releases all 64 fragments of the page but page pp_ref_count is\n 63 =\u0026gt; negative reference counting error.\n\nResulting splat during the test:\n\n WARNING: CPU: 0 PID: 188225 at ./include/net/page_pool/helpers.h:297 mlx5e_page_release_fragmented.isra.0+0xbd/0xe0 [mlx5_core]\n Modules linked in: [...]\n CPU: 0 UID: 0 PID: 188225 Comm: ip Not tainted 6.18.0-rc7_for_upstream_min_debug_2025_12_08_11_44 #1 NONE\n Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.13.0-0-gf21b5a4aeb02-prebuilt.qemu.org 04/01/2014\n RIP: 0010:mlx5e_page_release_fragmented.isra.0+0xbd/0xe0 [mlx5_core]\n [...]\n Call Trace:\n \u0026lt;TASK\u0026gt;\n mlx5e_free_rx_mpwqe+0x20a/0x250 [mlx5_core]\n mlx5e_dealloc_rx_mpwqe+0x37/0xb0 [mlx5_core]\n mlx5e_free_rx_descs+0x11a/0x170 [mlx5_core]\n mlx5e_close_rq+0x78/0xa0 [mlx5_core]\n mlx5e_close_queues+0x46/0x2a0 [mlx5_core]\n mlx5e_close_channel+0x24/0x90 [mlx5_core]\n mlx5e_close_channels+0x5d/0xf0 [mlx5_core]\n mlx5e_safe_switch_params+0x2ec/0x380 [mlx5_core]\n mlx5e_change_mtu+0x11d/0x490 [mlx5_core]\n mlx5e_change_nic_mtu+0x19/0x30 [mlx5_core]\n netif_set_mtu_ext+0xfc/0x240\n do_setlink.isra.0+0x226/0x1100\n rtnl_newlink+0x7a9/0xba0\n rtnetlink_rcv_msg+0x220/0x3c0\n netlink_rcv_skb+0x4b/0xf0\n netlink_unicast+0x255/0x380\n netlink_sendmsg+0x1f3/0x420\n __sock_sendmsg+0x38/0x60\n ____sys_sendmsg+0x1e8/0x240\n ___sys_sendmsg+0x7c/0xb0\n [...]\n __sys_sendmsg+0x5f/0xb0\n do_syscall_64+0x55/0xc70\n\nThe problem applies for XDP_PASS as well which is handled in a different\ncode path in the driver.\n\nThis patch fixes the issue by doing page frag counting on all the\noriginal XDP buffer fragments for all relevant XDP actions (XDP_TX ,\nXDP_REDIRECT and XDP_PASS). This is basically reverting to the original\ncounting before the commit in the fixes tag.\n\nAs frag_page is still pointing to the original tail, the nr_frags\nparameter to xdp_update_skb_frags_info() needs to be calculated\nin a different way to reflect the new nr_frags.(CVE-2026-43465)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/mlx5e: Fix DMA FIFO desync on error CQE SQ recovery\n\nIn case of a TX error CQE, a recovery flow is triggered,\nmlx5e_reset_txqsq_cc_pc() resets dma_fifo_cc to 0 but not dma_fifo_pc,\ndesyncing the DMA FIFO producer and consumer.\n\nAfter recovery, the producer pushes new DMA entries at the old\ndma_fifo_pc, while the consumer reads from position 0.\nThis causes us to unmap stale DMA addresses from before the recovery.\n\nThe DMA FIFO is a purely software construct with no HW counterpart.\nAt the point of reset, all WQEs have been flushed so dma_fifo_cc is\nalready equal to dma_fifo_pc. There is no need to reset either counter,\nsimilar to how skb_fifo pc/cc are untouched.\n\nRemove the \u0026apos;dma_fifo_cc = 0\u0026apos; reset.\n\nThis fixes the following WARNING:\n WARNING: CPU: 0 PID: 0 at drivers/iommu/dma-iommu.c:1240 iommu_dma_unmap_page+0x79/0x90\n Modules linked in: mlx5_vdpa vringh vdpa bonding mlx5_ib mlx5_vfio_pci ipip mlx5_fwctl tunnel4 mlx5_core ib_ipoib geneve ip6_gre ip_gre gre nf_tables ip6_tunnel rdma_ucm ib_uverbs ib_umad vfio_pci vfio_pci_core act_mirred act_skbedit act_vlan vhost_net vhost tap ip6table_mangle ip6table_nat ip6table_filter ip6_tables iptable_mangle cls_matchall nfnetlink_cttimeout act_gact cls_flower sch_ingress vhost_iotlb iptable_raw tunnel6 vfio_iommu_type1 vfio openvswitch nsh rpcsec_gss_krb5 auth_rpcgss oid_registry xt_conntrack xt_MASQUERADE nf_conntrack_netlink nfnetlink iptable_nat nf_nat xt_addrtype br_netfilter overlay zram zsmalloc rpcrdma ib_iser libiscsi scsi_transport_iscsi rdma_cm iw_cm ib_cm ib_core fuse [last unloaded: nf_tables]\n CPU: 0 UID: 0 PID: 0 Comm: swapper/0 Not tainted 6.13.0-rc5_for_upstream_min_debug_2024_12_30_21_33 #1\n Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.13.0-0-gf21b5a4aeb02-prebuilt.qemu.org 04/01/2014\n RIP: 0010:iommu_dma_unmap_page+0x79/0x90\n Code: 2b 4d 3b 21 72 26 4d 3b 61 08 73 20 49 89 d8 44 89 f9 5b 4c 89 f2 4c 89 e6 48 89 ef 5d 41 5c 41 5d 41 5e 41 5f e9 c7 ae 9e ff \u0026lt;0f\u0026gt; 0b 5b 5d 41 5c 41 5d 41 5e 41 5f c3 66 2e 0f 1f 84 00 00 00 00\n Call Trace:\n \u0026lt;IRQ\u0026gt;\n ? __warn+0x7d/0x110\n ? iommu_dma_unmap_page+0x79/0x90\n ? report_bug+0x16d/0x180\n ? handle_bug+0x4f/0x90\n ? exc_invalid_op+0x14/0x70\n ? asm_exc_invalid_op+0x16/0x20\n ? iommu_dma_unmap_page+0x79/0x90\n ? iommu_dma_unmap_page+0x2e/0x90\n dma_unmap_page_attrs+0x10d/0x1b0\n mlx5e_tx_wi_dma_unmap+0xbe/0x120 [mlx5_core]\n mlx5e_poll_tx_cq+0x16d/0x690 [mlx5_core]\n mlx5e_napi_poll+0x8b/0xac0 [mlx5_core]\n __napi_poll+0x24/0x190\n net_rx_action+0x32a/0x3b0\n ? mlx5_eq_comp_int+0x7e/0x270 [mlx5_core]\n ? notifier_call_chain+0x35/0xa0\n handle_softirqs+0xc9/0x270\n irq_exit_rcu+0x71/0xd0\n common_interrupt+0x7f/0xa0\n \u0026lt;/IRQ\u0026gt;\n \u0026lt;TASK\u0026gt;\n asm_common_interrupt+0x22/0x40(CVE-2026-43466)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipvs: skip ipv6 extension headers for csum checks\n\nProtocol checksum validation fails for IPv6 if there are extension\nheaders before the protocol header. iph-\u0026gt;len already contains its\noffset, so use it to fix the problem.(CVE-2026-45850)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\napparmor: Fix \u0026amp; Optimize table creation from possibly unaligned memory\n\nSource blob may come from userspace and might be unaligned.\nTry to optize the copying process by avoiding unaligned memory accesses.\n\n- Added Fixes tag\n- Added \u0026quot;Fix \u0026amp;\u0026quot; to description as this doesn\u0026apos;t just optimize but fixes\n a potential unaligned memory access\n[jj: remove duplicate word \u0026quot;convert\u0026quot; in comment trigger checkpatch warning](CVE-2026-45893)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/vt-d: Clear Present bit before tearing down PASID entry\n\nThe Intel VT-d Scalable Mode PASID table entry consists of 512 bits (64\nbytes). When tearing down an entry, the current implementation zeros the\nentire 64-byte structure immediately using multiple 64-bit writes.\n\nSince the IOMMU hardware may fetch these 64 bytes using multiple\ninternal transactions (e.g., four 128-bit bursts), updating or zeroing\nthe entire entry while it is active (P=1) risks a \u0026quot;torn\u0026quot; read. If a\nhardware fetch occurs simultaneously with the CPU zeroing the entry, the\nhardware could observe an inconsistent state, leading to unpredictable\nbehavior or spurious faults.\n\nFollow the \u0026quot;Guidance to Software for Invalidations\u0026quot; in the VT-d spec\n(Section 6.5.3.3) by implementing the recommended ownership handshake:\n\n1. Clear only the \u0026apos;Present\u0026apos; (P) bit of the PASID entry.\n2. Use a dma_wmb() to ensure the cleared bit is visible to hardware\n before proceeding.\n3. Execute the required invalidation sequence (PASID cache, IOTLB, and\n Device-TLB flush) to ensure the hardware has released all cached\n references.\n4. Only after the flushes are complete, zero out the remaining fields\n of the PASID entry.\n\nAlso, add a dma_wmb() in pasid_set_present() to ensure that all other\nfields of the PASID entry are visible to the hardware before the Present\nbit is set.(CVE-2026-45894)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nquota: fix livelock between quotactl and freeze_super\n\nWhen a filesystem is frozen, quotactl_block() enters a retry loop\nwaiting for the filesystem to thaw. It acquires s_umount, checks the\nfreeze state, drops s_umount and uses sb_start_write() - sb_end_write()\npair to wait for the unfreeze.\n\nHowever, this retry loop can trigger a livelock issue, specifically on\nkernels with preemption disabled.\n\nThe mechanism is as follows:\n1. freeze_super() sets SB_FREEZE_WRITE and calls sb_wait_write().\n2. sb_wait_write() calls percpu_down_write(), which initiates\n synchronize_rcu().\n3. Simultaneously, quotactl_block() spins in its retry loop, immediately\n executing the sb_start_write() - sb_end_write() pair.\n4. Because the kernel is non-preemptible and the loop contains no\n scheduling points, quotactl_block() never yields the CPU. This\n prevents that CPU from reaching an RCU quiescent state.\n5. synchronize_rcu() in the freezer thread waits indefinitely for the\n quotactl_block() CPU to report a quiescent state.\n6. quotactl_block() spins indefinitely waiting for the freezer to\n advance, which it cannot do as it is blocked on the RCU sync.\n\nThis results in a hang of the freezer process and 100% CPU usage by the\nquota process.\n\nWhile this can occur intermittently on multi-core systems, it is\nreliably reproducing on a node with the following script, running both\nthe freezer and the quota toggle on the same CPU:\n\n # mkfs.ext4 -O quota /dev/sda 2g \u0026amp;\u0026amp; mkdir a_mount\n # mount /dev/sda -o quota,usrquota,grpquota a_mount\n # taskset -c 3 bash -c \u0026quot;while true; do xfs_freeze -f a_mount; \\\n xfs_freeze -u a_mount; done\u0026quot; \u0026amp;\n # taskset -c 3 bash -c \u0026quot;while true; do quotaon a_mount; \\\n quotaoff a_mount; done\u0026quot; \u0026amp;\n\nAdding cond_resched() to the retry loop fixes the issue. It acts as an\nRCU quiescent state, allowing synchronize_rcu() in percpu_down_write()\nto complete.(CVE-2026-45895)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfat: avoid parent link count underflow in rmdir\n\nCorrupted FAT images can leave a directory inode with an incorrect\ni_nlink (e.g. 2 even though subdirectories exist). rmdir then\nunconditionally calls drop_nlink(dir) and can drive i_nlink to 0,\ntriggering the WARN_ON in drop_nlink().\n\nAdd a sanity check in vfat_rmdir() and msdos_rmdir(): only drop the\nparent link count when it is at least 3, otherwise report a filesystem\nerror.(CVE-2026-45915)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\next4: fix dirtyclusters double decrement on fs shutdown\n\nfstests test generic/388 occasionally reproduces a warning in\next4_put_super() associated with the dirty clusters count:\n\n WARNING: CPU: 7 PID: 76064 at fs/ext4/super.c:1324 ext4_put_super+0x48c/0x590 [ext4]\n\nTracing the failure shows that the warning fires due to an\ns_dirtyclusters_counter value of -1. IOW, this appears to be a\nspurious decrement as opposed to some sort of leak. Further tracing\nof the dirty cluster count deltas and an LLM scan of the resulting\noutput identified the cause as a double decrement in the error path\nbetween ext4_mb_mark_diskspace_used() and the caller\next4_mb_new_blocks().\n\nFirst, note that generic/388 is a shutdown vs. fsstress test and so\nproduces a random set of operations and shutdown injections. In the\nproblematic case, the shutdown triggers an error return from the\next4_handle_dirty_metadata() call(s) made from\next4_mb_mark_context(). The changed value is non-zero at this point,\nso ext4_mb_mark_diskspace_used() does not exit after the error\nbubbles up from ext4_mb_mark_context(). Instead, the former\ndecrements both cluster counters and returns the error up to\next4_mb_new_blocks(). The latter falls into the !ar-\u0026gt;len out path\nwhich decrements the dirty clusters counter a second time, creating\nthe inconsistency.\n\nTo avoid this problem and simplify ownership of the cluster\nreservation in this codepath, lift the counter reduction to a single\nplace in the caller. This makes it more clear that\next4_mb_new_blocks() is responsible for acquiring cluster\nreservation (via ext4_claim_free_clusters()) in the !delalloc case\nas well as releasing it, regardless of whether it ends up consumed\nor returned due to failure.(CVE-2026-45920)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/vt-d: Clear Present bit before tearing down context entry\n\nWhen tearing down a context entry, the current implementation zeros the\nentire 128-bit entry using multiple 64-bit writes. This creates a window\nwhere the hardware can fetch a \u0026quot;torn\u0026quot; entry \u2014 where some fields are\nalready zeroed while the \u0026apos;Present\u0026apos; bit is still set \u2014 leading to\nunpredictable behavior or spurious faults.\n\nWhile x86 provides strong write ordering, the compiler may reorder writes\nto the two 64-bit halves of the context entry. Even without compiler\nreordering, the hardware fetch is not guaranteed to be atomic with\nrespect to multiple CPU writes.\n\nAlign with the \u0026quot;Guidance to Software for Invalidations\u0026quot; in the VT-d spec\n(Section 6.5.3.3) by implementing the recommended ownership handshake:\n\n1. Clear only the \u0026apos;Present\u0026apos; (P) bit of the context entry first to\n signal the transition of ownership from hardware to software.\n2. Use dma_wmb() to ensure the cleared bit is visible to the IOMMU.\n3. Perform the required cache and context-cache invalidation to ensure\n hardware no longer has cached references to the entry.\n4. Fully zero out the entry only after the invalidation is complete.\n\nAlso, add a dma_wmb() to context_set_present() to ensure the entry\nis fully initialized before the \u0026apos;Present\u0026apos; bit becomes visible.(CVE-2026-45944)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nhwrng: core - use RCU and work_struct to fix race condition\n\nCurrently, hwrng_fill is not cleared until the hwrng_fillfn() thread\nexits. Since hwrng_unregister() reads hwrng_fill outside the rng_mutex\nlock, a concurrent hwrng_unregister() may call kthread_stop() again on\nthe same task.\n\nAdditionally, if hwrng_unregister() is called immediately after\nhwrng_register(), the stopped thread may have never been executed. Thus,\nhwrng_fill remains dirty even after hwrng_unregister() returns. In this\ncase, subsequent calls to hwrng_register() will fail to start new\nthreads, and hwrng_unregister() will call kthread_stop() on the same\nfreed task. In both cases, a use-after-free occurs:\n\nrefcount_t: addition on 0; use-after-free.\nWARNING: ... at lib/refcount.c:25 refcount_warn_saturate+0xec/0x1c0\nCall Trace:\n kthread_stop+0x181/0x360\n hwrng_unregister+0x288/0x380\n virtrng_remove+0xe3/0x200\n\nThis patch fixes the race by protecting the global hwrng_fill pointer\ninside the rng_mutex lock, so that hwrng_fillfn() thread is stopped only\nonce, and calls to kthread_run() and kthread_stop() are serialized\nwith the lock held.\n\nTo avoid deadlock in hwrng_fillfn() while being stopped with the lock\nheld, we convert current_rng to RCU, so that get_current_rng() can read\ncurrent_rng without holding the lock. To remove the lock from put_rng(),\nwe also delay the actual cleanup into a work_struct.\n\nSince get_current_rng() no longer returns ERR_PTR values, the IS_ERR()\nchecks are removed from its callers.\n\nWith hwrng_fill protected by the rng_mutex lock, hwrng_fillfn() can no\nlonger clear hwrng_fill itself. Therefore, if hwrng_fillfn() returns\ndirectly after current_rng is dropped, kthread_stop() would be called on\na freed task_struct later. To fix this, hwrng_fillfn() calls schedule()\nnow to keep the task alive until being stopped. The kthread_stop() call\nis also moved from hwrng_unregister() to drop_current_rng(), ensuring\nkthread_stop() is called on all possible paths where current_rng becomes\nNULL, so that the thread would not wait forever.(CVE-2026-45949)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncpuidle: Skip governor when only one idle state is available\n\nOn certain platforms (PowerNV systems without a power-mgt DT node),\ncpuidle may register only a single idle state. In cases where that\nsingle state is a polling state (state 0), the ladder governor may\nincorrectly treat state 1 as the first usable state and pass an\nout-of-bounds index. This can lead to a NULL enter callback being\ninvoked, ultimately resulting in a system crash.\n\n[ 13.342636] cpuidle-powernv : Only Snooze is available\n[ 13.351854] Faulting instruction address: 0x00000000\n[ 13.376489] NIP [0000000000000000] 0x0\n[ 13.378351] LR [c000000001e01974] cpuidle_enter_state+0x2c4/0x668\n\nFix this by adding a bail-out in cpuidle_select() that returns state 0\ndirectly when state_count \u0026lt;= 1, bypassing the governor and keeping the\ntick running.(CVE-2026-45968)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/mlx5: Fix UMR hang in LAG error state unload\n\nDuring firmware reset in LAG mode, a race condition causes the driver\nto hang indefinitely while waiting for UMR completion during device\nunload. See [1].\n\nIn LAG mode the bond device is only registered on the master, so it\nnever sees sys_error events from the slave.\nDuring firmware reset this causes UMR waits to hang forever on unload\nas the slave is dead but the master hasn\u0026apos;t entered error state yet, so\nUMR posts succeed but completions never arrive.\n\nFix this by adding a sys_error notifier that gets registered before\nMLX5_IB_STAGE_IB_REG and stays alive until after ib_unregister_device().\nThis ensures error events reach the bond device throughout teardown.\n\n[1]\nCall Trace:\n __schedule+0x2bd/0x760\n schedule+0x37/0xa0\n schedule_preempt_disabled+0xa/0x10\n __mutex_lock.isra.6+0x2b5/0x4a0\n __mlx5_ib_dereg_mr+0x606/0x870 [mlx5_ib]\n ? __xa_erase+0x4a/0xa0\n ? _cond_resched+0x15/0x30\n ? wait_for_completion+0x31/0x100\n ib_dereg_mr_user+0x48/0xc0 [ib_core]\n ? rdmacg_uncharge_hierarchy+0xa0/0x100\n destroy_hw_idr_uobject+0x20/0x50 [ib_uverbs]\n uverbs_destroy_uobject+0x37/0x150 [ib_uverbs]\n __uverbs_cleanup_ufile+0xda/0x140 [ib_uverbs]\n uverbs_destroy_ufile_hw+0x3a/0xf0 [ib_uverbs]\n ib_uverbs_remove_one+0xc3/0x140 [ib_uverbs]\n remove_client_context+0x8b/0xd0 [ib_core]\n disable_device+0x8c/0x130 [ib_core]\n __ib_unregister_device+0x10d/0x180 [ib_core]\n ib_unregister_device+0x21/0x30 [ib_core]\n __mlx5_ib_remove+0x1e4/0x1f0 [mlx5_ib]\n auxiliary_bus_remove+0x1e/0x30\n device_release_driver_internal+0x103/0x1f0\n bus_remove_device+0xf7/0x170\n device_del+0x181/0x410\n mlx5_rescan_drivers_locked.part.10+0xa9/0x1d0 [mlx5_core]\n mlx5_disable_lag+0x253/0x260 [mlx5_core]\n mlx5_lag_disable_change+0x89/0xc0 [mlx5_core]\n mlx5_eswitch_disable+0x67/0xa0 [mlx5_core]\n mlx5_unload+0x15/0xd0 [mlx5_core]\n mlx5_unload_one+0x71/0xc0 [mlx5_core]\n mlx5_sync_reset_reload_work+0x83/0x100 [mlx5_core]\n process_one_work+0x1a7/0x360\n worker_thread+0x30/0x390\n ? create_worker+0x1a0/0x1a0\n kthread+0x116/0x130\n ? kthread_flush_work_fn+0x10/0x10\n ret_from_fork+0x22/0x40(CVE-2026-45973)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ngfs2: Fix use-after-free in iomap inline data write path\n\nThe inline data buffer head (dibh) is being released prematurely in\ngfs2_iomap_begin() via release_metapath() while iomap-\u0026gt;inline_data\nstill points to dibh-\u0026gt;b_data. This causes a use-after-free when\niomap_write_end_inline() later attempts to write to the inline data\narea.\n\nThe bug sequence:\n1. gfs2_iomap_begin() calls gfs2_meta_inode_buffer() to read inode\n metadata into dibh\n2. Sets iomap-\u0026gt;inline_data = dibh-\u0026gt;b_data + sizeof(struct gfs2_dinode)\n3. Calls release_metapath() which calls brelse(dibh), dropping refcount\n to 0\n4. kswapd reclaims the page (~39ms later in the syzbot report)\n5. iomap_write_end_inline() tries to memcpy() to iomap-\u0026gt;inline_data\n6. KASAN detects use-after-free write to freed memory\n\nFix by storing dibh in iomap-\u0026gt;private and incrementing its refcount\nwith get_bh() in gfs2_iomap_begin(). The buffer is then properly\nreleased in gfs2_iomap_end() after the inline write completes,\nensuring the page stays alive for the entire iomap operation.\n\nNote: A C reproducer is not available for this issue. The fix is based\non analysis of the KASAN report and code review showing the buffer head\nis freed before use.\n\n[agruenba: Take buffer head reference in gfs2_iomap_begin() to avoid\nleaks in gfs2_iomap_get() and gfs2_iomap_alloc().](CVE-2026-45984)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrm/nouveau: fix u32 overflow in pushbuf reloc bounds check\n\nnouveau_gem_pushbuf_reloc_apply() validates each relocation with\n\n if (r-\u0026gt;reloc_bo_offset + 4 \u0026gt; nvbo-\u0026gt;bo.base.size)\n\nbut reloc_bo_offset is __u32 (uapi/drm/nouveau_drm.h) and the integer\nliteral 4 promotes to unsigned int, so the addition is performed in 32\nbits and wraps before the comparison against the size_t bo size.\n\nCast to u64 so the addition happens in 64-bit arithmetic.\n\n[ Add Fixes: tag. - Danilo ](CVE-2026-46006)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nthermal: core: Fix thermal zone governor cleanup issues\n\nIf thermal_zone_device_register_with_trips() fails after adding\na thermal governor to the thermal zone being registered, the\ngovernor is not removed from it as appropriate which may lead to\na memory leak.\n\nIn turn, thermal_zone_device_unregister() calls thermal_set_governor()\nwithout acquiring the thermal zone lock beforehand which may race with\na governor update via sysfs and may lead to a use-after-free in that\ncase.\n\nAddress these issues by adding two thermal_set_governor() calls, one to\nthermal_release() to remove the governor from the given thermal zone,\nand one to the thermal zone registration error path to cover failures\npreceding the thermal zone device registration.(CVE-2026-46021)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nKVM: nSVM: Triple fault if restore host CR3 fails on nested #VMEXIT\n\nIf loading L1\u0026apos;s CR3 fails on a nested #VMEXIT, nested_svm_vmexit()\nreturns an error code that is ignored by most callers, and continues to\nrun L1 with corrupted state. A sane recovery is not possible in this\ncase, and HW behavior is to cause a shutdown. Inject a triple fault\ninstead, and do not return early from nested_svm_vmexit(). Continue\ncleaning up the vCPU state (e.g. clear pending exceptions), to handle\nthe failure as gracefully as possible.\n\nFrom the APM:\n\n Upon #VMEXIT, the processor performs the following actions in order to\n return to the host execution context:\n\n ...\n\n if (illegal host state loaded, or exception while loading host state)\n shutdown\n else\n execute first host instruction following the VMRUN\n\nRemove the return value of nested_svm_vmexit(), which is mostly\nunchecked anyway.(CVE-2026-46032)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: authencesn - reject short ahash digests during instance creation\n\nauthencesn requires either a zero authsize or an authsize of at least\n4 bytes because the ESN encrypt/decrypt paths always move 4 bytes of\nhigh-order sequence number data at the end of the authenticated data.\n\nWhile crypto_authenc_esn_setauthsize() already rejects explicit\nnon-zero authsizes in the range 1..3, crypto_authenc_esn_create()\nstill copied auth-\u0026gt;digestsize into inst-\u0026gt;alg.maxauthsize without\nvalidating it. The AEAD core then initialized the tfm\u0026apos;s default\nauthsize from that value.\n\nAs a result, selecting an ahash with digest size 1..3, such as\ncbcmac(cipher_null), exposed authencesn instances whose default\nauthsize was invalid even though setauthsize() would have rejected the\nsame value. AF_ALG could then trigger the ESN tail handling with a\ntoo-short tag and hit an out-of-bounds access.\n\nReject authencesn instances whose ahash digest size is in the invalid\nnon-zero range 1..3 so that no tfm can inherit an unsupported default\nauthsize.(CVE-2026-46033)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nceph: only d_add() negative dentries when they are unhashed\n\nCeph can call d_add(dentry, NULL) on a negative dentry that is already\npresent in the primary dcache hash.\n\nIn the current VFS that is not safe. d_add() goes through __d_add()\nto __d_rehash(), which unconditionally reinserts dentry-\u0026gt;d_hash into\nthe hlist_bl bucket. If the dentry is already hashed, reinserting the\nsame node can corrupt the bucket, including creating a self-loop.\nOnce that happens, __d_lookup() can spin forever in the hlist_bl walk,\ntypically looping only on the d_name.hash mismatch check and\neventually triggering RCU stall reports like this one:\n\n rcu: INFO: rcu_sched self-detected stall on CPU\n rcu: 87-....: (2100 ticks this GP) idle=3a4c/1/0x4000000000000000 softirq=25003319/25003319 fqs=829\n rcu: (t=2101 jiffies g=79058445 q=698988 ncpus=192)\n CPU: 87 UID: 2952868916 PID: 3933303 Comm: php-cgi8.3 Not tainted 6.18.17-i1-amd #950 NONE\n Hardware name: Dell Inc. PowerEdge R7615/0G9DHV, BIOS 1.6.6 09/22/2023\n RIP: 0010:__d_lookup+0x46/0xb0\n Code: c1 e8 07 48 8d 04 c2 48 8b 00 49 89 fc 49 89 f5 48 89 c3 48 83 e3 fe 48 83 f8 01 77 0f eb 2d 0f 1f 44 00 00 48 8b 1b 48 85 db \u0026lt;74\u0026gt; 20 39 6b 18 75 f3 48 8d 7b 78 e8 ba 85 d0 00 4c 39 63 10 74 1f\n RSP: 0018:ff745a70c8253898 EFLAGS: 00000282\n RAX: ff26e470054cb208 RBX: ff26e470054cb208 RCX: 000000006e958966\n RDX: ff26e48267340000 RSI: ff745a70c82539b0 RDI: ff26e458f74655c0\n RBP: 000000006e958966 R08: 0000000000000180 R09: 9cd08d909b919a89\n R10: ff26e458f74655c0 R11: 0000000000000000 R12: ff26e458f74655c0\n R13: ff745a70c82539b0 R14: d0d0d0d0d0d0d0d0 R15: 2f2f2f2f2f2f2f2f\n FS: 00007f5770896980(0000) GS:ff26e482c5d88000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 00007f5764de50c0 CR3: 000000a72abb5001 CR4: 0000000000771ef0\n PKRU: 55555554\n Call Trace:\n \u0026lt;TASK\u0026gt;\n lookup_fast+0x9f/0x100\n walk_component+0x1f/0x150\n link_path_walk+0x20e/0x3d0\n path_lookupat+0x68/0x180\n filename_lookup+0xdc/0x1e0\n vfs_statx+0x6c/0x140\n vfs_fstatat+0x67/0xa0\n __do_sys_newfstatat+0x24/0x60\n do_syscall_64+0x6a/0x230\n entry_SYSCALL_64_after_hwframe+0x76/0x7e\n\nThis is reachable with reused cached negative dentries. A Ceph lookup\nor atomic_open can be handed a negative dentry that is already hashed,\nand fs/ceph/dir.c then hits one of two paths that incorrectly assume\n\u0026quot;negative\u0026quot; also means \u0026quot;unhashed\u0026quot;:\n\n - ceph_finish_lookup():\n MDS reply is -ENOENT with no trace\n -\u0026gt; d_add(dentry, NULL)\n\n - ceph_lookup():\n local ENOENT fast path for a complete directory with shared caps\n -\u0026gt; d_add(dentry, NULL)\n\nBoth paths can therefore re-add an already-hashed negative dentry.\n\nCeph already uses the correct pattern elsewhere: ceph_fill_trace() only\ncalls d_add(dn, NULL) for a negative null-dentry reply when d_unhashed(dn)\nis true.\n\nFix both fs/ceph/dir.c sites the same way: only call d_add() for a\nnegative dentry when it is actually unhashed. If the negative dentry\nis already hashed, leave it in place and reuse it as-is.\n\nThis preserves the existing behavior for unhashed dentries while\navoiding d_hash list corruption for reused hashed negatives.(CVE-2026-46052)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfbdev: defio: Disconnect deferred I/O from the lifetime of struct fb_info\n\nHold state of deferred I/O in struct fb_deferred_io_state. Allocate an\ninstance as part of initializing deferred I/O and remove it only after\nthe final mapping has been closed. If the fb_info and the contained\ndeferred I/O meanwhile goes away, clear struct fb_deferred_io_state.info\nto invalidate the mapping. Any access will then result in a SIGBUS\nsignal.\n\nFixes a long-standing problem, where a device hot-unplug happens while\nuser space still has an active mapping of the graphics memory. The hot-\nunplug frees the instance of struct fb_info. Accessing the memory will\noperate on undefined state.(CVE-2026-46065)\n\nIn the Linux kernel, the vlan_dev_set_egress_priority() function currently keeps cleared egress priority mappings in the hash as tombstones. Repeated set/clear cycles with distinct skb priorities accumulate mapping nodes until device teardown, causing memory leakage. This vulnerability is fixed by deleting mappings instead of keeping tombstones, using RCU protection for safe deallocation.(CVE-2026-46153)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\neventpoll: fix ep_remove struct eventpoll / struct file UAF\n\nep_remove() (via ep_remove_file()) cleared file-\u0026gt;f_ep under\nfile-\u0026gt;f_lock but then kept using @file inside the critical section\n(is_file_epoll(), hlist_del_rcu() through the head, spin_unlock).\nA concurrent __fput() taking the eventpoll_release() fastpath in\nthat window observed the transient NULL, skipped\neventpoll_release_file() and ran to f_op-\u0026gt;release / file_free().\n\nFor the epoll-watches-epoll case, f_op-\u0026gt;release is\nep_eventpoll_release() -\u0026gt; ep_clear_and_put() -\u0026gt; ep_free(), which\nkfree()s the watched struct eventpoll. Its embedded -\u0026gt;refs\nhlist_head is exactly where epi-\u0026gt;fllink.pprev points, so the\nsubsequent hlist_del_rcu()\u0026apos;s \u0026quot;*pprev = next\u0026quot; scribbles into freed\nkmalloc-192 memory.\n\nIn addition, struct file is SLAB_TYPESAFE_BY_RCU, so the slot\nbacking @file could be recycled by alloc_empty_file() --\nreinitializing f_lock and f_ep -- while ep_remove() is still\nnominally inside that lock. The upshot is an attacker-controllable\nkmem_cache_free() against the wrong slab cache.\n\nPin @file via epi_fget() at the top of ep_remove() and gate the\ncritical section on the pin succeeding. With the pin held @file\ncannot reach refcount zero, which holds __fput() off and\ntransitively keeps the watched struct eventpoll alive across the\nhlist_del_rcu() and the f_lock use, closing both UAFs.\n\nIf the pin fails @file has already reached refcount zero and its\n__fput() is in flight. Because we bailed before clearing f_ep,\nthat path takes the eventpoll_release() slow path into\neventpoll_release_file() and blocks on ep-\u0026gt;mtx until the waiter\nside\u0026apos;s ep_clear_and_put() drops it. The bailed epi\u0026apos;s share of\nep-\u0026gt;refcount stays intact, so the trailing ep_refcount_dec_and_test()\nin ep_clear_and_put() cannot free the eventpoll out from under\neventpoll_release_file(); the orphaned epi is then cleaned up\nthere.\n\nA successful pin also proves we are not racing\neventpoll_release_file() on this epi, so drop the now-redundant\nre-check of epi-\u0026gt;dying under f_lock. The cheap lockless\nREAD_ONCE(epi-\u0026gt;dying) fast-path bailout stays.(CVE-2026-46242)\n\nIn the Linux kernel, the following vulnerability has been resolved: drm/amd/display: Fix dc_link NULL handling in HPD init amdgpu_dm_hpd_init() may see connectors without a valid dc_link. The code already checks dc_link for the polling decision, but later unconditionally dereferences it when setting up HPD interrupts. Assign dc_link early and skip connectors where it is NULL. Fixes the below: drivers/gpu/drm/amd/amdgpu/../display/amdgpu_dm/amdgpu_dm_irq.c:940 amdgpu_dm_hpd_init() error: we previously assumed \u0026apos;dc_link\u0026apos; could be null (see line 931) drivers/gpu/drm/amd/amdgpu/../display/amdgpu_dm/amdgpu_dm_irq.c 923 /* 924 * Analog connectors may be hot-plugged unlike other connector 925 * types that don\u0026apos;t support HPD. Only poll analog connectors. 926 */ 927 use_polling |= 928 amdgpu_dm_connector-\u0026gt;dc_link \u0026amp;\u0026amp; ^^^^^^^^^^^^^^^^^^^^^^^^^^^^ The patch adds this NULL check but hopefully it can be removed 929 dc_connector_supports_analog(amdgpu_dm_connector-\u0026gt;dc_link-\u0026gt;link_id.id); 930 931 dc_link = amdgpu_dm_connector-\u0026gt;dc_link; dc_link assigned here. 932 933 /* 934 * Get a base driver irq reference for hpd ints for the lifetime 935 * of dm. Note that only hpd interrupt types are registered with 936 * base driver; hpd_rx types aren\u0026apos;t. IOW, amdgpu_irq_get/put on 937 * hpd_rx isn\u0026apos;t available. DM currently controls hpd_rx 938 * explicitly with dc_interrupt_set() 939 */ --\u0026gt; 940 if (dc_link-\u0026gt;irq_source_hpd != DC_IRQ_SOURCE_INVALID) { ^^^^^^^^^^^^^^^^^^^^^^^ If it\u0026apos;s NULL then we are trouble because we dereference it here. 941 irq_type = dc_link-\u0026gt;irq_source_hpd - DC_IRQ_SOURCE_HPD1; 942 /* 943 * TODO: There\u0026apos;s a mismatch between mode_info.num_hpd 944 * and what bios reports as the # of connectors with hpd The Linux kernel CVE team has assigned CVE-2026-46245 to this issue.(CVE-2026-46245)",
"id": "OESA-2026-2676",
"modified": "2026-08-06T11:11:36Z",
"published": "2026-06-12T11:11:36Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-2676"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39781"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-71109"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-23213"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-23214"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31527"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31607"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31662"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31709"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31759"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43024"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43038"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43059"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43083"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43088"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43089"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43101"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43107"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43180"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43194"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43198"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43216"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43248"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43303"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43334"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43465"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43466"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45850"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45893"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45894"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45895"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45915"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45920"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45944"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45949"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45968"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45973"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45984"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46006"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46021"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46032"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46033"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46052"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46065"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46153"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46242"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46245"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2025-39781",
"CVE-2025-71109",
"CVE-2026-23213",
"CVE-2026-23214",
"CVE-2026-31527",
"CVE-2026-31607",
"CVE-2026-31662",
"CVE-2026-31709",
"CVE-2026-31759",
"CVE-2026-43024",
"CVE-2026-43038",
"CVE-2026-43059",
"CVE-2026-43083",
"CVE-2026-43088",
"CVE-2026-43089",
"CVE-2026-43101",
"CVE-2026-43107",
"CVE-2026-43180",
"CVE-2026-43194",
"CVE-2026-43198",
"CVE-2026-43216",
"CVE-2026-43248",
"CVE-2026-43303",
"CVE-2026-43334",
"CVE-2026-43465",
"CVE-2026-43466",
"CVE-2026-45850",
"CVE-2026-45893",
"CVE-2026-45894",
"CVE-2026-45895",
"CVE-2026-45915",
"CVE-2026-45920",
"CVE-2026-45944",
"CVE-2026-45949",
"CVE-2026-45968",
"CVE-2026-45973",
"CVE-2026-45984",
"CVE-2026-46006",
"CVE-2026-46021",
"CVE-2026-46032",
"CVE-2026-46033",
"CVE-2026-46052",
"CVE-2026-46065",
"CVE-2026-46153",
"CVE-2026-46242",
"CVE-2026-46245"
]
}
OESA-2026-3453 (CVE-2026-23336)
Vulnerability from osv_openeuler – Published: 2026-08-20 09:59 – Updated: 2026-08-20 09:59 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
wifi: cfg80211: cancel rfkill_block work in wiphy_unregister()
There is a use-after-free error in cfg80211_shutdown_all_interfaces found by syzkaller:
BUG: KASAN: use-after-free in cfg80211_shutdown_all_interfaces+0x213/0x220 Read of size 8 at addr ffff888112a78d98 by task kworker/0:5/5326 CPU: 0 UID: 0 PID: 5326 Comm: kworker/0:5 Not tainted 6.19.0-rc2 #2 PREEMPT(voluntary) Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014 Workqueue: events cfg80211_rfkill_block_work Call Trace: <TASK> dump_stack_lvl+0x116/0x1f0 print_report+0xcd/0x630 kasan_report+0xe0/0x110 cfg80211_shutdown_all_interfaces+0x213/0x220 cfg80211_rfkill_block_work+0x1e/0x30 process_one_work+0x9cf/0x1b70 worker_thread+0x6c8/0xf10 kthread+0x3c5/0x780 ret_from_fork+0x56d/0x700 ret_from_fork_asm+0x1a/0x30 </TASK>
The problem arises due to the rfkill_block work is not cancelled when wiphy is being unregistered. In order to fix the issue cancel the corresponding work in wiphy_unregister().
Found by Linux Verification Center (linuxtesting.org) with Syzkaller.(CVE-2026-23336)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: L2CAP: Fix type confusion in l2cap_ecred_reconf_rsp()
l2cap_ecred_reconf_rsp() casts the incoming data to struct l2cap_ecred_conn_rsp (the ECRED connection response, 8 bytes with result at offset 6) instead of struct l2cap_ecred_reconf_rsp (2 bytes with result at offset 0).
This causes two problems:
-
The sizeof(*rsp) length check requires 8 bytes instead of the correct 2, so valid L2CAP_ECRED_RECONF_RSP packets are rejected with -EPROTO.
-
rsp->result reads from offset 6 instead of offset 0, returning wrong data when the packet is large enough to pass the check.
Fix by using the correct type. Also pass the already byte-swapped result variable to BT_DBG instead of the raw __le16 field.(CVE-2026-43062)
In the Linux kernel, the following vulnerability has been resolved:
apparmor: Fix & Optimize table creation from possibly unaligned memory
Source blob may come from userspace and might be unaligned. Try to optize the copying process by avoiding unaligned memory accesses.
- Added Fixes tag
- Added "Fix &" to description as this doesn't just optimize but fixes a potential unaligned memory access jj: remove duplicate word "convert" in comment trigger checkpatch warning
In the Linux kernel, the following vulnerability has been resolved:
md/raid5: validate payload size before accessing journal metadata
r5c_recovery_analyze_meta_block() and r5l_recovery_verify_data_checksum_for_mb() iterate over payloads in a journal metadata block using on-disk payload size fields without validating them against the remaining space in the metadata block.
A corrupted journal contains payload sizes extending beyond the PAGE_SIZE boundary can cause out-of-bounds reads when accessing payload fields or computing offsets.
Add bounds validation for each payload type to ensure the full payload fits within meta_size before processing.(CVE-2026-46070)
In the Linux kernel, the following vulnerability has been resolved:
KVM: x86: Fix shadow paging use-after-free due to unexpected GFN
The shadow MMU computes GFNs for direct shadow pages using sp->gfn plus the SPTE index. This assumption breaks for shadow paging if the guest page tables are modified between VM entries (similar to commit aad885e77496, "KVM: x86/mmu: Drop/zap existing present SPTE even when creating an MMIO SPTE", 2026-03-27). The flow is as follows:
-
a PDE is installed for a 2MB mapping, and a page in that area is accessed. KVM creates a kvm_mmu_page consisting of 512 4KB pages; the kvm_mmu_page is marked by FNAME(fetch) as direct-mapped because the guest's mapping is a huge page (and thus contiguous).
-
the PDE mapping is changed from outside the guest.
-
the guest accesses another page in the same 2MB area. KVM installs a new leaf SPTE and rmap entry; the SPTE uses the "correct" GFN (i.e. based on the new mapping, as changed in the previous step) but that GFN is outside of the [sp->gfn, sp->gfn + 511] range; therefore the rmap entry cannot be found and removed when the kvm_mmu_page is zapped.
-
the memslot that covers the first 2MB mapping is deleted, and the kvm_mmu_page for the now-invalid GPA is zapped. However, rmap_remove() only looks at the [sp->gfn, sp->gfn + 511] range established in step 1, and fails to find the rmap entry that was recorded by step 3.
-
any operation that causes an rmap walk for the same page accessed by step 3 then walks a stale rmap and dereferences a freed kvm_mmu_page. This includes dirty logging or MMU notifier invalidations (e.g., from MADV_DONTNEED).
The underlying issue is that KVM's walking of shadow PTEs assumes that if a SPTE is present when KVM wants to install a non-leaf SPTE, then the existing kvm_mmu_page must be for the correct gfn. Because the only way for the gfn to be wrong is if KVM messed up and failed to zap a SPTE... which shouldn't happen, but actually only happens in response to a guest write.
That bug dates back literally forever, as even the first version of KVM assumes that the GFN matches and walks into the "wrong" shadow page. However, that was only an imprecision until 2032a93d66fa ("KVM: MMU: Don't allocate gfns page for direct mmu pages") came along.
Fix it by checking for a target gfn mismatch and zapping the existing SPTE. That way the old SP and rmap entries are gone, KVM installs the rmap in the right location, and everyone is happy.(CVE-2026-46113)
In the Linux kernel, the following vulnerability has been resolved:
NFSv4/flexfiles: reject zero filehandle version count
ff_layout_alloc_lseg() decodes the filehandle-version array count from the flexfiles layout body. The value is used as the count for kzalloc_objs(), and the current code only rejects NULL.
A zero count yields ZERO_SIZE_PTR, which can be stored in dss_info->fh_versions even though later flexfiles paths assume that at least one filehandle version exists.
Reject fh_count == 0 before the allocation, matching the existing zero version_count validation in the flexfiles GETDEVICEINFO parser.
A QEMU/KASAN run with a malformed flexfiles layout hit:
KASAN: null-ptr-deref in range [0x0000000000000010-0x0000000000000017] RIP: 0010:ff_layout_encode_ff_layoutupdate.isra.0+0x15f/0x750 ff_layout_encode_layoutreturn+0x683/0x970 nfs4_xdr_enc_layoutreturn+0x278/0x3a0 Kernel panic - not syncing: Fatal exception
The patched kernel rejects the malformed layout without KASAN/oops/panic, and a valid fh_count=1 regression still opens, reads, and unmounts cleanly.(CVE-2026-53392)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: fbcon: fix out-of-bounds read in err_out of fbcon_do_set_font()
When fbcon_do_set_font() fails (e.g., due to a memory allocation failure
inside vc_resize() under heavy memory pressure), it jumps to the err_out
label to roll back the console state. However, the current rollback logic
forgets to restore the hi_font state, leading to a severe state machine
corruption.
Earlier in the function, set_vc_hi_font() might be called to change
vc->vc_hi_font_mask and mutate the screen buffer. If vc_resize()
subsequently fails, the err_out path restores vc_font.charcount
but entirely skips rolling back the vc_hi_font_mask and the screen
buffer.
This mismatch leaves the terminal in a desynchronized state. Because
vc_hi_font_mask remains set, the VT subsystem will still accept
character indices greater than 255 from userspace and write them to the
screen buffer. Subsequent rendering calls (e.g., fbcon_putcs()) will
then use these inflated indices to access the reverted, 256-character
font array, leading to a deterministic out-of-bounds read and potential
kernel memory disclosure.
Fix this by adding the missing rollback logic for the hi_font mask
and screen buffer in the error path.(CVE-2026-53402)
In the Linux kernel, the following vulnerability has been resolved:
pNFS: Fix use-after-free in pnfs_update_layout()
When hitting the NFS_LAYOUT_RETURN branch in pnfs_update_layout(), the code calls pnfs_prepare_to_retry_layoutget(lo). If it succeeds, pnfs_put_layout_hdr(lo) is called before trace_pnfs_update_layout(), which still references 'lo'. This results in a use-after-free when the tracepoint accesses lo's fields.
Fix this by moving the tracepoint call before pnfs_put_layout_hdr(lo).(CVE-2026-63800)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/core: Prefer NLA_NUL_STRING
These attributes are evaluated as c-string (passed to strcmp), but NLA_STRING doesn't check for the presence of a \0 terminator.
Either this needs to switch to nla_strcmp() and needs to adjust printf fmt specifier to not use plain %s, or this needs to use NLA_NUL_STRING.
As the code has been this way for long time, it seems to me that userspace does include the terminating nul, even tough its not enforced so far, and thus NLA_NUL_STRING use is the simpler solution.(CVE-2026-63860)
In the Linux kernel, the following vulnerability has been resolved:
USB: serial: mxuport: fix memory corruption with small endpoint
Make sure that the bulk-out endpoint max packet size is at least eight bytes to avoid user-controlled slab corruption should a malicious device report a smaller size.(CVE-2026-63899)
In the Linux kernel, the following vulnerability has been resolved:
USB: serial: digi_acceleport: fix memory corruption with small endpoints
Add the missing bulk-out buffer size sanity checks to avoid out-of-bounds memory accesses or slab corruption should a malicious device report smaller buffers than expected.(CVE-2026-63901)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: exthdrs: refresh nh pointer after ipv6_hop_jumbo()
ipv6_hop_jumbo() calls pskb_trim_rcsum(), which can change skb pointers. Let's recompute nh pointer to make sure any change won't mess things up.(CVE-2026-63924)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: HIDP: fix missing length checks in hidp_input_report()
hidp_input_report() reads keyboard and mouse payload data from an skb without first verifying that skb->len contains enough data.
hidp_recv_intr_frame() pulls the 1-byte HIDP header before dispatching to hidp_input_report(). If a paired device sends a truncated packet, the handler reads beyond the valid skb data, resulting in an out-of-bounds read of skb data. The OOB bytes may be interpreted as phantom key presses or spurious mouse movement.
Replace the open-coded length tracking and pointer arithmetic with skb_pull_data() calls. skb_pull_data() returns NULL if the requested bytes are not present, eliminating the need for a manual size variable and the separate skb->len guard.(CVE-2026-63947)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: rpl: fix hdrlen overflow in ipv6_rpl_srh_decompress()
ipv6_rpl_srh_decompress() computes:
outhdr->hdrlen = (((n + 1) * sizeof(struct in6_addr)) >> 3);
hdrlen is __u8. For n >= 127 the result exceeds 255 and silently truncates. With n=127 (cmpri=15, cmpre=15, pad=0, hdrlen=16):
(128 * 16) >> 3 = 256, truncated to 0 as __u8
The caller in ipv6_rpl_srh_rcv() then places the compressed header at buf + ((ohdr->hdrlen + 1) << 3). With hdrlen=0 this is buf + 8, but the decompressed region occupies buf[0..2055] (8-byte header plus 128 full addresses). The compressed header overlaps the decompressed data, and ipv6_rpl_srh_compress() writes into this overlap, corrupting the routing header of the forwarded packet.
The existing guard at exthdrs.c:546 checks (n + 1) > 255, which prevents n+1 from overflowing unsigned char (the segments_left field), but does not prevent the computed hdrlen from overflowing __u8. n=127 passes because 128 <= 255, yet hdrlen=256 does not fit.
Tighten the bound to (n + 1) > 127. This caps n at 126, giving hdrlen = (127 * 16) >> 3 = 254, which fits in __u8. The compressed header then lands at buf + ((254 + 1) << 3) = buf + 2040, exactly past the decompressed region (buf[0..2039]). No overlap. 127 segments is well beyond any realistic RPL deployment.(CVE-2026-63984)
In the Linux kernel, the following vulnerability has been resolved:
tunnels: do not assume transport header in iptunnel_pmtud_check_icmp()
In some cases, iptunnel_pmtud_check_icmp() can be called while skb transport header is not set.
This triggers an out-of-bound access, because (typeof(skb->transport_header))~0U is 65535.
Access the icmp header based on IPv4 network header, after making sure icmp->type is present in skb linear part.
Note that iptunnel_pmtud_check_icmpv6()) is fine.(CVE-2026-63992)
In the Linux kernel, the following vulnerability has been resolved:
tunnels: load network headers after skb_cow() in iptunnel_pmtud_build_icmpv6
Sashiko found that iptunnel_pmtud_build_icmp() and iptunnel_pmtud_build_icmpv6() were caching ip_hdr() and ipv6_hdr() before an skb_cow() call which can reallocate skb->head.
Fix this possible UAF by initializing the local variables after the skb_cow() call.
Remove skb_reset_network_header() calls which were not needed.(CVE-2026-63994)
In the Linux kernel, the following vulnerability has been resolved:
ipv4: free net->ipv4.sysctl_local_reserved_ports after unregister_net_sysctl_table()
ipv4_sysctl_exit_net() is currently freeing net->ipv4.sysctl_local_reserved_ports too soon.
Only after unregister_net_sysctl_table() we can be sure no threads can possibly use the sysctls, including /proc/sys/net/ipv4/ip_local_reserved_ports.(CVE-2026-64002)
In the Linux kernel, the following vulnerability has been resolved:
Input: synaptics-rmi4 - bound the F30 keymap to the GPIO/LED count
rmi_f30_map_gpios() allocates gpioled_key_map with min(gpioled_count, TRACKSTICK_RANGE_END) == at most 6 entries, but rmi_f30_attention() iterates the full f30->gpioled_count (device query register, range 0..31) and dereferences gpioled_key_map[i], and input->keycodemax is set to the full gpioled_count while input->keycode points at the 6-entry allocation.
A device that reports gpioled_count > 6 with GPIO support enabled therefore causes an out-of-bounds read on the attention interrupt and out-of-bounds read/write through the EVIOCGKEYCODE/EVIOCSKEYCODE ioctls, which bound the index only against keycodemax. This is the same defect as the F3A handler, which was copied from F30.
Size the keymap for the full gpioled_count; the mapping loop still assigns only the first min(gpioled_count, TRACKSTICK_RANGE_END) entries.(CVE-2026-64276)
In the Linux kernel, the following vulnerability has been resolved:
i2c: core: fix adapter deregistration race
Adapters can be looked up by their id using i2c_get_adapter() which takes a reference to the embedded struct device.
Remove the adapter from the IDR before tearing it down during deregistration (and on registration failure) to make sure its resources are not accessed after having been freed (e.g. the device name).(CVE-2026-64279)
In the Linux kernel, the following vulnerability has been resolved:
exfat: bound uniname advance in exfat_find_dir_entry()
In exfat_find_dir_entry(), each TYPE_EXTEND (file name) entry advances the output pointer by a fixed amount while the loop guard only tracks the accumulated name length:
if (++order == 2)
uniname = p_uniname->name;
else
uniname += EXFAT_FILE_NAME_LEN;
len = exfat_extract_uni_name(ep, entry_uniname);
name_len += len;
unichar = *(uniname+len);
*(uniname+len) = 0x0;
uniname grows by EXFAT_FILE_NAME_LEN (15) per name entry, but name_len
grows only by the actual extracted length, which is shorter when a name
fragment contains an early NUL. The only guard is
name_len >= MAX_NAME_LENGTH, so a crafted directory with many short
name fragments lets uniname run far past the
p_uniname->name[MAX_NAME_LENGTH + 3] buffer while name_len stays small,
causing an out-of-bounds read and write at *(uniname+len).
The sibling extractor exfat_get_uniname_from_ext_entry() already stops
on a short fragment (the lockstep len != EXFAT_FILE_NAME_LEN guard
added in commit d42334578eba ("exfat: check if filename entries exceeds
max filename length")); exfat_find_dir_entry() never got the
equivalent. Track the per-entry write offset as a count and reject a
fragment once the offset, or the offset plus the extracted length, would
exceed MAX_NAME_LENGTH, before forming the output pointer.(CVE-2026-64296)
In the Linux kernel, the following vulnerability has been resolved:
crypto: qat - validate RSA CRT component lengths
The generic RSA key parser (rsa_helper.c) bounds each CRT component (p, q, dp, dq, qinv) by the modulus size n_sz, but qat_rsa_setkey_crt() allocates half-size DMA buffers (key_sz / 2) and right-aligns each component with:
memcpy(dst + half_key_sz - len, src, len)
When a CRT component is larger than half_key_sz the subtraction underflows and memcpy writes past the DMA buffer, causing memory corruption.
Add a len > half_key_sz check next to the existing !len check for each of the five CRT components so the driver falls back to the non-CRT path instead of writing out of bounds.(CVE-2026-64304)
In the Linux kernel, the following vulnerability has been resolved:
USB: serial: digi_acceleport: fix write buffer corruption
The digi_write_inb_command() is supposed to wait for the write urb to become available or return an error, but instead it updates the transfer buffer and tries to resubmit the urb on timeout.
To make things worse, for commands like break control where no timeout is used, the driver would corrupt the urb immediately due to a broken jiffies comparison (on 32-bit machines this takes five minutes of uptime to trigger due to INITIAL_JIFFIES).
Fix this by adding the missing return on timeout and waiting indefinitely when no timeout has been specified as intended.
This issue was (sort of) flagged by Sashiko when reviewing an unrelated change to the driver.(CVE-2026-64333)
In the Linux kernel, the following vulnerability has been resolved:
USB: legousbtower: fix use-after-free on disconnect race
mutex_unlock() may access the mutex structure after releasing the lock and therefore cannot be used to manage lifetime of objects directly (unlike spinlocks and refcounts). [1][2]
Use a kref to release the driver data to avoid use-after-free in mutex_unlock() when release() races with disconnect().
[1] a51749ab34d9 ("locking/mutex: Document that mutex_unlock() is non-atomic") [2] 2b9d9e0a9ba0 ("locking/mutex: Clarify that mutex_unlock(), and most other sleeping locks, can still use the lock object after it's unlocked")(CVE-2026-64340)
In the Linux kernel, the following vulnerability has been resolved:
proc: protect ptrace_may_access() with exec_update_lock (part 1)
Fix the easy cases where procfs currently calls ptrace_may_access() without exec_update_lock protection, where the fix is to simply add the extra lock or use mm_access():
- do_task_stat(): grab exec_update_lock
- proc_pid_wchan(): grab exec_update_lock
- proc_map_files_lookup(): use mm_access() instead of get_task_mm()
- proc_map_files_readdir(): use mm_access() instead of get_task_mm()
- proc_ns_get_link(): grab exec_update_lock
- proc_ns_readlink(): grab exec_update_lock(CVE-2026-64371)
In the Linux kernel, the following vulnerability has been resolved:
smb/client: fix chown/chgrp with SMB3 POSIX Extensions
Ownership (chown) and group (chgrp) modifications were being ignored when mounting with SMB3 POSIX Extensions unless CIFS_MOUNT_CIFS_ACL or CIFS_MOUNT_MODE_FROM_SID were also explicitly set.
Fix this by checking for posix_extensions in cifs_setattr_nounix() when updating UID and GID, ensuring that id_mode_to_cifs_acl() is called to map and set the ownership/group information on the server.(CVE-2026-64388)
In the Linux kernel, the following vulnerability has been resolved: Bluetooth: fix UAF in bt_accept_dequeue(). bt_accept_get() takes a temporary reference before dropping the accept queue lock. bt_accept_dequeue() currently drops that reference before bt_accept_unlink(), leaving only the queue reference. bt_accept_unlink() drops the queue reference. The subsequent sock_hold() therefore accesses freed memory if it was the final reference, as observed by KASAN during listening L2CAP socket cleanup. Retain the temporary queue-walk reference through unlink and hand it to the caller on success. Drop it explicitly on the closed and not-yet-connected paths.(CVE-2026-64406)
In the Linux kernel, the following vulnerability has been resolved:
net: qualcomm: rmnet: validate MAP frame length before ingress parsing
When ingress deaggregation is disabled, rmnet_map_ingress_handler() passes the skb straight to __rmnet_map_ingress_handler(), skipping the length validation that rmnet_map_deaggregate() performs on the aggregated path. The parser then dereferences the MAP header and csum header/trailer based on the on-wire pkt_len without checking skb->len, so a short frame is read out of bounds:
BUG: KASAN: slab-out-of-bounds in rmnet_map_checksum_downlink_packet Read of size 1 at addr ffff88801118ed00 by task exploit/147 Call Trace: ... rmnet_map_checksum_downlink_packet (drivers/net/ethernet/qualcomm/rmnet/rmnet_map_data.c:413) __rmnet_map_ingress_handler (drivers/net/ethernet/qualcomm/rmnet/rmnet_handlers.c:96) rmnet_rx_handler (drivers/net/ethernet/qualcomm/rmnet/rmnet_handlers.c:129) __netif_receive_skb_core.constprop.0 (net/core/dev.c:6089) netif_receive_skb (net/core/dev.c:6460) tun_get_user (drivers/net/tun.c:1955) tun_chr_write_iter (drivers/net/tun.c:2001) vfs_write (fs/read_write.c:688) ksys_write (fs/read_write.c:740) do_syscall_64 (arch/x86/entry/syscall_64.c:94) ...
Factor that validation out of rmnet_map_deaggregate() into rmnet_map_validate_packet_len() and run it on the no-aggregation path too. The MAP header is bounds-checked first, since this path can receive a frame shorter than the header.(CVE-2026-64550)
In the Linux kernel, a use-after-free vulnerability exists in the SCTP ASCONF processing. sctp_process_asconf() caches the transport the ASCONF chunk is processed against in asconf->transport. For an ASCONF located through its Address Parameter by __sctp_rcv_asconf_lookup(), that cached transport corresponds to the Address Parameter, which need not be the packet's source address. sctp_process_asconf_param() rejects a DEL-IP for the packet source address, but nothing protects asconf->transport. A single ASCONF can carry [Address Parameter L] [DEL-IP L] [DEL-IP 0.0.0.0] where L differs from the source, causing the freed transport to be dereferenced, potentially leading to system crash or code execution.(CVE-2026-64564)
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: defer destroy_previous_session() until after NTLM authentication
In ntlm_authenticate(), destroy_previous_session() is called using a user pointer resolved from the client-supplied NTLM blob username field before the NTLMv2 response is validated. An authenticated attacker can set the NTLM blob username to match a victim account and set PreviousSessionId to the victim's session ID; destroy_previous_session() destroys the victim's session while ksmbd_decode_ntlmssp_auth_blob() subsequently rejects the request with -EPERM.
Move destroy_previous_session() and the prev_id assignment to after ksmbd_decode_ntlmssp_auth_blob() returns success and use sess->user rather than the pre-authentication lookup result. This matches the ordering already used by krb5_authenticate(), where destroy_previous_session() is called only after ksmbd_krb5_authenticate() returns success.(CVE-2026-68130)
In the Linux kernel, the following vulnerability has been resolved:
libceph: bound pg_{temp,upmap,upmap_items} length to CEPH_PG_MAX_SIZE
__decode_pg_temp() decodes an user-controlled length but only rejects values large enough to overflow the allocation; it does not bound it to CEPH_PG_MAX_SIZE. The helper backs both pg_temp and pg_upmap decoding, and apply_upmap()/get_temp_osds() later copy the decoded list into the fixed-size on-stack array struct ceph_osds.osds[CEPH_PG_MAX_SIZE]. A monitor that sends an OSDMap with a pg_temp/pg_upmap entry longer than 32 thus causes a stack out-of-bounds write.
An OSD set for a single PG can never exceed CEPH_PG_MAX_SIZE, so reject longer entries at decode time. The bound is well below the old overflow threshold, so it also covers the allocation-size overflow the previous check guarded against.
BUG: KASAN: stack-out-of-bounds in ceph_pg_to_up_acting_osds Write of size 4 ... by task exploit kasan_report (mm/kasan/report.c:595) ceph_pg_to_up_acting_osds (net/ceph/osdmap.c:2617 net/ceph/osdmap.c:2833) calc_target (net/ceph/osd_client.c:1638) __submit_request (net/ceph/osd_client.c:2394) ceph_osdc_start_request (net/ceph/osd_client.c:2490) ceph_osdc_call (net/ceph/osd_client.c:5164) rbd_dev_image_probe (drivers/block/rbd.c:6899) do_rbd_add (drivers/block/rbd.c:7138) ... kernel BUG at net/ceph/osdmap.c:2670!
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"bpftool-debuginfo-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"kernel-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"kernel-debuginfo-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"kernel-debugsource-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"kernel-devel-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"kernel-headers-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"kernel-source-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"kernel-tools-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"kernel-tools-devel-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"perf-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"perf-debuginfo-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"python3-perf-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-329.0.0.230.oe2203sp4.aarch64.rpm"
],
"src": [
"kernel-5.10.0-329.0.0.230.oe2203sp4.src.rpm"
],
"x86_64": [
"bpftool-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"bpftool-debuginfo-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"kernel-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"kernel-debuginfo-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"kernel-debugsource-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"kernel-devel-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"kernel-headers-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"kernel-source-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"kernel-tools-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"kernel-tools-devel-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"perf-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"perf-debuginfo-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"python3-perf-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-329.0.0.230.oe2203sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-329.0.0.230.oe2203sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: cfg80211: cancel rfkill_block work in wiphy_unregister()\n\nThere is a use-after-free error in cfg80211_shutdown_all_interfaces found\nby syzkaller:\n\nBUG: KASAN: use-after-free in cfg80211_shutdown_all_interfaces+0x213/0x220\nRead of size 8 at addr ffff888112a78d98 by task kworker/0:5/5326\nCPU: 0 UID: 0 PID: 5326 Comm: kworker/0:5 Not tainted 6.19.0-rc2 #2 PREEMPT(voluntary)\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014\nWorkqueue: events cfg80211_rfkill_block_work\nCall Trace:\n \u0026lt;TASK\u0026gt;\n dump_stack_lvl+0x116/0x1f0\n print_report+0xcd/0x630\n kasan_report+0xe0/0x110\n cfg80211_shutdown_all_interfaces+0x213/0x220\n cfg80211_rfkill_block_work+0x1e/0x30\n process_one_work+0x9cf/0x1b70\n worker_thread+0x6c8/0xf10\n kthread+0x3c5/0x780\n ret_from_fork+0x56d/0x700\n ret_from_fork_asm+0x1a/0x30\n \u0026lt;/TASK\u0026gt;\n\nThe problem arises due to the rfkill_block work is not cancelled when wiphy\nis being unregistered. In order to fix the issue cancel the corresponding\nwork in wiphy_unregister().\n\nFound by Linux Verification Center (linuxtesting.org) with Syzkaller.(CVE-2026-23336)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBluetooth: L2CAP: Fix type confusion in l2cap_ecred_reconf_rsp()\n\nl2cap_ecred_reconf_rsp() casts the incoming data to struct\nl2cap_ecred_conn_rsp (the ECRED *connection* response, 8 bytes with\nresult at offset 6) instead of struct l2cap_ecred_reconf_rsp (2 bytes\nwith result at offset 0).\n\nThis causes two problems:\n\n - The sizeof(*rsp) length check requires 8 bytes instead of the\n correct 2, so valid L2CAP_ECRED_RECONF_RSP packets are rejected\n with -EPROTO.\n\n - rsp-\u0026gt;result reads from offset 6 instead of offset 0, returning\n wrong data when the packet is large enough to pass the check.\n\nFix by using the correct type. Also pass the already byte-swapped\nresult variable to BT_DBG instead of the raw __le16 field.(CVE-2026-43062)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\napparmor: Fix \u0026amp; Optimize table creation from possibly unaligned memory\n\nSource blob may come from userspace and might be unaligned.\nTry to optize the copying process by avoiding unaligned memory accesses.\n\n- Added Fixes tag\n- Added \u0026quot;Fix \u0026amp;\u0026quot; to description as this doesn\u0026apos;t just optimize but fixes\n a potential unaligned memory access\n[jj: remove duplicate word \u0026quot;convert\u0026quot; in comment trigger checkpatch warning](CVE-2026-45893)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmd/raid5: validate payload size before accessing journal metadata\n\nr5c_recovery_analyze_meta_block() and\nr5l_recovery_verify_data_checksum_for_mb() iterate over payloads in a\njournal metadata block using on-disk payload size fields without\nvalidating them against the remaining space in the metadata block.\n\nA corrupted journal contains payload sizes extending beyond the PAGE_SIZE\nboundary can cause out-of-bounds reads when accessing payload fields or\ncomputing offsets.\n\nAdd bounds validation for each payload type to ensure the full payload\nfits within meta_size before processing.(CVE-2026-46070)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nKVM: x86: Fix shadow paging use-after-free due to unexpected GFN\n\nThe shadow MMU computes GFNs for direct shadow pages using sp-\u0026gt;gfn plus\nthe SPTE index. This assumption breaks for shadow paging if the guest\npage tables are modified between VM entries (similar to commit\naad885e77496, \u0026quot;KVM: x86/mmu: Drop/zap existing present SPTE even\nwhen creating an MMIO SPTE\u0026quot;, 2026-03-27). The flow is as follows:\n\n- a PDE is installed for a 2MB mapping, and a page in that area is\n accessed. KVM creates a kvm_mmu_page consisting of 512 4KB pages;\n the kvm_mmu_page is marked by FNAME(fetch) as direct-mapped because\n the guest\u0026apos;s mapping is a huge page (and thus contiguous).\n\n- the PDE mapping is changed from outside the guest.\n\n- the guest accesses another page in the same 2MB area. KVM installs\n a new leaf SPTE and rmap entry; the SPTE uses the \u0026quot;correct\u0026quot; GFN\n (i.e. based on the new mapping, as changed in the previous step) but\n that GFN is outside of the [sp-\u0026gt;gfn, sp-\u0026gt;gfn + 511] range; therefore\n the rmap entry cannot be found and removed when the kvm_mmu_page\n is zapped.\n\n- the memslot that covers the first 2MB mapping is deleted, and the\n kvm_mmu_page for the now-invalid GPA is zapped. However, rmap_remove()\n only looks at the [sp-\u0026gt;gfn, sp-\u0026gt;gfn + 511] range established in step 1,\n and fails to find the rmap entry that was recorded by step 3.\n\n- any operation that causes an rmap walk for the same page accessed\n by step 3 then walks a stale rmap and dereferences a freed kvm_mmu_page.\n This includes dirty logging or MMU notifier invalidations (e.g., from\n MADV_DONTNEED).\n\nThe underlying issue is that KVM\u0026apos;s walking of shadow PTEs assumes that\nif a SPTE is present when KVM wants to install a non-leaf SPTE, then the\nexisting kvm_mmu_page must be for the correct gfn. Because the only way\nfor the gfn to be wrong is if KVM messed up and failed to zap a SPTE...\nwhich shouldn\u0026apos;t happen, but *actually* only happens in response to a\nguest write.\n\nThat bug dates back literally forever, as even the first version of KVM\nassumes that the GFN matches and walks into the \u0026quot;wrong\u0026quot; shadow page.\nHowever, that was only an imprecision until 2032a93d66fa (\u0026quot;KVM: MMU:\nDon\u0026apos;t allocate gfns page for direct mmu pages\u0026quot;) came along.\n\nFix it by checking for a target gfn mismatch and zapping the existing\nSPTE. That way the old SP and rmap entries are gone, KVM installs\nthe rmap in the right location, and everyone is happy.(CVE-2026-46113)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nNFSv4/flexfiles: reject zero filehandle version count\n\nff_layout_alloc_lseg() decodes the filehandle-version array count\nfrom the flexfiles layout body. The value is used as the count for\nkzalloc_objs(), and the current code only rejects NULL.\n\nA zero count yields ZERO_SIZE_PTR, which can be stored in\ndss_info-\u0026gt;fh_versions even though later flexfiles paths assume that at\nleast one filehandle version exists.\n\nReject fh_count == 0 before the allocation, matching the existing zero\nversion_count validation in the flexfiles GETDEVICEINFO parser.\n\nA QEMU/KASAN run with a malformed flexfiles layout hit:\n\n KASAN: null-ptr-deref in range [0x0000000000000010-0x0000000000000017]\n RIP: 0010:ff_layout_encode_ff_layoutupdate.isra.0+0x15f/0x750\n ff_layout_encode_layoutreturn+0x683/0x970\n nfs4_xdr_enc_layoutreturn+0x278/0x3a0\n Kernel panic - not syncing: Fatal exception\n\nThe patched kernel rejects the malformed layout without KASAN/oops/panic,\nand a valid fh_count=1 regression still opens, reads, and unmounts cleanly.(CVE-2026-53392)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfbdev: fbcon: fix out-of-bounds read in err_out of fbcon_do_set_font()\n\nWhen fbcon_do_set_font() fails (e.g., due to a memory allocation failure\ninside vc_resize() under heavy memory pressure), it jumps to the `err_out`\nlabel to roll back the console state. However, the current rollback logic\nforgets to restore the `hi_font` state, leading to a severe state machine\ncorruption.\n\nEarlier in the function, `set_vc_hi_font()` might be called to change\n`vc-\u0026gt;vc_hi_font_mask` and mutate the screen buffer. If `vc_resize()`\nsubsequently fails, the `err_out` path restores `vc_font.charcount`\nbut entirely skips rolling back the `vc_hi_font_mask` and the screen\nbuffer.\n\nThis mismatch leaves the terminal in a desynchronized state. Because\n`vc_hi_font_mask` remains set, the VT subsystem will still accept\ncharacter indices greater than 255 from userspace and write them to the\nscreen buffer. Subsequent rendering calls (e.g., `fbcon_putcs()`) will\nthen use these inflated indices to access the reverted, 256-character\nfont array, leading to a deterministic out-of-bounds read and potential\nkernel memory disclosure.\n\nFix this by adding the missing rollback logic for the `hi_font` mask\nand screen buffer in the error path.(CVE-2026-53402)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\npNFS: Fix use-after-free in pnfs_update_layout()\n\nWhen hitting the NFS_LAYOUT_RETURN branch in pnfs_update_layout(),\nthe code calls pnfs_prepare_to_retry_layoutget(lo). If it succeeds,\npnfs_put_layout_hdr(lo) is called before trace_pnfs_update_layout(),\nwhich still references \u0026apos;lo\u0026apos;. This results in a use-after-free when the\ntracepoint accesses lo\u0026apos;s fields.\n\nFix this by moving the tracepoint call before pnfs_put_layout_hdr(lo).(CVE-2026-63800)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/core: Prefer NLA_NUL_STRING\n\nThese attributes are evaluated as c-string (passed to strcmp), but\nNLA_STRING doesn\u0026apos;t check for the presence of a \\0 terminator.\n\nEither this needs to switch to nla_strcmp() and needs to adjust printf fmt\nspecifier to not use plain %s, or this needs to use NLA_NUL_STRING.\n\nAs the code has been this way for long time, it seems to me that userspace\ndoes include the terminating nul, even tough its not enforced so far, and\nthus NLA_NUL_STRING use is the simpler solution.(CVE-2026-63860)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nUSB: serial: mxuport: fix memory corruption with small endpoint\n\nMake sure that the bulk-out endpoint max packet size is at least eight\nbytes to avoid user-controlled slab corruption should a malicious device\nreport a smaller size.(CVE-2026-63899)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nUSB: serial: digi_acceleport: fix memory corruption with small endpoints\n\nAdd the missing bulk-out buffer size sanity checks to avoid\nout-of-bounds memory accesses or slab corruption should a malicious\ndevice report smaller buffers than expected.(CVE-2026-63901)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipv6: exthdrs: refresh nh pointer after ipv6_hop_jumbo()\n\nipv6_hop_jumbo() calls pskb_trim_rcsum(), which can change skb pointers.\nLet\u0026apos;s recompute nh pointer to make sure any change won\u0026apos;t mess things up.(CVE-2026-63924)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBluetooth: HIDP: fix missing length checks in hidp_input_report()\n\nhidp_input_report() reads keyboard and mouse payload data from an skb\nwithout first verifying that skb-\u0026gt;len contains enough data.\n\nhidp_recv_intr_frame() pulls the 1-byte HIDP header before dispatching\nto hidp_input_report(). If a paired device sends a truncated packet,\nthe handler reads beyond the valid skb data, resulting in an\nout-of-bounds read of skb data. The OOB bytes may be interpreted as\nphantom key presses or spurious mouse movement.\n\nReplace the open-coded length tracking and pointer arithmetic with\nskb_pull_data() calls. skb_pull_data() returns NULL if the requested\nbytes are not present, eliminating the need for a manual size variable\nand the separate skb-\u0026gt;len guard.(CVE-2026-63947)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipv6: rpl: fix hdrlen overflow in ipv6_rpl_srh_decompress()\n\nipv6_rpl_srh_decompress() computes:\n\n outhdr-\u0026gt;hdrlen = (((n + 1) * sizeof(struct in6_addr)) \u0026gt;\u0026gt; 3);\n\nhdrlen is __u8. For n \u0026gt;= 127 the result exceeds 255 and silently\ntruncates. With n=127 (cmpri=15, cmpre=15, pad=0, hdrlen=16):\n\n (128 * 16) \u0026gt;\u0026gt; 3 = 256, truncated to 0 as __u8\n\nThe caller in ipv6_rpl_srh_rcv() then places the compressed header\nat buf + ((ohdr-\u0026gt;hdrlen + 1) \u0026lt;\u0026lt; 3). With hdrlen=0 this is buf + 8,\nbut the decompressed region occupies buf[0..2055] (8-byte header\nplus 128 full addresses). The compressed header overlaps the\ndecompressed data, and ipv6_rpl_srh_compress() writes into this\noverlap, corrupting the routing header of the forwarded packet.\n\nThe existing guard at exthdrs.c:546 checks (n + 1) \u0026gt; 255, which\nprevents n+1 from overflowing unsigned char (the segments_left\nfield), but does not prevent the computed hdrlen from overflowing\n__u8. n=127 passes because 128 \u0026lt;= 255, yet hdrlen=256 does not\nfit.\n\nTighten the bound to (n + 1) \u0026gt; 127. This caps n at 126, giving\nhdrlen = (127 * 16) \u0026gt;\u0026gt; 3 = 254, which fits in __u8. The compressed\nheader then lands at buf + ((254 + 1) \u0026lt;\u0026lt; 3) = buf + 2040, exactly\npast the decompressed region (buf[0..2039]). No overlap. 127\nsegments is well beyond any realistic RPL deployment.(CVE-2026-63984)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntunnels: do not assume transport header in iptunnel_pmtud_check_icmp()\n\nIn some cases, iptunnel_pmtud_check_icmp() can be called while\nskb transport header is not set.\n\nThis triggers an out-of-bound access, because\n(typeof(skb-\u0026gt;transport_header))~0U is 65535.\n\nAccess the icmp header based on IPv4 network header,\nafter making sure icmp-\u0026gt;type is present in skb linear part.\n\nNote that iptunnel_pmtud_check_icmpv6()) is fine.(CVE-2026-63992)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntunnels: load network headers after skb_cow() in iptunnel_pmtud_build_icmp[v6]()\n\nSashiko found that iptunnel_pmtud_build_icmp() and\niptunnel_pmtud_build_icmpv6() were caching ip_hdr() and ipv6_hdr()\nbefore an skb_cow() call which can reallocate skb-\u0026gt;head.\n\nFix this possible UAF by initializing the local variables\nafter the skb_cow() call.\n\nRemove skb_reset_network_header() calls which were not needed.(CVE-2026-63994)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipv4: free net-\u0026gt;ipv4.sysctl_local_reserved_ports after unregister_net_sysctl_table()\n\nipv4_sysctl_exit_net() is currently freeing net-\u0026gt;ipv4.sysctl_local_reserved_ports\ntoo soon.\n\nOnly after unregister_net_sysctl_table() we can be sure no threads can possibly\nuse the sysctls, including /proc/sys/net/ipv4/ip_local_reserved_ports.(CVE-2026-64002)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nInput: synaptics-rmi4 - bound the F30 keymap to the GPIO/LED count\n\nrmi_f30_map_gpios() allocates gpioled_key_map with\nmin(gpioled_count, TRACKSTICK_RANGE_END) == at most 6 entries, but\nrmi_f30_attention() iterates the full f30-\u0026gt;gpioled_count (device query\nregister, range 0..31) and dereferences gpioled_key_map[i], and\ninput-\u0026gt;keycodemax is set to the full gpioled_count while input-\u0026gt;keycode\npoints at the 6-entry allocation.\n\nA device that reports gpioled_count \u0026gt; 6 with GPIO support enabled\ntherefore causes an out-of-bounds read on the attention interrupt and\nout-of-bounds read/write through the EVIOCGKEYCODE/EVIOCSKEYCODE ioctls,\nwhich bound the index only against keycodemax. This is the same defect\nas the F3A handler, which was copied from F30.\n\nSize the keymap for the full gpioled_count; the mapping loop still\nassigns only the first min(gpioled_count, TRACKSTICK_RANGE_END) entries.(CVE-2026-64276)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ni2c: core: fix adapter deregistration race\n\nAdapters can be looked up by their id using i2c_get_adapter() which\ntakes a reference to the embedded struct device.\n\nRemove the adapter from the IDR before tearing it down during\nderegistration (and on registration failure) to make sure its resources\nare not accessed after having been freed (e.g. the device name).(CVE-2026-64279)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nexfat: bound uniname advance in exfat_find_dir_entry()\n\nIn exfat_find_dir_entry(), each TYPE_EXTEND (file name) entry advances the\noutput pointer by a fixed amount while the loop guard only tracks the\naccumulated name length:\n\n\tif (++order == 2)\n\t\tuniname = p_uniname-\u0026gt;name;\n\telse\n\t\tuniname += EXFAT_FILE_NAME_LEN;\n\tlen = exfat_extract_uni_name(ep, entry_uniname);\n\tname_len += len;\n\tunichar = *(uniname+len);\n\t*(uniname+len) = 0x0;\n\nuniname grows by EXFAT_FILE_NAME_LEN (15) per name entry, but name_len\ngrows only by the actual extracted length, which is shorter when a name\nfragment contains an early NUL. The only guard is\n`name_len \u0026gt;= MAX_NAME_LENGTH`, so a crafted directory with many short\nname fragments lets uniname run far past the\np_uniname-\u0026gt;name[MAX_NAME_LENGTH + 3] buffer while name_len stays small,\ncausing an out-of-bounds read and write at *(uniname+len).\n\nThe sibling extractor exfat_get_uniname_from_ext_entry() already stops\non a short fragment (the lockstep `len != EXFAT_FILE_NAME_LEN` guard\nadded in commit d42334578eba (\u0026quot;exfat: check if filename entries exceeds\nmax filename length\u0026quot;)); exfat_find_dir_entry() never got the\nequivalent. Track the per-entry write offset as a count and reject a\nfragment once the offset, or the offset plus the extracted length, would\nexceed MAX_NAME_LENGTH, before forming the output pointer.(CVE-2026-64296)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: qat - validate RSA CRT component lengths\n\nThe generic RSA key parser (rsa_helper.c) bounds each CRT component (p,\nq, dp, dq, qinv) by the modulus size n_sz, but qat_rsa_setkey_crt()\nallocates half-size DMA buffers (key_sz / 2) and right-aligns each\ncomponent with:\n\n memcpy(dst + half_key_sz - len, src, len)\n\nWhen a CRT component is larger than half_key_sz the subtraction\nunderflows and memcpy writes past the DMA buffer, causing memory\ncorruption.\n\nAdd a len \u0026gt; half_key_sz check next to the existing !len check for each\nof the five CRT components so the driver falls back to the non-CRT path\ninstead of writing out of bounds.(CVE-2026-64304)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nUSB: serial: digi_acceleport: fix write buffer corruption\n\nThe digi_write_inb_command() is supposed to wait for the write urb to\nbecome available or return an error, but instead it updates the transfer\nbuffer and tries to resubmit the urb on timeout.\n\nTo make things worse, for commands like break control where no timeout\nis used, the driver would corrupt the urb immediately due to a broken\njiffies comparison (on 32-bit machines this takes five minutes of uptime\nto trigger due to INITIAL_JIFFIES).\n\nFix this by adding the missing return on timeout and waiting\nindefinitely when no timeout has been specified as intended.\n\nThis issue was (sort of) flagged by Sashiko when reviewing an unrelated\nchange to the driver.(CVE-2026-64333)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nUSB: legousbtower: fix use-after-free on disconnect race\n\nmutex_unlock() may access the mutex structure after releasing the lock\nand therefore cannot be used to manage lifetime of objects directly\n(unlike spinlocks and refcounts). [1][2]\n\nUse a kref to release the driver data to avoid use-after-free in\nmutex_unlock() when release() races with disconnect().\n\n[1] a51749ab34d9 (\u0026quot;locking/mutex: Document that mutex_unlock() is\n non-atomic\u0026quot;)\n[2] 2b9d9e0a9ba0 (\u0026quot;locking/mutex: Clarify that mutex_unlock(), and most\n other sleeping locks, can still use the lock object\n after it\u0026apos;s unlocked\u0026quot;)(CVE-2026-64340)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nproc: protect ptrace_may_access() with exec_update_lock (part 1)\n\nFix the easy cases where procfs currently calls ptrace_may_access() without\nexec_update_lock protection, where the fix is to simply add the extra lock\nor use mm_access():\n\n - do_task_stat(): grab exec_update_lock\n - proc_pid_wchan(): grab exec_update_lock\n - proc_map_files_lookup(): use mm_access() instead of get_task_mm()\n - proc_map_files_readdir(): use mm_access() instead of get_task_mm()\n - proc_ns_get_link(): grab exec_update_lock\n - proc_ns_readlink(): grab exec_update_lock(CVE-2026-64371)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsmb/client: fix chown/chgrp with SMB3 POSIX Extensions\n\nOwnership (chown) and group (chgrp) modifications were being ignored when\nmounting with SMB3 POSIX Extensions unless CIFS_MOUNT_CIFS_ACL or\nCIFS_MOUNT_MODE_FROM_SID were also explicitly set.\n\nFix this by checking for posix_extensions in cifs_setattr_nounix() when\nupdating UID and GID, ensuring that id_mode_to_cifs_acl() is called to map\nand set the ownership/group information on the server.(CVE-2026-64388)\n\nIn the Linux kernel, the following vulnerability has been resolved: Bluetooth: fix UAF in bt_accept_dequeue(). bt_accept_get() takes a temporary reference before dropping the accept queue lock. bt_accept_dequeue() currently drops that reference before bt_accept_unlink(), leaving only the queue reference. bt_accept_unlink() drops the queue reference. The subsequent sock_hold() therefore accesses freed memory if it was the final reference, as observed by KASAN during listening L2CAP socket cleanup. Retain the temporary queue-walk reference through unlink and hand it to the caller on success. Drop it explicitly on the closed and not-yet-connected paths.(CVE-2026-64406)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: qualcomm: rmnet: validate MAP frame length before ingress parsing\n\nWhen ingress deaggregation is disabled, rmnet_map_ingress_handler() passes\nthe skb straight to __rmnet_map_ingress_handler(), skipping the length\nvalidation that rmnet_map_deaggregate() performs on the aggregated path.\nThe parser then dereferences the MAP header and csum header/trailer based on\nthe on-wire pkt_len without checking skb-\u0026gt;len, so a short frame is read out\nof bounds:\n\n BUG: KASAN: slab-out-of-bounds in rmnet_map_checksum_downlink_packet\n Read of size 1 at addr ffff88801118ed00 by task exploit/147\n Call Trace:\n ...\n rmnet_map_checksum_downlink_packet (drivers/net/ethernet/qualcomm/rmnet/rmnet_map_data.c:413)\n __rmnet_map_ingress_handler (drivers/net/ethernet/qualcomm/rmnet/rmnet_handlers.c:96)\n rmnet_rx_handler (drivers/net/ethernet/qualcomm/rmnet/rmnet_handlers.c:129)\n __netif_receive_skb_core.constprop.0 (net/core/dev.c:6089)\n netif_receive_skb (net/core/dev.c:6460)\n tun_get_user (drivers/net/tun.c:1955)\n tun_chr_write_iter (drivers/net/tun.c:2001)\n vfs_write (fs/read_write.c:688)\n ksys_write (fs/read_write.c:740)\n do_syscall_64 (arch/x86/entry/syscall_64.c:94)\n ...\n\nFactor that validation out of rmnet_map_deaggregate() into\nrmnet_map_validate_packet_len() and run it on the no-aggregation path too.\nThe MAP header is bounds-checked first, since this path can receive a frame\nshorter than the header.(CVE-2026-64550)\n\nIn the Linux kernel, a use-after-free vulnerability exists in the SCTP ASCONF processing. sctp_process_asconf() caches the transport the ASCONF chunk is processed against in asconf-\u0026gt;transport. For an ASCONF located through its Address Parameter by __sctp_rcv_asconf_lookup(), that cached transport corresponds to the Address Parameter, which need not be the packet\u0026apos;s source address. sctp_process_asconf_param() rejects a DEL-IP for the packet source address, but nothing protects asconf-\u0026gt;transport. A single ASCONF can carry [Address Parameter L] [DEL-IP L] [DEL-IP 0.0.0.0] where L differs from the source, causing the freed transport to be dereferenced, potentially leading to system crash or code execution.(CVE-2026-64564)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nksmbd: defer destroy_previous_session() until after NTLM authentication\n\nIn ntlm_authenticate(), destroy_previous_session() is called using a\nuser pointer resolved from the client-supplied NTLM blob username field\nbefore the NTLMv2 response is validated. An authenticated attacker can\nset the NTLM blob username to match a victim account and set\nPreviousSessionId to the victim\u0026apos;s session ID; destroy_previous_session()\ndestroys the victim\u0026apos;s session while ksmbd_decode_ntlmssp_auth_blob()\nsubsequently rejects the request with -EPERM.\n\nMove destroy_previous_session() and the prev_id assignment to after\nksmbd_decode_ntlmssp_auth_blob() returns success and use sess-\u0026gt;user\nrather than the pre-authentication lookup result. This matches the\nordering already used by krb5_authenticate(), where\ndestroy_previous_session() is called only after\nksmbd_krb5_authenticate() returns success.(CVE-2026-68130)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nlibceph: bound pg_{temp,upmap,upmap_items} length to CEPH_PG_MAX_SIZE\n\n__decode_pg_temp() decodes an user-controlled length but only rejects\nvalues large enough to overflow the allocation; it does not bound it to\nCEPH_PG_MAX_SIZE. The helper backs both pg_temp and pg_upmap decoding, and\napply_upmap()/get_temp_osds() later copy the decoded list into the fixed-size\non-stack array struct ceph_osds.osds[CEPH_PG_MAX_SIZE]. A monitor that sends\nan OSDMap with a pg_temp/pg_upmap entry longer than 32 thus causes a stack\nout-of-bounds write.\n\nAn OSD set for a single PG can never exceed CEPH_PG_MAX_SIZE, so reject longer\nentries at decode time. The bound is well below the old overflow threshold, so\nit also covers the allocation-size overflow the previous check guarded against.\n\n BUG: KASAN: stack-out-of-bounds in ceph_pg_to_up_acting_osds\n Write of size 4 ... by task exploit\n kasan_report (mm/kasan/report.c:595)\n ceph_pg_to_up_acting_osds (net/ceph/osdmap.c:2617 net/ceph/osdmap.c:2833)\n calc_target (net/ceph/osd_client.c:1638)\n __submit_request (net/ceph/osd_client.c:2394)\n ceph_osdc_start_request (net/ceph/osd_client.c:2490)\n ceph_osdc_call (net/ceph/osd_client.c:5164)\n rbd_dev_image_probe (drivers/block/rbd.c:6899)\n do_rbd_add (drivers/block/rbd.c:7138)\n ...\n kernel BUG at net/ceph/osdmap.c:2670!\n\n[ idryomov: do the same in __decode_pg_upmap_items() ](CVE-2026-68159)",
"id": "OESA-2026-3453",
"modified": "2026-08-20T09:59:07Z",
"published": "2026-08-20T09:59:07Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-3453"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-23336"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43062"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45893"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46070"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46113"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53392"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-53402"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63800"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63860"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63899"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63901"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63924"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63947"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63984"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63992"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-63994"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64002"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64276"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64279"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64296"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64304"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64333"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64340"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64371"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64388"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64406"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64550"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-64564"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-68130"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-68159"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2026-23336",
"CVE-2026-43062",
"CVE-2026-45893",
"CVE-2026-46070",
"CVE-2026-46113",
"CVE-2026-53392",
"CVE-2026-53402",
"CVE-2026-63800",
"CVE-2026-63860",
"CVE-2026-63899",
"CVE-2026-63901",
"CVE-2026-63924",
"CVE-2026-63947",
"CVE-2026-63984",
"CVE-2026-63992",
"CVE-2026-63994",
"CVE-2026-64002",
"CVE-2026-64276",
"CVE-2026-64279",
"CVE-2026-64296",
"CVE-2026-64304",
"CVE-2026-64333",
"CVE-2026-64340",
"CVE-2026-64371",
"CVE-2026-64388",
"CVE-2026-64406",
"CVE-2026-64550",
"CVE-2026-64564",
"CVE-2026-68130",
"CVE-2026-68159"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.